diff --git a/spec2vec/Test-ComponentIndex/Reset_ComponentIndex.py b/spec2vec/Test-ComponentIndex/Reset_ComponentIndex.py
new file mode 100644
index 00000000..ad1dfe08
--- /dev/null
+++ b/spec2vec/Test-ComponentIndex/Reset_ComponentIndex.py
@@ -0,0 +1,15 @@
+import networkx as nx
+
+G = nx.read_graphml('SPEC2VEC-1f01c492-download_graphml-main.graphml')
+
+component_index = 0
+
+for component in nx.connected_components(G):
+ component_index += 1
+ for node in component:
+ if len(component) == 1:
+ G.node[node]['componentindex'] = "-1"
+ else:
+ G.node[node]['componentindex'] = str(component_index)
+
+nx.write_graphml(G, 'output_graphml.graphml')
\ No newline at end of file
diff --git a/spec2vec/Test-ComponentIndex/SPEC2VEC-1f01c492-download_graphml-main.graphml b/spec2vec/Test-ComponentIndex/SPEC2VEC-1f01c492-download_graphml-main.graphml
new file mode 100644
index 00000000..ead9e6c7
--- /dev/null
+++ b/spec2vec/Test-ComponentIndex/SPEC2VEC-1f01c492-download_graphml-main.graphml
@@ -0,0 +1,54263 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8146
+ 5
+ 0
+ Feature Node
+ N/A
+ 1249081.4520805678
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5304.0","main.cluster index_upperinput":"5304.0"}
+ 5304
+ 16.8146
+ -1
+ This Node is a Singleton
+ N/A
+ 448.2309
+ N/A
+ 0.0
+ 448.2309
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9951
+ 5
+ 0
+ Feature Node
+ N/A
+ 7301878.409146197
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2753.0","main.cluster index_upperinput":"2753.0"}
+ 2753
+ 14.9951
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 447.0923
+ N/A
+ 0.0
+ 447.0923
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9183
+ 1
+ 0
+ Feature Node
+ N/A
+ 347111.6661663127
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"60.0","main.cluster index_upperinput":"60.0"}
+ 60
+ 0.9183
+ -1
+ This Node is a Singleton
+ N/A
+ 217.0143
+ N/A
+ 0.0
+ 217.0143
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.666
+ 4
+ 0
+ Feature Node
+ N/A
+ 1159265.2781364343
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4974.0","main.cluster index_upperinput":"4974.0"}
+ 4974
+ 15.666
+ -1
+ This Node is a Singleton
+ N/A
+ 429.1529
+ N/A
+ 0.0
+ 429.1529
+
+
+ 23
+ 0.8296309999999999
+ CCMSLIB00003134511
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134511
+ InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H2,23,24)/b10-9-
+ 0
+ QQQ
+ InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H2,23,24)/b10-9-
+ 0.0
+ Spectral Match to 13-Docosenamide, (Z)- from NIST14
+ CCCCCCCC/C=C\\CCCCCCCCCCCC(=O)N
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134511
+ 11
+ 3.2471200000000002
+ Feature Node
+ N/A
+ 23
+ 0.0
+ 0.0
+ Data deposited by eriche
+ Spectral Match to 13-Docosenamide, (Z)- from NIST14
+ Positive
+ Data deposited by eriche
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"28.0","main.cluster index_upperinput":"28.0"}
+ 3.2471200000000002
+ 3
+ CCCCCCCC/C=C\\CCCCCCCCCCCC(=O)N
+ Data from Piel
+ 3
+ 338.3421
+ CCMSLIB00003134511
+ 338.3421
+ 0.0
+ Data from Piel
+ 13916293.609778142
+ QQQ
+ Isolated
+ 0.00109863
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.7587
+ 9
+ 0.8296309999999999
+ 0.0
+ Isolated
+ 28
+ 0.00109863
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.7587
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.0319
+ 8
+ 0
+ Feature Node
+ N/A
+ 1166808.1132334797
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1410.0","main.cluster index_upperinput":"1410.0"}
+ 1410
+ 33.0319
+ -1
+ This Node is a Singleton
+ N/A
+ 481.3554
+ N/A
+ 0.0
+ 481.3554
+
+
+ 17
+ 0.890516
+ CCMSLIB00000847746
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847746
+ InChI=1S/C24H26O13/c1-32-11-5-4-9(6-10(11)26)21-23(34-3)18(29)15-12(35-21)7-13(22(33-2)17(15)28)36-24-20(31)19(30)16(27)14(8-25)37-24/h4-7,14,16,19-20,24-28,30-31H,8H2,1-3H3/t14-,16-,19+,20-,24-/m1/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C24H26O13/c1-32-11-5-4-9(6-10(11)26)21-23(34-3)18(29)15-12(35-21)7-13(22(33-2)17(15)28)36-24-20(31)19(30)16(27)14(8-25)37-24/h4-7,14,16,19-20,24-28,30-31H,8H2,1-3H3/t14-,16-,19+,20-,24-/m1/s1
+ 0.0
+ NCGC00385512-01!5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+ COC1=C(O)C=C(C=C1)C2=C(OC)C(=O)C3=C(O)C(OC)=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3O2
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847746
+ 8
+ 2.68341
+ Feature Node
+ N/A
+ 17
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00385512-01!5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4503.0","main.cluster index_upperinput":"4503.0"}
+ 2.68341
+ 1
+ COC1=C(O)C=C(C=C1)C2=C(OC)C(=O)C3=C(O)C(OC)=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3O2
+ Jadhav/Dorrestein
+ 1
+ 523.1454
+ CCMSLIB00000847746
+ 523.1454
+ 0.0
+ Jadhav/Dorrestein
+ 7459719.001855942
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.00140381
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 17.7713
+ 5
+ 0.890516
+ 0.0
+ isolated
+ 4503
+ 0.00140381
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.7713
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.2184
+ 2
+ 0
+ Feature Node
+ N/A
+ 1200861.986762946
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4682.0","main.cluster index_upperinput":"4682.0"}
+ 4682
+ 15.2184
+ -1
+ This Node is a Singleton
+ N/A
+ 451.1936
+ N/A
+ 0.0
+ 451.1936
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.2849
+ 9
+ 0
+ Feature Node
+ N/A
+ 3320955.221245815
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2121.0","main.cluster index_upperinput":"2121.0"}
+ 2121
+ 32.2849
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3717
+ N/A
+ 0.0
+ 429.3717
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.9917
+ 6
+ 0
+ Feature Node
+ N/A
+ 779314.9344583361
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"170.0","main.cluster index_upperinput":"170.0"}
+ 170
+ 26.9917
+ 55
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 268.1002
+ N/A
+ 0.0
+ 268.1002
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.2881
+ 5
+ 0
+ Feature Node
+ N/A
+ 3570762.229622576
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3602.0","main.cluster index_upperinput":"3602.0"}
+ 3602
+ 7.2881
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 442.2431
+ N/A
+ 0.0
+ 442.2431
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.7971
+ 8
+ 0
+ Feature Node
+ N/A
+ 3626554.5555401766
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5172.0","main.cluster index_upperinput":"5172.0"}
+ 5172
+ 22.7971
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8902
+ N/A
+ 0.0
+ 84.9451
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.9432
+ 4
+ 0
+ Feature Node
+ N/A
+ 601590.936468636
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"27744.0","main.cluster index_upperinput":"27744.0"}
+ 27744
+ 7.9432
+ 61
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=61&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.219
+ N/A
+ 0.0
+ 496.219
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.0491
+ 8
+ 0
+ Feature Node
+ N/A
+ 1767586.533594747
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5195.0","main.cluster index_upperinput":"5195.0"}
+ 5195
+ 21.0491
+ -1
+ This Node is a Singleton
+ N/A
+ 181.1218
+ N/A
+ 0.0
+ 181.1218
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1155
+ 4
+ 0
+ Feature Node
+ N/A
+ 3836003.564263604
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"81.0","main.cluster index_upperinput":"81.0"}
+ 81
+ 23.1155
+ 9
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=9&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 393.2865
+ N/A
+ 0.0
+ 393.2865
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.6956
+ 5
+ 0
+ Feature Node
+ N/A
+ 730252.1750182833
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2946.0","main.cluster index_upperinput":"2946.0"}
+ 2946
+ 14.6956
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 479.1178
+ N/A
+ 0.0
+ 479.1178
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.7443
+ 6
+ 0
+ Feature Node
+ N/A
+ 1751904.1015508363
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4836.0","main.cluster index_upperinput":"4836.0"}
+ 4836
+ 13.7443
+ -1
+ This Node is a Singleton
+ N/A
+ 287.1253
+ N/A
+ 0.0
+ 287.1253
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.535
+ 8
+ 0
+ Feature Node
+ N/A
+ 2905177.708348213
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"45.0","main.cluster index_upperinput":"45.0"}
+ 45
+ 25.535
+ 55
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 254.0841
+ N/A
+ 0.0
+ 254.0841
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.1038
+ 8
+ 0
+ Feature Node
+ N/A
+ 2291852.562817203
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2528.0","main.cluster index_upperinput":"2528.0"}
+ 2528
+ 13.1038
+ 38
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 151.0388
+ N/A
+ 0.0
+ 151.0388
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.7256
+ 4
+ 0
+ Feature Node
+ N/A
+ 348278.5999983921
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14563.0","main.cluster index_upperinput":"14563.0"}
+ 14563
+ 24.7256
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 684.4157
+ N/A
+ 0.0
+ 684.4157
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7229
+ 4
+ 0
+ Feature Node
+ N/A
+ 1062485.8431644645
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4574.0","main.cluster index_upperinput":"4574.0"}
+ 4574
+ 17.7229
+ -1
+ This Node is a Singleton
+ N/A
+ 515.1165
+ N/A
+ 0.0
+ 515.1165
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.8842
+ 3
+ 0
+ Feature Node
+ N/A
+ 977802.6265394851
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"243.0","main.cluster index_upperinput":"243.0"}
+ 243
+ 30.8842
+ 82
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=82&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 367.3181
+ N/A
+ 0.0
+ 367.3181
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.8279
+ 5
+ 0
+ Feature Node
+ N/A
+ 256976.14311037914
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3631.0","main.cluster index_upperinput":"3631.0"}
+ 3631
+ 19.8279
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=56&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 625.2593
+ N/A
+ 0.0
+ 625.2593
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.8052
+ 5
+ 0
+ Feature Node
+ N/A
+ 1245608.4310451236
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5046.0","main.cluster index_upperinput":"5046.0"}
+ 5046
+ 7.8052
+ 52
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.2218
+ N/A
+ 0.0
+ 394.2218
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9262
+ 5
+ 0
+ Feature Node
+ N/A
+ 5948711.742031584
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13615.0","main.cluster index_upperinput":"13615.0"}
+ 13615
+ 16.9262
+ 81
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 366.1918
+ N/A
+ 0.0
+ 366.1918
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5365
+ 6
+ 0
+ Feature Node
+ N/A
+ 17410860.033584096
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1668.0","main.cluster index_upperinput":"1668.0"}
+ 1668
+ 33.5365
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 797.5189
+ N/A
+ 0.0
+ 797.5189
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1412
+ 8
+ 0
+ Feature Node
+ N/A
+ 7800960.794381272
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3026.0","main.cluster index_upperinput":"3026.0"}
+ 3026
+ 32.1412
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 367.2826
+ N/A
+ 0.0
+ 367.2826
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.0356
+ 8
+ 0
+ Feature Node
+ N/A
+ 4745331.034511559
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1206.0","main.cluster index_upperinput":"1206.0"}
+ 1206
+ 1.0356
+ 88
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 160.9894
+ N/A
+ 0.0
+ 160.9894
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.8968
+ 2
+ 0
+ Feature Node
+ N/A
+ 3057465.5421761977
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13673.0","main.cluster index_upperinput":"13673.0"}
+ 13673
+ 14.8968
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 432.2012
+ N/A
+ 0.0
+ 432.2012
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.3918
+ 3
+ 0
+ Feature Node
+ N/A
+ 1102437.1318208224
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7827.0","main.cluster index_upperinput":"7827.0"}
+ 7827
+ 10.3918
+ 52
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 528.1999
+ N/A
+ 0.0
+ 528.1999
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.5613
+ 7
+ 0
+ Feature Node
+ N/A
+ 6438713.495733419
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3685.0","main.cluster index_upperinput":"3685.0"}
+ 3685
+ 28.5613
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 861.4099
+ N/A
+ 0.0
+ 861.4099
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.935
+ 8
+ 0
+ Feature Node
+ N/A
+ 16662194.575077448
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"22481.0","main.cluster index_upperinput":"22481.0"}
+ 22481
+ 30.935
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 409.3823
+ N/A
+ 0.0
+ 409.3823
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.8395
+ 8
+ 0
+ Feature Node
+ N/A
+ 9160503.459211562
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"351.0","main.cluster index_upperinput":"351.0"}
+ 351
+ 30.8395
+ -1
+ This Node is a Singleton
+ N/A
+ 629.4027
+ N/A
+ 0.0
+ 629.4027
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.4852
+ 7
+ 0
+ Feature Node
+ N/A
+ 27753389.688350685
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2689.0","main.cluster index_upperinput":"2689.0"}
+ 2689
+ 34.4852
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 975.566
+ N/A
+ 0.0
+ 975.566
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.9407
+ 6
+ 0
+ Feature Node
+ N/A
+ 496117.1643787464
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"406.0","main.cluster index_upperinput":"406.0"}
+ 406
+ 23.9407
+ -1
+ This Node is a Singleton
+ N/A
+ 167.0702
+ N/A
+ 0.0
+ 167.0702
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.8637
+ 9
+ 0
+ Feature Node
+ N/A
+ 8876356.412253514
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4697.0","main.cluster index_upperinput":"4697.0"}
+ 4697
+ 27.8637
+ -1
+ This Node is a Singleton
+ N/A
+ 293.2096
+ N/A
+ 0.0
+ 293.2096
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.956
+ 8
+ 0
+ Feature Node
+ N/A
+ 4129147.722108776
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1194.0","main.cluster index_upperinput":"1194.0"}
+ 1194
+ 0.956
+ -1
+ This Node is a Singleton
+ N/A
+ 260.1127
+ N/A
+ 0.0
+ 260.1127
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.007
+ 7
+ 0
+ Feature Node
+ N/A
+ 19150900.017287962
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1184.0","main.cluster index_upperinput":"1184.0"}
+ 1184
+ 25.007
+ 80
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=80&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 316.2846
+ N/A
+ 0.0
+ 316.2846
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.3454
+ 4
+ 0
+ Feature Node
+ N/A
+ 1778664.7996528696
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13878.0","main.cluster index_upperinput":"13878.0"}
+ 13878
+ 25.3454
+ -1
+ This Node is a Singleton
+ N/A
+ 715.3511
+ N/A
+ 0.0
+ 715.3511
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.4583
+ 5
+ 0
+ Feature Node
+ N/A
+ 1700875.7938528375
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7770.0","main.cluster index_upperinput":"7770.0"}
+ 7770
+ 14.4583
+ -1
+ This Node is a Singleton
+ N/A
+ 545.1981
+ N/A
+ 0.0
+ 545.1981
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2345
+ 1
+ 0
+ Feature Node
+ N/A
+ 1184535.1331669444
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7666.0","main.cluster index_upperinput":"7666.0"}
+ 7666
+ 23.2345
+ -1
+ This Node is a Singleton
+ N/A
+ 353.1367
+ N/A
+ 0.0
+ 353.1367
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.8317
+ 4
+ 0
+ Feature Node
+ N/A
+ 719643957.4873966
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13583.0","main.cluster index_upperinput":"13583.0"}
+ 13583
+ 10.8317
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2142
+ N/A
+ 0.0
+ 462.2142
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5287
+ 9
+ 0
+ Feature Node
+ N/A
+ 21213091.937901758
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1574.0","main.cluster index_upperinput":"1574.0"}
+ 1574
+ 33.5287
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 608.4738
+ N/A
+ 0.0
+ 608.4738
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.0994
+ 9
+ 0
+ Feature Node
+ N/A
+ 8213315.299273698
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1265.0","main.cluster index_upperinput":"1265.0"}
+ 1265
+ 32.0994
+ -1
+ This Node is a Singleton
+ N/A
+ 391.2841
+ N/A
+ 0.0
+ 391.2841
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0751
+ 6
+ 0
+ Feature Node
+ N/A
+ 2088051.8713251078
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3152.0","main.cluster index_upperinput":"3152.0"}
+ 3152
+ 19.0751
+ -1
+ This Node is a Singleton
+ N/A
+ 371.148
+ N/A
+ 0.0
+ 371.148
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.6597
+ 5
+ 0
+ Feature Node
+ N/A
+ 1721192.9512343807
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4555.0","main.cluster index_upperinput":"4555.0"}
+ 4555
+ 14.6597
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 449.1082
+ N/A
+ 0.0
+ 449.1082
+
+
+ 10
+ 0.96065
+ CCMSLIB00003139668
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139668
+ InChI=1S/C24H38O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3
+ 0
+ qTof
+ InChI=1S/C24H38O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3
+ 0.0
+ Spectral Match to Dioctyl phthalate from NIST14
+ CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139668
+ 105
+ 6.39541
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Dioctyl phthalate from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2495.0","main.cluster index_upperinput":"2495.0"}
+ 6.39541
+ 3
+ CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC
+ Data from Maria Maansson
+ 3
+ 391.2845
+ CCMSLIB00003139668
+ 391.2845
+ 0.0
+ Data from Maria Maansson
+ 110619034.10916401
+ qTof
+ Isolated
+ 0.00250244
+ M+H
+ N/A
+ ESI
+ Positive
+ 34.2376
+ 9
+ 0.96065
+ 0.0
+ Isolated
+ 2495
+ 0.00250244
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=105&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.2376
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.5191
+ 9
+ 0
+ Feature Node
+ N/A
+ 243625295.82271612
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9484.0","main.cluster index_upperinput":"9484.0"}
+ 9484
+ 32.5191
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 343.3391
+ N/A
+ 0.0
+ 343.3391
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.8547
+ 6
+ 0
+ Feature Node
+ N/A
+ 435843.3497304233
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7783.0","main.cluster index_upperinput":"7783.0"}
+ 7783
+ 26.8547
+ -1
+ This Node is a Singleton
+ N/A
+ 493.2864
+ N/A
+ 0.0
+ 493.2864
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.048
+ 9
+ 0
+ Feature Node
+ N/A
+ 3485926.545196906
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2626.0","main.cluster index_upperinput":"2626.0"}
+ 2626
+ 34.048
+ -1
+ This Node is a Singleton
+ N/A
+ 417.3339
+ N/A
+ 0.0
+ 417.3339
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.7915
+ 9
+ 0
+ Feature Node
+ N/A
+ 4932998.841464961
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2087.0","main.cluster index_upperinput":"2087.0"}
+ 2087
+ 22.7915
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 181.1221
+ N/A
+ 0.0
+ 181.1221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.8012
+ 8
+ 0
+ Feature Node
+ N/A
+ 4640463.809853285
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2796.0","main.cluster index_upperinput":"2796.0"}
+ 2796
+ 29.8012
+ -1
+ This Node is a Singleton
+ N/A
+ 701.3729
+ N/A
+ 0.0
+ 701.3729
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.4316
+ 5
+ 0
+ Feature Node
+ N/A
+ 4982933.836091062
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3695.0","main.cluster index_upperinput":"3695.0"}
+ 3695
+ 1.4316
+ -1
+ This Node is a Singleton
+ N/A
+ 412.1965
+ N/A
+ 0.0
+ 412.1965
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.9
+ 5
+ 0
+ Feature Node
+ N/A
+ 3338481.898830253
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1263.0","main.cluster index_upperinput":"1263.0"}
+ 1263
+ 15.9
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 463.124
+ N/A
+ 0.0
+ 463.124
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.8577
+ 6
+ 0
+ Feature Node
+ N/A
+ 2134231.8744840883
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5391.0","main.cluster index_upperinput":"5391.0"}
+ 5391
+ 12.8577
+ -1
+ This Node is a Singleton
+ N/A
+ 538.2282
+ N/A
+ 0.0
+ 538.2282
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.5269
+ 6
+ 0
+ Feature Node
+ N/A
+ 1342343.4338033178
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15085.0","main.cluster index_upperinput":"15085.0"}
+ 15085
+ 10.5269
+ 52
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.222
+ N/A
+ 0.0
+ 394.222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.6257
+ 8
+ 0
+ Feature Node
+ N/A
+ 505083.20285915805
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7816.0","main.cluster index_upperinput":"7816.0"}
+ 7816
+ 29.6257
+ -1
+ This Node is a Singleton
+ N/A
+ 499.3395
+ N/A
+ 0.0
+ 499.3395
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.2234
+ 6
+ 0
+ Feature Node
+ N/A
+ 85903713.10737306
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11220.0","main.cluster index_upperinput":"11220.0"}
+ 11220
+ 11.2234
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2136
+ N/A
+ 0.0
+ 462.2136
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.972
+ 1
+ 0
+ Feature Node
+ N/A
+ 1406430.0350954174
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1197.0","main.cluster index_upperinput":"1197.0"}
+ 1197
+ 18.972
+ -1
+ This Node is a Singleton
+ N/A
+ 513.1004
+ N/A
+ 0.0
+ 513.1004
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3199
+ 5
+ 0
+ Feature Node
+ N/A
+ 1382453.3517153442
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1294.0","main.cluster index_upperinput":"1294.0"}
+ 1294
+ 22.3199
+ 33
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 448.2177
+ N/A
+ 0.0
+ 448.2177
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.7278
+ 7
+ 0
+ Feature Node
+ N/A
+ 1068356.9226518832
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"132.0","main.cluster index_upperinput":"132.0"}
+ 132
+ 23.7278
+ 53
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=53&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 539.2102
+ N/A
+ 0.0
+ 539.2102
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.7122
+ 9
+ 0
+ Feature Node
+ N/A
+ 25557531.418297783
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7627.0","main.cluster index_upperinput":"7627.0"}
+ 7627
+ 28.7122
+ -1
+ This Node is a Singleton
+ N/A
+ 319.2244
+ N/A
+ 0.0
+ 319.2244
+
+
+ 11
+ 0.790199
+ CCMSLIB00005742378
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0
+ qTof
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0.0
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 8
+ 1.55846
+ Feature Node
+ N/A
+ 11
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10586.0","main.cluster index_upperinput":"10586.0"}
+ 1.55846
+ 3
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ Massbank
+ 3
+ 509.1298
+ CCMSLIB00005742378
+ 509.1298
+ 0.0
+ Massbank
+ 15884967.444121486
+ qTof
+ Isolated
+ 0.000793457
+ M+H
+ N/A
+ ESI
+ Positive
+ 16.6701
+ 6
+ 0.790199
+ 0.0
+ Isolated
+ 10586
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.6701
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.1373
+ 9
+ 0
+ Feature Node
+ N/A
+ 23312884.36955374
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1154.0","main.cluster index_upperinput":"1154.0"}
+ 1154
+ 27.1373
+ 72
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=72&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 579.2922
+ N/A
+ 0.0
+ 579.2922
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.8963
+ 7
+ 0
+ Feature Node
+ N/A
+ 6248637.506914418
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1204.0","main.cluster index_upperinput":"1204.0"}
+ 1204
+ 25.8963
+ 23
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 277.179
+ N/A
+ 0.0
+ 277.179
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.913
+ 9
+ 0
+ Feature Node
+ N/A
+ 67085144.41459696
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1155.0","main.cluster index_upperinput":"1155.0"}
+ 1155
+ 31.913
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 642.2107
+ N/A
+ 0.0
+ 642.2107
+
+
+ 21
+ 0.707359
+ CCMSLIB00003138911
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138911
+ InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+
+ 0
+ qTof
+ InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+
+ 0.0
+ Spectral Match to 9-Oxo-10E,12Z-octadecadienoic acid from NIST14
+ CCCCC/C=C\\C=C\\C(=O)CCCCCCCC(=O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138911
+ 11
+ 2.37751
+ Feature Node
+ N/A
+ 21
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 9-Oxo-10E,12Z-octadecadienoic acid from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1540.0","main.cluster index_upperinput":"1540.0"}
+ 2.37751
+ 3
+ CCCCC/C=C\\C=C\\C(=O)CCCCCCCC(=O)O
+ Data from Wolfender/Litaudon
+ 3
+ 295.2263
+ CCMSLIB00003138911
+ 295.2263
+ 0.0
+ Data from Wolfender/Litaudon
+ 3783448.324987889
+ qTof
+ Isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ ESI
+ Positive
+ 22.9282
+ 8
+ 0.707359
+ 0.0
+ Isolated
+ 1540
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 22.9282
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.2464
+ 7
+ 0
+ Feature Node
+ N/A
+ 5219867.298225547
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"122.0","main.cluster index_upperinput":"122.0"}
+ 122
+ 31.2464
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 813.512
+ N/A
+ 0.0
+ 813.512
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.0792
+ 9
+ 0
+ Feature Node
+ N/A
+ 5170175.729874854
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1261.0","main.cluster index_upperinput":"1261.0"}
+ 1261
+ 33.0792
+ -1
+ This Node is a Singleton
+ N/A
+ 503.3355
+ N/A
+ 0.0
+ 503.3355
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.9674
+ 6
+ 0
+ Feature Node
+ N/A
+ 3080050.372258077
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2474.0","main.cluster index_upperinput":"2474.0"}
+ 2474
+ 28.9674
+ 20
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=20&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 469.3637
+ N/A
+ 0.0
+ 469.3637
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.7742
+ 2
+ 0
+ Feature Node
+ N/A
+ 999687.1434278773
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4993.0","main.cluster index_upperinput":"4993.0"}
+ 4993
+ 19.7742
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 586.2654
+ N/A
+ 0.0
+ 586.2654
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.7716
+ 4
+ 0
+ Feature Node
+ N/A
+ 2129316.9222890674
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"22561.0","main.cluster index_upperinput":"22561.0"}
+ 22561
+ 18.7716
+ -1
+ This Node is a Singleton
+ N/A
+ 385.1642
+ N/A
+ 0.0
+ 385.1642
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4102
+ 6
+ 0
+ Feature Node
+ N/A
+ 867810.4617674882
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"418.0","main.cluster index_upperinput":"418.0"}
+ 418
+ 26.4102
+ -1
+ This Node is a Singleton
+ N/A
+ 337.075
+ N/A
+ 0.0
+ 337.075
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.5847
+ 3
+ 0
+ Feature Node
+ N/A
+ 1179488.7696451363
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4602.0","main.cluster index_upperinput":"4602.0"}
+ 4602
+ 14.5847
+ -1
+ This Node is a Singleton
+ N/A
+ 455.0945
+ N/A
+ 0.0
+ 455.0945
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 5.5482
+ 2
+ 0
+ Feature Node
+ N/A
+ 466496.6032460307
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8076.0","main.cluster index_upperinput":"8076.0"}
+ 8076
+ 5.5482
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 470.1943
+ N/A
+ 0.0
+ 470.1943
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4443
+ 6
+ 0
+ Feature Node
+ N/A
+ 1366612.4929284519
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2512.0","main.cluster index_upperinput":"2512.0"}
+ 2512
+ 26.4443
+ 108
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 119.0862
+ N/A
+ 0.0
+ 119.0862
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.8014
+ 6
+ 0
+ Feature Node
+ N/A
+ 6522364.642472192
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2490.0","main.cluster index_upperinput":"2490.0"}
+ 2490
+ 34.8014
+ -1
+ This Node is a Singleton
+ N/A
+ 613.4812
+ N/A
+ 0.0
+ 613.4812
+
+
+ 8
+ 0.794866
+ CCMSLIB00006422785
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006422785
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3
+ 0
+ Orbitrap
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3
+ 0.0
+ Eupatilin
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006422785
+ 32
+ 21.1356
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ BMDMS-NP
+ Eupatilin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7742.0","main.cluster index_upperinput":"7742.0"}
+ 21.1356
+ 1
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
+ BMDMS-NP
+ 1
+ 345.0973
+ CCMSLIB00006422785
+ 345.0973
+ 0.0
+ BMDMS-NP
+ 13801295.484932978
+ Orbitrap
+ Commercial standard
+ 0.0072937
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 22.6731
+ 8
+ 0.794866
+ 0.0
+ Commercial standard
+ 7742
+ 0.0072937
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 22.6731
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.0405
+ 5
+ 0
+ Feature Node
+ N/A
+ 3921363.1125284913
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"38.0","main.cluster index_upperinput":"38.0"}
+ 38
+ 31.0405
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 395.3655
+ N/A
+ 0.0
+ 395.3655
+
+
+ 33
+ 0.802131
+ CCMSLIB00003136883
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136883
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to Monobehenin from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136883
+ 11
+ 41.2414
+ Feature Node
+ N/A
+ 33
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Monobehenin from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2493.0","main.cluster index_upperinput":"2493.0"}
+ 41.2414
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 397.3824
+ CCMSLIB00003136883
+ 397.3824
+ 0.0
+ Data from Wolfender/Litaudon
+ 15094628.060232813
+ HCD
+ Isolated
+ 0.0163879
+ M+H-H2O
+ N/A
+ ESI
+ Positive
+ 33.3498
+ 8
+ 0.802131
+ 0.0
+ Isolated
+ 2493
+ 0.0163879
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 33.3498
+ 0.0
+ M+H-H2O
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.6721
+ 3
+ 0
+ Feature Node
+ N/A
+ 1097331.9519446734
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10278.0","main.cluster index_upperinput":"10278.0"}
+ 10278
+ 19.6721
+ -1
+ This Node is a Singleton
+ N/A
+ 475.1938
+ N/A
+ 0.0
+ 475.1938
+
+
+ 39
+ 0.881582
+ CCMSLIB00004696002
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004696002
+ InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2
+ 0
+ ESI-QFT
+ InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2
+ 0.0
+ apigenin 6,8-digalactoside
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004696002
+ 26
+ 0.205103
+ Feature Node
+ N/A
+ 39
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF004939
+ apigenin 6,8-digalactoside
+ positive
+ MoNA:VF-NPL-QEHF004939
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7931.0","main.cluster index_upperinput":"7931.0"}
+ 0.205103
+ 3
+ N/A
+ MoNA
+ 3
+ 595.1659
+ CCMSLIB00004696002
+ 595.1659
+ 0.0
+ MoNA
+ 2866018.267371926
+ ESI-QFT
+ isolated
+ 0.00012207
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 11.0864
+ 5
+ 0.881582
+ 0.0
+ isolated
+ 7931
+ 0.00012207
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=26&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 11.0864
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.03
+ 8
+ 0
+ Feature Node
+ N/A
+ 1700052.2395256157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"190.0","main.cluster index_upperinput":"190.0"}
+ 190
+ 22.03
+ -1
+ This Node is a Singleton
+ N/A
+ 255.1582
+ N/A
+ 0.0
+ 255.1582
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8502
+ 8
+ 0
+ Feature Node
+ N/A
+ 4689152.785272506
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1239.0","main.cluster index_upperinput":"1239.0"}
+ 1239
+ 21.8502
+ -1
+ This Node is a Singleton
+ N/A
+ 250.1781
+ N/A
+ 0.0
+ 250.1781
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.5754
+ 9
+ 0
+ Feature Node
+ N/A
+ 10226561.266648717
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1495.0","main.cluster index_upperinput":"1495.0"}
+ 1495
+ 27.5754
+ -1
+ This Node is a Singleton
+ N/A
+ 315.1934
+ N/A
+ 0.0
+ 315.1934
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.8053
+ 5
+ 0
+ Feature Node
+ N/A
+ 1071400.8608769071
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20637.0","main.cluster index_upperinput":"20637.0"}
+ 20637
+ 10.8053
+ -1
+ This Node is a Singleton
+ N/A
+ 412.2324
+ N/A
+ 0.0
+ 412.2324
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.363
+ 4
+ 0
+ Feature Node
+ N/A
+ 2020330.0205620434
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1520.0","main.cluster index_upperinput":"1520.0"}
+ 1520
+ 33.363
+ 175
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=175&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1175.8667
+ N/A
+ 0.0
+ 1175.8667
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.729
+ 5
+ 0
+ Feature Node
+ N/A
+ 762544.6917031942
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7755.0","main.cluster index_upperinput":"7755.0"}
+ 7755
+ 19.729
+ -1
+ This Node is a Singleton
+ N/A
+ 271.1307
+ N/A
+ 0.0
+ 271.1307
+
+
+ 6
+ 0.7526510000000001
+ CCMSLIB00004693356
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693356
+ InChI=1S/C26H34O11/c1-33-17-6-5-14(10-18(17)35-26-23(32)22(31)21(30)20(12-29)36-26)24-16(11-28)15-8-13(4-3-7-27)9-19(34-2)25(15)37-24/h5-6,8-10,16,20-24,26-32H,3-4,7,11-12H2,1-2H3
+ 0
+ ESI-QFT
+ InChI=1S/C26H34O11/c1-33-17-6-5-14(10-18(17)35-26-23(32)22(31)21(30)20(12-29)36-26)24-16(11-28)15-8-13(4-3-7-27)9-19(34-2)25(15)37-24/h5-6,8-10,16,20-24,26-32H,3-4,7,11-12H2,1-2H3
+ 0.0
+ 2-(hydroxymethyl)-6-[5-[3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenoxy]oxane-3,4,5-triol
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693356
+ 124
+ 0.5648850000000001
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002293
+ 2-(hydroxymethyl)-6-[5-[3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenoxy]oxane-3,4,5-triol
+ positive
+ MoNA:VF-NPL-QEHF002293
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4670.0","main.cluster index_upperinput":"4670.0"}
+ 0.5648850000000001
+ 3
+ N/A
+ MoNA
+ 3
+ 540.2437
+ CCMSLIB00004693356
+ 540.2437
+ 0.0
+ MoNA
+ 2184297.3024828243
+ ESI-QFT
+ isolated
+ 0.000305176
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 12.9931
+ 4
+ 0.7526510000000001
+ 0.0
+ isolated
+ 4670
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=124&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 12.9931
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.4223
+ 6
+ 0
+ Feature Node
+ N/A
+ 21912680.22065202
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"12201.0","main.cluster index_upperinput":"12201.0"}
+ 12201
+ 10.4223
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2132
+ N/A
+ 0.0
+ 462.2132
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.8705
+ 9
+ 0
+ Feature Node
+ N/A
+ 12928462.035305316
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1274.0","main.cluster index_upperinput":"1274.0"}
+ 1274
+ 22.8705
+ -1
+ This Node is a Singleton
+ N/A
+ 353.2294
+ N/A
+ 0.0
+ 353.2294
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3684
+ 9
+ 0
+ Feature Node
+ N/A
+ 7808253.0728146145
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1383.0","main.cluster index_upperinput":"1383.0"}
+ 1383
+ 32.3684
+ -1
+ This Node is a Singleton
+ N/A
+ 379.2828
+ N/A
+ 0.0
+ 379.2828
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6184
+ 8
+ 0
+ Feature Node
+ N/A
+ 2736483.3134896574
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2505.0","main.cluster index_upperinput":"2505.0"}
+ 2505
+ 23.6184
+ 32
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 315.0864
+ N/A
+ 0.0
+ 315.0864
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8071
+ 4
+ 0
+ Feature Node
+ N/A
+ 3293385.4205220356
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1288.0","main.cluster index_upperinput":"1288.0"}
+ 1288
+ 16.8071
+ 37
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 469.2331
+ N/A
+ 0.0
+ 469.2331
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1233
+ 5
+ 0
+ Feature Node
+ N/A
+ 863455.1553997096
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1268.0","main.cluster index_upperinput":"1268.0"}
+ 1268
+ 23.1233
+ 53
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=53&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 539.2098
+ N/A
+ 0.0
+ 539.2098
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.2845
+ 6
+ 0
+ Feature Node
+ N/A
+ 3418720.6409419538
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3665.0","main.cluster index_upperinput":"3665.0"}
+ 3665
+ 28.2845
+ -1
+ This Node is a Singleton
+ N/A
+ 405.2044
+ N/A
+ 0.0
+ 405.2044
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.2792
+ 6
+ 0
+ Feature Node
+ N/A
+ 2299756.9516272238
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"150.0","main.cluster index_upperinput":"150.0"}
+ 150
+ 35.2792
+ 28
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=28&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3728
+ N/A
+ 0.0
+ 429.3728
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.3397
+ 7
+ 0
+ Feature Node
+ N/A
+ 9916311.435400225
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1409.0","main.cluster index_upperinput":"1409.0"}
+ 1409
+ 30.3397
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 677.3715
+ N/A
+ 0.0
+ 677.3715
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.7795
+ 6
+ 0
+ Feature Node
+ N/A
+ 2546614.7513837004
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10343.0","main.cluster index_upperinput":"10343.0"}
+ 10343
+ 4.7795
+ -1
+ This Node is a Singleton
+ N/A
+ 469.2015
+ N/A
+ 0.0
+ 469.2015
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.7859
+ 6
+ 0
+ Feature Node
+ N/A
+ 791300.0996119287
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2353.0","main.cluster index_upperinput":"2353.0"}
+ 2353
+ 8.7859
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2365
+ N/A
+ 0.0
+ 446.2365
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.2505
+ 4
+ 0
+ Feature Node
+ N/A
+ 1574037.1492890697
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3342.0","main.cluster index_upperinput":"3342.0"}
+ 3342
+ 30.2505
+ -1
+ This Node is a Singleton
+ N/A
+ 738.5482
+ N/A
+ 0.0
+ 738.5482
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0527
+ 4
+ 0
+ Feature Node
+ N/A
+ 1011593.8438341508
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3569.0","main.cluster index_upperinput":"3569.0"}
+ 3569
+ 19.0527
+ 4
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 347.0757
+ N/A
+ 0.0
+ 347.0757
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.5816
+ 7
+ 0
+ Feature Node
+ N/A
+ 5871422.193224185
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1947.0","main.cluster index_upperinput":"1947.0"}
+ 1947
+ 31.5816
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 427.3575
+ N/A
+ 0.0
+ 427.3575
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.273
+ 7
+ 0
+ Feature Node
+ N/A
+ 3771352.371402735
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1509.0","main.cluster index_upperinput":"1509.0"}
+ 1509
+ 16.273
+ 32
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 313.0702
+ N/A
+ 0.0
+ 313.0702
+
+
+ 28
+ 0.945888
+ CCMSLIB00005738462
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738462
+ 1S/C24H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)30-21-23(26)22-32-33(28,29)31-20-19-25(2,3)4/h23,26H,5-22H2,1-4H3
+ 0
+ qTof
+ 1S/C24H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)30-21-23(26)22-32-33(28,29)31-20-19-25(2,3)4/h23,26H,5-22H2,1-4H3
+ 0.0
+ Massbank:RP012103 PC(16:0/0:0)|Palmitoyllysolectithin|(3-hexadecanoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate
+ CCCCCCCCCCCCCCCC(=O)OCC(O)COP([O-])(=O)OCC[N+](C)(C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738462
+ 2
+ 1.5986200000000002
+ Feature Node
+ N/A
+ 28
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP012103 PC(16:0/0:0)|Palmitoyllysolectithin|(3-hexadecanoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1253.0","main.cluster index_upperinput":"1253.0"}
+ 1.5986200000000002
+ 3
+ CCCCCCCCCCCCCCCC(=O)OCC(O)COP([O-])(=O)OCC[N+](C)(C)C
+ Massbank
+ 3
+ 496.3408
+ CCMSLIB00005738462
+ 496.3408
+ 0.0
+ Massbank
+ 33160530.294679314
+ qTof
+ Isolated
+ 0.000793457
+ M+H
+ N/A
+ ESI
+ Positive
+ 30.7352
+ 9
+ 0.945888
+ 0.0
+ Isolated
+ 1253
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 30.7352
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.1012
+ 3
+ 0
+ Feature Node
+ N/A
+ 845711.1950708412
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4685.0","main.cluster index_upperinput":"4685.0"}
+ 4685
+ 20.1012
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 470.296
+ N/A
+ 0.0
+ 470.296
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.6563
+ 5
+ 0
+ Feature Node
+ N/A
+ 2091209.4667480686
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11703.0","main.cluster index_upperinput":"11703.0"}
+ 11703
+ 33.6563
+ -1
+ This Node is a Singleton
+ N/A
+ 797.5201
+ N/A
+ 0.0
+ 797.5201
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.3277
+ 2
+ 0
+ Feature Node
+ N/A
+ 586658.9455112463
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7822.0","main.cluster index_upperinput":"7822.0"}
+ 7822
+ 16.3277
+ 37
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 603.2104
+ N/A
+ 0.0
+ 603.2104
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4251
+ 1
+ 0
+ Feature Node
+ N/A
+ 8683405.30966857
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13609.0","main.cluster index_upperinput":"13609.0"}
+ 13609
+ 28.4251
+ 63
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=63&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 958.5222
+ N/A
+ 0.0
+ 958.5222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9136
+ 4
+ 0
+ Feature Node
+ N/A
+ 115865.6444994486
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3653.0","main.cluster index_upperinput":"3653.0"}
+ 3653
+ 19.9136
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=56&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 625.2679
+ N/A
+ 0.0
+ 625.2679
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1972
+ 6
+ 0
+ Feature Node
+ N/A
+ 3166950.839701846
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4519.0","main.cluster index_upperinput":"4519.0"}
+ 4519
+ 16.1972
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 433.1132
+ N/A
+ 0.0
+ 433.1132
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3567
+ 5
+ 0
+ Feature Node
+ N/A
+ 1686550.5015396692
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14391.0","main.cluster index_upperinput":"14391.0"}
+ 14391
+ 32.3567
+ -1
+ This Node is a Singleton
+ N/A
+ 347.2559
+ N/A
+ 0.0
+ 347.2559
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.3837
+ 2
+ 0
+ Feature Node
+ N/A
+ 3799942.867622849
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13648.0","main.cluster index_upperinput":"13648.0"}
+ 13648
+ 16.3837
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 464.1936
+ N/A
+ 0.0
+ 464.1936
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.7004
+ 2
+ 0
+ Feature Node
+ N/A
+ 573776.2029047015
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7799.0","main.cluster index_upperinput":"7799.0"}
+ 7799
+ 20.7004
+ -1
+ This Node is a Singleton
+ N/A
+ 429.1523
+ N/A
+ 0.0
+ 429.1523
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.3648
+ 8
+ 0
+ Feature Node
+ N/A
+ 1832658.6431269748
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9511.0","main.cluster index_upperinput":"9511.0"}
+ 9511
+ 29.3648
+ 20
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=20&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 469.3629
+ N/A
+ 0.0
+ 469.3629
+
+
+ 27
+ 0.829209
+ CCMSLIB00003139642
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139642
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 9Z,11E,13E-Octadecatrienoic acid methyl ester from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139642
+ 11
+ 1.0406799999999998
+ Feature Node
+ N/A
+ 27
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 9Z,11E,13E-Octadecatrienoic acid methyl ester from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1234.0","main.cluster index_upperinput":"1234.0"}
+ 1.0406799999999998
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 293.2467
+ CCMSLIB00003139642
+ 293.2467
+ 0.0
+ Data from Wolfender/Litaudon
+ 25796339.418756492
+ HCD
+ Isolated
+ 0.000305176
+ M+H
+ N/A
+ ESI
+ Positive
+ 33.2165
+ 9
+ 0.829209
+ 0.0
+ Isolated
+ 1234
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 33.2165
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.665
+ 1
+ 0
+ Feature Node
+ N/A
+ 672985.6030759403
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10372.0","main.cluster index_upperinput":"10372.0"}
+ 10372
+ 25.665
+ 112
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=112&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 731.3471
+ N/A
+ 0.0
+ 731.3471
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9288
+ 1
+ 0
+ Feature Node
+ N/A
+ 6781288.0921226675
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7633.0","main.cluster index_upperinput":"7633.0"}
+ 7633
+ 14.9288
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 279.0789
+ N/A
+ 0.0
+ 279.0789
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.731
+ 9
+ 0
+ Feature Node
+ N/A
+ 6909795.136533012
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2491.0","main.cluster index_upperinput":"2491.0"}
+ 2491
+ 25.731
+ 23
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 235.1688
+ N/A
+ 0.0
+ 235.1688
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.998
+ 8
+ 0
+ Feature Node
+ N/A
+ 1362950.8751596506
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4995.0","main.cluster index_upperinput":"4995.0"}
+ 4995
+ 23.998
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8904
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.6441
+ 1
+ 0
+ Feature Node
+ N/A
+ 460298.4115460711
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14059.0","main.cluster index_upperinput":"14059.0"}
+ 14059
+ 24.6441
+ -1
+ This Node is a Singleton
+ N/A
+ 253.1622
+ N/A
+ 0.0
+ 253.1622
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3332
+ 5
+ 0
+ Feature Node
+ N/A
+ 865170.8598434604
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1378.0","main.cluster index_upperinput":"1378.0"}
+ 1378
+ 22.3332
+ 53
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=53&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 453.1732
+ N/A
+ 0.0
+ 453.1732
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.9208
+ 6
+ 0
+ Feature Node
+ N/A
+ 1273196.915271754
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3636.0","main.cluster index_upperinput":"3636.0"}
+ 3636
+ 26.9208
+ -1
+ This Node is a Singleton
+ N/A
+ 529.2053
+ N/A
+ 0.0
+ 529.2053
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.3002
+ 6
+ 0
+ Feature Node
+ N/A
+ 8681293.6148144
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1181.0","main.cluster index_upperinput":"1181.0"}
+ 1181
+ 31.3002
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=99&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 617.1201
+ N/A
+ 0.0
+ 617.1201
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.4689
+ 3
+ 0
+ Feature Node
+ N/A
+ 1625856.871987003
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4595.0","main.cluster index_upperinput":"4595.0"}
+ 4595
+ 13.4689
+ -1
+ This Node is a Singleton
+ N/A
+ 476.1915
+ N/A
+ 0.0
+ 476.1915
+
+
+ 19
+ 0.726846
+ CCMSLIB00000206266
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000206266
+ 1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1
+ 0
+ LC-ESI-QTOF
+ 1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1
+ 0.0
+ Massbank: Nandrolone
+ [H]OC([H])(C([H])([H])4)C(C([H])([H])[H])(C([H])([H])3)C([H])(C([H])([H])4)C([H])(C([H])([H])1)C([H])(C([H])([H])3)C([H])(C([H])([H])2)C(=C([H])C(=O)C([H])([H])2)C([H])([H])1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000206266
+ 11
+ 4.32479
+ Feature Node
+ N/A
+ 19
+ 0.0
+ 0.0
+ Massbank
+ Massbank: Nandrolone
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1679.0","main.cluster index_upperinput":"1679.0"}
+ 4.32479
+ 3
+ [H]OC([H])(C([H])([H])4)C(C([H])([H])[H])(C([H])([H])3)C([H])(C([H])([H])4)C([H])(C([H])([H])1)C([H])(C([H])([H])3)C([H])(C([H])([H])2)C(=C([H])C(=O)C([H])([H])2)C([H])([H])1
+ Putative Massbank Match
+ 3
+ 275.1998
+ CCMSLIB00000206266
+ 275.1998
+ 0.0
+ Putative Massbank Match
+ 3151076.758354351
+ LC-ESI-QTOF
+ Isolated
+ 0.00119019
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 21.8768
+ 6
+ 0.726846
+ 0.0
+ Isolated
+ 1679
+ 0.00119019
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.8768
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1412
+ 8
+ 0
+ Feature Node
+ N/A
+ 33244922.325722415
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1405.0","main.cluster index_upperinput":"1405.0"}
+ 1405
+ 32.1412
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 309.2786
+ N/A
+ 0.0
+ 309.2786
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.4759
+ 5
+ 0
+ Feature Node
+ N/A
+ 864816.1545464223
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"19733.0","main.cluster index_upperinput":"19733.0"}
+ 19733
+ 10.4759
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.232
+ N/A
+ 0.0
+ 412.232
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.1187
+ 4
+ 0
+ Feature Node
+ N/A
+ 1528041.4223983928
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7130.0","main.cluster index_upperinput":"7130.0"}
+ 7130
+ 35.1187
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=99&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 707.1713
+ N/A
+ 0.0
+ 707.1713
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5996
+ 5
+ 0
+ Feature Node
+ N/A
+ 1614792.4175686832
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10296.0","main.cluster index_upperinput":"10296.0"}
+ 10296
+ 16.5996
+ -1
+ This Node is a Singleton
+ N/A
+ 463.1939
+ N/A
+ 0.0
+ 463.1939
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.6483
+ 1
+ 0
+ Feature Node
+ N/A
+ 2677542.054172869
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10250.0","main.cluster index_upperinput":"10250.0"}
+ 10250
+ 12.6483
+ -1
+ This Node is a Singleton
+ N/A
+ 879.3981
+ N/A
+ 0.0
+ 879.3981
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.4187
+ 7
+ 0
+ Feature Node
+ N/A
+ 12942112.25669604
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3580.0","main.cluster index_upperinput":"3580.0"}
+ 3580
+ 32.4187
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 599.4301
+ N/A
+ 0.0
+ 599.4301
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.6168
+ 5
+ 0
+ Feature Node
+ N/A
+ 1043427.7988200617
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3691.0","main.cluster index_upperinput":"3691.0"}
+ 3691
+ 26.6168
+ -1
+ This Node is a Singleton
+ N/A
+ 493.2811
+ N/A
+ 0.0
+ 493.2811
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.872
+ 7
+ 0
+ Feature Node
+ N/A
+ 3313045.3349876995
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4748.0","main.cluster index_upperinput":"4748.0"}
+ 4748
+ 15.872
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 447.0934
+ N/A
+ 0.0
+ 447.0934
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.7366
+ 7
+ 0
+ Feature Node
+ N/A
+ 1879142.2183384944
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"102.0","main.cluster index_upperinput":"102.0"}
+ 102
+ 23.7366
+ 33
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 534.2546
+ N/A
+ 0.0
+ 534.2546
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.1359
+ 7
+ 0
+ Feature Node
+ N/A
+ 9010850.106906014
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1293.0","main.cluster index_upperinput":"1293.0"}
+ 1293
+ 31.1359
+ 130
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=130&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 389.2667
+ N/A
+ 0.0
+ 389.2667
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.3922
+ 4
+ 0
+ Feature Node
+ N/A
+ 2611622.572847216
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8182.0","main.cluster index_upperinput":"8182.0"}
+ 8182
+ 12.3922
+ -1
+ This Node is a Singleton
+ N/A
+ 547.215
+ N/A
+ 0.0
+ 547.215
+
+
+ 17
+ 0.8008270000000001
+ CCMSLIB00003139642
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139642
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 9Z,11E,13E-Octadecatrienoic acid methyl ester from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139642
+ 11
+ 0.0
+ Feature Node
+ N/A
+ 17
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 9Z,11E,13E-Octadecatrienoic acid methyl ester from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1221.0","main.cluster index_upperinput":"1221.0"}
+ 0.0
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 293.247
+ CCMSLIB00003139642
+ 293.247
+ 0.0
+ Data from Wolfender/Litaudon
+ 21798568.04603951
+ HCD
+ Isolated
+ 0.0
+ M+H
+ N/A
+ ESI
+ Positive
+ 29.9129
+ 9
+ 0.8008270000000001
+ 0.0
+ Isolated
+ 1221
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 29.9129
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.9754
+ 7
+ 0
+ Feature Node
+ N/A
+ 1922768.5950194749
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1187.0","main.cluster index_upperinput":"1187.0"}
+ 1187
+ 13.9754
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 359.1491
+ N/A
+ 0.0
+ 359.1491
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1591
+ 2
+ 0
+ Feature Node
+ N/A
+ 3706337.8598993635
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7635.0","main.cluster index_upperinput":"7635.0"}
+ 7635
+ 32.1591
+ 96
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=96&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 641.3673
+ N/A
+ 0.0
+ 641.3673
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.2676
+ 7
+ 0
+ Feature Node
+ N/A
+ 6232294.578127155
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7708.0","main.cluster index_upperinput":"7708.0"}
+ 7708
+ 22.2676
+ -1
+ This Node is a Singleton
+ N/A
+ 337.069
+ N/A
+ 0.0
+ 337.069
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.0491
+ 1
+ 0
+ Feature Node
+ N/A
+ 2948162.718896355
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13721.0","main.cluster index_upperinput":"13721.0"}
+ 13721
+ 21.0491
+ 64
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 790.3434
+ N/A
+ 0.0
+ 790.3434
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.4225
+ 8
+ 0
+ Feature Node
+ N/A
+ 2105111.6526007983
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8538.0","main.cluster index_upperinput":"8538.0"}
+ 8538
+ 12.4225
+ -1
+ This Node is a Singleton
+ N/A
+ 542.2589
+ N/A
+ 0.0
+ 542.2589
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.3785
+ 5
+ 0
+ Feature Node
+ N/A
+ 5509889.304401414
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4662.0","main.cluster index_upperinput":"4662.0"}
+ 4662
+ 11.3785
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.238
+ N/A
+ 0.0
+ 446.238
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8615
+ 2
+ 0
+ Feature Node
+ N/A
+ 145001.36983562662
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8167.0","main.cluster index_upperinput":"8167.0"}
+ 8167
+ 23.8615
+ -1
+ This Node is a Singleton
+ N/A
+ 593.2024
+ N/A
+ 0.0
+ 593.2024
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9542
+ 8
+ 0
+ Feature Node
+ N/A
+ 4982644.703698013
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8014.0","main.cluster index_upperinput":"8014.0"}
+ 8014
+ 33.9542
+ 47
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=47&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 639.2825
+ N/A
+ 0.0
+ 639.2825
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.9009
+ 7
+ 0
+ Feature Node
+ N/A
+ 389005.4033094855
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7728.0","main.cluster index_upperinput":"7728.0"}
+ 7728
+ 29.9009
+ -1
+ This Node is a Singleton
+ N/A
+ 483.3802
+ N/A
+ 0.0
+ 483.3802
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.9208
+ 5
+ 0
+ Feature Node
+ N/A
+ 7217362.1488494305
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4618.0","main.cluster index_upperinput":"4618.0"}
+ 4618
+ 17.9208
+ 81
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 396.2028
+ N/A
+ 0.0
+ 396.2028
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8922
+ 7
+ 0
+ Feature Node
+ N/A
+ 225310505.04809976
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"12784.0","main.cluster index_upperinput":"12784.0"}
+ 12784
+ 32.8922
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 343.3389
+ N/A
+ 0.0
+ 343.3389
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.0677
+ 3
+ 0
+ Feature Node
+ N/A
+ 1148557.0800015137
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8411.0","main.cluster index_upperinput":"8411.0"}
+ 8411
+ 4.0677
+ 61
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=61&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2069
+ N/A
+ 0.0
+ 478.2069
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.7018
+ 2
+ 0
+ Feature Node
+ N/A
+ 2542376.472325719
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4854.0","main.cluster index_upperinput":"4854.0"}
+ 4854
+ 9.7018
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2385
+ N/A
+ 0.0
+ 446.2385
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.5685
+ 4
+ 0
+ Feature Node
+ N/A
+ 1064813.0610407442
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5023.0","main.cluster index_upperinput":"5023.0"}
+ 5023
+ 26.5685
+ -1
+ This Node is a Singleton
+ N/A
+ 574.3248
+ N/A
+ 0.0
+ 574.3248
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.6946
+ 7
+ 0
+ Feature Node
+ N/A
+ 825549.9773699206
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8135.0","main.cluster index_upperinput":"8135.0"}
+ 8135
+ 15.6946
+ -1
+ This Node is a Singleton
+ N/A
+ 349.1256
+ N/A
+ 0.0
+ 349.1256
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.4442
+ 8
+ 0
+ Feature Node
+ N/A
+ 1316907.074332047
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1282.0","main.cluster index_upperinput":"1282.0"}
+ 1282
+ 15.4442
+ -1
+ This Node is a Singleton
+ N/A
+ 287.1257
+ N/A
+ 0.0
+ 287.1257
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.6807
+ 4
+ 0
+ Feature Node
+ N/A
+ 2350327.6692292867
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2497.0","main.cluster index_upperinput":"2497.0"}
+ 2497
+ 18.6807
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 528.2598
+ N/A
+ 0.0
+ 528.2598
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.0716
+ 4
+ 0
+ Feature Node
+ N/A
+ 19954651.248197477
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13628.0","main.cluster index_upperinput":"13628.0"}
+ 13628
+ 11.0716
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 436.1966
+ N/A
+ 0.0
+ 436.1966
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.3112
+ 4
+ 0
+ Feature Node
+ N/A
+ 6189809.810185551
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1176.0","main.cluster index_upperinput":"1176.0"}
+ 1176
+ 16.3112
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.2488
+ N/A
+ 0.0
+ 536.2488
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.0625
+ 8
+ 0
+ Feature Node
+ N/A
+ 872251.6705952093
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"178.0","main.cluster index_upperinput":"178.0"}
+ 178
+ 23.0625
+ 53
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=53&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 453.1736
+ N/A
+ 0.0
+ 453.1736
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.6546
+ 5
+ 0
+ Feature Node
+ N/A
+ 21428411.443243675
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"354.0","main.cluster index_upperinput":"354.0"}
+ 354
+ 24.6546
+ -1
+ This Node is a Singleton
+ N/A
+ 351.0843
+ N/A
+ 0.0
+ 351.0843
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.6749
+ 6
+ 0
+ Feature Node
+ N/A
+ 15023234.265443355
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1454.0","main.cluster index_upperinput":"1454.0"}
+ 1454
+ 19.6749
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 606.2576
+ N/A
+ 0.0
+ 606.2576
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.1924
+ 5
+ 0
+ Feature Node
+ N/A
+ 10641491.570010342
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9700.0","main.cluster index_upperinput":"9700.0"}
+ 9700
+ 20.1924
+ -1
+ This Node is a Singleton
+ N/A
+ 385.1635
+ N/A
+ 0.0
+ 385.1635
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.9186
+ 5
+ 0
+ Feature Node
+ N/A
+ 6745616.419210746
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2479.0","main.cluster index_upperinput":"2479.0"}
+ 2479
+ 18.9186
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1223
+ N/A
+ 0.0
+ 229.1223
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9967
+ 4
+ 0
+ Feature Node
+ N/A
+ 6941327.361369176
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7632.0","main.cluster index_upperinput":"7632.0"}
+ 7632
+ 14.9967
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 297.0885
+ N/A
+ 0.0
+ 297.0885
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.1477
+ 6
+ 0
+ Feature Node
+ N/A
+ 4428535.347234422
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1203.0","main.cluster index_upperinput":"1203.0"}
+ 1203
+ 33.1477
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 850.2512
+ N/A
+ 0.0
+ 850.2512
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3942
+ 8
+ 0
+ Feature Node
+ N/A
+ 3647912.975697018
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5233.0","main.cluster index_upperinput":"5233.0"}
+ 5233
+ 22.3942
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8899
+ N/A
+ 0.0
+ 84.945
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3735
+ 8
+ 0
+ Feature Node
+ N/A
+ 1210131.499192173
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"193.0","main.cluster index_upperinput":"193.0"}
+ 193
+ 22.3735
+ -1
+ This Node is a Singleton
+ N/A
+ 242.2842
+ N/A
+ 0.0
+ 242.2842
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.0276
+ 9
+ 0
+ Feature Node
+ N/A
+ 2545638.721954119
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"97.0","main.cluster index_upperinput":"97.0"}
+ 97
+ 25.0276
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 227.1643
+ N/A
+ 0.0
+ 227.1643
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.028
+ 2
+ 0
+ Feature Node
+ N/A
+ 107521.89510910326
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4965.0","main.cluster index_upperinput":"4965.0"}
+ 4965
+ 26.028
+ -1
+ This Node is a Singleton
+ N/A
+ 789.4404
+ N/A
+ 0.0
+ 789.4404
+
+
+ 47
+ 0.9626459999999999
+ CCMSLIB00004694670
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694670
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0.0
+ arctiin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694670
+ 85
+ 1.43679
+ Feature Node
+ N/A
+ 47
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF003607
+ arctiin
+ positive
+ MoNA:VF-NPL-QEHF003607
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1521.0","main.cluster index_upperinput":"1521.0"}
+ 1.43679
+ 3
+ N/A
+ MoNA
+ 3
+ 552.2432
+ CCMSLIB00004694670
+ 552.2432
+ 0.0
+ MoNA
+ 10785461.673689043
+ ESI-QFT
+ isolated
+ 0.000793457
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 15.6267
+ 6
+ 0.9626459999999999
+ 0.0
+ isolated
+ 1521
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.6267
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.0898
+ 8
+ 0
+ Feature Node
+ N/A
+ 5500773.39476157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"24.0","main.cluster index_upperinput":"24.0"}
+ 24
+ 26.0898
+ 23
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 235.169
+ N/A
+ 0.0
+ 235.169
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.6871
+ 7
+ 0
+ Feature Node
+ N/A
+ 1829514.8975435377
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4880.0","main.cluster index_upperinput":"4880.0"}
+ 4880
+ 31.6871
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 347.3154
+ N/A
+ 0.0
+ 347.3154
+
+
+ 7
+ 0.901387
+ CCMSLIB00005738172
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738172
+ 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
+ 0
+ qTof
+ 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
+ 0.0
+ Massbank:RP019903 Dibutylphthalate|dibutyl phthalate|dibutyl benzene-1,2-dicarboxylate
+ CCCCOC(=O)c1ccccc1C(=O)OCCCC
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738172
+ 105
+ 1.0932
+ Feature Node
+ N/A
+ 7
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP019903 Dibutylphthalate|dibutyl phthalate|dibutyl benzene-1,2-dicarboxylate
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10243.0","main.cluster index_upperinput":"10243.0"}
+ 1.0932
+ 3
+ CCCCOC(=O)c1ccccc1C(=O)OCCCC
+ Massbank
+ 3
+ 279.1593
+ CCMSLIB00005738172
+ 279.1593
+ 0.0
+ Massbank
+ 10960140.698794415
+ qTof
+ Isolated
+ 0.000305176
+ M+H
+ N/A
+ ESI
+ Positive
+ 27.3205
+ 5
+ 0.901387
+ 0.0
+ Isolated
+ 10243
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=105&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 27.3205
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.6587
+ 5
+ 0
+ Feature Node
+ N/A
+ 1567881.4715333274
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4565.0","main.cluster index_upperinput":"4565.0"}
+ 4565
+ 10.6587
+ 38
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 193.0498
+ N/A
+ 0.0
+ 193.0498
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.0836
+ 6
+ 0
+ Feature Node
+ N/A
+ 1816696.9660786265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"42.0","main.cluster index_upperinput":"42.0"}
+ 42
+ 32.0836
+ -1
+ This Node is a Singleton
+ N/A
+ 449.3406
+ N/A
+ 0.0
+ 449.3406
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.5537
+ 9
+ 0
+ Feature Node
+ N/A
+ 3103097.5518360315
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1271.0","main.cluster index_upperinput":"1271.0"}
+ 1271
+ 24.5537
+ -1
+ This Node is a Singleton
+ N/A
+ 227.1641
+ N/A
+ 0.0
+ 227.1641
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.3362
+ 4
+ 0
+ Feature Node
+ N/A
+ 1214156.7007526532
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10339.0","main.cluster index_upperinput":"10339.0"}
+ 10339
+ 15.3362
+ 52
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 564.2792
+ N/A
+ 0.0
+ 564.2792
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.3577
+ 9
+ 0
+ Feature Node
+ N/A
+ 4259759.203935113
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2570.0","main.cluster index_upperinput":"2570.0"}
+ 2570
+ 28.3577
+ -1
+ This Node is a Singleton
+ N/A
+ 309.2041
+ N/A
+ 0.0
+ 309.2041
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.9465
+ 5
+ 0
+ Feature Node
+ N/A
+ 583187.6048031957
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3601.0","main.cluster index_upperinput":"3601.0"}
+ 3601
+ 20.9465
+ 4
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 361.0917
+ N/A
+ 0.0
+ 361.0917
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.1198
+ 7
+ 0
+ Feature Node
+ N/A
+ 4575937.329302846
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3582.0","main.cluster index_upperinput":"3582.0"}
+ 3582
+ 27.1198
+ -1
+ This Node is a Singleton
+ N/A
+ 391.2455
+ N/A
+ 0.0
+ 391.2455
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.4307
+ 9
+ 0
+ Feature Node
+ N/A
+ 1381952.1110339903
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1292.0","main.cluster index_upperinput":"1292.0"}
+ 1292
+ 1.4307
+ 88
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 144.0655
+ N/A
+ 0.0
+ 144.0655
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.6147
+ 8
+ 0
+ Feature Node
+ N/A
+ 2967952.7515695747
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"43.0","main.cluster index_upperinput":"43.0"}
+ 43
+ 22.6147
+ -1
+ This Node is a Singleton
+ N/A
+ 250.1781
+ N/A
+ 0.0
+ 250.1781
+
+
+ 32
+ 0.845599
+ CCMSLIB00005778294
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005778294
+ 1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22+,23+,25-,26-/m0/s1
+ 0
+ qTof
+ 1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22+,23+,25-,26-/m0/s1
+ 0.0
+ Massbank:FIO00721 Isoschaftoside
+ Oc(c([C@H](O5)[C@@H]([C@H]([C@@H]([C@H]5CO)O)O)O)1)c([C@H](O4)[C@@H]([C@@H](O)[C@@H](O)C4)O)c(c(C2=O)c1OC(c(c3)ccc(O)c3)=C2)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005778294
+ 26
+ 1.72796
+ Feature Node
+ N/A
+ 32
+ 0.0
+ 0.0
+ Massbank
+ Massbank:FIO00721 Isoschaftoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7859.0","main.cluster index_upperinput":"7859.0"}
+ 1.72796
+ 3
+ Oc(c([C@H](O5)[C@@H]([C@H]([C@@H]([C@H]5CO)O)O)O)1)c([C@H](O4)[C@@H]([C@@H](O)[C@@H](O)C4)O)c(c(C2=O)c1OC(c(c3)ccc(O)c3)=C2)O
+ Massbank
+ 3
+ 565.156
+ CCMSLIB00005778294
+ 565.156
+ 0.0
+ Massbank
+ 5928452.88468615
+ qTof
+ Isolated
+ 0.0009765619999999999
+ M+H
+ N/A
+ ESI
+ Positive
+ 12.2992
+ 4
+ 0.845599
+ 0.0
+ Isolated
+ 7859
+ 0.0009765619999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=26&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 12.2992
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.811
+ 9
+ 0
+ Feature Node
+ N/A
+ 2077875.5549563565
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8283.0","main.cluster index_upperinput":"8283.0"}
+ 8283
+ 4.811
+ -1
+ This Node is a Singleton
+ N/A
+ 193.0859
+ N/A
+ 0.0
+ 193.0859
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.612
+ 5
+ 0
+ Feature Node
+ N/A
+ 1627732.038066816
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4585.0","main.cluster index_upperinput":"4585.0"}
+ 4585
+ 13.612
+ -1
+ This Node is a Singleton
+ N/A
+ 394.2218
+ N/A
+ 0.0
+ 394.2218
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6283
+ 4
+ 0
+ Feature Node
+ N/A
+ 5992824.41077976
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3523.0","main.cluster index_upperinput":"3523.0"}
+ 3523
+ 32.6283
+ -1
+ This Node is a Singleton
+ N/A
+ 419.2772
+ N/A
+ 0.0
+ 419.2772
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.645
+ 8
+ 0
+ Feature Node
+ N/A
+ 5604246.928276086
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2571.0","main.cluster index_upperinput":"2571.0"}
+ 2571
+ 33.645
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 568.1917
+ N/A
+ 0.0
+ 568.1917
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8036
+ 4
+ 0
+ Feature Node
+ N/A
+ 1653893.7989523215
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10297.0","main.cluster index_upperinput":"10297.0"}
+ 10297
+ 16.8036
+ -1
+ This Node is a Singleton
+ N/A
+ 552.2445
+ N/A
+ 0.0
+ 552.2445
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.7831
+ 7
+ 0
+ Feature Node
+ N/A
+ 3122347.048803833
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14891.0","main.cluster index_upperinput":"14891.0"}
+ 14891
+ 4.7831
+ -1
+ This Node is a Singleton
+ N/A
+ 395.1311
+ N/A
+ 0.0
+ 395.1311
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.2096
+ 7
+ 0
+ Feature Node
+ N/A
+ 6115501.704338637
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2744.0","main.cluster index_upperinput":"2744.0"}
+ 2744
+ 32.2096
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 510.4367
+ N/A
+ 0.0
+ 510.4367
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.829
+ 7
+ 0
+ Feature Node
+ N/A
+ 5046156.826898968
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9004.0","main.cluster index_upperinput":"9004.0"}
+ 9004
+ 34.829
+ 47
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=47&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 639.2819
+ N/A
+ 0.0
+ 639.2819
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7646
+ 4
+ 0
+ Feature Node
+ N/A
+ 622345.6872420048
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7766.0","main.cluster index_upperinput":"7766.0"}
+ 7766
+ 17.7646
+ -1
+ This Node is a Singleton
+ N/A
+ 229.1224
+ N/A
+ 0.0
+ 229.1224
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5912
+ 8
+ 0
+ Feature Node
+ N/A
+ 49376419.099483415
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3721.0","main.cluster index_upperinput":"3721.0"}
+ 3721
+ 33.5912
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 311.3123
+ N/A
+ 0.0
+ 311.3123
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.5837
+ 9
+ 0
+ Feature Node
+ N/A
+ 5300388.506654087
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"54.0","main.cluster index_upperinput":"54.0"}
+ 54
+ 31.5837
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 630.191
+ N/A
+ 0.0
+ 630.191
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.9444
+ 7
+ 0
+ Feature Node
+ N/A
+ 7299147.455741209
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4566.0","main.cluster index_upperinput":"4566.0"}
+ 4566
+ 17.9444
+ -1
+ This Node is a Singleton
+ N/A
+ 401.158
+ N/A
+ 0.0
+ 401.158
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6988
+ 9
+ 0
+ Feature Node
+ N/A
+ 3306148.9255757104
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5984.0","main.cluster index_upperinput":"5984.0"}
+ 5984
+ 25.6988
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.986
+ 5
+ 0
+ Feature Node
+ N/A
+ 1310405.5732964026
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3725.0","main.cluster index_upperinput":"3725.0"}
+ 3725
+ 19.986
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 558.3484
+ N/A
+ 0.0
+ 558.3484
+
+
+ 6
+ 0.759579
+ CCMSLIB00005742378
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0
+ qTof
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0.0
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 8
+ 0.0
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2703.0","main.cluster index_upperinput":"2703.0"}
+ 0.0
+ 3
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ Massbank
+ 3
+ 509.129
+ CCMSLIB00005742378
+ 509.129
+ 0.0
+ Massbank
+ 2281197.6235761913
+ qTof
+ Isolated
+ 0.0
+ M+H
+ N/A
+ ESI
+ Positive
+ 15.7808
+ 4
+ 0.759579
+ 0.0
+ Isolated
+ 2703
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.7808
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.169
+ 8
+ 0
+ Feature Node
+ N/A
+ 2907207.0638428433
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11531.0","main.cluster index_upperinput":"11531.0"}
+ 11531
+ 23.169
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8904
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.2191
+ 2
+ 0
+ Feature Node
+ N/A
+ 5348375.667601779
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7623.0","main.cluster index_upperinput":"7623.0"}
+ 7623
+ 21.2191
+ -1
+ This Node is a Singleton
+ N/A
+ 405.1085
+ N/A
+ 0.0
+ 405.1085
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.7865
+ 8
+ 0
+ Feature Node
+ N/A
+ 11703055.69420084
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1590.0","main.cluster index_upperinput":"1590.0"}
+ 1590
+ 34.7865
+ -1
+ This Node is a Singleton
+ N/A
+ 716.5672
+ N/A
+ 0.0
+ 716.5672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.783
+ 3
+ 0
+ Feature Node
+ N/A
+ 1051007.5219368057
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4686.0","main.cluster index_upperinput":"4686.0"}
+ 4686
+ 20.783
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 558.3486
+ N/A
+ 0.0
+ 558.3486
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6951
+ 5
+ 0
+ Feature Node
+ N/A
+ 206583.78931104613
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20565.0","main.cluster index_upperinput":"20565.0"}
+ 20565
+ 23.6951
+ 86
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=86&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.2797
+ N/A
+ 0.0
+ 441.2797
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.832
+ 2
+ 0
+ Feature Node
+ N/A
+ 3728207.0097804265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13647.0","main.cluster index_upperinput":"13647.0"}
+ 13647
+ 29.832
+ -1
+ This Node is a Singleton
+ N/A
+ 857.453
+ N/A
+ 0.0
+ 857.453
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3565
+ 9
+ 0
+ Feature Node
+ N/A
+ 9805830.617363598
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1423.0","main.cluster index_upperinput":"1423.0"}
+ 1423
+ 32.3565
+ -1
+ This Node is a Singleton
+ N/A
+ 303.2293
+ N/A
+ 0.0
+ 303.2293
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5783
+ 9
+ 0
+ Feature Node
+ N/A
+ 2541665.283759132
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2569.0","main.cluster index_upperinput":"2569.0"}
+ 2569
+ 16.5783
+ -1
+ This Node is a Singleton
+ N/A
+ 219.1739
+ N/A
+ 0.0
+ 219.1739
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.2043
+ 4
+ 0
+ Feature Node
+ N/A
+ 1700003.321689792
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4766.0","main.cluster index_upperinput":"4766.0"}
+ 4766
+ 15.2043
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2387
+ N/A
+ 0.0
+ 446.2387
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.2738
+ 7
+ 0
+ Feature Node
+ N/A
+ 5172630.1692460375
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1167.0","main.cluster index_upperinput":"1167.0"}
+ 1167
+ 21.2738
+ -1
+ This Node is a Singleton
+ N/A
+ 810.3558
+ N/A
+ 0.0
+ 810.3558
+
+
+ 36
+ 0.8503629999999999
+ CCMSLIB00004705627
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705627
+ InChI=1S/C19H18O7/c1-22-10-5-6-11(14(7-10)23-2)15-8-12(20)17-13(21)9-16(24-3)18(25-4)19(17)26-15/h5-9,21H,1-4H3
+ 0
+ ESI-QFT
+ InChI=1S/C19H18O7/c1-22-10-5-6-11(14(7-10)23-2)15-8-12(20)17-13(21)9-16(24-3)18(25-4)19(17)26-15/h5-9,21H,1-4H3
+ 0.0
+ 5-Hydroxy-2',4',7,8-Tetramethoxyflavone
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705627
+ 4
+ 1.10475
+ Feature Node
+ N/A
+ 36
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF014564
+ 5-Hydroxy-2',4',7,8-Tetramethoxyflavone
+ positive
+ MoNA:VF-NPL-QEHF014564
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7878.0","main.cluster index_upperinput":"7878.0"}
+ 1.10475
+ 3
+ N/A
+ MoNA
+ 3
+ 359.1134
+ CCMSLIB00004705627
+ 359.1134
+ 0.0
+ MoNA
+ 8300232.0915521635
+ ESI-QFT
+ isolated
+ 0.000396729
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 23.387
+ 6
+ 0.8503629999999999
+ 0.0
+ isolated
+ 7878
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 23.387
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.4699
+ 3
+ 0
+ Feature Node
+ N/A
+ 260131.59090840738
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2565.0","main.cluster index_upperinput":"2565.0"}
+ 2565
+ 22.4699
+ -1
+ This Node is a Singleton
+ N/A
+ 360.217
+ N/A
+ 0.0
+ 360.217
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.7642
+ 6
+ 0
+ Feature Node
+ N/A
+ 2674951.4371559597
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1479.0","main.cluster index_upperinput":"1479.0"}
+ 1479
+ 33.7642
+ 96
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=96&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 653.4754
+ N/A
+ 0.0
+ 653.4754
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.9065
+ 7
+ 0
+ Feature Node
+ N/A
+ 4270006.985895708
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1166.0","main.cluster index_upperinput":"1166.0"}
+ 1166
+ 13.9065
+ 35
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=35&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 543.1842
+ N/A
+ 0.0
+ 543.1842
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.622
+ 8
+ 0
+ Feature Node
+ N/A
+ 6584537.46024011
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3738.0","main.cluster index_upperinput":"3738.0"}
+ 3738
+ 33.622
+ -1
+ This Node is a Singleton
+ N/A
+ 395.3138
+ N/A
+ 0.0
+ 395.3138
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.8578
+ 6
+ 0
+ Feature Node
+ N/A
+ 1003523.9809235106
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4552.0","main.cluster index_upperinput":"4552.0"}
+ 4552
+ 33.8578
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 656.2256
+ N/A
+ 0.0
+ 656.2256
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2154
+ 3
+ 0
+ Feature Node
+ N/A
+ 6145393.172708221
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7.0","main.cluster index_upperinput":"7.0"}
+ 7
+ 33.2154
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 959.5725
+ N/A
+ 0.0
+ 959.5725
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.3122
+ 9
+ 0
+ Feature Node
+ N/A
+ 718268.1599596309
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"412.0","main.cluster index_upperinput":"412.0"}
+ 412
+ 25.3122
+ -1
+ This Node is a Singleton
+ N/A
+ 263.2215
+ N/A
+ 0.0
+ 263.2215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2669
+ 4
+ 0
+ Feature Node
+ N/A
+ 1260307.1010284186
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10311.0","main.cluster index_upperinput":"10311.0"}
+ 10311
+ 23.2669
+ -1
+ This Node is a Singleton
+ N/A
+ 531.3496
+ N/A
+ 0.0
+ 531.3496
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.4107
+ 7
+ 0
+ Feature Node
+ N/A
+ 1389743.6248976677
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1349.0","main.cluster index_upperinput":"1349.0"}
+ 1349
+ 13.4107
+ -1
+ This Node is a Singleton
+ N/A
+ 289.1407
+ N/A
+ 0.0
+ 289.1407
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0607
+ 7
+ 0
+ Feature Node
+ N/A
+ 23885185.65127536
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"17.0","main.cluster index_upperinput":"17.0"}
+ 17
+ 34.0607
+ 65
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=65&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 463.3772
+ N/A
+ 0.0
+ 463.3772
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.0567
+ 9
+ 0
+ Feature Node
+ N/A
+ 8194891.820347122
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3678.0","main.cluster index_upperinput":"3678.0"}
+ 3678
+ 32.0567
+ 182
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=182&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.2988
+ N/A
+ 0.0
+ 441.2988
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.0615
+ 9
+ 0
+ Feature Node
+ N/A
+ 2650411.082622042
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"86.0","main.cluster index_upperinput":"86.0"}
+ 86
+ 25.0615
+ -1
+ This Node is a Singleton
+ N/A
+ 267.1571
+ N/A
+ 0.0
+ 267.1571
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.964
+ 7
+ 0
+ Feature Node
+ N/A
+ 13742807.597437948
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7661.0","main.cluster index_upperinput":"7661.0"}
+ 7661
+ 0.964
+ -1
+ This Node is a Singleton
+ N/A
+ 232.1177
+ N/A
+ 0.0
+ 232.1177
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.195
+ 4
+ 0
+ Feature Node
+ N/A
+ 1026702.9907043057
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4684.0","main.cluster index_upperinput":"4684.0"}
+ 4684
+ 19.195
+ 16
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=16&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.2165
+ N/A
+ 0.0
+ 607.2165
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.8289
+ 4
+ 0
+ Feature Node
+ N/A
+ 1951739.9415684207
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4568.0","main.cluster index_upperinput":"4568.0"}
+ 4568
+ 14.8289
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 243.1015
+ N/A
+ 0.0
+ 243.1015
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.5818
+ 6
+ 0
+ Feature Node
+ N/A
+ 2274765.7208027355
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10284.0","main.cluster index_upperinput":"10284.0"}
+ 10284
+ 12.5818
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.2529
+ N/A
+ 0.0
+ 496.2529
+
+
+ 54
+ 0.8506389999999999
+ CCMSLIB00004718161
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718161
+ InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3
+ 0
+ ESI-QTOF
+ InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3
+ 0.0
+ cirsimaritin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718161
+ 4
+ 1.9371
+ Feature Node
+ N/A
+ 54
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QTOF000610
+ cirsimaritin
+ positive
+ MoNA:VF-NPL-QTOF000610
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4674.0","main.cluster index_upperinput":"4674.0"}
+ 1.9371
+ 3
+ N/A
+ MoNA
+ 3
+ 315.0866
+ CCMSLIB00004718161
+ 315.0866
+ 0.0
+ MoNA
+ 29513265.39611353
+ ESI-QTOF
+ isolated
+ 0.000610352
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 22.3126
+ 6
+ 0.8506389999999999
+ 0.0
+ isolated
+ 4674
+ 0.000610352
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 22.3126
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.172
+ 3
+ 0
+ Feature Node
+ N/A
+ 274897.9891054763
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4650.0","main.cluster index_upperinput":"4650.0"}
+ 4650
+ 19.172
+ 137
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=137&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 559.195
+ N/A
+ 0.0
+ 559.195
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.2692
+ 2
+ 0
+ Feature Node
+ N/A
+ 381682.63597673544
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8032.0","main.cluster index_upperinput":"8032.0"}
+ 8032
+ 4.2692
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 452.184
+ N/A
+ 0.0
+ 452.184
+
+
+ 10
+ 0.876085
+ CCMSLIB00000851805
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000851805
+ InChI=1S/C45H73NO15/c1-19-6-9-27-20(2)31-28(46(27)16-19)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)57-43-40(61-41-37(54)35(52)32(49)21(3)56-41)39(34(51)30(18-48)59-43)60-42-38(55)36(53)33(50)29(17-47)58-42/h7,19-21,23-43,47-55H,6,8-18H2,1-5H3/t19-,20+,21-,23?,24+,25-,26-,27+,28-,29+,30+,31-,32-,33+,34+,35+,36-,37+,38+,39-,40-,41-,42-,43+,44-,45-/m0/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C45H73NO15/c1-19-6-9-27-20(2)31-28(46(27)16-19)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)57-43-40(61-41-37(54)35(52)32(49)21(3)56-41)39(34(51)30(18-48)59-43)60-42-38(55)36(53)33(50)29(17-47)58-42/h7,19-21,23-43,47-55H,6,8-18H2,1-5H3/t19-,20+,21-,23?,24+,25-,26-,27+,28-,29+,30+,31-,32-,33+,34+,35+,36-,37+,38+,39-,40-,41-,42-,43+,44-,45-/m0/s1
+ 0.0
+ NCGC00169933-02_C45H73NO15_beta-D-Mannopyranoside, solanid-5-en-3-yl O-6-deoxy-alpha-L-mannopyranosyl-(1->2)-O-[beta-D-glucopyranosyl-(1->3)]-
+ C[C@H]1CC[C@@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5C\\C=C6\\CC(CC[C@]6(C)[C@H]5CC[C@]34C)O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@H]7O[C@@H]9O[C@@H](C)[C@H](O)[C@@H](O)[C@H]9O)N2C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000851805
+ -1
+ 0.21082800000000002
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00169933-02_C45H73NO15_beta-D-Mannopyranoside, solanid-5-en-3-yl O-6-deoxy-alpha-L-mannopyranosyl-(1->2)-O-[beta-D-glucopyranosyl-(1->3)]-
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2485.0","main.cluster index_upperinput":"2485.0"}
+ 0.21082800000000002
+ 1
+ C[C@H]1CC[C@@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5C\\C=C6\\CC(CC[C@]6(C)[C@H]5CC[C@]34C)O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@H]7O[C@@H]9O[C@@H](C)[C@H](O)[C@@H](O)[C@H]9O)N2C1
+ Jadhav/Dorrestein
+ 1
+ 868.5048
+ CCMSLIB00000851805
+ 868.5048
+ 0.0
+ Jadhav/Dorrestein
+ 4840147.189865526
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.000183105
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 18.6476
+ 3
+ 0.876085
+ 0.0
+ isolated
+ 2485
+ 0.000183105
+ This Node is a Singleton
+ 18.6476
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.567
+ 6
+ 0
+ Feature Node
+ N/A
+ 715764.5743405733
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7699.0","main.cluster index_upperinput":"7699.0"}
+ 7699
+ 29.567
+ -1
+ This Node is a Singleton
+ N/A
+ 355.2253
+ N/A
+ 0.0
+ 355.2253
+
+
+ 31
+ 0.8452850000000001
+ CCMSLIB00000847637
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847637
+ InChI=1S/C46H50N4O8/c51-39-17-5-35(6-18-39)13-25-43(55)47-29-3-33-49(45(57)27-15-37-9-21-41(53)22-10-37)31-1-2-32-50(46(58)28-16-38-11-23-42(54)24-12-38)34-4-30-48-44(56)26-14-36-7-19-40(52)20-8-36/h5-28,51-54H,1-4,29-34H2,(H,47,55)(H,48,56)/b25-13+,26-14+,27-15+,28-16+
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C46H50N4O8/c51-39-17-5-35(6-18-39)13-25-43(55)47-29-3-33-49(45(57)27-15-37-9-21-41(53)22-10-37)31-1-2-32-50(46(58)28-16-38-11-23-42(54)24-12-38)34-4-30-48-44(56)26-14-36-7-19-40(52)20-8-36/h5-28,51-54H,1-4,29-34H2,(H,47,55)(H,48,56)/b25-13+,26-14+,27-15+,28-16+
+ 0.0
+ NCGC00384571-01!(E)-3-(4-hydroxyphenyl)-N-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]amino]propyl]prop-2-enamide
+ OC1=CC=C(\\C=C\\C(=O)NCCCN(CCCCN(CCCNC(=O)\\C=C\\C2=CC=C(O)C=C2)C(=O)\\C=C\\C3=CC=C(O)C=C3)C(=O)\\C=C\\C4=CC=C(O)C=C4)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847637
+ 18
+ 0.465107
+ Feature Node
+ N/A
+ 31
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00384571-01!(E)-3-(4-hydroxyphenyl)-N-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]amino]propyl]prop-2-enamide
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2494.0","main.cluster index_upperinput":"2494.0"}
+ 0.465107
+ 1
+ OC1=CC=C(\\C=C\\C(=O)NCCCN(CCCCN(CCCNC(=O)\\C=C\\C2=CC=C(O)C=C2)C(=O)\\C=C\\C3=CC=C(O)C=C3)C(=O)\\C=C\\C4=CC=C(O)C=C4)C=C1
+ Jadhav/Dorrestein
+ 1
+ 787.3696
+ CCMSLIB00000847637
+ 787.3696
+ 0.0
+ Jadhav/Dorrestein
+ 12755329.450813219
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.00036621099999999997
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 21.2738
+ 7
+ 0.8452850000000001
+ 0.0
+ isolated
+ 2494
+ 0.00036621099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=18&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.2738
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.112
+ 7
+ 0
+ Feature Node
+ N/A
+ 5456736.956871903
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7692.0","main.cluster index_upperinput":"7692.0"}
+ 7692
+ 17.112
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 493.135
+ N/A
+ 0.0
+ 493.135
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.6215
+ 5
+ 0
+ Feature Node
+ N/A
+ 2717865.1836542343
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4530.0","main.cluster index_upperinput":"4530.0"}
+ 4530
+ 22.6215
+ -1
+ This Node is a Singleton
+ N/A
+ 367.0794
+ N/A
+ 0.0
+ 367.0794
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.4232
+ 8
+ 0
+ Feature Node
+ N/A
+ 6982756.284753685
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2518.0","main.cluster index_upperinput":"2518.0"}
+ 2518
+ 29.4232
+ -1
+ This Node is a Singleton
+ N/A
+ 321.2402
+ N/A
+ 0.0
+ 321.2402
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.0898
+ 5
+ 0
+ Feature Node
+ N/A
+ 298193.7136136346
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4722.0","main.cluster index_upperinput":"4722.0"}
+ 4722
+ 20.0898
+ -1
+ This Node is a Singleton
+ N/A
+ 371.1491
+ N/A
+ 0.0
+ 371.1491
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4308
+ 9
+ 0
+ Feature Node
+ N/A
+ 2596993.016967828
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"344.0","main.cluster index_upperinput":"344.0"}
+ 344
+ 28.4308
+ -1
+ This Node is a Singleton
+ N/A
+ 411.0942
+ N/A
+ 0.0
+ 411.0942
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.6846
+ 6
+ 0
+ Feature Node
+ N/A
+ 1654374.939265138
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1974.0","main.cluster index_upperinput":"1974.0"}
+ 1974
+ 18.6846
+ 103
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=103&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2476
+ N/A
+ 0.0
+ 462.2476
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.2261
+ 6
+ 0
+ Feature Node
+ N/A
+ 4355468.878387155
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4542.0","main.cluster index_upperinput":"4542.0"}
+ 4542
+ 31.2261
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 814.5163
+ N/A
+ 0.0
+ 814.5163
+
+
+ 43
+ 0.773093
+ CCMSLIB00005720103
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0
+ Orbitrap
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0.0
+ 22-Hydoxy-2-hopen-1-one
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ 11
+ 0.207427
+ Feature Node
+ N/A
+ 43
+ 0.0
+ 0.0
+ Damien OLIVIER
+ 22-Hydoxy-2-hopen-1-one
+ Positive
+ Damien OLIVIER
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2956.0","main.cluster index_upperinput":"2956.0"}
+ 0.207427
+ 3
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 3
+ 441.3729
+ CCMSLIB00005720103
+ 441.3729
+ 0.0
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 4555204.030046496
+ Orbitrap
+ Isolated
+ 9.15527e-05
+ [M+H]
+ N/A
+ LC-ESI
+ Positive
+ 32.7863
+ 9
+ 0.773093
+ 0.0
+ Isolated
+ 2956
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 32.7863
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.6613
+ 4
+ 0
+ Feature Node
+ N/A
+ 5683134.65175893
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4680.0","main.cluster index_upperinput":"4680.0"}
+ 4680
+ 10.6613
+ 164
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=164&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 556.2747
+ N/A
+ 0.0
+ 556.2747
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1075
+ 9
+ 0
+ Feature Node
+ N/A
+ 3291453.1968384264
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5914.0","main.cluster index_upperinput":"5914.0"}
+ 5914
+ 26.1075
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.0006
+ 8
+ 0
+ Feature Node
+ N/A
+ 1163903.882840964
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7823.0","main.cluster index_upperinput":"7823.0"}
+ 7823
+ 10.0006
+ -1
+ This Node is a Singleton
+ N/A
+ 536.1658
+ N/A
+ 0.0
+ 536.1658
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.6775
+ 7
+ 0
+ Feature Node
+ N/A
+ 3527710.987980737
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4526.0","main.cluster index_upperinput":"4526.0"}
+ 4526
+ 16.6775
+ 32
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 347.0765
+ N/A
+ 0.0
+ 347.0765
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.3404
+ 9
+ 0
+ Feature Node
+ N/A
+ 5305118.459268133
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"32.0","main.cluster index_upperinput":"32.0"}
+ 32
+ 30.3404
+ -1
+ This Node is a Singleton
+ N/A
+ 628.1949
+ N/A
+ 0.0
+ 628.1949
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3417
+ 7
+ 0
+ Feature Node
+ N/A
+ 2592935.7047714978
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5923.0","main.cluster index_upperinput":"5923.0"}
+ 5923
+ 26.3417
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.1504
+ 8
+ 0
+ Feature Node
+ N/A
+ 7871169.299562684
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3835.0","main.cluster index_upperinput":"3835.0"}
+ 3835
+ 33.1504
+ -1
+ This Node is a Singleton
+ N/A
+ 363.2872
+ N/A
+ 0.0
+ 363.2872
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.0315
+ 7
+ 0
+ Feature Node
+ N/A
+ 5219122.26627705
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13625.0","main.cluster index_upperinput":"13625.0"}
+ 13625
+ 24.0315
+ -1
+ This Node is a Singleton
+ N/A
+ 111.1167
+ N/A
+ 0.0
+ 111.1167
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6144
+ 3
+ 0
+ Feature Node
+ N/A
+ 712596.5031225024
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2525.0","main.cluster index_upperinput":"2525.0"}
+ 2525
+ 17.6144
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 528.2587
+ N/A
+ 0.0
+ 528.2587
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.8588
+ 1
+ 0
+ Feature Node
+ N/A
+ 2506155.2872344186
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13783.0","main.cluster index_upperinput":"13783.0"}
+ 13783
+ 13.8588
+ -1
+ This Node is a Singleton
+ N/A
+ 498.2099
+ N/A
+ 0.0
+ 498.2099
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.0591
+ 6
+ 0
+ Feature Node
+ N/A
+ 1398347.4871536682
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4578.0","main.cluster index_upperinput":"4578.0"}
+ 4578
+ 14.0591
+ 51
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=51&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 544.1828
+ N/A
+ 0.0
+ 544.1828
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8248
+ 7
+ 0
+ Feature Node
+ N/A
+ 12209737.616564333
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1435.0","main.cluster index_upperinput":"1435.0"}
+ 1435
+ 32.8248
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=36&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 954.6134
+ N/A
+ 0.0
+ 954.6134
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.3256
+ 2
+ 0
+ Feature Node
+ N/A
+ 192840.99953819354
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4773.0","main.cluster index_upperinput":"4773.0"}
+ 4773
+ 20.3256
+ -1
+ This Node is a Singleton
+ N/A
+ 359.1379
+ N/A
+ 0.0
+ 359.1379
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.4786
+ 9
+ 0
+ Feature Node
+ N/A
+ 285529691.96057796
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1.0","main.cluster index_upperinput":"1.0"}
+ 1
+ 34.4786
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 776.2323
+ N/A
+ 0.0
+ 776.2323
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.3384
+ 8
+ 0
+ Feature Node
+ N/A
+ 4212243.390756721
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11306.0","main.cluster index_upperinput":"11306.0"}
+ 11306
+ 25.3384
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9453
+ N/A
+ 0.0
+ 84.9453
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9403
+ 9
+ 0
+ Feature Node
+ N/A
+ 10376569.878026046
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1191.0","main.cluster index_upperinput":"1191.0"}
+ 1191
+ 0.9403
+ -1
+ This Node is a Singleton
+ N/A
+ 116.0704
+ N/A
+ 0.0
+ 116.0704
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.6933
+ 1
+ 0
+ Feature Node
+ N/A
+ 393443.1856087807
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7854.0","main.cluster index_upperinput":"7854.0"}
+ 7854
+ 20.6933
+ -1
+ This Node is a Singleton
+ N/A
+ 424.1972
+ N/A
+ 0.0
+ 424.1972
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.4638
+ 4
+ 0
+ Feature Node
+ N/A
+ 4731714.110289918
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5385.0","main.cluster index_upperinput":"5385.0"}
+ 5385
+ 17.4638
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2432
+ N/A
+ 0.0
+ 478.2432
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.9917
+ 6
+ 0
+ Feature Node
+ N/A
+ 938486.1613927514
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4153.0","main.cluster index_upperinput":"4153.0"}
+ 4153
+ 7.9917
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 368.2066
+ N/A
+ 0.0
+ 368.2066
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.0615
+ 1
+ 0
+ Feature Node
+ N/A
+ 6352040.590879005
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13642.0","main.cluster index_upperinput":"13642.0"}
+ 13642
+ 27.0615
+ 63
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=63&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 970.5215
+ N/A
+ 0.0
+ 970.5215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.3063
+ 5
+ 0
+ Feature Node
+ N/A
+ 24774620.25807144
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4505.0","main.cluster index_upperinput":"4505.0"}
+ 4505
+ 17.3063
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.2488
+ N/A
+ 0.0
+ 536.2488
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.5117
+ 8
+ 0
+ Feature Node
+ N/A
+ 4847054.245436737
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"35.0","main.cluster index_upperinput":"35.0"}
+ 35
+ 22.5117
+ -1
+ This Node is a Singleton
+ N/A
+ 266.1732
+ N/A
+ 0.0
+ 266.1732
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.9254
+ 6
+ 0
+ Feature Node
+ N/A
+ 1171294.262470087
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4675.0","main.cluster index_upperinput":"4675.0"}
+ 4675
+ 9.9254
+ -1
+ This Node is a Singleton
+ N/A
+ 307.1153
+ N/A
+ 0.0
+ 307.1153
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.4614
+ 9
+ 0
+ Feature Node
+ N/A
+ 3856466.3511360395
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6053.0","main.cluster index_upperinput":"6053.0"}
+ 6053
+ 24.4614
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9172
+ 7
+ 0
+ Feature Node
+ N/A
+ 11656625.75076603
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1808.0","main.cluster index_upperinput":"1808.0"}
+ 1808
+ 16.9172
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1223
+ N/A
+ 0.0
+ 229.1223
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5201
+ 7
+ 0
+ Feature Node
+ N/A
+ 16351524.544453213
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2519.0","main.cluster index_upperinput":"2519.0"}
+ 2519
+ 33.5201
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 696.5252
+ N/A
+ 0.0
+ 696.5252
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9485
+ 7
+ 0
+ Feature Node
+ N/A
+ 10304387.952404505
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4637.0","main.cluster index_upperinput":"4637.0"}
+ 4637
+ 0.9485
+ 88
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 98.961
+ N/A
+ 0.0
+ 98.961
+
+
+ 24
+ 0.936716
+ CCMSLIB00005778154
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005778154
+ 1S/C21H20O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21+/m1/s1
+ 0
+ qTof
+ 1S/C21H20O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21+/m1/s1
+ 0.0
+ Massbank:FIO00751 Isovitexin
+ OC[C@H]([C@@H](O)4)O[C@H]([C@H](O)[C@@H](O)4)c(c(O)1)c(O)c(C(=O)3)c(OC(=C3)c(c2)ccc(O)c2)c1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005778154
+ -1
+ 1.1273799999999998
+ Feature Node
+ N/A
+ 24
+ 0.0
+ 0.0
+ Massbank
+ Massbank:FIO00751 Isovitexin
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2509.0","main.cluster index_upperinput":"2509.0"}
+ 1.1273799999999998
+ 3
+ OC[C@H]([C@@H](O)4)O[C@H]([C@H](O)[C@@H](O)4)c(c(O)1)c(O)c(C(=O)3)c(OC(=C3)c(c2)ccc(O)c2)c1
+ Massbank
+ 3
+ 433.1135
+ CCMSLIB00005778154
+ 433.1135
+ 0.0
+ Massbank
+ 7160666.461671267
+ qTof
+ Isolated
+ 0.00048828099999999997
+ M+H
+ N/A
+ ESI
+ Positive
+ 13.8063
+ 6
+ 0.936716
+ 0.0
+ Isolated
+ 2509
+ 0.00048828099999999997
+ This Node is a Singleton
+ 13.8063
+ 0.0
+ M+H
+
+
+ 23
+ 0.929465
+ CCMSLIB00000222011
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000222011
+ 1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H
+ 0
+ LC-ESI-QTOF
+ 1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H
+ 0.0
+ Massbank:PB000743 Luteolin|5,7,3',4'-tetrahydroxy-flavone
+ C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000222011
+ 71
+ 2.44518
+ Feature Node
+ N/A
+ 23
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PB000743 Luteolin|5,7,3',4'-tetrahydroxy-flavone
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2735.0","main.cluster index_upperinput":"2735.0"}
+ 2.44518
+ 3
+ C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O
+ Putative Massbank Match
+ 3
+ 287.0553
+ CCMSLIB00000222011
+ 287.0553
+ 0.0
+ Putative Massbank Match
+ 7095546.972243165
+ LC-ESI-QTOF
+ Isolated
+ 0.0007019039999999999
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 18.5865
+ 7
+ 0.929465
+ 0.0
+ Isolated
+ 2735
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.5865
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.6059
+ 7
+ 0
+ Feature Node
+ N/A
+ 57487825.52658472
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8341.0","main.cluster index_upperinput":"8341.0"}
+ 8341
+ 14.6059
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 476.2274
+ N/A
+ 0.0
+ 476.2274
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.4764
+ 5
+ 0
+ Feature Node
+ N/A
+ 973368.4950666378
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3575.0","main.cluster index_upperinput":"3575.0"}
+ 3575
+ 12.4764
+ 26
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=26&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 565.1552
+ N/A
+ 0.0
+ 565.1552
+
+
+ 6
+ 0.8819739999999999
+ CCMSLIB00005745975
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745975
+ 1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1
+ 0
+ qTof
+ 1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1
+ 0.0
+ Massbank:PR303098 Petunidin-3-O-beta-glucoside
+ COC1=CC(=CC(O)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C2C(O)=CC(O)=CC2=[O+]1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745975
+ 8
+ 2.29303
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303098 Petunidin-3-O-beta-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4502.0","main.cluster index_upperinput":"4502.0"}
+ 2.29303
+ 3
+ COC1=CC(=CC(O)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C2C(O)=CC(O)=CC2=[O+]1
+ Massbank
+ 3
+ 479.1191
+ CCMSLIB00005745975
+ 479.1191
+ 0.0
+ Massbank
+ 13293856.63735443
+ qTof
+ Isolated
+ 0.00109863
+ M
+ N/A
+ ESI
+ Positive
+ 16.3876
+ 4
+ 0.8819739999999999
+ 0.0
+ Isolated
+ 4502
+ 0.00109863
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.3876
+ 0.0
+ M
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.421
+ 1
+ 0
+ Feature Node
+ N/A
+ 1850856.6961663298
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13751.0","main.cluster index_upperinput":"13751.0"}
+ 13751
+ 21.421
+ 84
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2173
+ N/A
+ 0.0
+ 446.2173
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.0057
+ 9
+ 0
+ Feature Node
+ N/A
+ 6309646.755972648
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1575.0","main.cluster index_upperinput":"1575.0"}
+ 1575
+ 33.0057
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 582.4578
+ N/A
+ 0.0
+ 582.4578
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.4118
+ 6
+ 0
+ Feature Node
+ N/A
+ 2427923.028202953
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10256.0","main.cluster index_upperinput":"10256.0"}
+ 10256
+ 16.4118
+ 127
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=127&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 500.2253
+ N/A
+ 0.0
+ 500.2253
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.4108
+ 6
+ 0
+ Feature Node
+ N/A
+ 2460102.554366074
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4620.0","main.cluster index_upperinput":"4620.0"}
+ 4620
+ 16.4108
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1223
+ N/A
+ 0.0
+ 229.1223
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1139
+ 8
+ 0
+ Feature Node
+ N/A
+ 2524225.0256285584
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"57.0","main.cluster index_upperinput":"57.0"}
+ 57
+ 32.1139
+ -1
+ This Node is a Singleton
+ N/A
+ 427.3563
+ N/A
+ 0.0
+ 427.3563
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.3105
+ 7
+ 0
+ Feature Node
+ N/A
+ 9285442.773798835
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1391.0","main.cluster index_upperinput":"1391.0"}
+ 1391
+ 1.3105
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 396.2011
+ N/A
+ 0.0
+ 396.2011
+
+
+ 13
+ 0.8603639999999999
+ CCMSLIB00004693630
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693630
+ InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0.0
+ arctigenin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693630
+ 85
+ 1.25139
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002567
+ arctigenin
+ positive
+ MoNA:VF-NPL-QEHF002567
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4508.0","main.cluster index_upperinput":"4508.0"}
+ 1.25139
+ 3
+ N/A
+ MoNA
+ 3
+ 390.1915
+ CCMSLIB00004693630
+ 390.1915
+ 0.0
+ MoNA
+ 3887336.226240979
+ ESI-QFT
+ isolated
+ 0.00048828099999999997
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 19.4084
+ 4
+ 0.8603639999999999
+ 0.0
+ isolated
+ 4508
+ 0.00048828099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.4084
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5404
+ 1
+ 0
+ Feature Node
+ N/A
+ 1145383.3324139083
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7730.0","main.cluster index_upperinput":"7730.0"}
+ 7730
+ 16.5404
+ 84
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 484.174
+ N/A
+ 0.0
+ 484.174
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7079
+ 7
+ 0
+ Feature Node
+ N/A
+ 5096993.468412326
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1207.0","main.cluster index_upperinput":"1207.0"}
+ 1207
+ 21.7079
+ -1
+ This Node is a Singleton
+ N/A
+ 266.1728
+ N/A
+ 0.0
+ 266.1728
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.197
+ 9
+ 0
+ Feature Node
+ N/A
+ 3243099.086908905
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5915.0","main.cluster index_upperinput":"5915.0"}
+ 5915
+ 25.197
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4004
+ 8
+ 0
+ Feature Node
+ N/A
+ 57031479.024112925
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1159.0","main.cluster index_upperinput":"1159.0"}
+ 1159
+ 33.4004
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 599.4273
+ N/A
+ 0.0
+ 599.4273
+
+
+ 10
+ 0.766576
+ CCMSLIB00006418726
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006418726
+ InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3
+ 0
+ Orbitrap
+ InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3
+ 0.0
+ Jaceosidin
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(O)=C(OC)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006418726
+ 32
+ 2.39656
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ BMDMS-NP
+ Jaceosidin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2489.0","main.cluster index_upperinput":"2489.0"}
+ 2.39656
+ 1
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(O)=C(OC)C3
+ BMDMS-NP
+ 1
+ 331.0812
+ CCMSLIB00006418726
+ 331.0812
+ 0.0
+ BMDMS-NP
+ 9611570.22542739
+ Orbitrap
+ Commercial standard
+ 0.000793457
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 20.4238
+ 7
+ 0.766576
+ 0.0
+ Commercial standard
+ 2489
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.4238
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.9277
+ 3
+ 0
+ Feature Node
+ N/A
+ 566383.8067679639
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10349.0","main.cluster index_upperinput":"10349.0"}
+ 10349
+ 20.9277
+ -1
+ This Node is a Singleton
+ N/A
+ 552.2796
+ N/A
+ 0.0
+ 552.2796
+
+
+ 9
+ 0.884036
+ CCMSLIB00003137888
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003137888
+ N/A
+ 0
+ Q-TOF
+ N/A
+ 0.0
+ Spectral Match to Malvidin 3-O-galactoside cation from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003137888
+ 8
+ 3.0323700000000002
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ Data deposited by daniel
+ Spectral Match to Malvidin 3-O-galactoside cation from NIST14
+ Positive
+ Data deposited by daniel
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4510.0","main.cluster index_upperinput":"4510.0"}
+ 3.0323700000000002
+ 3
+ N/A
+ Data from PC Dorrestein
+ 3
+ 493.1345
+ CCMSLIB00003137888
+ 493.1345
+ 0.0
+ Data from PC Dorrestein
+ 6638752.342707651
+ Q-TOF
+ Isolated
+ 0.00149536
+ Cat
+ N/A
+ ESI
+ Positive
+ 17.6698
+ 6
+ 0.884036
+ 0.0
+ Isolated
+ 4510
+ 0.00149536
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.6698
+ 0.0
+ Cat
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5151
+ 3
+ 0
+ Feature Node
+ N/A
+ 445656.0982643175
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7873.0","main.cluster index_upperinput":"7873.0"}
+ 7873
+ 16.5151
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.1617
+ N/A
+ 0.0
+ 430.1617
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.303
+ 2
+ 0
+ Feature Node
+ N/A
+ 1126883.1279707514
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10356.0","main.cluster index_upperinput":"10356.0"}
+ 10356
+ 10.303
+ -1
+ This Node is a Singleton
+ N/A
+ 483.2188
+ N/A
+ 0.0
+ 483.2188
+
+
+ 6
+ 0.8992
+ CCMSLIB00005738172
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738172
+ 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
+ 0
+ qTof
+ 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
+ 0.0
+ Massbank:RP019903 Dibutylphthalate|dibutyl phthalate|dibutyl benzene-1,2-dicarboxylate
+ CCCCOC(=O)c1ccccc1C(=O)OCCCC
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738172
+ 105
+ 0.327959
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP019903 Dibutylphthalate|dibutyl phthalate|dibutyl benzene-1,2-dicarboxylate
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3524.0","main.cluster index_upperinput":"3524.0"}
+ 0.327959
+ 3
+ CCCCOC(=O)c1ccccc1C(=O)OCCCC
+ Massbank
+ 3
+ 279.1589
+ CCMSLIB00005738172
+ 279.1589
+ 0.0
+ Massbank
+ 11569748.024358984
+ qTof
+ Isolated
+ 9.15527e-05
+ M+H
+ N/A
+ ESI
+ Positive
+ 27.137
+ 7
+ 0.8992
+ 0.0
+ Isolated
+ 3524
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=105&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 27.137
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.6217
+ 4
+ 0
+ Feature Node
+ N/A
+ 684873.1686872458
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5006.0","main.cluster index_upperinput":"5006.0"}
+ 5006
+ 20.6217
+ -1
+ This Node is a Singleton
+ N/A
+ 530.3538
+ N/A
+ 0.0
+ 530.3538
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1155
+ 4
+ 0
+ Feature Node
+ N/A
+ 2959397.4243693063
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"103.0","main.cluster index_upperinput":"103.0"}
+ 103
+ 23.1155
+ 9
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=9&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 376.2598
+ N/A
+ 0.0
+ 376.2598
+
+
+ 13
+ 0.715491
+ CCMSLIB00000847486
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847486
+ InChI=1S/C17H14O7/c1-22-14-7-13-15(16(21)17(14)23-2)11(20)6-12(24-13)8-3-4-9(18)10(19)5-8/h3-7,18-19,21H,1-2H3
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C17H14O7/c1-22-14-7-13-15(16(21)17(14)23-2)11(20)6-12(24-13)8-3-4-9(18)10(19)5-8/h3-7,18-19,21H,1-2H3
+ 0.0
+ NCGC00385220-01!2-(3,4-dihydroxyphenyl)-5-hydroxy-6,7-dimethoxychromen-4-one
+ COC1=C(OC)C(O)=C2C(=O)C=C(OC2=C1)C3=CC(O)=C(O)C=C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847486
+ 4
+ 0.9217559999999999
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00385220-01!2-(3,4-dihydroxyphenyl)-5-hydroxy-6,7-dimethoxychromen-4-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1177.0","main.cluster index_upperinput":"1177.0"}
+ 0.9217559999999999
+ 1
+ COC1=C(OC)C(O)=C2C(=O)C=C(OC2=C1)C3=CC(O)=C(O)C=C3
+ Jadhav/Dorrestein
+ 1
+ 331.0813
+ CCMSLIB00000847486
+ 331.0813
+ 0.0
+ Jadhav/Dorrestein
+ 4572197.215817441
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.000305176
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 20.0638
+ 5
+ 0.715491
+ 0.0
+ isolated
+ 1177
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.0638
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9206
+ 5
+ 0
+ Feature Node
+ N/A
+ 1024703.1543837361
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5276.0","main.cluster index_upperinput":"5276.0"}
+ 5276
+ 0.9206
+ 52
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 408.2372
+ N/A
+ 0.0
+ 408.2372
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0463
+ 6
+ 0
+ Feature Node
+ N/A
+ 1173336.227682013
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13334.0","main.cluster index_upperinput":"13334.0"}
+ 13334
+ 19.0463
+ 23
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 211.1315
+ N/A
+ 0.0
+ 211.1315
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.0729
+ 9
+ 0
+ Feature Node
+ N/A
+ 2886555.614122175
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1833.0","main.cluster index_upperinput":"1833.0"}
+ 1833
+ 20.0729
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 181.122
+ N/A
+ 0.0
+ 181.122
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.4055
+ 6
+ 0
+ Feature Node
+ N/A
+ 12981278.337961683
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13606.0","main.cluster index_upperinput":"13606.0"}
+ 13606
+ 14.4055
+ -1
+ This Node is a Singleton
+ N/A
+ 568.2389
+ N/A
+ 0.0
+ 568.2389
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6049
+ 7
+ 0
+ Feature Node
+ N/A
+ 8529090.995764965
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4518.0","main.cluster index_upperinput":"4518.0"}
+ 4518
+ 23.6049
+ -1
+ This Node is a Singleton
+ N/A
+ 353.2301
+ N/A
+ 0.0
+ 353.2301
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.0668
+ 7
+ 0
+ Feature Node
+ N/A
+ 2044598.3825406474
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1319.0","main.cluster index_upperinput":"1319.0"}
+ 1319
+ 21.0668
+ -1
+ This Node is a Singleton
+ N/A
+ 255.1581
+ N/A
+ 0.0
+ 255.1581
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.7667
+ 5
+ 0
+ Feature Node
+ N/A
+ 2921692.607312195
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1235.0","main.cluster index_upperinput":"1235.0"}
+ 1235
+ 15.7667
+ 43
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=43&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 270.0872
+ N/A
+ 0.0
+ 270.0872
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2542
+ 8
+ 0
+ Feature Node
+ N/A
+ 2661775.703572605
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5078.0","main.cluster index_upperinput":"5078.0"}
+ 5078
+ 23.2542
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8904
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.7556
+ 2
+ 0
+ Feature Node
+ N/A
+ 972431.3990810747
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4588.0","main.cluster index_upperinput":"4588.0"}
+ 4588
+ 10.7556
+ -1
+ This Node is a Singleton
+ N/A
+ 453.2376
+ N/A
+ 0.0
+ 453.2376
+
+
+ 101
+ 0.976131
+ CCMSLIB00004694670
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694670
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0.0
+ arctiin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694670
+ 85
+ 2.54201
+ Feature Node
+ N/A
+ 101
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF003607
+ arctiin
+ positive
+ MoNA:VF-NPL-QEHF003607
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4498.0","main.cluster index_upperinput":"4498.0"}
+ 2.54201
+ 3
+ N/A
+ MoNA
+ 3
+ 552.2454
+ CCMSLIB00004694670
+ 552.2454
+ 0.0
+ MoNA
+ 46467629.4673318
+ ESI-QFT
+ isolated
+ 0.00140381
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 16.4615
+ 4
+ 0.976131
+ 0.0
+ isolated
+ 4498
+ 0.00140381
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.4615
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8187
+ 3
+ 0
+ Feature Node
+ N/A
+ 1895828.1229498608
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1186.0","main.cluster index_upperinput":"1186.0"}
+ 1186
+ 16.8187
+ -1
+ This Node is a Singleton
+ N/A
+ 381.1306
+ N/A
+ 0.0
+ 381.1306
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.827
+ 6
+ 0
+ Feature Node
+ N/A
+ 4911036.320671199
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8111.0","main.cluster index_upperinput":"8111.0"}
+ 8111
+ 33.827
+ -1
+ This Node is a Singleton
+ N/A
+ 365.3029
+ N/A
+ 0.0
+ 365.3029
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.9819
+ 5
+ 0
+ Feature Node
+ N/A
+ 3450687.6425322527
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7658.0","main.cluster index_upperinput":"7658.0"}
+ 7658
+ 11.9819
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 398.1814
+ N/A
+ 0.0
+ 398.1814
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.1778
+ 9
+ 0
+ Feature Node
+ N/A
+ 34548295.69235789
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1189.0","main.cluster index_upperinput":"1189.0"}
+ 1189
+ 29.1778
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 291.2313
+ N/A
+ 0.0
+ 291.2313
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0778
+ 9
+ 0
+ Feature Node
+ N/A
+ 9757540.602358224
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2632.0","main.cluster index_upperinput":"2632.0"}
+ 2632
+ 34.0778
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 377.3415
+ N/A
+ 0.0
+ 377.3415
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.04
+ 5
+ 0
+ Feature Node
+ N/A
+ 2616788.536023654
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4575.0","main.cluster index_upperinput":"4575.0"}
+ 4575
+ 11.04
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 402.2276
+ N/A
+ 0.0
+ 402.2276
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.4199
+ 2
+ 0
+ Feature Node
+ N/A
+ 677199.3726923497
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7846.0","main.cluster index_upperinput":"7846.0"}
+ 7846
+ 3.4199
+ 49
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=49&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 470.1949
+ N/A
+ 0.0
+ 470.1949
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4257
+ 8
+ 0
+ Feature Node
+ N/A
+ 2244039.5202071145
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"531.0","main.cluster index_upperinput":"531.0"}
+ 531
+ 26.4257
+ 92
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=92&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 223.0638
+ N/A
+ 0.0
+ 223.0638
+
+
+ 38
+ 0.832421
+ CCMSLIB00005467698
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+
+ 0
+ qTof
+
+ 0.0
+ Dihydroactinidiolide
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+ 11
+ 11.6261
+ Feature Node
+ N/A
+ 38
+ 0.0
+ 0.0
+ Armando Alcazar
+ Dihydroactinidiolide
+ Positive
+ Armando Alcazar
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1300.0","main.cluster index_upperinput":"1300.0"}
+ 11.6261
+ 3
+
+ Claudia Maier
+ 3
+ 181.1221
+ CCMSLIB00005467698
+ 181.1221
+ 0.0
+ Claudia Maier
+ 16136736.540062351
+ qTof
+ Isolated
+ 0.00210571
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 17.2973
+ 9
+ 0.832421
+ 0.0
+ Isolated
+ 1300
+ 0.00210571
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.2973
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.5694
+ 1
+ 0
+ Feature Node
+ N/A
+ 1349560.068288259
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7694.0","main.cluster index_upperinput":"7694.0"}
+ 7694
+ 20.5694
+ -1
+ This Node is a Singleton
+ N/A
+ 814.2617
+ N/A
+ 0.0
+ 814.2617
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7208
+ 9
+ 0
+ Feature Node
+ N/A
+ 965130.0282623894
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"249.0","main.cluster index_upperinput":"249.0"}
+ 249
+ 21.7208
+ -1
+ This Node is a Singleton
+ N/A
+ 199.1327
+ N/A
+ 0.0
+ 199.1327
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.8884
+ 3
+ 0
+ Feature Node
+ N/A
+ 4642998.235403888
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3901.0","main.cluster index_upperinput":"3901.0"}
+ 3901
+ 18.8884
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 520.2546
+ N/A
+ 0.0
+ 520.2546
+
+
+ 8
+ 0.794567
+ CCMSLIB00000078868
+ N/A
+ DI-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000078868
+ InChI=1S/C16H12O7/c1-22-16-14(21)13-11(20)5-8(17)6-12(13)23-15(16)7-2-3-9(18)10(19)4-7/h2-6,17-20H,1H3
+ 0
+ qTof
+ InChI=1S/C16H12O7/c1-22-16-14(21)13-11(20)5-8(17)6-12(13)23-15(16)7-2-3-9(18)10(19)4-7/h2-6,17-20H,1H3
+ 0.0
+ 3-O-methylquercetin
+ O=C1C2=C(O)C=C(O)C=C2OC(C3=CC(O)=C(O)C=C3)=C1OC
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000078868
+ 32
+ 2.2137599999999997
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Denise Silva
+ 3-O-methylquercetin
+ Positive
+ Denise Silva
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11911.0","main.cluster index_upperinput":"11911.0"}
+ 2.2137599999999997
+ 3
+ O=C1C2=C(O)C=C(O)C=C2OC(C3=CC(O)=C(O)C=C3)=C1OC
+ Norberto Lopes
+ 3
+ 317.0657
+ CCMSLIB00000078868
+ 317.0657
+ 0.0
+ Norberto Lopes
+ 1425651.660578889
+ qTof
+ Isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ DI-ESI
+ Positive
+ 20.8121
+ 9
+ 0.794567
+ 0.0
+ Isolated
+ 11911
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.8121
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.3776
+ 6
+ 0
+ Feature Node
+ N/A
+ 2651767.9711683844
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4603.0","main.cluster index_upperinput":"4603.0"}
+ 4603
+ 3.3776
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.2427
+ N/A
+ 0.0
+ 430.2427
+
+
+ 8
+ 0.789928
+ CCMSLIB00005716522
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005716522
+ N/A
+ 0
+ qTof
+ N/A
+ 0.0
+ KU002-14
+ OC1=CC(O)=C(C(CC(C2=CC=CC=C2)O3)=O)C3=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005716522
+ -1
+ 5.46059
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Oliver Gericke
+ KU002-14
+ Positive
+ Oliver Gericke
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"27.0","main.cluster index_upperinput":"27.0"}
+ 5.46059
+ 3
+ OC1=CC(O)=C(C(CC(C2=CC=CC=C2)O3)=O)C3=C1
+ Birger L. Moller
+ 3
+ 257.0814
+ CCMSLIB00005716522
+ 257.0814
+ 0.0
+ Birger L. Moller
+ 1487557.1272464946
+ qTof
+ Isolated
+ 0.00140381
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 17.716
+ 1
+ 0.789928
+ 0.0
+ Isolated
+ 27
+ 0.00140381
+ This Node is a Singleton
+ 17.716
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.9989
+ 9
+ 0
+ Feature Node
+ N/A
+ 10038028.835828776
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"129.0","main.cluster index_upperinput":"129.0"}
+ 129
+ 34.9989
+ -1
+ This Node is a Singleton
+ N/A
+ 885.3679
+ N/A
+ 0.0
+ 885.3679
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.5777
+ 5
+ 0
+ Feature Node
+ N/A
+ 1753561.8437012795
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7725.0","main.cluster index_upperinput":"7725.0"}
+ 7725
+ 9.5777
+ -1
+ This Node is a Singleton
+ N/A
+ 444.2191
+ N/A
+ 0.0
+ 444.2191
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.2481
+ 7
+ 0
+ Feature Node
+ N/A
+ 2351039.341284856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"87.0","main.cluster index_upperinput":"87.0"}
+ 87
+ 24.2481
+ -1
+ This Node is a Singleton
+ N/A
+ 277.1789
+ N/A
+ 0.0
+ 277.1789
+
+
+ 9
+ 0.8313159999999999
+ CCMSLIB00004693630
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693630
+ InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0.0
+ arctigenin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693630
+ 85
+ 0.782119
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002567
+ arctigenin
+ positive
+ MoNA:VF-NPL-QEHF002567
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2483.0","main.cluster index_upperinput":"2483.0"}
+ 0.782119
+ 3
+ N/A
+ MoNA
+ 3
+ 390.1913
+ CCMSLIB00004693630
+ 390.1913
+ 0.0
+ MoNA
+ 2068966.2681994417
+ ESI-QFT
+ isolated
+ 0.000305176
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 18.4807
+ 4
+ 0.8313159999999999
+ 0.0
+ isolated
+ 2483
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.4807
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.2349
+ 5
+ 0
+ Feature Node
+ N/A
+ 1044418.6908727069
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13829.0","main.cluster index_upperinput":"13829.0"}
+ 13829
+ 19.2349
+ -1
+ This Node is a Singleton
+ N/A
+ 470.296
+ N/A
+ 0.0
+ 470.296
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.3767
+ 4
+ 0
+ Feature Node
+ N/A
+ 303806.7589400092
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4652.0","main.cluster index_upperinput":"4652.0"}
+ 4652
+ 20.3767
+ 19
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 337.1563
+ N/A
+ 0.0
+ 337.1563
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8076
+ 5
+ 0
+ Feature Node
+ N/A
+ 1336470.6128743745
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1360.0","main.cluster index_upperinput":"1360.0"}
+ 1360
+ 23.8076
+ -1
+ This Node is a Singleton
+ N/A
+ 172.1693
+ N/A
+ 0.0
+ 172.1693
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.4808
+ 2
+ 0
+ Feature Node
+ N/A
+ 3321596.794685386
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13664.0","main.cluster index_upperinput":"13664.0"}
+ 13664
+ 19.4808
+ 64
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 722.3172
+ N/A
+ 0.0
+ 722.3172
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8362
+ 6
+ 0
+ Feature Node
+ N/A
+ 12197891.630365066
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1419.0","main.cluster index_upperinput":"1419.0"}
+ 1419
+ 32.8362
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 341.305
+ N/A
+ 0.0
+ 341.305
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.9772
+ 4
+ 0
+ Feature Node
+ N/A
+ 1124177.2160266032
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10336.0","main.cluster index_upperinput":"10336.0"}
+ 10336
+ 13.9772
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 510.2689
+ N/A
+ 0.0
+ 510.2689
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.1151
+ 5
+ 0
+ Feature Node
+ N/A
+ 6125625.494488411
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3535.0","main.cluster index_upperinput":"3535.0"}
+ 3535
+ 31.1151
+ -1
+ This Node is a Singleton
+ N/A
+ 433.3434
+ N/A
+ 0.0
+ 433.3434
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1537
+ 6
+ 0
+ Feature Node
+ N/A
+ 860713.9319732707
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2631.0","main.cluster index_upperinput":"2631.0"}
+ 2631
+ 26.1537
+ -1
+ This Node is a Singleton
+ N/A
+ 337.0748
+ N/A
+ 0.0
+ 337.0748
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.7108
+ 8
+ 0
+ Feature Node
+ N/A
+ 4218392.047961905
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11321.0","main.cluster index_upperinput":"11321.0"}
+ 11321
+ 24.7108
+ -1
+ This Node is a Singleton
+ N/A
+ 84.9453
+ N/A
+ 0.0
+ 84.9453
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5569
+ 8
+ 0
+ Feature Node
+ N/A
+ 14598339.191907197
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4517.0","main.cluster index_upperinput":"4517.0"}
+ 4517
+ 34.5569
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.1655
+ N/A
+ 0.0
+ 536.1655
+
+
+ 54
+ 0.864671
+ CCMSLIB00004718328
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718328
+ InChI=1S/C16H12O6/c1-21-9-4-2-8(3-5-9)12-6-10(17)14-13(22-12)7-11(18)15(19)16(14)20/h2-7,18-20H,1H3
+ 0
+ ESI-QTOF
+ InChI=1S/C16H12O6/c1-21-9-4-2-8(3-5-9)12-6-10(17)14-13(22-12)7-11(18)15(19)16(14)20/h2-7,18-20H,1H3
+ 0.0
+ Scutellarein 4'-methyl ether
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718328
+ 32
+ 1.72318
+ Feature Node
+ N/A
+ 54
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QTOF000757
+ Scutellarein 4'-methyl ether
+ positive
+ MoNA:VF-NPL-QTOF000757
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2498.0","main.cluster index_upperinput":"2498.0"}
+ 1.72318
+ 3
+ N/A
+ MoNA
+ 3
+ 301.0705
+ CCMSLIB00004718328
+ 301.0705
+ 0.0
+ MoNA
+ 54078584.63494246
+ ESI-QTOF
+ isolated
+ 0.000518799
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 20.2703
+ 9
+ 0.864671
+ 0.0
+ isolated
+ 2498
+ 0.000518799
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.2703
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.6504
+ 8
+ 0
+ Feature Node
+ N/A
+ 1748650.6649149412
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1369.0","main.cluster index_upperinput":"1369.0"}
+ 1369
+ 24.6504
+ -1
+ This Node is a Singleton
+ N/A
+ 283.1881
+ N/A
+ 0.0
+ 283.1881
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.7499
+ 7
+ 0
+ Feature Node
+ N/A
+ 1556463.735261962
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"18086.0","main.cluster index_upperinput":"18086.0"}
+ 18086
+ 7.7499
+ 52
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.2213
+ N/A
+ 0.0
+ 394.2213
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.192
+ 9
+ 0
+ Feature Node
+ N/A
+ 5288279.7183603095
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"329.0","main.cluster index_upperinput":"329.0"}
+ 329
+ 29.192
+ -1
+ This Node is a Singleton
+ N/A
+ 319.2245
+ N/A
+ 0.0
+ 319.2245
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6344
+ 7
+ 0
+ Feature Node
+ N/A
+ 2315924.0826394586
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"17228.0","main.cluster index_upperinput":"17228.0"}
+ 17228
+ 30.6344
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 481.3636
+ N/A
+ 0.0
+ 481.3636
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5837
+ 1
+ 0
+ Feature Node
+ N/A
+ 1097694.1046055048
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"44.0","main.cluster index_upperinput":"44.0"}
+ 44
+ 33.5837
+ 175
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=175&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1175.8671
+ N/A
+ 0.0
+ 1175.8671
+
+
+ 7
+ 0.891589
+ CCMSLIB00003137888
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003137888
+ N/A
+ 0
+ Q-TOF
+ N/A
+ 0.0
+ Spectral Match to Malvidin 3-O-galactoside cation from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003137888
+ 8
+ 3.2799099999999997
+ Feature Node
+ N/A
+ 7
+ 0.0
+ 0.0
+ Data deposited by daniel
+ Spectral Match to Malvidin 3-O-galactoside cation from NIST14
+ Positive
+ Data deposited by daniel
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3525.0","main.cluster index_upperinput":"3525.0"}
+ 3.2799099999999997
+ 3
+ N/A
+ Data from PC Dorrestein
+ 3
+ 493.1346
+ CCMSLIB00003137888
+ 493.1346
+ 0.0
+ Data from PC Dorrestein
+ 3120782.551087007
+ Q-TOF
+ Isolated
+ 0.00161743
+ Cat
+ N/A
+ ESI
+ Positive
+ 16.7306
+ 6
+ 0.891589
+ 0.0
+ Isolated
+ 3525
+ 0.00161743
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.7306
+ 0.0
+ Cat
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.6924
+ 6
+ 0
+ Feature Node
+ N/A
+ 1206264.5178823522
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7741.0","main.cluster index_upperinput":"7741.0"}
+ 7741
+ 12.6924
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 480.2272
+ N/A
+ 0.0
+ 480.2272
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7309
+ 9
+ 0
+ Feature Node
+ N/A
+ 1054854.8050933594
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5190.0","main.cluster index_upperinput":"5190.0"}
+ 5190
+ 21.7309
+ -1
+ This Node is a Singleton
+ N/A
+ 277.1773
+ N/A
+ 0.0
+ 277.1773
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.3357
+ 6
+ 0
+ Feature Node
+ N/A
+ 352304.5993753013
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1286.0","main.cluster index_upperinput":"1286.0"}
+ 1286
+ 19.3357
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 521.1298
+ N/A
+ 0.0
+ 521.1298
+
+
+ 80
+ 0.815802
+ CCMSLIB00000076748
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000076748
+
+ 0
+ qTof
+
+ 0.0
+ Pheophorbide A
+ CCC1=C2C=C3C(=C4C(=O)C(C(=C5C(C(C(=N5)C=C6C(=C(C(=CC(=C1C)N2)N6)C=C)C)C)CCC(=O)O)C4=N3)C(=O)OC)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000076748
+ 96
+ 12.0369
+ Feature Node
+ N/A
+ 80
+ 0.0
+ 0.0
+ Jimmy Yi Zeng
+ Pheophorbide A
+ Positive
+ Jimmy Yi Zeng
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"302.0","main.cluster index_upperinput":"302.0"}
+ 12.0369
+ 3
+ CCC1=C2C=C3C(=C4C(=O)C(C(=C5C(C(C(=N5)C=C6C(=C(C(=CC(=C1C)N2)N6)C=C)C)C)CCC(=O)O)C4=N3)C(=O)OC)C
+ Pieter Dorrestein
+ 3
+ 593.2761
+ CCMSLIB00000076748
+ 593.2761
+ 0.0
+ Pieter Dorrestein
+ 144767210.4157913
+ qTof
+ Commercial
+ 0.00714111
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 34.5275
+ 8
+ 0.815802
+ 0.0
+ Commercial
+ 302
+ 0.00714111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=96&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.5275
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.0642
+ 8
+ 0
+ Feature Node
+ N/A
+ 9164586.195955452
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"37.0","main.cluster index_upperinput":"37.0"}
+ 37
+ 31.0642
+ 150
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=150&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 654.3321
+ N/A
+ 0.0
+ 654.3321
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.9614
+ 9
+ 0
+ Feature Node
+ N/A
+ 3205062.25470956
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1228.0","main.cluster index_upperinput":"1228.0"}
+ 1228
+ 25.9614
+ 41
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=41&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 161.0958
+ N/A
+ 0.0
+ 161.0958
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9756
+ 4
+ 0
+ Feature Node
+ N/A
+ 354250.45620691276
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3618.0","main.cluster index_upperinput":"3618.0"}
+ 3618
+ 19.9756
+ -1
+ This Node is a Singleton
+ N/A
+ 552.2798
+ N/A
+ 0.0
+ 552.2798
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.0642
+ 8
+ 0
+ Feature Node
+ N/A
+ 15770825.193772085
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14.0","main.cluster index_upperinput":"14.0"}
+ 14
+ 31.0642
+ 150
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=150&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 637.3055
+ N/A
+ 0.0
+ 637.3055
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.1989
+ 3
+ 0
+ Feature Node
+ N/A
+ 9762208.555755744
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13656.0","main.cluster index_upperinput":"13656.0"}
+ 13656
+ 12.1989
+ -1
+ This Node is a Singleton
+ N/A
+ 547.2645
+ N/A
+ 0.0
+ 547.2645
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.3973
+ 6
+ 0
+ Feature Node
+ N/A
+ 3847155.892888145
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15800.0","main.cluster index_upperinput":"15800.0"}
+ 15800
+ 1.3973
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 428.2275
+ N/A
+ 0.0
+ 428.2275
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.0315
+ 5
+ 0
+ Feature Node
+ N/A
+ 1634160.9464120988
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7702.0","main.cluster index_upperinput":"7702.0"}
+ 7702
+ 12.0315
+ -1
+ This Node is a Singleton
+ N/A
+ 403.1373
+ N/A
+ 0.0
+ 403.1373
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6012
+ 6
+ 0
+ Feature Node
+ N/A
+ 2390512.5171179413
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4576.0","main.cluster index_upperinput":"4576.0"}
+ 4576
+ 23.6012
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 295.2262
+ N/A
+ 0.0
+ 295.2262
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.4642
+ 2
+ 0
+ Feature Node
+ N/A
+ 1395861.9891423066
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13809.0","main.cluster index_upperinput":"13809.0"}
+ 13809
+ 21.4642
+ 42
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=42&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 474.2131
+ N/A
+ 0.0
+ 474.2131
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.7198
+ 7
+ 0
+ Feature Node
+ N/A
+ 1987223.7304709856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4109.0","main.cluster index_upperinput":"4109.0"}
+ 4109
+ 31.7198
+ -1
+ This Node is a Singleton
+ N/A
+ 501.3197
+ N/A
+ 0.0
+ 501.3197
+
+
+ 6
+ 0.8948440000000001
+ CCMSLIB00000852261
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852261
+ InChI=1S/C17H20O9/c1-25-13-6-9(2-4-10(13)18)3-5-14(21)26-15-11(19)7-17(24,16(22)23)8-12(15)20/h2-6,11-12,15,18-20,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,12-,15-,17+/m1/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C17H20O9/c1-25-13-6-9(2-4-10(13)18)3-5-14(21)26-15-11(19)7-17(24,16(22)23)8-12(15)20/h2-6,11-12,15,18-20,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,12-,15-,17+/m1/s1
+ 0.0
+ NCGC00380877-01_C17H20O9_Cyclohexanecarboxylic acid, 1,3,5-trihydroxy-4-[[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]oxy]-, (1alpha,3alpha,4alpha,5beta)-
+ COC1=CC(=CC=C1O)\\C=C\\C(=O)O[C@H]2[C@H](O)C[C@@](O)(C[C@H]2O)C(O)=O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852261
+ 19
+ 0.248031
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00380877-01_C17H20O9_Cyclohexanecarboxylic acid, 1,3,5-trihydroxy-4-[[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]oxy]-, (1alpha,3alpha,4alpha,5beta)-
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4826.0","main.cluster index_upperinput":"4826.0"}
+ 0.248031
+ 1
+ COC1=CC(=CC=C1O)\\C=C\\C(=O)O[C@H]2[C@H](O)C[C@@](O)(C[C@H]2O)C(O)=O
+ Jadhav/Dorrestein
+ 1
+ 369.1181
+ CCMSLIB00000852261
+ 369.1181
+ 0.0
+ Jadhav/Dorrestein
+ 3319893.205181988
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 9.15527e-05
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 8.992
+ 8
+ 0.8948440000000001
+ 0.0
+ isolated
+ 4826
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 8.992
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.3678
+ 9
+ 0
+ Feature Node
+ N/A
+ 3553656.36253803
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3530.0","main.cluster index_upperinput":"3530.0"}
+ 3530
+ 23.3678
+ 32
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 315.0866
+ N/A
+ 0.0
+ 315.0866
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.4163
+ 2
+ 0
+ Feature Node
+ N/A
+ 3567318.336654934
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7668.0","main.cluster index_upperinput":"7668.0"}
+ 7668
+ 9.4163
+ 61
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=61&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.174
+ N/A
+ 0.0
+ 496.174
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8866
+ 6
+ 0
+ Feature Node
+ N/A
+ 6564444.393105616
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1382.0","main.cluster index_upperinput":"1382.0"}
+ 1382
+ 21.8866
+ -1
+ This Node is a Singleton
+ N/A
+ 351.2139
+ N/A
+ 0.0
+ 351.2139
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.0958
+ 4
+ 0
+ Feature Node
+ N/A
+ 5372080.866219682
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4655.0","main.cluster index_upperinput":"4655.0"}
+ 4655
+ 15.0958
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 396.237
+ N/A
+ 0.0
+ 396.237
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.2142
+ 9
+ 0
+ Feature Node
+ N/A
+ 2186325.513152566
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2696.0","main.cluster index_upperinput":"2696.0"}
+ 2696
+ 35.2142
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=99&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 707.1713
+ N/A
+ 0.0
+ 707.1713
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.5367
+ 8
+ 0
+ Feature Node
+ N/A
+ 2615112.1738147116
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13778.0","main.cluster index_upperinput":"13778.0"}
+ 13778
+ 23.5367
+ -1
+ This Node is a Singleton
+ N/A
+ 331.1883
+ N/A
+ 0.0
+ 331.1883
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1164
+ 7
+ 0
+ Feature Node
+ N/A
+ 930880.9885549463
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4030.0","main.cluster index_upperinput":"4030.0"}
+ 4030
+ 19.1164
+ 81
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 380.2074
+ N/A
+ 0.0
+ 380.2074
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5694
+ 7
+ 0
+ Feature Node
+ N/A
+ 3130938.8455739846
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2625.0","main.cluster index_upperinput":"2625.0"}
+ 2625
+ 34.5694
+ -1
+ This Node is a Singleton
+ N/A
+ 484.3408
+ N/A
+ 0.0
+ 484.3408
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.9328
+ 6
+ 0
+ Feature Node
+ N/A
+ 33892970.87605588
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5815.0","main.cluster index_upperinput":"5815.0"}
+ 5815
+ 31.9328
+ -1
+ This Node is a Singleton
+ N/A
+ 353.2667
+ N/A
+ 0.0
+ 353.2667
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.9427
+ 8
+ 0
+ Feature Node
+ N/A
+ 3658521.8352699243
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11270.0","main.cluster index_upperinput":"11270.0"}
+ 11270
+ 25.9427
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9453
+ N/A
+ 0.0
+ 84.9453
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.691
+ 1
+ 0
+ Feature Node
+ N/A
+ 2236627.1010845983
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1174.0","main.cluster index_upperinput":"1174.0"}
+ 1174
+ 22.691
+ -1
+ This Node is a Singleton
+ N/A
+ 381.095
+ N/A
+ 0.0
+ 381.095
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.1269
+ 5
+ 0
+ Feature Node
+ N/A
+ 12748434.123675829
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2214.0","main.cluster index_upperinput":"2214.0"}
+ 2214
+ 17.1269
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.2229
+ N/A
+ 0.0
+ 430.2229
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.3128
+ 9
+ 0
+ Feature Node
+ N/A
+ 12610522.671565061
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1787.0","main.cluster index_upperinput":"1787.0"}
+ 1787
+ 29.3128
+ 2
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 518.3247
+ N/A
+ 0.0
+ 518.3247
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1845
+ 6
+ 0
+ Feature Node
+ N/A
+ 7576164.772631672
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1222.0","main.cluster index_upperinput":"1222.0"}
+ 1222
+ 16.1845
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.2223
+ N/A
+ 0.0
+ 430.2223
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.5103
+ 3
+ 0
+ Feature Node
+ N/A
+ 350217.32293116965
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7922.0","main.cluster index_upperinput":"7922.0"}
+ 7922
+ 12.5103
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 484.2289
+ N/A
+ 0.0
+ 484.2289
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.1446
+ 4
+ 0
+ Feature Node
+ N/A
+ 670894.2988872246
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2544.0","main.cluster index_upperinput":"2544.0"}
+ 2544
+ 21.1446
+ -1
+ This Node is a Singleton
+ N/A
+ 524.2851
+ N/A
+ 0.0
+ 524.2851
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.6027
+ 1
+ 0
+ Feature Node
+ N/A
+ 13904379.93812854
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13602.0","main.cluster index_upperinput":"13602.0"}
+ 13602
+ 14.6027
+ -1
+ This Node is a Singleton
+ N/A
+ 446.2171
+ N/A
+ 0.0
+ 446.2171
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.0419
+ 3
+ 0
+ Feature Node
+ N/A
+ 2000194.232098279
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7835.0","main.cluster index_upperinput":"7835.0"}
+ 7835
+ 16.0419
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 512.2275
+ N/A
+ 0.0
+ 512.2275
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.028
+ 8
+ 0
+ Feature Node
+ N/A
+ 3558330.4142912035
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11346.0","main.cluster index_upperinput":"11346.0"}
+ 11346
+ 26.028
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9454
+ N/A
+ 0.0
+ 84.9454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.5402
+ 4
+ 0
+ Feature Node
+ N/A
+ 781710.3130786241
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10319.0","main.cluster index_upperinput":"10319.0"}
+ 10319
+ 20.5402
+ -1
+ This Node is a Singleton
+ N/A
+ 445.1838
+ N/A
+ 0.0
+ 445.1838
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1257
+ 8
+ 0
+ Feature Node
+ N/A
+ 3141622.281925241
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1687.0","main.cluster index_upperinput":"1687.0"}
+ 1687
+ 32.1257
+ -1
+ This Node is a Singleton
+ N/A
+ 331.2613
+ N/A
+ 0.0
+ 331.2613
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.4675
+ 7
+ 0
+ Feature Node
+ N/A
+ 2681399.343616149
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3743.0","main.cluster index_upperinput":"3743.0"}
+ 3743
+ 2.4675
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 326.1957
+ N/A
+ 0.0
+ 326.1957
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.9885
+ 5
+ 0
+ Feature Node
+ N/A
+ 2322328.6485726214
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5505.0","main.cluster index_upperinput":"5505.0"}
+ 5505
+ 11.9885
+ 164
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=164&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 540.2795
+ N/A
+ 0.0
+ 540.2795
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.1856
+ 4
+ 0
+ Feature Node
+ N/A
+ 1381143.160632182
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13837.0","main.cluster index_upperinput":"13837.0"}
+ 13837
+ 18.1856
+ 18
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=18&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 584.2754
+ N/A
+ 0.0
+ 584.2754
+
+
+ 8
+ 0.841784
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 93
+ 1.31576
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"31.0","main.cluster index_upperinput":"31.0"}
+ 1.31576
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1015
+ CCMSLIB00003136238
+ 371.1015
+ 0.0
+ Data from Maria Maansson
+ 4809804.698145876
+ QQQ
+ Isolated
+ 0.00048828099999999997
+ M+H
+ N/A
+ ESI
+ Positive
+ 34.5922
+ 5
+ 0.841784
+ 0.0
+ Isolated
+ 31
+ 0.00048828099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.5922
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.7712
+ 6
+ 0
+ Feature Node
+ N/A
+ 470170.70136298524
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1434.0","main.cluster index_upperinput":"1434.0"}
+ 1434
+ 11.7712
+ -1
+ This Node is a Singleton
+ N/A
+ 289.1409
+ N/A
+ 0.0
+ 289.1409
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.2445
+ 6
+ 0
+ Feature Node
+ N/A
+ 8098510.334287436
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"259.0","main.cluster index_upperinput":"259.0"}
+ 259
+ 35.2445
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 702.2132
+ N/A
+ 0.0
+ 702.2132
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1601
+ 1
+ 0
+ Feature Node
+ N/A
+ 2215797.2822535527
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7643.0","main.cluster index_upperinput":"7643.0"}
+ 7643
+ 32.1601
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 636.4122
+ N/A
+ 0.0
+ 636.4122
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.7398
+ 7
+ 0
+ Feature Node
+ N/A
+ 105786815.56628117
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2651.0","main.cluster index_upperinput":"2651.0"}
+ 2651
+ 6.7398
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 380.2067
+ N/A
+ 0.0
+ 380.2067
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.5249
+ 3
+ 0
+ Feature Node
+ N/A
+ 10764799.246633206
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3522.0","main.cluster index_upperinput":"3522.0"}
+ 3522
+ 32.5249
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 686.1834
+ N/A
+ 0.0
+ 686.1834
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.6667
+ 4
+ 0
+ Feature Node
+ N/A
+ 4549310.098325344
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2482.0","main.cluster index_upperinput":"2482.0"}
+ 2482
+ 18.6667
+ -1
+ This Node is a Singleton
+ N/A
+ 576.39
+ N/A
+ 0.0
+ 576.39
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.4805
+ 3
+ 0
+ Feature Node
+ N/A
+ 12217940.156033816
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13590.0","main.cluster index_upperinput":"13590.0"}
+ 13590
+ 11.4805
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2128
+ N/A
+ 0.0
+ 462.2128
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.7056
+ 7
+ 0
+ Feature Node
+ N/A
+ 588356.5194734614
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7852.0","main.cluster index_upperinput":"7852.0"}
+ 7852
+ 26.7056
+ -1
+ This Node is a Singleton
+ N/A
+ 315.1936
+ N/A
+ 0.0
+ 315.1936
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.9701
+ 4
+ 0
+ Feature Node
+ N/A
+ 862333.1281018631
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4634.0","main.cluster index_upperinput":"4634.0"}
+ 4634
+ 1.9701
+ -1
+ This Node is a Singleton
+ N/A
+ 323.1603
+ N/A
+ 0.0
+ 323.1603
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0337
+ 6
+ 0
+ Feature Node
+ N/A
+ 1737428.0924940114
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14168.0","main.cluster index_upperinput":"14168.0"}
+ 14168
+ 19.0337
+ 25
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=25&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 833.2988
+ N/A
+ 0.0
+ 833.2988
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7794
+ 7
+ 0
+ Feature Node
+ N/A
+ 573332.2140608191
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10359.0","main.cluster index_upperinput":"10359.0"}
+ 10359
+ 21.7794
+ -1
+ This Node is a Singleton
+ N/A
+ 409.2201
+ N/A
+ 0.0
+ 409.2201
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.2599
+ 8
+ 0
+ Feature Node
+ N/A
+ 2378280.0212073703
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"41.0","main.cluster index_upperinput":"41.0"}
+ 41
+ 26.2599
+ -1
+ This Node is a Singleton
+ N/A
+ 299.1619
+ N/A
+ 0.0
+ 299.1619
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.5986
+ 2
+ 0
+ Feature Node
+ N/A
+ 5041541.1889748955
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10255.0","main.cluster index_upperinput":"10255.0"}
+ 10255
+ 14.5986
+ 52
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 506.2748
+ N/A
+ 0.0
+ 506.2748
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.3316
+ 2
+ 0
+ Feature Node
+ N/A
+ 3900009.431098058
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10.0","main.cluster index_upperinput":"10.0"}
+ 10
+ 34.3316
+ -1
+ This Node is a Singleton
+ N/A
+ 437.3598
+ N/A
+ 0.0
+ 437.3598
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2059
+ 9
+ 0
+ Feature Node
+ N/A
+ 6881443.897551997
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"246.0","main.cluster index_upperinput":"246.0"}
+ 246
+ 33.2059
+ -1
+ This Node is a Singleton
+ N/A
+ 301.2115
+ N/A
+ 0.0
+ 301.2115
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.992
+ 9
+ 0
+ Feature Node
+ N/A
+ 7510009.54347136
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"136.0","main.cluster index_upperinput":"136.0"}
+ 136
+ 34.992
+ -1
+ This Node is a Singleton
+ N/A
+ 907.3497
+ N/A
+ 0.0
+ 907.3497
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5236
+ 9
+ 0
+ Feature Node
+ N/A
+ 21315195.76021224
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1599.0","main.cluster index_upperinput":"1599.0"}
+ 1599
+ 33.5236
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 652.4989
+ N/A
+ 0.0
+ 652.4989
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.4041
+ 9
+ 0
+ Feature Node
+ N/A
+ 4893450.9975707345
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10266.0","main.cluster index_upperinput":"10266.0"}
+ 10266
+ 25.4041
+ -1
+ This Node is a Singleton
+ N/A
+ 367.2452
+ N/A
+ 0.0
+ 367.2452
+
+
+ 11
+ 0.726224
+ CCMSLIB00006406564
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006406564
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)
+ 0
+ Orbitrap
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)
+ 0.0
+ Moupinamide
+ O=C(C=CC1=CC=C(O)C(OC)=C1)NCCC2=CC=C(O)C=C2
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006406564
+ 19
+ 2.23437
+ Feature Node
+ N/A
+ 11
+ 0.0
+ 0.0
+ BMDMS-NP
+ Moupinamide
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4514.0","main.cluster index_upperinput":"4514.0"}
+ 2.23437
+ 1
+ O=C(C=CC1=CC=C(O)C(OC)=C1)NCCC2=CC=C(O)C=C2
+ BMDMS-NP
+ 1
+ 314.1393
+ CCMSLIB00006406564
+ 314.1393
+ 0.0
+ BMDMS-NP
+ 8670308.290850414
+ Orbitrap
+ Commercial standard
+ 0.0007019039999999999
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 16.8589
+ 4
+ 0.726224
+ 0.0
+ Commercial standard
+ 4514
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.8589
+ 0.0
+ [M+H]+
+
+
+ 14
+ 0.714264
+ CCMSLIB00005467698
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+
+ 0
+ qTof
+
+ 0.0
+ Dihydroactinidiolide
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+ 11
+ 12.1315
+ Feature Node
+ N/A
+ 14
+ 0.0
+ 0.0
+ Armando Alcazar
+ Dihydroactinidiolide
+ Positive
+ Armando Alcazar
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9925.0","main.cluster index_upperinput":"9925.0"}
+ 12.1315
+ 3
+
+ Claudia Maier
+ 3
+ 181.1222
+ CCMSLIB00005467698
+ 181.1222
+ 0.0
+ Claudia Maier
+ 2252821.665392649
+ qTof
+ Isolated
+ 0.00219727
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 17.2233
+ 7
+ 0.714264
+ 0.0
+ Isolated
+ 9925
+ 0.00219727
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.2233
+ 0.0
+ M+H
+
+
+ 14
+ 0.716589
+ CCMSLIB00003138418
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138418
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to Monolinolenin (9c,12c,15c) from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138418
+ 11
+ 5.44233
+ Feature Node
+ N/A
+ 14
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Monolinolenin (9c,12c,15c) from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5818.0","main.cluster index_upperinput":"5818.0"}
+ 5.44233
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 353.2671
+ CCMSLIB00003138418
+ 353.2671
+ 0.0
+ Data from Wolfender/Litaudon
+ 10771480.543452308
+ HCD
+ Isolated
+ 0.00192261
+ M+H
+ N/A
+ ESI
+ Positive
+ 29.4981
+ 8
+ 0.716589
+ 0.0
+ Isolated
+ 5818
+ 0.00192261
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 29.4981
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9292
+ 2
+ 0
+ Feature Node
+ N/A
+ 1583678.248769511
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4567.0","main.cluster index_upperinput":"4567.0"}
+ 4567
+ 19.9292
+ -1
+ This Node is a Singleton
+ N/A
+ 540.2798
+ N/A
+ 0.0
+ 540.2798
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.0195
+ 9
+ 0
+ Feature Node
+ N/A
+ 6287067.017692467
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1610.0","main.cluster index_upperinput":"1610.0"}
+ 1610
+ 33.0195
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 626.4835
+ N/A
+ 0.0
+ 626.4835
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.6129
+ 8
+ 0
+ Feature Node
+ N/A
+ 5402568.6686104555
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7706.0","main.cluster index_upperinput":"7706.0"}
+ 7706
+ 22.6129
+ -1
+ This Node is a Singleton
+ N/A
+ 282.204
+ N/A
+ 0.0
+ 282.204
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0075
+ 5
+ 0
+ Feature Node
+ N/A
+ 7569019.175678555
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4589.0","main.cluster index_upperinput":"4589.0"}
+ 4589
+ 18.0075
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1222
+ N/A
+ 0.0
+ 229.1222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5879
+ 9
+ 0
+ Feature Node
+ N/A
+ 8541511.101834888
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2666.0","main.cluster index_upperinput":"2666.0"}
+ 2666
+ 34.5879
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.3713
+ N/A
+ 0.0
+ 441.3713
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9778
+ 6
+ 0
+ Feature Node
+ N/A
+ 3822696.4967144346
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4738.0","main.cluster index_upperinput":"4738.0"}
+ 4738
+ 14.9778
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 393.1885
+ N/A
+ 0.0
+ 393.1885
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.2093
+ 4
+ 0
+ Feature Node
+ N/A
+ 1084427.6901699018
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4616.0","main.cluster index_upperinput":"4616.0"}
+ 4616
+ 14.2093
+ 51
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=51&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 574.1935
+ N/A
+ 0.0
+ 574.1935
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.2665
+ 3
+ 0
+ Feature Node
+ N/A
+ 1062466.2480869093
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5666.0","main.cluster index_upperinput":"5666.0"}
+ 5666
+ 20.2665
+ -1
+ This Node is a Singleton
+ N/A
+ 443.1687
+ N/A
+ 0.0
+ 443.1687
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4955
+ 7
+ 0
+ Feature Node
+ N/A
+ 3448498.1034955047
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4218.0","main.cluster index_upperinput":"4218.0"}
+ 4218
+ 33.4955
+ -1
+ This Node is a Singleton
+ N/A
+ 363.287
+ N/A
+ 0.0
+ 363.287
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.8783
+ 7
+ 0
+ Feature Node
+ N/A
+ 5095427.912471893
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1361.0","main.cluster index_upperinput":"1361.0"}
+ 1361
+ 25.8783
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 500.3734
+ N/A
+ 0.0
+ 500.3734
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1241
+ 7
+ 0
+ Feature Node
+ N/A
+ 2736037.8002693173
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13772.0","main.cluster index_upperinput":"13772.0"}
+ 13772
+ 26.1241
+ -1
+ This Node is a Singleton
+ N/A
+ 553.2994
+ N/A
+ 0.0
+ 553.2994
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.622
+ 8
+ 0
+ Feature Node
+ N/A
+ 1645993.5578476528
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8068.0","main.cluster index_upperinput":"8068.0"}
+ 8068
+ 31.622
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 580.4426
+ N/A
+ 0.0
+ 580.4426
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.1518
+ 8
+ 0
+ Feature Node
+ N/A
+ 220214.97247516253
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4705.0","main.cluster index_upperinput":"4705.0"}
+ 4705
+ 27.1518
+ -1
+ This Node is a Singleton
+ N/A
+ 335.1277
+ N/A
+ 0.0
+ 335.1277
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.0297
+ 7
+ 0
+ Feature Node
+ N/A
+ 1586044.829852911
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7740.0","main.cluster index_upperinput":"7740.0"}
+ 7740
+ 24.0297
+ -1
+ This Node is a Singleton
+ N/A
+ 337.0685
+ N/A
+ 0.0
+ 337.0685
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.5538
+ 6
+ 0
+ Feature Node
+ N/A
+ 838234.0329333141
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"24963.0","main.cluster index_upperinput":"24963.0"}
+ 24963
+ 27.5538
+ -1
+ This Node is a Singleton
+ N/A
+ 529.3479
+ N/A
+ 0.0
+ 529.3479
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.7126
+ 4
+ 0
+ Feature Node
+ N/A
+ 805988.746828987
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10314.0","main.cluster index_upperinput":"10314.0"}
+ 10314
+ 18.7126
+ -1
+ This Node is a Singleton
+ N/A
+ 469.2054
+ N/A
+ 0.0
+ 469.2054
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.3555
+ 9
+ 0
+ Feature Node
+ N/A
+ 37369511.71004481
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1198.0","main.cluster index_upperinput":"1198.0"}
+ 1198
+ 30.3555
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 375.2507
+ N/A
+ 0.0
+ 375.2507
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.0213
+ 5
+ 0
+ Feature Node
+ N/A
+ 1759932.8981540177
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13740.0","main.cluster index_upperinput":"13740.0"}
+ 13740
+ 22.0213
+ -1
+ This Node is a Singleton
+ N/A
+ 626.2954
+ N/A
+ 0.0
+ 626.2954
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.5369
+ 5
+ 0
+ Feature Node
+ N/A
+ 458758.89998328313
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"386.0","main.cluster index_upperinput":"386.0"}
+ 386
+ 24.5369
+ 33
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 620.2914
+ N/A
+ 0.0
+ 620.2914
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.8494
+ 6
+ 0
+ Feature Node
+ N/A
+ 1711360.5135023564
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4611.0","main.cluster index_upperinput":"4611.0"}
+ 4611
+ 13.8494
+ 51
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=51&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 590.1871
+ N/A
+ 0.0
+ 590.1871
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.98
+ 8
+ 0
+ Feature Node
+ N/A
+ 14619754.574562645
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2644.0","main.cluster index_upperinput":"2644.0"}
+ 2644
+ 28.98
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 694.4015
+ N/A
+ 0.0
+ 694.4015
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.2557
+ 7
+ 0
+ Feature Node
+ N/A
+ 145317727.82460308
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7664.0","main.cluster index_upperinput":"7664.0"}
+ 7664
+ 3.2557
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 378.1912
+ N/A
+ 0.0
+ 378.1912
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.598
+ 5
+ 0
+ Feature Node
+ N/A
+ 1423176.0678384684
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4581.0","main.cluster index_upperinput":"4581.0"}
+ 4581
+ 13.598
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 426.2477
+ N/A
+ 0.0
+ 426.2477
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.3168
+ 3
+ 0
+ Feature Node
+ N/A
+ 723148.2603504458
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7811.0","main.cluster index_upperinput":"7811.0"}
+ 7811
+ 15.3168
+ -1
+ This Node is a Singleton
+ N/A
+ 446.2162
+ N/A
+ 0.0
+ 446.2162
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.5763
+ 6
+ 0
+ Feature Node
+ N/A
+ 2041634.0674261255
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5217.0","main.cluster index_upperinput":"5217.0"}
+ 5217
+ 19.5763
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1221
+ N/A
+ 0.0
+ 229.1221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.0532
+ 1
+ 0
+ Feature Node
+ N/A
+ 2498268.618522216
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13728.0","main.cluster index_upperinput":"13728.0"}
+ 13728
+ 28.0532
+ -1
+ This Node is a Singleton
+ N/A
+ 921.4678
+ N/A
+ 0.0
+ 921.4678
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.7844
+ 3
+ 0
+ Feature Node
+ N/A
+ 1125518.806913342
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13850.0","main.cluster index_upperinput":"13850.0"}
+ 13850
+ 19.7844
+ -1
+ This Node is a Singleton
+ N/A
+ 530.3531
+ N/A
+ 0.0
+ 530.3531
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.748
+ 6
+ 0
+ Feature Node
+ N/A
+ 924937.1035848656
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3551.0","main.cluster index_upperinput":"3551.0"}
+ 3551
+ 10.748
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 402.2279
+ N/A
+ 0.0
+ 402.2279
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.2429
+ 2
+ 0
+ Feature Node
+ N/A
+ 1077111.3249234953
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4571.0","main.cluster index_upperinput":"4571.0"}
+ 4571
+ 15.2429
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 581.1506
+ N/A
+ 0.0
+ 581.1506
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.6224
+ 5
+ 0
+ Feature Node
+ N/A
+ 1208667.0377397968
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4579.0","main.cluster index_upperinput":"4579.0"}
+ 4579
+ 19.6224
+ 71
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 287.0557
+ N/A
+ 0.0
+ 287.0557
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.2862
+ 6
+ 0
+ Feature Node
+ N/A
+ 630859.3180322277
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1269.0","main.cluster index_upperinput":"1269.0"}
+ 1269
+ 15.2862
+ -1
+ This Node is a Singleton
+ N/A
+ 433.183
+ N/A
+ 0.0
+ 433.183
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5632
+ 2
+ 0
+ Feature Node
+ N/A
+ 982600.0517985214
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13890.0","main.cluster index_upperinput":"13890.0"}
+ 13890
+ 16.5632
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 514.2428
+ N/A
+ 0.0
+ 514.2428
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.8985
+ 4
+ 0
+ Feature Node
+ N/A
+ 3955427.8862255495
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7648.0","main.cluster index_upperinput":"7648.0"}
+ 7648
+ 1.8985
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.2182
+ N/A
+ 0.0
+ 496.2182
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.1465
+ 9
+ 0
+ Feature Node
+ N/A
+ 3556689.0939797275
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5997.0","main.cluster index_upperinput":"5997.0"}
+ 5997
+ 25.1465
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.3597
+ 7
+ 0
+ Feature Node
+ N/A
+ 491199.1512686255
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8188.0","main.cluster index_upperinput":"8188.0"}
+ 8188
+ 35.3597
+ -1
+ This Node is a Singleton
+ N/A
+ 443.3879
+ N/A
+ 0.0
+ 443.3879
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.1051
+ 5
+ 0
+ Feature Node
+ N/A
+ 31034694.91166747
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13592.0","main.cluster index_upperinput":"13592.0"}
+ 13592
+ 15.1051
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 428.2066
+ N/A
+ 0.0
+ 428.2066
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.1473
+ 5
+ 0
+ Feature Node
+ N/A
+ 2641415.507361026
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10265.0","main.cluster index_upperinput":"10265.0"}
+ 10265
+ 13.1473
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 424.232
+ N/A
+ 0.0
+ 424.232
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.602
+ 6
+ 0
+ Feature Node
+ N/A
+ 1463936.4035016228
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10432.0","main.cluster index_upperinput":"10432.0"}
+ 10432
+ 8.602
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 440.2278
+ N/A
+ 0.0
+ 440.2278
+
+
+ 13
+ 0.9145399999999999
+ CCMSLIB00005769981
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005769981
+ 1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3/t8-,10-,13-,15-/m0/s1
+ 0
+ Hybrid FT
+ 1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3/t8-,10-,13-,15-/m0/s1
+ 0.0
+ Massbank:NA003103 alpha-Santonin|Santonin|(3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione
+ C[C@H]1[C@@H]2CC[C@]3(C=CC(=O)C(=C3[C@H]2OC1=O)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005769981
+ -1
+ 2.4079900000000003
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ Massbank
+ Massbank:NA003103 alpha-Santonin|Santonin|(3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1160.0","main.cluster index_upperinput":"1160.0"}
+ 2.4079900000000003
+ 3
+ C[C@H]1[C@@H]2CC[C@]3(C=CC(=O)C(=C3[C@H]2OC1=O)C)C
+ Massbank
+ 3
+ 247.1324
+ CCMSLIB00005769981
+ 247.1324
+ 0.0
+ Massbank
+ 5635157.237140418
+ Hybrid FT
+ Isolated
+ 0.000595093
+ M+H
+ N/A
+ ESI
+ Positive
+ 15.8923
+ 9
+ 0.9145399999999999
+ 0.0
+ Isolated
+ 1160
+ 0.000595093
+ This Node is a Singleton
+ 15.8923
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.9576
+ 1
+ 0
+ Feature Node
+ N/A
+ 315771.90076120663
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8131.0","main.cluster index_upperinput":"8131.0"}
+ 8131
+ 3.9576
+ -1
+ This Node is a Singleton
+ N/A
+ 398.137
+ N/A
+ 0.0
+ 398.137
+
+
+ 6
+ 0.770708
+ CCMSLIB00006443171
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006443171
+ InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3
+ 0
+ Orbitrap
+ InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3
+ 0.0
+ Chrysosplenetin B
+ O=C1C(OC)=C(OC2=CC(OC)=C(OC)C(O)=C12)C=3C=CC(O)=C(OC)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006443171
+ 4
+ 5.53223
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ BMDMS-NP
+ Chrysosplenetin B
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13731.0","main.cluster index_upperinput":"13731.0"}
+ 5.53223
+ 1
+ O=C1C(OC)=C(OC2=CC(OC)=C(OC)C(O)=C12)C=3C=CC(O)=C(OC)C3
+ BMDMS-NP
+ 1
+ 375.1079
+ CCMSLIB00006443171
+ 375.1079
+ 0.0
+ BMDMS-NP
+ 1477855.7282944683
+ Orbitrap
+ Commercial standard
+ 0.0020751999999999997
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 22.025
+ 2
+ 0.770708
+ 0.0
+ Commercial standard
+ 13731
+ 0.0020751999999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 22.025
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.7865
+ 5
+ 0
+ Feature Node
+ N/A
+ 5634330.456239888
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1580.0","main.cluster index_upperinput":"1580.0"}
+ 1580
+ 32.7865
+ -1
+ This Node is a Singleton
+ N/A
+ 613.4819
+ N/A
+ 0.0
+ 613.4819
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.4705
+ 2
+ 0
+ Feature Node
+ N/A
+ 697665.1706903478
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13805.0","main.cluster index_upperinput":"13805.0"}
+ 13805
+ 24.4705
+ 111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=111&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 222.1849
+ N/A
+ 0.0
+ 222.1849
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.8687
+ 6
+ 0
+ Feature Node
+ N/A
+ 777952.9862427624
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4452.0","main.cluster index_upperinput":"4452.0"}
+ 4452
+ 3.8687
+ -1
+ This Node is a Singleton
+ N/A
+ 442.2429
+ N/A
+ 0.0
+ 442.2429
+
+
+ 28
+ 0.780854
+ CCMSLIB00003136883
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136883
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to Monobehenin from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136883
+ 11
+ 40.5502
+ Feature Node
+ N/A
+ 28
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Monobehenin from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11.0","main.cluster index_upperinput":"11.0"}
+ 40.5502
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 397.3821
+ CCMSLIB00003136883
+ 397.3821
+ 0.0
+ Data from Wolfender/Litaudon
+ 6309755.94232601
+ HCD
+ Isolated
+ 0.016113299999999997
+ M+H-H2O
+ N/A
+ ESI
+ Positive
+ 33.6281
+ 5
+ 0.780854
+ 0.0
+ Isolated
+ 11
+ 0.016113299999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 33.6281
+ 0.0
+ M+H-H2O
+
+
+ 13
+ 0.7867149999999999
+ CCMSLIB00006388888
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006388888
+ InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3
+ 0
+ Orbitrap
+ InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3
+ 0.0
+ 5,7-dihydroxy-6-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=CC3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006388888
+ 32
+ 12.0098
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ BMDMS-NP
+ 5,7-dihydroxy-6-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5042.0","main.cluster index_upperinput":"5042.0"}
+ 12.0098
+ 1
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=CC3
+ BMDMS-NP
+ 1
+ 315.0862
+ CCMSLIB00006388888
+ 315.0862
+ 0.0
+ BMDMS-NP
+ 11875395.741594443
+ Orbitrap
+ Commercial standard
+ 0.00378418
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 24.0569
+ 9
+ 0.7867149999999999
+ 0.0
+ Commercial standard
+ 5042
+ 0.00378418
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 24.0569
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4006
+ 9
+ 0
+ Feature Node
+ N/A
+ 4806965.936633
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"39.0","main.cluster index_upperinput":"39.0"}
+ 39
+ 33.4006
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 702.2131
+ N/A
+ 0.0
+ 702.2131
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.5538
+ 8
+ 0
+ Feature Node
+ N/A
+ 25210151.04134559
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1255.0","main.cluster index_upperinput":"1255.0"}
+ 1255
+ 1.5538
+ 185
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=185&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 310.1285
+ N/A
+ 0.0
+ 310.1285
+
+
+ 64
+ 0.79115
+ CCMSLIB00004692320
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692320
+ InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9-
+ 0
+ ESI-QFT
+ InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9-
+ 0.0
+ monolinolein
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692320
+ 11
+ 2.2333
+ Feature Node
+ N/A
+ 64
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF001257
+ monolinolein
+ positive
+ MoNA:VF-NPL-QEHF001257
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1547.0","main.cluster index_upperinput":"1547.0"}
+ 2.2333
+ 3
+ N/A
+ MoNA
+ 3
+ 355.2832
+ CCMSLIB00004692320
+ 355.2832
+ 0.0
+ MoNA
+ 23338089.313483216
+ ESI-QFT
+ isolated
+ 0.000793457
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 31.2734
+ 8
+ 0.79115
+ 0.0
+ isolated
+ 1547
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.2734
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.9898
+ 6
+ 0
+ Feature Node
+ N/A
+ 9472291.486647518
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13626.0","main.cluster index_upperinput":"13626.0"}
+ 13626
+ 29.9898
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 309.2415
+ N/A
+ 0.0
+ 309.2415
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4763
+ 8
+ 0
+ Feature Node
+ N/A
+ 449950.911581177
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4047.0","main.cluster index_upperinput":"4047.0"}
+ 4047
+ 26.4763
+ -1
+ This Node is a Singleton
+ N/A
+ 203.1791
+ N/A
+ 0.0
+ 203.1791
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.2966
+ 7
+ 0
+ Feature Node
+ N/A
+ 15309332.431120673
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2573.0","main.cluster index_upperinput":"2573.0"}
+ 2573
+ 32.2966
+ 29
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=29&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 609.2716
+ N/A
+ 0.0
+ 609.2716
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9602
+ 2
+ 0
+ Feature Node
+ N/A
+ 3765032.2483169576
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10240.0","main.cluster index_upperinput":"10240.0"}
+ 10240
+ 19.9602
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 544.2756
+ N/A
+ 0.0
+ 544.2756
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.701
+ 8
+ 0
+ Feature Node
+ N/A
+ 2793297.1361398483
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1301.0","main.cluster index_upperinput":"1301.0"}
+ 1301
+ 23.701
+ -1
+ This Node is a Singleton
+ N/A
+ 277.1784
+ N/A
+ 0.0
+ 277.1784
+
+
+ 6
+ 0.835441
+ CCMSLIB00005745975
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745975
+ 1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1
+ 0
+ qTof
+ 1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1
+ 0.0
+ Massbank:PR303098 Petunidin-3-O-beta-glucoside
+ COC1=CC(=CC(O)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C2C(O)=CC(O)=CC2=[O+]1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745975
+ 8
+ 0.254781
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303098 Petunidin-3-O-beta-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2842.0","main.cluster index_upperinput":"2842.0"}
+ 0.254781
+ 3
+ COC1=CC(=CC(O)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C2C(O)=CC(O)=CC2=[O+]1
+ Massbank
+ 3
+ 479.1179
+ CCMSLIB00005745975
+ 479.1179
+ 0.0
+ Massbank
+ 5842490.873495759
+ qTof
+ Isolated
+ 0.00012207
+ M
+ N/A
+ ESI
+ Positive
+ 15.3975
+ 7
+ 0.835441
+ 0.0
+ Isolated
+ 2842
+ 0.00012207
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.3975
+ 0.0
+ M
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6356
+ 7
+ 0
+ Feature Node
+ N/A
+ 561717.5147988731
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"398.0","main.cluster index_upperinput":"398.0"}
+ 398
+ 23.6356
+ 55
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 240.0684
+ N/A
+ 0.0
+ 240.0684
+
+
+ 8
+ 0.96452
+ CCMSLIB00003138795
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138795
+ N/A
+ 0
+ Q-TOF
+ N/A
+ 0.0
+ Spectral Match to 1-Hexadecanoyl-2-octadecadienoyl-sn-glycero-3-phosphocholine from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138795
+ 2
+ 0.563226
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Data deposited by fevargas
+ Spectral Match to 1-Hexadecanoyl-2-octadecadienoyl-sn-glycero-3-phosphocholine from NIST14
+ Positive
+ Data deposited by fevargas
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1169.0","main.cluster index_upperinput":"1169.0"}
+ 0.563226
+ 3
+ N/A
+ Data from Kevin Bush
+ 3
+ 758.5694
+ CCMSLIB00003138795
+ 758.5694
+ 0.0
+ Data from Kevin Bush
+ 14429564.74490955
+ Q-TOF
+ Isolated
+ 0.000427246
+ M+H
+ N/A
+ ESI
+ Positive
+ 34.6916
+ 6
+ 0.96452
+ 0.0
+ Isolated
+ 1169
+ 0.000427246
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.6916
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.577
+ 3
+ 0
+ Feature Node
+ N/A
+ 732298.0108258808
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8579.0","main.cluster index_upperinput":"8579.0"}
+ 8579
+ 35.577
+ -1
+ This Node is a Singleton
+ N/A
+ 469.366
+ N/A
+ 0.0
+ 469.366
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.3181
+ 9
+ 0
+ Feature Node
+ N/A
+ 10643244.294594727
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5846.0","main.cluster index_upperinput":"5846.0"}
+ 5846
+ 21.3181
+ -1
+ This Node is a Singleton
+ N/A
+ 128.9514
+ N/A
+ 0.0
+ 128.9514
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.8329
+ 2
+ 0
+ Feature Node
+ N/A
+ 773527.8561918916
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14016.0","main.cluster index_upperinput":"14016.0"}
+ 14016
+ 17.8329
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.167
+ N/A
+ 0.0
+ 607.167
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.266
+ 9
+ 0
+ Feature Node
+ N/A
+ 55245058.0205451
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1202.0","main.cluster index_upperinput":"1202.0"}
+ 1202
+ 31.266
+ -1
+ This Node is a Singleton
+ N/A
+ 377.2666
+ N/A
+ 0.0
+ 377.2666
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.7493
+ 2
+ 0
+ Feature Node
+ N/A
+ 1464633.9558323517
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7724.0","main.cluster index_upperinput":"7724.0"}
+ 7724
+ 14.7493
+ -1
+ This Node is a Singleton
+ N/A
+ 564.2006
+ N/A
+ 0.0
+ 564.2006
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.7725
+ 7
+ 0
+ Feature Node
+ N/A
+ 7460217.255533516
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"73.0","main.cluster index_upperinput":"73.0"}
+ 73
+ 30.7725
+ -1
+ This Node is a Singleton
+ N/A
+ 754.5436
+ N/A
+ 0.0
+ 754.5436
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.2462
+ 6
+ 0
+ Feature Node
+ N/A
+ 2319406.6825632127
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1210.0","main.cluster index_upperinput":"1210.0"}
+ 1210
+ 32.2462
+ -1
+ This Node is a Singleton
+ N/A
+ 347.2561
+ N/A
+ 0.0
+ 347.2561
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.1079
+ 3
+ 0
+ Feature Node
+ N/A
+ 1287900.2525224832
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1348.0","main.cluster index_upperinput":"1348.0"}
+ 1348
+ 12.1079
+ -1
+ This Node is a Singleton
+ N/A
+ 451.194
+ N/A
+ 0.0
+ 451.194
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.938
+ 4
+ 0
+ Feature Node
+ N/A
+ 1084285.5748550957
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1273.0","main.cluster index_upperinput":"1273.0"}
+ 1273
+ 10.938
+ -1
+ This Node is a Singleton
+ N/A
+ 451.1935
+ N/A
+ 0.0
+ 451.1935
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.7143
+ 2
+ 0
+ Feature Node
+ N/A
+ 504022.2215230646
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4613.0","main.cluster index_upperinput":"4613.0"}
+ 4613
+ 15.7143
+ -1
+ This Node is a Singleton
+ N/A
+ 437.242
+ N/A
+ 0.0
+ 437.242
+
+
+ 21
+ 0.901824
+ CCMSLIB00006444022
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006444022
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3
+ 0
+ Orbitrap
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3
+ 0.0
+ Eupatorin
+ O=C1C=C(OC=2C=C(OC)C(OC)=C(O)C12)C=3C=CC(OC)=C(O)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006444022
+ 4
+ 7.51664
+ Feature Node
+ N/A
+ 21
+ 0.0
+ 0.0
+ BMDMS-NP
+ Eupatorin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1163.0","main.cluster index_upperinput":"1163.0"}
+ 7.51664
+ 1
+ O=C1C=C(OC=2C=C(OC)C(OC)=C(O)C12)C=3C=CC(OC)=C(O)C3
+ BMDMS-NP
+ 1
+ 345.0974
+ CCMSLIB00006444022
+ 345.0974
+ 0.0
+ BMDMS-NP
+ 5325521.054104207
+ Orbitrap
+ Commercial standard
+ 0.00259399
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 21.4952
+ 7
+ 0.901824
+ 0.0
+ Commercial standard
+ 1163
+ 0.00259399
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.4952
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.0886
+ 4
+ 0
+ Feature Node
+ N/A
+ 2536959.7966410457
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4625.0","main.cluster index_upperinput":"4625.0"}
+ 4625
+ 14.0886
+ -1
+ This Node is a Singleton
+ N/A
+ 284.1852
+ N/A
+ 0.0
+ 284.1852
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8763
+ 6
+ 0
+ Feature Node
+ N/A
+ 7126549.184635905
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4516.0","main.cluster index_upperinput":"4516.0"}
+ 4516
+ 16.8763
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 463.1228
+ N/A
+ 0.0
+ 463.1228
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8385
+ 8
+ 0
+ Feature Node
+ N/A
+ 40017536.18780566
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2526.0","main.cluster index_upperinput":"2526.0"}
+ 2526
+ 32.8385
+ 29
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=29&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 609.2714
+ N/A
+ 0.0
+ 609.2714
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.1062
+ 2
+ 0
+ Feature Node
+ N/A
+ 1140610.7665840336
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13781.0","main.cluster index_upperinput":"13781.0"}
+ 13781
+ 18.1062
+ -1
+ This Node is a Singleton
+ N/A
+ 414.1913
+ N/A
+ 0.0
+ 414.1913
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.8224
+ 5
+ 0
+ Feature Node
+ N/A
+ 1736656.1667164166
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1303.0","main.cluster index_upperinput":"1303.0"}
+ 1303
+ 22.8224
+ -1
+ This Node is a Singleton
+ N/A
+ 290.2688
+ N/A
+ 0.0
+ 290.2688
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.118
+ 5
+ 0
+ Feature Node
+ N/A
+ 12922761.737362226
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5160.0","main.cluster index_upperinput":"5160.0"}
+ 5160
+ 35.118
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 702.2134
+ N/A
+ 0.0
+ 702.2134
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.5601
+ 9
+ 0
+ Feature Node
+ N/A
+ 3444341.0405529384
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5874.0","main.cluster index_upperinput":"5874.0"}
+ 5874
+ 24.5601
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.7681
+ 2
+ 0
+ Feature Node
+ N/A
+ 1785260.3821190032
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13707.0","main.cluster index_upperinput":"13707.0"}
+ 13707
+ 25.7681
+ -1
+ This Node is a Singleton
+ N/A
+ 578.405
+ N/A
+ 0.0
+ 578.405
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.8535
+ 4
+ 0
+ Feature Node
+ N/A
+ 4105685.4145382615
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13616.0","main.cluster index_upperinput":"13616.0"}
+ 13616
+ 31.8535
+ -1
+ This Node is a Singleton
+ N/A
+ 449.3277
+ N/A
+ 0.0
+ 449.3277
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5089
+ 8
+ 0
+ Feature Node
+ N/A
+ 94506636.82947218
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9385.0","main.cluster index_upperinput":"9385.0"}
+ 9385
+ 34.5089
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 343.339
+ N/A
+ 0.0
+ 343.339
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4826
+ 8
+ 0
+ Feature Node
+ N/A
+ 4292941.029834525
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7803.0","main.cluster index_upperinput":"7803.0"}
+ 7803
+ 33.4826
+ 73
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=73&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3727
+ N/A
+ 0.0
+ 429.3727
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.1423
+ 4
+ 0
+ Feature Node
+ N/A
+ 233018.7407787448
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7928.0","main.cluster index_upperinput":"7928.0"}
+ 7928
+ 24.1423
+ -1
+ This Node is a Singleton
+ N/A
+ 531.2576
+ N/A
+ 0.0
+ 531.2576
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.717
+ 3
+ 0
+ Feature Node
+ N/A
+ 607252.2477815888
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4610.0","main.cluster index_upperinput":"4610.0"}
+ 4610
+ 11.717
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 671.1813
+ N/A
+ 0.0
+ 671.1813
+
+
+ 25
+ 0.9127639999999999
+ CCMSLIB00005747303
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005747303
+ 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
+ 0
+ qTof
+ 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
+ 0.0
+ Massbank:PR304003 Matairesinol
+ COC1=C(O)C=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005747303
+ 85
+ 0.849719
+ Feature Node
+ N/A
+ 25
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR304003 Matairesinol
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1165.0","main.cluster index_upperinput":"1165.0"}
+ 0.849719
+ 3
+ COC1=C(O)C=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)=C1
+ Massbank
+ 3
+ 359.1493
+ CCMSLIB00005747303
+ 359.1493
+ 0.0
+ Massbank
+ 4944585.622538391
+ qTof
+ Isolated
+ 0.000305176
+ M+H
+ N/A
+ ESI
+ Positive
+ 16.8198
+ 7
+ 0.9127639999999999
+ 0.0
+ Isolated
+ 1165
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.8198
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.1089
+ 6
+ 0
+ Feature Node
+ N/A
+ 2615103.016334719
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3752.0","main.cluster index_upperinput":"3752.0"}
+ 3752
+ 30.1089
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 259.205
+ N/A
+ 0.0
+ 259.205
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.574
+ 1
+ 0
+ Feature Node
+ N/A
+ 235242.08195911878
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10646.0","main.cluster index_upperinput":"10646.0"}
+ 10646
+ 21.574
+ -1
+ This Node is a Singleton
+ N/A
+ 446.2389
+ N/A
+ 0.0
+ 446.2389
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.0146
+ 3
+ 0
+ Feature Node
+ N/A
+ 3869365.9693508586
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4524.0","main.cluster index_upperinput":"4524.0"}
+ 4524
+ 16.0146
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.2323
+ N/A
+ 0.0
+ 412.2323
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6603
+ 8
+ 0
+ Feature Node
+ N/A
+ 12608022.748829301
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3400.0","main.cluster index_upperinput":"3400.0"}
+ 3400
+ 32.6603
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 379.2835
+ N/A
+ 0.0
+ 379.2835
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6717
+ 5
+ 0
+ Feature Node
+ N/A
+ 631514.8115012563
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10285.0","main.cluster index_upperinput":"10285.0"}
+ 10285
+ 32.6717
+ -1
+ This Node is a Singleton
+ N/A
+ 579.3509
+ N/A
+ 0.0
+ 579.3509
+
+
+ 6
+ 0.8458129999999999
+ CCMSLIB00000846805
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000846805
+ InChI=1S/C22H22O13/c1-32-20-10(26)2-7(3-11(20)27)19-21(16(29)14-9(25)4-8(24)5-12(14)33-19)35-22-18(31)17(30)15(28)13(6-23)34-22/h2-5,13,15,17-18,22-28,30-31H,6H2,1H3/t13-,15-,17+,18-,22+/m1/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C22H22O13/c1-32-20-10(26)2-7(3-11(20)27)19-21(16(29)14-9(25)4-8(24)5-12(14)33-19)35-22-18(31)17(30)15(28)13(6-23)34-22/h2-5,13,15,17-18,22-28,30-31H,6H2,1H3/t13-,15-,17+,18-,22+/m1/s1
+ 0.0
+ NCGC00385532-01!2-(3,5-dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+ COC1=C(O)C=C(C=C1O)C2=C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C(=O)C4=C(O)C=C(O)C=C4O2
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000846805
+ 8
+ 1.4176600000000001
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00385532-01!2-(3,5-dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4522.0","main.cluster index_upperinput":"4522.0"}
+ 1.4176600000000001
+ 1
+ COC1=C(O)C=C(C=C1O)C2=C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C(=O)C4=C(O)C=C(O)C=C4O2
+ Jadhav/Dorrestein
+ 1
+ 495.1137
+ CCMSLIB00000846805
+ 495.1137
+ 0.0
+ Jadhav/Dorrestein
+ 4479533.367906134
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 14.6014
+ 5
+ 0.8458129999999999
+ 0.0
+ isolated
+ 4522
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.6014
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.5776
+ 1
+ 0
+ Feature Node
+ N/A
+ 1058797.409177819
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7679.0","main.cluster index_upperinput":"7679.0"}
+ 7679
+ 19.5776
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 382.1867
+ N/A
+ 0.0
+ 382.1867
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.8634
+ 7
+ 0
+ Feature Node
+ N/A
+ 2055203.0081609879
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2931.0","main.cluster index_upperinput":"2931.0"}
+ 2931
+ 19.8634
+ 32
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 317.0658
+ N/A
+ 0.0
+ 317.0658
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.3024
+ 6
+ 0
+ Feature Node
+ N/A
+ 7844725.125524452
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3521.0","main.cluster index_upperinput":"3521.0"}
+ 3521
+ 33.3024
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 716.2294
+ N/A
+ 0.0
+ 716.2294
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.495
+ 9
+ 0
+ Feature Node
+ N/A
+ 28597136.092171587
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1192.0","main.cluster index_upperinput":"1192.0"}
+ 1192
+ 1.495
+ 108
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 120.0807
+ N/A
+ 0.0
+ 120.0807
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.7946
+ 7
+ 0
+ Feature Node
+ N/A
+ 3441386.0914561693
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7686.0","main.cluster index_upperinput":"7686.0"}
+ 7686
+ 33.7946
+ -1
+ This Node is a Singleton
+ N/A
+ 601.3722
+ N/A
+ 0.0
+ 601.3722
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9423
+ 3
+ 0
+ Feature Node
+ N/A
+ 750613.9973360753
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3545.0","main.cluster index_upperinput":"3545.0"}
+ 3545
+ 16.9423
+ -1
+ This Node is a Singleton
+ N/A
+ 520.2542
+ N/A
+ 0.0
+ 520.2542
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.2291
+ 3
+ 0
+ Feature Node
+ N/A
+ 546314.6723622666
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7892.0","main.cluster index_upperinput":"7892.0"}
+ 7892
+ 2.2291
+ 49
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=49&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 460.1739
+ N/A
+ 0.0
+ 460.1739
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8906
+ 8
+ 0
+ Feature Node
+ N/A
+ 3046973.7429934265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11652.0","main.cluster index_upperinput":"11652.0"}
+ 11652
+ 21.8906
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8898
+ N/A
+ 0.0
+ 84.9449
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.8379
+ 6
+ 0
+ Feature Node
+ N/A
+ 3597814.05403459
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"23.0","main.cluster index_upperinput":"23.0"}
+ 23
+ 31.8379
+ -1
+ This Node is a Singleton
+ N/A
+ 629.4033
+ N/A
+ 0.0
+ 629.4033
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0297
+ 8
+ 0
+ Feature Node
+ N/A
+ 15972525.347046196
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1195.0","main.cluster index_upperinput":"1195.0"}
+ 1195
+ 34.0297
+ -1
+ This Node is a Singleton
+ N/A
+ 485.3604
+ N/A
+ 0.0
+ 485.3604
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.7826
+ 4
+ 0
+ Feature Node
+ N/A
+ 2800428.1668925975
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3543.0","main.cluster index_upperinput":"3543.0"}
+ 3543
+ 33.7826
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1099.6391
+ N/A
+ 0.0
+ 1099.6391
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.032
+ 1
+ 0
+ Feature Node
+ N/A
+ 322050.73485600174
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8261.0","main.cluster index_upperinput":"8261.0"}
+ 8261
+ 10.032
+ -1
+ This Node is a Singleton
+ N/A
+ 468.1784
+ N/A
+ 0.0
+ 468.1784
+
+
+ 22
+ 0.763972
+ CCMSLIB00005467698
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+
+ 0
+ qTof
+
+ 0.0
+ Dihydroactinidiolide
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+ 11
+ 8.84592
+ Feature Node
+ N/A
+ 22
+ 0.0
+ 0.0
+ Armando Alcazar
+ Dihydroactinidiolide
+ Positive
+ Armando Alcazar
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20624.0","main.cluster index_upperinput":"20624.0"}
+ 8.84592
+ 3
+
+ Claudia Maier
+ 3
+ 181.1216
+ CCMSLIB00005467698
+ 181.1216
+ 0.0
+ Claudia Maier
+ 2907944.289331866
+ qTof
+ Isolated
+ 0.00160217
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 18.3358
+ 7
+ 0.763972
+ 0.0
+ Isolated
+ 20624
+ 0.00160217
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.3358
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3408
+ 7
+ 0
+ Feature Node
+ N/A
+ 2621785.514080423
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11101.0","main.cluster index_upperinput":"11101.0"}
+ 11101
+ 26.3408
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9454
+ N/A
+ 0.0
+ 84.9454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.488
+ 9
+ 0
+ Feature Node
+ N/A
+ 7175450.208315823
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"19.0","main.cluster index_upperinput":"19.0"}
+ 19
+ 22.488
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 226.1803
+ N/A
+ 0.0
+ 226.1803
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.3709
+ 1
+ 0
+ Feature Node
+ N/A
+ 1418819.757994257
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7789.0","main.cluster index_upperinput":"7789.0"}
+ 7789
+ 14.3709
+ -1
+ This Node is a Singleton
+ N/A
+ 445.1476
+ N/A
+ 0.0
+ 445.1476
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.215
+ 5
+ 0
+ Feature Node
+ N/A
+ 2429545.266282058
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2516.0","main.cluster index_upperinput":"2516.0"}
+ 2516
+ 14.215
+ -1
+ This Node is a Singleton
+ N/A
+ 396.2016
+ N/A
+ 0.0
+ 396.2016
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.2507
+ 7
+ 0
+ Feature Node
+ N/A
+ 3550026.6921151914
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7691.0","main.cluster index_upperinput":"7691.0"}
+ 7691
+ 12.2507
+ -1
+ This Node is a Singleton
+ N/A
+ 399.1423
+ N/A
+ 0.0
+ 399.1423
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.8906
+ 5
+ 0
+ Feature Node
+ N/A
+ 10320111.223776337
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10427.0","main.cluster index_upperinput":"10427.0"}
+ 10427
+ 33.8906
+ -1
+ This Node is a Singleton
+ N/A
+ 485.3615
+ N/A
+ 0.0
+ 485.3615
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.0665
+ 9
+ 0
+ Feature Node
+ N/A
+ 1546797.0117324856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"109.0","main.cluster index_upperinput":"109.0"}
+ 109
+ 23.0665
+ 33
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 448.2182
+ N/A
+ 0.0
+ 448.2182
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.9073
+ 9
+ 0
+ Feature Node
+ N/A
+ 9318760.029178144
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2527.0","main.cluster index_upperinput":"2527.0"}
+ 2527
+ 27.9073
+ -1
+ This Node is a Singleton
+ N/A
+ 393.2608
+ N/A
+ 0.0
+ 393.2608
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.8724
+ 2
+ 0
+ Feature Node
+ N/A
+ 1950548.228575297
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10263.0","main.cluster index_upperinput":"10263.0"}
+ 10263
+ 18.8724
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 494.2745
+ N/A
+ 0.0
+ 494.2745
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.6984
+ 9
+ 0
+ Feature Node
+ N/A
+ 2105148.7969315094
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5889.0","main.cluster index_upperinput":"5889.0"}
+ 5889
+ 26.6984
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.7556
+ 8
+ 0
+ Feature Node
+ N/A
+ 10831470.32030061
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3546.0","main.cluster index_upperinput":"3546.0"}
+ 3546
+ 6.7556
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.2328
+ N/A
+ 0.0
+ 412.2328
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.7154
+ 7
+ 0
+ Feature Node
+ N/A
+ 26519229.18241005
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1447.0","main.cluster index_upperinput":"1447.0"}
+ 1447
+ 19.7154
+ 18
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=18&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 584.2753
+ N/A
+ 0.0
+ 584.2753
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1388
+ 4
+ 0
+ Feature Node
+ N/A
+ 610257.3833775778
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7808.0","main.cluster index_upperinput":"7808.0"}
+ 7808
+ 16.1388
+ -1
+ This Node is a Singleton
+ N/A
+ 418.1627
+ N/A
+ 0.0
+ 418.1627
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.716
+ 1
+ 0
+ Feature Node
+ N/A
+ 1003580.9013168528
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"40.0","main.cluster index_upperinput":"40.0"}
+ 40
+ 17.716
+ -1
+ This Node is a Singleton
+ N/A
+ 573.1586
+ N/A
+ 0.0
+ 573.1586
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.3711
+ 5
+ 0
+ Feature Node
+ N/A
+ 874757.1413551702
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1403.0","main.cluster index_upperinput":"1403.0"}
+ 1403
+ 13.3711
+ -1
+ This Node is a Singleton
+ N/A
+ 284.1854
+ N/A
+ 0.0
+ 284.1854
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.876
+ 9
+ 0
+ Feature Node
+ N/A
+ 8203812.43874892
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"208.0","main.cluster index_upperinput":"208.0"}
+ 208
+ 0.876
+ 88
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 141.9584
+ N/A
+ 0.0
+ 141.9584
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.0685
+ 5
+ 0
+ Feature Node
+ N/A
+ 8080774.135251883
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10545.0","main.cluster index_upperinput":"10545.0"}
+ 10545
+ 12.0685
+ -1
+ This Node is a Singleton
+ N/A
+ 542.2687
+ N/A
+ 0.0
+ 542.2687
+
+
+ 7
+ 0.9586879999999999
+ CCMSLIB00003138768
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138768
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 1,2-Di-(9Z,12Z,15Z-octadecatrienoyl)-sn-glycero-3-phosphocholine from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138768
+ 2
+ 3.68468
+ Feature Node
+ N/A
+ 7
+ 0.0
+ 0.0
+ Data deposited by daniel
+ Spectral Match to 1,2-Di-(9Z,12Z,15Z-octadecatrienoyl)-sn-glycero-3-phosphocholine from NIST14
+ Positive
+ Data deposited by daniel
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3285.0","main.cluster index_upperinput":"3285.0"}
+ 3.68468
+ 3
+ N/A
+ Data from Pieter C. Dorrestein
+ 3
+ 778.5389
+ CCMSLIB00003138768
+ 778.5389
+ 0.0
+ Data from Pieter C. Dorrestein
+ 7792913.002486946
+ HCD
+ Isolated
+ 0.00286865
+ M+H
+ N/A
+ ESI
+ Positive
+ 32.3517
+ 5
+ 0.9586879999999999
+ 0.0
+ Isolated
+ 3285
+ 0.00286865
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 32.3517
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.4645
+ 5
+ 0
+ Feature Node
+ N/A
+ 1554467.8640722376
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10261.0","main.cluster index_upperinput":"10261.0"}
+ 10261
+ 23.4645
+ -1
+ This Node is a Singleton
+ N/A
+ 381.0949
+ N/A
+ 0.0
+ 381.0949
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.9509
+ 5
+ 0
+ Feature Node
+ N/A
+ 6251765.544493575
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"91.0","main.cluster index_upperinput":"91.0"}
+ 91
+ 30.9509
+ 96
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=96&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.2915
+ N/A
+ 0.0
+ 607.2915
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6495
+ 8
+ 0
+ Feature Node
+ N/A
+ 2901249.5579880825
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3562.0","main.cluster index_upperinput":"3562.0"}
+ 3562
+ 30.6495
+ -1
+ This Node is a Singleton
+ N/A
+ 335.2561
+ N/A
+ 0.0
+ 335.2561
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1495
+ 6
+ 0
+ Feature Node
+ N/A
+ 1290492.1385350684
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3533.0","main.cluster index_upperinput":"3533.0"}
+ 3533
+ 19.1495
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 521.1291
+ N/A
+ 0.0
+ 521.1291
+
+
+ 6
+ 0.9110370000000001
+ CCMSLIB00005738688
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0
+ qTof
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0.0
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 11
+ 0.6557470000000001
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1068.0","main.cluster index_upperinput":"1068.0"}
+ 0.6557470000000001
+ 3
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ Massbank
+ 3
+ 279.2318
+ CCMSLIB00005738688
+ 279.2318
+ 0.0
+ Massbank
+ 4907598.523328204
+ qTof
+ Isolated
+ 0.000183105
+ M+H
+ N/A
+ ESI
+ Positive
+ 30.6168
+ 9
+ 0.9110370000000001
+ 0.0
+ Isolated
+ 1068
+ 0.000183105
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 30.6168
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9979
+ 3
+ 0
+ Feature Node
+ N/A
+ 3456956.3880056157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10248.0","main.cluster index_upperinput":"10248.0"}
+ 10248
+ 19.9979
+ -1
+ This Node is a Singleton
+ N/A
+ 549.2309
+ N/A
+ 0.0
+ 549.2309
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5127
+ 3
+ 0
+ Feature Node
+ N/A
+ 28902390.895116795
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3.0","main.cluster index_upperinput":"3.0"}
+ 3
+ 33.5127
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 599.4298
+ N/A
+ 0.0
+ 599.4298
+
+
+ 9
+ 0.8864219999999999
+ CCMSLIB00006406564
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006406564
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)
+ 0
+ Orbitrap
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)
+ 0.0
+ Moupinamide
+ O=C(C=CC1=CC=C(O)C(OC)=C1)NCCC2=CC=C(O)C=C2
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006406564
+ 19
+ 3.8858599999999996
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ BMDMS-NP
+ Moupinamide
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4667.0","main.cluster index_upperinput":"4667.0"}
+ 3.8858599999999996
+ 1
+ O=C(C=CC1=CC=C(O)C(OC)=C1)NCCC2=CC=C(O)C=C2
+ BMDMS-NP
+ 1
+ 314.1388
+ CCMSLIB00006406564
+ 314.1388
+ 0.0
+ BMDMS-NP
+ 2092868.6019164245
+ Orbitrap
+ Commercial standard
+ 0.0012207000000000001
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 14.7321
+ 4
+ 0.8864219999999999
+ 0.0
+ Commercial standard
+ 4667
+ 0.0012207000000000001
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.7321
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.9508
+ 9
+ 0
+ Feature Node
+ N/A
+ 7003543.716786966
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3658.0","main.cluster index_upperinput":"3658.0"}
+ 3658
+ 8.9508
+ -1
+ This Node is a Singleton
+ N/A
+ 177.0546
+ N/A
+ 0.0
+ 177.0546
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4311
+ 7
+ 0
+ Feature Node
+ N/A
+ 263255.7786876307
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3172.0","main.cluster index_upperinput":"3172.0"}
+ 3172
+ 28.4311
+ -1
+ This Node is a Singleton
+ N/A
+ 395.3683
+ N/A
+ 0.0
+ 395.3683
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6519
+ 1
+ 0
+ Feature Node
+ N/A
+ 689381.0972960416
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7700.0","main.cluster index_upperinput":"7700.0"}
+ 7700
+ 25.6519
+ -1
+ This Node is a Singleton
+ N/A
+ 691.2397
+ N/A
+ 0.0
+ 691.2397
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9899
+ 7
+ 0
+ Feature Node
+ N/A
+ 1334989.6736396959
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4583.0","main.cluster index_upperinput":"4583.0"}
+ 4583
+ 19.9899
+ 4
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 347.0766
+ N/A
+ 0.0
+ 347.0766
+
+
+ 12
+ 0.733911
+ CCMSLIB00004693356
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693356
+ InChI=1S/C26H34O11/c1-33-17-6-5-14(10-18(17)35-26-23(32)22(31)21(30)20(12-29)36-26)24-16(11-28)15-8-13(4-3-7-27)9-19(34-2)25(15)37-24/h5-6,8-10,16,20-24,26-32H,3-4,7,11-12H2,1-2H3
+ 0
+ ESI-QFT
+ InChI=1S/C26H34O11/c1-33-17-6-5-14(10-18(17)35-26-23(32)22(31)21(30)20(12-29)36-26)24-16(11-28)15-8-13(4-3-7-27)9-19(34-2)25(15)37-24/h5-6,8-10,16,20-24,26-32H,3-4,7,11-12H2,1-2H3
+ 0.0
+ 2-(hydroxymethyl)-6-[5-[3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenoxy]oxane-3,4,5-triol
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693356
+ 124
+ 4.63206
+ Feature Node
+ N/A
+ 12
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002293
+ 2-(hydroxymethyl)-6-[5-[3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenoxy]oxane-3,4,5-triol
+ positive
+ MoNA:VF-NPL-QEHF002293
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7719.0","main.cluster index_upperinput":"7719.0"}
+ 4.63206
+ 3
+ N/A
+ MoNA
+ 3
+ 540.2415
+ CCMSLIB00004693356
+ 540.2415
+ 0.0
+ MoNA
+ 1938809.1778773735
+ ESI-QFT
+ isolated
+ 0.00250244
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 14.4644
+ 7
+ 0.733911
+ 0.0
+ isolated
+ 7719
+ 0.00250244
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=124&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.4644
+ 0.0
+ [M+NH4]+
+
+
+ 33
+ 0.804925
+ CCMSLIB00003135173
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135173
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 6-Methoxyluteolin from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135173
+ 32
+ 7.2187
+ Feature Node
+ N/A
+ 33
+ 0.0
+ 0.0
+ Data deposited by lfnothias
+ Spectral Match to 6-Methoxyluteolin from NIST14
+ Positive
+ Data deposited by lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1581.0","main.cluster index_upperinput":"1581.0"}
+ 7.2187
+ 3
+ N/A
+ Data from Pieter Dorrestein;Ajit Jadhav
+ 3
+ 317.0657
+ CCMSLIB00003135173
+ 317.0657
+ 0.0
+ Data from Pieter Dorrestein;Ajit Jadhav
+ 24909138.866243303
+ HCD
+ Isolated
+ 0.00228882
+ M+H
+ N/A
+ ESI
+ Positive
+ 18.7482
+ 8
+ 0.804925
+ 0.0
+ Isolated
+ 1581
+ 0.00228882
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.7482
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.6812
+ 1
+ 0
+ Feature Node
+ N/A
+ 4814437.534327881
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13705.0","main.cluster index_upperinput":"13705.0"}
+ 13705
+ 12.6812
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 528.2239
+ N/A
+ 0.0
+ 528.2239
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.5676
+ 6
+ 0
+ Feature Node
+ N/A
+ 3274617.1613219967
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1401.0","main.cluster index_upperinput":"1401.0"}
+ 1401
+ 32.5676
+ -1
+ This Node is a Singleton
+ N/A
+ 453.3554
+ N/A
+ 0.0
+ 453.3554
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.4046
+ 8
+ 0
+ Feature Node
+ N/A
+ 20492889.18461853
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1474.0","main.cluster index_upperinput":"1474.0"}
+ 1474
+ 32.4046
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 327.2897
+ N/A
+ 0.0
+ 327.2897
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.2329
+ 4
+ 0
+ Feature Node
+ N/A
+ 3632871.0096798744
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1427.0","main.cluster index_upperinput":"1427.0"}
+ 1427
+ 9.2329
+ -1
+ This Node is a Singleton
+ N/A
+ 362.1959
+ N/A
+ 0.0
+ 362.1959
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.3002
+ 5
+ 0
+ Feature Node
+ N/A
+ 928920.9852521468
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7861.0","main.cluster index_upperinput":"7861.0"}
+ 7861
+ 20.3002
+ -1
+ This Node is a Singleton
+ N/A
+ 606.2581
+ N/A
+ 0.0
+ 606.2581
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.9061
+ 7
+ 0
+ Feature Node
+ N/A
+ 1861615.2573813107
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3747.0","main.cluster index_upperinput":"3747.0"}
+ 3747
+ 9.9061
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.2322
+ N/A
+ 0.0
+ 412.2322
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.5445
+ 5
+ 0
+ Feature Node
+ N/A
+ 5161166.834932342
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4693.0","main.cluster index_upperinput":"4693.0"}
+ 4693
+ 19.5445
+ -1
+ This Node is a Singleton
+ N/A
+ 443.1676
+ N/A
+ 0.0
+ 443.1676
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.3754
+ 9
+ 0
+ Feature Node
+ N/A
+ 2659849.427211669
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"142.0","main.cluster index_upperinput":"142.0"}
+ 142
+ 17.3754
+ -1
+ This Node is a Singleton
+ N/A
+ 219.1743
+ N/A
+ 0.0
+ 219.1743
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.9994
+ 2
+ 0
+ Feature Node
+ N/A
+ 5191078.638750628
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4561.0","main.cluster index_upperinput":"4561.0"}
+ 4561
+ 18.9994
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 520.2546
+ N/A
+ 0.0
+ 520.2546
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.2672
+ 6
+ 0
+ Feature Node
+ N/A
+ 337465.4015345902
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3612.0","main.cluster index_upperinput":"3612.0"}
+ 3612
+ 22.2672
+ -1
+ This Node is a Singleton
+ N/A
+ 215.1426
+ N/A
+ 0.0
+ 215.1426
+
+
+ 43
+ 0.78819
+ CCMSLIB00005720103
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0
+ Orbitrap
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0.0
+ 22-Hydoxy-2-hopen-1-one
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ 11
+ 2.21256
+ Feature Node
+ N/A
+ 43
+ 0.0
+ 0.0
+ Damien OLIVIER
+ 22-Hydoxy-2-hopen-1-one
+ Positive
+ Damien OLIVIER
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3122.0","main.cluster index_upperinput":"3122.0"}
+ 2.21256
+ 3
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 3
+ 441.372
+ CCMSLIB00005720103
+ 441.372
+ 0.0
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 2790951.1194996247
+ Orbitrap
+ Isolated
+ 0.0009765619999999999
+ [M+H]
+ N/A
+ LC-ESI
+ Positive
+ 31.6375
+ 6
+ 0.78819
+ 0.0
+ Isolated
+ 3122
+ 0.0009765619999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.6375
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.4986
+ 3
+ 0
+ Feature Node
+ N/A
+ 4343848.783345189
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13627.0","main.cluster index_upperinput":"13627.0"}
+ 13627
+ 22.4986
+ -1
+ This Node is a Singleton
+ N/A
+ 353.1356
+ N/A
+ 0.0
+ 353.1356
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.6397
+ 7
+ 0
+ Feature Node
+ N/A
+ 2974447.55311586
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1987.0","main.cluster index_upperinput":"1987.0"}
+ 1987
+ 11.6397
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 382.222
+ N/A
+ 0.0
+ 382.222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.5082
+ 8
+ 0
+ Feature Node
+ N/A
+ 9604768.690681214
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"28000.0","main.cluster index_upperinput":"28000.0"}
+ 28000
+ 27.5082
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 702.2137
+ N/A
+ 0.0
+ 702.2137
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.0889
+ 6
+ 0
+ Feature Node
+ N/A
+ 793809.2960072516
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"161.0","main.cluster index_upperinput":"161.0"}
+ 161
+ 26.0889
+ -1
+ This Node is a Singleton
+ N/A
+ 327.0783
+ N/A
+ 0.0
+ 327.0783
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.3851
+ 2
+ 0
+ Feature Node
+ N/A
+ 3251622.919689074
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8223.0","main.cluster index_upperinput":"8223.0"}
+ 8223
+ 7.3851
+ -1
+ This Node is a Singleton
+ N/A
+ 364.1755
+ N/A
+ 0.0
+ 364.1755
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.8702
+ 7
+ 0
+ Feature Node
+ N/A
+ 2307039.0667282287
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1338.0","main.cluster index_upperinput":"1338.0"}
+ 1338
+ 12.8702
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.2222
+ N/A
+ 0.0
+ 394.2222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.1825
+ 9
+ 0
+ Feature Node
+ N/A
+ 28895300.85514251
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2575.0","main.cluster index_upperinput":"2575.0"}
+ 2575
+ 34.1825
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 409.3829
+ N/A
+ 0.0
+ 409.3829
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.5269
+ 6
+ 0
+ Feature Node
+ N/A
+ 952109.7381752883
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1359.0","main.cluster index_upperinput":"1359.0"}
+ 1359
+ 14.5269
+ -1
+ This Node is a Singleton
+ N/A
+ 546.3056
+ N/A
+ 0.0
+ 546.3056
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.8806
+ 7
+ 0
+ Feature Node
+ N/A
+ 3665840.9492557035
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3107.0","main.cluster index_upperinput":"3107.0"}
+ 3107
+ 34.8806
+ 28
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=28&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 609.4836
+ N/A
+ 0.0
+ 609.4836
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.1769
+ 9
+ 0
+ Feature Node
+ N/A
+ 15146603.355750648
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1310.0","main.cluster index_upperinput":"1310.0"}
+ 1310
+ 30.1769
+ 2
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 520.3407
+ N/A
+ 0.0
+ 520.3407
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.4127
+ 6
+ 0
+ Feature Node
+ N/A
+ 17071044.235387236
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7657.0","main.cluster index_upperinput":"7657.0"}
+ 7657
+ 32.4127
+ -1
+ This Node is a Singleton
+ N/A
+ 675.5529
+ N/A
+ 0.0
+ 675.5529
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1931
+ 7
+ 0
+ Feature Node
+ N/A
+ 1071089.8089379522
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5026.0","main.cluster index_upperinput":"5026.0"}
+ 5026
+ 19.1931
+ -1
+ This Node is a Singleton
+ N/A
+ 441.2454
+ N/A
+ 0.0
+ 441.2454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0833
+ 9
+ 0
+ Feature Node
+ N/A
+ 4598514.5786643615
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2577.0","main.cluster index_upperinput":"2577.0"}
+ 2577
+ 34.0833
+ -1
+ This Node is a Singleton
+ N/A
+ 347.2922
+ N/A
+ 0.0
+ 347.2922
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3629
+ 5
+ 0
+ Feature Node
+ N/A
+ 1492983.6173541099
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10307.0","main.cluster index_upperinput":"10307.0"}
+ 10307
+ 26.3629
+ -1
+ This Node is a Singleton
+ N/A
+ 553.2992
+ N/A
+ 0.0
+ 553.2992
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.0873
+ 5
+ 0
+ Feature Node
+ N/A
+ 8985261.855863284
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13641.0","main.cluster index_upperinput":"13641.0"}
+ 13641
+ 13.0873
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.2213
+ N/A
+ 0.0
+ 394.2213
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.7253
+ 8
+ 0
+ Feature Node
+ N/A
+ 7000023.707290265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3625.0","main.cluster index_upperinput":"3625.0"}
+ 3625
+ 32.7253
+ -1
+ This Node is a Singleton
+ N/A
+ 667.4558
+ N/A
+ 0.0
+ 667.4558
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.2845
+ 7
+ 0
+ Feature Node
+ N/A
+ 3013826.382473879
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4790.0","main.cluster index_upperinput":"4790.0"}
+ 4790
+ 2.2845
+ -1
+ This Node is a Singleton
+ N/A
+ 444.2221
+ N/A
+ 0.0
+ 444.2221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.2301
+ 8
+ 0
+ Feature Node
+ N/A
+ 1777539.944284711
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1695.0","main.cluster index_upperinput":"1695.0"}
+ 1695
+ 30.2301
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 231.2106
+ N/A
+ 0.0
+ 231.2106
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.9143
+ 9
+ 0
+ Feature Node
+ N/A
+ 12839362.21306569
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1352.0","main.cluster index_upperinput":"1352.0"}
+ 1352
+ 31.9143
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 313.2739
+ N/A
+ 0.0
+ 313.2739
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.25
+ 5
+ 0
+ Feature Node
+ N/A
+ 1721610.2383471818
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4789.0","main.cluster index_upperinput":"4789.0"}
+ 4789
+ 16.25
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 544.2534
+ N/A
+ 0.0
+ 544.2534
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.7289
+ 4
+ 0
+ Feature Node
+ N/A
+ 1539419.5226464106
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10404.0","main.cluster index_upperinput":"10404.0"}
+ 10404
+ 4.7289
+ -1
+ This Node is a Singleton
+ N/A
+ 464.2481
+ N/A
+ 0.0
+ 464.2481
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.9698
+ 7
+ 0
+ Feature Node
+ N/A
+ 2305028.230020751
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"106.0","main.cluster index_upperinput":"106.0"}
+ 106
+ 32.9698
+ -1
+ This Node is a Singleton
+ N/A
+ 486.3563
+ N/A
+ 0.0
+ 486.3563
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.0282
+ 1
+ 0
+ Feature Node
+ N/A
+ 4952205.417006008
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13676.0","main.cluster index_upperinput":"13676.0"}
+ 13676
+ 16.0282
+ 37
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 551.2391
+ N/A
+ 0.0
+ 551.2391
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.3595
+ 9
+ 0
+ Feature Node
+ N/A
+ 2949520.374455325
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5829.0","main.cluster index_upperinput":"5829.0"}
+ 5829
+ 24.3595
+ 111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=111&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 219.1741
+ N/A
+ 0.0
+ 219.1741
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1545
+ 4
+ 0
+ Feature Node
+ N/A
+ 3017088.892387165
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4972.0","main.cluster index_upperinput":"4972.0"}
+ 4972
+ 16.1545
+ 81
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 433.1831
+ N/A
+ 0.0
+ 433.1831
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3683
+ 9
+ 0
+ Feature Node
+ N/A
+ 2437173.2318673665
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6038.0","main.cluster index_upperinput":"6038.0"}
+ 6038
+ 26.3683
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8695
+ 8
+ 0
+ Feature Node
+ N/A
+ 25350527.401867487
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1193.0","main.cluster index_upperinput":"1193.0"}
+ 1193
+ 32.8695
+ 130
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=130&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 367.2822
+ N/A
+ 0.0
+ 367.2822
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.7311
+ 4
+ 0
+ Feature Node
+ N/A
+ 2700848.071744424
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"74.0","main.cluster index_upperinput":"74.0"}
+ 74
+ 16.7311
+ 43
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=43&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 270.0876
+ N/A
+ 0.0
+ 270.0876
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.8907
+ 5
+ 0
+ Feature Node
+ N/A
+ 6357134.16438157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1173.0","main.cluster index_upperinput":"1173.0"}
+ 1173
+ 10.8907
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 494.2382
+ N/A
+ 0.0
+ 494.2382
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.4991
+ 1
+ 0
+ Feature Node
+ N/A
+ 1727797.3497915638
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7653.0","main.cluster index_upperinput":"7653.0"}
+ 7653
+ 21.4991
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 402.1679
+ N/A
+ 0.0
+ 402.1679
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.9722
+ 8
+ 0
+ Feature Node
+ N/A
+ 45851159.245654106
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1375.0","main.cluster index_upperinput":"1375.0"}
+ 1375
+ 28.9722
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 699.3566
+ N/A
+ 0.0
+ 699.3566
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.759
+ 5
+ 0
+ Feature Node
+ N/A
+ 9163819.877622504
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13633.0","main.cluster index_upperinput":"13633.0"}
+ 13633
+ 11.759
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2121
+ N/A
+ 0.0
+ 462.2121
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0897
+ 4
+ 0
+ Feature Node
+ N/A
+ 12715660.31333598
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7621.0","main.cluster index_upperinput":"7621.0"}
+ 7621
+ 18.0897
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 227.1071
+ N/A
+ 0.0
+ 227.1071
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8276
+ 8
+ 0
+ Feature Node
+ N/A
+ 1894826.1192255027
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5148.0","main.cluster index_upperinput":"5148.0"}
+ 5148
+ 23.8276
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8904
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.5649
+ 7
+ 0
+ Feature Node
+ N/A
+ 21630839.048587535
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1275.0","main.cluster index_upperinput":"1275.0"}
+ 1275
+ 1.5649
+ 185
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=185&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 328.139
+ N/A
+ 0.0
+ 328.139
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.264
+ 1
+ 0
+ Feature Node
+ N/A
+ 1011012.215739168
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13820.0","main.cluster index_upperinput":"13820.0"}
+ 13820
+ 25.264
+ -1
+ This Node is a Singleton
+ N/A
+ 432.3316
+ N/A
+ 0.0
+ 432.3316
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6462
+ 8
+ 0
+ Feature Node
+ N/A
+ 28887144.845616937
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1487.0","main.cluster index_upperinput":"1487.0"}
+ 1487
+ 30.6462
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 482.405
+ N/A
+ 0.0
+ 482.405
+
+
+ 10
+ 0.766675
+ CCMSLIB00004692205
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692205
+ InChI=1S/C24H30O4/c1-15-5-9-20-23(2,3)21(25)11-12-24(20,4)18(15)14-27-17-8-6-16-7-10-22(26)28-19(16)13-17/h6-8,10,13,18,20-21,25H,1,5,9,11-12,14H2,2-4H3
+ 0
+ ESI-QFT
+ InChI=1S/C24H30O4/c1-15-5-9-20-23(2,3)21(25)11-12-24(20,4)18(15)14-27-17-8-6-16-7-10-22(26)28-19(16)13-17/h6-8,10,13,18,20-21,25H,1,5,9,11-12,14H2,2-4H3
+ 0.0
+ 7-[(6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methoxy]chromen-2-one
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692205
+ -1
+ 3.10573
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF001142
+ 7-[(6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methoxy]chromen-2-one
+ positive
+ MoNA:VF-NPL-QEHF001142
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4997.0","main.cluster index_upperinput":"4997.0"}
+ 3.10573
+ 3
+ N/A
+ MoNA
+ 3
+ 383.2208
+ CCMSLIB00004692205
+ 383.2208
+ 0.0
+ MoNA
+ 1530831.8859131131
+ ESI-QFT
+ isolated
+ 0.00119019
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 28.2741
+ 5
+ 0.766675
+ 0.0
+ isolated
+ 4997
+ 0.00119019
+ This Node is a Singleton
+ 28.2741
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.1216
+ 2
+ 0
+ Feature Node
+ N/A
+ 2317679.3086518715
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13719.0","main.cluster index_upperinput":"13719.0"}
+ 13719
+ 28.1216
+ 63
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=63&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 916.5126
+ N/A
+ 0.0
+ 916.5126
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.2645
+ 9
+ 0
+ Feature Node
+ N/A
+ 1502999.5086203178
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1399.0","main.cluster index_upperinput":"1399.0"}
+ 1399
+ 25.2645
+ -1
+ This Node is a Singleton
+ N/A
+ 279.2312
+ N/A
+ 0.0
+ 279.2312
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.5468
+ 9
+ 0
+ Feature Node
+ N/A
+ 3242109.296301544
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1283.0","main.cluster index_upperinput":"1283.0"}
+ 1283
+ 24.5468
+ -1
+ This Node is a Singleton
+ N/A
+ 267.1572
+ N/A
+ 0.0
+ 267.1572
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7773
+ 5
+ 0
+ Feature Node
+ N/A
+ 2148752.2523002424
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4587.0","main.cluster index_upperinput":"4587.0"}
+ 4587
+ 17.7773
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 568.2754
+ N/A
+ 0.0
+ 568.2754
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.5255
+ 4
+ 0
+ Feature Node
+ N/A
+ 599471.9769923693
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4983.0","main.cluster index_upperinput":"4983.0"}
+ 4983
+ 26.5255
+ -1
+ This Node is a Singleton
+ N/A
+ 579.2803
+ N/A
+ 0.0
+ 579.2803
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.718
+ 1
+ 0
+ Feature Node
+ N/A
+ 290768.734195608
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7794.0","main.cluster index_upperinput":"7794.0"}
+ 7794
+ 32.718
+ -1
+ This Node is a Singleton
+ N/A
+ 647.3578
+ N/A
+ 0.0
+ 647.3578
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3104
+ 9
+ 0
+ Feature Node
+ N/A
+ 1998360.324382435
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6482.0","main.cluster index_upperinput":"6482.0"}
+ 6482
+ 26.3104
+ 68
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=68&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 219.1742
+ N/A
+ 0.0
+ 219.1742
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9738
+ 5
+ 0
+ Feature Node
+ N/A
+ 2308303.475101755
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7979.0","main.cluster index_upperinput":"7979.0"}
+ 7979
+ 33.9738
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 395.3144
+ N/A
+ 0.0
+ 395.3144
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.3597
+ 3
+ 0
+ Feature Node
+ N/A
+ 2635693.8706052313
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10260.0","main.cluster index_upperinput":"10260.0"}
+ 10260
+ 19.3597
+ 81
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 417.188
+ N/A
+ 0.0
+ 417.188
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.3062
+ 4
+ 0
+ Feature Node
+ N/A
+ 1643267.8793584898
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4550.0","main.cluster index_upperinput":"4550.0"}
+ 4550
+ 21.3062
+ -1
+ This Node is a Singleton
+ N/A
+ 353.0633
+ N/A
+ 0.0
+ 353.0633
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.0471
+ 5
+ 0
+ Feature Node
+ N/A
+ 3639450.437306791
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"34.0","main.cluster index_upperinput":"34.0"}
+ 34
+ 30.0471
+ -1
+ This Node is a Singleton
+ N/A
+ 585.4129
+ N/A
+ 0.0
+ 585.4129
+
+
+ 6
+ 0.882178
+ CCMSLIB00006404791
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006404791
+ InChI=1S/C16H12O6/c1-21-16-14(20)13-11(19)6-10(18)7-12(13)22-15(16)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3
+ 0
+ Orbitrap
+ InChI=1S/C16H12O6/c1-21-16-14(20)13-11(19)6-10(18)7-12(13)22-15(16)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3
+ 0.0
+ Isokaempferide
+ O=C1C(OC)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=CC3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006404791
+ 32
+ 2.33137
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ BMDMS-NP
+ Isokaempferide
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1285.0","main.cluster index_upperinput":"1285.0"}
+ 2.33137
+ 1
+ O=C1C(OC)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=CC3
+ BMDMS-NP
+ 1
+ 301.0707
+ CCMSLIB00006404791
+ 301.0707
+ 0.0
+ BMDMS-NP
+ 655320.7248086032
+ Orbitrap
+ Commercial standard
+ 0.0007019039999999999
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 19.0138
+ 4
+ 0.882178
+ 0.0
+ Commercial standard
+ 1285
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.0138
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.4513
+ 6
+ 0
+ Feature Node
+ N/A
+ 1418496.1959938451
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"26328.0","main.cluster index_upperinput":"26328.0"}
+ 26328
+ 2.4513
+ -1
+ This Node is a Singleton
+ N/A
+ 430.2426
+ N/A
+ 0.0
+ 430.2426
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.2742
+ 6
+ 0
+ Feature Node
+ N/A
+ 4284383.872712078
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7663.0","main.cluster index_upperinput":"7663.0"}
+ 7663
+ 1.2742
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.1965
+ N/A
+ 0.0
+ 412.1965
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.1244
+ 5
+ 0
+ Feature Node
+ N/A
+ 6045976.79574973
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4642.0","main.cluster index_upperinput":"4642.0"}
+ 4642
+ 12.1244
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 382.2224
+ N/A
+ 0.0
+ 382.2224
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.2383
+ 6
+ 0
+ Feature Node
+ N/A
+ 3820823.5822628797
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4627.0","main.cluster index_upperinput":"4627.0"}
+ 4627
+ 25.2383
+ 80
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=80&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 316.2845
+ N/A
+ 0.0
+ 316.2845
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0109
+ 3
+ 0
+ Feature Node
+ N/A
+ 5985278.241630225
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1158.0","main.cluster index_upperinput":"1158.0"}
+ 1158
+ 19.0109
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 491.1192
+ N/A
+ 0.0
+ 491.1192
+
+
+ 8
+ 0.83391
+ CCMSLIB00006422785
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006422785
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3
+ 0
+ Orbitrap
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3
+ 0.0
+ Eupatilin
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006422785
+ 32
+ 19.986
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ BMDMS-NP
+ Eupatilin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2476.0","main.cluster index_upperinput":"2476.0"}
+ 19.986
+ 1
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
+ BMDMS-NP
+ 1
+ 345.0969
+ CCMSLIB00006422785
+ 345.0969
+ 0.0
+ BMDMS-NP
+ 8122715.209299802
+ Orbitrap
+ Commercial standard
+ 0.00689697
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 21.938
+ 9
+ 0.83391
+ 0.0
+ Commercial standard
+ 2476
+ 0.00689697
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.938
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.4519
+ 6
+ 0
+ Feature Node
+ N/A
+ 4088476.904452964
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7753.0","main.cluster index_upperinput":"7753.0"}
+ 7753
+ 31.4519
+ -1
+ This Node is a Singleton
+ N/A
+ 465.335
+ N/A
+ 0.0
+ 465.335
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.8159
+ 9
+ 0
+ Feature Node
+ N/A
+ 1978029.679127257
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5975.0","main.cluster index_upperinput":"5975.0"}
+ 5975
+ 26.8159
+ -1
+ This Node is a Singleton
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 5.3896
+ 2
+ 0
+ Feature Node
+ N/A
+ 393748.126674839
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8051.0","main.cluster index_upperinput":"8051.0"}
+ 8051
+ 5.3896
+ -1
+ This Node is a Singleton
+ N/A
+ 339.0959
+ N/A
+ 0.0
+ 339.0959
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.6268
+ 4
+ 0
+ Feature Node
+ N/A
+ 685750.2713910462
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"18848.0","main.cluster index_upperinput":"18848.0"}
+ 18848
+ 19.6268
+ 25
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=25&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 833.3016
+ N/A
+ 0.0
+ 833.3016
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.4659
+ 1
+ 0
+ Feature Node
+ N/A
+ 1049518.1184647232
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7786.0","main.cluster index_upperinput":"7786.0"}
+ 7786
+ 10.4659
+ -1
+ This Node is a Singleton
+ N/A
+ 538.2281
+ N/A
+ 0.0
+ 538.2281
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8063
+ 7
+ 0
+ Feature Node
+ N/A
+ 373696.74318810424
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4840.0","main.cluster index_upperinput":"4840.0"}
+ 4840
+ 23.8063
+ 86
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=86&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.2807
+ N/A
+ 0.0
+ 441.2807
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.58
+ 4
+ 0
+ Feature Node
+ N/A
+ 2797212.596411882
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2608.0","main.cluster index_upperinput":"2608.0"}
+ 2608
+ 33.58
+ -1
+ This Node is a Singleton
+ N/A
+ 1121.6228
+ N/A
+ 0.0
+ 1121.6228
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9256
+ 9
+ 0
+ Feature Node
+ N/A
+ 8450189.480120493
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1257.0","main.cluster index_upperinput":"1257.0"}
+ 1257
+ 0.9256
+ -1
+ This Node is a Singleton
+ N/A
+ 365.1055
+ N/A
+ 0.0
+ 365.1055
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.4479
+ 8
+ 0
+ Feature Node
+ N/A
+ 2287762.740179059
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11368.0","main.cluster index_upperinput":"11368.0"}
+ 11368
+ 23.4479
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8905
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8131
+ 8
+ 0
+ Feature Node
+ N/A
+ 5785825.593884494
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1214.0","main.cluster index_upperinput":"1214.0"}
+ 1214
+ 21.8131
+ -1
+ This Node is a Singleton
+ N/A
+ 282.2038
+ N/A
+ 0.0
+ 282.2038
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3928
+ 9
+ 0
+ Feature Node
+ N/A
+ 56965261.24653977
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1216.0","main.cluster index_upperinput":"1216.0"}
+ 1216
+ 32.3928
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 349.2713
+ N/A
+ 0.0
+ 349.2713
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.2021
+ 8
+ 0
+ Feature Node
+ N/A
+ 5954662.463161357
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2634.0","main.cluster index_upperinput":"2634.0"}
+ 2634
+ 34.2021
+ -1
+ This Node is a Singleton
+ N/A
+ 629.4775
+ N/A
+ 0.0
+ 629.4775
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.5199
+ 4
+ 0
+ Feature Node
+ N/A
+ 384760.1380195682
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2091.0","main.cluster index_upperinput":"2091.0"}
+ 2091
+ 17.5199
+ -1
+ This Node is a Singleton
+ N/A
+ 469.2333
+ N/A
+ 0.0
+ 469.2333
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9996
+ 4
+ 0
+ Feature Node
+ N/A
+ 49827088.486622445
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8321.0","main.cluster index_upperinput":"8321.0"}
+ 8321
+ 14.9996
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2434
+ N/A
+ 0.0
+ 478.2434
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7014
+ 6
+ 0
+ Feature Node
+ N/A
+ 8325452.36170641
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2488.0","main.cluster index_upperinput":"2488.0"}
+ 2488
+ 21.7014
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 226.1802
+ N/A
+ 0.0
+ 226.1802
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.9786
+ 5
+ 0
+ Feature Node
+ N/A
+ 5493456.712752116
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1162.0","main.cluster index_upperinput":"1162.0"}
+ 1162
+ 13.9786
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 538.2286
+ N/A
+ 0.0
+ 538.2286
+
+
+ 37
+ 0.7749520000000001
+ CCMSLIB00000848806
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000848806
+ InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3
+ 0.0
+ NCGC00169741-02!2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxychromen-4-one
+ COC1=C(OC)C(O)=C2C(=O)C(OC)=C(OC2=C1)C3=CC(O)=C(O)C=C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000848806
+ 4
+ 0.591603
+ Feature Node
+ N/A
+ 37
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00169741-02!2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxychromen-4-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2273.0","main.cluster index_upperinput":"2273.0"}
+ 0.591603
+ 1
+ COC1=C(OC)C(O)=C2C(=O)C(OC)=C(OC2=C1)C3=CC(O)=C(O)C=C3
+ Jadhav/Dorrestein
+ 1
+ 361.0918
+ CCMSLIB00000848806
+ 361.0918
+ 0.0
+ Jadhav/Dorrestein
+ 6243395.2967505725
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.000213623
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 20.3375
+ 6
+ 0.7749520000000001
+ 0.0
+ isolated
+ 2273
+ 0.000213623
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.3375
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.6686
+ 6
+ 0
+ Feature Node
+ N/A
+ 17495553.665893577
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4584.0","main.cluster index_upperinput":"4584.0"}
+ 4584
+ 12.6686
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2382
+ N/A
+ 0.0
+ 446.2382
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.3202
+ 4
+ 0
+ Feature Node
+ N/A
+ 37487238.79178417
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1156.0","main.cluster index_upperinput":"1156.0"}
+ 1156
+ 31.3202
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 612.1647
+ N/A
+ 0.0
+ 612.1647
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.0485
+ 1
+ 0
+ Feature Node
+ N/A
+ 236405.40541310442
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8536.0","main.cluster index_upperinput":"8536.0"}
+ 8536
+ 8.0485
+ -1
+ This Node is a Singleton
+ N/A
+ 531.175
+ N/A
+ 0.0
+ 531.175
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8385
+ 8
+ 0
+ Feature Node
+ N/A
+ 35695699.5713855
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1179.0","main.cluster index_upperinput":"1179.0"}
+ 1179
+ 32.8385
+ -1
+ This Node is a Singleton
+ N/A
+ 381.2982
+ N/A
+ 0.0
+ 381.2982
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.4649
+ 3
+ 0
+ Feature Node
+ N/A
+ 273986.68259055755
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5371.0","main.cluster index_upperinput":"5371.0"}
+ 5371
+ 21.4649
+ -1
+ This Node is a Singleton
+ N/A
+ 662.4321
+ N/A
+ 0.0
+ 662.4321
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.4633
+ 5
+ 0
+ Feature Node
+ N/A
+ 65357331.240921
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4537.0","main.cluster index_upperinput":"4537.0"}
+ 4537
+ 16.4633
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2434
+ N/A
+ 0.0
+ 478.2434
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.8447
+ 4
+ 0
+ Feature Node
+ N/A
+ 4055084.284626933
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4590.0","main.cluster index_upperinput":"4590.0"}
+ 4590
+ 14.8447
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 538.2282
+ N/A
+ 0.0
+ 538.2282
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.2906
+ 2
+ 0
+ Feature Node
+ N/A
+ 739138.1516001928
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13900.0","main.cluster index_upperinput":"13900.0"}
+ 13900
+ 19.2906
+ -1
+ This Node is a Singleton
+ N/A
+ 627.279
+ N/A
+ 0.0
+ 627.279
+
+
+ 35
+ 0.705094
+ CCMSLIB00004693379
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693379
+ InChI=1S/C21H34O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h12,14-15,18,22,24H,3-11,13,16H2,1-2H3/t18-/m1/s1
+ 0
+ ESI-QFT
+ InChI=1S/C21H34O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h12,14-15,18,22,24H,3-11,13,16H2,1-2H3/t18-/m1/s1
+ 0.0
+ (5R)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradecan-3-one
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693379
+ 11
+ 2.78023
+ Feature Node
+ N/A
+ 35
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002316
+ (5R)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradecan-3-one
+ positive
+ MoNA:VF-NPL-QEHF002316
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2287.0","main.cluster index_upperinput":"2287.0"}
+ 2.78023
+ 3
+ N/A
+ MoNA
+ 3
+ 351.252
+ CCMSLIB00004693379
+ 351.252
+ 0.0
+ MoNA
+ 5870169.9309723
+ ESI-QFT
+ isolated
+ 0.0009765619999999999
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 27.0484
+ 8
+ 0.705094
+ 0.0
+ isolated
+ 2287
+ 0.0009765619999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 27.0484
+ 0.0
+ [M+H]+
+
+
+ 11
+ 0.807477
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 93
+ 1.56247
+ Feature Node
+ N/A
+ 11
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5812.0","main.cluster index_upperinput":"5812.0"}
+ 1.56247
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1014
+ CCMSLIB00003136238
+ 371.1014
+ 0.0
+ Data from Maria Maansson
+ 8336688.669635268
+ QQQ
+ Isolated
+ 0.000579834
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.4129
+ 8
+ 0.807477
+ 0.0
+ Isolated
+ 5812
+ 0.000579834
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.4129
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.3877
+ 5
+ 0
+ Feature Node
+ N/A
+ 5475861.977536066
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1414.0","main.cluster index_upperinput":"1414.0"}
+ 1414
+ 14.3877
+ -1
+ This Node is a Singleton
+ N/A
+ 466.2413
+ N/A
+ 0.0
+ 466.2413
+
+
+ 8
+ 0.8529329999999999
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 93
+ 1.8914099999999998
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4605.0","main.cluster index_upperinput":"4605.0"}
+ 1.8914099999999998
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1013
+ CCMSLIB00003136238
+ 371.1013
+ 0.0
+ Data from Maria Maansson
+ 4049217.420641046
+ QQQ
+ Isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.842
+ 6
+ 0.8529329999999999
+ 0.0
+ Isolated
+ 4605
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.842
+ 0.0
+ M+H
+
+
+ 13
+ 0.80157
+ CCMSLIB00005724788
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005724788
+ InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3
+ 0
+ Orbitrap
+ InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3
+ 0.0
+ 2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1,4-diol
+ COc(cc(CC(CO)C(Cc(cc1)cc(OC)c1O)CO)cc1)c1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005724788
+ 85
+ 1.21265
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ Luis Quiros-Guerrero
+ 2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1,4-diol
+ Positive
+ Luis Quiros-Guerrero
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5273.0","main.cluster index_upperinput":"5273.0"}
+ 1.21265
+ 1
+ COc(cc(CC(CO)C(Cc(cc1)cc(OC)c1O)CO)cc1)c1O
+ Wolfender
+ 1
+ 327.1594
+ CCMSLIB00005724788
+ 327.1594
+ 0.0
+ Wolfender
+ 2136568.868979859
+ Orbitrap
+ Isolated
+ 0.000396729
+ M-2H2O+H
+ N/A
+ ESI
+ Positive
+ 15.8051
+ 4
+ 0.80157
+ 0.0
+ Isolated
+ 5273
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.8051
+ 0.0
+ M-2H2O+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.2206
+ 8
+ 0
+ Feature Node
+ N/A
+ 206911174.46940643
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13598.0","main.cluster index_upperinput":"13598.0"}
+ 13598
+ 27.2206
+ -1
+ This Node is a Singleton
+ N/A
+ 301.1411
+ N/A
+ 0.0
+ 301.1411
+
+
+ 6
+ 0.955304
+ CCMSLIB00004694664
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694664
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0.0
+ arctiin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694664
+ 35
+ 0.43815699999999996
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF003601
+ arctiin
+ positive
+ MoNA:VF-NPL-QEHF003601
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1497.0","main.cluster index_upperinput":"1497.0"}
+ 0.43815699999999996
+ 3
+ N/A
+ MoNA
+ 3
+ 557.1992
+ CCMSLIB00004694664
+ 557.1992
+ 0.0
+ MoNA
+ 8356136.260282811
+ ESI-QFT
+ isolated
+ 0.00024414099999999997
+ [M+Na]+
+ N/A
+ N/A
+ positive
+ 15.6449
+ 4
+ 0.955304
+ 0.0
+ isolated
+ 1497
+ 0.00024414099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=35&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.6449
+ 0.0
+ [M+Na]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.8995
+ 5
+ 0
+ Feature Node
+ N/A
+ 1290176.2332343124
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"16227.0","main.cluster index_upperinput":"16227.0"}
+ 16227
+ 8.8995
+ -1
+ This Node is a Singleton
+ N/A
+ 561.1946
+ N/A
+ 0.0
+ 561.1946
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7937
+ 5
+ 0
+ Feature Node
+ N/A
+ 905278.2827176421
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7832.0","main.cluster index_upperinput":"7832.0"}
+ 7832
+ 17.7937
+ -1
+ This Node is a Singleton
+ N/A
+ 371.1471
+ N/A
+ 0.0
+ 371.1471
+
+
+ 24
+ 0.7912680000000001
+ CCMSLIB00005467698
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+
+ 0
+ qTof
+
+ 0.0
+ Dihydroactinidiolide
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+ 11
+ 11.0363
+ Feature Node
+ N/A
+ 24
+ 0.0
+ 0.0
+ Armando Alcazar
+ Dihydroactinidiolide
+ Positive
+ Armando Alcazar
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4559.0","main.cluster index_upperinput":"4559.0"}
+ 11.0363
+ 3
+
+ Claudia Maier
+ 3
+ 181.122
+ CCMSLIB00005467698
+ 181.122
+ 0.0
+ Claudia Maier
+ 10525073.401965298
+ qTof
+ Isolated
+ 0.0019989
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 18.487
+ 8
+ 0.7912680000000001
+ 0.0
+ Isolated
+ 4559
+ 0.0019989
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.487
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.7261
+ 8
+ 0
+ Feature Node
+ N/A
+ 3554717.7055147756
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3669.0","main.cluster index_upperinput":"3669.0"}
+ 3669
+ 22.7261
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 213.1483
+ N/A
+ 0.0
+ 213.1483
+
+
+ 10
+ 0.730635
+ CCMSLIB00003136733
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136733
+ InChI=1S/C18H30O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h3-4,6,8,11,14,17,21H,2,5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/b4-3-,8-6-,14-11+/t17-/m1/s1
+ 0
+ qTof
+ InChI=1S/C18H30O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h3-4,6,8,11,14,17,21H,2,5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/b4-3-,8-6-,14-11+/t17-/m1/s1
+ 0.0
+ Spectral Match to 9(S)-HpOTrE from NIST14
+ CC/C=C\\C/C=C\\C=C\\[C@H](CCCCCCCC(=O)O)OO
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136733
+ 11
+ 3.43466
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to 9(S)-HpOTrE from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5524.0","main.cluster index_upperinput":"5524.0"}
+ 3.43466
+ 3
+ CC/C=C\\C/C=C\\C=C\\[C@H](CCCCCCCC(=O)O)OO
+ Data from Maria Maansson
+ 3
+ 293.21
+ CCMSLIB00003136733
+ 293.21
+ 0.0
+ Data from Maria Maansson
+ 2091757.305600518
+ qTof
+ Isolated
+ 0.00100708
+ M+H-H2O
+ N/A
+ ESI
+ Positive
+ 26.6121
+ 9
+ 0.730635
+ 0.0
+ Isolated
+ 5524
+ 0.00100708
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 26.6121
+ 0.0
+ M+H-H2O
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.1977
+ 9
+ 0
+ Feature Node
+ N/A
+ 16883976.533224158
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13729.0","main.cluster index_upperinput":"13729.0"}
+ 13729
+ 18.1977
+ -1
+ This Node is a Singleton
+ N/A
+ 298.0471
+ N/A
+ 0.0
+ 298.0471
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9346
+ 7
+ 0
+ Feature Node
+ N/A
+ 6394536.185904849
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9.0","main.cluster index_upperinput":"9.0"}
+ 9
+ 33.9346
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 656.2261
+ N/A
+ 0.0
+ 656.2261
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.0642
+ 8
+ 0
+ Feature Node
+ N/A
+ 12230283.985006649
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15.0","main.cluster index_upperinput":"15.0"}
+ 15
+ 31.0642
+ -1
+ This Node is a Singleton
+ N/A
+ 659.2879
+ N/A
+ 0.0
+ 659.2879
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.8173
+ 1
+ 0
+ Feature Node
+ N/A
+ 168835.95168267874
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8005.0","main.cluster index_upperinput":"8005.0"}
+ 8005
+ 20.8173
+ 108
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 185.1086
+ N/A
+ 0.0
+ 185.1086
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.7824
+ 7
+ 0
+ Feature Node
+ N/A
+ 2306823.4585964587
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8355.0","main.cluster index_upperinput":"8355.0"}
+ 8355
+ 26.7824
+ -1
+ This Node is a Singleton
+ N/A
+ 369.1807
+ N/A
+ 0.0
+ 369.1807
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.4369
+ 1
+ 0
+ Feature Node
+ N/A
+ 306956.11115848785
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8314.0","main.cluster index_upperinput":"8314.0"}
+ 8314
+ 6.4369
+ -1
+ This Node is a Singleton
+ N/A
+ 502.1837
+ N/A
+ 0.0
+ 502.1837
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6017
+ 2
+ 0
+ Feature Node
+ N/A
+ 2231598.9599131006
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3527.0","main.cluster index_upperinput":"3527.0"}
+ 3527
+ 17.6017
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 537.1237
+ N/A
+ 0.0
+ 537.1237
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.3307
+ 8
+ 0
+ Feature Node
+ N/A
+ 4271224.553671027
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2775.0","main.cluster index_upperinput":"2775.0"}
+ 2775
+ 23.3307
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 181.1219
+ N/A
+ 0.0
+ 181.1219
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.8505
+ 3
+ 0
+ Feature Node
+ N/A
+ 2471764.5460543875
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13747.0","main.cluster index_upperinput":"13747.0"}
+ 13747
+ 14.8505
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 472.2333
+ N/A
+ 0.0
+ 472.2333
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.1099
+ 6
+ 0
+ Feature Node
+ N/A
+ 6237255.447806681
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7629.0","main.cluster index_upperinput":"7629.0"}
+ 7629
+ 18.1099
+ -1
+ This Node is a Singleton
+ N/A
+ 369.1318
+ N/A
+ 0.0
+ 369.1318
+
+
+ 15
+ 0.8355459999999999
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 93
+ 0.740115
+ Feature Node
+ N/A
+ 15
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5332.0","main.cluster index_upperinput":"5332.0"}
+ 0.740115
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1017
+ CCMSLIB00003136238
+ 371.1017
+ 0.0
+ Data from Maria Maansson
+ 4433954.920384865
+ QQQ
+ Isolated
+ 0.000274658
+ M+H
+ N/A
+ ESI
+ Positive
+ 32.9244
+ 8
+ 0.8355459999999999
+ 0.0
+ Isolated
+ 5332
+ 0.000274658
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 32.9244
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.121
+ 7
+ 0
+ Feature Node
+ N/A
+ 6221664.397260188
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2761.0","main.cluster index_upperinput":"2761.0"}
+ 2761
+ 32.121
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 554.4628
+ N/A
+ 0.0
+ 554.4628
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.3025
+ 5
+ 0
+ Feature Node
+ N/A
+ 1408374.3802853352
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10318.0","main.cluster index_upperinput":"10318.0"}
+ 10318
+ 13.3025
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 466.2431
+ N/A
+ 0.0
+ 466.2431
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.3502
+ 5
+ 0
+ Feature Node
+ N/A
+ 21242672.78246537
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2.0","main.cluster index_upperinput":"2.0"}
+ 2
+ 27.3502
+ 72
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=72&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 579.2934
+ N/A
+ 0.0
+ 579.2934
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4725
+ 6
+ 0
+ Feature Node
+ N/A
+ 1680303.7714203673
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10964.0","main.cluster index_upperinput":"10964.0"}
+ 10964
+ 26.4725
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 366.3364
+ N/A
+ 0.0
+ 366.3364
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.9527
+ 9
+ 0
+ Feature Node
+ N/A
+ 2849692.9869862446
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1232.0","main.cluster index_upperinput":"1232.0"}
+ 1232
+ 25.9527
+ -1
+ This Node is a Singleton
+ N/A
+ 299.1615
+ N/A
+ 0.0
+ 299.1615
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9665
+ 8
+ 0
+ Feature Node
+ N/A
+ 7132692.557105476
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1298.0","main.cluster index_upperinput":"1298.0"}
+ 1298
+ 0.9665
+ -1
+ This Node is a Singleton
+ N/A
+ 262.1284
+ N/A
+ 0.0
+ 262.1284
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2437
+ 3
+ 0
+ Feature Node
+ N/A
+ 1932352.5525098746
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10473.0","main.cluster index_upperinput":"10473.0"}
+ 10473
+ 33.2437
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 850.2518
+ N/A
+ 0.0
+ 850.2518
+
+
+ 9
+ 0.9565319999999999
+ CCMSLIB00004694664
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694664
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0.0
+ arctiin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694664
+ 35
+ 0.43815699999999996
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF003601
+ arctiin
+ positive
+ MoNA:VF-NPL-QEHF003601
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4499.0","main.cluster index_upperinput":"4499.0"}
+ 0.43815699999999996
+ 3
+ N/A
+ MoNA
+ 3
+ 557.1992
+ CCMSLIB00004694664
+ 557.1992
+ 0.0
+ MoNA
+ 24894341.05050269
+ ESI-QFT
+ isolated
+ 0.00024414099999999997
+ [M+Na]+
+ N/A
+ N/A
+ positive
+ 16.5773
+ 4
+ 0.9565319999999999
+ 0.0
+ isolated
+ 4499
+ 0.00024414099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=35&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.5773
+ 0.0
+ [M+Na]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.1378
+ 8
+ 0
+ Feature Node
+ N/A
+ 5762291.731882633
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13741.0","main.cluster index_upperinput":"13741.0"}
+ 13741
+ 24.1378
+ -1
+ This Node is a Singleton
+ N/A
+ 365.2294
+ N/A
+ 0.0
+ 365.2294
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.7211
+ 3
+ 0
+ Feature Node
+ N/A
+ 483891.3542616637
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10414.0","main.cluster index_upperinput":"10414.0"}
+ 10414
+ 20.7211
+ -1
+ This Node is a Singleton
+ N/A
+ 359.2052
+ N/A
+ 0.0
+ 359.2052
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1653
+ 3
+ 0
+ Feature Node
+ N/A
+ 1840317.698683997
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13685.0","main.cluster index_upperinput":"13685.0"}
+ 13685
+ 26.1653
+ 111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=111&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 224.2009
+ N/A
+ 0.0
+ 224.2009
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.6452
+ 3
+ 0
+ Feature Node
+ N/A
+ 1639284.1778449249
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7703.0","main.cluster index_upperinput":"7703.0"}
+ 7703
+ 13.6452
+ 61
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=61&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 444.2018
+ N/A
+ 0.0
+ 444.2018
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.8712
+ 4
+ 0
+ Feature Node
+ N/A
+ 26210.618788399068
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11741.0","main.cluster index_upperinput":"11741.0"}
+ 11741
+ 6.8712
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 354.1906
+ N/A
+ 0.0
+ 354.1906
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.1029
+ 8
+ 0
+ Feature Node
+ N/A
+ 16814660.907572143
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1295.0","main.cluster index_upperinput":"1295.0"}
+ 1295
+ 1.1029
+ 185
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=185&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 276.1439
+ N/A
+ 0.0
+ 276.1439
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.5953
+ 7
+ 0
+ Feature Node
+ N/A
+ 957891.854925413
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15539.0","main.cluster index_upperinput":"15539.0"}
+ 15539
+ 9.5953
+ -1
+ This Node is a Singleton
+ N/A
+ 307.1152
+ N/A
+ 0.0
+ 307.1152
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.9576
+ 1
+ 0
+ Feature Node
+ N/A
+ 377723.8711067346
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7997.0","main.cluster index_upperinput":"7997.0"}
+ 7997
+ 3.9576
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 460.1737
+ N/A
+ 0.0
+ 460.1737
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.4552
+ 4
+ 0
+ Feature Node
+ N/A
+ 155017.4613466349
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4178.0","main.cluster index_upperinput":"4178.0"}
+ 4178
+ 6.4552
+ -1
+ This Node is a Singleton
+ N/A
+ 354.1908
+ N/A
+ 0.0
+ 354.1908
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.7091
+ 9
+ 0
+ Feature Node
+ N/A
+ 21406375.495852787
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1218.0","main.cluster index_upperinput":"1218.0"}
+ 1218
+ 34.7091
+ -1
+ This Node is a Singleton
+ N/A
+ 317.2451
+ N/A
+ 0.0
+ 317.2451
+
+
+ 9
+ 0.819171
+ CCMSLIB00005745136
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745136
+ 1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3
+ 0
+ qTof
+ 1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3
+ 0.0
+ Massbank:PR303697 Tectorigenin
+ COC1=C(O)C2=C(OC=C(C2=O)C2=CC=C(O)C=C2)C=C1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745136
+ 32
+ 0.91227
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303697 Tectorigenin
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4513.0","main.cluster index_upperinput":"4513.0"}
+ 0.91227
+ 3
+ COC1=C(O)C2=C(OC=C(C2=O)C2=CC=C(O)C=C2)C=C1O
+ Massbank
+ 3
+ 301.0713
+ CCMSLIB00005745136
+ 301.0713
+ 0.0
+ Massbank
+ 8821837.899372188
+ qTof
+ Isolated
+ 0.000274658
+ M+H
+ N/A
+ ESI
+ Positive
+ 21.1686
+ 7
+ 0.819171
+ 0.0
+ Isolated
+ 4513
+ 0.000274658
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.1686
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.051
+ 6
+ 0
+ Feature Node
+ N/A
+ 2332894.8492009663
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1364.0","main.cluster index_upperinput":"1364.0"}
+ 1364
+ 26.051
+ 44
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=44&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 343.2951
+ N/A
+ 0.0
+ 343.2951
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.5453
+ 5
+ 0
+ Feature Node
+ N/A
+ 730096.894340147
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8383.0","main.cluster index_upperinput":"8383.0"}
+ 8383
+ 6.5453
+ -1
+ This Node is a Singleton
+ N/A
+ 439.1576
+ N/A
+ 0.0
+ 439.1576
+
+
+ 24
+ 0.914941
+ CCMSLIB00005739719
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005739719
+ 1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0
+ qTof
+ 1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0.0
+ Massbank:PR303918 Arctigenin
+ COC1=C(OC)C=C(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005739719
+ 85
+ 0.24534099999999998
+ Feature Node
+ N/A
+ 24
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303918 Arctigenin
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4504.0","main.cluster index_upperinput":"4504.0"}
+ 0.24534099999999998
+ 3
+ COC1=C(OC)C=C(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)C=C1
+ Massbank
+ 3
+ 373.1651
+ CCMSLIB00005739719
+ 373.1651
+ 0.0
+ Massbank
+ 5912673.223655301
+ qTof
+ Isolated
+ 9.15527e-05
+ M+H
+ N/A
+ ESI
+ Positive
+ 19.4239
+ 7
+ 0.914941
+ 0.0
+ Isolated
+ 4504
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.4239
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.4758
+ 6
+ 0
+ Feature Node
+ N/A
+ 9027505.84605999
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4549.0","main.cluster index_upperinput":"4549.0"}
+ 4549
+ 13.4758
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 526.2637
+ N/A
+ 0.0
+ 526.2637
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.8355
+ 3
+ 0
+ Feature Node
+ N/A
+ 1151266.6802694597
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14013.0","main.cluster index_upperinput":"14013.0"}
+ 14013
+ 13.8355
+ -1
+ This Node is a Singleton
+ N/A
+ 430.2215
+ N/A
+ 0.0
+ 430.2215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.8996
+ 3
+ 0
+ Feature Node
+ N/A
+ 7681202.94481804
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13607.0","main.cluster index_upperinput":"13607.0"}
+ 13607
+ 20.8996
+ -1
+ This Node is a Singleton
+ N/A
+ 383.1467
+ N/A
+ 0.0
+ 383.1467
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.976
+ 6
+ 0
+ Feature Node
+ N/A
+ 1037646.1295271566
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1429.0","main.cluster index_upperinput":"1429.0"}
+ 1429
+ 26.976
+ -1
+ This Node is a Singleton
+ N/A
+ 310.2364
+ N/A
+ 0.0
+ 310.2364
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.9538
+ 4
+ 0
+ Feature Node
+ N/A
+ 814263.938237379
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2559.0","main.cluster index_upperinput":"2559.0"}
+ 2559
+ 17.9538
+ -1
+ This Node is a Singleton
+ N/A
+ 417.1884
+ N/A
+ 0.0
+ 417.1884
+
+
+ 9
+ 0.8853989999999999
+ CCMSLIB00004705056
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705056
+ InChI=1S/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18-,20+,21-,24-/m1/s1
+ 0
+ ESI-QFT
+ InChI=1S/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18-,20+,21-,24-/m1/s1
+ 0.0
+ Iridin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705056
+ 8
+ 0.816688
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF013993
+ Iridin
+ positive
+ MoNA:VF-NPL-QEHF013993
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3534.0","main.cluster index_upperinput":"3534.0"}
+ 0.816688
+ 3
+ N/A
+ MoNA
+ 3
+ 523.1446
+ CCMSLIB00004705056
+ 523.1446
+ 0.0
+ MoNA
+ 1131055.0315693982
+ ESI-QFT
+ isolated
+ 0.000427246
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 16.8601
+ 3
+ 0.8853989999999999
+ 0.0
+ isolated
+ 3534
+ 0.000427246
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.8601
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.385
+ 6
+ 0
+ Feature Node
+ N/A
+ 1030707.3583318568
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13935.0","main.cluster index_upperinput":"13935.0"}
+ 13935
+ 18.385
+ 25
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=25&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 833.3
+ N/A
+ 0.0
+ 833.3
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0447
+ 5
+ 0
+ Feature Node
+ N/A
+ 3182049.3725127103
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1339.0","main.cluster index_upperinput":"1339.0"}
+ 1339
+ 18.0447
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 520.2535
+ N/A
+ 0.0
+ 520.2535
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.738
+ 2
+ 0
+ Feature Node
+ N/A
+ 398427.40969867
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8154.0","main.cluster index_upperinput":"8154.0"}
+ 8154
+ 2.738
+ 104
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=104&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 611.2374
+ N/A
+ 0.0
+ 611.2374
+
+
+ 9
+ 0.704022
+ CCMSLIB00003135014
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135014
+ InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2
+ 0
+ qTof
+ InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2
+ 0.0
+ Spectral Match to 3-(2-Hydroxyethyl)indole from NIST14
+ C1=CC=C2C(=C1)C(=CN2)CCO
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135014
+ 108
+ 0.635425
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ Data deposited by quinnr
+ Spectral Match to 3-(2-Hydroxyethyl)indole from NIST14
+ Positive
+ Data deposited by quinnr
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"28840.0","main.cluster index_upperinput":"28840.0"}
+ 0.635425
+ 3
+ C1=CC=C2C(=C1)C(=CN2)CCO
+ Data from Dorrestein/Knight
+ 3
+ 144.0809
+ CCMSLIB00003135014
+ 144.0809
+ 0.0
+ Data from Dorrestein/Knight
+ 1054941.8180955078
+ qTof
+ Isolated
+ 9.15527e-05
+ M+H-H2O
+ N/A
+ ESI
+ Positive
+ 2.1327
+ 5
+ 0.704022
+ 0.0
+ Isolated
+ 28840
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 2.1327
+ 0.0
+ M+H-H2O
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.2595
+ 9
+ 0
+ Feature Node
+ N/A
+ 2913945.0717389337
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3581.0","main.cluster index_upperinput":"3581.0"}
+ 3581
+ 2.2595
+ -1
+ This Node is a Singleton
+ N/A
+ 188.0705
+ N/A
+ 0.0
+ 188.0705
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4946
+ 9
+ 0
+ Feature Node
+ N/A
+ 13130881.412980482
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2502.0","main.cluster index_upperinput":"2502.0"}
+ 2502
+ 28.4946
+ -1
+ This Node is a Singleton
+ N/A
+ 317.2086
+ N/A
+ 0.0
+ 317.2086
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.2163
+ 4
+ 0
+ Feature Node
+ N/A
+ 2999511.8213226944
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3567.0","main.cluster index_upperinput":"3567.0"}
+ 3567
+ 20.2163
+ -1
+ This Node is a Singleton
+ N/A
+ 323.0521
+ N/A
+ 0.0
+ 323.0521
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.5694
+ 1
+ 0
+ Feature Node
+ N/A
+ 1028965.726416392
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7737.0","main.cluster index_upperinput":"7737.0"}
+ 7737
+ 20.5694
+ -1
+ This Node is a Singleton
+ N/A
+ 819.2175
+ N/A
+ 0.0
+ 819.2175
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.1675
+ 5
+ 0
+ Feature Node
+ N/A
+ 2901436.863805427
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1523.0","main.cluster index_upperinput":"1523.0"}
+ 1523
+ 34.1675
+ -1
+ This Node is a Singleton
+ N/A
+ 437.3593
+ N/A
+ 0.0
+ 437.3593
+
+
+ 8
+ 0.794405
+ CCMSLIB00005742378
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0
+ qTof
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0.0
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 8
+ 0.77923
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3528.0","main.cluster index_upperinput":"3528.0"}
+ 0.77923
+ 3
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ Massbank
+ 3
+ 509.1286
+ CCMSLIB00005742378
+ 509.1286
+ 0.0
+ Massbank
+ 4987730.779616318
+ qTof
+ Isolated
+ 0.000396729
+ M+H
+ N/A
+ ESI
+ Positive
+ 15.1462
+ 7
+ 0.794405
+ 0.0
+ Isolated
+ 3528
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.1462
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6327
+ 2
+ 0
+ Feature Node
+ N/A
+ 618470.9102321024
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3557.0","main.cluster index_upperinput":"3557.0"}
+ 3557
+ 17.6327
+ -1
+ This Node is a Singleton
+ N/A
+ 559.1059
+ N/A
+ 0.0
+ 559.1059
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.5403
+ 1
+ 0
+ Feature Node
+ N/A
+ 3048097.770127635
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7636.0","main.cluster index_upperinput":"7636.0"}
+ 7636
+ 31.5403
+ 24
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=24&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 665.368
+ N/A
+ 0.0
+ 665.368
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.7752
+ 4
+ 0
+ Feature Node
+ N/A
+ 869463.4921827872
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5090.0","main.cluster index_upperinput":"5090.0"}
+ 5090
+ 30.7752
+ 82
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=82&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 367.318
+ N/A
+ 0.0
+ 367.318
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.5892
+ 5
+ 0
+ Feature Node
+ N/A
+ 3550715.343363897
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4661.0","main.cluster index_upperinput":"4661.0"}
+ 4661
+ 11.5892
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 512.2491
+ N/A
+ 0.0
+ 512.2491
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.307
+ 7
+ 0
+ Feature Node
+ N/A
+ 3635665.892161077
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3766.0","main.cluster index_upperinput":"3766.0"}
+ 3766
+ 3.307
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 428.2273
+ N/A
+ 0.0
+ 428.2273
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1282
+ 3
+ 0
+ Feature Node
+ N/A
+ 353996.5104109944
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3597.0","main.cluster index_upperinput":"3597.0"}
+ 3597
+ 19.1282
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 551.1389
+ N/A
+ 0.0
+ 551.1389
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.9398
+ 8
+ 0
+ Feature Node
+ N/A
+ 10764912.503532806
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2630.0","main.cluster index_upperinput":"2630.0"}
+ 2630
+ 26.9398
+ -1
+ This Node is a Singleton
+ N/A
+ 391.2452
+ N/A
+ 0.0
+ 391.2452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.703
+ 5
+ 0
+ Feature Node
+ N/A
+ 3043476.88329294
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10239.0","main.cluster index_upperinput":"10239.0"}
+ 10239
+ 23.703
+ 81
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 422.2182
+ N/A
+ 0.0
+ 422.2182
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.8137
+ 1
+ 0
+ Feature Node
+ N/A
+ 646527.9817344587
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10316.0","main.cluster index_upperinput":"10316.0"}
+ 10316
+ 22.8137
+ -1
+ This Node is a Singleton
+ N/A
+ 427.1738
+ N/A
+ 0.0
+ 427.1738
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4144
+ 9
+ 0
+ Feature Node
+ N/A
+ 3278506.2319819415
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1503.0","main.cluster index_upperinput":"1503.0"}
+ 1503
+ 33.4144
+ -1
+ This Node is a Singleton
+ N/A
+ 393.2984
+ N/A
+ 0.0
+ 393.2984
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0549
+ 8
+ 0
+ Feature Node
+ N/A
+ 4038686.4506001417
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10446.0","main.cluster index_upperinput":"10446.0"}
+ 10446
+ 34.0549
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 423.3615
+ N/A
+ 0.0
+ 423.3615
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.9541
+ 8
+ 0
+ Feature Node
+ N/A
+ 4040342.390257119
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2805.0","main.cluster index_upperinput":"2805.0"}
+ 2805
+ 32.9541
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 494.4053
+ N/A
+ 0.0
+ 494.4053
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.756
+ 8
+ 0
+ Feature Node
+ N/A
+ 12761533.132809265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"33.0","main.cluster index_upperinput":"33.0"}
+ 33
+ 34.756
+ -1
+ This Node is a Singleton
+ N/A
+ 485.3606
+ N/A
+ 0.0
+ 485.3606
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.9271
+ 8
+ 0
+ Feature Node
+ N/A
+ 2196423.725286804
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"155.0","main.cluster index_upperinput":"155.0"}
+ 155
+ 24.9271
+ 68
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=68&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 219.1743
+ N/A
+ 0.0
+ 219.1743
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.5262
+ 2
+ 0
+ Feature Node
+ N/A
+ 277649.8913123118
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7879.0","main.cluster index_upperinput":"7879.0"}
+ 7879
+ 26.5262
+ -1
+ This Node is a Singleton
+ N/A
+ 655.3818
+ N/A
+ 0.0
+ 655.3818
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.507
+ 6
+ 0
+ Feature Node
+ N/A
+ 5534117.149190869
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4539.0","main.cluster index_upperinput":"4539.0"}
+ 4539
+ 30.507
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 395.3661
+ N/A
+ 0.0
+ 395.3661
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8619
+ 4
+ 0
+ Feature Node
+ N/A
+ 487245.7375238376
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2561.0","main.cluster index_upperinput":"2561.0"}
+ 2561
+ 23.8619
+ -1
+ This Node is a Singleton
+ N/A
+ 229.1217
+ N/A
+ 0.0
+ 229.1217
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.933
+ 1
+ 0
+ Feature Node
+ N/A
+ 845581.5857207144
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7762.0","main.cluster index_upperinput":"7762.0"}
+ 7762
+ 21.933
+ -1
+ This Node is a Singleton
+ N/A
+ 762.2891
+ N/A
+ 0.0
+ 762.2891
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.3444
+ 3
+ 0
+ Feature Node
+ N/A
+ 5781141.223056713
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13724.0","main.cluster index_upperinput":"13724.0"}
+ 13724
+ 13.3444
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 472.232
+ N/A
+ 0.0
+ 472.232
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.0285
+ 8
+ 0
+ Feature Node
+ N/A
+ 7180779.93779882
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13714.0","main.cluster index_upperinput":"13714.0"}
+ 13714
+ 25.0285
+ -1
+ This Node is a Singleton
+ N/A
+ 367.245
+ N/A
+ 0.0
+ 367.245
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.4549
+ 7
+ 0
+ Feature Node
+ N/A
+ 7061768.350064984
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"284.0","main.cluster index_upperinput":"284.0"}
+ 284
+ 30.4549
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 409.3821
+ N/A
+ 0.0
+ 409.3821
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.8355
+ 4
+ 0
+ Feature Node
+ N/A
+ 496205.7560606825
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10352.0","main.cluster index_upperinput":"10352.0"}
+ 10352
+ 20.8355
+ -1
+ This Node is a Singleton
+ N/A
+ 483.2203
+ N/A
+ 0.0
+ 483.2203
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9288
+ 1
+ 0
+ Feature Node
+ N/A
+ 14538054.446879866
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7622.0","main.cluster index_upperinput":"7622.0"}
+ 7622
+ 14.9288
+ -1
+ This Node is a Singleton
+ N/A
+ 421.1029
+ N/A
+ 0.0
+ 421.1029
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1038
+ 9
+ 0
+ Feature Node
+ N/A
+ 3453109.1389056193
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5935.0","main.cluster index_upperinput":"5935.0"}
+ 5935
+ 26.1038
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.5689
+ 7
+ 0
+ Feature Node
+ N/A
+ 12405491.94150471
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7845.0","main.cluster index_upperinput":"7845.0"}
+ 7845
+ 11.5689
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 464.2252
+ N/A
+ 0.0
+ 464.2252
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5876
+ 8
+ 0
+ Feature Node
+ N/A
+ 3722362.60485438
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"53.0","main.cluster index_upperinput":"53.0"}
+ 53
+ 33.5876
+ 73
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=73&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3726
+ N/A
+ 0.0
+ 429.3726
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.1663
+ 9
+ 0
+ Feature Node
+ N/A
+ 3849265.979198103
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1604.0","main.cluster index_upperinput":"1604.0"}
+ 1604
+ 30.1663
+ 2
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 542.3225
+ N/A
+ 0.0
+ 542.3225
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.3444
+ 7
+ 0
+ Feature Node
+ N/A
+ 2051258.8020990477
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2879.0","main.cluster index_upperinput":"2879.0"}
+ 2879
+ 31.3444
+ -1
+ This Node is a Singleton
+ N/A
+ 499.3745
+ N/A
+ 0.0
+ 499.3745
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.816
+ 7
+ 0
+ Feature Node
+ N/A
+ 8158529.929410027
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4525.0","main.cluster index_upperinput":"4525.0"}
+ 4525
+ 21.816
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 809.3525
+ N/A
+ 0.0
+ 809.3525
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.7605
+ 9
+ 0
+ Feature Node
+ N/A
+ 10014301.679710811
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"30.0","main.cluster index_upperinput":"30.0"}
+ 30
+ 31.7605
+ -1
+ This Node is a Singleton
+ N/A
+ 360.3234
+ N/A
+ 0.0
+ 360.3234
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.2635
+ 8
+ 0
+ Feature Node
+ N/A
+ 3401344.9023944493
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"36.0","main.cluster index_upperinput":"36.0"}
+ 36
+ 24.2635
+ -1
+ This Node is a Singleton
+ N/A
+ 317.1722
+ N/A
+ 0.0
+ 317.1722
+
+
+ 11
+ 0.836585
+ CCMSLIB00006377815
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006377815
+ InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H
+ 0
+ Orbitrap
+ InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H
+ 0.0
+ Quercetin
+ O=C1C(O)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=C(O)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006377815
+ 71
+ 1.00701
+ Feature Node
+ N/A
+ 11
+ 0.0
+ 0.0
+ BMDMS-NP
+ Quercetin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13869.0","main.cluster index_upperinput":"13869.0"}
+ 1.00701
+ 1
+ O=C1C(O)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=C(O)C3
+ BMDMS-NP
+ 1
+ 303.0503
+ CCMSLIB00006377815
+ 303.0503
+ 0.0
+ BMDMS-NP
+ 1176644.1532411298
+ Orbitrap
+ Commercial standard
+ 0.000305176
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 15.8193
+ 3
+ 0.836585
+ 0.0
+ Commercial standard
+ 13869
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.8193
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 5.1242
+ 3
+ 0
+ Feature Node
+ N/A
+ 2850740.6247571292
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"26406.0","main.cluster index_upperinput":"26406.0"}
+ 26406
+ 5.1242
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.2182
+ N/A
+ 0.0
+ 496.2182
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6385
+ 8
+ 0
+ Feature Node
+ N/A
+ 5593702.528212339
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4679.0","main.cluster index_upperinput":"4679.0"}
+ 4679
+ 32.6385
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 656.5297
+ N/A
+ 0.0
+ 656.5297
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.728
+ 7
+ 0
+ Feature Node
+ N/A
+ 2294286.31350053
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4732.0","main.cluster index_upperinput":"4732.0"}
+ 4732
+ 13.728
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1221
+ N/A
+ 0.0
+ 229.1221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2795
+ 7
+ 0
+ Feature Node
+ N/A
+ 5028171.3703986425
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2649.0","main.cluster index_upperinput":"2649.0"}
+ 2649
+ 33.2795
+ 47
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=47&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 625.2669
+ N/A
+ 0.0
+ 625.2669
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.688
+ 3
+ 0
+ Feature Node
+ N/A
+ 12934536.672602829
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7625.0","main.cluster index_upperinput":"7625.0"}
+ 7625
+ 24.688
+ -1
+ This Node is a Singleton
+ N/A
+ 679.1795
+ N/A
+ 0.0
+ 679.1795
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.2503
+ 8
+ 0
+ Feature Node
+ N/A
+ 78718458.26638679
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"46.0","main.cluster index_upperinput":"46.0"}
+ 46
+ 34.2503
+ -1
+ This Node is a Singleton
+ N/A
+ 413.2665
+ N/A
+ 0.0
+ 413.2665
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8795
+ 9
+ 0
+ Feature Node
+ N/A
+ 6704953.617114445
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1511.0","main.cluster index_upperinput":"1511.0"}
+ 1511
+ 32.8795
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 283.2634
+ N/A
+ 0.0
+ 283.2634
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.1098
+ 4
+ 0
+ Feature Node
+ N/A
+ 406611.9740822153
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4775.0","main.cluster index_upperinput":"4775.0"}
+ 4775
+ 12.1098
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2227
+ N/A
+ 0.0
+ 446.2227
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.9491
+ 5
+ 0
+ Feature Node
+ N/A
+ 1333991.2634390246
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4831.0","main.cluster index_upperinput":"4831.0"}
+ 4831
+ 12.9491
+ -1
+ This Node is a Singleton
+ N/A
+ 331.1541
+ N/A
+ 0.0
+ 331.1541
+
+
+ 59
+ 0.712322
+ CCMSLIB00004705105
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705105
+ InChI=1S/C27H44O7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17,19-22,29-34H,6-11,13-14H2,1-5H3/t15-,17-,19+,20-,21-,22+,24+,25+,26+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H44O7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17,19-22,29-34H,6-11,13-14H2,1-5H3/t15-,17-,19+,20-,21-,22+,24+,25+,26+,27+/m0/s1
+ 0.0
+ CRUSTECDYSONE
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705105
+ 90
+ 0.824258
+ Feature Node
+ N/A
+ 59
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF014042
+ CRUSTECDYSONE
+ positive
+ MoNA:VF-NPL-QEHF014042
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13666.0","main.cluster index_upperinput":"13666.0"}
+ 0.824258
+ 3
+ N/A
+ MoNA
+ 3
+ 481.3156
+ CCMSLIB00004705105
+ 481.3156
+ 0.0
+ MoNA
+ 5610544.476596168
+ ESI-QFT
+ isolated
+ 0.000396729
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 14.8506
+ 1
+ 0.712322
+ 0.0
+ isolated
+ 13666
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=90&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.8506
+ 0.0
+ [M+H]+
+
+
+ 9
+ 0.8716709999999999
+ CCMSLIB00005738688
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0
+ qTof
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0.0
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 11
+ 0.6557470000000001
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"914.0","main.cluster index_upperinput":"914.0"}
+ 0.6557470000000001
+ 3
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ Massbank
+ 3
+ 279.2318
+ CCMSLIB00005738688
+ 279.2318
+ 0.0
+ Massbank
+ 15099986.047164313
+ qTof
+ Isolated
+ 0.000183105
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.3422
+ 9
+ 0.8716709999999999
+ 0.0
+ Isolated
+ 914
+ 0.000183105
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.3422
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.6019
+ 3
+ 0
+ Feature Node
+ N/A
+ 554957.226405934
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7810.0","main.cluster index_upperinput":"7810.0"}
+ 7810
+ 18.6019
+ 84
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 432.2018
+ N/A
+ 0.0
+ 432.2018
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.1001
+ 6
+ 0
+ Feature Node
+ N/A
+ 472047.20388648333
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7780.0","main.cluster index_upperinput":"7780.0"}
+ 7780
+ 22.1001
+ -1
+ This Node is a Singleton
+ N/A
+ 521.2715
+ N/A
+ 0.0
+ 521.2715
+
+
+ 42
+ 0.739524
+ CCMSLIB00000852963
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852963
+ InChI=1S/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h9-14,16-17H,1-5H2/t9-,10-,11+,12-,13+,14+/m0/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h9-14,16-17H,1-5H2/t9-,10-,11+,12-,13+,14+/m0/s1
+ 0.0
+ NCGC00169726-02_C15H18O4_(3aR,4R,6aR,8S,9aR,9bR)-4,8-Dihydroxy-3,6,9-tris(methylene)decahydroazuleno[4,5-b]furan-2(3H)-one
+ O[C@@H]1CC(=C)[C@@H]2C[C@H](O)C(=C)[C@@H]2[C@H]3OC(=O)C(=C)[C@H]13
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852963
+ 11
+ 2.86355
+ Feature Node
+ N/A
+ 42
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00169726-02_C15H18O4_(3aR,4R,6aR,8S,9aR,9bR)-4,8-Dihydroxy-3,6,9-tris(methylene)decahydroazuleno[4,5-b]furan-2(3H)-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7628.0","main.cluster index_upperinput":"7628.0"}
+ 2.86355
+ 1
+ O[C@@H]1CC(=C)[C@@H]2C[C@H](O)C(=C)[C@@H]2[C@H]3OC(=O)C(=C)[C@H]13
+ Jadhav/Dorrestein
+ 1
+ 245.1177
+ CCMSLIB00000852963
+ 245.1177
+ 0.0
+ Jadhav/Dorrestein
+ 6853506.5163230095
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.0007019039999999999
+ M-H2O+H
+ N/A
+ LC-ESI
+ positive
+ 18.0626
+ 6
+ 0.739524
+ 0.0
+ isolated
+ 7628
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.0626
+ 0.0
+ M-H2O+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8798
+ 7
+ 0
+ Feature Node
+ N/A
+ 25523743.654954515
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1246.0","main.cluster index_upperinput":"1246.0"}
+ 1246
+ 32.8798
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 959.5715
+ N/A
+ 0.0
+ 959.5715
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.5004
+ 7
+ 0
+ Feature Node
+ N/A
+ 1881702.2328941296
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2712.0","main.cluster index_upperinput":"2712.0"}
+ 2712
+ 15.5004
+ -1
+ This Node is a Singleton
+ N/A
+ 496.2529
+ N/A
+ 0.0
+ 496.2529
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2107
+ 3
+ 0
+ Feature Node
+ N/A
+ 2202693.330194623
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"48.0","main.cluster index_upperinput":"48.0"}
+ 48
+ 33.2107
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=36&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 954.6068
+ N/A
+ 0.0
+ 954.6068
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.7499
+ 9
+ 0
+ Feature Node
+ N/A
+ 4635021.944554756
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1248.0","main.cluster index_upperinput":"1248.0"}
+ 1248
+ 3.7499
+ 108
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 144.0807
+ N/A
+ 0.0
+ 144.0807
+
+
+ 9
+ 0.8904719999999999
+ CCMSLIB00000221138
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000221138
+ 1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H
+ 0
+ LC-Q-TOF/MS
+ 1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H
+ 0.0
+ ReSpect:PT103933 Apigenin|Apig|4',5,7-trihydroxyflavone|Apigenol|Chamomile|5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone|Naringenin Chalcone|5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000221138
+ 71
+ 1.46361
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ ReSpect
+ ReSpect:PT103933 Apigenin|Apig|4',5,7-trihydroxyflavone|Apigenol|Chamomile|5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone|Naringenin Chalcone|5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ Positive
+ ReSpect
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1183.0","main.cluster index_upperinput":"1183.0"}
+ 1.46361
+ 3
+ C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
+ Putative ReSpect Match
+ 3
+ 271.0606
+ CCMSLIB00000221138
+ 271.0606
+ 0.0
+ Putative ReSpect Match
+ 5559069.247025287
+ LC-Q-TOF/MS
+ Isolated
+ 0.000396729
+ [M+H]
+ N/A
+ ESI
+ Positive
+ 20.0821
+ 7
+ 0.8904719999999999
+ 0.0
+ Isolated
+ 1183
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.0821
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.4786
+ 9
+ 0
+ Feature Node
+ N/A
+ 53174239.119865336
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6.0","main.cluster index_upperinput":"6.0"}
+ 6
+ 34.4786
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=99&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 781.1919
+ N/A
+ 0.0
+ 781.1919
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4928
+ 8
+ 0
+ Feature Node
+ N/A
+ 2330368.9224305814
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11194.0","main.cluster index_upperinput":"11194.0"}
+ 11194
+ 26.4928
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9454
+ N/A
+ 0.0
+ 84.9454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.3229
+ 7
+ 0
+ Feature Node
+ N/A
+ 2859084.691543487
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3714.0","main.cluster index_upperinput":"3714.0"}
+ 3714
+ 3.3229
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 336.2164
+ N/A
+ 0.0
+ 336.2164
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.322
+ 9
+ 0
+ Feature Node
+ N/A
+ 24368158.024731725
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"779.0","main.cluster index_upperinput":"779.0"}
+ 779
+ 31.322
+ -1
+ This Node is a Singleton
+ N/A
+ 301.2136
+ N/A
+ 0.0
+ 301.2136
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8226
+ 4
+ 0
+ Feature Node
+ N/A
+ 1455564.2563759838
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1196.0","main.cluster index_upperinput":"1196.0"}
+ 1196
+ 16.8226
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 376.1753
+ N/A
+ 0.0
+ 376.1753
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.82
+ 7
+ 0
+ Feature Node
+ N/A
+ 3683105.9045907273
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5084.0","main.cluster index_upperinput":"5084.0"}
+ 5084
+ 13.82
+ 38
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 151.0387
+ N/A
+ 0.0
+ 151.0387
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.2617
+ 5
+ 0
+ Feature Node
+ N/A
+ 1645957.1768183797
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13794.0","main.cluster index_upperinput":"13794.0"}
+ 13794
+ 13.2617
+ -1
+ This Node is a Singleton
+ N/A
+ 323.1486
+ N/A
+ 0.0
+ 323.1486
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.3451
+ 4
+ 0
+ Feature Node
+ N/A
+ 1589489.1557533476
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13816.0","main.cluster index_upperinput":"13816.0"}
+ 13816
+ 25.3451
+ 112
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=112&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 731.3459
+ N/A
+ 0.0
+ 731.3459
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.8897
+ 3
+ 0
+ Feature Node
+ N/A
+ 3659953.090500396
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7707.0","main.cluster index_upperinput":"7707.0"}
+ 7707
+ 34.8897
+ -1
+ This Node is a Singleton
+ N/A
+ 738.5493
+ N/A
+ 0.0
+ 738.5493
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.8688
+ 5
+ 0
+ Feature Node
+ N/A
+ 308045.3079436157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3623.0","main.cluster index_upperinput":"3623.0"}
+ 3623
+ 18.8688
+ -1
+ This Node is a Singleton
+ N/A
+ 586.2648
+ N/A
+ 0.0
+ 586.2648
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.7345
+ 1
+ 0
+ Feature Node
+ N/A
+ 3113551.358743947
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7637.0","main.cluster index_upperinput":"7637.0"}
+ 7637
+ 30.7345
+ 24
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=24&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 663.3528
+ N/A
+ 0.0
+ 663.3528
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.1874
+ 2
+ 0
+ Feature Node
+ N/A
+ 1270868.4108238458
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4556.0","main.cluster index_upperinput":"4556.0"}
+ 4556
+ 15.1874
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 425.2427
+ N/A
+ 0.0
+ 425.2427
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.5863
+ 8
+ 0
+ Feature Node
+ N/A
+ 2166666.0767047647
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"61.0","main.cluster index_upperinput":"61.0"}
+ 61
+ 25.5863
+ -1
+ This Node is a Singleton
+ N/A
+ 355.2454
+ N/A
+ 0.0
+ 355.2454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.2947
+ 4
+ 0
+ Feature Node
+ N/A
+ 1876611.7328269212
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1182.0","main.cluster index_upperinput":"1182.0"}
+ 1182
+ 18.2947
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 461.1077
+ N/A
+ 0.0
+ 461.1077
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.2416
+ 4
+ 0
+ Feature Node
+ N/A
+ 1871734.189313318
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10299.0","main.cluster index_upperinput":"10299.0"}
+ 10299
+ 13.2416
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 434.2529
+ N/A
+ 0.0
+ 434.2529
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.1891
+ 7
+ 0
+ Feature Node
+ N/A
+ 11768549.039192425
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1345.0","main.cluster index_upperinput":"1345.0"}
+ 1345
+ 11.1891
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 197.117
+ N/A
+ 0.0
+ 197.117
+
+
+ 25
+ 0.819992
+ CCMSLIB00004718161
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718161
+ InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3
+ 0
+ ESI-QTOF
+ InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3
+ 0.0
+ cirsimaritin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718161
+ 4
+ 1.25911
+ Feature Node
+ N/A
+ 25
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QTOF000610
+ cirsimaritin
+ positive
+ MoNA:VF-NPL-QTOF000610
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1157.0","main.cluster index_upperinput":"1157.0"}
+ 1.25911
+ 3
+ N/A
+ MoNA
+ 3
+ 315.0864
+ CCMSLIB00004718161
+ 315.0864
+ 0.0
+ MoNA
+ 5946004.116581957
+ ESI-QTOF
+ isolated
+ 0.000396729
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 21.4528
+ 6
+ 0.819992
+ 0.0
+ isolated
+ 1157
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.4528
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.3334
+ 3
+ 0
+ Feature Node
+ N/A
+ 2451942.760257565
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10251.0","main.cluster index_upperinput":"10251.0"}
+ 10251
+ 17.3334
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 480.2583
+ N/A
+ 0.0
+ 480.2583
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9171
+ 9
+ 0
+ Feature Node
+ N/A
+ 4097035.8289681943
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2653.0","main.cluster index_upperinput":"2653.0"}
+ 2653
+ 33.9171
+ -1
+ This Node is a Singleton
+ N/A
+ 333.2765
+ N/A
+ 0.0
+ 333.2765
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.8988
+ 3
+ 0
+ Feature Node
+ N/A
+ 845097.052697124
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7795.0","main.cluster index_upperinput":"7795.0"}
+ 7795
+ 26.8988
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 514.3885
+ N/A
+ 0.0
+ 514.3885
+
+
+ 8
+ 0.918408
+ CCMSLIB00000221138
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000221138
+ 1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H
+ 0
+ LC-Q-TOF/MS
+ 1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H
+ 0.0
+ ReSpect:PT103933 Apigenin|Apig|4',5,7-trihydroxyflavone|Apigenol|Chamomile|5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone|Naringenin Chalcone|5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000221138
+ 71
+ 0.0
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ ReSpect
+ ReSpect:PT103933 Apigenin|Apig|4',5,7-trihydroxyflavone|Apigenol|Chamomile|5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone|Naringenin Chalcone|5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ Positive
+ ReSpect
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4520.0","main.cluster index_upperinput":"4520.0"}
+ 0.0
+ 3
+ C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
+ Putative ReSpect Match
+ 3
+ 271.061
+ CCMSLIB00000221138
+ 271.061
+ 0.0
+ Putative ReSpect Match
+ 3112411.1219316716
+ LC-Q-TOF/MS
+ Isolated
+ 0.0
+ [M+H]
+ N/A
+ ESI
+ Positive
+ 21.0356
+ 8
+ 0.918408
+ 0.0
+ Isolated
+ 4520
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.0356
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.0389
+ 5
+ 0
+ Feature Node
+ N/A
+ 243388.22033986507
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3634.0","main.cluster index_upperinput":"3634.0"}
+ 3634
+ 23.0389
+ -1
+ This Node is a Singleton
+ N/A
+ 427.1728
+ N/A
+ 0.0
+ 427.1728
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.918
+ 6
+ 0
+ Feature Node
+ N/A
+ 484075.12668842316
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4929.0","main.cluster index_upperinput":"4929.0"}
+ 4929
+ 22.918
+ -1
+ This Node is a Singleton
+ N/A
+ 439.2658
+ N/A
+ 0.0
+ 439.2658
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9953
+ 1
+ 0
+ Feature Node
+ N/A
+ 1945737.7136965247
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13744.0","main.cluster index_upperinput":"13744.0"}
+ 13744
+ 19.9953
+ 42
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=42&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 488.228
+ N/A
+ 0.0
+ 488.228
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7783
+ 5
+ 0
+ Feature Node
+ N/A
+ 515122.2381787443
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8851.0","main.cluster index_upperinput":"8851.0"}
+ 8851
+ 21.7783
+ -1
+ This Node is a Singleton
+ N/A
+ 353.0634
+ N/A
+ 0.0
+ 353.0634
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.7908
+ 5
+ 0
+ Feature Node
+ N/A
+ 2851063.6239308636
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3626.0","main.cluster index_upperinput":"3626.0"}
+ 3626
+ 31.7908
+ -1
+ This Node is a Singleton
+ N/A
+ 455.3366
+ N/A
+ 0.0
+ 455.3366
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.559
+ 1
+ 0
+ Feature Node
+ N/A
+ 159699.55099075413
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"264.0","main.cluster index_upperinput":"264.0"}
+ 264
+ 21.559
+ -1
+ This Node is a Singleton
+ N/A
+ 593.1866
+ N/A
+ 0.0
+ 593.1866
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.7014
+ 1
+ 0
+ Feature Node
+ N/A
+ 206617.8875694272
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8126.0","main.cluster index_upperinput":"8126.0"}
+ 8126
+ 4.7014
+ -1
+ This Node is a Singleton
+ N/A
+ 496.2008
+ N/A
+ 0.0
+ 496.2008
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.259
+ 9
+ 0
+ Feature Node
+ N/A
+ 1258650.0846197593
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1499.0","main.cluster index_upperinput":"1499.0"}
+ 1499
+ 26.259
+ -1
+ This Node is a Singleton
+ N/A
+ 259.1674
+ N/A
+ 0.0
+ 259.1674
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6907
+ 9
+ 0
+ Feature Node
+ N/A
+ 32308209.363404583
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2566.0","main.cluster index_upperinput":"2566.0"}
+ 2566
+ 30.6907
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 570.4573
+ N/A
+ 0.0
+ 570.4573
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.0682
+ 2
+ 0
+ Feature Node
+ N/A
+ 649519.5179768108
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7698.0","main.cluster index_upperinput":"7698.0"}
+ 7698
+ 29.0682
+ 125
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=125&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 585.3039
+ N/A
+ 0.0
+ 585.3039
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.392
+ 2
+ 0
+ Feature Node
+ N/A
+ 10142084.553771261
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13610.0","main.cluster index_upperinput":"13610.0"}
+ 13610
+ 15.392
+ 37
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 467.2181
+ N/A
+ 0.0
+ 467.2181
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.5955
+ 5
+ 0
+ Feature Node
+ N/A
+ 13107874.820961185
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1555.0","main.cluster index_upperinput":"1555.0"}
+ 1555
+ 15.5955
+ -1
+ This Node is a Singleton
+ N/A
+ 478.2435
+ N/A
+ 0.0
+ 478.2435
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.8287
+ 4
+ 0
+ Feature Node
+ N/A
+ 996411.924837827
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1240.0","main.cluster index_upperinput":"1240.0"}
+ 1240
+ 12.8287
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 526.2639
+ N/A
+ 0.0
+ 526.2639
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.2451
+ 7
+ 0
+ Feature Node
+ N/A
+ 3217668.890262785
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1376.0","main.cluster index_upperinput":"1376.0"}
+ 1376
+ 4.2451
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 398.2167
+ N/A
+ 0.0
+ 398.2167
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.0998
+ 6
+ 0
+ Feature Node
+ N/A
+ 2458290.1741112764
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1170.0","main.cluster index_upperinput":"1170.0"}
+ 1170
+ 24.0998
+ 4
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 329.1025
+ N/A
+ 0.0
+ 329.1025
+
+
+ 16
+ 0.84259
+ CCMSLIB00005768077
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005768077
+ 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
+ 0
+ Hybrid FT
+ 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
+ 0.0
+ Massbank:NA001474 Matairesinol
+ COC1=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC=C(O)C(OC)=C2)=CC=C1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005768077
+ 85
+ 1.69944
+ Feature Node
+ N/A
+ 16
+ 0.0
+ 0.0
+ Massbank
+ Massbank:NA001474 Matairesinol
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4507.0","main.cluster index_upperinput":"4507.0"}
+ 1.69944
+ 3
+ COC1=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC=C(O)C(OC)=C2)=CC=C1O
+ Massbank
+ 3
+ 359.1496
+ CCMSLIB00005768077
+ 359.1496
+ 0.0
+ Massbank
+ 6096761.125805867
+ Hybrid FT
+ Isolated
+ 0.000610352
+ M+H
+ N/A
+ ESI
+ Positive
+ 17.7525
+ 5
+ 0.84259
+ 0.0
+ Isolated
+ 4507
+ 0.000610352
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.7525
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.4985
+ 3
+ 0
+ Feature Node
+ N/A
+ 760804.454121086
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5054.0","main.cluster index_upperinput":"5054.0"}
+ 5054
+ 15.4985
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 414.2473
+ N/A
+ 0.0
+ 414.2473
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.2503
+ 9
+ 0
+ Feature Node
+ N/A
+ 5855658.3397934595
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"49.0","main.cluster index_upperinput":"49.0"}
+ 49
+ 26.2503
+ 23
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 277.1792
+ N/A
+ 0.0
+ 277.1792
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1082
+ 3
+ 0
+ Feature Node
+ N/A
+ 1561522.1956955837
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4694.0","main.cluster index_upperinput":"4694.0"}
+ 4694
+ 16.1082
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.2487
+ N/A
+ 0.0
+ 536.2487
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.3709
+ 1
+ 0
+ Feature Node
+ N/A
+ 1988871.2022478841
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7690.0","main.cluster index_upperinput":"7690.0"}
+ 7690
+ 14.3709
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 440.1919
+ N/A
+ 0.0
+ 440.1919
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.1212
+ 9
+ 0
+ Feature Node
+ N/A
+ 1952695.7375194118
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1738.0","main.cluster index_upperinput":"1738.0"}
+ 1738
+ 24.1212
+ 23
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 275.1998
+ N/A
+ 0.0
+ 275.1998
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.7091
+ 4
+ 0
+ Feature Node
+ N/A
+ 1587109.978741709
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1335.0","main.cluster index_upperinput":"1335.0"}
+ 1335
+ 26.7091
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 514.3885
+ N/A
+ 0.0
+ 514.3885
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.917
+ 9
+ 0
+ Feature Node
+ N/A
+ 25071710.31461161
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1344.0","main.cluster index_upperinput":"1344.0"}
+ 1344
+ 27.917
+ -1
+ This Node is a Singleton
+ N/A
+ 317.2088
+ N/A
+ 0.0
+ 317.2088
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0117
+ 1
+ 0
+ Feature Node
+ N/A
+ 3077536.469322812
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13698.0","main.cluster index_upperinput":"13698.0"}
+ 13698
+ 18.0117
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 526.2438
+ N/A
+ 0.0
+ 526.2438
+
+
+ 14
+ 0.8394860000000001
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 93
+ 1.8914099999999998
+ Feature Node
+ N/A
+ 14
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4573.0","main.cluster index_upperinput":"4573.0"}
+ 1.8914099999999998
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1013
+ CCMSLIB00003136238
+ 371.1013
+ 0.0
+ Data from Maria Maansson
+ 11432784.806097012
+ QQQ
+ Isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ ESI
+ Positive
+ 34.4763
+ 6
+ 0.8394860000000001
+ 0.0
+ Isolated
+ 4573
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.4763
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.4123
+ 6
+ 0
+ Feature Node
+ N/A
+ 1915829.6121904906
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2824.0","main.cluster index_upperinput":"2824.0"}
+ 2824
+ 30.4123
+ -1
+ This Node is a Singleton
+ N/A
+ 483.3798
+ N/A
+ 0.0
+ 483.3798
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.0585
+ 6
+ 0
+ Feature Node
+ N/A
+ 2064226.4155160703
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1322.0","main.cluster index_upperinput":"1322.0"}
+ 1322
+ 15.0585
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.2324
+ N/A
+ 0.0
+ 412.2324
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.2142
+ 1
+ 0
+ Feature Node
+ N/A
+ 1786460.2964522126
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13754.0","main.cluster index_upperinput":"13754.0"}
+ 13754
+ 16.2142
+ 90
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=90&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 537.3055
+ N/A
+ 0.0
+ 537.3055
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.493
+ 2
+ 0
+ Feature Node
+ N/A
+ 1280291.7782708886
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13826.0","main.cluster index_upperinput":"13826.0"}
+ 13826
+ 17.493
+ 64
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 740.3283
+ N/A
+ 0.0
+ 740.3283
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.3803
+ 9
+ 0
+ Feature Node
+ N/A
+ 8211091.962950429
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"144.0","main.cluster index_upperinput":"144.0"}
+ 144
+ 31.3803
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 554.176
+ N/A
+ 0.0
+ 554.176
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.6748
+ 4
+ 0
+ Feature Node
+ N/A
+ 647897.6109037921
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7760.0","main.cluster index_upperinput":"7760.0"}
+ 7760
+ 10.6748
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.2056
+ N/A
+ 0.0
+ 536.2056
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9036
+ 7
+ 0
+ Feature Node
+ N/A
+ 7136748.895206897
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"311.0","main.cluster index_upperinput":"311.0"}
+ 311
+ 33.9036
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 425.3756
+ N/A
+ 0.0
+ 425.3756
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6034
+ 7
+ 0
+ Feature Node
+ N/A
+ 29285666.017621182
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3540.0","main.cluster index_upperinput":"3540.0"}
+ 3540
+ 30.6034
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 597.4123
+ N/A
+ 0.0
+ 597.4123
+
+
+ 8
+ 0.837822
+ CCMSLIB00005726386
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005726386
+ 1S/C19H38N2O3/c1-4-5-6-7-8-9-10-11-12-14-18(22)20-15-13-16-21(2,3)17-19(23)24/h4-17H2,1-3H3,(H-,20,22,23,24)/p+1
+ 0
+ Hybrid FT
+ 1S/C19H38N2O3/c1-4-5-6-7-8-9-10-11-12-14-18(22)20-15-13-16-21(2,3)17-19(23)24/h4-17H2,1-3H3,(H-,20,22,23,24)/p+1
+ 0.0
+ Massbank: Lauramidopropyl betaine|3-(Dodecanoylamino)propyl(carboxymethyl)dimethylammonium|carboxymethyl-[3-(dodecanoylamino)propyl]-dimethylazanium
+ CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC(O)=O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005726386
+ 44
+ 2.0446
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Massbank
+ Massbank: Lauramidopropyl betaine|3-(Dodecanoylamino)propyl(carboxymethyl)dimethylammonium|carboxymethyl-[3-(dodecanoylamino)propyl]-dimethylazanium
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"160.0","main.cluster index_upperinput":"160.0"}
+ 2.0446
+ 3
+ CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC(O)=O
+ Massbank
+ 3
+ 343.2953
+ CCMSLIB00005726386
+ 343.2953
+ 0.0
+ Massbank
+ 1652512.9267020319
+ Hybrid FT
+ Isolated
+ 0.0007019039999999999
+ M
+ N/A
+ ESI
+ Positive
+ 26.3292
+ 6
+ 0.837822
+ 0.0
+ Isolated
+ 160
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=44&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 26.3292
+ 0.0
+ M
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.3127
+ 5
+ 0
+ Feature Node
+ N/A
+ 1638262.7100923914
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20868.0","main.cluster index_upperinput":"20868.0"}
+ 20868
+ 1.3127
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.1639
+ N/A
+ 0.0
+ 430.1639
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.9077
+ 3
+ 0
+ Feature Node
+ N/A
+ 3006710.3803407084
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7681.0","main.cluster index_upperinput":"7681.0"}
+ 7681
+ 1.9077
+ 104
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=104&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 629.2478
+ N/A
+ 0.0
+ 629.2478
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.0595
+ 5
+ 0
+ Feature Node
+ N/A
+ 925620.7778586963
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10292.0","main.cluster index_upperinput":"10292.0"}
+ 10292
+ 21.0595
+ -1
+ This Node is a Singleton
+ N/A
+ 399.1987
+ N/A
+ 0.0
+ 399.1987
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8005
+ 5
+ 0
+ Feature Node
+ N/A
+ 1238174.4810558478
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4536.0","main.cluster index_upperinput":"4536.0"}
+ 4536
+ 21.8005
+ 4
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 361.0927
+ N/A
+ 0.0
+ 361.0927
+
+
+ 6
+ 0.715584
+ CCMSLIB00003135173
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135173
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 6-Methoxyluteolin from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135173
+ 32
+ 6.6412
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Data deposited by lfnothias
+ Spectral Match to 6-Methoxyluteolin from NIST14
+ Positive
+ Data deposited by lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10324.0","main.cluster index_upperinput":"10324.0"}
+ 6.6412
+ 3
+ N/A
+ Data from Pieter Dorrestein;Ajit Jadhav
+ 3
+ 317.0659
+ CCMSLIB00003135173
+ 317.0659
+ 0.0
+ Data from Pieter Dorrestein;Ajit Jadhav
+ 2500317.3073869627
+ HCD
+ Isolated
+ 0.00210571
+ M+H
+ N/A
+ ESI
+ Positive
+ 19.7429
+ 7
+ 0.715584
+ 0.0
+ Isolated
+ 10324
+ 0.00210571
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.7429
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1007
+ 5
+ 0
+ Feature Node
+ N/A
+ 1966459.9164168458
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13776.0","main.cluster index_upperinput":"13776.0"}
+ 13776
+ 26.1007
+ 112
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=112&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 569.2947
+ N/A
+ 0.0
+ 569.2947
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.1849
+ 1
+ 0
+ Feature Node
+ N/A
+ 2309222.967759012
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7665.0","main.cluster index_upperinput":"7665.0"}
+ 7665
+ 14.1849
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 498.1893
+ N/A
+ 0.0
+ 498.1893
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.9986
+ 8
+ 0
+ Feature Node
+ N/A
+ 12893101.447830036
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1287.0","main.cluster index_upperinput":"1287.0"}
+ 1287
+ 34.9986
+ 28
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=28&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3727
+ N/A
+ 0.0
+ 429.3727
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.0985
+ 1
+ 0
+ Feature Node
+ N/A
+ 9611662.887105402
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13613.0","main.cluster index_upperinput":"13613.0"}
+ 13613
+ 15.0985
+ 90
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=90&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 501.2843
+ N/A
+ 0.0
+ 501.2843
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.2177
+ 7
+ 0
+ Feature Node
+ N/A
+ 2496066.8787167324
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4327.0","main.cluster index_upperinput":"4327.0"}
+ 4327
+ 2.2177
+ 108
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 144.0808
+ N/A
+ 0.0
+ 144.0808
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.8266
+ 9
+ 0
+ Feature Node
+ N/A
+ 14038481.12340129
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1244.0","main.cluster index_upperinput":"1244.0"}
+ 1244
+ 29.8266
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 309.2411
+ N/A
+ 0.0
+ 309.2411
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.3317
+ 7
+ 0
+ Feature Node
+ N/A
+ 3079919.5441019232
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10291.0","main.cluster index_upperinput":"10291.0"}
+ 10291
+ 29.3317
+ 2
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 540.3076
+ N/A
+ 0.0
+ 540.3076
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.1885
+ 7
+ 0
+ Feature Node
+ N/A
+ 12596999.115117373
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9302.0","main.cluster index_upperinput":"9302.0"}
+ 9302
+ 35.1885
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 797.5184
+ N/A
+ 0.0
+ 797.5184
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.1892
+ 1
+ 0
+ Feature Node
+ N/A
+ 4973554.70633117
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7624.0","main.cluster index_upperinput":"7624.0"}
+ 7624
+ 21.1892
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 400.1524
+ N/A
+ 0.0
+ 400.1524
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.3335
+ 4
+ 0
+ Feature Node
+ N/A
+ 502578.4016431629
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4914.0","main.cluster index_upperinput":"4914.0"}
+ 4914
+ 21.3335
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 646.4011
+ N/A
+ 0.0
+ 646.4011
+
+
+ 8
+ 0.815705
+ CCMSLIB00005738370
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738370
+ 1S/C17H30O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h8,10,12-15,17-19H,3-7,9,11H2,1-2H3,(H,20,21)/b10-8+
+ 0
+ qTof
+ 1S/C17H30O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h8,10,12-15,17-19H,3-7,9,11H2,1-2H3,(H,20,21)/b10-8+
+ 0.0
+ Massbank:RP010203 ascr#17|(E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid
+ CC(CCCCCC\\C=C\\C(O)=O)OC1OC(C)C(O)CC1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738370
+ -1
+ 40.4492
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP010203 ascr#17|(E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1178.0","main.cluster index_upperinput":"1178.0"}
+ 40.4492
+ 3
+ CC(CCCCCC\\C=C\\C(O)=O)OC1OC(C)C(O)CC1O
+ Massbank
+ 3
+ 331.2244
+ CCMSLIB00005738370
+ 331.2244
+ 0.0
+ Massbank
+ 31273424.036383282
+ qTof
+ Isolated
+ 0.013397200000000001
+ M+H
+ N/A
+ ESI
+ Positive
+ 29.1796
+ 9
+ 0.815705
+ 0.0
+ Isolated
+ 1178
+ 0.013397200000000001
+ This Node is a Singleton
+ 29.1796
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.193
+ 8
+ 0
+ Feature Node
+ N/A
+ 1577085.3347349574
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"320.0","main.cluster index_upperinput":"320.0"}
+ 320
+ 15.193
+ -1
+ This Node is a Singleton
+ N/A
+ 314.0419
+ N/A
+ 0.0
+ 314.0419
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.267
+ 9
+ 0
+ Feature Node
+ N/A
+ 8913591.554596208
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1461.0","main.cluster index_upperinput":"1461.0"}
+ 1461
+ 33.267
+ -1
+ This Node is a Singleton
+ N/A
+ 335.2921
+ N/A
+ 0.0
+ 335.2921
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.9857
+ 9
+ 0
+ Feature Node
+ N/A
+ 1032540.5479039823
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8150.0","main.cluster index_upperinput":"8150.0"}
+ 8150
+ 20.9857
+ -1
+ This Node is a Singleton
+ N/A
+ 233.1531
+ N/A
+ 0.0
+ 233.1531
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6448
+ 3
+ 0
+ Feature Node
+ N/A
+ 13307765.650315905
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13596.0","main.cluster index_upperinput":"13596.0"}
+ 13596
+ 17.6448
+ 84
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 432.2023
+ N/A
+ 0.0
+ 432.2023
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.2218
+ 3
+ 0
+ Feature Node
+ N/A
+ 2149163.0101193013
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13670.0","main.cluster index_upperinput":"13670.0"}
+ 13670
+ 20.2218
+ -1
+ This Node is a Singleton
+ N/A
+ 654.0462
+ N/A
+ 0.0
+ 654.0462
+
+
+ 52
+ 0.8009270000000001
+ CCMSLIB00005720103
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0
+ Orbitrap
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0.0
+ 22-Hydoxy-2-hopen-1-one
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ 11
+ 0.207427
+ Feature Node
+ N/A
+ 52
+ 0.0
+ 0.0
+ Damien OLIVIER
+ 22-Hydoxy-2-hopen-1-one
+ Positive
+ Damien OLIVIER
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3771.0","main.cluster index_upperinput":"3771.0"}
+ 0.207427
+ 3
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 3
+ 441.3729
+ CCMSLIB00005720103
+ 441.3729
+ 0.0
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 7324153.220680505
+ Orbitrap
+ Isolated
+ 9.15527e-05
+ [M+H]
+ N/A
+ LC-ESI
+ Positive
+ 34.0723
+ 9
+ 0.8009270000000001
+ 0.0
+ Isolated
+ 3771
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.0723
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.3294
+ 7
+ 0
+ Feature Node
+ N/A
+ 2511704.27825489
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1720.0","main.cluster index_upperinput":"1720.0"}
+ 1720
+ 2.3294
+ -1
+ This Node is a Singleton
+ N/A
+ 398.2162
+ N/A
+ 0.0
+ 398.2162
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6758
+ 5
+ 0
+ Feature Node
+ N/A
+ 25540238.707606856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4500.0","main.cluster index_upperinput":"4500.0"}
+ 4500
+ 17.6758
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 426.2484
+ N/A
+ 0.0
+ 426.2484
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.4865
+ 6
+ 0
+ Feature Node
+ N/A
+ 2673341.418913299
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5194.0","main.cluster index_upperinput":"5194.0"}
+ 5194
+ 22.4865
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8903
+ N/A
+ 0.0
+ 84.9451
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.5009
+ 9
+ 0
+ Feature Node
+ N/A
+ 2701530.394294788
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6019.0","main.cluster index_upperinput":"6019.0"}
+ 6019
+ 25.5009
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 8
+ 0.9400649999999999
+ CCMSLIB00000852865
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852865
+ InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3/b4-3-,7-6-,10-9-
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3/b4-3-,7-6-,10-9-
+ 0.0
+ NCGC00380867-01_C27H46O9_9,12,15-Octadecatrienoic acid, 3-(hexopyranosyloxy)-2-hydroxypropyl ester, (9Z,12Z,15Z)-
+ CC\\C=C/C/C=C\\C\\C=C/CCCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852865
+ 34
+ 3.18067
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00380867-01_C27H46O9_9,12,15-Octadecatrienoic acid, 3-(hexopyranosyloxy)-2-hydroxypropyl ester, (9Z,12Z,15Z)-
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1272.0","main.cluster index_upperinput":"1272.0"}
+ 3.18067
+ 1
+ CC\\C=C/C/C=C\\C\\C=C/CCCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O
+ Jadhav/Dorrestein
+ 1
+ 537.3047
+ CCMSLIB00000852865
+ 537.3047
+ 0.0
+ Jadhav/Dorrestein
+ 34892992.38277557
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.00170898
+ M+Na
+ N/A
+ LC-ESI
+ positive
+ 29.587
+ 7
+ 0.9400649999999999
+ 0.0
+ isolated
+ 1272
+ 0.00170898
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 29.587
+ 0.0
+ M+Na
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.0629
+ 5
+ 0
+ Feature Node
+ N/A
+ 1064042.4516885078
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1422.0","main.cluster index_upperinput":"1422.0"}
+ 1422
+ 22.0629
+ -1
+ This Node is a Singleton
+ N/A
+ 230.2476
+ N/A
+ 0.0
+ 230.2476
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.1145
+ 8
+ 0
+ Feature Node
+ N/A
+ 7009044.711870915
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1665.0","main.cluster index_upperinput":"1665.0"}
+ 1665
+ 34.1145
+ 65
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=65&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 445.3674
+ N/A
+ 0.0
+ 445.3674
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.9405
+ 3
+ 0
+ Feature Node
+ N/A
+ 371059.3332727456
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8193.0","main.cluster index_upperinput":"8193.0"}
+ 8193
+ 9.9405
+ -1
+ This Node is a Singleton
+ N/A
+ 450.2123
+ N/A
+ 0.0
+ 450.2123
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5875
+ 9
+ 0
+ Feature Node
+ N/A
+ 3939310.8290627142
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"51.0","main.cluster index_upperinput":"51.0"}
+ 51
+ 34.5875
+ -1
+ This Node is a Singleton
+ N/A
+ 582.2071
+ N/A
+ 0.0
+ 582.2071
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6636
+ 8
+ 0
+ Feature Node
+ N/A
+ 8737907.425953781
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3666.0","main.cluster index_upperinput":"3666.0"}
+ 3666
+ 32.6636
+ 182
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=182&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.2985
+ N/A
+ 0.0
+ 441.2985
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.3034
+ 6
+ 0
+ Feature Node
+ N/A
+ 992239.6696096599
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7718.0","main.cluster index_upperinput":"7718.0"}
+ 7718
+ 23.3034
+ -1
+ This Node is a Singleton
+ N/A
+ 355.1527
+ N/A
+ 0.0
+ 355.1527
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.6186
+ 6
+ 0
+ Feature Node
+ N/A
+ 1470491.1044041764
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2692.0","main.cluster index_upperinput":"2692.0"}
+ 2692
+ 26.6186
+ 64
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 515.2626
+ N/A
+ 0.0
+ 515.2626
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.354
+ 4
+ 0
+ Feature Node
+ N/A
+ 2867246.989002333
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4643.0","main.cluster index_upperinput":"4643.0"}
+ 4643
+ 11.354
+ 127
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=127&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 516.2215
+ N/A
+ 0.0
+ 516.2215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9005
+ 7
+ 0
+ Feature Node
+ N/A
+ 9926045.26405664
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20.0","main.cluster index_upperinput":"20.0"}
+ 20
+ 33.9005
+ -1
+ This Node is a Singleton
+ N/A
+ 597.4134
+ N/A
+ 0.0
+ 597.4134
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.3714
+ 1
+ 0
+ Feature Node
+ N/A
+ 3165344.2055188264
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13660.0","main.cluster index_upperinput":"13660.0"}
+ 13660
+ 27.3714
+ 63
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=63&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1012.5329
+ N/A
+ 0.0
+ 1012.5329
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.1275
+ 6
+ 0
+ Feature Node
+ N/A
+ 2962564.4615801233
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3259.0","main.cluster index_upperinput":"3259.0"}
+ 3259
+ 34.1275
+ -1
+ This Node is a Singleton
+ N/A
+ 481.3657
+ N/A
+ 0.0
+ 481.3657
+
+
+ 15
+ 0.9066709999999999
+ CCMSLIB00004692251
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692251
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+
+ 0
+ ESI-QFT
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+
+ 0.0
+ feruloyltyramine
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692251
+ 19
+ 1.6514900000000001
+ Feature Node
+ N/A
+ 15
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF001188
+ feruloyltyramine
+ positive
+ MoNA:VF-NPL-QEHF001188
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1379.0","main.cluster index_upperinput":"1379.0"}
+ 1.6514900000000001
+ 3
+ N/A
+ MoNA
+ 3
+ 314.1385
+ CCMSLIB00004692251
+ 314.1385
+ 0.0
+ MoNA
+ 9094325.812385706
+ ESI-QFT
+ isolated
+ 0.000518799
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 15.9548
+ 4
+ 0.9066709999999999
+ 0.0
+ isolated
+ 1379
+ 0.000518799
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.9548
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.6732
+ 9
+ 0
+ Feature Node
+ N/A
+ 14434983.733589055
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2506.0","main.cluster index_upperinput":"2506.0"}
+ 2506
+ 28.6732
+ -1
+ This Node is a Singleton
+ N/A
+ 295.226
+ N/A
+ 0.0
+ 295.226
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1299
+ 5
+ 0
+ Feature Node
+ N/A
+ 1265453.0085276233
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1252.0","main.cluster index_upperinput":"1252.0"}
+ 1252
+ 23.1299
+ 33
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 534.2549
+ N/A
+ 0.0
+ 534.2549
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.4696
+ 8
+ 0
+ Feature Node
+ N/A
+ 1092029.5444329376
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"158.0","main.cluster index_upperinput":"158.0"}
+ 158
+ 24.4696
+ -1
+ This Node is a Singleton
+ N/A
+ 172.1694
+ N/A
+ 0.0
+ 172.1694
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.9884
+ 7
+ 0
+ Feature Node
+ N/A
+ 16381396.868072327
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1227.0","main.cluster index_upperinput":"1227.0"}
+ 1227
+ 34.9884
+ -1
+ This Node is a Singleton
+ N/A
+ 469.3652
+ N/A
+ 0.0
+ 469.3652
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.374
+ 3
+ 0
+ Feature Node
+ N/A
+ 1319815.8722936052
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10900.0","main.cluster index_upperinput":"10900.0"}
+ 10900
+ 17.374
+ 16
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=16&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.216
+ N/A
+ 0.0
+ 607.216
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1652
+ 6
+ 0
+ Feature Node
+ N/A
+ 2892873.414430489
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1449.0","main.cluster index_upperinput":"1449.0"}
+ 1449
+ 23.1652
+ -1
+ This Node is a Singleton
+ N/A
+ 662.4265
+ N/A
+ 0.0
+ 662.4265
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.9402
+ 6
+ 0
+ Feature Node
+ N/A
+ 8729881.193342445
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4410.0","main.cluster index_upperinput":"4410.0"}
+ 4410
+ 28.9402
+ -1
+ This Node is a Singleton
+ N/A
+ 597.4118
+ N/A
+ 0.0
+ 597.4118
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.5727
+ 4
+ 0
+ Feature Node
+ N/A
+ 685892.2937336279
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14070.0","main.cluster index_upperinput":"14070.0"}
+ 14070
+ 20.5727
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 646.3995
+ N/A
+ 0.0
+ 646.3995
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0387
+ 7
+ 0
+ Feature Node
+ N/A
+ 3511435.968243828
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2861.0","main.cluster index_upperinput":"2861.0"}
+ 2861
+ 18.0387
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 247.1328
+ N/A
+ 0.0
+ 247.1328
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.8779
+ 8
+ 0
+ Feature Node
+ N/A
+ 3042926.1247117985
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10954.0","main.cluster index_upperinput":"10954.0"}
+ 10954
+ 31.8779
+ -1
+ This Node is a Singleton
+ N/A
+ 411.3632
+ N/A
+ 0.0
+ 411.3632
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.863
+ 2
+ 0
+ Feature Node
+ N/A
+ 513449.4742878258
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7825.0","main.cluster index_upperinput":"7825.0"}
+ 7825
+ 19.863
+ -1
+ This Node is a Singleton
+ N/A
+ 384.202
+ N/A
+ 0.0
+ 384.202
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2577
+ 2
+ 0
+ Feature Node
+ N/A
+ 700159.9941753248
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10304.0","main.cluster index_upperinput":"10304.0"}
+ 10304
+ 23.2577
+ -1
+ This Node is a Singleton
+ N/A
+ 413.2153
+ N/A
+ 0.0
+ 413.2153
+
+
+ 14
+ 0.9050600000000001
+ CCMSLIB00003139561
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139561
+ N/A
+ 0
+ QqQ
+ N/A
+ 0.0
+ Spectral Match to 1-Hexadecanoyl-sn-glycerol from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139561
+ 11
+ 1.47391
+ Feature Node
+ N/A
+ 14
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 1-Hexadecanoyl-sn-glycerol from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"270.0","main.cluster index_upperinput":"270.0"}
+ 1.47391
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 331.2845
+ CCMSLIB00003139561
+ 331.2845
+ 0.0
+ Data from Wolfender/Litaudon
+ 14850018.304919442
+ QqQ
+ Isolated
+ 0.00048828099999999997
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.9075
+ 9
+ 0.9050600000000001
+ 0.0
+ Isolated
+ 270
+ 0.00048828099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.9075
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.4962
+ 4
+ 0
+ Feature Node
+ N/A
+ 2143612.0087425834
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2484.0","main.cluster index_upperinput":"2484.0"}
+ 2484
+ 18.4962
+ -1
+ This Node is a Singleton
+ N/A
+ 395.1469
+ N/A
+ 0.0
+ 395.1469
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.0634
+ 2
+ 0
+ Feature Node
+ N/A
+ 1873702.7713601745
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10271.0","main.cluster index_upperinput":"10271.0"}
+ 10271
+ 15.0634
+ 127
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=127&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 500.226
+ N/A
+ 0.0
+ 500.226
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.6775
+ 8
+ 0
+ Feature Node
+ N/A
+ 1750168.1159796019
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2408.0","main.cluster index_upperinput":"2408.0"}
+ 2408
+ 15.6775
+ 38
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 137.0599
+ N/A
+ 0.0
+ 137.0599
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7929
+ 1
+ 0
+ Feature Node
+ N/A
+ 2919602.1867954982
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13790.0","main.cluster index_upperinput":"13790.0"}
+ 13790
+ 21.7929
+ 42
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=42&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 488.2281
+ N/A
+ 0.0
+ 488.2281
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.4072
+ 7
+ 0
+ Feature Node
+ N/A
+ 1435538.473365185
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"115.0","main.cluster index_upperinput":"115.0"}
+ 115
+ 23.4072
+ -1
+ This Node is a Singleton
+ N/A
+ 290.2691
+ N/A
+ 0.0
+ 290.2691
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4251
+ 1
+ 0
+ Feature Node
+ N/A
+ 11929287.21673901
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13599.0","main.cluster index_upperinput":"13599.0"}
+ 13599
+ 28.4251
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 963.4781
+ N/A
+ 0.0
+ 963.4781
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0781
+ 8
+ 0
+ Feature Node
+ N/A
+ 6161306.248223056
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2656.0","main.cluster index_upperinput":"2656.0"}
+ 2656
+ 34.0781
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 325.3096
+ N/A
+ 0.0
+ 325.3096
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.7466
+ 8
+ 0
+ Feature Node
+ N/A
+ 1093649.8866694306
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1388.0","main.cluster index_upperinput":"1388.0"}
+ 1388
+ 26.7466
+ 55
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 268.1003
+ N/A
+ 0.0
+ 268.1003
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.6805
+ 6
+ 0
+ Feature Node
+ N/A
+ 9428213.539364876
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3716.0","main.cluster index_upperinput":"3716.0"}
+ 3716
+ 31.6805
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 937.5861
+ N/A
+ 0.0
+ 937.5861
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.2255
+ 8
+ 0
+ Feature Node
+ N/A
+ 1142722.8416407006
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15146.0","main.cluster index_upperinput":"15146.0"}
+ 15146
+ 35.2255
+ -1
+ This Node is a Singleton
+ N/A
+ 517.3864
+ N/A
+ 0.0
+ 517.3864
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.9649
+ 9
+ 0
+ Feature Node
+ N/A
+ 19568439.26567344
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"58.0","main.cluster index_upperinput":"58.0"}
+ 58
+ 32.9649
+ 27
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 628.1948
+ N/A
+ 0.0
+ 628.1948
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.9819
+ 2
+ 0
+ Feature Node
+ N/A
+ 896015.9608333664
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13980.0","main.cluster index_upperinput":"13980.0"}
+ 13980
+ 18.9819
+ 84
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 434.2169
+ N/A
+ 0.0
+ 434.2169
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.9276
+ 2
+ 0
+ Feature Node
+ N/A
+ 23959798.14006394
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13617.0","main.cluster index_upperinput":"13617.0"}
+ 13617
+ 10.9276
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 484.1958
+ N/A
+ 0.0
+ 484.1958
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1634
+ 5
+ 0
+ Feature Node
+ N/A
+ 2744033.263284408
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4658.0","main.cluster index_upperinput":"4658.0"}
+ 4658
+ 19.1634
+ 25
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=25&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 833.2991
+ N/A
+ 0.0
+ 833.2991
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.6584
+ 6
+ 0
+ Feature Node
+ N/A
+ 21532827.336337216
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1351.0","main.cluster index_upperinput":"1351.0"}
+ 1351
+ 34.6584
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 738.5485
+ N/A
+ 0.0
+ 738.5485
+
+
+ 53
+ 0.719234
+ CCMSLIB00000852864
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852864
+ InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3/b4-3-,7-6-,10-9-
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3/b4-3-,7-6-,10-9-
+ 0.0
+ NCGC00380867-01_C27H46O9_9,12,15-Octadecatrienoic acid, 3-(hexopyranosyloxy)-2-hydroxypropyl ester, (9Z,12Z,15Z)-
+ CC\\C=C/C/C=C\\C\\C=C/CCCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852864
+ 11
+ 3.0956200000000003
+ Feature Node
+ N/A
+ 53
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00380867-01_C27H46O9_9,12,15-Octadecatrienoic acid, 3-(hexopyranosyloxy)-2-hydroxypropyl ester, (9Z,12Z,15Z)-
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3667.0","main.cluster index_upperinput":"3667.0"}
+ 3.0956200000000003
+ 1
+ CC\\C=C/C/C=C\\C\\C=C/CCCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O
+ Jadhav/Dorrestein
+ 1
+ 532.3497
+ CCMSLIB00000852864
+ 532.3497
+ 0.0
+ Jadhav/Dorrestein
+ 9394796.394311195
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.00164795
+ M+NH4
+ N/A
+ LC-ESI
+ positive
+ 29.5924
+ 6
+ 0.719234
+ 0.0
+ isolated
+ 3667
+ 0.00164795
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 29.5924
+ 0.0
+ M+NH4
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.1475
+ 7
+ 0
+ Feature Node
+ N/A
+ 1482899.0122477433
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"151.0","main.cluster index_upperinput":"151.0"}
+ 151
+ 25.1475
+ -1
+ This Node is a Singleton
+ N/A
+ 283.1881
+ N/A
+ 0.0
+ 283.1881
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.8991
+ 7
+ 0
+ Feature Node
+ N/A
+ 1121392.537287224
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7880.0","main.cluster index_upperinput":"7880.0"}
+ 7880
+ 29.8991
+ -1
+ This Node is a Singleton
+ N/A
+ 513.3439
+ N/A
+ 0.0
+ 513.3439
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.6672
+ 7
+ 0
+ Feature Node
+ N/A
+ 170822607.16960382
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"69.0","main.cluster index_upperinput":"69.0"}
+ 69
+ 24.6672
+ 4
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 329.1023
+ N/A
+ 0.0
+ 329.1023
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.8366
+ 9
+ 0
+ Feature Node
+ N/A
+ 5265190.313405459
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"110.0","main.cluster index_upperinput":"110.0"}
+ 110
+ 28.8366
+ -1
+ This Node is a Singleton
+ N/A
+ 425.215
+ N/A
+ 0.0
+ 425.215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.0585
+ 8
+ 0
+ Feature Node
+ N/A
+ 1146505.0204533322
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1412.0","main.cluster index_upperinput":"1412.0"}
+ 1412
+ 24.0585
+ -1
+ This Node is a Singleton
+ N/A
+ 307.2259
+ N/A
+ 0.0
+ 307.2259
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.9545
+ 8
+ 0
+ Feature Node
+ N/A
+ 1616328.0355416287
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10896.0","main.cluster index_upperinput":"10896.0"}
+ 10896
+ 26.9545
+ -1
+ This Node is a Singleton
+ N/A
+ 281.1722
+ N/A
+ 0.0
+ 281.1722
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0209
+ 9
+ 0
+ Feature Node
+ N/A
+ 9027064.79785253
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"50.0","main.cluster index_upperinput":"50.0"}
+ 50
+ 34.0209
+ -1
+ This Node is a Singleton
+ N/A
+ 381.2985
+ N/A
+ 0.0
+ 381.2985
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.7383
+ 6
+ 0
+ Feature Node
+ N/A
+ 3162019.7043053824
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4671.0","main.cluster index_upperinput":"4671.0"}
+ 4671
+ 6.7383
+ -1
+ This Node is a Singleton
+ N/A
+ 402.1887
+ N/A
+ 0.0
+ 402.1887
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.6002
+ 9
+ 0
+ Feature Node
+ N/A
+ 4780434.483203352
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2888.0","main.cluster index_upperinput":"2888.0"}
+ 2888
+ 28.6002
+ -1
+ This Node is a Singleton
+ N/A
+ 351.2509
+ N/A
+ 0.0
+ 351.2509
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6627
+ 9
+ 0
+ Feature Node
+ N/A
+ 31043109.454098985
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1482.0","main.cluster index_upperinput":"1482.0"}
+ 1482
+ 30.6627
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 526.4318
+ N/A
+ 0.0
+ 526.4318
+
+
+ 17
+ 0.897842
+ CCMSLIB00005738688
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0
+ qTof
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0.0
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 11
+ 0.6557470000000001
+ Feature Node
+ N/A
+ 17
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"343.0","main.cluster index_upperinput":"343.0"}
+ 0.6557470000000001
+ 3
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ Massbank
+ 3
+ 279.2318
+ CCMSLIB00005738688
+ 279.2318
+ 0.0
+ Massbank
+ 51006575.9753264
+ qTof
+ Isolated
+ 0.000183105
+ M+H
+ N/A
+ ESI
+ Positive
+ 28.7159
+ 9
+ 0.897842
+ 0.0
+ Isolated
+ 343
+ 0.000183105
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 28.7159
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.2757
+ 1
+ 0
+ Feature Node
+ N/A
+ 1531000.8606507885
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7752.0","main.cluster index_upperinput":"7752.0"}
+ 7752
+ 3.2757
+ -1
+ This Node is a Singleton
+ N/A
+ 496.1953
+ N/A
+ 0.0
+ 496.1953
+
+
+ 24
+ 0.833425
+ CCMSLIB00000847637
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847637
+ InChI=1S/C46H50N4O8/c51-39-17-5-35(6-18-39)13-25-43(55)47-29-3-33-49(45(57)27-15-37-9-21-41(53)22-10-37)31-1-2-32-50(46(58)28-16-38-11-23-42(54)24-12-38)34-4-30-48-44(56)26-14-36-7-19-40(52)20-8-36/h5-28,51-54H,1-4,29-34H2,(H,47,55)(H,48,56)/b25-13+,26-14+,27-15+,28-16+
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C46H50N4O8/c51-39-17-5-35(6-18-39)13-25-43(55)47-29-3-33-49(45(57)27-15-37-9-21-41(53)22-10-37)31-1-2-32-50(46(58)28-16-38-11-23-42(54)24-12-38)34-4-30-48-44(56)26-14-36-7-19-40(52)20-8-36/h5-28,51-54H,1-4,29-34H2,(H,47,55)(H,48,56)/b25-13+,26-14+,27-15+,28-16+
+ 0.0
+ NCGC00384571-01!(E)-3-(4-hydroxyphenyl)-N-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]amino]propyl]prop-2-enamide
+ OC1=CC=C(\\C=C\\C(=O)NCCCN(CCCCN(CCCNC(=O)\\C=C\\C2=CC=C(O)C=C2)C(=O)\\C=C\\C3=CC=C(O)C=C3)C(=O)\\C=C\\C4=CC=C(O)C=C4)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847637
+ 18
+ 0.38758899999999996
+ Feature Node
+ N/A
+ 24
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00384571-01!(E)-3-(4-hydroxyphenyl)-N-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]amino]propyl]prop-2-enamide
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4545.0","main.cluster index_upperinput":"4545.0"}
+ 0.38758899999999996
+ 1
+ OC1=CC=C(\\C=C\\C(=O)NCCCN(CCCCN(CCCNC(=O)\\C=C\\C2=CC=C(O)C=C2)C(=O)\\C=C\\C3=CC=C(O)C=C3)C(=O)\\C=C\\C4=CC=C(O)C=C4)C=C1
+ Jadhav/Dorrestein
+ 1
+ 787.3697
+ CCMSLIB00000847637
+ 787.3697
+ 0.0
+ Jadhav/Dorrestein
+ 5676125.796386943
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.000305176
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 21.8629
+ 5
+ 0.833425
+ 0.0
+ isolated
+ 4545
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=18&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.8629
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.9985
+ 8
+ 0
+ Feature Node
+ N/A
+ 3419635.731342093
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4785.0","main.cluster index_upperinput":"4785.0"}
+ 4785
+ 31.9985
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 686.5413
+ N/A
+ 0.0
+ 686.5413
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.417
+ 9
+ 0
+ Feature Node
+ N/A
+ 2449054.5104293493
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1909.0","main.cluster index_upperinput":"1909.0"}
+ 1909
+ 28.417
+ 92
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=92&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 223.0636
+ N/A
+ 0.0
+ 223.0636
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.705
+ 2
+ 0
+ Feature Node
+ N/A
+ 452714.58544331143
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7954.0","main.cluster index_upperinput":"7954.0"}
+ 7954
+ 3.705
+ -1
+ This Node is a Singleton
+ N/A
+ 416.1475
+ N/A
+ 0.0
+ 416.1475
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.8794
+ 5
+ 0
+ Feature Node
+ N/A
+ 2838100.252386241
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2665.0","main.cluster index_upperinput":"2665.0"}
+ 2665
+ 13.8794
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 495.1131
+ N/A
+ 0.0
+ 495.1131
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.2857
+ 8
+ 0
+ Feature Node
+ N/A
+ 2494820.860533824
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"77.0","main.cluster index_upperinput":"77.0"}
+ 77
+ 26.2857
+ 41
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=41&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 161.0959
+ N/A
+ 0.0
+ 161.0959
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.3714
+ 1
+ 0
+ Feature Node
+ N/A
+ 5721352.514431703
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13618.0","main.cluster index_upperinput":"13618.0"}
+ 13618
+ 27.3714
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1017.4883
+ N/A
+ 0.0
+ 1017.4883
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.9068
+ 9
+ 0
+ Feature Node
+ N/A
+ 17808991.436290592
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3693.0","main.cluster index_upperinput":"3693.0"}
+ 3693
+ 23.9068
+ -1
+ This Node is a Singleton
+ N/A
+ 239.162
+ N/A
+ 0.0
+ 239.162
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.8727
+ 7
+ 0
+ Feature Node
+ N/A
+ 21500486.41597149
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2628.0","main.cluster index_upperinput":"2628.0"}
+ 2628
+ 33.8727
+ 29
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=29&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 623.2863
+ N/A
+ 0.0
+ 623.2863
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.0455
+ 8
+ 0
+ Feature Node
+ N/A
+ 3102099.0466506965
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5175.0","main.cluster index_upperinput":"5175.0"}
+ 5175
+ 22.0455
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8899
+ N/A
+ 0.0
+ 84.9449
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.0155
+ 1
+ 0
+ Feature Node
+ N/A
+ 1289195.817438995
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7732.0","main.cluster index_upperinput":"7732.0"}
+ 7732
+ 12.0155
+ -1
+ This Node is a Singleton
+ N/A
+ 516.1998
+ N/A
+ 0.0
+ 516.1998
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.0449
+ 2
+ 0
+ Feature Node
+ N/A
+ 907150.6126028959
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13694.0","main.cluster index_upperinput":"13694.0"}
+ 13694
+ 12.0449
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.213
+ N/A
+ 0.0
+ 462.213
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.0367
+ 1
+ 0
+ Feature Node
+ N/A
+ 5255373.444215419
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13624.0","main.cluster index_upperinput":"13624.0"}
+ 13624
+ 30.0367
+ -1
+ This Node is a Singleton
+ N/A
+ 899.463
+ N/A
+ 0.0
+ 899.463
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.3743
+ 6
+ 0
+ Feature Node
+ N/A
+ 2875307.235281382
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4597.0","main.cluster index_upperinput":"4597.0"}
+ 4597
+ 18.3743
+ 16
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=16&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.2156
+ N/A
+ 0.0
+ 607.2156
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.4064
+ 5
+ 0
+ Feature Node
+ N/A
+ 772832.0532592804
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15865.0","main.cluster index_upperinput":"15865.0"}
+ 15865
+ 13.4064
+ 26
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=26&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 565.1557
+ N/A
+ 0.0
+ 565.1557
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6326
+ 8
+ 0
+ Feature Node
+ N/A
+ 2884527.155233339
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1251.0","main.cluster index_upperinput":"1251.0"}
+ 1251
+ 23.6326
+ -1
+ This Node is a Singleton
+ N/A
+ 317.1721
+ N/A
+ 0.0
+ 317.1721
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.5436
+ 7
+ 0
+ Feature Node
+ N/A
+ 4049354.2303785738
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"26.0","main.cluster index_upperinput":"26.0"}
+ 26
+ 32.5436
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 409.3301
+ N/A
+ 0.0
+ 409.3301
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.0951
+ 8
+ 0
+ Feature Node
+ N/A
+ 12749995.523185268
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1340.0","main.cluster index_upperinput":"1340.0"}
+ 1340
+ 1.0951
+ 185
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=185&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 294.1547
+ N/A
+ 0.0
+ 294.1547
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6346
+ 4
+ 0
+ Feature Node
+ N/A
+ 1902719.2249584212
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10258.0","main.cluster index_upperinput":"10258.0"}
+ 10258
+ 17.6346
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 560.2703
+ N/A
+ 0.0
+ 560.2703
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.9847
+ 8
+ 0
+ Feature Node
+ N/A
+ 4043983.585667048
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"258.0","main.cluster index_upperinput":"258.0"}
+ 258
+ 29.9847
+ -1
+ This Node is a Singleton
+ N/A
+ 485.1127
+ N/A
+ 0.0
+ 485.1127
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8383
+ 1
+ 0
+ Feature Node
+ N/A
+ 747671.2868934269
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13785.0","main.cluster index_upperinput":"13785.0"}
+ 13785
+ 23.8383
+ -1
+ This Node is a Singleton
+ N/A
+ 455.3352
+ N/A
+ 0.0
+ 455.3352
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.8023
+ 5
+ 0
+ Feature Node
+ N/A
+ 5017713.699861904
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2859.0","main.cluster index_upperinput":"2859.0"}
+ 2859
+ 31.8023
+ -1
+ This Node is a Singleton
+ N/A
+ 471.3089
+ N/A
+ 0.0
+ 471.3089
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3106
+ 9
+ 0
+ Feature Node
+ N/A
+ 4990949.473437689
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1220.0","main.cluster index_upperinput":"1220.0"}
+ 1220
+ 32.3106
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 293.247
+ N/A
+ 0.0
+ 293.247
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.655
+ 3
+ 0
+ Feature Node
+ N/A
+ 5265996.145620106
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5073.0","main.cluster index_upperinput":"5073.0"}
+ 5073
+ 23.655
+ -1
+ This Node is a Singleton
+ N/A
+ 427.1727
+ N/A
+ 0.0
+ 427.1727
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.513
+ 8
+ 0
+ Feature Node
+ N/A
+ 639890.7681331699
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7897.0","main.cluster index_upperinput":"7897.0"}
+ 7897
+ 24.513
+ -1
+ This Node is a Singleton
+ N/A
+ 239.162
+ N/A
+ 0.0
+ 239.162
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.8402
+ 5
+ 0
+ Feature Node
+ N/A
+ 878105.7350186895
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7683.0","main.cluster index_upperinput":"7683.0"}
+ 7683
+ 26.8402
+ 64
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 515.264
+ N/A
+ 0.0
+ 515.264
+
+
+ 27
+ 0.7553270000000001
+ CCMSLIB00004711258
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004711258
+ InChI=1S/C22H28O8/c1-13-5-4-6-16(11-23)10-19-20(14(2)21(26)29-19)18(9-13)30-22(27)17(12-24)7-8-28-15(3)25/h5,7,10,18-20,23-24H,2,4,6,8-9,11-12H2,1,3H3/b13-5+,16-10-,17-7-/t18-,19+,20+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C22H28O8/c1-13-5-4-6-16(11-23)10-19-20(14(2)21(26)29-19)18(9-13)30-22(27)17(12-24)7-8-28-15(3)25/h5,7,10,18-20,23-24H,2,4,6,8-9,11-12H2,1,3H3/b13-5+,16-10-,17-7-/t18-,19+,20+/m0/s1
+ 0.0
+ [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-4-acetyloxy-2-(hydroxymethyl)but-2-enoate
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004711258
+ 81
+ 2.5070799999999998
+ Feature Node
+ N/A
+ 27
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF020195
+ [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-4-acetyloxy-2-(hydroxymethyl)but-2-enoate
+ positive
+ MoNA:VF-NPL-QEHF020195
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10246.0","main.cluster index_upperinput":"10246.0"}
+ 2.5070799999999998
+ 3
+ N/A
+ MoNA
+ 3
+ 438.2131
+ CCMSLIB00004711258
+ 438.2131
+ 0.0
+ MoNA
+ 4106778.1487845406
+ ESI-QFT
+ isolated
+ 0.00109863
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 19.5227
+ 3
+ 0.7553270000000001
+ 0.0
+ isolated
+ 10246
+ 0.00109863
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.5227
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.9772
+ 7
+ 0
+ Feature Node
+ N/A
+ 4732987.14616393
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1317.0","main.cluster index_upperinput":"1317.0"}
+ 1317
+ 30.9772
+ -1
+ This Node is a Singleton
+ N/A
+ 515.3208
+ N/A
+ 0.0
+ 515.3208
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1124
+ 5
+ 0
+ Feature Node
+ N/A
+ 1079522.7680494145
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3815.0","main.cluster index_upperinput":"3815.0"}
+ 3815
+ 19.1124
+ -1
+ This Node is a Singleton
+ N/A
+ 385.1625
+ N/A
+ 0.0
+ 385.1625
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.5907
+ 7
+ 0
+ Feature Node
+ N/A
+ 2264512.9999624
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7704.0","main.cluster index_upperinput":"7704.0"}
+ 7704
+ 23.5907
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 181.1221
+ N/A
+ 0.0
+ 181.1221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.7586
+ 4
+ 0
+ Feature Node
+ N/A
+ 894749.74208427
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1245.0","main.cluster index_upperinput":"1245.0"}
+ 1245
+ 20.7586
+ -1
+ This Node is a Singleton
+ N/A
+ 323.0525
+ N/A
+ 0.0
+ 323.0525
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.4731
+ 3
+ 0
+ Feature Node
+ N/A
+ 1175551.920766687
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4649.0","main.cluster index_upperinput":"4649.0"}
+ 4649
+ 20.4731
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 514.3224
+ N/A
+ 0.0
+ 514.3224
+
+
+ 16
+ 0.892134
+ CCMSLIB00005739719
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005739719
+ 1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0
+ qTof
+ 1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0.0
+ Massbank:PR303918 Arctigenin
+ COC1=C(OC)C=C(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005739719
+ 85
+ 2.45341
+ Feature Node
+ N/A
+ 16
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303918 Arctigenin
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2478.0","main.cluster index_upperinput":"2478.0"}
+ 2.45341
+ 3
+ COC1=C(OC)C=C(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)C=C1
+ Massbank
+ 3
+ 373.1641
+ CCMSLIB00005739719
+ 373.1641
+ 0.0
+ Massbank
+ 3618928.2210599985
+ qTof
+ Isolated
+ 0.000915527
+ M+H
+ N/A
+ ESI
+ Positive
+ 18.4965
+ 6
+ 0.892134
+ 0.0
+ Isolated
+ 2478
+ 0.000915527
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.4965
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6786
+ 9
+ 0
+ Feature Node
+ N/A
+ 700451.7257199598
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1326.0","main.cluster index_upperinput":"1326.0"}
+ 1326
+ 25.6786
+ -1
+ This Node is a Singleton
+ N/A
+ 325.2346
+ N/A
+ 0.0
+ 325.2346
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2382
+ 3
+ 0
+ Feature Node
+ N/A
+ 1319784.723544864
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7667.0","main.cluster index_upperinput":"7667.0"}
+ 7667
+ 23.2382
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 227.1069
+ N/A
+ 0.0
+ 227.1069
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.9302
+ 5
+ 0
+ Feature Node
+ N/A
+ 2344425.0616729814
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4548.0","main.cluster index_upperinput":"4548.0"}
+ 4548
+ 15.9302
+ 8
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 595.1663
+ N/A
+ 0.0
+ 595.1663
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.5617
+ 6
+ 0
+ Feature Node
+ N/A
+ 1570664.1746289209
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13800.0","main.cluster index_upperinput":"13800.0"}
+ 13800
+ 23.5617
+ -1
+ This Node is a Singleton
+ N/A
+ 465.1189
+ N/A
+ 0.0
+ 465.1189
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9847
+ 4
+ 0
+ Feature Node
+ N/A
+ 1199727.4230490352
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"22.0","main.cluster index_upperinput":"22.0"}
+ 22
+ 0.9847
+ 88
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 178.9461
+ N/A
+ 0.0
+ 178.9461
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.1456
+ 7
+ 0
+ Feature Node
+ N/A
+ 1981904.425281821
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4829.0","main.cluster index_upperinput":"4829.0"}
+ 4829
+ 14.1456
+ -1
+ This Node is a Singleton
+ N/A
+ 289.1412
+ N/A
+ 0.0
+ 289.1412
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.9887
+ 7
+ 0
+ Feature Node
+ N/A
+ 4076907.9954415904
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1217.0","main.cluster index_upperinput":"1217.0"}
+ 1217
+ 24.9887
+ 55
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 254.0837
+ N/A
+ 0.0
+ 254.0837
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.248
+ 2
+ 0
+ Feature Node
+ N/A
+ 2623670.973610177
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7639.0","main.cluster index_upperinput":"7639.0"}
+ 7639
+ 25.248
+ 125
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=125&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 699.2061
+ N/A
+ 0.0
+ 699.2061
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.0693
+ 8
+ 0
+ Feature Node
+ N/A
+ 5528466.66711173
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2783.0","main.cluster index_upperinput":"2783.0"}
+ 2783
+ 32.0693
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 598.4885
+ N/A
+ 0.0
+ 598.4885
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9983
+ 4
+ 0
+ Feature Node
+ N/A
+ 3945561.505261169
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4532.0","main.cluster index_upperinput":"4532.0"}
+ 4532
+ 16.9983
+ -1
+ This Node is a Singleton
+ N/A
+ 501.1009
+ N/A
+ 0.0
+ 501.1009
+
+
+ 25
+ 0.938098
+ CCMSLIB00003134510
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134510
+ InChI=1S/C24H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)30-21-23(26)22-32-33(28,29)31-20-19-25(2,3)4/h23,26H,5-22H2,1-4H3/t23-/m1/s1
+ 0
+ qTof
+ InChI=1S/C24H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)30-21-23(26)22-32-33(28,29)31-20-19-25(2,3)4/h23,26H,5-22H2,1-4H3/t23-/m1/s1
+ 0.0
+ Spectral Match to 1-Hexadecanoyl-sn-glycero-3-phosphocholine from NIST14
+ CCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134510
+ 2
+ 1.0598
+ Feature Node
+ N/A
+ 25
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 1-Hexadecanoyl-sn-glycero-3-phosphocholine from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1395.0","main.cluster index_upperinput":"1395.0"}
+ 1.0598
+ 3
+ CCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O
+ Data from Wolfender/Litaudon
+ 3
+ 518.3226
+ CCMSLIB00003134510
+ 518.3226
+ 0.0
+ Data from Wolfender/Litaudon
+ 10916464.725525787
+ qTof
+ Isolated
+ 0.000549316
+ M+Na
+ N/A
+ ESI
+ Positive
+ 30.731
+ 8
+ 0.938098
+ 0.0
+ Isolated
+ 1395
+ 0.000549316
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 30.731
+ 0.0
+ M+Na
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.6026
+ 6
+ 0
+ Feature Node
+ N/A
+ 3188641.028032116
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13737.0","main.cluster index_upperinput":"13737.0"}
+ 13737
+ 16.6026
+ -1
+ This Node is a Singleton
+ N/A
+ 905.4157
+ N/A
+ 0.0
+ 453.2079
+
+
+ 17
+ 0.8093520000000001
+ CCMSLIB00003134993
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134993
+ InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17+,18-/m0/s1
+ 0
+ qTof
+ InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17+,18-/m0/s1
+ 0.0
+ Spectral Match to Phytosphingosine from NIST14
+ CCCCCCCCCCCCCC[C@H]([C@H]([C@H](CO)N)O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134993
+ 80
+ 0.671137
+ Feature Node
+ N/A
+ 17
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Phytosphingosine from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1201.0","main.cluster index_upperinput":"1201.0"}
+ 0.671137
+ 3
+ CCCCCCCCCCCCCC[C@H]([C@H]([C@H](CO)N)O)O
+ Data from Wolfender/Litaudon
+ 3
+ 318.3002
+ CCMSLIB00003134993
+ 318.3002
+ 0.0
+ Data from Wolfender/Litaudon
+ 6726891.828490719
+ qTof
+ Isolated
+ 0.000213623
+ M+H
+ N/A
+ ESI
+ Positive
+ 25.8315
+ 9
+ 0.8093520000000001
+ 0.0
+ Isolated
+ 1201
+ 0.000213623
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=80&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 25.8315
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.4269
+ 2
+ 0
+ Feature Node
+ N/A
+ 22375.50644502794
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5414.0","main.cluster index_upperinput":"5414.0"}
+ 5414
+ 19.4269
+ 137
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=137&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 559.1951
+ N/A
+ 0.0
+ 559.1951
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9414
+ 6
+ 0
+ Feature Node
+ N/A
+ 1645409.6360419078
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1954.0","main.cluster index_upperinput":"1954.0"}
+ 1954
+ 16.9414
+ -1
+ This Node is a Singleton
+ N/A
+ 401.1586
+ N/A
+ 0.0
+ 401.1586
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.1645
+ 5
+ 0
+ Feature Node
+ N/A
+ 995359.8572263932
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2541.0","main.cluster index_upperinput":"2541.0"}
+ 2541
+ 13.1645
+ -1
+ This Node is a Singleton
+ N/A
+ 464.2278
+ N/A
+ 0.0
+ 464.2278
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2532
+ 4
+ 0
+ Feature Node
+ N/A
+ 319758.70394855225
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2678.0","main.cluster index_upperinput":"2678.0"}
+ 2678
+ 23.2532
+ -1
+ This Node is a Singleton
+ N/A
+ 760.3316
+ N/A
+ 0.0
+ 760.3316
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.6571
+ 5
+ 0
+ Feature Node
+ N/A
+ 10815739.532277834
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1164.0","main.cluster index_upperinput":"1164.0"}
+ 1164
+ 16.6571
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 426.2486
+ N/A
+ 0.0
+ 426.2486
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.3345
+ 6
+ 0
+ Feature Node
+ N/A
+ 666568.4729110928
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4334.0","main.cluster index_upperinput":"4334.0"}
+ 4334
+ 10.3345
+ 38
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 193.0495
+ N/A
+ 0.0
+ 193.0495
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9288
+ 5
+ 0
+ Feature Node
+ N/A
+ 209513.23934563954
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3675.0","main.cluster index_upperinput":"3675.0"}
+ 3675
+ 19.9288
+ 37
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 567.2698
+ N/A
+ 0.0
+ 567.2698
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.2659
+ 6
+ 0
+ Feature Node
+ N/A
+ 9961733.739554685
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2513.0","main.cluster index_upperinput":"2513.0"}
+ 2513
+ 21.2659
+ 34
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 809.352
+ N/A
+ 0.0
+ 809.352
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.7223
+ 8
+ 0
+ Feature Node
+ N/A
+ 6526776.047611578
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2726.0","main.cluster index_upperinput":"2726.0"}
+ 2726
+ 32.7223
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 612.5031
+ N/A
+ 0.0
+ 612.5031
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.358
+ 5
+ 0
+ Feature Node
+ N/A
+ 8543954.560071927
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1297.0","main.cluster index_upperinput":"1297.0"}
+ 1297
+ 22.358
+ 9
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=9&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 376.2593
+ N/A
+ 0.0
+ 376.2593
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.6411
+ 7
+ 0
+ Feature Node
+ N/A
+ 8204935.198247491
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4546.0","main.cluster index_upperinput":"4546.0"}
+ 4546
+ 11.6411
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 197.117
+ N/A
+ 0.0
+ 197.117
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.5276
+ 3
+ 0
+ Feature Node
+ N/A
+ 1649564.1312077802
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13777.0","main.cluster index_upperinput":"13777.0"}
+ 13777
+ 15.5276
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 582.2568
+ N/A
+ 0.0
+ 582.2568
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.9021
+ 4
+ 0
+ Feature Node
+ N/A
+ 741533.258466238
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1307.0","main.cluster index_upperinput":"1307.0"}
+ 1307
+ 12.9021
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 426.2478
+ N/A
+ 0.0
+ 426.2478
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6519
+ 1
+ 0
+ Feature Node
+ N/A
+ 978485.4853071215
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7678.0","main.cluster index_upperinput":"7678.0"}
+ 7678
+ 25.6519
+ 125
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=125&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 713.2216
+ N/A
+ 0.0
+ 713.2216
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.068
+ 7
+ 0
+ Feature Node
+ N/A
+ 1608779.9360603692
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"25587.0","main.cluster index_upperinput":"25587.0"}
+ 25587
+ 35.068
+ -1
+ This Node is a Singleton
+ N/A
+ 613.48
+ N/A
+ 0.0
+ 613.48
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6003
+ 7
+ 0
+ Feature Node
+ N/A
+ 79167996.215047
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3700.0","main.cluster index_upperinput":"3700.0"}
+ 3700
+ 32.6003
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 311.3123
+ N/A
+ 0.0
+ 311.3123
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9236
+ 4
+ 0
+ Feature Node
+ N/A
+ 1233575.6815463016
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"25.0","main.cluster index_upperinput":"25.0"}
+ 25
+ 0.9236
+ 88
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 134.9562
+ N/A
+ 0.0
+ 134.9562
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.4991
+ 1
+ 0
+ Feature Node
+ N/A
+ 1893273.5448573981
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7650.0","main.cluster index_upperinput":"7650.0"}
+ 7650
+ 21.4991
+ -1
+ This Node is a Singleton
+ N/A
+ 407.1237
+ N/A
+ 0.0
+ 407.1237
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6928
+ 5
+ 0
+ Feature Node
+ N/A
+ 5407660.164732529
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3770.0","main.cluster index_upperinput":"3770.0"}
+ 3770
+ 25.6928
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 364.3207
+ N/A
+ 0.0
+ 364.3207
+
+
+ 6
+ 0.817516
+ CCMSLIB00004706475
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004706475
+ InChI=1S/C27H30O15/c1-9-17(32)20(35)21(36)26(38-9)41-24-18(33)15(8-28)40-27(22(24)37)42-25-19(34)16-13(31)6-12(30)7-14(16)39-23(25)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,24,26-33,35-37H,8H2,1H3/t9-,15+,17-,18+,20+,21+,22+,24-,26-,27-/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H30O15/c1-9-17(32)20(35)21(36)26(38-9)41-24-18(33)15(8-28)40-27(22(24)37)42-25-19(34)16-13(31)6-12(30)7-14(16)39-23(25)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,24,26-33,35-37H,8H2,1H3/t9-,15+,17-,18+,20+,21+,22+,24-,26-,27-/m0/s1
+ 0.0
+ 3-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004706475
+ 8
+ 0.102551
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF015412
+ 3-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ positive
+ MoNA:VF-NPL-QEHF015412
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7751.0","main.cluster index_upperinput":"7751.0"}
+ 0.102551
+ 3
+ N/A
+ MoNA
+ 3
+ 595.1661
+ CCMSLIB00004706475
+ 595.1661
+ 0.0
+ MoNA
+ 1403008.89923215
+ ESI-QFT
+ isolated
+ 6.10352e-05
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 14.6236
+ 4
+ 0.817516
+ 0.0
+ isolated
+ 7751
+ 6.10352e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.6236
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6702
+ 1
+ 0
+ Feature Node
+ N/A
+ 355940.8376845406
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1296.0","main.cluster index_upperinput":"1296.0"}
+ 1296
+ 17.6702
+ -1
+ This Node is a Singleton
+ N/A
+ 332.1318
+ N/A
+ 0.0
+ 332.1318
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.4992
+ 5
+ 0
+ Feature Node
+ N/A
+ 16179522.597552754
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1967.0","main.cluster index_upperinput":"1967.0"}
+ 1967
+ 14.4992
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2429
+ N/A
+ 0.0
+ 478.2429
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.2594
+ 9
+ 0
+ Feature Node
+ N/A
+ 2108652.3930513016
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1256.0","main.cluster index_upperinput":"1256.0"}
+ 1256
+ 25.2594
+ -1
+ This Node is a Singleton
+ N/A
+ 355.2452
+ N/A
+ 0.0
+ 355.2452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.3877
+ 5
+ 0
+ Feature Node
+ N/A
+ 7239473.826819501
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13637.0","main.cluster index_upperinput":"13637.0"}
+ 13637
+ 14.3877
+ 35
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=35&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 573.1945
+ N/A
+ 0.0
+ 573.1945
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3671
+ 5
+ 0
+ Feature Node
+ N/A
+ 9667652.848631147
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1270.0","main.cluster index_upperinput":"1270.0"}
+ 1270
+ 22.3671
+ 9
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=9&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 393.2859
+ N/A
+ 0.0
+ 393.2859
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.9502
+ 7
+ 0
+ Feature Node
+ N/A
+ 1679802.625915169
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4987.0","main.cluster index_upperinput":"4987.0"}
+ 4987
+ 12.9502
+ -1
+ This Node is a Singleton
+ N/A
+ 401.157
+ N/A
+ 0.0
+ 401.157
+
+
+ 44
+ 0.876872
+ CCMSLIB00003138418
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138418
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to Monolinolenin (9c,12c,15c) from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138418
+ 11
+ 4.578469999999999
+ Feature Node
+ N/A
+ 44
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Monolinolenin (9c,12c,15c) from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7731.0","main.cluster index_upperinput":"7731.0"}
+ 4.578469999999999
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 353.2674
+ CCMSLIB00003138418
+ 353.2674
+ 0.0
+ Data from Wolfender/Litaudon
+ 25938389.320386942
+ HCD
+ Isolated
+ 0.00161743
+ M+H
+ N/A
+ ESI
+ Positive
+ 30.3973
+ 9
+ 0.876872
+ 0.0
+ Isolated
+ 7731
+ 0.00161743
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 30.3973
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.8955
+ 7
+ 0
+ Feature Node
+ N/A
+ 5637365.989495093
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1417.0","main.cluster index_upperinput":"1417.0"}
+ 1417
+ 24.8955
+ -1
+ This Node is a Singleton
+ N/A
+ 478.3374
+ N/A
+ 0.0
+ 478.3374
+
+
+ 6
+ 0.793813
+ CCMSLIB00005724039
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005724039
+
+ 0
+ qTof
+
+ 0.0
+ Aminobacteriohopanetriol
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005724039
+ -1
+ 2.01035
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ AMarshall
+ Aminobacteriohopanetriol
+ Positive
+ AMarshall
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4563.0","main.cluster index_upperinput":"4563.0"}
+ 2.01035
+ 3
+
+ ECarlson
+ 3
+ 546.4881
+ CCMSLIB00005724039
+ 546.4881
+ 0.0
+ ECarlson
+ 6951383.034211076
+ qTof
+ Crude
+ 0.00109863
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 31.0883
+ 7
+ 0.793813
+ 0.0
+ Crude
+ 4563
+ 0.00109863
+ This Node is a Singleton
+ 31.0883
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.7844
+ 5
+ 0
+ Feature Node
+ N/A
+ 1062059.4863244041
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"26810.0","main.cluster index_upperinput":"26810.0"}
+ 26810
+ 3.7844
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 368.2065
+ N/A
+ 0.0
+ 368.2065
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.9358
+ 9
+ 0
+ Feature Node
+ N/A
+ 20598863.270406745
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1188.0","main.cluster index_upperinput":"1188.0"}
+ 1188
+ 29.9358
+ -1
+ This Node is a Singleton
+ N/A
+ 333.2398
+ N/A
+ 0.0
+ 333.2398
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.0769
+ 6
+ 0
+ Feature Node
+ N/A
+ 3027539.8041400616
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2682.0","main.cluster index_upperinput":"2682.0"}
+ 2682
+ 30.0769
+ -1
+ This Node is a Singleton
+ N/A
+ 651.4595
+ N/A
+ 0.0
+ 651.4595
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.9478
+ 6
+ 0
+ Feature Node
+ N/A
+ 1552712.6328308177
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4622.0","main.cluster index_upperinput":"4622.0"}
+ 4622
+ 15.9478
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 331.1535
+ N/A
+ 0.0
+ 331.1535
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.9551
+ 6
+ 0
+ Feature Node
+ N/A
+ 2597322.8055982315
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2486.0","main.cluster index_upperinput":"2486.0"}
+ 2486
+ 15.9551
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 510.2689
+ N/A
+ 0.0
+ 510.2689
+
+
+ 6
+ 0.7844810000000001
+ CCMSLIB00000081737
+ N/A
+ DI-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000081737
+ InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3
+ 0
+ qTof
+ InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3
+ 0.0
+ Quercetin 3,7-dimethyl ether
+ OC1=C(O)C=C(C2=C(OC)C(C3=C(O)C=C(OC)C=C3O2)=O)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000081737
+ 32
+ 16.0388
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Gobbo Neto
+ Quercetin 3,7-dimethyl ether
+ Positive
+ Gobbo Neto
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7774.0","main.cluster index_upperinput":"7774.0"}
+ 16.0388
+ 3
+ OC1=C(O)C=C(C2=C(OC)C(C3=C(O)C=C(OC)C=C3O2)=O)C=C1
+ Norberto Lopes
+ 3
+ 331.0813
+ CCMSLIB00000081737
+ 331.0813
+ 0.0
+ Norberto Lopes
+ 1490311.7783124517
+ qTof
+ Isolated
+ 0.00531006
+ M+H
+ N/A
+ DI-ESI
+ Positive
+ 16.4649
+ 3
+ 0.7844810000000001
+ 0.0
+ Isolated
+ 7774
+ 0.00531006
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.4649
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.9579
+ 3
+ 0
+ Feature Node
+ N/A
+ 414929.0471389856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2558.0","main.cluster index_upperinput":"2558.0"}
+ 2558
+ 23.9579
+ -1
+ This Node is a Singleton
+ N/A
+ 369.1673
+ N/A
+ 0.0
+ 369.1673
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.6868
+ 3
+ 0
+ Feature Node
+ N/A
+ 903081.2263049826
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13806.0","main.cluster index_upperinput":"13806.0"}
+ 13806
+ 21.6868
+ -1
+ This Node is a Singleton
+ N/A
+ 433.1835
+ N/A
+ 0.0
+ 433.1835
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.2513
+ 9
+ 0
+ Feature Node
+ N/A
+ 3093211.6042451914
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3804.0","main.cluster index_upperinput":"3804.0"}
+ 3804
+ 31.2513
+ -1
+ This Node is a Singleton
+ N/A
+ 541.3721
+ N/A
+ 0.0
+ 541.3721
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7032
+ 6
+ 0
+ Feature Node
+ N/A
+ 3704244.759637276
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1223.0","main.cluster index_upperinput":"1223.0"}
+ 1223
+ 17.7032
+ 103
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=103&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2483
+ N/A
+ 0.0
+ 462.2483
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.7689
+ 2
+ 0
+ Feature Node
+ N/A
+ 1157828.6897580242
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10301.0","main.cluster index_upperinput":"10301.0"}
+ 10301
+ 8.7689
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 382.2215
+ N/A
+ 0.0
+ 382.2215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.6559
+ 7
+ 0
+ Feature Node
+ N/A
+ 342060.5246044051
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10608.0","main.cluster index_upperinput":"10608.0"}
+ 10608
+ 20.6559
+ -1
+ This Node is a Singleton
+ N/A
+ 407.2043
+ N/A
+ 0.0
+ 407.2043
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.1238
+ 6
+ 0
+ Feature Node
+ N/A
+ 813126.7204450044
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7715.0","main.cluster index_upperinput":"7715.0"}
+ 7715
+ 31.1238
+ -1
+ This Node is a Singleton
+ N/A
+ 511.3745
+ N/A
+ 0.0
+ 511.3745
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.3398
+ 5
+ 0
+ Feature Node
+ N/A
+ 2501149.9867495717
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"70.0","main.cluster index_upperinput":"70.0"}
+ 70
+ 35.3398
+ -1
+ This Node is a Singleton
+ N/A
+ 469.3654
+ N/A
+ 0.0
+ 469.3654
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1118
+ 3
+ 0
+ Feature Node
+ N/A
+ 443645.41711594426
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3571.0","main.cluster index_upperinput":"3571.0"}
+ 3571
+ 19.1118
+ -1
+ This Node is a Singleton
+ N/A
+ 543.1111
+ N/A
+ 0.0
+ 543.1111
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.0884
+ 6
+ 0
+ Feature Node
+ N/A
+ 1351569.1633841472
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1505.0","main.cluster index_upperinput":"1505.0"}
+ 1505
+ 3.0884
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 336.2165
+ N/A
+ 0.0
+ 336.2165
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2183
+ 9
+ 0
+ Feature Node
+ N/A
+ 36803762.31630709
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1185.0","main.cluster index_upperinput":"1185.0"}
+ 1185
+ 33.2183
+ -1
+ This Node is a Singleton
+ N/A
+ 315.2295
+ N/A
+ 0.0
+ 315.2295
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.3795
+ 4
+ 0
+ Feature Node
+ N/A
+ 854247.8285742884
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13972.0","main.cluster index_upperinput":"13972.0"}
+ 13972
+ 19.3795
+ -1
+ This Node is a Singleton
+ N/A
+ 486.3269
+ N/A
+ 0.0
+ 486.3269
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.6522
+ 5
+ 0
+ Feature Node
+ N/A
+ 733297.7244499301
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5168.0","main.cluster index_upperinput":"5168.0"}
+ 5168
+ 6.6522
+ 3
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 354.1911
+ N/A
+ 0.0
+ 354.1911
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.803
+ 7
+ 0
+ Feature Node
+ N/A
+ 3356661.4701652788
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7767.0","main.cluster index_upperinput":"7767.0"}
+ 7767
+ 21.803
+ 32
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 331.0813
+ N/A
+ 0.0
+ 331.0813
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.5993
+ 8
+ 0
+ Feature Node
+ N/A
+ 23656414.003031906
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1653.0","main.cluster index_upperinput":"1653.0"}
+ 1653
+ 30.5993
+ 15
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 438.3791
+ N/A
+ 0.0
+ 438.3791
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.4207
+ 3
+ 0
+ Feature Node
+ N/A
+ 103114778.12487909
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7710.0","main.cluster index_upperinput":"7710.0"}
+ 7710
+ 2.4207
+ 104
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=104&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 577.2749
+ N/A
+ 0.0
+ 577.2749
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.3464
+ 5
+ 0
+ Feature Node
+ N/A
+ 3945604.6216868428
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2487.0","main.cluster index_upperinput":"2487.0"}
+ 2487
+ 19.3464
+ 81
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 380.2071
+ N/A
+ 0.0
+ 380.2071
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.5739
+ 7
+ 0
+ Feature Node
+ N/A
+ 4097931.75506004
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3674.0","main.cluster index_upperinput":"3674.0"}
+ 3674
+ 4.5739
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 368.2066
+ N/A
+ 0.0
+ 368.2066
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4467
+ 6
+ 0
+ Feature Node
+ N/A
+ 2539573.2604580563
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7882.0","main.cluster index_upperinput":"7882.0"}
+ 7882
+ 33.4467
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 432.3684
+ N/A
+ 0.0
+ 432.3684
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9515
+ 3
+ 0
+ Feature Node
+ N/A
+ 26850131.026373304
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7620.0","main.cluster index_upperinput":"7620.0"}
+ 7620
+ 14.9515
+ 11
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 416.1486
+ N/A
+ 0.0
+ 416.1486
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.1249
+ 3
+ 0
+ Feature Node
+ N/A
+ 659679.68837183
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7881.0","main.cluster index_upperinput":"7881.0"}
+ 7881
+ 9.1249
+ -1
+ This Node is a Singleton
+ N/A
+ 536.2036
+ N/A
+ 0.0
+ 536.2036
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.3692
+ 2
+ 0
+ Feature Node
+ N/A
+ 462832.78886316693
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10333.0","main.cluster index_upperinput":"10333.0"}
+ 10333
+ 15.3692
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 480.2572
+ N/A
+ 0.0
+ 480.2572
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.7739
+ 7
+ 0
+ Feature Node
+ N/A
+ 4039107.807104065
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"66.0","main.cluster index_upperinput":"66.0"}
+ 66
+ 34.7739
+ 65
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=65&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 463.3775
+ N/A
+ 0.0
+ 463.3775
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.6028
+ 9
+ 0
+ Feature Node
+ N/A
+ 6453017.313569223
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4527.0","main.cluster index_upperinput":"4527.0"}
+ 4527
+ 22.6028
+ -1
+ This Node is a Singleton
+ N/A
+ 351.2144
+ N/A
+ 0.0
+ 351.2144
+
+
+ 5304
+ 4537
+ 30.01249999999999
+ 5304
+ 0.7344144520464302
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7344144520464302
+
+
+ 5304
+ 4581
+ -21.98320000000001
+ 5304
+ 0.7709442303346912
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7709442303346912
+
+
+ 5304
+ 1967
+ 30.012
+ 5304
+ 0.7353733016999827
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7353733016999827
+
+
+ 5304
+ 1555
+ 30.012599999999964
+ 5304
+ 0.7480948695933904
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7480948695933904
+
+
+ 5304
+ 2651
+ -68.02420000000001
+ 5304
+ 0.749614292792464
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.749614292792464
+
+
+ 4748
+ 2753
+ -0.001099999999951251
+ 4748
+ 0.8204940194451813
+ 4748.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8204940194451813
+
+
+ 2753
+ 1182
+ 14.0154
+ 2753
+ 0.8918886163415309
+ 2753.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8918886163415309
+
+
+ 4519
+ 2753
+ 13.979100000000017
+ 4519
+ 0.8183387963054145
+ 4519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8183387963054145
+
+
+ 1405
+ 28
+ 29.063500000000033
+ 1405
+ 0.7022474111030708
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7022474111030708
+
+
+ 2632
+ 28
+ -38.99939999999998
+ 2632
+ 0.7213324806314514
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7213324806314514
+
+
+ 2656
+ 28
+ 13.032500000000027
+ 2656
+ 0.7979632908778675
+ 2656.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7979632908778675
+
+
+ 4503
+ 3534
+ -0.0008000000000265572
+ 4503
+ 0.8448660601832343
+ 4503.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8448660601832343
+
+
+ 4536
+ 4503
+ 162.05270000000002
+ 4536
+ 0.7016558603828067
+ 4536.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7016558603828067
+
+
+ 2121
+ 38
+ -34.00619999999998
+ 2121
+ 0.715891953921592
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.715891953921592
+
+
+ 2666
+ 2121
+ -11.999600000000044
+ 2666
+ 0.7182680466550031
+ 2666.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7182680466550031
+
+
+ 2121
+ 11
+ -31.989599999999996
+ 2121
+ 0.773780667202226
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.773780667202226
+
+
+ 2121
+ 284
+ -19.989599999999996
+ 2121
+ 0.7086509031950268
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7086509031950268
+
+
+ 2121
+ 311
+ -3.996099999999956
+ 2121
+ 0.7371743185974848
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7371743185974848
+
+
+ 2121
+ 1547
+ -74.08849999999995
+ 2121
+ 0.7135389090967328
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7135389090967328
+
+
+ 2121
+ 1947
+ -2.01419999999996
+ 2121
+ 0.707424531038481
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.707424531038481
+
+
+ 2493
+ 2121
+ 31.989299999999957
+ 2493
+ 0.7435587260240298
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7435587260240298
+
+
+ 2575
+ 2121
+ 19.98879999999997
+ 2575
+ 0.7469756502393592
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7469756502393592
+
+
+ 2644
+ 2121
+ -265.0298000000001
+ 2644
+ 0.7124412375964764
+ 2644.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7124412375964764
+
+
+ 2956
+ 2121
+ -12.00120000000004
+ 2956
+ 0.8338778216676173
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8338778216676173
+
+
+ 3122
+ 2121
+ -12.000300000000038
+ 3122
+ 0.814911173387197
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.814911173387197
+
+
+ 3667
+ 2121
+ -102.97800000000001
+ 3667
+ 0.7576906197877284
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7576906197877284
+
+
+ 3771
+ 2121
+ -12.00120000000004
+ 3771
+ 0.8206134372281456
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8206134372281456
+
+
+ 4539
+ 2121
+ 34.00559999999996
+ 4539
+ 0.7131588092708339
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131588092708339
+
+
+ 10446
+ 2121
+ 6.0101999999999975
+ 10446
+ 0.7187331176677412
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7187331176677412
+
+
+ 22481
+ 2121
+ 19.98939999999999
+ 22481
+ 0.7898804535681174
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7898804535681174
+
+
+ 3602
+ 3546
+ -30.01030000000003
+ 3602
+ 0.7985464255994978
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7985464255994978
+
+
+ 3602
+ 2692
+ 73.0195
+ 3602
+ 0.7349970377187728
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7349970377187728
+
+
+ 7732
+ 3602
+ -73.95669999999996
+ 7732
+ 0.7787348005769381
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7787348005769381
+
+
+ 4537
+ 3602
+ -36.00029999999998
+ 4537
+ 0.7530586718810084
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7530586718810084
+
+
+ 3602
+ 1322
+ -30.010700000000043
+ 3602
+ 0.8652391427617447
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8652391427617447
+
+
+ 4581
+ 3602
+ 15.995400000000018
+ 4581
+ 0.8018179626488671
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8018179626488671
+
+
+ 4603
+ 3602
+ 12.000400000000013
+ 4603
+ 0.7159604528971741
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7159604528971741
+
+
+ 3602
+ 1376
+ -44.026400000000024
+ 3602
+ 0.765652584880001
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765652584880001
+
+
+ 4500
+ 3602
+ 15.994700000000023
+ 4500
+ 0.8315600697016436
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8315600697016436
+
+
+ 7811
+ 3602
+ -3.973099999999988
+ 7811
+ 0.7822858393694567
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7822858393694567
+
+
+ 3602
+ 1164
+ -15.994500000000016
+ 3602
+ 0.8276067727743148
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8276067727743148
+
+
+ 3602
+ 1967
+ 35.99979999999999
+ 3602
+ 0.7473944258766461
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7473944258766461
+
+
+ 4505
+ 3602
+ -94.00569999999993
+ 4505
+ 0.7901933139922511
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7901933139922511
+
+
+ 3901
+ 3602
+ -78.01149999999996
+ 3901
+ 0.7319785641553663
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7319785641553663
+
+
+ 3602
+ 1307
+ -15.995300000000043
+ 3602
+ 0.8367714867162924
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367714867162924
+
+
+ 8341
+ 3602
+ -33.98429999999996
+ 8341
+ 0.7283969191852452
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7283969191852452
+
+
+ 3602
+ 1361
+ 58.13029999999998
+ 3602
+ 0.8173617371707375
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8173617371707375
+
+
+ 4587
+ 3602
+ -126.03229999999996
+ 4587
+ 0.7508417973727177
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7508417973727177
+
+
+ 15800
+ 3602
+ 14.015600000000006
+ 15800
+ 0.7911426964658828
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7911426964658828
+
+
+ 4452
+ 3602
+ 0.0002000000000066393
+ 4452
+ 0.7656196965925893
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7656196965925893
+
+
+ 7795
+ 3602
+ -72.1454
+ 7795
+ 0.8041297132580842
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8041297132580842
+
+
+ 3602
+ 2544
+ 82.04200000000003
+ 3602
+ 0.7373155525962454
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7373155525962454
+
+
+ 4549
+ 3602
+ -84.02059999999994
+ 4549
+ 0.75565519404953
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.75565519404953
+
+
+ 3602
+ 1173
+ 51.99509999999998
+ 3602
+ 0.7381882236695442
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7381882236695442
+
+
+ 3766
+ 3602
+ 14.015800000000013
+ 3766
+ 0.8460905928259282
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8460905928259282
+
+
+ 26406
+ 3602
+ -53.9751
+ 26406
+ 0.8350216906245809
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8350216906245809
+
+
+ 11220
+ 3602
+ -19.97049999999996
+ 11220
+ 0.7387078332144256
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7387078332144256
+
+
+ 3602
+ 1391
+ -46.04200000000003
+ 3602
+ 0.8040962263396993
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8040962263396993
+
+
+ 3602
+ 1240
+ 84.02080000000001
+ 3602
+ 0.7326416456606066
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7326416456606066
+
+
+ 13633
+ 3602
+ -19.968999999999994
+ 13633
+ 0.8028427979587769
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8028427979587769
+
+
+ 4680
+ 3602
+ -114.03160000000003
+ 4680
+ 0.8174858307021338
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8174858307021338
+
+
+ 7663
+ 3602
+ 30.046600000000012
+ 7663
+ 0.8059331725037213
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8059331725037213
+
+
+ 3602
+ 1449
+ 220.1834
+ 3602
+ 0.7612844474722413
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7612844474722413
+
+
+ 7741
+ 3602
+ -37.984099999999955
+ 7741
+ 0.7585643694755902
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7585643694755902
+
+
+ 7665
+ 3602
+ -55.946199999999976
+ 7665
+ 0.813628047161999
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.813628047161999
+
+
+ 3602
+ 1296
+ -110.11130000000003
+ 3602
+ 0.7785635665712465
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785635665712465
+
+
+ 3602
+ 1176
+ 94.00569999999993
+ 3602
+ 0.7646671945046897
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7646671945046897
+
+
+ 10432
+ 3602
+ 2.0153000000000247
+ 10432
+ 0.807623339502634
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.807623339502634
+
+
+ 3602
+ 2486
+ 68.02579999999995
+ 3602
+ 0.7557720827692351
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7557720827692351
+
+
+ 13590
+ 3602
+ -19.96969999999999
+ 13590
+ 0.7785143573206562
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785143573206562
+
+
+ 4561
+ 3602
+ -78.01149999999996
+ 4561
+ 0.7785887655572539
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785887655572539
+
+
+ 3602
+ 1335
+ 72.1454
+ 3602
+ 0.7765906610866784
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765906610866784
+
+
+ 3602
+ 2651
+ -62.036400000000015
+ 3602
+ 0.8060747729664385
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8060747729664385
+
+
+ 4524
+ 3602
+ 30.010800000000017
+ 4524
+ 0.8697149380399049
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8697149380399049
+
+
+ 4661
+ 3602
+ -70.00599999999997
+ 4661
+ 0.8084880862988078
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8084880862988078
+
+
+ 5505
+ 3602
+ -98.03639999999996
+ 5505
+ 0.7531784820932602
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7531784820932602
+
+
+ 7664
+ 3602
+ 64.05190000000005
+ 7664
+ 0.7756918955625833
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7756918955625833
+
+
+ 8321
+ 3602
+ -36.00029999999998
+ 8321
+ 0.7735948576777987
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7735948576777987
+
+
+ 20868
+ 3602
+ 12.079200000000014
+ 20868
+ 0.8047357193112071
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8047357193112071
+
+
+ 26328
+ 3602
+ 12.000500000000045
+ 26328
+ 0.7485283835876764
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7485283835876764
+
+
+ 5175
+ 5172
+ 0.00019999999999242846
+ 5175
+ 1.0000000000000002
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11101
+ 5172
+ -0.00030000000000995897
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11306
+ 5172
+ -0.0002000000000066393
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11368
+ 5172
+ -0.00010000000000331966
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5172
+ 4995
+ 0.00010000000000331966
+ 5172
+ 1.0000000000000002
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5172
+ 208
+ 57.013300000000015
+ 5172
+ 0.7720262431782003
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 11531
+ 5172
+ -0.00010000000000331966
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11194
+ 5172
+ -0.00030000000000995897
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 5172
+ 25
+ 50.0111
+ 5172
+ 0.7765014360319091
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 5172
+ 4637
+ 14.015900000000002
+ 5172
+ 0.7465660405620628
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 5172
+ 5078
+ 0.00010000000000331966
+ 5172
+ 1.0000000000000002
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5172
+ 5148
+ 0.00010000000000331966
+ 5172
+ 1.0000000000000002
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5194
+ 5172
+ 0.0
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5233
+ 5172
+ 0.00010000000000331966
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11270
+ 5172
+ -0.0002000000000066393
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11321
+ 5172
+ -0.0002000000000066393
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 11346
+ 5172
+ -0.00030000000000995897
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11652
+ 5172
+ 0.00019999999999242846
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 27744
+ 7665
+ 1.9703000000000088
+ 27744
+ 0.7215513523947923
+ 27744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7215513523947923
+
+
+ 1297
+ 81
+ 17.027199999999993
+ 1297
+ 0.8043731510806602
+ 1297.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8043731510806602
+
+
+ 103
+ 81
+ 17.026700000000005
+ 103
+ 0.767833132696352
+ 103.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.767833132696352
+
+
+ 1270
+ 81
+ 0.0005999999999630745
+ 1270
+ 0.8794548674300747
+ 1270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8794548674300747
+
+
+ 2946
+ 2842
+ 0.00010000000003174137
+ 2946
+ 0.7365359880841337
+ 2946.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7365359880841337
+
+
+ 5084
+ 2528
+ 0.00010000000000331966
+ 5084
+ 0.8285334913215109
+ 5084.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8285334913215109
+
+
+ 5090
+ 243
+ 0.00010000000003174137
+ 5090
+ 1.0
+ 5090.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 18086
+ 5046
+ 0.0004999999999881766
+ 18086
+ 1.0
+ 18086.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 3026
+ 1221
+ -74.03559999999999
+ 3026
+ 0.7656581721414648
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7656581721414648
+
+
+ 10964
+ 3026
+ 0.9461999999999762
+ 10964
+ 0.7046110636144964
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7046110636144964
+
+
+ 3026
+ 914
+ -88.05079999999998
+ 3026
+ 0.7212610527029386
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7212610527029386
+
+
+ 3026
+ 1234
+ -74.03590000000003
+ 3026
+ 0.7480613906195074
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7480613906195074
+
+
+ 3026
+ 1419
+ -25.977599999999995
+ 3026
+ 0.7898130712808873
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7898130712808873
+
+
+ 3026
+ 343
+ -88.05079999999998
+ 3026
+ 0.7418153348902734
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7418153348902734
+
+
+ 3026
+ 1405
+ -58.00400000000002
+ 3026
+ 0.7403268109935597
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7403268109935597
+
+
+ 7731
+ 3026
+ 14.015199999999993
+ 7731
+ 0.7110382290764712
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7110382290764712
+
+
+ 3026
+ 1547
+ -11.99939999999998
+ 3026
+ 0.8246942180329755
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8246942180329755
+
+
+ 3026
+ 1220
+ -74.03559999999999
+ 3026
+ 0.717339101887424
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.717339101887424
+
+
+ 1206
+ 208
+ -19.030999999999977
+ 1206
+ 0.8516239373079879
+ 1206.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8516239373079879
+
+
+ 1206
+ 25
+ -26.033199999999994
+ 1206
+ 0.8021791482364236
+ 1206.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8021791482364236
+
+
+ 4637
+ 1206
+ 62.02839999999999
+ 4637
+ 0.7671475246064894
+ 4637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7671475246064894
+
+
+ 22481
+ 11
+ -12.000200000000007
+ 22481
+ 0.7117852294237987
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7117852294237987
+
+
+ 22481
+ 284
+ -0.0002000000000066393
+ 22481
+ 0.83507174349074
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.83507174349074
+
+
+ 22481
+ 311
+ 15.993300000000033
+ 22481
+ 0.7141981870664138
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7141981870664138
+
+
+ 22481
+ 1547
+ -54.099099999999964
+ 22481
+ 0.7598623189403694
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7598623189403694
+
+
+ 22481
+ 2493
+ -11.999899999999968
+ 22481
+ 0.7131831039629489
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131831039629489
+
+
+ 22481
+ 2575
+ 0.0006000000000199179
+ 22481
+ 0.9014871128968096
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9014871128968096
+
+
+ 22481
+ 2632
+ -32.04079999999999
+ 22481
+ 0.7075182285879547
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7075182285879547
+
+
+ 22481
+ 2956
+ 31.99060000000003
+ 22481
+ 0.7961935028838072
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7961935028838072
+
+
+ 22481
+ 3122
+ 31.989700000000028
+ 22481
+ 0.720104678294849
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.720104678294849
+
+
+ 22481
+ 3667
+ 122.9674
+ 22481
+ 0.7429403695993747
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7429403695993747
+
+
+ 22481
+ 3771
+ 31.99060000000003
+ 22481
+ 0.7952370556969728
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7952370556969728
+
+
+ 22481
+ 4539
+ -14.01619999999997
+ 22481
+ 0.7034516013595979
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7034516013595979
+
+
+ 22481
+ 7731
+ -56.11489999999998
+ 22481
+ 0.7322124168190203
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7322124168190203
+
+
+ 22481
+ 10446
+ 13.979199999999992
+ 22481
+ 0.8883701398963231
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8883701398963231
+
+
+ 1419
+ 1184
+ -25.020399999999995
+ 1419
+ 0.704156815818768
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.704156815818768
+
+
+ 1201
+ 1184
+ -2.0156000000000063
+ 1201
+ 0.8079753208225399
+ 1201.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8079753208225399
+
+
+ 2519
+ 1574
+ -88.05140000000006
+ 2519
+ 0.8986601742934771
+ 2519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8986601742934771
+
+
+ 1610
+ 1574
+ -18.009700000000066
+ 1610
+ 0.713530538396776
+ 1610.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.713530538396776
+
+
+ 1599
+ 1574
+ -44.025100000000066
+ 1599
+ 0.8741372470664268
+ 1599.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8741372470664268
+
+
+ 7882
+ 1574
+ 176.10539999999997
+ 7882
+ 0.7344341512901172
+ 7882.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7344341512901172
+
+
+ 3524
+ 2495
+ 112.12559999999996
+ 3524
+ 0.8239440208846887
+ 3524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8239440208846887
+
+
+ 10243
+ 2495
+ 112.1252
+ 10243
+ 0.8644149402252541
+ 10243.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8644149402252541
+
+
+ 9484
+ 3721
+ -32.02679999999998
+ 9484
+ 0.7772851018319281
+ 9484.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7772851018319281
+
+
+ 12784
+ 9484
+ 0.0001999999999497959
+ 12784
+ 0.9325281450932503
+ 12784.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9325281450932503
+
+
+ 9484
+ 3700
+ -32.02679999999998
+ 9484
+ 0.7772851018319281
+ 9484.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7772851018319281
+
+
+ 9484
+ 9385
+ -9.999999997489795e-05
+ 9484
+ 0.949656969954427
+ 9484.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.949656969954427
+
+
+ 7783
+ 3691
+ -0.005300000000033833
+ 7783
+ 0.7332277678406319
+ 7783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7332277678406319
+
+
+ 2087
+ 1300
+ 0.0
+ 2087
+ 0.7577200355370418
+ 2087.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7577200355370418
+
+
+ 2087
+ 1833
+ -9.999999997489795e-05
+ 2087
+ 0.7809809953373239
+ 2087.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7809809953373239
+
+
+ 2775
+ 2087
+ 0.0001999999999782176
+ 2775
+ 0.7865512955137142
+ 2775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7865512955137142
+
+
+ 7704
+ 2087
+ 0.0
+ 7704
+ 0.7131482618763827
+ 7704.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131482618763827
+
+
+ 20624
+ 2087
+ 0.0004999999999881766
+ 20624
+ 0.7188923080634381
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7188923080634381
+
+
+ 3695
+ 3546
+ 0.0362999999999829
+ 3695
+ 0.7594931247845949
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7594931247845949
+
+
+ 4537
+ 3695
+ -66.0469
+ 4537
+ 0.7474900347695507
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7474900347695507
+
+
+ 4581
+ 3695
+ -14.051199999999994
+ 4581
+ 0.7247769931745209
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7247769931745209
+
+
+ 3695
+ 1164
+ 14.052099999999996
+ 3695
+ 0.7611344679452916
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7611344679452916
+
+
+ 3695
+ 1967
+ 66.0464
+ 3695
+ 0.7450240656523828
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7450240656523828
+
+
+ 4505
+ 3695
+ -124.05229999999995
+ 4505
+ 0.7440808548110834
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7440808548110834
+
+
+ 3901
+ 3695
+ -108.05809999999997
+ 3901
+ 0.7230743583425419
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7230743583425419
+
+
+ 8341
+ 3695
+ -64.03089999999997
+ 8341
+ 0.7175588163536286
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7175588163536286
+
+
+ 3695
+ 1361
+ 88.17689999999999
+ 3695
+ 0.731487073396109
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.731487073396109
+
+
+ 4587
+ 3695
+ -156.07889999999998
+ 4587
+ 0.706447085218658
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.706447085218658
+
+
+ 15800
+ 3695
+ -16.031000000000006
+ 15800
+ 0.7384915981875756
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7384915981875756
+
+
+ 4549
+ 3695
+ -114.06719999999996
+ 4549
+ 0.7237593716818591
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7237593716818591
+
+
+ 3695
+ 1173
+ 82.04169999999999
+ 3695
+ 0.714123738218702
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.714123738218702
+
+
+ 3695
+ 1176
+ 124.05229999999995
+ 3695
+ 0.7205754330538594
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7205754330538594
+
+
+ 3695
+ 1391
+ -15.995400000000018
+ 3695
+ 0.780480313563672
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.780480313563672
+
+
+ 3695
+ 1555
+ 66.04699999999997
+ 3695
+ 0.7218531159722177
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218531159722177
+
+
+ 3695
+ 2651
+ -31.989800000000002
+ 3695
+ 0.7342227427741025
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7342227427741025
+
+
+ 4524
+ 3695
+ -0.035799999999994725
+ 4524
+ 0.7533797400122287
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7533797400122287
+
+
+ 4661
+ 3695
+ -100.05259999999998
+ 4661
+ 0.7400961071444431
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400961071444431
+
+
+ 7663
+ 3695
+ 0.0
+ 7663
+ 0.7650848089932543
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7650848089932543
+
+
+ 7664
+ 3695
+ 34.005300000000034
+ 7664
+ 0.7712080429316863
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7712080429316863
+
+
+ 10432
+ 3695
+ -28.031299999999987
+ 10432
+ 0.7101417699957217
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101417699957217
+
+
+ 11220
+ 3695
+ -50.01709999999997
+ 11220
+ 0.7228321366196182
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7228321366196182
+
+
+ 13590
+ 3695
+ -50.0163
+ 13590
+ 0.7514827293805988
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7514827293805988
+
+
+ 13633
+ 3695
+ -50.015600000000006
+ 13633
+ 0.7769157736841388
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7769157736841388
+
+
+ 20868
+ 3695
+ -17.967399999999998
+ 20868
+ 0.736670375381745
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.736670375381745
+
+
+ 1263
+ 1158
+ 27.995199999999954
+ 1263
+ 0.8670808822264087
+ 1263.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8670808822264087
+
+
+ 4516
+ 1263
+ 0.0012000000000398359
+ 4516
+ 0.8872880757667982
+ 4516.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8872880757667982
+
+
+ 4548
+ 1263
+ -132.04229999999995
+ 4548
+ 0.8184404598151797
+ 4548.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8184404598151797
+
+
+ 10297
+ 5391
+ -14.016300000000001
+ 10297
+ 0.7032473978230875
+ 10297.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7032473978230875
+
+
+ 11220
+ 3546
+ -49.98079999999999
+ 11220
+ 0.8047136156164197
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8047136156164197
+
+
+ 11220
+ 4537
+ 16.029800000000023
+ 11220
+ 0.7849124600594989
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7849124600594989
+
+
+ 11220
+ 1322
+ -49.9812
+ 11220
+ 0.741457963817032
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741457963817032
+
+
+ 11220
+ 4581
+ -35.965899999999976
+ 11220
+ 0.7205527910192036
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7205527910192036
+
+
+ 11220
+ 1376
+ -63.99689999999998
+ 11220
+ 0.7174897589780398
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7174897589780398
+
+
+ 11220
+ 4500
+ -35.96519999999998
+ 11220
+ 0.7754894255033702
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7754894255033702
+
+
+ 11220
+ 1164
+ -35.964999999999975
+ 11220
+ 0.7731868524671952
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7731868524671952
+
+
+ 11220
+ 1967
+ 16.029300000000035
+ 11220
+ 0.8030271188696427
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8030271188696427
+
+
+ 11220
+ 4505
+ 74.03519999999997
+ 11220
+ 0.7957405464998357
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7957405464998357
+
+
+ 13602
+ 11220
+ 15.996499999999969
+ 13602
+ 0.7133132859170419
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7133132859170419
+
+
+ 11220
+ 3901
+ 58.041
+ 11220
+ 0.7286249780507655
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7286249780507655
+
+
+ 11220
+ 1307
+ -35.9658
+ 11220
+ 0.7281238456256796
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7281238456256796
+
+
+ 11220
+ 8341
+ 14.013800000000003
+ 11220
+ 0.885983515317287
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.885983515317287
+
+
+ 11220
+ 4587
+ 106.0618
+ 11220
+ 0.7357933193155615
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7357933193155615
+
+
+ 15800
+ 11220
+ 33.986099999999965
+ 15800
+ 0.7297968247394834
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7297968247394834
+
+
+ 11220
+ 7795
+ 52.17490000000004
+ 11220
+ 0.7013774437777829
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013774437777829
+
+
+ 11220
+ 4549
+ 64.05009999999999
+ 11220
+ 0.7337668592508626
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7337668592508626
+
+
+ 11220
+ 1173
+ 32.02460000000002
+ 11220
+ 0.7373294060477242
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7373294060477242
+
+
+ 11220
+ 7648
+ 34.00460000000004
+ 11220
+ 0.8031320440636947
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8031320440636947
+
+
+ 26406
+ 11220
+ -34.00460000000004
+ 26406
+ 0.769426162382709
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.769426162382709
+
+
+ 11220
+ 1176
+ 74.03519999999997
+ 11220
+ 0.7549181770630964
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7549181770630964
+
+
+ 11220
+ 1335
+ 52.17490000000004
+ 11220
+ 0.7105837649410915
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7105837649410915
+
+
+ 11220
+ 1391
+ -66.01249999999999
+ 11220
+ 0.7350733595079555
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7350733595079555
+
+
+ 11220
+ 1449
+ 200.21290000000005
+ 11220
+ 0.7011820137878435
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7011820137878435
+
+
+ 11220
+ 1555
+ 16.029899999999998
+ 11220
+ 0.718934939367385
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.718934939367385
+
+
+ 11220
+ 2651
+ -82.00689999999997
+ 11220
+ 0.809082073301524
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.809082073301524
+
+
+ 11220
+ 4524
+ -49.981299999999976
+ 11220
+ 0.7801130496733726
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7801130496733726
+
+
+ 11220
+ 4561
+ 58.041
+ 11220
+ 0.7615003492401238
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7615003492401238
+
+
+ 11220
+ 4661
+ 50.03550000000001
+ 11220
+ 0.7256229482441166
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7256229482441166
+
+
+ 11220
+ 4680
+ 94.06110000000007
+ 11220
+ 0.7400936427643684
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400936427643684
+
+
+ 11220
+ 7663
+ -50.01709999999997
+ 11220
+ 0.7274103558351996
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7274103558351996
+
+
+ 11220
+ 7664
+ -84.0224
+ 11220
+ 0.8082237730808561
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8082237730808561
+
+
+ 11220
+ 7665
+ 35.97570000000002
+ 11220
+ 0.7505165201278037
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7505165201278037
+
+
+ 11220
+ 8321
+ 16.029800000000023
+ 11220
+ 0.7695176607233686
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7695176607233686
+
+
+ 12201
+ 11220
+ 0.0004000000000132786
+ 12201
+ 0.8609303611555306
+ 12201.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8609303611555306
+
+
+ 13590
+ 11220
+ 0.0007999999999697138
+ 13590
+ 0.9072490955914636
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9072490955914636
+
+
+ 13633
+ 11220
+ 0.0014999999999645297
+ 13633
+ 0.9431305295297964
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9431305295297964
+
+
+ 13737
+ 11220
+ 9.00569999999999
+ 13737
+ 0.7840869821541714
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7840869821541714
+
+
+ 20868
+ 11220
+ 32.04969999999997
+ 20868
+ 0.7506359487646915
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7506359487646915
+
+
+ 1294
+ 386
+ 172.07369999999997
+ 1294
+ 0.8488490598740466
+ 1294.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8488490598740466
+
+
+ 1294
+ 102
+ 86.0369
+ 1294
+ 0.8057301168898261
+ 1294.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8057301168898261
+
+
+ 1294
+ 109
+ 0.00050000000004502
+ 1294
+ 0.7903383365204155
+ 1294.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7903383365204155
+
+
+ 1294
+ 1252
+ 86.03720000000004
+ 1294
+ 0.7988622867642146
+ 1294.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7988622867642146
+
+
+ 10586
+ 3528
+ -0.0011999999999829924
+ 10586
+ 0.8439330202256786
+ 10586.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8439330202256786
+
+
+ 10586
+ 2703
+ -0.0007999999999697138
+ 10586
+ 0.8663458868059664
+ 10586.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8663458868059664
+
+
+ 1154
+ 2
+ 0.0012000000000398359
+ 1154
+ 0.8705589146777352
+ 1154.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8705589146777352
+
+
+ 1203
+ 1155
+ -208.04050000000007
+ 1203
+ 0.8655778433180707
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8655778433180707
+
+
+ 10473
+ 1155
+ -208.04110000000003
+ 10473
+ 0.8655778433180707
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8655778433180707
+
+
+ 28000
+ 1155
+ -60.00300000000004
+ 28000
+ 0.9209023933261088
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9209023933261088
+
+
+ 4605
+ 1155
+ 271.1094
+ 4605
+ 0.705543334949455
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.705543334949455
+
+
+ 1155
+ 1
+ 134.02160000000003
+ 1155
+ 0.9133645871855882
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9133645871855882
+
+
+ 1155
+ 9
+ 14.0154
+ 1155
+ 0.9175099853208153
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9175099853208153
+
+
+ 2571
+ 1155
+ 74.019
+ 2571
+ 0.8435889684931681
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8435889684931681
+
+
+ 4517
+ 1155
+ 106.04520000000002
+ 4517
+ 0.7829182708250284
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7829182708250284
+
+
+ 1155
+ 259
+ 60.002500000000055
+ 1155
+ 0.9109755838344882
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9109755838344882
+
+
+ 7635
+ 1155
+ 0.8433999999999742
+ 7635
+ 0.8062979877508201
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8062979877508201
+
+
+ 3521
+ 1155
+ -74.01870000000008
+ 3521
+ 0.9679154544162896
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9679154544162896
+
+
+ 4552
+ 1155
+ -14.014900000000011
+ 4552
+ 0.9031236616837173
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9031236616837173
+
+
+ 3522
+ 1155
+ -43.97270000000003
+ 3522
+ 0.8899739195012284
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8899739195012284
+
+
+ 1155
+ 6
+ 138.98120000000006
+ 1155
+ 0.7553129678930819
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553129678930819
+
+
+ 1155
+ 31
+ -271.1092
+ 1155
+ 0.7011623773848672
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7011623773848672
+
+
+ 1155
+ 39
+ 60.00240000000008
+ 1155
+ 0.8910706180253997
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8910706180253997
+
+
+ 1155
+ 54
+ -12.019699999999943
+ 1155
+ 0.8329363578319362
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8329363578319362
+
+
+ 1155
+ 58
+ -14.015899999999988
+ 1155
+ 0.8688179184439764
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8688179184439764
+
+
+ 1155
+ 144
+ -88.03469999999993
+ 1155
+ 0.849850900184079
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.849850900184079
+
+
+ 1156
+ 1155
+ 30.045999999999935
+ 1156
+ 0.8195488854450933
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8195488854450933
+
+
+ 1479
+ 1155
+ -11.264700000000062
+ 1479
+ 0.853347145918151
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.853347145918151
+
+
+ 5160
+ 1155
+ -60.002700000000004
+ 5160
+ 0.9262146392460844
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9262146392460844
+
+
+ 5332
+ 1155
+ 271.109
+ 5332
+ 0.7665554082962938
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7665554082962938
+
+
+ 1540
+ 1244
+ 14.014800000000037
+ 1540
+ 0.7267995672116246
+ 1540.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7267995672116246
+
+
+ 4576
+ 1540
+ 9.999999997489795e-05
+ 4576
+ 0.7051646493776003
+ 4576.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7051646493776003
+
+
+ 9511
+ 2474
+ 0.0007999999999697138
+ 9511
+ 1.0
+ 9511.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 4993
+ 2214
+ -156.04250000000002
+ 4993
+ 0.814915655945658
+ 4993.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.814915655945658
+
+
+ 13592
+ 4993
+ 158.05880000000002
+ 13592
+ 0.7458700364923894
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7458700364923894
+
+
+ 4993
+ 4789
+ -42.011999999999944
+ 4993
+ 0.7531977192939415
+ 4993.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7531977192939415
+
+
+ 4993
+ 2497
+ -58.00559999999996
+ 4993
+ 0.7874303041617772
+ 4993.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7874303041617772
+
+
+ 4993
+ 2525
+ -58.00670000000002
+ 4993
+ 0.7712089288434372
+ 4993.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7712089288434372
+
+
+ 13698
+ 4993
+ 60.021600000000035
+ 13698
+ 0.7300814843190786
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7300814843190786
+
+
+ 2512
+ 1192
+ 0.994499999999988
+ 2512
+ 0.807651398132234
+ 2512.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.807651398132234
+
+
+ 7742
+ 2476
+ -0.0004000000000132786
+ 7742
+ 0.9098741536617603
+ 7742.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9098741536617603
+
+
+ 38
+ 11
+ 2.0165999999999826
+ 38
+ 0.7947227214684931
+ 38.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7947227214684931
+
+
+ 2493
+ 38
+ -2.016900000000021
+ 2493
+ 0.7750782350751233
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7750782350751233
+
+
+ 3771
+ 38
+ -46.00740000000002
+ 3771
+ 0.7136202564816345
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7136202564816345
+
+
+ 4539
+ 38
+ -0.0006000000000199179
+ 4539
+ 0.8606687441950156
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8606687441950156
+
+
+ 7731
+ 38
+ 42.09809999999999
+ 7731
+ 0.7031069988199695
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7031069988199695
+
+
+ 4539
+ 2493
+ 2.016300000000001
+ 4539
+ 0.8241835400517588
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8241835400517588
+
+
+ 2493
+ 11
+ -0.0003000000000383807
+ 2493
+ 0.9108787174159405
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9108787174159405
+
+
+ 2493
+ 1419
+ -56.07740000000001
+ 2493
+ 0.7306633632828473
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7306633632828473
+
+
+ 2493
+ 1547
+ -42.099199999999996
+ 2493
+ 0.7194645854692416
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7194645854692416
+
+
+ 2575
+ 2493
+ -12.000499999999988
+ 2575
+ 0.7101988126060368
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101988126060368
+
+
+ 7931
+ 2509
+ -162.05239999999998
+ 7931
+ 0.7182440326604289
+ 7931.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7182440326604289
+
+
+ 7931
+ 3575
+ -30.01069999999993
+ 7931
+ 0.8830255386645163
+ 7931.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8830255386645163
+
+
+ 7931
+ 7859
+ -30.009900000000016
+ 7931
+ 0.9278006426634611
+ 7931.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9278006426634611
+
+
+ 15865
+ 7931
+ 30.01019999999994
+ 15865
+ 0.8911228507098409
+ 15865.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8911228507098409
+
+
+ 20637
+ 1322
+ 0.0
+ 20637
+ 0.7437381098280345
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7437381098280345
+
+
+ 20637
+ 1173
+ 82.00580000000002
+ 20637
+ 0.7326390798031415
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7326390798031415
+
+
+ 20637
+ 1307
+ 14.0154
+ 20637
+ 0.715695640062288
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.715695640062288
+
+
+ 20637
+ 4661
+ 100.01670000000001
+ 20637
+ 0.7206767677751681
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206767677751681
+
+
+ 20637
+ 7663
+ -0.03589999999996962
+ 20637
+ 0.7273917897225644
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7273917897225644
+
+
+ 20637
+ 15800
+ 15.995100000000036
+ 20637
+ 0.7172744488815417
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7172744488815417
+
+
+ 20868
+ 20637
+ -17.931500000000028
+ 20868
+ 0.7186533346122039
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7186533346122039
+
+
+ 7719
+ 4670
+ 0.002200000000016189
+ 7719
+ 0.7332963011021447
+ 7719.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7332963011021447
+
+
+ 12201
+ 8341
+ 14.014200000000017
+ 12201
+ 0.7827025212907195
+ 12201.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7827025212907195
+
+
+ 12201
+ 7648
+ 34.00500000000005
+ 12201
+ 0.707541949648786
+ 12201.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.707541949648786
+
+
+ 13633
+ 12201
+ 0.001099999999951251
+ 13633
+ 0.7867328189125501
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7867328189125501
+
+
+ 13590
+ 12201
+ 0.0003999999999564352
+ 13590
+ 0.7717597822116571
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7717597822116571
+
+
+ 4766
+ 2353
+ -0.002200000000016189
+ 4766
+ 0.7942440930131931
+ 4766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7942440930131931
+
+
+ 4854
+ 2353
+ -0.0020000000000095497
+ 4854
+ 0.7596247135461998
+ 4854.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7596247135461998
+
+
+ 10240
+ 2353
+ -98.03910000000008
+ 10240
+ 0.7064613282440434
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7064613282440434
+
+
+ 10404
+ 2353
+ -18.011600000000044
+ 10404
+ 0.7146276246276508
+ 10404.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7146276246276508
+
+
+ 2956
+ 1947
+ -14.0154
+ 2956
+ 0.7005013221740003
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7005013221740003
+
+
+ 3771
+ 1947
+ -14.0154
+ 3771
+ 0.703032174475851
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.703032174475851
+
+
+ 1787
+ 1253
+ -21.983900000000006
+ 1787
+ 0.9200705326458943
+ 1787.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9200705326458943
+
+
+ 1310
+ 1253
+ -23.99989999999997
+ 1310
+ 0.9330399167729522
+ 1310.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9330399167729522
+
+
+ 3285
+ 1253
+ -282.1981
+ 3285
+ 0.8467668155037447
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8467668155037447
+
+
+ 1253
+ 1169
+ 262.2286
+ 1253
+ 0.8487356590849324
+ 1253.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8487356590849324
+
+
+ 13642
+ 13609
+ -11.999299999999948
+ 13642
+ 0.8278357652854851
+ 13642.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8278357652854851
+
+
+ 13660
+ 13609
+ -54.01070000000004
+ 13660
+ 0.8233073997097531
+ 13660.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8233073997097531
+
+
+ 13719
+ 13609
+ 42.00959999999998
+ 13719
+ 0.8402373439354043
+ 13719.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8402373439354043
+
+
+ 4748
+ 4519
+ -13.980199999999968
+ 4748
+ 0.7766496308471901
+ 4748.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7766496308471901
+
+
+ 4519
+ 1182
+ 27.994500000000016
+ 4519
+ 0.8114501274770394
+ 4519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8114501274770394
+
+
+ 1234
+ 1221
+ 0.0003000000000383807
+ 1234
+ 0.9227094492700184
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9227094492700184
+
+
+ 5818
+ 1234
+ -60.02040000000005
+ 5818
+ 0.7670934226937828
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7670934226937828
+
+
+ 2632
+ 1234
+ -84.09480000000002
+ 2632
+ 0.7768095731207301
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7768095731207301
+
+
+ 10964
+ 1234
+ -73.08970000000005
+ 10964
+ 0.8192428076481593
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8192428076481593
+
+
+ 1234
+ 1068
+ -14.014899999999955
+ 1234
+ 0.8145852786029653
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8145852786029653
+
+
+ 1234
+ 914
+ -14.014899999999955
+ 1234
+ 0.9046146790469793
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9046146790469793
+
+
+ 1234
+ 343
+ -14.014899999999955
+ 1234
+ 0.9446122263062846
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9446122263062846
+
+
+ 1234
+ 1220
+ 0.0003000000000383807
+ 1234
+ 0.8232620548712922
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8232620548712922
+
+
+ 1405
+ 1234
+ -16.031900000000007
+ 1405
+ 0.7415746491495357
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7415746491495357
+
+
+ 1419
+ 1234
+ -48.05830000000003
+ 1419
+ 0.8132201225889226
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8132201225889226
+
+
+ 1547
+ 1234
+ -62.036500000000046
+ 1547
+ 0.8713447233562852
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713447233562852
+
+
+ 3770
+ 1234
+ -71.07400000000001
+ 3770
+ 0.712767831352374
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.712767831352374
+
+
+ 7731
+ 1234
+ -60.02070000000003
+ 7731
+ 0.8388270539136374
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8388270539136374
+
+
+ 13816
+ 10372
+ 0.001199999999926149
+ 13816
+ 0.7471154676079341
+ 13816.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7471154676079341
+
+
+ 7633
+ 7632
+ 18.009600000000034
+ 7633
+ 0.8326859751306808
+ 7633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8326859751306808
+
+
+ 7633
+ 7628
+ -33.96119999999996
+ 7633
+ 0.7811289690078043
+ 7633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7811289690078043
+
+
+ 7633
+ 4589
+ -49.956699999999984
+ 7633
+ 0.7101020216018803
+ 7633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101020216018803
+
+
+ 2491
+ 24
+ 0.0002000000000066393
+ 2491
+ 0.7047198629324718
+ 2491.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7047198629324718
+
+
+ 5175
+ 4995
+ 0.0002999999999957481
+ 5175
+ 1.0000000000000002
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11101
+ 4995
+ -0.0002000000000066393
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11306
+ 4995
+ -0.00010000000000331966
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11368
+ 4995
+ 0.0
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 4995
+ 25
+ 50.010999999999996
+ 4995
+ 0.7765014360319091
+ 4995.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 4995
+ 208
+ 57.01320000000001
+ 4995
+ 0.7720262431782003
+ 4995.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 4995
+ 4637
+ 14.015799999999999
+ 4995
+ 0.7465660405620628
+ 4995.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 5078
+ 4995
+ 0.0
+ 5078
+ 1.0000000000000002
+ 5078.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5148
+ 4995
+ 0.0
+ 5148
+ 1.0000000000000002
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5194
+ 4995
+ 0.00010000000000331966
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5233
+ 4995
+ 0.0002000000000066393
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11194
+ 4995
+ -0.0002000000000066393
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11270
+ 4995
+ -0.00010000000000331966
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11321
+ 4995
+ -0.00010000000000331966
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 11346
+ 4995
+ -0.0002000000000066393
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11531
+ 4995
+ 0.0
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11652
+ 4995
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 3752
+ 1679
+ 15.994799999999998
+ 3752
+ 0.7171517351157293
+ 3752.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7171517351157293
+
+
+ 2287
+ 1679
+ -76.05220000000003
+ 2287
+ 0.7059824339548566
+ 2287.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7059824339548566
+
+
+ 1474
+ 1405
+ -18.0111
+ 1474
+ 0.7853542886820077
+ 1474.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7853542886820077
+
+
+ 1405
+ 1244
+ -0.037499999999965894
+ 1405
+ 0.7134390387660311
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7134390387660311
+
+
+ 1405
+ 1221
+ -16.03159999999997
+ 1405
+ 0.7227141359260585
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7227141359260585
+
+
+ 2632
+ 1405
+ -68.06290000000001
+ 2632
+ 0.7812110136276462
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7812110136276462
+
+
+ 1405
+ 270
+ 22.005899999999997
+ 1405
+ 0.7848299475800582
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7848299475800582
+
+
+ 10964
+ 1405
+ -57.05780000000004
+ 10964
+ 0.8017282432903488
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8017282432903488
+
+
+ 1405
+ 914
+ -30.046799999999962
+ 1405
+ 0.7045338768361806
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7045338768361806
+
+
+ 1419
+ 1405
+ -32.026400000000024
+ 1419
+ 0.8708279395733682
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8708279395733682
+
+
+ 1405
+ 343
+ -30.046799999999962
+ 1405
+ 0.7278045857560856
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7278045857560856
+
+
+ 1405
+ 1352
+ 3.995300000000043
+ 1405
+ 0.7878786501325126
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7878786501325126
+
+
+ 1547
+ 1405
+ -46.00460000000004
+ 1547
+ 0.8114856622627353
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8114856622627353
+
+
+ 19733
+ 3546
+ 0.0007999999999697138
+ 19733
+ 0.7802608152888822
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7802608152888822
+
+
+ 19733
+ 1164
+ 14.016599999999983
+ 19733
+ 0.7806719873157493
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7806719873157493
+
+
+ 19733
+ 1307
+ 14.015799999999956
+ 19733
+ 0.7109625276765146
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7109625276765146
+
+
+ 19733
+ 3747
+ 0.0001999999999497959
+ 19733
+ 0.7603828728366142
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7603828728366142
+
+
+ 19733
+ 4500
+ 14.016399999999976
+ 19733
+ 0.7967805564690362
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7967805564690362
+
+
+ 19733
+ 4549
+ 114.03169999999994
+ 19733
+ 0.7195390650854484
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7195390650854484
+
+
+ 19733
+ 4603
+ 18.010699999999986
+ 19733
+ 0.7217810792832124
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7217810792832124
+
+
+ 19733
+ 4661
+ 100.01709999999997
+ 19733
+ 0.7509848409336357
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7509848409336357
+
+
+ 19733
+ 7664
+ -34.04080000000005
+ 19733
+ 0.7271957359005612
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7271957359005612
+
+
+ 26328
+ 19733
+ -18.010599999999954
+ 26328
+ 0.7531096055436386
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7531096055436386
+
+
+ 7130
+ 6
+ 74.02060000000006
+ 7130
+ 0.7114586408169032
+ 7130.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7114586408169032
+
+
+ 7130
+ 2696
+ 0.0
+ 7130
+ 0.7066319339722262
+ 7130.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7066319339722262
+
+
+ 4748
+ 1182
+ 14.014300000000048
+ 4748
+ 0.8631775019966819
+ 4748.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8631775019966819
+
+
+ 386
+ 102
+ -86.03679999999997
+ 386
+ 0.8240485506661712
+ 386.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8240485506661712
+
+
+ 109
+ 102
+ 86.03639999999996
+ 109
+ 0.7590772324092623
+ 109.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7590772324092623
+
+
+ 1252
+ 102
+ -0.0003000000000383807
+ 1252
+ 0.8175805505167573
+ 1252.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8175805505167573
+
+
+ 1221
+ 343
+ -14.015199999999993
+ 1221
+ 0.9205357085318602
+ 1221.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9205357085318602
+
+
+ 1221
+ 914
+ -14.015199999999993
+ 1221
+ 0.8611351626496024
+ 1221.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8611351626496024
+
+
+ 1221
+ 1068
+ -14.015199999999993
+ 1221
+ 0.793949614376015
+ 1221.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.793949614376015
+
+
+ 1221
+ 1220
+ 0.0
+ 1221
+ 0.8089668077239309
+ 1221.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8089668077239309
+
+
+ 1419
+ 1221
+ -48.05799999999999
+ 1419
+ 0.775293609346556
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.775293609346556
+
+
+ 1547
+ 1221
+ -62.03620000000001
+ 1547
+ 0.8554217733194884
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8554217733194884
+
+
+ 2632
+ 1221
+ -84.09449999999998
+ 2632
+ 0.7777354925858587
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7777354925858587
+
+
+ 3770
+ 1221
+ -71.07369999999997
+ 3770
+ 0.7012291355150512
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7012291355150512
+
+
+ 5818
+ 1221
+ -60.02010000000001
+ 5818
+ 0.752946558278959
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.752946558278959
+
+
+ 7731
+ 1221
+ -60.020399999999995
+ 7731
+ 0.8198281074348206
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8198281074348206
+
+
+ 10964
+ 1221
+ -73.08940000000001
+ 10964
+ 0.7876213832319938
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7876213832319938
+
+
+ 5273
+ 1187
+ 31.98969999999997
+ 5273
+ 0.7364154404766117
+ 5273.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7364154404766117
+
+
+ 4504
+ 1187
+ -14.01600000000002
+ 4504
+ 0.8250658965975559
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8250658965975559
+
+
+ 1187
+ 1162
+ 179.07950000000005
+ 1187
+ 0.7872214730685516
+ 1187.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872214730685516
+
+
+ 2483
+ 1187
+ -31.042200000000037
+ 2483
+ 0.7602874186073685
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7602874186073685
+
+
+ 4507
+ 1187
+ -0.00050000000004502
+ 4507
+ 0.883384932825698
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.883384932825698
+
+
+ 1187
+ 1165
+ 0.0002000000000066393
+ 1187
+ 0.9272971101558853
+ 1187.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9272971101558853
+
+
+ 2478
+ 1187
+ -14.015000000000043
+ 2478
+ 0.7771681970792208
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7771681970792208
+
+
+ 1196
+ 1187
+ -17.026200000000017
+ 1196
+ 0.8944782577371233
+ 1196.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8944782577371233
+
+
+ 4508
+ 1187
+ -31.042400000000043
+ 4508
+ 0.7962817192880156
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7962817192880156
+
+
+ 7635
+ 1203
+ 208.88390000000004
+ 7635
+ 0.7184506527315702
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7184506527315702
+
+
+ 10473
+ 7635
+ -208.8845
+ 10473
+ 0.7184506527315702
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7184506527315702
+
+
+ 28000
+ 7635
+ -60.84640000000002
+ 28000
+ 0.7424720167874623
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7424720167874623
+
+
+ 7635
+ 1
+ 134.865
+ 7635
+ 0.7303282455265786
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7303282455265786
+
+
+ 7635
+ 9
+ 14.858799999999974
+ 7635
+ 0.7302285988581841
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7302285988581841
+
+
+ 7635
+ 2571
+ -73.17560000000003
+ 7635
+ 0.7823808867954816
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7823808867954816
+
+
+ 7635
+ 259
+ 60.84590000000003
+ 7635
+ 0.7408988662766178
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408988662766178
+
+
+ 7635
+ 39
+ 60.845800000000054
+ 7635
+ 0.7314639216106239
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7314639216106239
+
+
+ 7635
+ 58
+ -13.172500000000014
+ 7635
+ 0.7234029085690521
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7234029085690521
+
+
+ 7635
+ 144
+ -87.19129999999996
+ 7635
+ 0.7093357653572645
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7093357653572645
+
+
+ 7635
+ 1479
+ 12.108100000000036
+ 7635
+ 0.7432482422786832
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7432482422786832
+
+
+ 7635
+ 3521
+ 74.86210000000005
+ 7635
+ 0.8038517853523826
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8038517853523826
+
+
+ 7635
+ 3522
+ 44.816100000000006
+ 7635
+ 0.7394313902138818
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7394313902138818
+
+
+ 7635
+ 4552
+ 14.858299999999986
+ 7635
+ 0.7398416947305744
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7398416947305744
+
+
+ 7635
+ 5160
+ 60.84609999999998
+ 7635
+ 0.742947525937506
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.742947525937506
+
+
+ 13721
+ 13664
+ -68.02620000000002
+ 13721
+ 0.727679155184577
+ 13721.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.727679155184577
+
+
+ 10258
+ 4662
+ -114.03230000000002
+ 10258
+ 0.7399714234788617
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7399714234788617
+
+
+ 4775
+ 4662
+ 0.015300000000024738
+ 4775
+ 0.8494154600297876
+ 4775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8494154600297876
+
+
+ 4662
+ 4584
+ 0.0002000000000066393
+ 4662
+ 0.8849451317291723
+ 4662.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8849451317291723
+
+
+ 10240
+ 4662
+ -98.03760000000005
+ 10240
+ 0.8141655199342035
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8141655199342035
+
+
+ 8014
+ 2526
+ -30.011100000000056
+ 8014
+ 0.7996052967992242
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7996052967992242
+
+
+ 8014
+ 2649
+ -14.015600000000063
+ 8014
+ 0.707912501867658
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.707912501867658
+
+
+ 8014
+ 302
+ -46.006399999999985
+ 8014
+ 0.7096719242269933
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7096719242269933
+
+
+ 8014
+ 2628
+ -15.996200000000044
+ 8014
+ 0.727453932430398
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.727453932430398
+
+
+ 8014
+ 2573
+ -30.010899999999992
+ 8014
+ 0.7889100787821206
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7889100787821206
+
+
+ 9004
+ 8014
+ 0.0006000000000767614
+ 9004
+ 0.7872509704571251
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872509704571251
+
+
+ 10239
+ 4618
+ -26.0154
+ 10239
+ 0.7698876711824088
+ 10239.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7698876711824088
+
+
+ 4618
+ 2487
+ -15.9957
+ 4618
+ 0.7426747379947732
+ 4618.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7426747379947732
+
+
+ 10246
+ 4618
+ -42.01029999999997
+ 10246
+ 0.8418240294098023
+ 10246.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8418240294098023
+
+
+ 4972
+ 4618
+ -36.9803
+ 4972
+ 0.7115894389163602
+ 4972.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7115894389163602
+
+
+ 4618
+ 4030
+ -15.995400000000018
+ 4618
+ 0.806132715252391
+ 4618.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.806132715252391
+
+
+ 12784
+ 3721
+ -32.02660000000003
+ 12784
+ 0.7519522857955085
+ 12784.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7519522857955085
+
+
+ 12784
+ 3700
+ -32.02660000000003
+ 12784
+ 0.7519522857955085
+ 12784.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7519522857955085
+
+
+ 12784
+ 9385
+ 9.999999997489795e-05
+ 12784
+ 0.9479861906585321
+ 12784.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9479861906585321
+
+
+ 4854
+ 4584
+ -0.00029999999998153726
+ 4854
+ 0.7326617053443288
+ 4854.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7326617053443288
+
+
+ 4854
+ 4766
+ 0.0002000000000066393
+ 4854
+ 0.7948434693111972
+ 4854.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7948434693111972
+
+
+ 10240
+ 4854
+ -98.03710000000007
+ 10240
+ 0.7704457441925701
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7704457441925701
+
+
+ 7835
+ 2497
+ 16.032300000000077
+ 7835
+ 0.7161804600098588
+ 7835.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7161804600098588
+
+
+ 2497
+ 2214
+ -98.03690000000006
+ 2497
+ 0.7788081273143392
+ 2497.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7788081273143392
+
+
+ 13890
+ 2497
+ 14.017000000000053
+ 13890
+ 0.7108054804293422
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7108054804293422
+
+
+ 13592
+ 2497
+ 100.05320000000006
+ 13592
+ 0.7819052246509179
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7819052246509179
+
+
+ 4789
+ 2497
+ -15.993600000000015
+ 4789
+ 0.7067973705044224
+ 4789.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7067973705044224
+
+
+ 2497
+ 1222
+ -98.03750000000002
+ 2497
+ 0.760117464427726
+ 2497.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.760117464427726
+
+
+ 2525
+ 2497
+ 0.001100000000064938
+ 2525
+ 0.7158659841207365
+ 2525.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7158659841207365
+
+
+ 13698
+ 2497
+ 2.0160000000000764
+ 13698
+ 0.7598164868006287
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7598164868006287
+
+
+ 3546
+ 1176
+ 124.01599999999996
+ 3546
+ 0.8044876531551107
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8044876531551107
+
+
+ 7732
+ 1176
+ 20.048999999999978
+ 7732
+ 0.7444370840000086
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7444370840000086
+
+
+ 1339
+ 1176
+ 15.99529999999993
+ 1339
+ 0.7567351827295026
+ 1339.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7567351827295026
+
+
+ 4537
+ 1176
+ 58.00539999999995
+ 4537
+ 0.8474304743698234
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8474304743698234
+
+
+ 4581
+ 1176
+ 110.00109999999995
+ 4581
+ 0.8000654004907126
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8000654004907126
+
+
+ 1376
+ 1176
+ 138.03209999999996
+ 1376
+ 0.7771139269294767
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7771139269294767
+
+
+ 4500
+ 1176
+ 110.00039999999996
+ 4500
+ 0.8304947515484594
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8304947515484594
+
+
+ 2541
+ 1176
+ 72.02099999999996
+ 2541
+ 0.7191671863807276
+ 2541.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7191671863807276
+
+
+ 1176
+ 1164
+ -110.00019999999995
+ 1176
+ 0.7985222060492583
+ 1176.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7985222060492583
+
+
+ 1967
+ 1176
+ 58.00589999999994
+ 1967
+ 0.8379170701289205
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8379170701289205
+
+
+ 4505
+ 1176
+ 0.0
+ 4505
+ 0.8995182630677155
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8995182630677155
+
+
+ 3901
+ 1176
+ 15.994199999999978
+ 3901
+ 0.8413782414451614
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8413782414451614
+
+
+ 1361
+ 1176
+ 35.875399999999956
+ 1361
+ 0.7860326766884633
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7860326766884633
+
+
+ 4587
+ 1176
+ -32.02660000000003
+ 4587
+ 0.7822251394887034
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7822251394887034
+
+
+ 15800
+ 1176
+ 108.02129999999994
+ 15800
+ 0.7550060523724507
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7550060523724507
+
+
+ 4452
+ 1176
+ 94.00589999999994
+ 4452
+ 0.739776770529118
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.739776770529118
+
+
+ 7795
+ 1176
+ 21.86029999999994
+ 7795
+ 0.7395961405664504
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7395961405664504
+
+
+ 2544
+ 1176
+ 11.963699999999903
+ 2544
+ 0.7272134469520044
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7272134469520044
+
+
+ 4549
+ 1176
+ 9.985099999999989
+ 4549
+ 0.7817631336621229
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7817631336621229
+
+
+ 1176
+ 1173
+ -42.010599999999954
+ 1176
+ 0.847460253072218
+ 1176.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.847460253072218
+
+
+ 3766
+ 1176
+ 108.02149999999995
+ 3766
+ 0.7832285653186108
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7832285653186108
+
+
+ 26406
+ 1176
+ 40.030599999999936
+ 26406
+ 0.7484772000558009
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7484772000558009
+
+
+ 1391
+ 1176
+ 140.04769999999996
+ 1391
+ 0.7966281553448001
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7966281553448001
+
+
+ 1240
+ 1176
+ 9.984899999999925
+ 1240
+ 0.7174790333632869
+ 1240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7174790333632869
+
+
+ 13633
+ 1176
+ 74.03669999999994
+ 13633
+ 0.8126637741947831
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8126637741947831
+
+
+ 13826
+ 1176
+ -204.07950000000005
+ 13826
+ 0.7256156562560675
+ 13826.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7256156562560675
+
+
+ 4680
+ 1176
+ -20.025900000000092
+ 4680
+ 0.7858405997570472
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7858405997570472
+
+
+ 7663
+ 1176
+ 124.05229999999995
+ 7663
+ 0.7411005868072673
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7411005868072673
+
+
+ 1449
+ 1176
+ -126.17770000000007
+ 1449
+ 0.7464847632892815
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7464847632892815
+
+
+ 4694
+ 1176
+ 9.999999997489795e-05
+ 4694
+ 0.8020818762764994
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8020818762764994
+
+
+ 7665
+ 1176
+ 38.05949999999996
+ 7665
+ 0.775512866003261
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.775512866003261
+
+
+ 1223
+ 1176
+ 74.00049999999999
+ 1223
+ 0.7560051816277469
+ 1223.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7560051816277469
+
+
+ 1335
+ 1176
+ 21.86029999999994
+ 1335
+ 0.7538903887165387
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7538903887165387
+
+
+ 1555
+ 1176
+ 58.00529999999998
+ 1555
+ 0.8003816795112269
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8003816795112269
+
+
+ 2486
+ 1176
+ 25.979899999999986
+ 2486
+ 0.7638680492540586
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7638680492540586
+
+
+ 2651
+ 1176
+ 156.04209999999995
+ 2651
+ 0.8344471671822231
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8344471671822231
+
+
+ 3747
+ 1176
+ 124.01659999999998
+ 3747
+ 0.7332609330277406
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7332609330277406
+
+
+ 4524
+ 1176
+ 124.01649999999995
+ 4524
+ 0.8179818912802685
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8179818912802685
+
+
+ 4561
+ 1176
+ 15.994199999999978
+ 4561
+ 0.8444571612087117
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8444571612087117
+
+
+ 4661
+ 1176
+ 23.99969999999996
+ 4661
+ 0.8013944435228462
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8013944435228462
+
+
+ 5385
+ 1176
+ 58.00559999999996
+ 5385
+ 0.7885443070355609
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7885443070355609
+
+
+ 5505
+ 1176
+ -4.030700000000024
+ 5505
+ 0.7333762784567808
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7333762784567808
+
+
+ 7664
+ 1176
+ 158.05759999999998
+ 7664
+ 0.7502616305824035
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7502616305824035
+
+
+ 8321
+ 1176
+ 58.00539999999995
+ 8321
+ 0.8587536704223167
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8587536704223167
+
+
+ 13590
+ 1176
+ 74.03599999999994
+ 13590
+ 0.8309887285300477
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8309887285300477
+
+
+ 13737
+ 1176
+ 83.04089999999997
+ 13737
+ 0.7558985067291744
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7558985067291744
+
+
+ 20868
+ 1176
+ 106.08489999999995
+ 20868
+ 0.7301333508338642
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7301333508338642
+
+
+ 4732
+ 2479
+ 0.0002000000000066393
+ 4732
+ 0.8067345080184596
+ 4732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8067345080184596
+
+
+ 5217
+ 2479
+ 0.0002000000000066393
+ 5217
+ 0.7648545462302034
+ 5217.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7648545462302034
+
+
+ 2479
+ 1808
+ 0.0
+ 2479
+ 0.7553209482850833
+ 2479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553209482850833
+
+
+ 4589
+ 2479
+ 0.00010000000000331966
+ 4589
+ 0.8074842248975349
+ 4589.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8074842248975349
+
+
+ 7667
+ 2479
+ 2.0153999999999996
+ 7667
+ 0.704494208975565
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.704494208975565
+
+
+ 7632
+ 7628
+ -51.9708
+ 7632
+ 0.7386943007863611
+ 7632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7386943007863611
+
+
+ 1203
+ 1
+ -74.01890000000003
+ 1203
+ 0.9642751441502224
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9642751441502224
+
+
+ 1203
+ 6
+ -69.05930000000001
+ 1203
+ 0.8083294471916564
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8083294471916564
+
+
+ 1203
+ 9
+ -194.02510000000007
+ 1203
+ 0.8750385558484055
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8750385558484055
+
+
+ 1203
+ 39
+ -148.0381
+ 1203
+ 0.9005206716379817
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9005206716379817
+
+
+ 1203
+ 54
+ -220.0602
+ 1203
+ 0.8174700451821512
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8174700451821512
+
+
+ 1203
+ 58
+ -222.05640000000005
+ 1203
+ 0.8613979483011278
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8613979483011278
+
+
+ 1203
+ 144
+ -296.0752
+ 1203
+ 0.7824093927514792
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7824093927514792
+
+
+ 1203
+ 259
+ -148.038
+ 1203
+ 0.9303156766492804
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9303156766492804
+
+
+ 1203
+ 1156
+ -238.0865
+ 1203
+ 0.8334072070031415
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8334072070031415
+
+
+ 1479
+ 1203
+ 196.7758
+ 1479
+ 0.8454167968235824
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8454167968235824
+
+
+ 2571
+ 1203
+ 282.05950000000007
+ 2571
+ 0.7208213942070807
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7208213942070807
+
+
+ 3521
+ 1203
+ 134.02179999999998
+ 3521
+ 0.8758029209484876
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8758029209484876
+
+
+ 3522
+ 1203
+ 164.06780000000003
+ 3522
+ 0.8962861204492923
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8962861204492923
+
+
+ 4517
+ 1203
+ 314.0857000000001
+ 4517
+ 0.7192267163672981
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7192267163672981
+
+
+ 4552
+ 1203
+ 194.02560000000005
+ 4552
+ 0.8748516885126687
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8748516885126687
+
+
+ 5160
+ 1203
+ 148.03780000000006
+ 5160
+ 0.9474182676741132
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9474182676741132
+
+
+ 10473
+ 1203
+ -0.0005999999999630745
+ 10473
+ 0.9999999999999994
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999994
+
+
+ 28000
+ 1203
+ 148.03750000000002
+ 28000
+ 0.9360036525586622
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9360036525586622
+
+
+ 5233
+ 5175
+ -9.99999999891088e-05
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11101
+ 5233
+ -0.0004000000000132786
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11306
+ 5233
+ -0.00030000000000995897
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11368
+ 5233
+ -0.0002000000000066393
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5233
+ 208
+ 57.01340000000002
+ 5233
+ 0.7720262431782003
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 11531
+ 5233
+ -0.0002000000000066393
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11194
+ 5233
+ -0.0004000000000132786
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11652
+ 5233
+ 9.99999999891088e-05
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5233
+ 5194
+ 0.00010000000000331966
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5233
+ 25
+ 50.0112
+ 5233
+ 0.7765014360319091
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 5233
+ 5078
+ 0.0002000000000066393
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11346
+ 5233
+ -0.0004000000000132786
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11270
+ 5233
+ -0.00030000000000995897
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 5233
+ 4637
+ 14.016000000000005
+ 5233
+ 0.7465660405620628
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 5233
+ 5148
+ 0.0002000000000066393
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11321
+ 5233
+ -0.00030000000000995897
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 13777
+ 1521
+ -30.013599999999997
+ 13777
+ 0.7075152022423374
+ 13777.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7075152022423374
+
+
+ 4504
+ 1521
+ 179.0781
+ 4504
+ 0.8613054571646633
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8613054571646633
+
+
+ 1521
+ 1162
+ -14.014599999999973
+ 1521
+ 0.79809564832877
+ 1521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.79809564832877
+
+
+ 2483
+ 1521
+ 162.0519
+ 2483
+ 0.8808578303300459
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8808578303300459
+
+
+ 1521
+ 1165
+ -193.09390000000002
+ 1521
+ 0.7278662695152889
+ 1521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7278662695152889
+
+
+ 2478
+ 1521
+ 179.07909999999998
+ 2478
+ 0.8582609406748869
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8582609406748869
+
+
+ 4498
+ 1521
+ -0.002200000000016189
+ 4498
+ 0.9569705693127243
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9569705693127243
+
+
+ 4508
+ 1521
+ 162.05169999999998
+ 4508
+ 0.8688212945633231
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8688212945633231
+
+
+ 4880
+ 270
+ -16.03090000000003
+ 4880
+ 0.7240697964050307
+ 4880.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7240697964050307
+
+
+ 10243
+ 3524
+ -0.0003999999999564352
+ 10243
+ 0.9532720221749758
+ 10243.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9532720221749758
+
+
+ 4565
+ 4334
+ -0.00030000000000995897
+ 4565
+ 0.8771198899569488
+ 4565.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8771198899569488
+
+
+ 3601
+ 2273
+ 9.999999997489795e-05
+ 3601
+ 0.7328172155565831
+ 3601.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7328172155565831
+
+
+ 4536
+ 3601
+ -0.0009999999999763531
+ 4536
+ 0.7271179098619855
+ 4536.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7271179098619855
+
+
+ 1292
+ 208
+ -2.107099999999974
+ 1292
+ 0.7032759991199617
+ 1292.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7032759991199617
+
+
+ 7859
+ 2509
+ -132.04249999999996
+ 7859
+ 0.7132526009100867
+ 7859.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7132526009100867
+
+
+ 7859
+ 3575
+ -0.0007999999999128704
+ 7859
+ 0.8517916300770556
+ 7859.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8517916300770556
+
+
+ 15865
+ 7859
+ 0.00029999999992469384
+ 15865
+ 0.866538765324294
+ 15865.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.866538765324294
+
+
+ 10473
+ 2571
+ -282.06010000000003
+ 10473
+ 0.7208213942070807
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7208213942070807
+
+
+ 28000
+ 2571
+ -134.02200000000005
+ 28000
+ 0.7547707044582108
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7547707044582108
+
+
+ 2571
+ 1
+ 208.04060000000004
+ 2571
+ 0.7371618767548243
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7371618767548243
+
+
+ 2571
+ 9
+ 88.0344
+ 2571
+ 0.7540562167498943
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7540562167498943
+
+
+ 2571
+ 39
+ 134.02140000000009
+ 2571
+ 0.7318855820294969
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7318855820294969
+
+
+ 2571
+ 54
+ 61.99930000000006
+ 2571
+ 0.7416790055364615
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7416790055364615
+
+
+ 2571
+ 58
+ 60.00310000000002
+ 2571
+ 0.7239657642585398
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7239657642585398
+
+
+ 2571
+ 144
+ -14.015699999999924
+ 2571
+ 0.7299623496731551
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7299623496731551
+
+
+ 2571
+ 259
+ 134.02150000000006
+ 2571
+ 0.7502737723068095
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7502737723068095
+
+
+ 2571
+ 1479
+ 85.28370000000007
+ 2571
+ 0.7491507406602997
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7491507406602997
+
+
+ 3521
+ 2571
+ -148.0377000000001
+ 3521
+ 0.8165389890979667
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8165389890979667
+
+
+ 3522
+ 2571
+ -117.99170000000004
+ 3522
+ 0.7676146998110744
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7676146998110744
+
+
+ 4552
+ 2571
+ -88.03390000000002
+ 4552
+ 0.7744121684673706
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7744121684673706
+
+
+ 5160
+ 2571
+ -134.0217
+ 5160
+ 0.7493176962697334
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7493176962697334
+
+
+ 5332
+ 2571
+ 197.08999999999997
+ 5332
+ 0.7258496458165189
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7258496458165189
+
+
+ 2744
+ 1653
+ -72.05759999999998
+ 2744
+ 0.7150388708536548
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7150388708536548
+
+
+ 4785
+ 2744
+ -176.1046
+ 4785
+ 0.7218116059010269
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218116059010269
+
+
+ 2783
+ 2744
+ -88.05180000000007
+ 2783
+ 0.7512775810688698
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7512775810688698
+
+
+ 2744
+ 1487
+ -28.0317
+ 2744
+ 0.7408177973172402
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408177973172402
+
+
+ 2744
+ 2566
+ 60.02060000000006
+ 2744
+ 0.7154742872555986
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7154742872555986
+
+
+ 4679
+ 2744
+ -146.09300000000007
+ 4679
+ 0.7009833121227512
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7009833121227512
+
+
+ 2761
+ 2744
+ -44.02610000000004
+ 2761
+ 0.7210223019702795
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7210223019702795
+
+
+ 2744
+ 1482
+ 15.99509999999998
+ 2744
+ 0.7323444487361321
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7323444487361321
+
+
+ 2744
+ 2726
+ 102.06640000000004
+ 2744
+ 0.741247004643866
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741247004643866
+
+
+ 9004
+ 2526
+ -30.01049999999998
+ 9004
+ 0.8194890271557977
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8194890271557977
+
+
+ 9004
+ 2649
+ -14.014999999999986
+ 9004
+ 0.7254086656447492
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7254086656447492
+
+
+ 9004
+ 2628
+ -15.995599999999968
+ 9004
+ 0.7249770014386758
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7249770014386758
+
+
+ 9004
+ 2573
+ -30.010299999999916
+ 9004
+ 0.7770538357929329
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7770538357929329
+
+
+ 3721
+ 3700
+ 0.0
+ 3721
+ 1.0
+ 3721.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 9385
+ 3721
+ -32.026700000000005
+ 9385
+ 0.741200267986588
+ 9385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741200267986588
+
+
+ 10473
+ 54
+ -220.06079999999997
+ 10473
+ 0.8174700451821512
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8174700451821512
+
+
+ 28000
+ 54
+ -72.02269999999999
+ 28000
+ 0.8713679239404047
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713679239404047
+
+
+ 4573
+ 54
+ 259.08970000000005
+ 4573
+ 0.7176325702530064
+ 4573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7176325702530064
+
+
+ 4605
+ 54
+ 259.08970000000005
+ 4605
+ 0.7107504112769489
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7107504112769489
+
+
+ 54
+ 1
+ 146.04129999999998
+ 54
+ 0.8600493838242864
+ 54.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8600493838242864
+
+
+ 54
+ 9
+ 26.035099999999943
+ 54
+ 0.8255190064801081
+ 54.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8255190064801081
+
+
+ 259
+ 54
+ -72.0222
+ 259
+ 0.8720518924709727
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8720518924709727
+
+
+ 3521
+ 54
+ -86.03840000000002
+ 3521
+ 0.8132745102218348
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8132745102218348
+
+
+ 4552
+ 54
+ -26.034599999999955
+ 4552
+ 0.8399131376257327
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8399131376257327
+
+
+ 3522
+ 54
+ -55.992399999999975
+ 3522
+ 0.8837696154446519
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8837696154446519
+
+
+ 54
+ 32
+ -1.9961000000000695
+ 54
+ 0.7335715439955501
+ 54.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7335715439955501
+
+
+ 54
+ 39
+ 72.02210000000002
+ 54
+ 0.8568703158602033
+ 54.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8568703158602033
+
+
+ 58
+ 54
+ 1.9962000000000444
+ 58
+ 0.8902519124015384
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8902519124015384
+
+
+ 144
+ 54
+ 76.01499999999999
+ 144
+ 0.8683935933895748
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8683935933895748
+
+
+ 1156
+ 54
+ 18.026299999999992
+ 1156
+ 0.8872350593035759
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8872350593035759
+
+
+ 1479
+ 54
+ -23.284400000000005
+ 1479
+ 0.8400716405546794
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8400716405546794
+
+
+ 5160
+ 54
+ -72.02239999999995
+ 5160
+ 0.8737875553979852
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8737875553979852
+
+
+ 5332
+ 54
+ 259.08930000000004
+ 5332
+ 0.7377905260981082
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7377905260981082
+
+
+ 5984
+ 5846
+ 1.9842000000000013
+ 5984
+ 0.7218154561616537
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 5984
+ 5874
+ -0.00010000000000331966
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5984
+ 5889
+ 0.0
+ 5984
+ 0.8713460865906011
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 5984
+ 5914
+ -0.00010000000000331966
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5984
+ 5915
+ 0.0
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5984
+ 5923
+ -0.00010000000000331966
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5984
+ 5935
+ 0.0
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5984
+ 5975
+ 0.0
+ 5984
+ 0.8840320085106907
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 5997
+ 5984
+ 0.0
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6019
+ 5984
+ 0.00010000000000331966
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6038
+ 5984
+ 0.0
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6053
+ 5984
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 14070
+ 3725
+ -88.05110000000002
+ 14070
+ 0.7314355824337173
+ 14070.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7314355824337173
+
+
+ 3528
+ 2703
+ 0.0004000000000132786
+ 3528
+ 0.7139551108853466
+ 3528.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7139551108853466
+
+
+ 11531
+ 5175
+ -0.0002999999999957481
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11531
+ 11101
+ 0.0002000000000066393
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11531
+ 11306
+ 0.00010000000000331966
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11531
+ 11368
+ 0.0
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11531
+ 208
+ 57.01320000000001
+ 11531
+ 0.7720262431782003
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 11531
+ 25
+ 50.010999999999996
+ 11531
+ 0.7765014360319091
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 11531
+ 4637
+ 14.015799999999999
+ 11531
+ 0.7465660405620628
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 11531
+ 5078
+ 0.0
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11531
+ 5148
+ 0.0
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11531
+ 5194
+ -0.00010000000000331966
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11531
+ 11194
+ 0.0002000000000066393
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11531
+ 11270
+ 0.00010000000000331966
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11531
+ 11321
+ 0.00010000000000331966
+ 11531
+ 0.9750631616472476
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 11531
+ 11346
+ 0.0002000000000066393
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11652
+ 11531
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 20565
+ 4840
+ 0.0010000000000331966
+ 20565
+ 1.0000000000000004
+ 20565.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000004
+
+
+ 10258
+ 4766
+ -114.03160000000003
+ 10258
+ 0.7375804166558343
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7375804166558343
+
+
+ 4775
+ 4766
+ 0.016000000000019554
+ 4775
+ 0.7131392959241057
+ 4775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131392959241057
+
+
+ 4766
+ 4584
+ -0.0004999999999881766
+ 4766
+ 0.7885006937241503
+ 4766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7885006937241503
+
+
+ 10240
+ 4766
+ -98.03690000000006
+ 10240
+ 0.8182410879440081
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8182410879440081
+
+
+ 10404
+ 4766
+ -18.009400000000028
+ 10404
+ 0.762398435480709
+ 10404.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.762398435480709
+
+
+ 10473
+ 1479
+ -196.77639999999997
+ 10473
+ 0.8454167968235824
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8454167968235824
+
+
+ 28000
+ 1479
+ -48.73829999999998
+ 28000
+ 0.894383117588947
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.894383117588947
+
+
+ 1479
+ 1
+ 122.75689999999997
+ 1479
+ 0.883918230203027
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.883918230203027
+
+
+ 1479
+ 9
+ 2.750699999999938
+ 1479
+ 0.8730086166578087
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8730086166578087
+
+
+ 4517
+ 1479
+ 117.30990000000008
+ 4517
+ 0.7632326422726833
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7632326422726833
+
+
+ 1479
+ 259
+ 48.73779999999999
+ 1479
+ 0.8892067896656892
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8892067896656892
+
+
+ 3521
+ 1479
+ -62.75400000000002
+ 3521
+ 0.8409396755570241
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8409396755570241
+
+
+ 4552
+ 1479
+ -2.75019999999995
+ 4552
+ 0.887645861600632
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.887645861600632
+
+
+ 3522
+ 1479
+ -32.70799999999997
+ 3522
+ 0.8523829166647449
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8523829166647449
+
+
+ 5160
+ 1479
+ -48.73799999999994
+ 5160
+ 0.8869999185549157
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8869999185549157
+
+
+ 1479
+ 32
+ -25.280500000000075
+ 1479
+ 0.7018764455936631
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7018764455936631
+
+
+ 1479
+ 1156
+ -41.3107
+ 1479
+ 0.7923950103404355
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7923950103404355
+
+
+ 1479
+ 39
+ 48.73770000000002
+ 1479
+ 0.8775357929156127
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8775357929156127
+
+
+ 1479
+ 58
+ -25.28060000000005
+ 1479
+ 0.8510026739707366
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8510026739707366
+
+
+ 1479
+ 144
+ -99.29939999999999
+ 1479
+ 0.8173652956889834
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8173652956889834
+
+
+ 5332
+ 1479
+ 282.37370000000004
+ 5332
+ 0.7027296305220124
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7027296305220124
+
+
+ 10473
+ 4552
+ -194.02620000000002
+ 10473
+ 0.8748516885126687
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8748516885126687
+
+
+ 28000
+ 4552
+ -45.98810000000003
+ 28000
+ 0.9259825825008555
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9259825825008555
+
+
+ 4605
+ 4552
+ 285.1243
+ 4605
+ 0.7013994719346371
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013994719346371
+
+
+ 4552
+ 1
+ 120.00670000000002
+ 4552
+ 0.9219763654232143
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9219763654232143
+
+
+ 4552
+ 9
+ 0.0004999999999881766
+ 4552
+ 0.9240642648860251
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9240642648860251
+
+
+ 4552
+ 4517
+ -120.06010000000003
+ 4552
+ 0.7700678348161261
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7700678348161261
+
+
+ 4552
+ 259
+ 45.98760000000004
+ 4552
+ 0.9281858308123327
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9281858308123327
+
+
+ 4552
+ 3521
+ 60.00380000000007
+ 4552
+ 0.8835358923622343
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8835358923622343
+
+
+ 4552
+ 6
+ 124.96630000000005
+ 4552
+ 0.7826734537901732
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7826734537901732
+
+
+ 4552
+ 32
+ -28.030700000000024
+ 4552
+ 0.7510486539948836
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7510486539948836
+
+
+ 4552
+ 39
+ 45.98750000000007
+ 4552
+ 0.9187737807676389
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9187737807676389
+
+
+ 4552
+ 58
+ -28.0308
+ 4552
+ 0.8957365529041382
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8957365529041382
+
+
+ 4552
+ 144
+ -102.04959999999994
+ 4552
+ 0.8541223296011362
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8541223296011362
+
+
+ 4552
+ 1156
+ -44.06089999999995
+ 4552
+ 0.8313528976678792
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8313528976678792
+
+
+ 4552
+ 3522
+ 29.95780000000002
+ 4552
+ 0.909395745447392
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.909395745447392
+
+
+ 5160
+ 4552
+ -45.98779999999999
+ 5160
+ 0.9356827400842365
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9356827400842365
+
+
+ 5332
+ 4552
+ 285.1239
+ 5332
+ 0.7240060190205946
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7240060190205946
+
+
+ 66
+ 17
+ -0.00029999999998153726
+ 66
+ 0.7334579289692975
+ 66.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7334579289692975
+
+
+ 3678
+ 3666
+ -0.0003000000000383807
+ 3678
+ 0.9999999999999993
+ 3678.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 7661
+ 1296
+ 100.01409999999998
+ 7661
+ 0.7017712844232444
+ 7661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7017712844232444
+
+
+ 4674
+ 1157
+ -0.0001999999999497959
+ 4674
+ 0.9502862836605377
+ 4674.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9502862836605377
+
+
+ 5414
+ 4650
+ -9.999999997489795e-05
+ 5414
+ 1.0
+ 5414.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 8032
+ 7760
+ 84.02159999999998
+ 8032
+ 0.8085707126699289
+ 8032.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8085707126699289
+
+
+ 8032
+ 3551
+ -49.95610000000005
+ 8032
+ 0.8157050843609397
+ 8032.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8157050843609397
+
+
+ 8032
+ 4575
+ -49.95640000000003
+ 8032
+ 0.8591317267743624
+ 8032.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8591317267743624
+
+
+ 8032
+ 7922
+ 32.044899999999984
+ 8032
+ 0.8339546907104021
+ 8032.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8339546907104021
+
+
+ 2494
+ 1447
+ -203.09429999999998
+ 2494
+ 0.7092056383648428
+ 2494.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7092056383648428
+
+
+ 4545
+ 2494
+ -9.999999997489795e-05
+ 4545
+ 0.9676092085480853
+ 4545.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9676092085480853
+
+
+ 7692
+ 3525
+ -0.0004000000000132786
+ 7692
+ 0.7876852642121439
+ 7692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7876852642121439
+
+
+ 3546
+ 1974
+ 50.01479999999998
+ 3546
+ 0.7274443514727357
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7274443514727357
+
+
+ 4537
+ 1974
+ -15.995800000000031
+ 4537
+ 0.7527947147544318
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7527947147544318
+
+
+ 1974
+ 1223
+ 0.0006999999999948159
+ 1974
+ 0.7592455208993265
+ 1974.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7592455208993265
+
+
+ 1974
+ 1967
+ 15.995300000000043
+ 1974
+ 0.7277851264425972
+ 1974.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7277851264425972
+
+
+ 4561
+ 1974
+ -58.007000000000005
+ 4561
+ 0.7302927978407447
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7302927978407447
+
+
+ 4694
+ 1974
+ -74.00110000000001
+ 4694
+ 0.7348902837294414
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7348902837294414
+
+
+ 8321
+ 1974
+ -15.995800000000031
+ 8321
+ 0.7547173181397864
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7547173181397864
+
+
+ 2956
+ 1580
+ 172.10899999999998
+ 2956
+ 0.7225258071301324
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7225258071301324
+
+
+ 2956
+ 2666
+ -0.001599999999996271
+ 2956
+ 0.7475354419199686
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7475354419199686
+
+
+ 4539
+ 2956
+ 46.0068
+ 4539
+ 0.7187834315658752
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7187834315658752
+
+
+ 2956
+ 2644
+ 253.02860000000004
+ 2956
+ 0.7731512753829964
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7731512753829964
+
+
+ 2956
+ 284
+ -31.990800000000036
+ 2956
+ 0.7139539659215133
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7139539659215133
+
+
+ 3667
+ 2956
+ -90.97679999999997
+ 3667
+ 0.8020821809738519
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8020821809738519
+
+
+ 2956
+ 11
+ -43.990800000000036
+ 2956
+ 0.7162702576955093
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7162702576955093
+
+
+ 2956
+ 311
+ -15.997299999999996
+ 2956
+ 0.7873579042970584
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7873579042970584
+
+
+ 2956
+ 1547
+ -86.0897
+ 2956
+ 0.7070815204908488
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7070815204908488
+
+
+ 2956
+ 2575
+ -31.99000000000001
+ 2956
+ 0.742931592465763
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.742931592465763
+
+
+ 3122
+ 2956
+ 0.0009000000000014552
+ 3122
+ 0.8061278686144449
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8061278686144449
+
+
+ 3771
+ 2956
+ 0.0
+ 3771
+ 0.8948147837867757
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8948147837867757
+
+
+ 7731
+ 2956
+ 88.1055
+ 7731
+ 0.7056543299168478
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7056543299168478
+
+
+ 10446
+ 2956
+ 18.011400000000037
+ 10446
+ 0.7601737289579666
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7601737289579666
+
+
+ 4680
+ 3546
+ -144.04190000000006
+ 4680
+ 0.7800016057558642
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7800016057558642
+
+
+ 4680
+ 2692
+ -41.01210000000003
+ 4680
+ 0.7138484718047005
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7138484718047005
+
+
+ 7732
+ 4680
+ 40.07490000000007
+ 7732
+ 0.7158089049934495
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7158089049934495
+
+
+ 4680
+ 4537
+ -78.03130000000004
+ 4680
+ 0.770210669515678
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.770210669515678
+
+
+ 4680
+ 1322
+ -144.04230000000007
+ 4680
+ 0.775404853196002
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.775404853196002
+
+
+ 4680
+ 4581
+ -130.02700000000004
+ 4680
+ 0.7568285840208935
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7568285840208935
+
+
+ 4680
+ 4603
+ -126.03200000000004
+ 4680
+ 0.7402541629406818
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7402541629406818
+
+
+ 4680
+ 1376
+ -158.05800000000005
+ 4680
+ 0.7091981593174528
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7091981593174528
+
+
+ 4680
+ 4500
+ -130.02630000000005
+ 4680
+ 0.817512513516292
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.817512513516292
+
+
+ 7811
+ 4680
+ 110.05850000000004
+ 7811
+ 0.7053544307641921
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7053544307641921
+
+
+ 4680
+ 1164
+ -130.02610000000004
+ 4680
+ 0.8044084869940756
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8044084869940756
+
+
+ 4680
+ 1967
+ -78.03180000000003
+ 4680
+ 0.7672848263809584
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7672848263809584
+
+
+ 4680
+ 4505
+ -20.025900000000092
+ 4680
+ 0.8017851597715531
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8017851597715531
+
+
+ 4680
+ 3901
+ -36.02010000000007
+ 4680
+ 0.7553858664626851
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553858664626851
+
+
+ 4680
+ 1307
+ -130.02690000000007
+ 4680
+ 0.7229940261971953
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7229940261971953
+
+
+ 8341
+ 4680
+ 80.04730000000006
+ 8341
+ 0.7216366301111956
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7216366301111956
+
+
+ 4680
+ 1361
+ -55.90130000000005
+ 4680
+ 0.7620720044510663
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7620720044510663
+
+
+ 4680
+ 4587
+ 12.000699999999938
+ 4680
+ 0.7872820857711293
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872820857711293
+
+
+ 15800
+ 4680
+ 128.04720000000003
+ 15800
+ 0.7548066428301936
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7548066428301936
+
+
+ 7795
+ 4680
+ 41.88620000000003
+ 7795
+ 0.7687114935340048
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7687114935340048
+
+
+ 4680
+ 2544
+ -31.989599999999996
+ 4680
+ 0.7816575074035013
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7816575074035013
+
+
+ 4680
+ 4549
+ -30.01100000000008
+ 4680
+ 0.7572857629544469
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7572857629544469
+
+
+ 4680
+ 1173
+ -62.036500000000046
+ 4680
+ 0.7441128689219894
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7441128689219894
+
+
+ 4680
+ 3766
+ -128.04740000000004
+ 4680
+ 0.7672855768223454
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7672855768223454
+
+
+ 26406
+ 4680
+ 60.05650000000003
+ 26406
+ 0.8003448023100057
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8003448023100057
+
+
+ 4680
+ 1391
+ -160.07360000000006
+ 4680
+ 0.7723934465060225
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7723934465060225
+
+
+ 13633
+ 4680
+ 94.06260000000003
+ 13633
+ 0.7823364938917945
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7823364938917945
+
+
+ 4680
+ 1335
+ -41.88620000000003
+ 4680
+ 0.750078707927228
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.750078707927228
+
+
+ 4680
+ 1449
+ 106.15179999999998
+ 4680
+ 0.7419474268401081
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7419474268401081
+
+
+ 4680
+ 2486
+ -46.00580000000008
+ 4680
+ 0.7251648086881755
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7251648086881755
+
+
+ 4680
+ 2651
+ -176.06800000000004
+ 4680
+ 0.7641313596375523
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7641313596375523
+
+
+ 4680
+ 4524
+ -144.04240000000004
+ 4680
+ 0.8403819892597301
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8403819892597301
+
+
+ 4680
+ 4561
+ -36.02010000000007
+ 4680
+ 0.7749847999209447
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7749847999209447
+
+
+ 4680
+ 4661
+ -44.025600000000054
+ 4680
+ 0.7464250376310991
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7464250376310991
+
+
+ 4694
+ 4680
+ 20.026000000000067
+ 4694
+ 0.7187932819429804
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7187932819429804
+
+
+ 5385
+ 4680
+ 78.03150000000005
+ 5385
+ 0.70736754719684
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.70736754719684
+
+
+ 5505
+ 4680
+ 15.995200000000068
+ 5505
+ 0.8443061802025436
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8443061802025436
+
+
+ 7663
+ 4680
+ 144.07820000000004
+ 7663
+ 0.7409404939031106
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7409404939031106
+
+
+ 7664
+ 4680
+ 178.08350000000007
+ 7664
+ 0.7401707146724892
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7401707146724892
+
+
+ 7665
+ 4680
+ 58.08540000000005
+ 7665
+ 0.7738361465998609
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738361465998609
+
+
+ 7741
+ 4680
+ 76.04750000000007
+ 7741
+ 0.7246156813601827
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7246156813601827
+
+
+ 8321
+ 4680
+ 78.03130000000004
+ 8321
+ 0.8013857434419305
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8013857434419305
+
+
+ 10349
+ 4680
+ 3.995100000000093
+ 10349
+ 0.7123452792320526
+ 10349.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7123452792320526
+
+
+ 10432
+ 4680
+ 116.04690000000005
+ 10432
+ 0.7231269930056997
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7231269930056997
+
+
+ 13590
+ 4680
+ 94.06190000000004
+ 13590
+ 0.7803908193414621
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7803908193414621
+
+
+ 13737
+ 4680
+ 103.06680000000006
+ 13737
+ 0.744109400153339
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.744109400153339
+
+
+ 20868
+ 4680
+ 126.11080000000004
+ 20868
+ 0.7684270096335556
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7684270096335556
+
+
+ 5923
+ 5914
+ 0.0
+ 5923
+ 0.9999999999999993
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5914
+ 5874
+ 0.0
+ 5914
+ 0.9999999999999993
+ 5914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5914
+ 5846
+ 1.9843000000000046
+ 5914
+ 0.7218154561616537
+ 5914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 5915
+ 5914
+ -0.00010000000000331966
+ 5915
+ 0.9999999999999993
+ 5915.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5997
+ 5914
+ -0.00010000000000331966
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6053
+ 5914
+ 0.0
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5975
+ 5914
+ -0.00010000000000331966
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 6038
+ 5914
+ -0.00010000000000331966
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6019
+ 5914
+ 0.0
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5935
+ 5914
+ -0.00010000000000331966
+ 5935
+ 0.9999999999999993
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5914
+ 5889
+ 0.00010000000000331966
+ 5914
+ 0.8713460865906011
+ 5914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 28000
+ 32
+ -74.01880000000006
+ 28000
+ 0.7445432530598621
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7445432530598621
+
+
+ 32
+ 1
+ 148.03740000000005
+ 32
+ 0.7205336097758785
+ 32.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7205336097758785
+
+
+ 32
+ 9
+ 28.031200000000013
+ 32
+ 0.7497690939603564
+ 32.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7497690939603564
+
+
+ 259
+ 32
+ -74.01830000000007
+ 259
+ 0.7599450079285094
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7599450079285094
+
+
+ 3522
+ 32
+ -57.988500000000045
+ 3522
+ 0.7933622742976667
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7933622742976667
+
+
+ 5160
+ 32
+ -74.01850000000002
+ 5160
+ 0.749779306177957
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.749779306177957
+
+
+ 39
+ 32
+ -74.01820000000009
+ 39
+ 0.759282716193409
+ 39.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.759282716193409
+
+
+ 58
+ 32
+ 9.999999997489795e-05
+ 58
+ 0.8195833344377808
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8195833344377808
+
+
+ 144
+ 32
+ 74.01889999999992
+ 144
+ 0.7620865529510146
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7620865529510146
+
+
+ 5923
+ 5846
+ 1.9843000000000046
+ 5923
+ 0.7218154561616537
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 5923
+ 5874
+ 0.0
+ 5923
+ 0.9999999999999993
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5923
+ 5889
+ 0.00010000000000331966
+ 5923
+ 0.8713460865906011
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 5923
+ 5915
+ 0.00010000000000331966
+ 5923
+ 0.9999999999999993
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5935
+ 5923
+ -0.00010000000000331966
+ 5935
+ 0.9999999999999993
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5975
+ 5923
+ -0.00010000000000331966
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 5997
+ 5923
+ -0.00010000000000331966
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6019
+ 5923
+ 0.0
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6038
+ 5923
+ -0.00010000000000331966
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6053
+ 5923
+ 0.0
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 13625
+ 25
+ 23.8395
+ 13625
+ 0.7199434499407491
+ 13625.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7199434499407491
+
+
+ 13625
+ 4637
+ -12.155699999999996
+ 13625
+ 0.7188255563622192
+ 13625.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7188255563622192
+
+
+ 2525
+ 2214
+ -98.0358
+ 2525
+ 0.7711449255876844
+ 2525.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7711449255876844
+
+
+ 13592
+ 2525
+ 100.0521
+ 13592
+ 0.729076151064606
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729076151064606
+
+
+ 4789
+ 2525
+ -15.99470000000008
+ 4789
+ 0.7107772520926079
+ 4789.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7107772520926079
+
+
+ 2525
+ 1222
+ -98.03639999999996
+ 2525
+ 0.7101055290946323
+ 2525.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101055290946323
+
+
+ 1580
+ 1435
+ 341.13149999999996
+ 1580
+ 0.7951619449453317
+ 1580.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7951619449453317
+
+
+ 1435
+ 48
+ -0.00659999999993488
+ 1435
+ 0.8679959638953401
+ 1435.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8679959638953401
+
+
+ 2644
+ 1435
+ 260.2118999999999
+ 2644
+ 0.7666867230930828
+ 2644.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666867230930828
+
+
+ 10473
+ 1
+ -74.0195
+ 10473
+ 0.9642751441502224
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9642751441502224
+
+
+ 28000
+ 1
+ 74.01859999999999
+ 28000
+ 0.9776162616438893
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9776162616438893
+
+
+ 6
+ 1
+ -4.959600000000023
+ 6
+ 0.8340203808876114
+ 6.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8340203808876114
+
+
+ 9
+ 1
+ 120.00620000000004
+ 9
+ 0.9106738456124996
+ 9.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9106738456124996
+
+
+ 39
+ 1
+ 74.01919999999996
+ 39
+ 0.9426245615577298
+ 39.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9426245615577298
+
+
+ 58
+ 1
+ 148.03750000000002
+ 58
+ 0.9157658265037045
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9157658265037045
+
+
+ 144
+ 1
+ 222.05629999999996
+ 144
+ 0.85638792660978
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.85638792660978
+
+
+ 259
+ 1
+ 74.01909999999998
+ 259
+ 0.9703689371875461
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9703689371875461
+
+
+ 1156
+ 1
+ 164.06759999999997
+ 1156
+ 0.877569159180295
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.877569159180295
+
+
+ 3521
+ 1
+ 60.002899999999954
+ 3521
+ 0.9075036901710403
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9075036901710403
+
+
+ 3522
+ 1
+ 90.0489
+ 3522
+ 0.9339784069050829
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9339784069050829
+
+
+ 4517
+ 1
+ 240.06680000000006
+ 4517
+ 0.7814613767487939
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7814613767487939
+
+
+ 5160
+ 1
+ 74.01890000000003
+ 5160
+ 0.9869944594660539
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9869944594660539
+
+
+ 11306
+ 5175
+ -0.00039999999999906777
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11306
+ 11101
+ 0.00010000000000331966
+ 11306
+ 1.0
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11306
+ 25
+ 50.01089999999999
+ 11306
+ 0.7738824635537842
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+
+
+ 11306
+ 208
+ 57.01310000000001
+ 11306
+ 0.702129081776425
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+
+
+ 11306
+ 5078
+ -0.00010000000000331966
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11306
+ 5148
+ -0.00010000000000331966
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11306
+ 5194
+ -0.0002000000000066393
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11306
+ 11194
+ 0.00010000000000331966
+ 11306
+ 1.0
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11306
+ 11270
+ 0.0
+ 11306
+ 1.0
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11321
+ 11306
+ 0.0
+ 11321
+ 0.8985381262898586
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+
+
+ 11346
+ 11306
+ -0.00010000000000331966
+ 11346
+ 1.0
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11368
+ 11306
+ 0.00010000000000331966
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11652
+ 11306
+ 0.00039999999999906777
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 5385
+ 3546
+ -66.0104
+ 5385
+ 0.7545931194580238
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7545931194580238
+
+
+ 5385
+ 1339
+ 42.01030000000003
+ 5385
+ 0.7621143376677103
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7621143376677103
+
+
+ 5385
+ 4537
+ 0.0002000000000066393
+ 5385
+ 0.870214408545168
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.870214408545168
+
+
+ 5385
+ 4581
+ -51.99549999999999
+ 5385
+ 0.7500529061321639
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7500529061321639
+
+
+ 5385
+ 4500
+ -51.9948
+ 5385
+ 0.7678295595384088
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7678295595384088
+
+
+ 5385
+ 1967
+ -0.00029999999998153726
+ 5385
+ 0.8638974835062689
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8638974835062689
+
+
+ 5385
+ 4505
+ 58.00559999999996
+ 5385
+ 0.8189058787485979
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8189058787485979
+
+
+ 13602
+ 5385
+ 32.026099999999985
+ 13602
+ 0.7339270649248313
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7339270649248313
+
+
+ 5385
+ 3901
+ 42.01139999999998
+ 5385
+ 0.8682952590070558
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8682952590070558
+
+
+ 5385
+ 4587
+ 90.03219999999999
+ 5385
+ 0.7271957615648585
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7271957615648585
+
+
+ 5385
+ 4549
+ 48.02049999999997
+ 5385
+ 0.7589154732591672
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7589154732591672
+
+
+ 5385
+ 1173
+ 15.995000000000005
+ 5385
+ 0.7948260281415064
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7948260281415064
+
+
+ 7845
+ 5385
+ 14.018000000000029
+ 7845
+ 0.743077728262811
+ 7845.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.743077728262811
+
+
+ 5385
+ 1391
+ -82.0421
+ 5385
+ 0.7482434230454644
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7482434230454644
+
+
+ 5385
+ 4694
+ 58.005499999999984
+ 5385
+ 0.7409655399191836
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7409655399191836
+
+
+ 5385
+ 2486
+ 32.02569999999997
+ 5385
+ 0.7203011664386312
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7203011664386312
+
+
+ 13590
+ 5385
+ 16.030399999999986
+ 13590
+ 0.7964751130510149
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7964751130510149
+
+
+ 5385
+ 4561
+ 42.01139999999998
+ 5385
+ 0.8399301017751086
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8399301017751086
+
+
+ 5385
+ 1335
+ 36.14530000000002
+ 5385
+ 0.7129054141365812
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7129054141365812
+
+
+ 5385
+ 1555
+ 0.00029999999998153726
+ 5385
+ 0.8238089265441233
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8238089265441233
+
+
+ 5385
+ 1223
+ -15.99490000000003
+ 5385
+ 0.7225189170777
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7225189170777
+
+
+ 5385
+ 2651
+ -98.03649999999999
+ 5385
+ 0.8289296747478798
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8289296747478798
+
+
+ 5385
+ 4661
+ 34.0059
+ 5385
+ 0.7424911177238644
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7424911177238644
+
+
+ 5505
+ 5385
+ -62.03629999999998
+ 5505
+ 0.7071457402935462
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7071457402935462
+
+
+ 8321
+ 5385
+ -0.0002000000000066393
+ 8321
+ 0.8965633623383651
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8965633623383651
+
+
+ 4153
+ 3674
+ 0.0
+ 4153
+ 0.7020630784223871
+ 4153.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7020630784223871
+
+
+ 13660
+ 13642
+ -42.011400000000094
+ 13660
+ 0.7590793634226061
+ 13660.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7590793634226061
+
+
+ 13719
+ 13642
+ 54.008899999999926
+ 13719
+ 0.8936541160535001
+ 13719.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8936541160535001
+
+
+ 4505
+ 3546
+ -124.01599999999996
+ 4505
+ 0.8184436845434377
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8184436845434377
+
+
+ 7732
+ 4505
+ 20.048999999999978
+ 7732
+ 0.7512800364839523
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7512800364839523
+
+
+ 4505
+ 1339
+ -15.99529999999993
+ 4505
+ 0.7820620281045852
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7820620281045852
+
+
+ 4537
+ 4505
+ 58.00539999999995
+ 4537
+ 0.9045818371454345
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9045818371454345
+
+
+ 4505
+ 1322
+ -124.01639999999998
+ 4505
+ 0.7739517366768146
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7739517366768146
+
+
+ 4581
+ 4505
+ 110.00109999999995
+ 4581
+ 0.8181567233131046
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8181567233131046
+
+
+ 4505
+ 1376
+ -138.03209999999996
+ 4505
+ 0.7849737594756034
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7849737594756034
+
+
+ 4505
+ 4500
+ -110.00039999999996
+ 4505
+ 0.8586919663520093
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8586919663520093
+
+
+ 4505
+ 1164
+ -110.00019999999995
+ 4505
+ 0.8274661087472317
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8274661087472317
+
+
+ 4505
+ 1967
+ -58.00589999999994
+ 4505
+ 0.9030674030152854
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9030674030152854
+
+
+ 4505
+ 1173
+ -42.010599999999954
+ 4505
+ 0.8706006993744732
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8706006993744732
+
+
+ 4505
+ 1223
+ -74.00049999999999
+ 4505
+ 0.764881748955613
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.764881748955613
+
+
+ 4505
+ 1240
+ -9.984899999999925
+ 4505
+ 0.761094384828431
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.761094384828431
+
+
+ 4505
+ 1335
+ -21.86029999999994
+ 4505
+ 0.7859407345387118
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7859407345387118
+
+
+ 4505
+ 1361
+ -35.875399999999956
+ 4505
+ 0.8083618986430136
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8083618986430136
+
+
+ 4505
+ 1391
+ -140.04769999999996
+ 4505
+ 0.7912915061928949
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7912915061928949
+
+
+ 4505
+ 1449
+ 126.17770000000007
+ 4505
+ 0.7373213225695963
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7373213225695963
+
+
+ 4505
+ 1555
+ -58.00529999999998
+ 4505
+ 0.8020247607563531
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8020247607563531
+
+
+ 4505
+ 2486
+ -25.979899999999986
+ 4505
+ 0.7711989656464305
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7711989656464305
+
+
+ 4505
+ 2544
+ -11.963699999999903
+ 4505
+ 0.7350881308437993
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7350881308437993
+
+
+ 4505
+ 2651
+ -156.04209999999995
+ 4505
+ 0.8723769290274772
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8723769290274772
+
+
+ 4505
+ 3766
+ -108.02149999999995
+ 4505
+ 0.8129591766460029
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8129591766460029
+
+
+ 4505
+ 3901
+ -15.994199999999978
+ 4505
+ 0.8934456726983816
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8934456726983816
+
+
+ 4505
+ 4452
+ -94.00589999999994
+ 4505
+ 0.7438375122453602
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7438375122453602
+
+
+ 4524
+ 4505
+ 124.01649999999995
+ 4524
+ 0.8366510413626045
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8366510413626045
+
+
+ 4549
+ 4505
+ 9.985099999999989
+ 4549
+ 0.8245601839914916
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8245601839914916
+
+
+ 4561
+ 4505
+ 15.994199999999978
+ 4561
+ 0.8875347397670992
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8875347397670992
+
+
+ 4587
+ 4505
+ -32.02660000000003
+ 4587
+ 0.7965585119392344
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7965585119392344
+
+
+ 4661
+ 4505
+ 23.99969999999996
+ 4661
+ 0.8393598070738519
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8393598070738519
+
+
+ 4694
+ 4505
+ 9.999999997489795e-05
+ 4694
+ 0.8275306387288315
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8275306387288315
+
+
+ 5505
+ 4505
+ -4.030700000000024
+ 5505
+ 0.7431941501769138
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7431941501769138
+
+
+ 7663
+ 4505
+ 124.05229999999995
+ 7663
+ 0.7637474997494679
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7637474997494679
+
+
+ 7664
+ 4505
+ 158.05759999999998
+ 7664
+ 0.7921975368015186
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7921975368015186
+
+
+ 7665
+ 4505
+ 38.05949999999996
+ 7665
+ 0.7965623850055321
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7965623850055321
+
+
+ 8321
+ 4505
+ 58.00539999999995
+ 8321
+ 0.9163043839149274
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9163043839149274
+
+
+ 8341
+ 4505
+ 60.02139999999997
+ 8341
+ 0.7649845927272073
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7649845927272073
+
+
+ 10432
+ 4505
+ 96.02099999999996
+ 10432
+ 0.749425318948823
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.749425318948823
+
+
+ 13590
+ 4505
+ 74.03599999999994
+ 13590
+ 0.854482768277046
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.854482768277046
+
+
+ 13602
+ 4505
+ 90.03169999999994
+ 13602
+ 0.7521639437848847
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7521639437848847
+
+
+ 13633
+ 4505
+ 74.03669999999994
+ 13633
+ 0.8432467740636854
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8432467740636854
+
+
+ 13737
+ 4505
+ 83.04089999999997
+ 13737
+ 0.7716096562402666
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7716096562402666
+
+
+ 15800
+ 4505
+ 108.02129999999994
+ 15800
+ 0.768032409903071
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.768032409903071
+
+
+ 20868
+ 4505
+ 106.08489999999995
+ 20868
+ 0.7616962811885368
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7616962811885368
+
+
+ 26406
+ 4505
+ 40.030599999999936
+ 26406
+ 0.8005887554245333
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8005887554245333
+
+
+ 6053
+ 5874
+ 0.0
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6053
+ 5846
+ 1.9843000000000046
+ 6053
+ 0.7218154561616537
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 6053
+ 5915
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6053
+ 5997
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6053
+ 5889
+ 0.00010000000000331966
+ 6053
+ 0.8713460865906011
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 6053
+ 5935
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6053
+ 5975
+ 0.00010000000000331966
+ 6053
+ 0.8840320085106907
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 6053
+ 6019
+ 0.0
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6053
+ 6038
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 4732
+ 1808
+ 0.0002000000000066393
+ 4732
+ 0.7546122826917636
+ 4732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7546122826917636
+
+
+ 5217
+ 1808
+ 0.0002000000000066393
+ 5217
+ 0.75584360963952
+ 5217.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.75584360963952
+
+
+ 4589
+ 1808
+ 0.00010000000000331966
+ 4589
+ 0.7589707294525772
+ 4589.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7589707294525772
+
+
+ 7667
+ 1808
+ 2.0153999999999996
+ 7667
+ 0.7715785562959148
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7715785562959148
+
+
+ 2519
+ 1482
+ -170.0934000000001
+ 2519
+ 0.703711911912945
+ 2519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.703711911912945
+
+
+ 2519
+ 1599
+ -44.02629999999999
+ 2519
+ 0.9238704997918817
+ 2519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9238704997918817
+
+
+ 2519
+ 1610
+ -70.04169999999999
+ 2519
+ 0.7274457168237762
+ 2519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7274457168237762
+
+
+ 2566
+ 2519
+ 126.06790000000001
+ 2566
+ 0.7276326465032978
+ 2566.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7276326465032978
+
+
+ 5175
+ 4637
+ 14.016099999999994
+ 5175
+ 0.7465660405620628
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 11368
+ 4637
+ 14.015799999999999
+ 11368
+ 0.7465660405620628
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 4637
+ 208
+ 42.99740000000001
+ 4637
+ 0.871356075801677
+ 4637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.871356075801677
+
+
+ 11652
+ 4637
+ 14.016099999999994
+ 11652
+ 0.7465660405620628
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 5194
+ 4637
+ 14.015900000000002
+ 5194
+ 0.7465660405620628
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 4637
+ 25
+ 35.9952
+ 4637
+ 0.8774727995922598
+ 4637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8774727995922598
+
+
+ 5078
+ 4637
+ 14.015799999999999
+ 5078
+ 0.7465660405620628
+ 5078.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 5148
+ 4637
+ 14.015799999999999
+ 5148
+ 0.7465660405620628
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+
+
+ 11321
+ 4637
+ 14.015699999999995
+ 11321
+ 0.7268821477567455
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7268821477567455
+
+
+ 3575
+ 2509
+ -132.04170000000005
+ 3575
+ 0.7033245909625492
+ 3575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7033245909625492
+
+
+ 15865
+ 2509
+ -132.04220000000004
+ 15865
+ 0.7276068594160687
+ 15865.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7276068594160687
+
+
+ 4579
+ 2735
+ -0.0004000000000132786
+ 4579
+ 0.792165344203428
+ 4579.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.792165344203428
+
+
+ 8341
+ 3546
+ -63.99459999999999
+ 8341
+ 0.7759270901915414
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7759270901915414
+
+
+ 8341
+ 7732
+ 39.97239999999999
+ 8341
+ 0.7136253180097863
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7136253180097863
+
+
+ 8341
+ 4537
+ 2.0160000000000196
+ 8341
+ 0.7489470127608895
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7489470127608895
+
+
+ 8341
+ 1322
+ -63.995000000000005
+ 8341
+ 0.7515175135872368
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7515175135872368
+
+
+ 8341
+ 4581
+ -49.97969999999998
+ 8341
+ 0.7400667306197957
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400667306197957
+
+
+ 8341
+ 1967
+ 2.0155000000000314
+ 8341
+ 0.7771101434990049
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7771101434990049
+
+
+ 13602
+ 8341
+ 30.010299999999972
+ 13602
+ 0.7013052097788057
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013052097788057
+
+
+ 8341
+ 3901
+ 44.02719999999999
+ 8341
+ 0.7229945485715048
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7229945485715048
+
+
+ 8341
+ 1307
+ -49.979600000000005
+ 8341
+ 0.7253802735397481
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7253802735397481
+
+
+ 8341
+ 1335
+ 38.16110000000003
+ 8341
+ 0.7367161736731382
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7367161736731382
+
+
+ 8341
+ 1361
+ 24.146000000000015
+ 8341
+ 0.7269405161428262
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7269405161428262
+
+
+ 8341
+ 1391
+ -80.02629999999999
+ 8341
+ 0.7317178577702568
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7317178577702568
+
+
+ 8341
+ 1555
+ 2.0160999999999945
+ 8341
+ 0.7118420686808837
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7118420686808837
+
+
+ 8341
+ 2651
+ -96.02069999999998
+ 8341
+ 0.7970069756725413
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7970069756725413
+
+
+ 8341
+ 3766
+ -48.000099999999975
+ 8341
+ 0.7427551341361719
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7427551341361719
+
+
+ 8341
+ 4524
+ -63.99509999999998
+ 8341
+ 0.7598337334837384
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7598337334837384
+
+
+ 8341
+ 4549
+ 50.03629999999998
+ 8341
+ 0.7356743868601239
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7356743868601239
+
+
+ 8341
+ 4561
+ 44.02719999999999
+ 8341
+ 0.745941374157076
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.745941374157076
+
+
+ 8341
+ 5505
+ 64.0521
+ 8341
+ 0.7106661180464238
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7106661180464238
+
+
+ 8341
+ 7648
+ 19.990800000000036
+ 8341
+ 0.7012459251589551
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7012459251589551
+
+
+ 8341
+ 7664
+ -98.03620000000001
+ 8341
+ 0.7462514134256624
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7462514134256624
+
+
+ 8341
+ 7665
+ 21.961900000000014
+ 8341
+ 0.7541050805070624
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7541050805070624
+
+
+ 8341
+ 8321
+ 2.0160000000000196
+ 8341
+ 0.7674660397558335
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7674660397558335
+
+
+ 10432
+ 8341
+ 35.99959999999999
+ 10432
+ 0.7042929821254559
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7042929821254559
+
+
+ 13590
+ 8341
+ 14.014599999999973
+ 13590
+ 0.8485996815456796
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8485996815456796
+
+
+ 13633
+ 8341
+ 14.015299999999968
+ 13633
+ 0.8597752055099311
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8597752055099311
+
+
+ 13737
+ 8341
+ 23.019499999999994
+ 13737
+ 0.775057774010899
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.775057774010899
+
+
+ 13747
+ 8341
+ 3.994100000000003
+ 13747
+ 0.724360857013356
+ 13747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.724360857013356
+
+
+ 15800
+ 8341
+ 47.99989999999997
+ 15800
+ 0.7186309373984334
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7186309373984334
+
+
+ 26406
+ 8341
+ -19.990800000000036
+ 26406
+ 0.7532714569335062
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7532714569335062
+
+
+ 15865
+ 3575
+ -0.0004999999999881766
+ 15865
+ 0.872070712590737
+ 15865.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.872070712590737
+
+
+ 4502
+ 3533
+ 42.00999999999999
+ 4502
+ 0.7532660745485535
+ 4502.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7532660745485535
+
+
+ 1610
+ 1575
+ -44.02570000000003
+ 1610
+ 0.7786367526493108
+ 1610.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7786367526493108
+
+
+ 2805
+ 1575
+ 88.05250000000001
+ 2805
+ 0.7495674296437889
+ 2805.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7495674296437889
+
+
+ 4620
+ 4589
+ -0.00010000000000331966
+ 4620
+ 0.7700578915328313
+ 4620.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7700578915328313
+
+
+ 3546
+ 1391
+ -16.0317
+ 3546
+ 0.800765151074984
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.800765151074984
+
+
+ 7732
+ 1391
+ -119.99869999999999
+ 7732
+ 0.7236139816059086
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7236139816059086
+
+
+ 4537
+ 1391
+ -82.04230000000001
+ 4537
+ 0.7881234709369317
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7881234709369317
+
+
+ 1391
+ 1322
+ 16.031299999999987
+ 1391
+ 0.7728901130523147
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7728901130523147
+
+
+ 4581
+ 1391
+ -30.046600000000012
+ 4581
+ 0.7672293294154924
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7672293294154924
+
+
+ 1391
+ 1376
+ 2.0156000000000063
+ 1391
+ 0.7551991777537019
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7551991777537019
+
+
+ 4500
+ 1391
+ -30.047300000000007
+ 4500
+ 0.8147937057617602
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8147937057617602
+
+
+ 1391
+ 1164
+ 30.047500000000014
+ 1391
+ 0.8096042696218257
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8096042696218257
+
+
+ 1967
+ 1391
+ -82.04180000000002
+ 1967
+ 0.7833756364338588
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7833756364338588
+
+
+ 13602
+ 1391
+ -50.01600000000002
+ 13602
+ 0.7247169056535181
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7247169056535181
+
+
+ 3901
+ 1391
+ -124.05349999999999
+ 3901
+ 0.7637065187114895
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7637065187114895
+
+
+ 1391
+ 1307
+ 30.046699999999987
+ 1391
+ 0.740794408918305
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.740794408918305
+
+
+ 1391
+ 1361
+ 104.1723
+ 1391
+ 0.7926932806653672
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7926932806653672
+
+
+ 15800
+ 1391
+ -32.026400000000024
+ 15800
+ 0.7861577137215938
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7861577137215938
+
+
+ 4452
+ 1391
+ -46.04180000000002
+ 4452
+ 0.7683817378950843
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7683817378950843
+
+
+ 7795
+ 1391
+ -118.18740000000003
+ 7795
+ 0.779097713027
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.779097713027
+
+
+ 2544
+ 1391
+ -128.08400000000006
+ 2544
+ 0.7127679451672815
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7127679451672815
+
+
+ 4549
+ 1391
+ -130.06259999999997
+ 4549
+ 0.7408028173330308
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408028173330308
+
+
+ 1391
+ 1173
+ 98.03710000000001
+ 1391
+ 0.7662214408356346
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7662214408356346
+
+
+ 3766
+ 1391
+ -32.02620000000002
+ 3766
+ 0.7898003375293212
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7898003375293212
+
+
+ 26406
+ 1391
+ -100.01710000000003
+ 26406
+ 0.7663593050700345
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7663593050700345
+
+
+ 1391
+ 1240
+ 130.06280000000004
+ 1391
+ 0.7352927237600451
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7352927237600451
+
+
+ 1391
+ 1296
+ -64.0693
+ 1391
+ 0.7729868692779378
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7729868692779378
+
+
+ 1391
+ 1335
+ 118.18740000000003
+ 1391
+ 0.7351269585457871
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7351269585457871
+
+
+ 1555
+ 1391
+ -82.04239999999999
+ 1555
+ 0.7272837365357119
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7272837365357119
+
+
+ 2486
+ 1391
+ -114.06779999999998
+ 2486
+ 0.7600574899643697
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7600574899643697
+
+
+ 2651
+ 1391
+ 15.994399999999985
+ 2651
+ 0.8293801689330615
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8293801689330615
+
+
+ 4524
+ 1391
+ -16.031200000000013
+ 4524
+ 0.8240858306782582
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8240858306782582
+
+
+ 4561
+ 1391
+ -124.05349999999999
+ 4561
+ 0.7598518348712169
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7598518348712169
+
+
+ 4661
+ 1391
+ -116.048
+ 4661
+ 0.7867755109532587
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7867755109532587
+
+
+ 4694
+ 1391
+ -140.0476
+ 4694
+ 0.753160938682554
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.753160938682554
+
+
+ 5505
+ 1391
+ -144.0784
+ 5505
+ 0.71471325254805
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.71471325254805
+
+
+ 7663
+ 1391
+ -15.995400000000018
+ 7663
+ 0.8059550302887314
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8059550302887314
+
+
+ 7664
+ 1391
+ 18.009900000000016
+ 7664
+ 0.7611561018922539
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7611561018922539
+
+
+ 7665
+ 1391
+ -101.9882
+ 7665
+ 0.8020819876255036
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8020819876255036
+
+
+ 7741
+ 1391
+ -84.02609999999999
+ 7741
+ 0.7078341044897148
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7078341044897148
+
+
+ 8321
+ 1391
+ -82.04230000000001
+ 8321
+ 0.8246562068791139
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8246562068791139
+
+
+ 10432
+ 1391
+ -44.026700000000005
+ 10432
+ 0.7639380922233755
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7639380922233755
+
+
+ 13590
+ 1391
+ -66.01170000000002
+ 13590
+ 0.7717348669665606
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7717348669665606
+
+
+ 13633
+ 1391
+ -66.01100000000002
+ 13633
+ 0.7931333114375944
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7931333114375944
+
+
+ 13737
+ 1391
+ -57.0068
+ 13737
+ 0.7363553517722539
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7363553517722539
+
+
+ 20868
+ 1391
+ -33.962800000000016
+ 20868
+ 0.7941066986588861
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7941066986588861
+
+
+ 4508
+ 4504
+ -17.026400000000024
+ 4508
+ 0.9285892017216034
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9285892017216034
+
+
+ 4508
+ 1162
+ 148.0371
+ 4508
+ 0.8067044145330626
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8067044145330626
+
+
+ 4508
+ 2483
+ -0.0002000000000066393
+ 4508
+ 0.9199811810374714
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9199811810374714
+
+
+ 4508
+ 4507
+ -31.0419
+ 4508
+ 0.8125404047040253
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8125404047040253
+
+
+ 4508
+ 1165
+ -31.042200000000037
+ 4508
+ 0.850497281703251
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.850497281703251
+
+
+ 4508
+ 2478
+ -17.0274
+ 4508
+ 0.9121955697825159
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9121955697825159
+
+
+ 4508
+ 4498
+ 162.0539
+ 4508
+ 0.8816337404572681
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8816337404572681
+
+
+ 4508
+ 1196
+ -14.016200000000026
+ 4508
+ 0.8202991636270559
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8202991636270559
+
+
+ 5915
+ 5874
+ -0.00010000000000331966
+ 5915
+ 0.9999999999999993
+ 5915.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5915
+ 5846
+ 1.9842000000000013
+ 5915
+ 0.7218154561616537
+ 5915.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 5915
+ 5889
+ 0.0
+ 5915
+ 0.8713460865906011
+ 5915.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 5935
+ 5915
+ 0.0
+ 5935
+ 0.9999999999999993
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5975
+ 5915
+ 0.0
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 5997
+ 5915
+ 0.0
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6019
+ 5915
+ 0.00010000000000331966
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6038
+ 5915
+ 0.0
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 10349
+ 4561
+ -32.02499999999998
+ 10349
+ 0.7415498445588087
+ 10349.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7415498445588087
+
+
+ 10349
+ 5505
+ -12.000099999999975
+ 10349
+ 0.7355534082886129
+ 10349.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7355534082886129
+
+
+ 4510
+ 3525
+ 9.999999997489795e-05
+ 4510
+ 0.774157733279498
+ 4510.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.774157733279498
+
+
+ 1297
+ 103
+ 0.0004999999999881766
+ 1297
+ 0.8627554293869262
+ 1297.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8627554293869262
+
+
+ 1270
+ 103
+ -17.026100000000042
+ 1270
+ 0.8017754365568209
+ 1270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8017754365568209
+
+
+ 1833
+ 1300
+ 9.999999997489795e-05
+ 1833
+ 0.728547024706825
+ 1833.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.728547024706825
+
+
+ 2775
+ 1833
+ 0.00010000000000331966
+ 2775
+ 0.7459060570818405
+ 2775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7459060570818405
+
+
+ 1235
+ 74
+ 0.0004000000000132786
+ 1235
+ 0.786055797481689
+ 1235.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.786055797481689
+
+
+ 5175
+ 5078
+ 0.0002999999999957481
+ 5175
+ 1.0000000000000002
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11101
+ 5078
+ -0.0002000000000066393
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11368
+ 5078
+ 0.0
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5078
+ 208
+ 57.01320000000001
+ 5078
+ 0.7720262431782003
+ 5078.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 11194
+ 5078
+ -0.0002000000000066393
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11652
+ 5078
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5194
+ 5078
+ 0.00010000000000331966
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5078
+ 25
+ 50.010999999999996
+ 5078
+ 0.7765014360319091
+ 5078.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 5148
+ 5078
+ 0.0
+ 5148
+ 1.0000000000000002
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11270
+ 5078
+ -0.00010000000000331966
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11321
+ 5078
+ -0.00010000000000331966
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 11346
+ 5078
+ -0.0002000000000066393
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 4504
+ 4498
+ 179.08030000000002
+ 4504
+ 0.8453577566491115
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8453577566491115
+
+
+ 4498
+ 1162
+ -14.01679999999999
+ 4498
+ 0.790398340203869
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.790398340203869
+
+
+ 4498
+ 2483
+ -162.0541
+ 4498
+ 0.8563098078958857
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8563098078958857
+
+
+ 4498
+ 1165
+ -193.09610000000004
+ 4498
+ 0.7259250361147604
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7259250361147604
+
+
+ 4498
+ 2478
+ -179.0813
+ 4498
+ 0.844114743035717
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.844114743035717
+
+
+ 7690
+ 7658
+ -42.01049999999998
+ 7690
+ 0.7575286975743138
+ 7690.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7575286975743138
+
+
+ 1300
+ 1189
+ 110.10919999999999
+ 1300
+ 0.7179919872004763
+ 1300.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7179919872004763
+
+
+ 1695
+ 1189
+ 60.02069999999998
+ 1695
+ 0.7640836799372503
+ 1695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7640836799372503
+
+
+ 2287
+ 1189
+ -60.02070000000003
+ 2287
+ 0.8097158234639181
+ 2287.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8097158234639181
+
+
+ 3770
+ 1189
+ -73.08940000000001
+ 3770
+ 0.7720521965223384
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720521965223384
+
+
+ 4559
+ 1189
+ 110.10929999999996
+ 4559
+ 0.7444484452052896
+ 4559.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7444484452052896
+
+
+ 5818
+ 1189
+ -62.03580000000005
+ 5818
+ 0.7077613971170813
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7077613971170813
+
+
+ 7731
+ 1189
+ -62.03610000000003
+ 7731
+ 0.7411565177869064
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7411565177869064
+
+
+ 9925
+ 1189
+ 110.10909999999998
+ 9925
+ 0.7636424072720185
+ 9925.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7636424072720185
+
+
+ 20624
+ 1189
+ 110.10969999999998
+ 20624
+ 0.7102586743729451
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7102586743729451
+
+
+ 3400
+ 2632
+ -1.9420000000000073
+ 3400
+ 0.7191438317803823
+ 3400.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7191438317803823
+
+
+ 5818
+ 2632
+ 24.07439999999997
+ 5818
+ 0.7810921428747585
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7810921428747585
+
+
+ 2632
+ 343
+ -98.10969999999998
+ 2632
+ 0.7519081238951925
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7519081238951925
+
+
+ 2632
+ 914
+ -98.10969999999998
+ 2632
+ 0.7133047921176153
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7133047921176153
+
+
+ 2632
+ 1193
+ -10.059300000000007
+ 2632
+ 0.7731979098723929
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7731979098723929
+
+
+ 2632
+ 1419
+ -36.03649999999999
+ 2632
+ 0.7656849912009569
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7656849912009569
+
+
+ 2632
+ 1547
+ -22.058299999999974
+ 2632
+ 0.8078769875644698
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8078769875644698
+
+
+ 3667
+ 2632
+ -155.0082
+ 3667
+ 0.7446562498688012
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7446562498688012
+
+
+ 3770
+ 2632
+ 13.020800000000008
+ 3770
+ 0.81386597831897
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.81386597831897
+
+
+ 7731
+ 2632
+ 24.074099999999987
+ 7731
+ 0.8550201321703159
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8550201321703159
+
+
+ 10446
+ 2632
+ -46.01999999999998
+ 10446
+ 0.7001928679023722
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7001928679023722
+
+
+ 10964
+ 2632
+ 11.00509999999997
+ 10964
+ 0.8231739921866272
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8231739921866272
+
+
+ 7760
+ 4575
+ -133.978
+ 7760
+ 0.8048112641820719
+ 7760.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8048112641820719
+
+
+ 4575
+ 3551
+ 0.00029999999998153726
+ 4575
+ 0.8050693777109803
+ 4575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8050693777109803
+
+
+ 7922
+ 4575
+ -82.00130000000001
+ 7922
+ 0.7964475888619336
+ 7922.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7964475888619336
+
+
+ 1909
+ 531
+ 0.0001999999999782176
+ 1909
+ 0.8564530361506346
+ 1909.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8564530361506346
+
+
+ 2775
+ 1300
+ 0.0001999999999782176
+ 2775
+ 0.7267130312621488
+ 2775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7267130312621488
+
+
+ 4559
+ 1300
+ 9.999999997489795e-05
+ 4559
+ 0.8890369144572587
+ 4559.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8890369144572587
+
+
+ 9925
+ 1300
+ -0.00010000000000331966
+ 9925
+ 0.8515014347282472
+ 9925.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8515014347282472
+
+
+ 20624
+ 1300
+ 0.0004999999999881766
+ 20624
+ 0.8921126397905124
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8921126397905124
+
+
+ 3901
+ 3546
+ -108.02179999999998
+ 3901
+ 0.7986267785785048
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7986267785785048
+
+
+ 7732
+ 3901
+ 4.0548
+ 7732
+ 0.720263780558529
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.720263780558529
+
+
+ 3901
+ 1339
+ -0.001099999999951251
+ 3901
+ 0.7829124925167454
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7829124925167454
+
+
+ 4537
+ 3901
+ 42.011199999999974
+ 4537
+ 0.9123102206161919
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9123102206161919
+
+
+ 3901
+ 3545
+ -0.0004000000000132786
+ 3901
+ 0.7069664844692359
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7069664844692359
+
+
+ 3901
+ 1322
+ -108.0222
+ 3901
+ 0.716720762642518
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.716720762642518
+
+
+ 4581
+ 3901
+ 94.00689999999997
+ 4581
+ 0.7881883118219735
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7881883118219735
+
+
+ 3901
+ 1376
+ -122.03789999999998
+ 3901
+ 0.7393354804793056
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7393354804793056
+
+
+ 4500
+ 3901
+ 94.00619999999998
+ 4500
+ 0.8098481159473523
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8098481159473523
+
+
+ 3901
+ 1164
+ -94.00599999999997
+ 3901
+ 0.7727759370364564
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7727759370364564
+
+
+ 3901
+ 1967
+ -42.01169999999996
+ 3901
+ 0.8851038475254405
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8851038475254405
+
+
+ 13602
+ 3901
+ 74.03749999999997
+ 13602
+ 0.7349957461672803
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7349957461672803
+
+
+ 3901
+ 1173
+ -26.016399999999976
+ 3901
+ 0.8542667557915937
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8542667557915937
+
+
+ 3901
+ 1223
+ -58.00630000000001
+ 3901
+ 0.7337991707265805
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7337991707265805
+
+
+ 3901
+ 1240
+ 6.009300000000053
+ 3901
+ 0.7440381301325522
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7440381301325522
+
+
+ 3901
+ 1335
+ -5.86609999999996
+ 3901
+ 0.7570301306976719
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7570301306976719
+
+
+ 3901
+ 1361
+ -19.88119999999998
+ 3901
+ 0.7692795352087685
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7692795352087685
+
+
+ 3901
+ 1449
+ 142.17190000000005
+ 3901
+ 0.711180924261321
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.711180924261321
+
+
+ 3901
+ 1555
+ -42.0111
+ 3901
+ 0.7791223271828416
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7791223271828416
+
+
+ 3901
+ 2486
+ -9.985700000000008
+ 3901
+ 0.7665400699425919
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7665400699425919
+
+
+ 3901
+ 2651
+ -140.04789999999997
+ 3901
+ 0.8693346212411143
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8693346212411143
+
+
+ 3901
+ 3747
+ -108.0224
+ 3901
+ 0.7153905336534034
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7153905336534034
+
+
+ 3901
+ 3766
+ -92.02729999999997
+ 3901
+ 0.7699170989840913
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7699170989840913
+
+
+ 4524
+ 3901
+ 108.02229999999997
+ 4524
+ 0.7693985851447038
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7693985851447038
+
+
+ 4549
+ 3901
+ -6.0090999999999894
+ 4549
+ 0.7886323424252911
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7886323424252911
+
+
+ 4561
+ 3901
+ 0.0
+ 4561
+ 0.8882423334298266
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8882423334298266
+
+
+ 4587
+ 3901
+ -48.02080000000001
+ 4587
+ 0.7600984691470813
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7600984691470813
+
+
+ 4661
+ 3901
+ 8.005499999999984
+ 4661
+ 0.8278706122504864
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8278706122504864
+
+
+ 4694
+ 3901
+ -15.994100000000003
+ 4694
+ 0.7912988771866627
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7912988771866627
+
+
+ 5505
+ 3901
+ -20.024900000000002
+ 5505
+ 0.7458144163706382
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7458144163706382
+
+
+ 7664
+ 3901
+ 142.0634
+ 7664
+ 0.7215929468073363
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7215929468073363
+
+
+ 7665
+ 3901
+ 22.06529999999998
+ 7665
+ 0.7373184087005229
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7373184087005229
+
+
+ 7795
+ 3901
+ 5.86609999999996
+ 7795
+ 0.7076032232410082
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7076032232410082
+
+
+ 8321
+ 3901
+ 42.011199999999974
+ 8321
+ 0.9161173594539591
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9161173594539591
+
+
+ 13590
+ 3901
+ 58.04179999999997
+ 13590
+ 0.8004474993985049
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8004474993985049
+
+
+ 13633
+ 3901
+ 58.04249999999996
+ 13633
+ 0.785928832559867
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.785928832559867
+
+
+ 13737
+ 3901
+ 67.04669999999999
+ 13737
+ 0.7162572525487072
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7162572525487072
+
+
+ 15800
+ 3901
+ 92.02709999999996
+ 15800
+ 0.7284490405209969
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7284490405209969
+
+
+ 26406
+ 3901
+ 24.036399999999958
+ 26406
+ 0.7170483262935357
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7170483262935357
+
+
+ 11911
+ 1581
+ 0.0
+ 11911
+ 0.7217929561095331
+ 11911.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7217929561095331
+
+
+ 4603
+ 3546
+ -18.009900000000016
+ 4603
+ 0.769910019185847
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.769910019185847
+
+
+ 4603
+ 2692
+ 85.0199
+ 4603
+ 0.7101103934153072
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101103934153072
+
+
+ 4603
+ 4537
+ 48.000699999999995
+ 4603
+ 0.7533581588476521
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7533581588476521
+
+
+ 4603
+ 1322
+ -18.01030000000003
+ 4603
+ 0.7455364355137896
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7455364355137896
+
+
+ 4603
+ 1164
+ -3.994100000000003
+ 4603
+ 0.7553121313311235
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553121313311235
+
+
+ 4603
+ 1173
+ 63.99549999999999
+ 4603
+ 0.7097322326931039
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7097322326931039
+
+
+ 4603
+ 1240
+ 96.02120000000002
+ 4603
+ 0.7002528089721138
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7002528089721138
+
+
+ 4603
+ 1307
+ -3.9949000000000296
+ 4603
+ 0.7520863987187125
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7520863987187125
+
+
+ 4603
+ 1967
+ 48.00020000000001
+ 4603
+ 0.7584250669985092
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7584250669985092
+
+
+ 4603
+ 2651
+ -50.036
+ 4603
+ 0.74751870858087
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.74751870858087
+
+
+ 4603
+ 4500
+ -3.9943000000000097
+ 4603
+ 0.7765163533604051
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765163533604051
+
+
+ 4661
+ 4603
+ -82.00639999999999
+ 4661
+ 0.7564681621816383
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7564681621816383
+
+
+ 7795
+ 4603
+ -84.14580000000001
+ 7795
+ 0.7217796352579398
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7217796352579398
+
+
+ 13633
+ 4603
+ -31.969400000000007
+ 13633
+ 0.7408589644445308
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408589644445308
+
+
+ 15800
+ 4603
+ 2.015199999999993
+ 15800
+ 0.7170282264819776
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7170282264819776
+
+
+ 20868
+ 4603
+ 0.07880000000000109
+ 20868
+ 0.7291606401977068
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7291606401977068
+
+
+ 4504
+ 2483
+ 17.026200000000017
+ 4504
+ 0.9200994886020961
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9200994886020961
+
+
+ 2483
+ 1162
+ 148.03730000000002
+ 2483
+ 0.7620590205240438
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7620590205240438
+
+
+ 2483
+ 1165
+ -31.04200000000003
+ 2483
+ 0.8183562385544039
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8183562385544039
+
+
+ 2483
+ 1196
+ -14.01600000000002
+ 2483
+ 0.7714586040613065
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7714586040613065
+
+
+ 2483
+ 2478
+ -17.027199999999993
+ 2483
+ 0.9164696257744831
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9164696257744831
+
+
+ 4507
+ 2483
+ 31.04169999999999
+ 4507
+ 0.7734535188194261
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7734535188194261
+
+
+ 13826
+ 13664
+ -18.011100000000056
+ 13826
+ 0.7078627454436122
+ 13826.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7078627454436122
+
+
+ 1474
+ 1419
+ 14.015300000000025
+ 1474
+ 0.8565647796733781
+ 1474.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8565647796733781
+
+
+ 1419
+ 270
+ -10.020500000000027
+ 1419
+ 0.7459953716298615
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7459953716298615
+
+
+ 10964
+ 1419
+ -25.03140000000002
+ 10964
+ 0.7999423683421758
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7999423683421758
+
+
+ 1419
+ 1068
+ -62.073199999999986
+ 1419
+ 0.713936690854152
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.713936690854152
+
+
+ 1419
+ 914
+ -62.073199999999986
+ 1419
+ 0.7586938342891549
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7586938342891549
+
+
+ 1419
+ 11
+ 56.07709999999997
+ 1419
+ 0.7066325985269599
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7066325985269599
+
+
+ 1419
+ 343
+ -62.073199999999986
+ 1419
+ 0.7888130845071628
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7888130845071628
+
+
+ 1419
+ 1220
+ -48.05799999999999
+ 1419
+ 0.7168813973290207
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7168813973290207
+
+
+ 1419
+ 1352
+ -28.03109999999998
+ 1419
+ 0.7400977642379214
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400977642379214
+
+
+ 1547
+ 1419
+ -13.978200000000015
+ 1547
+ 0.923673342484428
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.923673342484428
+
+
+ 7731
+ 1419
+ -11.962400000000002
+ 7731
+ 0.7408775165622947
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408775165622947
+
+
+ 11321
+ 5175
+ -0.00039999999999906777
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 11321
+ 11101
+ 0.00010000000000331966
+ 11321
+ 0.8985381262898586
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+
+
+ 11368
+ 11321
+ 0.00010000000000331966
+ 11368
+ 0.9750631616472476
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 11321
+ 208
+ 57.01310000000001
+ 11321
+ 0.765852343141411
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765852343141411
+
+
+ 11321
+ 11194
+ 0.00010000000000331966
+ 11321
+ 0.8985381262898586
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+
+
+ 11652
+ 11321
+ 0.00039999999999906777
+ 11652
+ 0.9750631616472476
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 11321
+ 5194
+ -0.0002000000000066393
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 11321
+ 25
+ 50.01089999999999
+ 11321
+ 0.7632544416367313
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7632544416367313
+
+
+ 11346
+ 11321
+ -0.00010000000000331966
+ 11346
+ 0.8985381262898586
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+
+
+ 11321
+ 11270
+ 0.0
+ 11321
+ 0.8985381262898586
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+
+
+ 11321
+ 5148
+ -0.00010000000000331966
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+
+
+ 10473
+ 4517
+ -314.08630000000005
+ 10473
+ 0.7192267163672981
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7192267163672981
+
+
+ 28000
+ 4517
+ -166.04820000000007
+ 28000
+ 0.7902931798827844
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7902931798827844
+
+
+ 4517
+ 9
+ 120.06060000000002
+ 4517
+ 0.8134920806291412
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8134920806291412
+
+
+ 4517
+ 39
+ 166.0476000000001
+ 4517
+ 0.7874462262392017
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7874462262392017
+
+
+ 4517
+ 144
+ 18.010500000000093
+ 4517
+ 0.7248717465870864
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7248717465870864
+
+
+ 4517
+ 259
+ 166.04770000000008
+ 4517
+ 0.7780783658879453
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7780783658879453
+
+
+ 4517
+ 3521
+ 180.0639000000001
+ 4517
+ 0.7678698025249613
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7678698025249613
+
+
+ 4517
+ 3522
+ 150.01790000000005
+ 4517
+ 0.7162157061890282
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7162157061890282
+
+
+ 5160
+ 4517
+ -166.04790000000003
+ 5160
+ 0.7824695418046577
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7824695418046577
+
+
+ 5332
+ 4517
+ 165.06379999999996
+ 5332
+ 0.7135941911087034
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7135941911087034
+
+
+ 4513
+ 2498
+ -0.0008000000000265572
+ 4513
+ 0.9181613526554788
+ 4513.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9181613526554788
+
+
+ 17228
+ 1653
+ -42.984500000000025
+ 17228
+ 0.8054636093133574
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8054636093133574
+
+
+ 17228
+ 4785
+ 205.17769999999996
+ 17228
+ 0.7319036112564217
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7319036112564217
+
+
+ 17228
+ 2783
+ 117.12490000000003
+ 17228
+ 0.818234410634913
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.818234410634913
+
+
+ 17228
+ 1487
+ 1.0413999999999533
+ 17228
+ 0.8244885250961219
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8244885250961219
+
+
+ 17228
+ 2566
+ 89.09370000000001
+ 17228
+ 0.8349277107414067
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8349277107414067
+
+
+ 17228
+ 1482
+ 45.06819999999993
+ 17228
+ 0.8299794040545694
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8299794040545694
+
+
+ 17228
+ 2726
+ 131.1395
+ 17228
+ 0.7720964080014941
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720964080014941
+
+
+ 17228
+ 2761
+ 73.0992
+ 17228
+ 0.766699813305034
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.766699813305034
+
+
+ 17228
+ 4679
+ 175.16610000000003
+ 17228
+ 0.70612944744713
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.70612944744713
+
+
+ 7741
+ 3546
+ -67.99439999999998
+ 7741
+ 0.7386097227949636
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7386097227949636
+
+
+ 7741
+ 1322
+ -67.9948
+ 7741
+ 0.7805901968315092
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7805901968315092
+
+
+ 7741
+ 1376
+ -82.01049999999998
+ 7741
+ 0.7177993174563163
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7177993174563163
+
+
+ 7741
+ 4500
+ -53.97879999999998
+ 7741
+ 0.7611910379321922
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7611910379321922
+
+
+ 7741
+ 1164
+ -53.97859999999997
+ 7741
+ 0.7725419088013727
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7725419088013727
+
+
+ 7741
+ 1307
+ -53.9794
+ 7741
+ 0.7062213270874391
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7062213270874391
+
+
+ 7741
+ 1361
+ 20.14620000000002
+ 7741
+ 0.7496258867626713
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7496258867626713
+
+
+ 7741
+ 4587
+ 88.04820000000001
+ 7741
+ 0.7016257270130307
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7016257270130307
+
+
+ 15800
+ 7741
+ 51.99969999999996
+ 15800
+ 0.729078952754635
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729078952754635
+
+
+ 7741
+ 4452
+ -37.98429999999996
+ 7741
+ 0.7401356438768415
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7401356438768415
+
+
+ 7795
+ 7741
+ -34.16130000000004
+ 7795
+ 0.7286391437550137
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7286391437550137
+
+
+ 7741
+ 4549
+ 46.03649999999999
+ 7741
+ 0.7154371818821299
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7154371818821299
+
+
+ 7741
+ 3766
+ -51.99989999999997
+ 7741
+ 0.74114820663649
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.74114820663649
+
+
+ 26406
+ 7741
+ -15.991000000000042
+ 26406
+ 0.7104716171156424
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7104716171156424
+
+
+ 13633
+ 7741
+ 18.01509999999996
+ 13633
+ 0.7495427659800147
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7495427659800147
+
+
+ 7741
+ 7663
+ -68.03069999999997
+ 7741
+ 0.7573029837951863
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7573029837951863
+
+
+ 7741
+ 1449
+ 182.19930000000005
+ 7741
+ 0.7407467081063229
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7407467081063229
+
+
+ 7741
+ 4524
+ -67.99489999999997
+ 7741
+ 0.7669785024341733
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7669785024341733
+
+
+ 7741
+ 5505
+ 60.0523
+ 7741
+ 0.7293527236137134
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7293527236137134
+
+
+ 7741
+ 7664
+ -102.036
+ 7741
+ 0.7491937023293509
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7491937023293509
+
+
+ 7741
+ 7665
+ 17.96210000000002
+ 7741
+ 0.745626563152205
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.745626563152205
+
+
+ 10432
+ 7741
+ 39.99939999999998
+ 10432
+ 0.7267417563890028
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7267417563890028
+
+
+ 20868
+ 7741
+ 50.06329999999997
+ 20868
+ 0.7666512184092706
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666512184092706
+
+
+ 2526
+ 302
+ -15.99529999999993
+ 2526
+ 0.8483241543578606
+ 2526.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8483241543578606
+
+
+ 2573
+ 302
+ -15.995499999999993
+ 2573
+ 0.8485105842401559
+ 2573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8485105842401559
+
+
+ 2628
+ 302
+ -30.01019999999994
+ 2628
+ 0.7916821797360637
+ 2628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7916821797360637
+
+
+ 15800
+ 3546
+ -15.994700000000023
+ 15800
+ 0.7817084441334194
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7817084441334194
+
+
+ 15800
+ 2692
+ 87.0351
+ 15800
+ 0.7393912663577968
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7393912663577968
+
+
+ 15800
+ 4537
+ 50.01589999999999
+ 15800
+ 0.7719323952478938
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7719323952478938
+
+
+ 15800
+ 1322
+ -15.995100000000036
+ 15800
+ 0.8172255859271971
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8172255859271971
+
+
+ 15800
+ 4581
+ -1.9798000000000116
+ 15800
+ 0.760378185180544
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.760378185180544
+
+
+ 15800
+ 1376
+ -30.010800000000017
+ 15800
+ 0.7609240137616035
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7609240137616035
+
+
+ 15800
+ 4500
+ -1.9791000000000167
+ 15800
+ 0.8232978691252866
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8232978691252866
+
+
+ 15800
+ 1164
+ -1.97890000000001
+ 15800
+ 0.8431164492693155
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8431164492693155
+
+
+ 15800
+ 1967
+ 50.0154
+ 15800
+ 0.7564190073277763
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7564190073277763
+
+
+ 15800
+ 1307
+ -1.9797000000000367
+ 15800
+ 0.7573371015885881
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7573371015885881
+
+
+ 15800
+ 1361
+ 72.14589999999998
+ 15800
+ 0.8009784565091245
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8009784565091245
+
+
+ 15800
+ 4587
+ 140.04789999999997
+ 15800
+ 0.7132426437238941
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7132426437238941
+
+
+ 15800
+ 1173
+ 66.01069999999999
+ 15800
+ 0.7690282771788319
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7690282771788319
+
+
+ 15800
+ 1240
+ 98.03640000000001
+ 15800
+ 0.7642349615903177
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7642349615903177
+
+
+ 15800
+ 1296
+ -96.09570000000002
+ 15800
+ 0.7447257044525522
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7447257044525522
+
+
+ 15800
+ 1335
+ 86.161
+ 15800
+ 0.7618111101612669
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7618111101612669
+
+
+ 15800
+ 1449
+ 234.199
+ 15800
+ 0.7553252759054714
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553252759054714
+
+
+ 15800
+ 2486
+ 82.04139999999995
+ 15800
+ 0.7530954520468246
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7530954520468246
+
+
+ 15800
+ 2544
+ 96.05760000000004
+ 15800
+ 0.7548864073299639
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7548864073299639
+
+
+ 15800
+ 2651
+ -48.02080000000001
+ 15800
+ 0.7856431270312557
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7856431270312557
+
+
+ 15800
+ 3766
+ -0.0002000000000066393
+ 15800
+ 0.8113217027065613
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8113217027065613
+
+
+ 15800
+ 4452
+ 14.0154
+ 15800
+ 0.7568661996005069
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7568661996005069
+
+
+ 15800
+ 4524
+ -15.995200000000011
+ 15800
+ 0.819855384328007
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.819855384328007
+
+
+ 15800
+ 4549
+ 98.03619999999995
+ 15800
+ 0.7460012191930722
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7460012191930722
+
+
+ 15800
+ 4561
+ 92.02709999999996
+ 15800
+ 0.7922908474958144
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7922908474958144
+
+
+ 15800
+ 4661
+ 84.02159999999998
+ 15800
+ 0.7775160588686607
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7775160588686607
+
+
+ 15800
+ 4694
+ 108.02119999999996
+ 15800
+ 0.7160817571688121
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7160817571688121
+
+
+ 15800
+ 5505
+ 112.05199999999996
+ 15800
+ 0.7170221579319435
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7170221579319435
+
+
+ 15800
+ 7663
+ -16.031000000000006
+ 15800
+ 0.8049762074567792
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8049762074567792
+
+
+ 15800
+ 7664
+ -50.03630000000004
+ 15800
+ 0.8028375099881336
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8028375099881336
+
+
+ 15800
+ 7665
+ 69.96179999999998
+ 15800
+ 0.7889903226174295
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7889903226174295
+
+
+ 15800
+ 7795
+ 86.161
+ 15800
+ 0.7845781413894442
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7845781413894442
+
+
+ 15800
+ 8321
+ 50.01589999999999
+ 15800
+ 0.7948691325691517
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7948691325691517
+
+
+ 15800
+ 10432
+ 12.000299999999982
+ 15800
+ 0.7798997990375811
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7798997990375811
+
+
+ 15800
+ 13590
+ 33.985299999999995
+ 15800
+ 0.8213964988253492
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8213964988253492
+
+
+ 15800
+ 13633
+ 33.9846
+ 15800
+ 0.8087240378103366
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8087240378103366
+
+
+ 20868
+ 15800
+ -1.936399999999992
+ 20868
+ 0.8181347275502544
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8181347275502544
+
+
+ 26406
+ 15800
+ -67.9907
+ 26406
+ 0.7639985801589267
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7639985801589267
+
+
+ 5042
+ 3530
+ 0.0003999999999564352
+ 5042
+ 0.7976533641382213
+ 5042.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7976533641382213
+
+
+ 13641
+ 4655
+ 2.015700000000038
+ 13641
+ 0.7199269967173689
+ 13641.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7199269967173689
+
+
+ 4030
+ 2487
+ -0.00029999999998153726
+ 4030
+ 0.785609653760605
+ 4030.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.785609653760605
+
+
+ 11270
+ 5175
+ -0.00039999999999906777
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11270
+ 11101
+ 0.00010000000000331966
+ 11270
+ 1.0
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11368
+ 11270
+ 0.00010000000000331966
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11270
+ 208
+ 57.01310000000001
+ 11270
+ 0.702129081776425
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+
+
+ 11270
+ 11194
+ 0.00010000000000331966
+ 11270
+ 1.0
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11652
+ 11270
+ 0.00039999999999906777
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11270
+ 5194
+ -0.0002000000000066393
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11270
+ 25
+ 50.01089999999999
+ 11270
+ 0.7738824635537842
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+
+
+ 11346
+ 11270
+ -0.00010000000000331966
+ 11346
+ 1.0
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11270
+ 5148
+ -0.00010000000000331966
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 7835
+ 2214
+ -82.00459999999998
+ 7835
+ 0.7180987417961967
+ 7835.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7180987417961967
+
+
+ 7724
+ 2214
+ -133.97770000000003
+ 7724
+ 0.7009794374884741
+ 7724.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7009794374884741
+
+
+ 2214
+ 1222
+ -0.0005999999999630745
+ 2214
+ 0.8014134160565736
+ 2214.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8014134160565736
+
+
+ 4789
+ 2214
+ -114.03050000000007
+ 4789
+ 0.7791600208727472
+ 4789.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7791600208727472
+
+
+ 13592
+ 2214
+ 2.016300000000001
+ 13592
+ 0.8167228591886702
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8167228591886702
+
+
+ 13698
+ 2214
+ -96.02089999999998
+ 13698
+ 0.7635908547626653
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7635908547626653
+
+
+ 1787
+ 1169
+ 240.24469999999997
+ 1787
+ 0.8089668976663382
+ 1787.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8089668976663382
+
+
+ 1787
+ 1310
+ 2.0159999999999627
+ 1787
+ 0.9252442424948043
+ 1787.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9252442424948043
+
+
+ 3285
+ 1787
+ -260.2142
+ 3285
+ 0.7920565288964205
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7920565288964205
+
+
+ 7835
+ 1222
+ -82.00519999999995
+ 7835
+ 0.709539557581635
+ 7835.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.709539557581635
+
+
+ 13890
+ 1222
+ -84.02049999999997
+ 13890
+ 0.7156837067327453
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7156837067327453
+
+
+ 13592
+ 1222
+ 2.015700000000038
+ 13592
+ 0.7477499036312675
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7477499036312675
+
+
+ 13698
+ 1222
+ -96.02149999999995
+ 13698
+ 0.7271309009405365
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7271309009405365
+
+
+ 7922
+ 7760
+ 51.976699999999994
+ 7922
+ 0.7493273355129844
+ 7922.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7493273355129844
+
+
+ 7922
+ 3551
+ -82.00100000000003
+ 7922
+ 0.7298147378155309
+ 7922.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7298147378155309
+
+
+ 4537
+ 2544
+ 46.04170000000005
+ 4537
+ 0.7380919239026524
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7380919239026524
+
+
+ 4567
+ 2544
+ -15.994699999999966
+ 4567
+ 0.704477122684575
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.704477122684575
+
+
+ 2544
+ 1322
+ -112.05270000000007
+ 2544
+ 0.7489921009280045
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7489921009280045
+
+
+ 4581
+ 2544
+ 98.03740000000005
+ 4581
+ 0.7214398478219913
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7214398478219913
+
+
+ 4500
+ 2544
+ 98.03670000000005
+ 4500
+ 0.8551008002614906
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8551008002614906
+
+
+ 2544
+ 1164
+ -98.03650000000005
+ 2544
+ 0.8585229058312428
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8585229058312428
+
+
+ 2544
+ 1967
+ -46.04220000000004
+ 2544
+ 0.7284826966974305
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7284826966974305
+
+
+ 2544
+ 1307
+ -98.03730000000007
+ 2544
+ 0.7633955088376531
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7633955088376531
+
+
+ 2544
+ 1361
+ -23.911700000000053
+ 2544
+ 0.7570740316140101
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7570740316140101
+
+
+ 4452
+ 2544
+ 82.04220000000004
+ 4452
+ 0.7213103171032356
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7213103171032356
+
+
+ 7795
+ 2544
+ 9.896600000000035
+ 7795
+ 0.7363897619908474
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7363897619908474
+
+
+ 2544
+ 1335
+ -9.896600000000035
+ 2544
+ 0.7277026380379605
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7277026380379605
+
+
+ 3747
+ 2544
+ 112.05290000000008
+ 3747
+ 0.7061651010380983
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7061651010380983
+
+
+ 3766
+ 2544
+ 96.05780000000004
+ 3766
+ 0.7582101984061722
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7582101984061722
+
+
+ 4524
+ 2544
+ 112.05280000000005
+ 4524
+ 0.8062708443350486
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8062708443350486
+
+
+ 4549
+ 2544
+ -1.9785999999999149
+ 4549
+ 0.7101893059577633
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101893059577633
+
+
+ 4561
+ 2544
+ 4.030500000000075
+ 4561
+ 0.7478422360696972
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7478422360696972
+
+
+ 5505
+ 2544
+ -15.994399999999928
+ 5505
+ 0.7197778369345904
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7197778369345904
+
+
+ 7663
+ 2544
+ 112.08860000000004
+ 7663
+ 0.7116160179163658
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7116160179163658
+
+
+ 7664
+ 2544
+ 146.09390000000008
+ 7664
+ 0.7109969803049567
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7109969803049567
+
+
+ 7665
+ 2544
+ 26.095800000000054
+ 7665
+ 0.7368547245943449
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7368547245943449
+
+
+ 8321
+ 2544
+ 46.04170000000005
+ 8321
+ 0.7424776185651933
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7424776185651933
+
+
+ 10432
+ 2544
+ 84.05730000000005
+ 10432
+ 0.7179667346358121
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7179667346358121
+
+
+ 20868
+ 2544
+ 94.12120000000004
+ 20868
+ 0.7413723397345189
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7413723397345189
+
+
+ 26406
+ 2544
+ 28.066900000000032
+ 26406
+ 0.7033336176859568
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7033336176859568
+
+
+ 13602
+ 1967
+ 32.025800000000004
+ 13602
+ 0.7568093433097334
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7568093433097334
+
+
+ 13602
+ 1173
+ 48.02109999999999
+ 13602
+ 0.7192679648615851
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7192679648615851
+
+
+ 13602
+ 1335
+ 68.1714
+ 13602
+ 0.7048439651102361
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7048439651102361
+
+
+ 13602
+ 2651
+ -66.0104
+ 13602
+ 0.7473287193669091
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7473287193669091
+
+
+ 13602
+ 4561
+ 74.03749999999997
+ 13602
+ 0.7517028681517817
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7517028681517817
+
+
+ 13602
+ 4694
+ 90.03159999999997
+ 13602
+ 0.7077281953175483
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7077281953175483
+
+
+ 13602
+ 8321
+ 32.02629999999999
+ 13602
+ 0.7587088605025054
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7587088605025054
+
+
+ 13602
+ 13590
+ 15.9957
+ 13602
+ 0.7369496786181469
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7369496786181469
+
+
+ 13633
+ 13602
+ -15.995000000000005
+ 13633
+ 0.7459414766950121
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7459414766950121
+
+
+ 13592
+ 7835
+ 84.02089999999998
+ 13592
+ 0.736481821868582
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.736481821868582
+
+
+ 13698
+ 7835
+ -14.016300000000001
+ 13698
+ 0.7578997074075979
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7578997074075979
+
+
+ 13890
+ 7835
+ -2.0153000000000247
+ 13890
+ 0.7365717636569858
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7365717636569858
+
+
+ 11346
+ 5175
+ -0.0005000000000023874
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11346
+ 11101
+ 0.0
+ 11346
+ 1.0
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11368
+ 11346
+ 0.0002000000000066393
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11346
+ 208
+ 57.013000000000005
+ 11346
+ 0.702129081776425
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+
+
+ 11346
+ 11194
+ 0.0
+ 11346
+ 1.0
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11652
+ 11346
+ 0.0005000000000023874
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11346
+ 5194
+ -0.00030000000000995897
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11346
+ 25
+ 50.01079999999999
+ 11346
+ 0.7738824635537842
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+
+
+ 11346
+ 5148
+ -0.0002000000000066393
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 7732
+ 5505
+ 24.079700000000003
+ 7732
+ 0.7074424704280009
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7074424704280009
+
+
+ 5505
+ 1322
+ -128.0471
+ 5505
+ 0.7178175153518717
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7178175153518717
+
+
+ 5505
+ 4581
+ -114.03179999999998
+ 5505
+ 0.7354887266585726
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7354887266585726
+
+
+ 5505
+ 1361
+ -39.90609999999998
+ 5505
+ 0.7442508097541658
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7442508097541658
+
+
+ 5505
+ 4587
+ 27.995900000000006
+ 5505
+ 0.7048213922072288
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7048213922072288
+
+
+ 7795
+ 5505
+ 25.890999999999963
+ 7795
+ 0.7128781011073293
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7128781011073293
+
+
+ 5505
+ 4549
+ -14.015800000000013
+ 5505
+ 0.728465657121335
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.728465657121335
+
+
+ 5505
+ 1173
+ -46.04129999999998
+ 5505
+ 0.7104731823627322
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7104731823627322
+
+
+ 5505
+ 3766
+ -112.05219999999997
+ 5505
+ 0.744497373587699
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.744497373587699
+
+
+ 26406
+ 5505
+ 44.06129999999996
+ 26406
+ 0.7064145740776412
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7064145740776412
+
+
+ 13633
+ 5505
+ 78.06739999999996
+ 13633
+ 0.7393173941571789
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7393173941571789
+
+
+ 5505
+ 1449
+ 122.14700000000005
+ 5505
+ 0.7435029818295574
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7435029818295574
+
+
+ 7665
+ 5505
+ 42.09019999999998
+ 7665
+ 0.7300539674084
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7300539674084
+
+
+ 13590
+ 5505
+ 78.06669999999997
+ 13590
+ 0.7419163021891946
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7419163021891946
+
+
+ 5505
+ 4561
+ -20.024900000000002
+ 5505
+ 0.7851440633438795
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7851440633438795
+
+
+ 5505
+ 1335
+ -25.890999999999963
+ 5505
+ 0.7075849672525388
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7075849672525388
+
+
+ 5505
+ 1555
+ -62.036
+ 5505
+ 0.7048616280388553
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7048616280388553
+
+
+ 5505
+ 4524
+ -128.04719999999998
+ 5505
+ 0.7667207769494101
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7667207769494101
+
+
+ 8321
+ 5505
+ 62.036099999999976
+ 8321
+ 0.7585235715091996
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7585235715091996
+
+
+ 13837
+ 1447
+ -9.999999997489795e-05
+ 13837
+ 0.8418061362151604
+ 13837.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8418061362151604
+
+
+ 5812
+ 31
+ 9.999999997489795e-05
+ 5812
+ 0.8088103418118395
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8088103418118395
+
+
+ 4573
+ 31
+ 0.0002000000000066393
+ 4573
+ 0.8525644493026685
+ 4573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8525644493026685
+
+
+ 4605
+ 31
+ 0.0002000000000066393
+ 4605
+ 0.8654175321593224
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8654175321593224
+
+
+ 144
+ 31
+ -183.07450000000006
+ 144
+ 0.7466063258671614
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7466063258671614
+
+
+ 5332
+ 31
+ -0.0002000000000066393
+ 5332
+ 0.9038893217453352
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9038893217453352
+
+
+ 10473
+ 259
+ -148.03859999999997
+ 10473
+ 0.9303156766492804
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9303156766492804
+
+
+ 28000
+ 259
+ -0.0004999999999881766
+ 28000
+ 0.9688601617875283
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9688601617875283
+
+
+ 259
+ 9
+ -45.987100000000055
+ 259
+ 0.9094629015767763
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9094629015767763
+
+
+ 259
+ 6
+ 78.9787
+ 259
+ 0.8014320567830068
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8014320567830068
+
+
+ 259
+ 39
+ -9.999999997489795e-05
+ 259
+ 0.9320185669648622
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9320185669648622
+
+
+ 259
+ 58
+ -74.01840000000004
+ 259
+ 0.9231424352876622
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9231424352876622
+
+
+ 259
+ 144
+ -148.03719999999998
+ 259
+ 0.8894556703011156
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8894556703011156
+
+
+ 1156
+ 259
+ 90.04849999999999
+ 1156
+ 0.8744187177089171
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8744187177089171
+
+
+ 3521
+ 259
+ -14.016200000000026
+ 3521
+ 0.8887614710882479
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8887614710882479
+
+
+ 3522
+ 259
+ 16.029800000000023
+ 3522
+ 0.9379852161625506
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9379852161625506
+
+
+ 5160
+ 259
+ -0.0001999999999497959
+ 5160
+ 0.9764810735522207
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9764810735522207
+
+
+ 5332
+ 259
+ 331.11150000000004
+ 5332
+ 0.7243173610498788
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7243173610498788
+
+
+ 7690
+ 7643
+ 196.2203
+ 7690
+ 0.7519810960809139
+ 7690.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7519810960809139
+
+
+ 3546
+ 2651
+ -32.026099999999985
+ 3546
+ 0.8808349437480676
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8808349437480676
+
+
+ 7732
+ 2651
+ -135.99309999999997
+ 7732
+ 0.74121828904961
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.74121828904961
+
+
+ 4537
+ 2651
+ -98.0367
+ 4537
+ 0.9033965552683112
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9033965552683112
+
+
+ 2651
+ 1322
+ 32.02569999999997
+ 2651
+ 0.7953512722010212
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7953512722010212
+
+
+ 4581
+ 2651
+ -46.041
+ 4581
+ 0.8284110892248467
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8284110892248467
+
+
+ 2651
+ 1376
+ 18.00999999999999
+ 2651
+ 0.7888766189924247
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7888766189924247
+
+
+ 4500
+ 2651
+ -46.04169999999999
+ 4500
+ 0.8505058423377839
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8505058423377839
+
+
+ 2651
+ 1164
+ 46.0419
+ 2651
+ 0.8393083375672916
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8393083375672916
+
+
+ 2651
+ 1967
+ 98.03620000000001
+ 2651
+ 0.8990655282270313
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8990655282270313
+
+
+ 2651
+ 1307
+ 46.04109999999997
+ 2651
+ 0.7820144490221412
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7820144490221412
+
+
+ 2651
+ 1361
+ 120.16669999999999
+ 2651
+ 0.8005374901845411
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8005374901845411
+
+
+ 4587
+ 2651
+ -188.06869999999998
+ 4587
+ 0.7596284364956462
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7596284364956462
+
+
+ 7795
+ 2651
+ -134.1818
+ 7795
+ 0.7613546055814798
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7613546055814798
+
+
+ 4549
+ 2651
+ -146.05699999999996
+ 4549
+ 0.8240907410764096
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8240907410764096
+
+
+ 2651
+ 1173
+ 114.0315
+ 2651
+ 0.8433366828124125
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8433366828124125
+
+
+ 3766
+ 2651
+ -48.0206
+ 3766
+ 0.8094555287107692
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8094555287107692
+
+
+ 26406
+ 2651
+ -116.01150000000001
+ 26406
+ 0.7877225539190854
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7877225539190854
+
+
+ 2651
+ 1240
+ 146.05720000000002
+ 2651
+ 0.7539953306178886
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7539953306178886
+
+
+ 13633
+ 2651
+ -82.00540000000001
+ 13633
+ 0.8478312154403914
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8478312154403914
+
+
+ 7663
+ 2651
+ -31.989800000000002
+ 7663
+ 0.7785434241988556
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785434241988556
+
+
+ 4694
+ 2651
+ -156.04199999999997
+ 4694
+ 0.7842413249915663
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7842413249915663
+
+
+ 7665
+ 2651
+ -117.98259999999999
+ 7665
+ 0.7962448899259598
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7962448899259598
+
+
+ 10432
+ 2651
+ -60.02109999999999
+ 10432
+ 0.7428840754214225
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7428840754214225
+
+
+ 2651
+ 2486
+ 130.06219999999996
+ 2651
+ 0.791436045752686
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.791436045752686
+
+
+ 13590
+ 2651
+ -82.0061
+ 13590
+ 0.8608089673709161
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8608089673709161
+
+
+ 4561
+ 2651
+ -140.04789999999997
+ 4561
+ 0.8504358592722726
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8504358592722726
+
+
+ 2651
+ 1335
+ 134.1818
+ 2651
+ 0.7457281536467055
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7457281536467055
+
+
+ 2651
+ 1555
+ 98.03679999999997
+ 2651
+ 0.8018020849655252
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8018020849655252
+
+
+ 7664
+ 2651
+ 2.0155000000000314
+ 7664
+ 0.8088380321705324
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8088380321705324
+
+
+ 20868
+ 2651
+ -49.9572
+ 20868
+ 0.7864505385279323
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7864505385279323
+
+
+ 2651
+ 1223
+ 82.04159999999996
+ 2651
+ 0.7698929772729828
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7698929772729828
+
+
+ 3747
+ 2651
+ -32.025499999999965
+ 3747
+ 0.7413662410182501
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7413662410182501
+
+
+ 4524
+ 2651
+ -32.0256
+ 4524
+ 0.8267091592822178
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8267091592822178
+
+
+ 4661
+ 2651
+ -132.0424
+ 4661
+ 0.8265321511561059
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8265321511561059
+
+
+ 8321
+ 2651
+ -98.0367
+ 8321
+ 0.9058132096131649
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9058132096131649
+
+
+ 13737
+ 2651
+ -73.00119999999998
+ 13737
+ 0.8105628134115304
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8105628134115304
+
+
+ 10473
+ 3522
+ -164.0684
+ 10473
+ 0.8962861204492923
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8962861204492923
+
+
+ 28000
+ 3522
+ -16.03030000000001
+ 28000
+ 0.9348537887921984
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9348537887921984
+
+
+ 4605
+ 3522
+ 315.0821
+ 4605
+ 0.7234965796979789
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7234965796979789
+
+
+ 3522
+ 9
+ -29.957300000000032
+ 3522
+ 0.907042598815542
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.907042598815542
+
+
+ 3522
+ 3521
+ 30.04600000000005
+ 3522
+ 0.8646445338991484
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8646445338991484
+
+
+ 3522
+ 6
+ 95.00850000000003
+ 3522
+ 0.7698400094191002
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7698400094191002
+
+
+ 3522
+ 39
+ 16.029700000000048
+ 3522
+ 0.9046002136490963
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9046002136490963
+
+
+ 3522
+ 58
+ -57.98860000000002
+ 3522
+ 0.935735963021777
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.935735963021777
+
+
+ 3522
+ 144
+ -132.00739999999996
+ 3522
+ 0.9045970545028876
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9045970545028876
+
+
+ 3522
+ 1156
+ -74.01869999999997
+ 3522
+ 0.909033707816147
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.909033707816147
+
+
+ 5160
+ 3522
+ -16.029999999999973
+ 5160
+ 0.9474264366025622
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9474264366025622
+
+
+ 5332
+ 3522
+ 315.0817
+ 5332
+ 0.7252414990129397
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7252414990129397
+
+
+ 13590
+ 3546
+ -49.98000000000002
+ 13590
+ 0.8344522861432693
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8344522861432693
+
+
+ 13590
+ 4537
+ 16.030599999999993
+ 13590
+ 0.857368746319674
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.857368746319674
+
+
+ 13590
+ 1322
+ -49.98040000000003
+ 13590
+ 0.7780518560807901
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7780518560807901
+
+
+ 13590
+ 4581
+ -35.96510000000001
+ 13590
+ 0.7936386031506033
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7936386031506033
+
+
+ 13590
+ 1376
+ -63.99610000000001
+ 13590
+ 0.7644296370344311
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7644296370344311
+
+
+ 13590
+ 4500
+ -35.96440000000001
+ 13590
+ 0.8348099103416968
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8348099103416968
+
+
+ 13590
+ 1164
+ -35.964200000000005
+ 13590
+ 0.8173556480419866
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8173556480419866
+
+
+ 13590
+ 1967
+ 16.030100000000004
+ 13590
+ 0.851204878753612
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.851204878753612
+
+
+ 13590
+ 1307
+ -35.96500000000003
+ 13590
+ 0.7697677399280218
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7697677399280218
+
+
+ 13590
+ 1361
+ 38.16059999999999
+ 13590
+ 0.7857357848215171
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7857357848215171
+
+
+ 13590
+ 4587
+ 106.06259999999997
+ 13590
+ 0.7640736501407912
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7640736501407912
+
+
+ 13590
+ 4452
+ -19.969899999999996
+ 13590
+ 0.734722507727239
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.734722507727239
+
+
+ 13590
+ 7795
+ 52.175700000000006
+ 13590
+ 0.7746049153248122
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7746049153248122
+
+
+ 13590
+ 4549
+ 64.05089999999996
+ 13590
+ 0.7832270446301923
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7832270446301923
+
+
+ 13590
+ 1173
+ 32.02539999999999
+ 13590
+ 0.816188578822395
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.816188578822395
+
+
+ 13590
+ 3766
+ -33.9855
+ 13590
+ 0.7888734289210702
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7888734289210702
+
+
+ 13590
+ 7648
+ 34.00540000000001
+ 13590
+ 0.7377680751894156
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7377680751894156
+
+
+ 26406
+ 13590
+ -34.00540000000001
+ 26406
+ 0.7876574927549467
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7876574927549467
+
+
+ 13590
+ 7845
+ 2.012399999999957
+ 13590
+ 0.7674883905150506
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7674883905150506
+
+
+ 13590
+ 1240
+ 64.05110000000002
+ 13590
+ 0.7403976883610626
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7403976883610626
+
+
+ 13633
+ 13590
+ 0.0006999999999948159
+ 13633
+ 0.9366845971618206
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9366845971618206
+
+
+ 13590
+ 7663
+ -50.0163
+ 13590
+ 0.7697707395625655
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7697707395625655
+
+
+ 13590
+ 1449
+ 200.21370000000002
+ 13590
+ 0.7638953908791284
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7638953908791284
+
+
+ 13590
+ 4694
+ 74.03589999999997
+ 13590
+ 0.75296029744039
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.75296029744039
+
+
+ 13590
+ 7665
+ 35.97649999999999
+ 13590
+ 0.8081089457413406
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8081089457413406
+
+
+ 13590
+ 10432
+ -21.985000000000014
+ 13590
+ 0.7382416487526563
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7382416487526563
+
+
+ 13590
+ 1335
+ 52.175700000000006
+ 13590
+ 0.7525388519500529
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7525388519500529
+
+
+ 13590
+ 1555
+ 16.030699999999968
+ 13590
+ 0.768892312640731
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.768892312640731
+
+
+ 13590
+ 4524
+ -49.980500000000006
+ 13590
+ 0.8177195750848526
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8177195750848526
+
+
+ 13590
+ 4561
+ 58.04179999999997
+ 13590
+ 0.8263460053535412
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8263460053535412
+
+
+ 13590
+ 4661
+ 50.03629999999998
+ 13590
+ 0.7729029924091716
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7729029924091716
+
+
+ 13590
+ 7664
+ -84.02160000000003
+ 13590
+ 0.8266195687418578
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8266195687418578
+
+
+ 13590
+ 8321
+ 16.030599999999993
+ 13590
+ 0.8508893407757119
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8508893407757119
+
+
+ 13737
+ 13590
+ 9.00490000000002
+ 13737
+ 0.8072242235825025
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8072242235825025
+
+
+ 20868
+ 13590
+ 32.0489
+ 20868
+ 0.7743642344827837
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7743642344827837
+
+
+ 14168
+ 4658
+ 0.00029999999992469384
+ 14168
+ 1.0000000000000009
+ 14168.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000009
+
+
+ 1232
+ 41
+ 0.0004000000000132786
+ 1232
+ 0.7009207500114989
+ 1232.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7009207500114989
+
+
+ 4667
+ 4514
+ 0.0004999999999881766
+ 4667
+ 0.8029935162095299
+ 4667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8029935162095299
+
+
+ 4514
+ 1379
+ -0.0007999999999697138
+ 4514
+ 0.8478609132663604
+ 4514.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8478609132663604
+
+
+ 9925
+ 1695
+ 50.08840000000001
+ 9925
+ 0.7121348928919904
+ 9925.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7121348928919904
+
+
+ 9925
+ 4559
+ -0.0001999999999782176
+ 9925
+ 0.8879823377698481
+ 9925.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8879823377698481
+
+
+ 20624
+ 9925
+ 0.0005999999999914962
+ 20624
+ 0.8472380350510349
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8472380350510349
+
+
+ 5818
+ 343
+ -74.0353
+ 5818
+ 0.7289099726032551
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7289099726032551
+
+
+ 5818
+ 1547
+ 2.0160999999999945
+ 5818
+ 0.7420371866678575
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7420371866678575
+
+
+ 5818
+ 3667
+ 179.08259999999996
+ 5818
+ 0.7253822493843919
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7253822493843919
+
+
+ 5818
+ 3770
+ 11.05359999999996
+ 5818
+ 0.7683860667302015
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7683860667302015
+
+
+ 7731
+ 5818
+ -0.00029999999998153726
+ 7731
+ 0.8813712679628389
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8813712679628389
+
+
+ 10964
+ 5818
+ -13.069299999999998
+ 10964
+ 0.7108028466907734
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7108028466907734
+
+
+ 4567
+ 1164
+ -114.03120000000001
+ 4567
+ 0.7557383876898784
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7557383876898784
+
+
+ 4567
+ 1361
+ -39.90640000000002
+ 4567
+ 0.7289775025275822
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7289775025275822
+
+
+ 4567
+ 4452
+ -98.0369
+ 4567
+ 0.7167064449779637
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7167064449779637
+
+
+ 4567
+ 4500
+ -114.03140000000002
+ 4567
+ 0.7666678596412394
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666678596412394
+
+
+ 7663
+ 4567
+ 128.0833
+ 7663
+ 0.715787662952265
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.715787662952265
+
+
+ 2805
+ 1610
+ 132.07820000000004
+ 2805
+ 0.8044029605805212
+ 2805.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8044029605805212
+
+
+ 4732
+ 4589
+ 0.00010000000000331966
+ 4732
+ 0.8224674300914043
+ 4732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8224674300914043
+
+
+ 5217
+ 4589
+ 0.00010000000000331966
+ 5217
+ 0.7984725679490471
+ 5217.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7984725679490471
+
+
+ 7628
+ 4589
+ -15.995500000000021
+ 7628
+ 0.7280720081356262
+ 7628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7280720081356262
+
+
+ 7667
+ 4589
+ 2.0152999999999963
+ 7667
+ 0.7553433544395592
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553433544395592
+
+
+ 3122
+ 2666
+ -0.0006999999999948159
+ 3122
+ 0.7143324562878193
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7143324562878193
+
+
+ 3771
+ 2666
+ -0.001599999999996271
+ 3771
+ 0.780506940774978
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.780506940774978
+
+
+ 3546
+ 1361
+ 88.1406
+ 3546
+ 0.8171648337460478
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8171648337460478
+
+
+ 2692
+ 1361
+ -14.889200000000017
+ 2692
+ 0.7685058917689218
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7685058917689218
+
+
+ 7732
+ 1361
+ -15.826399999999978
+ 7732
+ 0.7692230930133516
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7692230930133516
+
+
+ 4537
+ 1361
+ 22.129999999999995
+ 4537
+ 0.7872982681773756
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872982681773756
+
+
+ 1361
+ 1322
+ -88.14100000000002
+ 1361
+ 0.8280554500397646
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8280554500397646
+
+
+ 4581
+ 1361
+ 74.1257
+ 4581
+ 0.7882761945446888
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7882761945446888
+
+
+ 1376
+ 1361
+ 102.1567
+ 1376
+ 0.7681425900759741
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7681425900759741
+
+
+ 4500
+ 1361
+ 74.125
+ 4500
+ 0.8609898405346869
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8609898405346869
+
+
+ 1361
+ 1164
+ -74.1248
+ 1361
+ 0.8400146564105676
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8400146564105676
+
+
+ 1967
+ 1361
+ 22.130499999999984
+ 1967
+ 0.7670066516485374
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7670066516485374
+
+
+ 1361
+ 1307
+ -74.12560000000002
+ 1361
+ 0.7665011952582076
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7665011952582076
+
+
+ 1361
+ 1173
+ -6.1351999999999975
+ 1361
+ 0.7691196647941445
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7691196647941445
+
+
+ 1361
+ 1223
+ -38.12510000000003
+ 1361
+ 0.7283479472364986
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7283479472364986
+
+
+ 1361
+ 1240
+ 25.89050000000003
+ 1361
+ 0.7283329292894407
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7283329292894407
+
+
+ 1361
+ 1296
+ -168.2416
+ 1361
+ 0.7878574368252342
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7878574368252342
+
+
+ 1361
+ 1335
+ 14.015100000000018
+ 1361
+ 0.8263573753022082
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8263573753022082
+
+
+ 1449
+ 1361
+ -162.05310000000003
+ 1449
+ 0.7590247492034078
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7590247492034078
+
+
+ 1555
+ 1361
+ 22.12990000000002
+ 1555
+ 0.7322694253234081
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7322694253234081
+
+
+ 2486
+ 1361
+ -9.89549999999997
+ 2486
+ 0.7917933963768189
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7917933963768189
+
+
+ 3766
+ 1361
+ 72.14609999999999
+ 3766
+ 0.8523598473015355
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8523598473015355
+
+
+ 4452
+ 1361
+ 58.130499999999984
+ 4452
+ 0.7919966964994016
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7919966964994016
+
+
+ 4524
+ 1361
+ 88.1411
+ 4524
+ 0.8687251868683437
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8687251868683437
+
+
+ 4549
+ 1361
+ -25.890299999999968
+ 4549
+ 0.7978714786176437
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7978714786176437
+
+
+ 4561
+ 1361
+ -19.88119999999998
+ 4561
+ 0.8259302481829909
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8259302481829909
+
+
+ 4587
+ 1361
+ -67.90199999999999
+ 4587
+ 0.7477006346067226
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7477006346067226
+
+
+ 4661
+ 1361
+ -11.875699999999995
+ 4661
+ 0.8162380166036378
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8162380166036378
+
+
+ 7663
+ 1361
+ 88.17689999999999
+ 7663
+ 0.7794907921102421
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7794907921102421
+
+
+ 7664
+ 1361
+ 122.18220000000002
+ 7664
+ 0.7708254372848087
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7708254372848087
+
+
+ 7665
+ 1361
+ 2.184100000000001
+ 7665
+ 0.8276028043031578
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8276028043031578
+
+
+ 7795
+ 1361
+ -14.015100000000018
+ 7795
+ 0.7725851203264391
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7725851203264391
+
+
+ 8321
+ 1361
+ 22.129999999999995
+ 8321
+ 0.8122197321330149
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8122197321330149
+
+
+ 10432
+ 1361
+ 60.1456
+ 10432
+ 0.8138202756597728
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8138202756597728
+
+
+ 13633
+ 1361
+ 38.16129999999998
+ 13633
+ 0.7904789435507433
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7904789435507433
+
+
+ 20868
+ 1361
+ 70.20949999999999
+ 20868
+ 0.8133477983147582
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8133477983147582
+
+
+ 26406
+ 1361
+ 4.155199999999979
+ 26406
+ 0.8064789432267667
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8064789432267667
+
+
+ 386
+ 109
+ -172.07319999999993
+ 386
+ 0.787220924688909
+ 386.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.787220924688909
+
+
+ 1252
+ 386
+ 86.03649999999993
+ 1252
+ 0.8820530753149793
+ 1252.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8820530753149793
+
+
+ 2644
+ 1580
+ -80.91960000000006
+ 2644
+ 0.7364023872362708
+ 2644.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7364023872362708
+
+
+ 2644
+ 48
+ 260.20529999999997
+ 2644
+ 0.7461710528841996
+ 2644.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7461710528841996
+
+
+ 3122
+ 2644
+ 253.02950000000004
+ 3122
+ 0.7243893796662125
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7243893796662125
+
+
+ 3667
+ 2644
+ 162.05180000000007
+ 3667
+ 0.8382022229079875
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8382022229079875
+
+
+ 3771
+ 2644
+ 253.02860000000004
+ 3771
+ 0.7578413811572691
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7578413811572691
+
+
+ 7664
+ 3546
+ 34.04160000000002
+ 7664
+ 0.8318901206495266
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8318901206495266
+
+
+ 7664
+ 4537
+ 100.05220000000003
+ 7664
+ 0.7991949669838369
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7991949669838369
+
+
+ 7664
+ 1322
+ 34.0412
+ 7664
+ 0.7946985931633762
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7946985931633762
+
+
+ 7664
+ 4581
+ 48.05650000000003
+ 7664
+ 0.7808853803358683
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7808853803358683
+
+
+ 7664
+ 1376
+ 20.025500000000022
+ 7664
+ 0.7872655706389096
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872655706389096
+
+
+ 7664
+ 4500
+ 48.05720000000002
+ 7664
+ 0.8420003838852146
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8420003838852146
+
+
+ 7664
+ 1164
+ 48.05740000000003
+ 7664
+ 0.8554967544108696
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8554967544108696
+
+
+ 7664
+ 1967
+ 100.05170000000004
+ 7664
+ 0.8052878873413405
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8052878873413405
+
+
+ 7664
+ 1307
+ 48.0566
+ 7664
+ 0.7854153455823205
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7854153455823205
+
+
+ 7664
+ 4587
+ 190.0842
+ 7664
+ 0.7704647636627133
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7704647636627133
+
+
+ 7664
+ 4452
+ 64.05170000000004
+ 7664
+ 0.729157668015004
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729157668015004
+
+
+ 7795
+ 7664
+ -136.19730000000004
+ 7795
+ 0.765070499173973
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765070499173973
+
+
+ 7664
+ 4549
+ 148.0725
+ 7664
+ 0.7736837679369405
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7736837679369405
+
+
+ 7664
+ 1173
+ 116.04700000000003
+ 7664
+ 0.7477243618057747
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7477243618057747
+
+
+ 7664
+ 3766
+ 50.03610000000003
+ 7664
+ 0.7556447500271066
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7556447500271066
+
+
+ 26406
+ 7664
+ -118.02700000000004
+ 26406
+ 0.7752004279143812
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7752004279143812
+
+
+ 7664
+ 1240
+ 148.07270000000005
+ 7664
+ 0.7494321685890581
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7494321685890581
+
+
+ 13633
+ 7664
+ -84.02090000000004
+ 13633
+ 0.840908849046024
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.840908849046024
+
+
+ 7664
+ 7663
+ 34.005300000000034
+ 7664
+ 0.8070592841748541
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8070592841748541
+
+
+ 7664
+ 4694
+ 158.0575
+ 7664
+ 0.7131576718315292
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131576718315292
+
+
+ 7665
+ 7664
+ -119.99810000000002
+ 7665
+ 0.7737220277174359
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7737220277174359
+
+
+ 7664
+ 1296
+ -46.05939999999998
+ 7664
+ 0.715994246767248
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.715994246767248
+
+
+ 10432
+ 7664
+ -62.03660000000002
+ 10432
+ 0.7387152346076689
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7387152346076689
+
+
+ 7664
+ 2486
+ 132.0777
+ 7664
+ 0.7030493638695241
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7030493638695241
+
+
+ 7664
+ 4561
+ 142.0634
+ 7664
+ 0.7728092691432258
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7728092691432258
+
+
+ 7664
+ 1335
+ 136.19730000000004
+ 7664
+ 0.7350382485226502
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7350382485226502
+
+
+ 7664
+ 1555
+ 100.0523
+ 7664
+ 0.725153344586166
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.725153344586166
+
+
+ 26328
+ 7664
+ -52.0514
+ 26328
+ 0.7112450173633448
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7112450173633448
+
+
+ 7664
+ 3747
+ 34.041
+ 7664
+ 0.7110766565590068
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7110766565590068
+
+
+ 7664
+ 4524
+ 34.04110000000003
+ 7664
+ 0.8229096549140043
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8229096549140043
+
+
+ 7664
+ 4661
+ 134.05790000000002
+ 7664
+ 0.7550091000431389
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7550091000431389
+
+
+ 8321
+ 7664
+ -100.05220000000003
+ 8321
+ 0.7767489606757378
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7767489606757378
+
+
+ 13737
+ 7664
+ -75.01670000000001
+ 13737
+ 0.7164096305867623
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7164096305867623
+
+
+ 20868
+ 7664
+ -51.97270000000003
+ 20868
+ 0.8269622619962195
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8269622619962195
+
+
+ 4581
+ 3546
+ -14.014900000000011
+ 4581
+ 0.8231759443384052
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8231759443384052
+
+
+ 4581
+ 2692
+ 89.01490000000001
+ 4581
+ 0.7679769742484848
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7679769742484848
+
+
+ 7732
+ 4581
+ -89.95209999999997
+ 7732
+ 0.7577198720980131
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7577198720980131
+
+
+ 4581
+ 4537
+ 51.9957
+ 4581
+ 0.7862130256746303
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7862130256746303
+
+
+ 4581
+ 1322
+ -14.015300000000025
+ 4581
+ 0.8026526235497524
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8026526235497524
+
+
+ 4581
+ 1164
+ 0.0009000000000014552
+ 4581
+ 0.8319828843555295
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8319828843555295
+
+
+ 4581
+ 1173
+ 67.9905
+ 4581
+ 0.781687542894947
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.781687542894947
+
+
+ 4581
+ 1296
+ -94.11590000000001
+ 4581
+ 0.7216421614779343
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7216421614779343
+
+
+ 4581
+ 1307
+ 9.999999997489795e-05
+ 4581
+ 0.7828413681020232
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7828413681020232
+
+
+ 4581
+ 1335
+ 88.14080000000001
+ 4581
+ 0.7870432242141118
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7870432242141118
+
+
+ 4581
+ 1376
+ -28.031000000000006
+ 4581
+ 0.7291106603049144
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7291106603049144
+
+
+ 4581
+ 1449
+ 236.17880000000002
+ 4581
+ 0.738148506310631
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.738148506310631
+
+
+ 4581
+ 1555
+ 51.995799999999974
+ 4581
+ 0.7623125846284046
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7623125846284046
+
+
+ 4581
+ 1967
+ 51.99520000000001
+ 4581
+ 0.817622370066687
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.817622370066687
+
+
+ 4581
+ 2486
+ 84.02119999999996
+ 4581
+ 0.7722998889642271
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7722998889642271
+
+
+ 4581
+ 2541
+ 37.98009999999999
+ 4581
+ 0.7186515874440732
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7186515874440732
+
+
+ 4581
+ 3747
+ -14.015500000000031
+ 4581
+ 0.7556089755347806
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7556089755347806
+
+
+ 4581
+ 3766
+ 1.979600000000005
+ 4581
+ 0.8202170382200697
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8202170382200697
+
+
+ 4581
+ 4500
+ 0.0006999999999948159
+ 4581
+ 0.8379502358167299
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8379502358167299
+
+
+ 4581
+ 4524
+ -14.0154
+ 4581
+ 0.8381863845599669
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8381863845599669
+
+
+ 4581
+ 4549
+ 100.01599999999996
+ 4581
+ 0.7859074732898833
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7859074732898833
+
+
+ 4581
+ 4561
+ 94.00689999999997
+ 4581
+ 0.7922611253991393
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7922611253991393
+
+
+ 4661
+ 4581
+ -86.00139999999999
+ 4661
+ 0.7786524353119546
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7786524353119546
+
+
+ 4694
+ 4581
+ -110.00099999999998
+ 4694
+ 0.758534878542366
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.758534878542366
+
+
+ 7663
+ 4581
+ 14.051199999999994
+ 7663
+ 0.7831903486775904
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7831903486775904
+
+
+ 7665
+ 4581
+ -71.9416
+ 7665
+ 0.7885793717295513
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7885793717295513
+
+
+ 7795
+ 4581
+ -88.14080000000001
+ 7795
+ 0.781492890949427
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.781492890949427
+
+
+ 8321
+ 4581
+ -51.9957
+ 8321
+ 0.827488185408775
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.827488185408775
+
+
+ 10432
+ 4581
+ -13.980099999999993
+ 10432
+ 0.7579277293284082
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7579277293284082
+
+
+ 13633
+ 4581
+ -35.96440000000001
+ 13633
+ 0.7945291422001121
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7945291422001121
+
+
+ 20868
+ 4581
+ -3.9162000000000035
+ 20868
+ 0.7837196583215753
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7837196583215753
+
+
+ 26406
+ 4581
+ -69.97050000000002
+ 26406
+ 0.7846355791306435
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7846355791306435
+
+
+ 7811
+ 1322
+ -33.98380000000003
+ 7811
+ 0.7397234663827941
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7397234663827941
+
+
+ 7811
+ 1376
+ -47.99950000000001
+ 7811
+ 0.734282344348196
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.734282344348196
+
+
+ 7811
+ 3766
+ -17.9889
+ 7811
+ 0.7472857571605862
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7472857571605862
+
+
+ 7811
+ 4524
+ -33.983900000000006
+ 7811
+ 0.7832726734441438
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7832726734441438
+
+
+ 7811
+ 7795
+ 68.1723
+ 7811
+ 0.7106377265045603
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7106377265045603
+
+
+ 10432
+ 7811
+ 5.988400000000013
+ 10432
+ 0.7307086938140607
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7307086938140607
+
+
+ 20868
+ 7811
+ 16.052300000000002
+ 20868
+ 0.741172357027142
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741172357027142
+
+
+ 5217
+ 4732
+ 0.0
+ 5217
+ 0.7345777407422028
+ 5217.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7345777407422028
+
+
+ 7667
+ 5217
+ 2.015199999999993
+ 7667
+ 0.7338379215757613
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7338379215757613
+
+
+ 13890
+ 13592
+ -86.03620000000001
+ 13890
+ 0.755609446510469
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.755609446510469
+
+
+ 13890
+ 13698
+ 12.000999999999976
+ 13890
+ 0.7472274076915648
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7472274076915648
+
+
+ 13633
+ 7648
+ 34.0061
+ 13633
+ 0.7779826197662838
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7779826197662838
+
+
+ 13737
+ 7648
+ 43.01030000000003
+ 13737
+ 0.716578852217014
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.716578852217014
+
+
+ 5997
+ 5874
+ -0.00010000000000331966
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5997
+ 5846
+ 1.9842000000000013
+ 5997
+ 0.7218154561616537
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 5997
+ 5889
+ 0.0
+ 5997
+ 0.8713460865906011
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 5997
+ 5935
+ 0.0
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5997
+ 5975
+ 0.0
+ 5997
+ 0.8840320085106907
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 6019
+ 5997
+ 0.00010000000000331966
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6038
+ 5997
+ 0.0
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 13592
+ 7724
+ 135.99400000000003
+ 13592
+ 0.7433277454961199
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7433277454961199
+
+
+ 13592
+ 4789
+ 116.04680000000008
+ 13592
+ 0.7459585145759681
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7459585145759681
+
+
+ 13698
+ 13592
+ -98.03719999999998
+ 13698
+ 0.8294730962660306
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8294730962660306
+
+
+ 10432
+ 3546
+ -27.995000000000005
+ 10432
+ 0.7800294577095632
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7800294577095632
+
+
+ 10432
+ 2692
+ 75.03480000000002
+ 10432
+ 0.7504259074683242
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7504259074683242
+
+
+ 10432
+ 7732
+ 75.97199999999998
+ 10432
+ 0.7182422122216472
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7182422122216472
+
+
+ 10432
+ 4537
+ 38.015600000000006
+ 10432
+ 0.743297873001513
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.743297873001513
+
+
+ 10432
+ 1322
+ -27.995400000000018
+ 10432
+ 0.8360368078578365
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8360368078578365
+
+
+ 10432
+ 1376
+ -42.0111
+ 10432
+ 0.7668835802937255
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7668835802937255
+
+
+ 10432
+ 4500
+ -13.979399999999998
+ 10432
+ 0.7938872586506811
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7938872586506811
+
+
+ 10432
+ 1164
+ -13.979199999999992
+ 10432
+ 0.8157201140382684
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8157201140382684
+
+
+ 10432
+ 1307
+ -13.980000000000018
+ 10432
+ 0.802712904013203
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.802712904013203
+
+
+ 10432
+ 4587
+ 128.0476
+ 10432
+ 0.7259218685188313
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7259218685188313
+
+
+ 10432
+ 4452
+ 2.015100000000018
+ 10432
+ 0.7307902938064268
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7307902938064268
+
+
+ 10432
+ 7795
+ 74.16070000000002
+ 10432
+ 0.7841609028504847
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7841609028504847
+
+
+ 10432
+ 4549
+ 86.03589999999997
+ 10432
+ 0.70653631172389
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.70653631172389
+
+
+ 10432
+ 3766
+ -12.000499999999988
+ 10432
+ 0.831534889680259
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.831534889680259
+
+
+ 26406
+ 10432
+ -55.99040000000002
+ 26406
+ 0.776802803585593
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.776802803585593
+
+
+ 13633
+ 10432
+ -21.98430000000002
+ 13633
+ 0.7663081269078061
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7663081269078061
+
+
+ 10432
+ 7663
+ -28.031299999999987
+ 10432
+ 0.7680697334030612
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7680697334030612
+
+
+ 10432
+ 1449
+ 222.19870000000003
+ 10432
+ 0.7451911421485573
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7451911421485573
+
+
+ 10432
+ 4694
+ 96.02089999999998
+ 10432
+ 0.7164599640017755
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7164599640017755
+
+
+ 10432
+ 7665
+ 57.9615
+ 10432
+ 0.8002128417720337
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8002128417720337
+
+
+ 10432
+ 1296
+ -108.096
+ 10432
+ 0.7833979394241086
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7833979394241086
+
+
+ 10432
+ 1335
+ 74.16070000000002
+ 10432
+ 0.7330413905540722
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7330413905540722
+
+
+ 10432
+ 2486
+ 70.04109999999997
+ 10432
+ 0.763470342041401
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.763470342041401
+
+
+ 10432
+ 4524
+ -27.995499999999993
+ 10432
+ 0.8211058457805318
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8211058457805318
+
+
+ 10432
+ 4561
+ 80.02679999999998
+ 10432
+ 0.7537950697607304
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7537950697607304
+
+
+ 10432
+ 4661
+ 72.0213
+ 10432
+ 0.7875069371714507
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7875069371714507
+
+
+ 10432
+ 8321
+ 38.015600000000006
+ 10432
+ 0.7531431992071737
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7531431992071737
+
+
+ 20868
+ 10432
+ 10.06389999999999
+ 20868
+ 0.8151760932215513
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8151760932215513
+
+
+ 1580
+ 48
+ 341.1249
+ 1580
+ 0.778336930769878
+ 1580.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.778336930769878
+
+
+ 1580
+ 311
+ -188.10629999999998
+ 1580
+ 0.7152694178476485
+ 1580.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7152694178476485
+
+
+ 3122
+ 1580
+ 172.10989999999998
+ 3122
+ 0.7380435073334306
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7380435073334306
+
+
+ 3667
+ 1580
+ 81.13220000000001
+ 3667
+ 0.7456173656608622
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7456173656608622
+
+
+ 3771
+ 1580
+ 172.10899999999998
+ 3771
+ 0.7858113611939106
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7858113611939106
+
+
+ 4452
+ 3546
+ -30.010100000000023
+ 4452
+ 0.7698087052034195
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7698087052034195
+
+
+ 4452
+ 2692
+ 73.0197
+ 4452
+ 0.7169479390641451
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7169479390641451
+
+
+ 4452
+ 1322
+ -30.010500000000036
+ 4452
+ 0.763665284992833
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.763665284992833
+
+
+ 4452
+ 1376
+ -44.02620000000002
+ 4452
+ 0.7053367136416187
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7053367136416187
+
+
+ 4500
+ 4452
+ 15.994500000000016
+ 4500
+ 0.7883756460519822
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7883756460519822
+
+
+ 4452
+ 1164
+ -15.99430000000001
+ 4452
+ 0.7997197887545953
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7997197887545953
+
+
+ 4452
+ 1307
+ -15.995100000000036
+ 4452
+ 0.7109773573289969
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7109773573289969
+
+
+ 4452
+ 1240
+ 84.02100000000002
+ 4452
+ 0.7002212742104246
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7002212742104246
+
+
+ 4452
+ 1296
+ -110.11110000000002
+ 4452
+ 0.7219922955841758
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7219922955841758
+
+
+ 4452
+ 1335
+ 72.1456
+ 4452
+ 0.7404435380373051
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7404435380373051
+
+
+ 4452
+ 1449
+ 220.1836
+ 4452
+ 0.7043535533077931
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7043535533077931
+
+
+ 4452
+ 3766
+ -14.015600000000006
+ 4452
+ 0.7478053322709437
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7478053322709437
+
+
+ 4524
+ 4452
+ 30.01060000000001
+ 4524
+ 0.780104592449151
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.780104592449151
+
+
+ 7663
+ 4452
+ 30.046400000000006
+ 7663
+ 0.7532935202501063
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7532935202501063
+
+
+ 7665
+ 4452
+ -55.94639999999998
+ 7665
+ 0.7942091103279474
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7942091103279474
+
+
+ 7795
+ 4452
+ -72.1456
+ 7795
+ 0.7370779717117724
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7370779717117724
+
+
+ 13633
+ 4452
+ -19.9692
+ 13633
+ 0.7574644019031742
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7574644019031742
+
+
+ 20868
+ 4452
+ 12.079000000000008
+ 20868
+ 0.7748789104923365
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7748789104923365
+
+
+ 26406
+ 4452
+ -53.975300000000004
+ 26406
+ 0.7732940560875348
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7732940560875348
+
+
+ 7979
+ 11
+ 2.067700000000002
+ 7979
+ 0.7206564776894646
+ 7979.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206564776894646
+
+
+ 4539
+ 11
+ 2.0159999999999627
+ 4539
+ 0.8378790961652245
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8378790961652245
+
+
+ 3667
+ 11
+ -134.9676
+ 3667
+ 0.7038183969668554
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7038183969668554
+
+
+ 3771
+ 11
+ -43.990800000000036
+ 3771
+ 0.7133850001344928
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7133850001344928
+
+
+ 1547
+ 11
+ 42.09889999999996
+ 1547
+ 0.7343324286248336
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7343324286248336
+
+
+ 3122
+ 11
+ -43.989900000000034
+ 3122
+ 0.7034548687446786
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7034548687446786
+
+
+ 7731
+ 11
+ 44.11469999999997
+ 7731
+ 0.7012606554256817
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7012606554256817
+
+
+ 10473
+ 39
+ -148.03869999999995
+ 10473
+ 0.9005206716379817
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9005206716379817
+
+
+ 28000
+ 39
+ -0.0005999999999630745
+ 28000
+ 0.947019197557845
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.947019197557845
+
+
+ 39
+ 9
+ -45.98700000000008
+ 39
+ 0.9094719150125461
+ 39.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9094719150125461
+
+
+ 3521
+ 39
+ -14.016300000000001
+ 3521
+ 0.8938549746348798
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8938549746348798
+
+
+ 5160
+ 39
+ -0.00029999999992469384
+ 5160
+ 0.9501235294786219
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9501235294786219
+
+
+ 39
+ 6
+ 78.97879999999998
+ 39
+ 0.7949506854742541
+ 39.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7949506854742541
+
+
+ 1156
+ 39
+ 90.04840000000002
+ 1156
+ 0.8472027927046718
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8472027927046718
+
+
+ 58
+ 39
+ 74.01830000000007
+ 58
+ 0.9034518644888905
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9034518644888905
+
+
+ 144
+ 39
+ 148.0371
+ 144
+ 0.8409521677005969
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8409521677005969
+
+
+ 1275
+ 1255
+ -18.010500000000036
+ 1275
+ 0.840841262832233
+ 1275.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.840841262832233
+
+
+ 1547
+ 1474
+ -27.99350000000004
+ 1547
+ 0.7855350897988105
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7855350897988105
+
+
+ 3667
+ 1547
+ -177.06649999999996
+ 3667
+ 0.7184844576850267
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7184844576850267
+
+
+ 10964
+ 1547
+ -11.053200000000004
+ 10964
+ 0.8146634401978005
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8146634401978005
+
+
+ 1547
+ 1068
+ -76.0514
+ 1547
+ 0.7136944426789613
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7136944426789613
+
+
+ 1547
+ 914
+ -76.0514
+ 1547
+ 0.8149847224196799
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8149847224196799
+
+
+ 1547
+ 343
+ -76.0514
+ 1547
+ 0.8484821256387172
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8484821256387172
+
+
+ 10446
+ 1547
+ -68.07829999999996
+ 10446
+ 0.7462147237942737
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7462147237942737
+
+
+ 3770
+ 1547
+ -9.037499999999966
+ 3770
+ 0.7050694420053412
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7050694420053412
+
+
+ 2575
+ 1547
+ -54.099699999999984
+ 2575
+ 0.7664665737547884
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7664665737547884
+
+
+ 7731
+ 1547
+ 2.015800000000013
+ 7731
+ 0.840921789945926
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.840921789945926
+
+
+ 1547
+ 1220
+ -62.03620000000001
+ 1547
+ 0.7239945726436752
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7239945726436752
+
+
+ 13626
+ 1244
+ -0.0003999999999564352
+ 13626
+ 0.8890215278311255
+ 13626.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8890215278311255
+
+
+ 13626
+ 5524
+ -16.031499999999994
+ 13626
+ 0.7140866836709849
+ 13626.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7140866836709849
+
+
+ 2573
+ 2526
+ -0.00020000000006348273
+ 2573
+ 0.9674734186781916
+ 2573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9674734186781916
+
+
+ 2628
+ 2573
+ -14.014699999999948
+ 2628
+ 0.8796890853500932
+ 2628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8796890853500932
+
+
+ 10258
+ 10240
+ -15.994699999999966
+ 10258
+ 0.8482118260962055
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8482118260962055
+
+
+ 10240
+ 4775
+ -98.05290000000008
+ 10240
+ 0.784567695841486
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.784567695841486
+
+
+ 10240
+ 4584
+ -98.03740000000005
+ 10240
+ 0.8913556173779417
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8913556173779417
+
+
+ 1310
+ 1169
+ 238.2287
+ 1310
+ 0.8169155911780275
+ 1310.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8169155911780275
+
+
+ 1169
+ 73
+ -4.025800000000004
+ 1169
+ 0.8066861025543268
+ 1169.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8066861025543268
+
+
+ 3285
+ 1169
+ -19.96950000000004
+ 3285
+ 0.9869130873391039
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9869130873391039
+
+
+ 5846
+ 208
+ 13.007000000000005
+ 5846
+ 0.7000361364435104
+ 5846.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7000361364435104
+
+
+ 5874
+ 5846
+ 1.9843000000000046
+ 5874
+ 0.7218154561616537
+ 5874.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 5846
+ 25
+ 6.004799999999989
+ 5846
+ 0.7461204215352448
+ 5846.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7461204215352448
+
+
+ 5889
+ 5846
+ 1.9842000000000013
+ 5889
+ 0.8116818213763026
+ 5889.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8116818213763026
+
+
+ 5935
+ 5846
+ 1.9842000000000013
+ 5935
+ 0.7218154561616537
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 5975
+ 5846
+ 1.9842000000000013
+ 5975
+ 0.7055845086886054
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7055845086886054
+
+
+ 6019
+ 5846
+ 1.9843000000000046
+ 6019
+ 0.7218154561616537
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 6038
+ 5846
+ 1.9842000000000013
+ 6038
+ 0.7218154561616537
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+
+
+ 3285
+ 73
+ -23.995300000000043
+ 3285
+ 0.8024511008845483
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8024511008845483
+
+
+ 4516
+ 1158
+ 27.996399999999994
+ 4516
+ 0.9092425255126506
+ 4516.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9092425255126506
+
+
+ 4548
+ 4516
+ -132.0435
+ 4548
+ 0.8276041447912992
+ 4548.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8276041447912992
+
+
+ 2628
+ 2526
+ -14.014900000000011
+ 2628
+ 0.8925010926543242
+ 2628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8925010926543242
+
+
+ 10473
+ 5160
+ -148.03840000000002
+ 10473
+ 0.9474182676741132
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9474182676741132
+
+
+ 28000
+ 5160
+ -0.0003000000000383807
+ 28000
+ 0.9807375043674307
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9807375043674307
+
+
+ 5160
+ 9
+ -45.987300000000005
+ 5160
+ 0.923601850330019
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.923601850330019
+
+
+ 5160
+ 3521
+ 14.016000000000076
+ 5160
+ 0.9117410813495535
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9117410813495535
+
+
+ 5160
+ 6
+ 78.97850000000005
+ 5160
+ 0.8234686033894387
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8234686033894387
+
+
+ 5160
+ 58
+ -74.01859999999999
+ 5160
+ 0.9298566999766009
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9298566999766009
+
+
+ 5160
+ 144
+ -148.03739999999993
+ 5160
+ 0.8926616243891328
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8926616243891328
+
+
+ 5160
+ 1156
+ -90.04869999999994
+ 5160
+ 0.8908592618992064
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8908592618992064
+
+
+ 5332
+ 5160
+ 331.1117
+ 5332
+ 0.7147297591000332
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7147297591000332
+
+
+ 5889
+ 5874
+ -0.00010000000000331966
+ 5889
+ 0.8713460865906011
+ 5889.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 5935
+ 5874
+ -0.00010000000000331966
+ 5935
+ 0.9999999999999993
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 5975
+ 5874
+ -0.00010000000000331966
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 6019
+ 5874
+ 0.0
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6038
+ 5874
+ -0.00010000000000331966
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 9385
+ 3700
+ -32.026700000000005
+ 9385
+ 0.741200267986588
+ 9385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741200267986588
+
+
+ 5273
+ 1165
+ 31.989899999999977
+ 5273
+ 0.7716626598358503
+ 5273.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7716626598358503
+
+
+ 4504
+ 1165
+ -14.015800000000013
+ 4504
+ 0.8679075054113705
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8679075054113705
+
+
+ 1165
+ 1162
+ 179.07930000000005
+ 1165
+ 0.8486082288748873
+ 1165.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8486082288748873
+
+
+ 4507
+ 1165
+ -0.0003000000000383807
+ 4507
+ 0.9217442025600888
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9217442025600888
+
+
+ 1196
+ 1165
+ -17.02600000000001
+ 1196
+ 0.894385633991355
+ 1196.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.894385633991355
+
+
+ 2478
+ 1165
+ -14.014800000000037
+ 2478
+ 0.8454304090256399
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8454304090256399
+
+
+ 4524
+ 3546
+ 0.0004999999999881766
+ 4524
+ 0.8526162530338657
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8526162530338657
+
+
+ 4524
+ 2692
+ 103.03030000000001
+ 4524
+ 0.7592621530411521
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7592621530411521
+
+
+ 7732
+ 4524
+ -103.96749999999997
+ 7732
+ 0.7659931904879267
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7659931904879267
+
+
+ 4537
+ 4524
+ -66.0111
+ 4537
+ 0.8025287383376064
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8025287383376064
+
+
+ 4524
+ 1322
+ 9.999999997489795e-05
+ 4524
+ 0.8609097183501437
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8609097183501437
+
+
+ 4524
+ 1376
+ -14.015600000000006
+ 4524
+ 0.7819135910509369
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7819135910509369
+
+
+ 4524
+ 4500
+ 14.016099999999994
+ 4524
+ 0.8940489178711453
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8940489178711453
+
+
+ 4524
+ 1164
+ 14.016300000000001
+ 4524
+ 0.8836221442183508
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8836221442183508
+
+
+ 4524
+ 1967
+ 66.01060000000001
+ 4524
+ 0.8002907267611696
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8002907267611696
+
+
+ 4524
+ 1307
+ 14.015499999999975
+ 4524
+ 0.7828746858469581
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7828746858469581
+
+
+ 4587
+ 4524
+ -156.04309999999998
+ 4587
+ 0.7996173966243616
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7996173966243616
+
+
+ 7795
+ 4524
+ -102.15620000000001
+ 7795
+ 0.8328203085201809
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8328203085201809
+
+
+ 4549
+ 4524
+ -114.03139999999996
+ 4549
+ 0.8231046078027471
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8231046078027471
+
+
+ 4524
+ 1173
+ 82.0059
+ 4524
+ 0.7928927940532007
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7928927940532007
+
+
+ 4524
+ 3766
+ 15.995000000000005
+ 4524
+ 0.8690750294209248
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8690750294209248
+
+
+ 26406
+ 4524
+ -83.98590000000002
+ 26406
+ 0.8570752791224555
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8570752791224555
+
+
+ 13633
+ 4524
+ -49.97980000000001
+ 13633
+ 0.8344660722616974
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8344660722616974
+
+
+ 7663
+ 4524
+ 0.035799999999994725
+ 7663
+ 0.818986218991886
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.818986218991886
+
+
+ 4524
+ 1449
+ 250.19420000000002
+ 4524
+ 0.7748279491969332
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7748279491969332
+
+
+ 7665
+ 4524
+ -85.957
+ 7665
+ 0.8459820377728133
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8459820377728133
+
+
+ 4524
+ 1296
+ -80.10050000000001
+ 4524
+ 0.7906543683310474
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7906543683310474
+
+
+ 4524
+ 2486
+ 98.03659999999996
+ 4524
+ 0.7732261000303422
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7732261000303422
+
+
+ 4561
+ 4524
+ -108.02229999999997
+ 4561
+ 0.7990905614665766
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7990905614665766
+
+
+ 4524
+ 1335
+ 102.15620000000001
+ 4524
+ 0.8241617876651458
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8241617876651458
+
+
+ 20868
+ 4524
+ -17.931600000000003
+ 20868
+ 0.8692609279917556
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8692609279917556
+
+
+ 13737
+ 4524
+ -40.975599999999986
+ 13737
+ 0.7820742092996067
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7820742092996067
+
+
+ 4524
+ 3747
+ -0.00010000000003174137
+ 4524
+ 0.7431549228848245
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7431549228848245
+
+
+ 4661
+ 4524
+ -100.01679999999999
+ 4661
+ 0.8167678735678996
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8167678735678996
+
+
+ 8321
+ 4524
+ -66.0111
+ 8321
+ 0.8096289076753352
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8096289076753352
+
+
+ 4522
+ 2665
+ -0.0006000000000199179
+ 4522
+ 0.8002020487684565
+ 4522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8002020487684565
+
+
+ 4522
+ 3527
+ 42.00999999999999
+ 4522
+ 0.7393882462638258
+ 4522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7393882462638258
+
+
+ 2931
+ 1581
+ -0.00010000000003174137
+ 2931
+ 0.7988154807483048
+ 2931.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7988154807483048
+
+
+ 10324
+ 2931
+ -9.999999997489795e-05
+ 10324
+ 0.7201283644248563
+ 10324.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7201283644248563
+
+
+ 10473
+ 3521
+ -134.02239999999995
+ 10473
+ 0.8758029209484876
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8758029209484876
+
+
+ 28000
+ 3521
+ 14.015700000000038
+ 28000
+ 0.9024803365749979
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9024803365749979
+
+
+ 3521
+ 9
+ -60.00330000000008
+ 3521
+ 0.8999161402653517
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8999161402653517
+
+
+ 3521
+ 6
+ 64.96249999999998
+ 3521
+ 0.7526595077304954
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7526595077304954
+
+
+ 3521
+ 58
+ -88.03460000000007
+ 3521
+ 0.8367123751742471
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367123751742471
+
+
+ 3521
+ 144
+ -162.0534
+ 3521
+ 0.8059475603021353
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8059475603021353
+
+
+ 3521
+ 1156
+ -104.06470000000002
+ 3521
+ 0.7911781187179483
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7911781187179483
+
+
+ 11652
+ 5175
+ 0.0
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11652
+ 11101
+ 0.0005000000000023874
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11652
+ 11368
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11652
+ 208
+ 57.01350000000001
+ 11652
+ 0.7720262431782003
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 11652
+ 11194
+ 0.0005000000000023874
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11652
+ 25
+ 50.01129999999999
+ 11652
+ 0.7765014360319091
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 11652
+ 5148
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11652
+ 5194
+ 0.00019999999999242846
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 20624
+ 1345
+ 15.99539999999999
+ 20624
+ 0.7071714136634972
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7071714136634972
+
+
+ 20624
+ 1695
+ 50.089
+ 20624
+ 0.7020258104803418
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7020258104803418
+
+
+ 20624
+ 2775
+ 0.00030000000000995897
+ 20624
+ 0.7121988528052141
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7121988528052141
+
+
+ 20624
+ 4559
+ 0.0004000000000132786
+ 20624
+ 0.8995527314951952
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8995527314951952
+
+
+ 11101
+ 5175
+ -0.0005000000000023874
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11101
+ 25
+ 50.01079999999999
+ 11101
+ 0.7738824635537842
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+
+
+ 11101
+ 208
+ 57.013000000000005
+ 11101
+ 0.702129081776425
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+
+
+ 11101
+ 5148
+ -0.0002000000000066393
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11101
+ 5194
+ -0.00030000000000995897
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11194
+ 11101
+ 0.0
+ 11194
+ 1.0
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+
+
+ 11368
+ 11101
+ 0.0002000000000066393
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 914
+ 19
+ -53.05150000000003
+ 914
+ 0.7062934837448891
+ 914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7062934837448891
+
+
+ 1252
+ 109
+ -86.0367
+ 1252
+ 0.7404795946299525
+ 1252.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7404795946299525
+
+
+ 5975
+ 5889
+ 0.0
+ 5975
+ 0.8838615477489413
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8838615477489413
+
+
+ 6038
+ 5889
+ 0.0
+ 6038
+ 0.8713460865906011
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 6019
+ 5889
+ 0.00010000000000331966
+ 6019
+ 0.8713460865906011
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 5935
+ 5889
+ 0.0
+ 5935
+ 0.8713460865906011
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+
+
+ 3546
+ 1164
+ 14.015800000000013
+ 3546
+ 0.8793244992033116
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8793244992033116
+
+
+ 3546
+ 1173
+ 82.00540000000001
+ 3546
+ 0.7828830741744861
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7828830741744861
+
+
+ 3546
+ 1223
+ 50.015499999999975
+ 3546
+ 0.7535990988683806
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7535990988683806
+
+
+ 3546
+ 1296
+ -80.101
+ 3546
+ 0.7457712449142684
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7457712449142684
+
+
+ 3546
+ 1307
+ 14.014999999999986
+ 3546
+ 0.7794251735135853
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7794251735135853
+
+
+ 3546
+ 1322
+ -0.0004000000000132786
+ 3546
+ 0.8074125004101471
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8074125004101471
+
+
+ 3546
+ 1335
+ 102.15570000000002
+ 3546
+ 0.7689090461140327
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7689090461140327
+
+
+ 3546
+ 1376
+ -14.016099999999994
+ 3546
+ 0.8246352450749646
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8246352450749646
+
+
+ 3546
+ 1555
+ 66.01069999999999
+ 3546
+ 0.7526626748294611
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7526626748294611
+
+
+ 3546
+ 1967
+ 66.01010000000002
+ 3546
+ 0.8526461861122617
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8526461861122617
+
+
+ 3546
+ 2486
+ 98.03609999999998
+ 3546
+ 0.7904804724736056
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7904804724736056
+
+
+ 3766
+ 3546
+ -15.994500000000016
+ 3766
+ 0.8099019127616017
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8099019127616017
+
+
+ 4500
+ 3546
+ -14.015600000000006
+ 4500
+ 0.8630023041655128
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8630023041655128
+
+
+ 4537
+ 3546
+ -66.01060000000001
+ 4537
+ 0.8481722280147458
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8481722280147458
+
+
+ 4549
+ 3546
+ -114.03089999999997
+ 4549
+ 0.8121775679710831
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8121775679710831
+
+
+ 4561
+ 3546
+ -108.02179999999998
+ 4561
+ 0.8111615965640255
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8111615965640255
+
+
+ 4587
+ 3546
+ -156.0426
+ 4587
+ 0.79355114911454
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.79355114911454
+
+
+ 4661
+ 3546
+ -100.0163
+ 4661
+ 0.8137976430006446
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8137976430006446
+
+
+ 4694
+ 3546
+ -124.01589999999999
+ 4694
+ 0.7725949549250163
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7725949549250163
+
+
+ 7663
+ 3546
+ 0.0362999999999829
+ 7663
+ 0.7887662259513708
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7887662259513708
+
+
+ 7665
+ 3546
+ -85.9565
+ 7665
+ 0.7843396546425048
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7843396546425048
+
+
+ 7795
+ 3546
+ -102.15570000000002
+ 7795
+ 0.7868784873004675
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7868784873004675
+
+
+ 8321
+ 3546
+ -66.01060000000001
+ 8321
+ 0.8367023894267491
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367023894267491
+
+
+ 13633
+ 3546
+ -49.97930000000002
+ 13633
+ 0.8461478630894581
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8461478630894581
+
+
+ 13737
+ 3546
+ -40.9751
+ 13737
+ 0.762793049010119
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.762793049010119
+
+
+ 20868
+ 3546
+ -17.931100000000015
+ 20868
+ 0.8189549112428063
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8189549112428063
+
+
+ 26406
+ 3546
+ -83.98540000000003
+ 26406
+ 0.7844611924289386
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7844611924289386
+
+
+ 5175
+ 208
+ 57.01350000000001
+ 5175
+ 0.7720262431782003
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 11368
+ 208
+ 57.01320000000001
+ 11368
+ 0.7720262431782003
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 208
+ 25
+ -7.002200000000016
+ 208
+ 0.8645323434684491
+ 208.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8645323434684491
+
+
+ 5148
+ 208
+ 57.01320000000001
+ 5148
+ 0.7720262431782003
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 5194
+ 208
+ 57.013300000000015
+ 5194
+ 0.7720262431782003
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+
+
+ 11194
+ 208
+ 57.013000000000005
+ 11194
+ 0.702129081776425
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+
+
+ 3285
+ 1310
+ -258.19820000000004
+ 3285
+ 0.8079383683448043
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8079383683448043
+
+
+ 1068
+ 343
+ 0.0
+ 1068
+ 0.7753395167412889
+ 1068.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7753395167412889
+
+
+ 1068
+ 914
+ 0.0
+ 1068
+ 0.7692111344591185
+ 1068.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7692111344591185
+
+
+ 1220
+ 1068
+ -14.015199999999993
+ 1220
+ 0.7052110063147057
+ 1220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7052110063147057
+
+
+ 4667
+ 1379
+ -0.00029999999998153726
+ 4667
+ 0.8854597982233787
+ 4667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8854597982233787
+
+
+ 10324
+ 1581
+ -0.0002000000000066393
+ 10324
+ 0.8027235562039201
+ 10324.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8027235562039201
+
+
+ 10964
+ 1474
+ -39.046700000000044
+ 10964
+ 0.73346424023061
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.73346424023061
+
+
+ 4500
+ 3747
+ -14.016200000000026
+ 4500
+ 0.8203846738344488
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8203846738344488
+
+
+ 3747
+ 1164
+ 14.016400000000033
+ 3747
+ 0.790755948993533
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.790755948993533
+
+
+ 4587
+ 3747
+ -156.0432
+ 4587
+ 0.7293753961686953
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7293753961686953
+
+
+ 4549
+ 3747
+ -114.0315
+ 4549
+ 0.7530296002010514
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7530296002010514
+
+
+ 3747
+ 1173
+ 82.00600000000003
+ 3747
+ 0.7124140725007002
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7124140725007002
+
+
+ 3766
+ 3747
+ -15.995100000000036
+ 3766
+ 0.7466153835685401
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7466153835685401
+
+
+ 3747
+ 1240
+ 114.03170000000006
+ 3747
+ 0.7520528028432132
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7520528028432132
+
+
+ 7663
+ 3747
+ 0.035699999999962984
+ 7663
+ 0.7219842678792172
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7219842678792172
+
+
+ 13737
+ 3747
+ -40.97570000000002
+ 13737
+ 0.7128012963017345
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7128012963017345
+
+
+ 8321
+ 3747
+ -66.01120000000003
+ 8321
+ 0.7613911289766184
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7613911289766184
+
+
+ 4661
+ 3747
+ -100.01690000000002
+ 4661
+ 0.7324993267104507
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7324993267104507
+
+
+ 7732
+ 4561
+ 4.0548
+ 7732
+ 0.7400288395718368
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400288395718368
+
+
+ 4561
+ 1339
+ -0.001099999999951251
+ 4561
+ 0.8031253345881758
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8031253345881758
+
+
+ 4561
+ 4537
+ -42.011199999999974
+ 4561
+ 0.8730652696074992
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8730652696074992
+
+
+ 4561
+ 1322
+ -108.0222
+ 4561
+ 0.763896298877169
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.763896298877169
+
+
+ 4561
+ 1376
+ -122.03789999999998
+ 4561
+ 0.7909365165516298
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7909365165516298
+
+
+ 4561
+ 4500
+ -94.00619999999998
+ 4561
+ 0.8290107577505195
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8290107577505195
+
+
+ 4561
+ 1164
+ -94.00599999999997
+ 4561
+ 0.815028020152927
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.815028020152927
+
+
+ 4561
+ 1967
+ -42.01169999999996
+ 4561
+ 0.8678754084093439
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8678754084093439
+
+
+ 4587
+ 4561
+ -48.02080000000001
+ 4587
+ 0.7644778742682641
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7644778742682641
+
+
+ 4561
+ 4549
+ 6.0090999999999894
+ 4561
+ 0.7884462394566427
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7884462394566427
+
+
+ 4561
+ 1173
+ -26.016399999999976
+ 4561
+ 0.8546126865823311
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8546126865823311
+
+
+ 4561
+ 3766
+ -92.02729999999997
+ 4561
+ 0.8161044974570639
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8161044974570639
+
+
+ 26406
+ 4561
+ 24.036399999999958
+ 26406
+ 0.7310222474771313
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7310222474771313
+
+
+ 4561
+ 1240
+ 6.009300000000053
+ 4561
+ 0.7456117577406673
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7456117577406673
+
+
+ 13633
+ 4561
+ 58.04249999999996
+ 13633
+ 0.8147788470350186
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8147788470350186
+
+
+ 7663
+ 4561
+ 108.05809999999997
+ 7663
+ 0.7555495191707877
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7555495191707877
+
+
+ 4561
+ 1449
+ 142.17190000000005
+ 4561
+ 0.747594835793248
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.747594835793248
+
+
+ 4694
+ 4561
+ -15.994100000000003
+ 4694
+ 0.7991811245600994
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7991811245600994
+
+
+ 7665
+ 4561
+ 22.06529999999998
+ 7665
+ 0.7806767931699561
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7806767931699561
+
+
+ 4561
+ 2486
+ -9.985700000000008
+ 4561
+ 0.81311898979567
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.81311898979567
+
+
+ 4561
+ 1223
+ -58.00630000000001
+ 4561
+ 0.7697152410206597
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7697152410206597
+
+
+ 4561
+ 1335
+ -5.86609999999996
+ 4561
+ 0.7861196361542652
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7861196361542652
+
+
+ 4561
+ 1555
+ -42.0111
+ 4561
+ 0.8242999059246818
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8242999059246818
+
+
+ 4661
+ 4561
+ 8.005499999999984
+ 4661
+ 0.8295646851644539
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8295646851644539
+
+
+ 8321
+ 4561
+ 42.011199999999974
+ 8321
+ 0.8857558419453324
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8857558419453324
+
+
+ 13737
+ 4561
+ 67.04669999999999
+ 13737
+ 0.7370392080685323
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7370392080685323
+
+
+ 20868
+ 4561
+ 90.09069999999997
+ 20868
+ 0.7675090267448648
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7675090267448648
+
+
+ 3667
+ 3122
+ -90.97769999999997
+ 3667
+ 0.7477037577406106
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7477037577406106
+
+
+ 3771
+ 3122
+ -0.0009000000000014552
+ 3771
+ 0.8413372190471624
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8413372190471624
+
+
+ 3122
+ 311
+ -15.996399999999994
+ 3122
+ 0.7023889373262369
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7023889373262369
+
+
+ 28000
+ 10473
+ 148.0381
+ 28000
+ 0.9360036525586622
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9360036525586622
+
+
+ 28000
+ 6
+ 78.97820000000002
+ 28000
+ 0.8160764092297264
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8160764092297264
+
+
+ 28000
+ 9
+ -45.98760000000004
+ 28000
+ 0.9215371878356318
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9215371878356318
+
+
+ 28000
+ 58
+ -74.01890000000003
+ 28000
+ 0.9212909515919987
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9212909515919987
+
+
+ 28000
+ 144
+ -148.03769999999997
+ 28000
+ 0.8799573303757411
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8799573303757411
+
+
+ 28000
+ 1156
+ -90.04899999999998
+ 28000
+ 0.8732979202981104
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8732979202981104
+
+
+ 28000
+ 5332
+ -331.112
+ 28000
+ 0.7113625195049174
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7113625195049174
+
+
+ 13641
+ 1338
+ 0.0009000000000014552
+ 13641
+ 0.7980033802458849
+ 13641.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7980033802458849
+
+
+ 2575
+ 284
+ -0.0008000000000265572
+ 2575
+ 0.8164531603319137
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8164531603319137
+
+
+ 3667
+ 2575
+ -122.96679999999998
+ 3667
+ 0.7253705487219619
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7253705487219619
+
+
+ 3771
+ 2575
+ -31.99000000000001
+ 3771
+ 0.7251102524133266
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7251102524133266
+
+
+ 2575
+ 311
+ 15.992700000000013
+ 2575
+ 0.7062406701299218
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7062406701299218
+
+
+ 10446
+ 2575
+ -13.978599999999972
+ 10446
+ 0.8999753679531999
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8999753679531999
+
+
+ 7731
+ 2575
+ 56.1155
+ 7731
+ 0.7169488062873204
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7169488062873204
+
+
+ 4559
+ 1695
+ 50.088599999999985
+ 4559
+ 0.7170509324806612
+ 4559.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7170509324806612
+
+
+ 1352
+ 270
+ 18.010599999999954
+ 1352
+ 0.8563378078396177
+ 1352.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8563378078396177
+
+
+ 13698
+ 4789
+ 18.00960000000009
+ 13698
+ 0.7309049034230997
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7309049034230997
+
+
+ 13676
+ 13610
+ -84.02100000000002
+ 13676
+ 0.7810920039377021
+ 13676.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7810920039377021
+
+
+ 6038
+ 5975
+ 0.0
+ 6038
+ 0.8840320085106907
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 6038
+ 5935
+ 0.0
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 6038
+ 6019
+ -0.00010000000000331966
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 10964
+ 1193
+ 0.9457999999999629
+ 10964
+ 0.7171219059323268
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7171219059323268
+
+
+ 7731
+ 1193
+ 14.01479999999998
+ 7731
+ 0.7014124112761397
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7014124112761397
+
+
+ 1339
+ 1173
+ -26.015300000000025
+ 1339
+ 0.8066641559490045
+ 1339.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8066641559490045
+
+
+ 4537
+ 1173
+ 15.994799999999998
+ 4537
+ 0.8564001559018828
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8564001559018828
+
+
+ 1322
+ 1173
+ 82.00580000000002
+ 1322
+ 0.7370539191821087
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7370539191821087
+
+
+ 1376
+ 1173
+ 96.0215
+ 1376
+ 0.7535949038696292
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7535949038696292
+
+
+ 4500
+ 1173
+ 67.9898
+ 4500
+ 0.8392533735358628
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8392533735358628
+
+
+ 2541
+ 1173
+ 30.010400000000004
+ 2541
+ 0.7101292434838536
+ 2541.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101292434838536
+
+
+ 1173
+ 1164
+ -67.9896
+ 1173
+ 0.7720170935236409
+ 1173.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720170935236409
+
+
+ 1967
+ 1173
+ 15.995299999999986
+ 1967
+ 0.8527043882889677
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8527043882889677
+
+
+ 4587
+ 1173
+ -74.03719999999998
+ 4587
+ 0.7430226083893596
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7430226083893596
+
+
+ 7795
+ 1173
+ -20.150300000000016
+ 7795
+ 0.7474656625550722
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7474656625550722
+
+
+ 4549
+ 1173
+ -32.025499999999965
+ 4549
+ 0.77698747812405
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.77698747812405
+
+
+ 1223
+ 1173
+ 31.989900000000034
+ 1223
+ 0.7350632353801019
+ 1223.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7350632353801019
+
+
+ 1240
+ 1173
+ -32.02570000000003
+ 1240
+ 0.7481440078358288
+ 1240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7481440078358288
+
+
+ 1335
+ 1173
+ -20.150300000000016
+ 1335
+ 0.7433682408351929
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7433682408351929
+
+
+ 1449
+ 1173
+ -168.18830000000003
+ 1449
+ 0.7206087939452487
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206087939452487
+
+
+ 1555
+ 1173
+ 15.994700000000023
+ 1555
+ 0.7909494753245667
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7909494753245667
+
+
+ 2486
+ 1173
+ -16.030699999999968
+ 2486
+ 0.7835363647356086
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7835363647356086
+
+
+ 3766
+ 1173
+ 66.01089999999999
+ 3766
+ 0.7766122485197371
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7766122485197371
+
+
+ 4661
+ 1173
+ -18.010899999999992
+ 4661
+ 0.8250227213882504
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8250227213882504
+
+
+ 4694
+ 1173
+ -42.01049999999998
+ 4694
+ 0.7868649521346712
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7868649521346712
+
+
+ 7663
+ 1173
+ 82.04169999999999
+ 7663
+ 0.7415522669540509
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7415522669540509
+
+
+ 7665
+ 1173
+ -3.9510999999999967
+ 7665
+ 0.7359749425183681
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7359749425183681
+
+
+ 8321
+ 1173
+ 15.994799999999998
+ 8321
+ 0.874888952943055
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.874888952943055
+
+
+ 13633
+ 1173
+ 32.026099999999985
+ 13633
+ 0.8025136343081888
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8025136343081888
+
+
+ 13737
+ 1173
+ 41.03030000000001
+ 13737
+ 0.7299415400310498
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7299415400310498
+
+
+ 20868
+ 1173
+ 64.0743
+ 20868
+ 0.7353894236462689
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7353894236462689
+
+
+ 26406
+ 1173
+ -1.9800000000000182
+ 26406
+ 0.7206619892436839
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206619892436839
+
+
+ 7653
+ 7620
+ 13.980700000000013
+ 7653
+ 0.7445894888430411
+ 7653.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7445894888430411
+
+
+ 7653
+ 7624
+ -2.0154999999999745
+ 7653
+ 0.7774040833823059
+ 7653.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7774040833823059
+
+
+ 13633
+ 2692
+ 53.0505
+ 13633
+ 0.7458115466778921
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7458115466778921
+
+
+ 13633
+ 4537
+ 16.031299999999987
+ 13633
+ 0.845664359251163
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.845664359251163
+
+
+ 13633
+ 1322
+ -49.97970000000004
+ 13633
+ 0.8043030834172109
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8043030834172109
+
+
+ 13633
+ 1376
+ -63.99540000000002
+ 13633
+ 0.7687686269218474
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7687686269218474
+
+
+ 13633
+ 4500
+ -35.96370000000002
+ 13633
+ 0.8364552663707707
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8364552663707707
+
+
+ 13633
+ 1164
+ -35.96350000000001
+ 13633
+ 0.8321570633161148
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8321570633161148
+
+
+ 13633
+ 1967
+ 16.0308
+ 13633
+ 0.840266026704837
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.840266026704837
+
+
+ 13633
+ 1307
+ -35.96430000000004
+ 13633
+ 0.784098407055699
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.784098407055699
+
+
+ 13633
+ 4587
+ 106.06329999999997
+ 13633
+ 0.7727052855957943
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7727052855957943
+
+
+ 13633
+ 7795
+ 52.1764
+ 13633
+ 0.7783756541354353
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7783756541354353
+
+
+ 13633
+ 4549
+ 64.05159999999995
+ 13633
+ 0.7741017917459859
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7741017917459859
+
+
+ 13633
+ 3766
+ -33.98480000000001
+ 13633
+ 0.8002918228341831
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8002918228341831
+
+
+ 26406
+ 13633
+ -34.0061
+ 26406
+ 0.8271753716584815
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8271753716584815
+
+
+ 13633
+ 1240
+ 64.05180000000001
+ 13633
+ 0.7465009965158613
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465009965158613
+
+
+ 13633
+ 1335
+ 52.1764
+ 13633
+ 0.7709303014100878
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7709303014100878
+
+
+ 13633
+ 1449
+ 200.2144
+ 13633
+ 0.7801012401104481
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7801012401104481
+
+
+ 13633
+ 1555
+ 16.031399999999962
+ 13633
+ 0.7651013678110163
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7651013678110163
+
+
+ 13633
+ 4661
+ 50.03699999999998
+ 13633
+ 0.7948445040574719
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7948445040574719
+
+
+ 13633
+ 7663
+ -50.015600000000006
+ 13633
+ 0.806759523302935
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.806759523302935
+
+
+ 13633
+ 7665
+ 35.97719999999998
+ 13633
+ 0.8367766085666717
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367766085666717
+
+
+ 13633
+ 8321
+ 16.031299999999987
+ 13633
+ 0.8311150501288278
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8311150501288278
+
+
+ 13737
+ 13633
+ 9.004200000000026
+ 13737
+ 0.8134557016391082
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8134557016391082
+
+
+ 20868
+ 13633
+ 32.04820000000001
+ 20868
+ 0.8288663928104931
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8288663928104931
+
+
+ 7628
+ 7621
+ -18.01060000000001
+ 7628
+ 0.8097593920769901
+ 7628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8097593920769901
+
+
+ 7667
+ 7621
+ 0.0002000000000066393
+ 7667
+ 0.7939764597013956
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7939764597013956
+
+
+ 5175
+ 5148
+ 0.0002999999999957481
+ 5175
+ 1.0000000000000002
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11368
+ 5148
+ 0.0
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11194
+ 5148
+ -0.0002000000000066393
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 5194
+ 5148
+ 0.00010000000000331966
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5148
+ 25
+ 50.010999999999996
+ 5148
+ 0.7765014360319091
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 1653
+ 1487
+ 44.02589999999998
+ 1653
+ 0.9093249798306463
+ 1653.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9093249798306463
+
+
+ 4785
+ 1487
+ -204.1363
+ 4785
+ 0.848268947250483
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.848268947250483
+
+
+ 2783
+ 1487
+ -116.08350000000007
+ 2783
+ 0.8846281446851625
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8846281446851625
+
+
+ 1487
+ 1482
+ 44.02679999999998
+ 1487
+ 0.9248756168839098
+ 1487.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9248756168839098
+
+
+ 2566
+ 1487
+ -88.05230000000006
+ 2566
+ 0.9399910711194035
+ 2566.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9399910711194035
+
+
+ 2726
+ 1487
+ -130.09810000000004
+ 2726
+ 0.8259030434209769
+ 2726.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8259030434209769
+
+
+ 2761
+ 1487
+ -72.05780000000004
+ 2761
+ 0.8022317071646724
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8022317071646724
+
+
+ 4679
+ 1487
+ -174.12470000000008
+ 4679
+ 0.7791128526481546
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7791128526481546
+
+
+ 13719
+ 13660
+ 96.02030000000002
+ 13719
+ 0.7388131895529652
+ 13719.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7388131895529652
+
+
+ 4587
+ 4537
+ -90.03199999999998
+ 4587
+ 0.7842098749446971
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7842098749446971
+
+
+ 4587
+ 1322
+ -156.043
+ 4587
+ 0.7467146970290905
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7467146970290905
+
+
+ 4587
+ 1376
+ -170.0587
+ 4587
+ 0.742367766289796
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.742367766289796
+
+
+ 4587
+ 4500
+ -142.027
+ 4587
+ 0.8186249150040003
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8186249150040003
+
+
+ 4587
+ 1164
+ -142.02679999999998
+ 4587
+ 0.8093157865557121
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8093157865557121
+
+
+ 4587
+ 1967
+ -90.03249999999997
+ 4587
+ 0.7684988355766591
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7684988355766591
+
+
+ 4587
+ 1240
+ -42.011499999999955
+ 4587
+ 0.718885372343228
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.718885372343228
+
+
+ 4587
+ 1335
+ -53.88689999999997
+ 4587
+ 0.7551841126614868
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7551841126614868
+
+
+ 4587
+ 1449
+ 94.15110000000004
+ 4587
+ 0.7137709838086508
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7137709838086508
+
+
+ 4587
+ 1555
+ -90.03190000000001
+ 4587
+ 0.7002214613669502
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7002214613669502
+
+
+ 4587
+ 3766
+ -140.04809999999998
+ 4587
+ 0.7594446463336337
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7594446463336337
+
+
+ 4587
+ 4549
+ -42.01170000000002
+ 4587
+ 0.8217179048871404
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8217179048871404
+
+
+ 4661
+ 4587
+ 56.02629999999999
+ 4661
+ 0.7666240310740251
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666240310740251
+
+
+ 7663
+ 4587
+ 156.07889999999998
+ 7663
+ 0.7226337643803658
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7226337643803658
+
+
+ 8321
+ 4587
+ 90.03199999999998
+ 8321
+ 0.7911197984051381
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7911197984051381
+
+
+ 20868
+ 4587
+ 138.11149999999998
+ 20868
+ 0.7265904816272102
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7265904816272102
+
+
+ 26406
+ 4587
+ 72.05719999999997
+ 26406
+ 0.7403551920670073
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7403551920670073
+
+
+ 26328
+ 1322
+ -18.010199999999998
+ 26328
+ 0.7302993927916551
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7302993927916551
+
+
+ 26328
+ 4500
+ -3.994199999999978
+ 26328
+ 0.7956793964208981
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7956793964208981
+
+
+ 26328
+ 1164
+ -3.9939999999999714
+ 26328
+ 0.7545050882923094
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7545050882923094
+
+
+ 26328
+ 1307
+ -3.994799999999998
+ 26328
+ 0.7003012388315275
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7003012388315275
+
+
+ 26328
+ 7795
+ 84.14590000000004
+ 26328
+ 0.7016671106469226
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7016671106469226
+
+
+ 26328
+ 3766
+ -2.015299999999968
+ 26328
+ 0.7454426580307357
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7454426580307357
+
+
+ 26328
+ 7663
+ -18.046099999999967
+ 26328
+ 0.7215279459717998
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7215279459717998
+
+
+ 26328
+ 4661
+ 82.00650000000002
+ 26328
+ 0.7298374829207233
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7298374829207233
+
+
+ 26328
+ 20868
+ -0.07869999999996935
+ 26328
+ 0.7161158715281237
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7161158715281237
+
+
+ 7663
+ 2692
+ 103.0661
+ 7663
+ 0.7236128216761095
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7236128216761095
+
+
+ 7732
+ 7663
+ -104.00329999999997
+ 7732
+ 0.729794047573183
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729794047573183
+
+
+ 7663
+ 4537
+ 66.0469
+ 7663
+ 0.7375342580690634
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7375342580690634
+
+
+ 7681
+ 7663
+ -217.05129999999997
+ 7681
+ 0.7121563463400618
+ 7681.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7121563463400618
+
+
+ 7663
+ 1322
+ 0.03589999999996962
+ 7663
+ 0.8209335754702527
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8209335754702527
+
+
+ 7663
+ 1376
+ -13.979800000000012
+ 7663
+ 0.7980512050447385
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7980512050447385
+
+
+ 7663
+ 4500
+ 14.05189999999999
+ 7663
+ 0.825952919003377
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.825952919003377
+
+
+ 7663
+ 1164
+ 14.052099999999996
+ 7663
+ 0.8383852890236886
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8383852890236886
+
+
+ 7663
+ 1967
+ 66.0464
+ 7663
+ 0.7504339693632678
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7504339693632678
+
+
+ 7663
+ 1307
+ 14.05129999999997
+ 7663
+ 0.7611343986167387
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7611343986167387
+
+
+ 7795
+ 7663
+ -102.19200000000001
+ 7795
+ 0.7617069382187817
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7617069382187817
+
+
+ 7663
+ 4549
+ 114.06719999999996
+ 7663
+ 0.7284060608847098
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7284060608847098
+
+
+ 7663
+ 3766
+ 16.0308
+ 7663
+ 0.8121756419301319
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8121756419301319
+
+
+ 26406
+ 7663
+ -84.02170000000001
+ 26406
+ 0.8281027724705226
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8281027724705226
+
+
+ 7663
+ 1240
+ 114.06740000000002
+ 7663
+ 0.7992944859524869
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7992944859524869
+
+
+ 7663
+ 1296
+ -80.06470000000002
+ 7663
+ 0.7975146736211863
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7975146736211863
+
+
+ 7663
+ 1335
+ 102.19200000000001
+ 7663
+ 0.7185627395516155
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7185627395516155
+
+
+ 7663
+ 1449
+ 250.23000000000002
+ 7663
+ 0.7163799117536901
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7163799117536901
+
+
+ 7663
+ 2486
+ 98.07239999999996
+ 7663
+ 0.7225843174813046
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7225843174813046
+
+
+ 7663
+ 4661
+ 100.05259999999998
+ 7663
+ 0.7811667883586639
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7811667883586639
+
+
+ 7665
+ 7663
+ -85.99279999999999
+ 7665
+ 0.7836590812669706
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7836590812669706
+
+
+ 8321
+ 7663
+ -66.0469
+ 8321
+ 0.765860955411227
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765860955411227
+
+
+ 20868
+ 7663
+ -17.967399999999998
+ 20868
+ 0.8602342917868183
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8602342917868183
+
+
+ 4548
+ 1158
+ -104.0471
+ 4548
+ 0.8938556962070379
+ 4548.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8938556962070379
+
+
+ 5975
+ 5935
+ 0.0
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 6019
+ 5975
+ 0.00010000000000331966
+ 6019
+ 0.8840320085106907
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+
+
+ 11368
+ 5175
+ -0.0002999999999957481
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11368
+ 25
+ 50.010999999999996
+ 11368
+ 0.7765014360319091
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 11368
+ 5194
+ -0.00010000000000331966
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 11368
+ 11194
+ 0.0002000000000066393
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 8321
+ 1339
+ 42.01010000000002
+ 8321
+ 0.7999373012314828
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7999373012314828
+
+
+ 8321
+ 4537
+ 0.0
+ 8321
+ 0.9511165265710031
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9511165265710031
+
+
+ 8321
+ 1322
+ -66.01100000000002
+ 8321
+ 0.7873383933138107
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7873383933138107
+
+
+ 8321
+ 1376
+ -80.0267
+ 8321
+ 0.7684349266352615
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7684349266352615
+
+
+ 8321
+ 4500
+ -51.995000000000005
+ 8321
+ 0.8755536332425305
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8755536332425305
+
+
+ 8321
+ 1164
+ -51.9948
+ 8321
+ 0.8306840231912003
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8306840231912003
+
+
+ 8321
+ 1967
+ -0.0004999999999881766
+ 8321
+ 0.9267915671837754
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9267915671837754
+
+
+ 8321
+ 1307
+ -51.995600000000024
+ 8321
+ 0.7423090585274036
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7423090585274036
+
+
+ 8321
+ 7795
+ 36.14510000000001
+ 8321
+ 0.7653176906710635
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7653176906710635
+
+
+ 8321
+ 4549
+ 48.02029999999996
+ 8321
+ 0.8224640029896837
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8224640029896837
+
+
+ 8321
+ 3766
+ -50.016099999999994
+ 8321
+ 0.8080120075402827
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8080120075402827
+
+
+ 26406
+ 8321
+ -17.974800000000016
+ 26406
+ 0.7752441633128537
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7752441633128537
+
+
+ 8321
+ 1240
+ 48.02050000000003
+ 8321
+ 0.7636996275599084
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7636996275599084
+
+
+ 8321
+ 4694
+ 58.00529999999998
+ 8321
+ 0.829013640395701
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.829013640395701
+
+
+ 8321
+ 7665
+ 19.945899999999995
+ 8321
+ 0.7755061074969237
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7755061074969237
+
+
+ 8321
+ 2486
+ 32.025499999999965
+ 8321
+ 0.8027958957327685
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8027958957327685
+
+
+ 8321
+ 1335
+ 36.14510000000001
+ 8321
+ 0.7695492527558442
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7695492527558442
+
+
+ 8321
+ 1555
+ 9.999999997489795e-05
+ 8321
+ 0.8357012072601446
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8357012072601446
+
+
+ 20868
+ 8321
+ 48.079499999999996
+ 20868
+ 0.7662607782657829
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7662607782657829
+
+
+ 13737
+ 8321
+ 25.035500000000013
+ 13737
+ 0.7632308904928097
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7632308904928097
+
+
+ 8321
+ 1223
+ -15.995100000000036
+ 8321
+ 0.7741744314954162
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7741744314954162
+
+
+ 8321
+ 4661
+ 34.00569999999999
+ 8321
+ 0.8554031193941803
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8554031193941803
+
+
+ 4504
+ 1162
+ 165.06350000000003
+ 4504
+ 0.8164098517514803
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8164098517514803
+
+
+ 4590
+ 1162
+ 0.0004000000000132786
+ 4590
+ 0.8074986227408434
+ 4590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8074986227408434
+
+
+ 1196
+ 1162
+ 162.05330000000004
+ 1196
+ 0.8217489893110046
+ 1196.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8217489893110046
+
+
+ 2478
+ 1162
+ 165.0645
+ 2478
+ 0.7808714634023075
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7808714634023075
+
+
+ 4507
+ 1162
+ 179.079
+ 4507
+ 0.820700883141278
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.820700883141278
+
+
+ 4536
+ 2273
+ -0.0009000000000014552
+ 4536
+ 0.7715091972008596
+ 4536.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7715091972008596
+
+
+ 10258
+ 4584
+ -114.03210000000001
+ 10258
+ 0.7976338031004642
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7976338031004642
+
+
+ 4775
+ 4584
+ 0.015500000000031378
+ 4775
+ 0.8403666147440325
+ 4775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8403666147440325
+
+
+ 10473
+ 1156
+ -238.08709999999996
+ 10473
+ 0.8334072070031415
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8334072070031415
+
+
+ 1156
+ 9
+ 44.061399999999935
+ 1156
+ 0.8155978017294079
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8155978017294079
+
+
+ 1156
+ 6
+ 169.0272
+ 1156
+ 0.7173136451001267
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7173136451001267
+
+
+ 1156
+ 58
+ 16.030099999999948
+ 1156
+ 0.90607076925165
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.90607076925165
+
+
+ 1156
+ 144
+ -57.988699999999994
+ 1156
+ 0.876683552820863
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.876683552820863
+
+
+ 4537
+ 1339
+ 42.01010000000002
+ 4537
+ 0.7882247339707944
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7882247339707944
+
+
+ 4537
+ 1164
+ -51.9948
+ 4537
+ 0.8228342017021323
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8228342017021323
+
+
+ 4537
+ 1223
+ -15.995100000000036
+ 4537
+ 0.7630024039120842
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7630024039120842
+
+
+ 4537
+ 1240
+ 48.02050000000003
+ 4537
+ 0.7599221196352439
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7599221196352439
+
+
+ 4537
+ 1307
+ -51.995600000000024
+ 4537
+ 0.7402014018615574
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7402014018615574
+
+
+ 4537
+ 1322
+ -66.01100000000002
+ 4537
+ 0.7573240595511265
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7573240595511265
+
+
+ 4537
+ 1335
+ 36.14510000000001
+ 4537
+ 0.7564223987300519
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7564223987300519
+
+
+ 4537
+ 1376
+ -80.0267
+ 4537
+ 0.7748272828257107
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7748272828257107
+
+
+ 4537
+ 1555
+ 9.999999997489795e-05
+ 4537
+ 0.8367246409662303
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367246409662303
+
+
+ 4537
+ 1967
+ -0.0004999999999881766
+ 4537
+ 0.9371939457025606
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9371939457025606
+
+
+ 4537
+ 2486
+ 32.025499999999965
+ 4537
+ 0.7785511411540855
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785511411540855
+
+
+ 4537
+ 3766
+ -50.016099999999994
+ 4537
+ 0.7900813177791646
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7900813177791646
+
+
+ 4537
+ 4500
+ -51.995000000000005
+ 4537
+ 0.8526305182950509
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8526305182950509
+
+
+ 4549
+ 4537
+ -48.02029999999996
+ 4549
+ 0.8174961398405545
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8174961398405545
+
+
+ 4661
+ 4537
+ -34.00569999999999
+ 4661
+ 0.8479208109484992
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8479208109484992
+
+
+ 4694
+ 4537
+ -58.00529999999998
+ 4694
+ 0.8240362969921723
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8240362969921723
+
+
+ 7665
+ 4537
+ -19.945899999999995
+ 7665
+ 0.7705656656271879
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7705656656271879
+
+
+ 7795
+ 4537
+ -36.14510000000001
+ 7795
+ 0.760055747504465
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.760055747504465
+
+
+ 13737
+ 4537
+ 25.035500000000013
+ 13737
+ 0.7654923294937866
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7654923294937866
+
+
+ 20868
+ 4537
+ 48.079499999999996
+ 20868
+ 0.759816580087185
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.759816580087185
+
+
+ 26406
+ 4537
+ -17.974800000000016
+ 26406
+ 0.7628269024321406
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7628269024321406
+
+
+ 7731
+ 2287
+ -2.0153999999999996
+ 7731
+ 0.7247547561216621
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7247547561216621
+
+
+ 5812
+ 58
+ 257.0934
+ 5812
+ 0.7273160695115695
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7273160695115695
+
+
+ 5812
+ 144
+ 183.07460000000003
+ 5812
+ 0.7529330453870031
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7529330453870031
+
+
+ 5812
+ 4573
+ -0.00010000000003174137
+ 5812
+ 0.8303858599274045
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8303858599274045
+
+
+ 5812
+ 4605
+ -0.00010000000003174137
+ 5812
+ 0.8533317817398547
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8533317817398547
+
+
+ 5812
+ 5332
+ 0.00029999999998153726
+ 5812
+ 0.8569097419651501
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8569097419651501
+
+
+ 4605
+ 4573
+ 0.0
+ 4605
+ 0.8833028749504108
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8833028749504108
+
+
+ 4605
+ 58
+ 257.0935
+ 4605
+ 0.7515619218514578
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7515619218514578
+
+
+ 4605
+ 144
+ 183.07470000000006
+ 4605
+ 0.7804921257315742
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7804921257315742
+
+
+ 5332
+ 4605
+ -0.0004000000000132786
+ 5332
+ 0.8938796872213203
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8938796872213203
+
+
+ 5273
+ 1196
+ 49.01589999999999
+ 5273
+ 0.7067572392413318
+ 5273.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7067572392413318
+
+
+ 5273
+ 4507
+ 31.990200000000016
+ 5273
+ 0.7121755450743515
+ 5273.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7121755450743515
+
+
+ 4499
+ 1497
+ 0.0
+ 4499
+ 0.8555254726413463
+ 4499.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8555254726413463
+
+
+ 4559
+ 2775
+ -0.00010000000000331966
+ 4559
+ 0.7140217909411135
+ 4559.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7140217909411135
+
+
+ 5524
+ 1244
+ 16.031100000000038
+ 5524
+ 0.7600417942029223
+ 5524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7600417942029223
+
+
+ 10473
+ 9
+ -194.02570000000003
+ 10473
+ 0.8750385558484055
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8750385558484055
+
+
+ 9
+ 6
+ 124.96580000000006
+ 9
+ 0.7638891547042874
+ 9.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7638891547042874
+
+
+ 58
+ 9
+ 28.031299999999987
+ 58
+ 0.8733909880214258
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8733909880214258
+
+
+ 144
+ 9
+ 102.05009999999993
+ 144
+ 0.8610953796284533
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8610953796284533
+
+
+ 5332
+ 9
+ 285.1244
+ 5332
+ 0.7406248209262456
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7406248209262456
+
+
+ 3527
+ 2665
+ -42.01060000000001
+ 3527
+ 0.7344276268577485
+ 3527.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7344276268577485
+
+
+ 7704
+ 2775
+ -0.0001999999999782176
+ 7704
+ 0.7395826901335367
+ 7704.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7395826901335367
+
+
+ 13747
+ 13724
+ -0.0012999999999578904
+ 13747
+ 0.76576533769383
+ 13747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.76576533769383
+
+
+ 5332
+ 4573
+ -0.0004000000000132786
+ 5332
+ 0.9055815784788334
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9055815784788334
+
+
+ 5332
+ 58
+ 257.0931
+ 5332
+ 0.7366849880216451
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7366849880216451
+
+
+ 5332
+ 144
+ 183.07430000000005
+ 5332
+ 0.8121110723552849
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8121110723552849
+
+
+ 2761
+ 1653
+ -116.08370000000002
+ 2761
+ 0.7694090339092938
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7694090339092938
+
+
+ 4785
+ 2761
+ -132.07849999999996
+ 4785
+ 0.7511859473786051
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7511859473786051
+
+
+ 2783
+ 2761
+ -44.02570000000003
+ 2783
+ 0.7864313164561963
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7864313164561963
+
+
+ 2761
+ 2566
+ 15.994500000000016
+ 2761
+ 0.805492302230625
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.805492302230625
+
+
+ 4679
+ 2761
+ -102.06690000000003
+ 4679
+ 0.7063628387013188
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7063628387013188
+
+
+ 2761
+ 1482
+ -28.031000000000063
+ 2761
+ 0.8098172256149058
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8098172256149058
+
+
+ 2761
+ 2726
+ 58.0403
+ 2761
+ 0.7688360741741032
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7688360741741032
+
+
+ 10318
+ 3674
+ -98.03650000000005
+ 10318
+ 0.700397164355981
+ 10318.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.700397164355981
+
+
+ 10964
+ 343
+ -87.1046
+ 10964
+ 0.7818532876744582
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7818532876744582
+
+
+ 10964
+ 914
+ -87.1046
+ 10964
+ 0.7665749885551236
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7665749885551236
+
+
+ 10964
+ 1220
+ -73.08940000000001
+ 10964
+ 0.7206720094300136
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206720094300136
+
+
+ 10964
+ 3770
+ -2.015700000000038
+ 10964
+ 0.7284802710588062
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7284802710588062
+
+
+ 10964
+ 7731
+ -13.069000000000017
+ 10964
+ 0.7777073105488517
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7777073105488517
+
+
+ 10473
+ 6
+ -69.05989999999997
+ 10473
+ 0.8083294471916564
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8083294471916564
+
+
+ 10473
+ 58
+ -222.05700000000002
+ 10473
+ 0.8613979483011278
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8613979483011278
+
+
+ 10473
+ 144
+ -296.07579999999996
+ 10473
+ 0.7824093927514792
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7824093927514792
+
+
+ 11741
+ 5168
+ 0.0004999999999881766
+ 11741
+ 0.9999999999999996
+ 11741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999996
+
+
+ 4504
+ 1196
+ 3.0101999999999975
+ 4504
+ 0.8297765773143058
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8297765773143058
+
+
+ 4504
+ 2478
+ -0.0009999999999763531
+ 4504
+ 0.9347224640063869
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9347224640063869
+
+
+ 4507
+ 4504
+ 14.015499999999975
+ 4507
+ 0.8391059596061563
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8391059596061563
+
+
+ 4549
+ 2712
+ -30.01079999999996
+ 4549
+ 0.7287640203784882
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7287640203784882
+
+
+ 4549
+ 1322
+ -114.03129999999999
+ 4549
+ 0.7600449791445076
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7600449791445076
+
+
+ 4549
+ 1376
+ -128.04699999999997
+ 4549
+ 0.7137383048352939
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7137383048352939
+
+
+ 4549
+ 4500
+ -100.01529999999997
+ 4549
+ 0.8175702995310199
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8175702995310199
+
+
+ 4549
+ 1164
+ -100.01509999999996
+ 4549
+ 0.8153558038279359
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8153558038279359
+
+
+ 4549
+ 1967
+ -48.02079999999995
+ 4549
+ 0.8045527309998968
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8045527309998968
+
+
+ 4549
+ 1223
+ -64.0154
+ 4549
+ 0.7395512062440517
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7395512062440517
+
+
+ 4549
+ 1240
+ 0.00020000000006348273
+ 4549
+ 0.766608611936314
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.766608611936314
+
+
+ 4549
+ 1335
+ -11.87519999999995
+ 4549
+ 0.781380174091065
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.781380174091065
+
+
+ 4549
+ 1449
+ 136.16280000000006
+ 4549
+ 0.702182889984132
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702182889984132
+
+
+ 4549
+ 1555
+ -48.02019999999999
+ 4549
+ 0.7587473642143105
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7587473642143105
+
+
+ 4549
+ 2486
+ -15.994799999999998
+ 4549
+ 0.7344509679691511
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7344509679691511
+
+
+ 4549
+ 3766
+ -98.03639999999996
+ 4549
+ 0.815778757831426
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.815778757831426
+
+
+ 4661
+ 4549
+ 14.014599999999973
+ 4661
+ 0.8045999808486788
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8045999808486788
+
+
+ 4694
+ 4549
+ -9.985000000000014
+ 4694
+ 0.7177092645080119
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7177092645080119
+
+
+ 7665
+ 4549
+ 28.07439999999997
+ 7665
+ 0.7443063423447049
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7443063423447049
+
+
+ 13737
+ 4549
+ 73.05579999999998
+ 13737
+ 0.7610102512520416
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7610102512520416
+
+
+ 20868
+ 4549
+ 96.09979999999996
+ 20868
+ 0.7370339263867569
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7370339263867569
+
+
+ 26406
+ 4549
+ 30.045499999999947
+ 26406
+ 0.7526911360538338
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7526911360538338
+
+
+ 1555
+ 1339
+ 42.01000000000005
+ 1555
+ 0.7281893504060184
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7281893504060184
+
+
+ 1967
+ 1339
+ 42.01060000000001
+ 1967
+ 0.7606271858773201
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7606271858773201
+
+
+ 2486
+ 1339
+ 9.984600000000057
+ 2486
+ 0.7293311152581581
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7293311152581581
+
+
+ 4694
+ 1339
+ -15.995199999999954
+ 4694
+ 0.7314273164370435
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7314273164370435
+
+
+ 28840
+ 1248
+ -0.0002000000000066393
+ 28840
+ 0.8597570112527155
+ 28840.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8597570112527155
+
+
+ 28840
+ 4327
+ -0.00010000000000331966
+ 28840
+ 0.9230244810858703
+ 28840.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9230244810858703
+
+
+ 4661
+ 2692
+ 3.013500000000022
+ 4661
+ 0.7299220493640461
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7299220493640461
+
+
+ 4661
+ 1322
+ -100.01670000000001
+ 4661
+ 0.7996710822332747
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7996710822332747
+
+
+ 4661
+ 1376
+ -114.0324
+ 4661
+ 0.761982528156744
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.761982528156744
+
+
+ 4661
+ 4500
+ -86.0007
+ 4661
+ 0.8372669624014374
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8372669624014374
+
+
+ 4661
+ 1164
+ -86.00049999999999
+ 4661
+ 0.8078080832175779
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8078080832175779
+
+
+ 4661
+ 1967
+ -34.00619999999998
+ 4661
+ 0.8211259228578475
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8211259228578475
+
+
+ 4661
+ 1307
+ -86.00130000000001
+ 4661
+ 0.7394180283183406
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7394180283183406
+
+
+ 7795
+ 4661
+ -2.1394000000000233
+ 7795
+ 0.7516580255418412
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7516580255418412
+
+
+ 4661
+ 3766
+ -84.02179999999998
+ 4661
+ 0.8419973276588826
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8419973276588826
+
+
+ 26406
+ 4661
+ 16.030899999999974
+ 26406
+ 0.7655498713402991
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7655498713402991
+
+
+ 4661
+ 1240
+ 14.014800000000037
+ 4661
+ 0.8081079954170991
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8081079954170991
+
+
+ 4661
+ 1449
+ 150.17740000000003
+ 4661
+ 0.7454503310412346
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7454503310412346
+
+
+ 4694
+ 4661
+ -23.999599999999987
+ 4694
+ 0.7800256254252864
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7800256254252864
+
+
+ 7665
+ 4661
+ 14.059799999999996
+ 7665
+ 0.7495002132485028
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7495002132485028
+
+
+ 4661
+ 1296
+ -180.1173
+ 4661
+ 0.7567145054322356
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7567145054322356
+
+
+ 4661
+ 2486
+ -1.9802000000000248
+ 4661
+ 0.7738088816802413
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738088816802413
+
+
+ 4661
+ 1335
+ 2.1394000000000233
+ 4661
+ 0.7733534459799833
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7733534459799833
+
+
+ 4661
+ 1555
+ -34.005600000000015
+ 4661
+ 0.7323906962064897
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7323906962064897
+
+
+ 20868
+ 4661
+ 82.08519999999999
+ 20868
+ 0.78700954842966
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.78700954842966
+
+
+ 3766
+ 2692
+ 87.0353
+ 3766
+ 0.754578026801175
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.754578026801175
+
+
+ 7732
+ 3766
+ -87.97249999999997
+ 7732
+ 0.7639382778499226
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7639382778499226
+
+
+ 3766
+ 1322
+ -15.99490000000003
+ 3766
+ 0.8470876542950243
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8470876542950243
+
+
+ 3766
+ 1376
+ -30.01060000000001
+ 3766
+ 0.7839049503571097
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7839049503571097
+
+
+ 4500
+ 3766
+ 1.97890000000001
+ 4500
+ 0.8569018834232668
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8569018834232668
+
+
+ 3766
+ 1164
+ -1.9787000000000035
+ 3766
+ 0.8521339902552261
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8521339902552261
+
+
+ 3766
+ 1967
+ 50.015600000000006
+ 3766
+ 0.7761308631054887
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7761308631054887
+
+
+ 3766
+ 1307
+ -1.97950000000003
+ 3766
+ 0.7840447191869013
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7840447191869013
+
+
+ 7795
+ 3766
+ -86.16120000000001
+ 7795
+ 0.7843934598373515
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7843934598373515
+
+
+ 3766
+ 1240
+ 98.03660000000002
+ 3766
+ 0.7797876496350051
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7797876496350051
+
+
+ 3766
+ 1296
+ -96.09550000000002
+ 3766
+ 0.7693534892218841
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7693534892218841
+
+
+ 3766
+ 1335
+ 86.16120000000001
+ 3766
+ 0.8118126872873841
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8118126872873841
+
+
+ 3766
+ 1449
+ 234.19920000000002
+ 3766
+ 0.7824983638834143
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7824983638834143
+
+
+ 3766
+ 2486
+ 82.04159999999996
+ 3766
+ 0.8031131651260015
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8031131651260015
+
+
+ 4694
+ 3766
+ -108.02139999999997
+ 4694
+ 0.7335510467062633
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7335510467062633
+
+
+ 7665
+ 3766
+ -69.96199999999999
+ 7665
+ 0.8271184113305441
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8271184113305441
+
+
+ 20868
+ 3766
+ -1.9365999999999985
+ 20868
+ 0.8182810964439488
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8182810964439488
+
+
+ 26406
+ 3766
+ -67.99090000000001
+ 26406
+ 0.7934361596333377
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7934361596333377
+
+
+ 10446
+ 284
+ -13.979399999999998
+ 10446
+ 0.8231431925469747
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8231431925469747
+
+
+ 10446
+ 3667
+ 108.9882
+ 10446
+ 0.7013731424213507
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013731424213507
+
+
+ 10446
+ 3771
+ 18.011400000000037
+ 10446
+ 0.7674937919319259
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7674937919319259
+
+
+ 4539
+ 311
+ 30.009500000000003
+ 4539
+ 0.736800521392811
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.736800521392811
+
+
+ 4539
+ 3667
+ 136.98359999999997
+ 4539
+ 0.7037384727274302
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7037384727274302
+
+
+ 4539
+ 3771
+ 46.0068
+ 4539
+ 0.7155343538547397
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7155343538547397
+
+
+ 6019
+ 5935
+ 0.00010000000000331966
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+
+
+ 1604
+ 1395
+ -23.999900000000025
+ 1604
+ 0.77006655272486
+ 1604.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.77006655272486
+
+
+ 4525
+ 2513
+ -0.0004999999999881766
+ 4525
+ 0.941353246702249
+ 4525.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.941353246702249
+
+
+ 26406
+ 2692
+ 19.044399999999996
+ 26406
+ 0.7694329722061235
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7694329722061235
+
+
+ 26406
+ 7732
+ 19.981599999999958
+ 26406
+ 0.740963364564245
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.740963364564245
+
+
+ 26406
+ 7681
+ 133.02959999999996
+ 26406
+ 0.7421771058411704
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7421771058411704
+
+
+ 26406
+ 1322
+ -83.98580000000004
+ 26406
+ 0.8709551528021924
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8709551528021924
+
+
+ 26406
+ 1376
+ -98.00150000000002
+ 26406
+ 0.7216100233358241
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7216100233358241
+
+
+ 26406
+ 4500
+ -69.96980000000002
+ 26406
+ 0.8313967055731342
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8313967055731342
+
+
+ 26406
+ 1164
+ -69.96960000000001
+ 26406
+ 0.7970604391265663
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7970604391265663
+
+
+ 26406
+ 1967
+ -17.975300000000004
+ 26406
+ 0.7677301876855243
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7677301876855243
+
+
+ 26406
+ 1307
+ -69.97040000000004
+ 26406
+ 0.7711044013193507
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7711044013193507
+
+
+ 26406
+ 7795
+ 18.170299999999997
+ 26406
+ 0.7512511853016856
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7512511853016856
+
+
+ 26406
+ 1240
+ 30.04570000000001
+ 26406
+ 0.7114364181836041
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7114364181836041
+
+
+ 26406
+ 1296
+ -164.08640000000003
+ 26406
+ 0.7382379550237833
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7382379550237833
+
+
+ 26406
+ 1335
+ 18.170299999999997
+ 26406
+ 0.7569061264823211
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7569061264823211
+
+
+ 26406
+ 1449
+ 166.2083
+ 26406
+ 0.7224541626137382
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7224541626137382
+
+
+ 26406
+ 1555
+ -17.97470000000004
+ 26406
+ 0.7207561319602911
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7207561319602911
+
+
+ 26406
+ 2486
+ 14.05069999999995
+ 26406
+ 0.7064040308918483
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7064040308918483
+
+
+ 26406
+ 7665
+ 1.9710999999999785
+ 26406
+ 0.8359818775999965
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8359818775999965
+
+
+ 26406
+ 13737
+ -43.01030000000003
+ 26406
+ 0.7332192314147685
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7332192314147685
+
+
+ 26406
+ 20868
+ -66.05430000000001
+ 26406
+ 0.8319535586918527
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8319535586918527
+
+
+ 4679
+ 1653
+ -218.15060000000005
+ 4679
+ 0.7517045603340821
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7517045603340821
+
+
+ 4785
+ 4679
+ -30.01159999999993
+ 4785
+ 0.7639185618930265
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7639185618930265
+
+
+ 4679
+ 2783
+ -58.0412
+ 4679
+ 0.7832832988428708
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7832832988428708
+
+
+ 4679
+ 2566
+ -86.07240000000002
+ 4679
+ 0.8025062027680925
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8025062027680925
+
+
+ 4679
+ 1482
+ -130.0979000000001
+ 4679
+ 0.7741177270955443
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7741177270955443
+
+
+ 4679
+ 2726
+ -44.02660000000003
+ 4679
+ 0.7804574401981137
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7804574401981137
+
+
+ 7667
+ 4732
+ 2.015199999999993
+ 7667
+ 0.7252108652588771
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7252108652588771
+
+
+ 1511
+ 270
+ 48.02109999999999
+ 1511
+ 0.7601368551757222
+ 1511.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7601368551757222
+
+
+ 10258
+ 4775
+ -114.04760000000005
+ 10258
+ 0.728447873223556
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.728447873223556
+
+
+ 914
+ 343
+ 0.0
+ 914
+ 0.9044059409483214
+ 914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9044059409483214
+
+
+ 1220
+ 914
+ -14.015199999999993
+ 1220
+ 0.7648067548917283
+ 1220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7648067548917283
+
+
+ 7731
+ 914
+ -74.03559999999999
+ 7731
+ 0.7446438351732421
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7446438351732421
+
+
+ 13596
+ 7810
+ -0.0004999999999881766
+ 13596
+ 0.7183885055241073
+ 13596.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7183885055241073
+
+
+ 7667
+ 7628
+ 18.010800000000017
+ 7667
+ 0.7327776314829841
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7327776314829841
+
+
+ 4327
+ 1248
+ -0.00010000000000331966
+ 4327
+ 0.7574619904103219
+ 4327.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7574619904103219
+
+
+ 4520
+ 1183
+ -0.0003999999999564352
+ 4520
+ 0.7853227760134743
+ 4520.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7853227760134743
+
+
+ 58
+ 6
+ 152.99710000000005
+ 58
+ 0.7310805342297133
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7310805342297133
+
+
+ 11194
+ 5175
+ -0.0005000000000023874
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 11194
+ 25
+ 50.01079999999999
+ 11194
+ 0.7738824635537842
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+
+
+ 11194
+ 5194
+ -0.00030000000000995897
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+
+
+ 4507
+ 1196
+ 17.025699999999972
+ 4507
+ 0.8647189816035392
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8647189816035392
+
+
+ 2478
+ 1196
+ 3.011199999999974
+ 2478
+ 0.7918143968620416
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7918143968620416
+
+
+ 4546
+ 1345
+ 0.0
+ 4546
+ 0.8206900618221651
+ 4546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8206900618221651
+
+
+ 7795
+ 2692
+ 0.8740999999999985
+ 7795
+ 0.7046384402100274
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7046384402100274
+
+
+ 7795
+ 1322
+ -102.15610000000004
+ 7795
+ 0.7696498660638114
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7696498660638114
+
+
+ 7795
+ 1376
+ -116.17180000000002
+ 7795
+ 0.7541647769910891
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7541647769910891
+
+
+ 7795
+ 4500
+ -88.14010000000002
+ 7795
+ 0.8286106228280599
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8286106228280599
+
+
+ 7795
+ 1164
+ -88.13990000000001
+ 7795
+ 0.8075784595832387
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8075784595832387
+
+
+ 7795
+ 1967
+ -36.1456
+ 7795
+ 0.747074901877226
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.747074901877226
+
+
+ 7795
+ 1307
+ -88.14070000000004
+ 7795
+ 0.7933181855897649
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7933181855897649
+
+
+ 7795
+ 1240
+ 11.875400000000013
+ 7795
+ 0.7005075121434275
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7005075121434275
+
+
+ 7795
+ 1296
+ -182.25670000000002
+ 7795
+ 0.7135762576531047
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7135762576531047
+
+
+ 7795
+ 1335
+ 0.0
+ 7795
+ 0.7585331345833688
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7585331345833688
+
+
+ 7795
+ 1449
+ 148.038
+ 7795
+ 0.7365534214562421
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7365534214562421
+
+
+ 7795
+ 2486
+ -4.119600000000048
+ 7795
+ 0.7261215131126089
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7261215131126089
+
+
+ 7795
+ 4694
+ 21.860199999999963
+ 7795
+ 0.7134592731505741
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7134592731505741
+
+
+ 7795
+ 7665
+ -16.19920000000002
+ 7795
+ 0.7569625927332879
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7569625927332879
+
+
+ 20868
+ 7795
+ 84.22460000000001
+ 20868
+ 0.8266232299790689
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8266232299790689
+
+
+ 13790
+ 13744
+ -9.999999997489795e-05
+ 13790
+ 0.8012232629029546
+ 13790.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8012232629029546
+
+
+ 2566
+ 1653
+ -132.07820000000004
+ 2566
+ 0.8846606792194505
+ 2566.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8846606792194505
+
+
+ 4785
+ 2566
+ -116.08399999999995
+ 4785
+ 0.8551412833770435
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8551412833770435
+
+
+ 2783
+ 2566
+ -28.031200000000013
+ 2783
+ 0.8843382233771084
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8843382233771084
+
+
+ 2566
+ 1482
+ -44.02550000000008
+ 2566
+ 0.9407334877751925
+ 2566.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9407334877751925
+
+
+ 2726
+ 2566
+ -42.045799999999986
+ 2726
+ 0.8497385009371045
+ 2726.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8497385009371045
+
+
+ 1555
+ 1376
+ -80.02679999999998
+ 1555
+ 0.7024193837352215
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7024193837352215
+
+
+ 4500
+ 1555
+ 51.99509999999998
+ 4500
+ 0.7723423924571776
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7723423924571776
+
+
+ 1555
+ 1164
+ -51.99489999999997
+ 1555
+ 0.746271146897007
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.746271146897007
+
+
+ 1967
+ 1555
+ 0.0005999999999630745
+ 1967
+ 0.8390195724644736
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8390195724644736
+
+
+ 4694
+ 1555
+ -58.0052
+ 4694
+ 0.7343963218290284
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7343963218290284
+
+
+ 7665
+ 1555
+ -19.94580000000002
+ 7665
+ 0.7297593959545514
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7297593959545514
+
+
+ 1555
+ 1335
+ 36.14500000000004
+ 1555
+ 0.7101123824580223
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101123824580223
+
+
+ 13737
+ 1555
+ 25.035599999999988
+ 13737
+ 0.7084176195321624
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7084176195321624
+
+
+ 1322
+ 1240
+ 114.03150000000005
+ 1322
+ 0.747141032642104
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.747141032642104
+
+
+ 1376
+ 1240
+ 128.04720000000003
+ 1376
+ 0.7226335520468117
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7226335520468117
+
+
+ 4500
+ 1240
+ 100.01550000000003
+ 4500
+ 0.7822436628771736
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7822436628771736
+
+
+ 1240
+ 1164
+ -100.01530000000002
+ 1240
+ 0.7872140874571354
+ 1240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872140874571354
+
+
+ 1967
+ 1240
+ 48.021000000000015
+ 1967
+ 0.751236825363835
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.751236825363835
+
+
+ 20868
+ 1240
+ 96.10000000000002
+ 20868
+ 0.7601679422730914
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7601679422730914
+
+
+ 1376
+ 1322
+ 14.015699999999981
+ 1376
+ 0.7517979220665135
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7517979220665135
+
+
+ 1376
+ 1164
+ 28.031900000000007
+ 1376
+ 0.8168375504441131
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8168375504441131
+
+
+ 1376
+ 1296
+ -66.0849
+ 1376
+ 0.7303227583978665
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7303227583978665
+
+
+ 1376
+ 1335
+ 116.17180000000002
+ 1376
+ 0.7104922244190991
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7104922244190991
+
+
+ 1967
+ 1376
+ -80.02620000000002
+ 1967
+ 0.7775443555570605
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7775443555570605
+
+
+ 2486
+ 1376
+ -112.05219999999997
+ 2486
+ 0.7675851474166064
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7675851474166064
+
+
+ 4500
+ 1376
+ -28.0317
+ 4500
+ 0.8108368286050882
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8108368286050882
+
+
+ 4694
+ 1376
+ -138.03199999999998
+ 4694
+ 0.7329059327273093
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7329059327273093
+
+
+ 7665
+ 1376
+ -99.9726
+ 7665
+ 0.7186670773968943
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7186670773968943
+
+
+ 20868
+ 1376
+ -31.94720000000001
+ 20868
+ 0.7906294442491173
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7906294442491173
+
+
+ 1170
+ 69
+ -0.0002000000000066393
+ 1170
+ 0.9301843579
+ 1170.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9301843579
+
+
+ 4507
+ 2478
+ 14.014499999999998
+ 4507
+ 0.808934390784182
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.808934390784182
+
+
+ 4694
+ 4500
+ -110.00029999999998
+ 4694
+ 0.7628576836893292
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7628576836893292
+
+
+ 4694
+ 1967
+ -58.005799999999965
+ 4694
+ 0.7941437971340921
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7941437971340921
+
+
+ 4694
+ 1307
+ -110.0009
+ 4694
+ 0.7161695363740572
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7161695363740572
+
+
+ 4694
+ 1223
+ -74.00040000000001
+ 4694
+ 0.7244913667806309
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7244913667806309
+
+
+ 4694
+ 1335
+ -21.860199999999963
+ 4694
+ 0.7214309685012016
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7214309685012016
+
+
+ 4694
+ 2486
+ -25.97980000000001
+ 4694
+ 0.7690960920900176
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7690960920900176
+
+
+ 7665
+ 4694
+ 38.05939999999998
+ 7665
+ 0.7229782167436878
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7229782167436878
+
+
+ 2692
+ 1335
+ -0.8740999999999985
+ 2692
+ 0.7671774056073459
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7671774056073459
+
+
+ 7732
+ 1335
+ -1.8112999999999602
+ 7732
+ 0.7192575937943765
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7192575937943765
+
+
+ 1335
+ 1322
+ -102.15610000000004
+ 1335
+ 0.7794273300366701
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7794273300366701
+
+
+ 4500
+ 1335
+ 88.14010000000002
+ 4500
+ 0.8253669799859673
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8253669799859673
+
+
+ 2541
+ 1335
+ 50.16070000000002
+ 2541
+ 0.7188611386825592
+ 2541.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7188611386825592
+
+
+ 1335
+ 1164
+ -88.13990000000001
+ 1335
+ 0.7862339773317886
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7862339773317886
+
+
+ 1967
+ 1335
+ 36.1456
+ 1967
+ 0.769603314008003
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.769603314008003
+
+
+ 1335
+ 1307
+ -88.14070000000004
+ 1335
+ 0.7293753672666943
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7293753672666943
+
+
+ 1449
+ 1335
+ -148.038
+ 1449
+ 0.75446627470522
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.75446627470522
+
+
+ 7665
+ 1335
+ 16.19920000000002
+ 7665
+ 0.7977469248244918
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7977469248244918
+
+
+ 2486
+ 1335
+ 4.119600000000048
+ 2486
+ 0.7314787625687822
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7314787625687822
+
+
+ 1335
+ 1223
+ -52.14020000000005
+ 1335
+ 0.7159080868333447
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7159080868333447
+
+
+ 20868
+ 1335
+ 84.22460000000001
+ 20868
+ 0.7699151342189468
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7699151342189468
+
+
+ 4573
+ 58
+ 257.0935
+ 4573
+ 0.706935411581155
+ 4573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.706935411581155
+
+
+ 4573
+ 144
+ 183.07470000000006
+ 4573
+ 0.7306575001900386
+ 4573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7306575001900386
+
+
+ 2692
+ 1322
+ -103.03020000000004
+ 2692
+ 0.8037237935765797
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8037237935765797
+
+
+ 7732
+ 1322
+ -103.9674
+ 7732
+ 0.7447465954502637
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7447465954502637
+
+
+ 1322
+ 1164
+ 14.016200000000026
+ 1322
+ 0.8599688757297299
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8599688757297299
+
+
+ 1322
+ 1296
+ -80.10059999999999
+ 1322
+ 0.7676739600785963
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7676739600785963
+
+
+ 1322
+ 1307
+ 14.0154
+ 1322
+ 0.864784470439568
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.864784470439568
+
+
+ 1449
+ 1322
+ -250.19410000000005
+ 1449
+ 0.7720104998939465
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720104998939465
+
+
+ 1967
+ 1322
+ -66.01050000000004
+ 1967
+ 0.7541416163138596
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7541416163138596
+
+
+ 2486
+ 1322
+ -98.03649999999999
+ 2486
+ 0.7743683143934724
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7743683143934724
+
+
+ 4500
+ 1322
+ -14.01600000000002
+ 4500
+ 0.8529575372097665
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8529575372097665
+
+
+ 7665
+ 1322
+ -85.95690000000002
+ 7665
+ 0.8149620201454973
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8149620201454973
+
+
+ 20868
+ 1322
+ -17.931500000000028
+ 20868
+ 0.820874081309024
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.820874081309024
+
+
+ 13754
+ 13613
+ -36.02120000000008
+ 13754
+ 0.7922081919739075
+ 13754.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7922081919739075
+
+
+ 13826
+ 7681
+ -111.08050000000003
+ 13826
+ 0.7433325161166867
+ 13826.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7433325161166867
+
+
+ 13826
+ 1449
+ -77.90179999999998
+ 13826
+ 0.7138967438535335
+ 13826.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7138967438535335
+
+
+ 144
+ 58
+ 74.01879999999994
+ 144
+ 0.9059964421265759
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9059964421265759
+
+
+ 3667
+ 311
+ -106.97409999999996
+ 3667
+ 0.729061707323615
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729061707323615
+
+
+ 3771
+ 311
+ -15.997299999999996
+ 3771
+ 0.7845694238665184
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7845694238665184
+
+
+ 270
+ 160
+ 12.010800000000017
+ 270
+ 0.7241078154133718
+ 270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7241078154133718
+
+
+ 20868
+ 2692
+ 85.09870000000001
+ 20868
+ 0.7787500818087499
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7787500818087499
+
+
+ 20868
+ 7732
+ 86.03589999999997
+ 20868
+ 0.7234752674501574
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7234752674501574
+
+
+ 20868
+ 7681
+ 199.08389999999997
+ 20868
+ 0.7248908224870868
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7248908224870868
+
+
+ 20868
+ 4500
+ -3.9155000000000086
+ 20868
+ 0.8468056052169505
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8468056052169505
+
+
+ 20868
+ 1164
+ -3.915300000000002
+ 20868
+ 0.8385704810654367
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8385704810654367
+
+
+ 20868
+ 1967
+ 48.07900000000001
+ 20868
+ 0.765975452274393
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765975452274393
+
+
+ 20868
+ 1307
+ -3.9161000000000286
+ 20868
+ 0.7891937493682792
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7891937493682792
+
+
+ 20868
+ 1449
+ 232.26260000000002
+ 20868
+ 0.732703409851635
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.732703409851635
+
+
+ 20868
+ 7665
+ 68.02539999999999
+ 20868
+ 0.8401956933492667
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8401956933492667
+
+
+ 20868
+ 1296
+ -98.03210000000001
+ 20868
+ 0.7955996313035669
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7955996313035669
+
+
+ 20868
+ 2486
+ 80.10499999999996
+ 20868
+ 0.759322934591776
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.759322934591776
+
+
+ 7681
+ 1449
+ 33.17870000000005
+ 7681
+ 0.707636380233894
+ 7681.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.707636380233894
+
+
+ 7681
+ 7665
+ -131.05849999999998
+ 7681
+ 0.7570436998465625
+ 7681.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7570436998465625
+
+
+ 7665
+ 2692
+ 17.073300000000017
+ 7665
+ 0.7635829200286655
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7635829200286655
+
+
+ 7732
+ 7665
+ -18.01049999999998
+ 7732
+ 0.8169616154115102
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8169616154115102
+
+
+ 7665
+ 4500
+ -71.9409
+ 7665
+ 0.8244621507842091
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8244621507842091
+
+
+ 7665
+ 1164
+ -71.94069999999999
+ 7665
+ 0.8086314183206176
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8086314183206176
+
+
+ 7665
+ 1967
+ -19.946399999999983
+ 7665
+ 0.7565935573311073
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7565935573311073
+
+
+ 7665
+ 1307
+ -71.94150000000002
+ 7665
+ 0.7671314492813278
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7671314492813278
+
+
+ 7665
+ 1449
+ 164.23720000000003
+ 7665
+ 0.7480574224077419
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7480574224077419
+
+
+ 7665
+ 1296
+ -166.0575
+ 7665
+ 0.7353197669312269
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7353197669312269
+
+
+ 7665
+ 2486
+ 12.07959999999997
+ 7665
+ 0.7409569964360518
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7409569964360518
+
+
+ 13737
+ 7665
+ 44.98140000000001
+ 13737
+ 0.7577152170860092
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7577152170860092
+
+
+ 10291
+ 1395
+ -21.985000000000014
+ 10291
+ 0.7178795767128796
+ 10291.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7178795767128796
+
+
+ 7624
+ 7620
+ 15.996199999999988
+ 7624
+ 0.7871534101893296
+ 7624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7871534101893296
+
+
+ 3771
+ 3667
+ 90.97679999999997
+ 3771
+ 0.7991555312519071
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7991555312519071
+
+
+ 25587
+ 3771
+ -172.1071
+ 25587
+ 0.7013988842172946
+ 25587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013988842172946
+
+
+ 7731
+ 3771
+ 88.1055
+ 7731
+ 0.7308237095596543
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7308237095596543
+
+
+ 4500
+ 1164
+ 0.0002000000000066393
+ 4500
+ 0.9235102377308329
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9235102377308329
+
+
+ 4500
+ 1307
+ -0.0006000000000199179
+ 4500
+ 0.8344800226211502
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8344800226211502
+
+
+ 4500
+ 1449
+ 236.17810000000003
+ 4500
+ 0.7714002330920218
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7714002330920218
+
+
+ 4500
+ 1967
+ 51.994500000000016
+ 4500
+ 0.8582728033464271
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8582728033464271
+
+
+ 4500
+ 2486
+ 84.02049999999997
+ 4500
+ 0.7897263266772947
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7897263266772947
+
+
+ 5194
+ 5175
+ -0.00019999999999242846
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+
+
+ 5194
+ 25
+ 50.0111
+ 5194
+ 0.7765014360319091
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 2692
+ 1164
+ -89.01400000000001
+ 2692
+ 0.7526547952040179
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7526547952040179
+
+
+ 2692
+ 1307
+ -89.01480000000004
+ 2692
+ 0.7244014068297405
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7244014068297405
+
+
+ 2692
+ 1449
+ 147.1639
+ 2692
+ 0.7215763112128273
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7215763112128273
+
+
+ 7732
+ 2692
+ -0.9371999999999616
+ 7732
+ 0.7041795924909788
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7041795924909788
+
+
+ 1449
+ 1164
+ -236.17790000000002
+ 1449
+ 0.7574059084406363
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7574059084406363
+
+
+ 1449
+ 1307
+ -236.17870000000005
+ 1449
+ 0.7142434858760744
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7142434858760744
+
+
+ 7731
+ 3667
+ 179.08229999999998
+ 7731
+ 0.8393159151728491
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8393159151728491
+
+
+ 1653
+ 1482
+ 88.05269999999996
+ 1653
+ 0.889803375072796
+ 1653.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.889803375072796
+
+
+ 4785
+ 1482
+ -160.10950000000003
+ 4785
+ 0.8560244789575602
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8560244789575602
+
+
+ 2783
+ 1482
+ -72.05670000000009
+ 2783
+ 0.8750686816709272
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8750686816709272
+
+
+ 2726
+ 1482
+ -86.07130000000006
+ 2726
+ 0.8451853914117339
+ 2726.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8451853914117339
+
+
+ 1220
+ 343
+ -14.015199999999993
+ 1220
+ 0.8485677609267931
+ 1220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8485677609267931
+
+
+ 7731
+ 343
+ -74.03559999999999
+ 7731
+ 0.8103733437255778
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8103733437255778
+
+
+ 4785
+ 1653
+ -248.16219999999998
+ 4785
+ 0.8006292822939076
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8006292822939076
+
+
+ 4785
+ 2726
+ -74.03819999999996
+ 4785
+ 0.8346810212301915
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8346810212301915
+
+
+ 4785
+ 2783
+ -88.05279999999993
+ 4785
+ 0.8554814016674146
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8554814016674146
+
+
+ 5175
+ 25
+ 50.01129999999999
+ 5175
+ 0.7765014360319091
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+
+
+ 7732
+ 2486
+ -5.930900000000008
+ 7732
+ 0.71852824293517
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.71852824293517
+
+
+ 25
+ 22
+ 43.989900000000006
+ 25
+ 0.7413654149145841
+ 25.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7413654149145841
+
+
+ 2783
+ 1653
+ -160.10940000000005
+ 2783
+ 0.8495209354306571
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8495209354306571
+
+
+ 2783
+ 2726
+ 14.014599999999973
+ 2783
+ 0.8660101192935002
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8660101192935002
+
+
+ 13737
+ 1967
+ 25.035000000000025
+ 13737
+ 0.7525488722971712
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7525488722971712
+
+
+ 2541
+ 1223
+ -1.97950000000003
+ 2541
+ 0.7050199860534161
+ 2541.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7050199860534161
+
+
+ 1307
+ 1164
+ 0.0008000000000265572
+ 1307
+ 0.8229714951102252
+ 1307.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8229714951102252
+
+
+ 1967
+ 1164
+ -51.99430000000001
+ 1967
+ 0.8192930619368571
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8192930619368571
+
+
+ 2486
+ 1164
+ -84.02029999999996
+ 2486
+ 0.7846481744200678
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7846481744200678
+
+
+ 2726
+ 1653
+ -174.12400000000002
+ 2726
+ 0.82344307100337
+ 2726.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.82344307100337
+
+
+ 1297
+ 1270
+ 17.02660000000003
+ 1297
+ 0.8351029425806448
+ 1297.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8351029425806448
+
+
+ 1967
+ 1307
+ -51.995100000000036
+ 1967
+ 0.7374725081175358
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7374725081175358
+
+
+ 2486
+ 1307
+ -84.02109999999999
+ 2486
+ 0.7096972935586895
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7096972935586895
+
+
+ 7731
+ 3770
+ 11.053299999999979
+ 7731
+ 0.8045708020018703
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8045708020018703
+
+
+ 1967
+ 1223
+ -15.994600000000048
+ 1967
+ 0.7666061714426515
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666061714426515
+
+
+ 2486
+ 1967
+ -32.025999999999954
+ 2486
+ 0.7522370090304027
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7522370090304027
+
+
+ 26810
+ 3674
+ 9.999999997489795e-05
+ 26810
+ 0.7575734214212644
+ 26810.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7575734214212644
+
+
\ No newline at end of file
diff --git a/spec2vec/Test-ComponentIndex/output_graphml.graphml b/spec2vec/Test-ComponentIndex/output_graphml.graphml
new file mode 100644
index 00000000..452f5f62
--- /dev/null
+++ b/spec2vec/Test-ComponentIndex/output_graphml.graphml
@@ -0,0 +1,56616 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8146
+ 5
+ 0
+ Feature Node
+ N/A
+ 1249081.4520805678
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5304.0","main.cluster index_upperinput":"5304.0"}
+ 5304
+ 16.8146
+ 1
+ This Node is a Singleton
+ N/A
+ 448.2309
+ N/A
+ 0.0
+ 448.2309
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9951
+ 5
+ 0
+ Feature Node
+ N/A
+ 7301878.409146197
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2753.0","main.cluster index_upperinput":"2753.0"}
+ 2753
+ 14.9951
+ 2
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 447.0923
+ N/A
+ 0.0
+ 447.0923
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9183
+ 1
+ 0
+ Feature Node
+ N/A
+ 347111.6661663127
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"60.0","main.cluster index_upperinput":"60.0"}
+ 60
+ 0.9183
+ -1
+ This Node is a Singleton
+ N/A
+ 217.0143
+ N/A
+ 0.0
+ 217.0143
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.666
+ 4
+ 0
+ Feature Node
+ N/A
+ 1159265.2781364343
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4974.0","main.cluster index_upperinput":"4974.0"}
+ 4974
+ 15.666
+ -1
+ This Node is a Singleton
+ N/A
+ 429.1529
+ N/A
+ 0.0
+ 429.1529
+
+
+ 23
+ 0.8296309999999999
+ CCMSLIB00003134511
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134511
+ InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H2,23,24)/b10-9-
+ 0
+ QQQ
+ InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H2,23,24)/b10-9-
+ 0.0
+ Spectral Match to 13-Docosenamide, (Z)- from NIST14
+ CCCCCCCC/C=C\\CCCCCCCCCCCC(=O)N
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134511
+ 5
+ 3.2471200000000002
+ Feature Node
+ N/A
+ 23
+ 0.0
+ 0.0
+ Data deposited by eriche
+ Spectral Match to 13-Docosenamide, (Z)- from NIST14
+ Positive
+ Data deposited by eriche
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"28.0","main.cluster index_upperinput":"28.0"}
+ 3.2471200000000002
+ 3
+ CCCCCCCC/C=C\\CCCCCCCCCCCC(=O)N
+ Data from Piel
+ 3
+ 338.3421
+ CCMSLIB00003134511
+ 338.3421
+ 0.0
+ Data from Piel
+ 13916293.609778142
+ QQQ
+ Isolated
+ 0.00109863
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.7587
+ 9
+ 0.8296309999999999
+ 0.0
+ Isolated
+ 28
+ 0.00109863
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.7587
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.0319
+ 8
+ 0
+ Feature Node
+ N/A
+ 1166808.1132334797
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1410.0","main.cluster index_upperinput":"1410.0"}
+ 1410
+ 33.0319
+ -1
+ This Node is a Singleton
+ N/A
+ 481.3554
+ N/A
+ 0.0
+ 481.3554
+
+
+ 17
+ 0.890516
+ CCMSLIB00000847746
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847746
+ InChI=1S/C24H26O13/c1-32-11-5-4-9(6-10(11)26)21-23(34-3)18(29)15-12(35-21)7-13(22(33-2)17(15)28)36-24-20(31)19(30)16(27)14(8-25)37-24/h4-7,14,16,19-20,24-28,30-31H,8H2,1-3H3/t14-,16-,19+,20-,24-/m1/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C24H26O13/c1-32-11-5-4-9(6-10(11)26)21-23(34-3)18(29)15-12(35-21)7-13(22(33-2)17(15)28)36-24-20(31)19(30)16(27)14(8-25)37-24/h4-7,14,16,19-20,24-28,30-31H,8H2,1-3H3/t14-,16-,19+,20-,24-/m1/s1
+ 0.0
+ NCGC00385512-01!5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+ COC1=C(O)C=C(C=C1)C2=C(OC)C(=O)C3=C(O)C(OC)=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3O2
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847746
+ 7
+ 2.68341
+ Feature Node
+ N/A
+ 17
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00385512-01!5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4503.0","main.cluster index_upperinput":"4503.0"}
+ 2.68341
+ 1
+ COC1=C(O)C=C(C=C1)C2=C(OC)C(=O)C3=C(O)C(OC)=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3O2
+ Jadhav/Dorrestein
+ 1
+ 523.1454
+ CCMSLIB00000847746
+ 523.1454
+ 0.0
+ Jadhav/Dorrestein
+ 7459719.001855942
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.00140381
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 17.7713
+ 5
+ 0.890516
+ 0.0
+ isolated
+ 4503
+ 0.00140381
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.7713
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.2184
+ 2
+ 0
+ Feature Node
+ N/A
+ 1200861.986762946
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4682.0","main.cluster index_upperinput":"4682.0"}
+ 4682
+ 15.2184
+ -1
+ This Node is a Singleton
+ N/A
+ 451.1936
+ N/A
+ 0.0
+ 451.1936
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.2849
+ 9
+ 0
+ Feature Node
+ N/A
+ 3320955.221245815
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2121.0","main.cluster index_upperinput":"2121.0"}
+ 2121
+ 32.2849
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3717
+ N/A
+ 0.0
+ 429.3717
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.9917
+ 6
+ 0
+ Feature Node
+ N/A
+ 779314.9344583361
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"170.0","main.cluster index_upperinput":"170.0"}
+ 170
+ 26.9917
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 268.1002
+ N/A
+ 0.0
+ 268.1002
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.2881
+ 5
+ 0
+ Feature Node
+ N/A
+ 3570762.229622576
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3602.0","main.cluster index_upperinput":"3602.0"}
+ 3602
+ 7.2881
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 442.2431
+ N/A
+ 0.0
+ 442.2431
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.7971
+ 8
+ 0
+ Feature Node
+ N/A
+ 3626554.5555401766
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5172.0","main.cluster index_upperinput":"5172.0"}
+ 5172
+ 22.7971
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8902
+ N/A
+ 0.0
+ 84.9451
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.9432
+ 4
+ 0
+ Feature Node
+ N/A
+ 601590.936468636
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"27744.0","main.cluster index_upperinput":"27744.0"}
+ 27744
+ 7.9432
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=61&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.219
+ N/A
+ 0.0
+ 496.219
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.0491
+ 8
+ 0
+ Feature Node
+ N/A
+ 1767586.533594747
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5195.0","main.cluster index_upperinput":"5195.0"}
+ 5195
+ 21.0491
+ -1
+ This Node is a Singleton
+ N/A
+ 181.1218
+ N/A
+ 0.0
+ 181.1218
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1155
+ 4
+ 0
+ Feature Node
+ N/A
+ 3836003.564263604
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"81.0","main.cluster index_upperinput":"81.0"}
+ 81
+ 23.1155
+ 12
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=9&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 393.2865
+ N/A
+ 0.0
+ 393.2865
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.6956
+ 5
+ 0
+ Feature Node
+ N/A
+ 730252.1750182833
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2946.0","main.cluster index_upperinput":"2946.0"}
+ 2946
+ 14.6956
+ 13
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 479.1178
+ N/A
+ 0.0
+ 479.1178
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.7443
+ 6
+ 0
+ Feature Node
+ N/A
+ 1751904.1015508363
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4836.0","main.cluster index_upperinput":"4836.0"}
+ 4836
+ 13.7443
+ -1
+ This Node is a Singleton
+ N/A
+ 287.1253
+ N/A
+ 0.0
+ 287.1253
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.535
+ 8
+ 0
+ Feature Node
+ N/A
+ 2905177.708348213
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"45.0","main.cluster index_upperinput":"45.0"}
+ 45
+ 25.535
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 254.0841
+ N/A
+ 0.0
+ 254.0841
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.1038
+ 8
+ 0
+ Feature Node
+ N/A
+ 2291852.562817203
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2528.0","main.cluster index_upperinput":"2528.0"}
+ 2528
+ 13.1038
+ 16
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 151.0388
+ N/A
+ 0.0
+ 151.0388
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.7256
+ 4
+ 0
+ Feature Node
+ N/A
+ 348278.5999983921
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14563.0","main.cluster index_upperinput":"14563.0"}
+ 14563
+ 24.7256
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 684.4157
+ N/A
+ 0.0
+ 684.4157
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7229
+ 4
+ 0
+ Feature Node
+ N/A
+ 1062485.8431644645
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4574.0","main.cluster index_upperinput":"4574.0"}
+ 4574
+ 17.7229
+ -1
+ This Node is a Singleton
+ N/A
+ 515.1165
+ N/A
+ 0.0
+ 515.1165
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.8842
+ 3
+ 0
+ Feature Node
+ N/A
+ 977802.6265394851
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"243.0","main.cluster index_upperinput":"243.0"}
+ 243
+ 30.8842
+ 19
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=82&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 367.3181
+ N/A
+ 0.0
+ 367.3181
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.8279
+ 5
+ 0
+ Feature Node
+ N/A
+ 256976.14311037914
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3631.0","main.cluster index_upperinput":"3631.0"}
+ 3631
+ 19.8279
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=56&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 625.2593
+ N/A
+ 0.0
+ 625.2593
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.8052
+ 5
+ 0
+ Feature Node
+ N/A
+ 1245608.4310451236
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5046.0","main.cluster index_upperinput":"5046.0"}
+ 5046
+ 7.8052
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.2218
+ N/A
+ 0.0
+ 394.2218
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9262
+ 5
+ 0
+ Feature Node
+ N/A
+ 5948711.742031584
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13615.0","main.cluster index_upperinput":"13615.0"}
+ 13615
+ 16.9262
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 366.1918
+ N/A
+ 0.0
+ 366.1918
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5365
+ 6
+ 0
+ Feature Node
+ N/A
+ 17410860.033584096
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1668.0","main.cluster index_upperinput":"1668.0"}
+ 1668
+ 33.5365
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 797.5189
+ N/A
+ 0.0
+ 797.5189
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1412
+ 8
+ 0
+ Feature Node
+ N/A
+ 7800960.794381272
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3026.0","main.cluster index_upperinput":"3026.0"}
+ 3026
+ 32.1412
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 367.2826
+ N/A
+ 0.0
+ 367.2826
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.0356
+ 8
+ 0
+ Feature Node
+ N/A
+ 4745331.034511559
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1206.0","main.cluster index_upperinput":"1206.0"}
+ 1206
+ 1.0356
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 160.9894
+ N/A
+ 0.0
+ 160.9894
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.8968
+ 2
+ 0
+ Feature Node
+ N/A
+ 3057465.5421761977
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13673.0","main.cluster index_upperinput":"13673.0"}
+ 13673
+ 14.8968
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 432.2012
+ N/A
+ 0.0
+ 432.2012
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.3918
+ 3
+ 0
+ Feature Node
+ N/A
+ 1102437.1318208224
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7827.0","main.cluster index_upperinput":"7827.0"}
+ 7827
+ 10.3918
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 528.1999
+ N/A
+ 0.0
+ 528.1999
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.5613
+ 7
+ 0
+ Feature Node
+ N/A
+ 6438713.495733419
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3685.0","main.cluster index_upperinput":"3685.0"}
+ 3685
+ 28.5613
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 861.4099
+ N/A
+ 0.0
+ 861.4099
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.935
+ 8
+ 0
+ Feature Node
+ N/A
+ 16662194.575077448
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"22481.0","main.cluster index_upperinput":"22481.0"}
+ 22481
+ 30.935
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 409.3823
+ N/A
+ 0.0
+ 409.3823
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.8395
+ 8
+ 0
+ Feature Node
+ N/A
+ 9160503.459211562
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"351.0","main.cluster index_upperinput":"351.0"}
+ 351
+ 30.8395
+ -1
+ This Node is a Singleton
+ N/A
+ 629.4027
+ N/A
+ 0.0
+ 629.4027
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.4852
+ 7
+ 0
+ Feature Node
+ N/A
+ 27753389.688350685
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2689.0","main.cluster index_upperinput":"2689.0"}
+ 2689
+ 34.4852
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 975.566
+ N/A
+ 0.0
+ 975.566
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.9407
+ 6
+ 0
+ Feature Node
+ N/A
+ 496117.1643787464
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"406.0","main.cluster index_upperinput":"406.0"}
+ 406
+ 23.9407
+ -1
+ This Node is a Singleton
+ N/A
+ 167.0702
+ N/A
+ 0.0
+ 167.0702
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.8637
+ 9
+ 0
+ Feature Node
+ N/A
+ 8876356.412253514
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4697.0","main.cluster index_upperinput":"4697.0"}
+ 4697
+ 27.8637
+ -1
+ This Node is a Singleton
+ N/A
+ 293.2096
+ N/A
+ 0.0
+ 293.2096
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.956
+ 8
+ 0
+ Feature Node
+ N/A
+ 4129147.722108776
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1194.0","main.cluster index_upperinput":"1194.0"}
+ 1194
+ 0.956
+ -1
+ This Node is a Singleton
+ N/A
+ 260.1127
+ N/A
+ 0.0
+ 260.1127
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.007
+ 7
+ 0
+ Feature Node
+ N/A
+ 19150900.017287962
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1184.0","main.cluster index_upperinput":"1184.0"}
+ 1184
+ 25.007
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=80&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 316.2846
+ N/A
+ 0.0
+ 316.2846
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.3454
+ 4
+ 0
+ Feature Node
+ N/A
+ 1778664.7996528696
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13878.0","main.cluster index_upperinput":"13878.0"}
+ 13878
+ 25.3454
+ -1
+ This Node is a Singleton
+ N/A
+ 715.3511
+ N/A
+ 0.0
+ 715.3511
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.4583
+ 5
+ 0
+ Feature Node
+ N/A
+ 1700875.7938528375
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7770.0","main.cluster index_upperinput":"7770.0"}
+ 7770
+ 14.4583
+ -1
+ This Node is a Singleton
+ N/A
+ 545.1981
+ N/A
+ 0.0
+ 545.1981
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2345
+ 1
+ 0
+ Feature Node
+ N/A
+ 1184535.1331669444
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7666.0","main.cluster index_upperinput":"7666.0"}
+ 7666
+ 23.2345
+ -1
+ This Node is a Singleton
+ N/A
+ 353.1367
+ N/A
+ 0.0
+ 353.1367
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.8317
+ 4
+ 0
+ Feature Node
+ N/A
+ 719643957.4873966
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13583.0","main.cluster index_upperinput":"13583.0"}
+ 13583
+ 10.8317
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2142
+ N/A
+ 0.0
+ 462.2142
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5287
+ 9
+ 0
+ Feature Node
+ N/A
+ 21213091.937901758
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1574.0","main.cluster index_upperinput":"1574.0"}
+ 1574
+ 33.5287
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 608.4738
+ N/A
+ 0.0
+ 608.4738
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.0994
+ 9
+ 0
+ Feature Node
+ N/A
+ 8213315.299273698
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1265.0","main.cluster index_upperinput":"1265.0"}
+ 1265
+ 32.0994
+ -1
+ This Node is a Singleton
+ N/A
+ 391.2841
+ N/A
+ 0.0
+ 391.2841
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0751
+ 6
+ 0
+ Feature Node
+ N/A
+ 2088051.8713251078
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3152.0","main.cluster index_upperinput":"3152.0"}
+ 3152
+ 19.0751
+ -1
+ This Node is a Singleton
+ N/A
+ 371.148
+ N/A
+ 0.0
+ 371.148
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.6597
+ 5
+ 0
+ Feature Node
+ N/A
+ 1721192.9512343807
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4555.0","main.cluster index_upperinput":"4555.0"}
+ 4555
+ 14.6597
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 449.1082
+ N/A
+ 0.0
+ 449.1082
+
+
+ 10
+ 0.96065
+ CCMSLIB00003139668
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139668
+ InChI=1S/C24H38O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3
+ 0
+ qTof
+ InChI=1S/C24H38O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3
+ 0.0
+ Spectral Match to Dioctyl phthalate from NIST14
+ CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139668
+ 40
+ 6.39541
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Dioctyl phthalate from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2495.0","main.cluster index_upperinput":"2495.0"}
+ 6.39541
+ 3
+ CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC
+ Data from Maria Maansson
+ 3
+ 391.2845
+ CCMSLIB00003139668
+ 391.2845
+ 0.0
+ Data from Maria Maansson
+ 110619034.10916401
+ qTof
+ Isolated
+ 0.00250244
+ M+H
+ N/A
+ ESI
+ Positive
+ 34.2376
+ 9
+ 0.96065
+ 0.0
+ Isolated
+ 2495
+ 0.00250244
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=105&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.2376
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.5191
+ 9
+ 0
+ Feature Node
+ N/A
+ 243625295.82271612
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9484.0","main.cluster index_upperinput":"9484.0"}
+ 9484
+ 32.5191
+ 41
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 343.3391
+ N/A
+ 0.0
+ 343.3391
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.8547
+ 6
+ 0
+ Feature Node
+ N/A
+ 435843.3497304233
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7783.0","main.cluster index_upperinput":"7783.0"}
+ 7783
+ 26.8547
+ 42
+ This Node is a Singleton
+ N/A
+ 493.2864
+ N/A
+ 0.0
+ 493.2864
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.048
+ 9
+ 0
+ Feature Node
+ N/A
+ 3485926.545196906
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2626.0","main.cluster index_upperinput":"2626.0"}
+ 2626
+ 34.048
+ -1
+ This Node is a Singleton
+ N/A
+ 417.3339
+ N/A
+ 0.0
+ 417.3339
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.7915
+ 9
+ 0
+ Feature Node
+ N/A
+ 4932998.841464961
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2087.0","main.cluster index_upperinput":"2087.0"}
+ 2087
+ 22.7915
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 181.1221
+ N/A
+ 0.0
+ 181.1221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.8012
+ 8
+ 0
+ Feature Node
+ N/A
+ 4640463.809853285
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2796.0","main.cluster index_upperinput":"2796.0"}
+ 2796
+ 29.8012
+ -1
+ This Node is a Singleton
+ N/A
+ 701.3729
+ N/A
+ 0.0
+ 701.3729
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.4316
+ 5
+ 0
+ Feature Node
+ N/A
+ 4982933.836091062
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3695.0","main.cluster index_upperinput":"3695.0"}
+ 3695
+ 1.4316
+ 1
+ This Node is a Singleton
+ N/A
+ 412.1965
+ N/A
+ 0.0
+ 412.1965
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.9
+ 5
+ 0
+ Feature Node
+ N/A
+ 3338481.898830253
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1263.0","main.cluster index_upperinput":"1263.0"}
+ 1263
+ 15.9
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 463.124
+ N/A
+ 0.0
+ 463.124
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.8577
+ 6
+ 0
+ Feature Node
+ N/A
+ 2134231.8744840883
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5391.0","main.cluster index_upperinput":"5391.0"}
+ 5391
+ 12.8577
+ 46
+ This Node is a Singleton
+ N/A
+ 538.2282
+ N/A
+ 0.0
+ 538.2282
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.5269
+ 6
+ 0
+ Feature Node
+ N/A
+ 1342343.4338033178
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15085.0","main.cluster index_upperinput":"15085.0"}
+ 15085
+ 10.5269
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.222
+ N/A
+ 0.0
+ 394.222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.6257
+ 8
+ 0
+ Feature Node
+ N/A
+ 505083.20285915805
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7816.0","main.cluster index_upperinput":"7816.0"}
+ 7816
+ 29.6257
+ -1
+ This Node is a Singleton
+ N/A
+ 499.3395
+ N/A
+ 0.0
+ 499.3395
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.2234
+ 6
+ 0
+ Feature Node
+ N/A
+ 85903713.10737306
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11220.0","main.cluster index_upperinput":"11220.0"}
+ 11220
+ 11.2234
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2136
+ N/A
+ 0.0
+ 462.2136
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.972
+ 1
+ 0
+ Feature Node
+ N/A
+ 1406430.0350954174
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1197.0","main.cluster index_upperinput":"1197.0"}
+ 1197
+ 18.972
+ -1
+ This Node is a Singleton
+ N/A
+ 513.1004
+ N/A
+ 0.0
+ 513.1004
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3199
+ 5
+ 0
+ Feature Node
+ N/A
+ 1382453.3517153442
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1294.0","main.cluster index_upperinput":"1294.0"}
+ 1294
+ 22.3199
+ 50
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 448.2177
+ N/A
+ 0.0
+ 448.2177
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.7278
+ 7
+ 0
+ Feature Node
+ N/A
+ 1068356.9226518832
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"132.0","main.cluster index_upperinput":"132.0"}
+ 132
+ 23.7278
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=53&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 539.2102
+ N/A
+ 0.0
+ 539.2102
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.7122
+ 9
+ 0
+ Feature Node
+ N/A
+ 25557531.418297783
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7627.0","main.cluster index_upperinput":"7627.0"}
+ 7627
+ 28.7122
+ -1
+ This Node is a Singleton
+ N/A
+ 319.2244
+ N/A
+ 0.0
+ 319.2244
+
+
+ 11
+ 0.790199
+ CCMSLIB00005742378
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0
+ qTof
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0.0
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 53
+ 1.55846
+ Feature Node
+ N/A
+ 11
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10586.0","main.cluster index_upperinput":"10586.0"}
+ 1.55846
+ 3
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ Massbank
+ 3
+ 509.1298
+ CCMSLIB00005742378
+ 509.1298
+ 0.0
+ Massbank
+ 15884967.444121486
+ qTof
+ Isolated
+ 0.000793457
+ M+H
+ N/A
+ ESI
+ Positive
+ 16.6701
+ 6
+ 0.790199
+ 0.0
+ Isolated
+ 10586
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.6701
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.1373
+ 9
+ 0
+ Feature Node
+ N/A
+ 23312884.36955374
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1154.0","main.cluster index_upperinput":"1154.0"}
+ 1154
+ 27.1373
+ 54
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=72&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 579.2922
+ N/A
+ 0.0
+ 579.2922
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.8963
+ 7
+ 0
+ Feature Node
+ N/A
+ 6248637.506914418
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1204.0","main.cluster index_upperinput":"1204.0"}
+ 1204
+ 25.8963
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 277.179
+ N/A
+ 0.0
+ 277.179
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.913
+ 9
+ 0
+ Feature Node
+ N/A
+ 67085144.41459696
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1155.0","main.cluster index_upperinput":"1155.0"}
+ 1155
+ 31.913
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 642.2107
+ N/A
+ 0.0
+ 642.2107
+
+
+ 21
+ 0.707359
+ CCMSLIB00003138911
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138911
+ InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+
+ 0
+ qTof
+ InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+
+ 0.0
+ Spectral Match to 9-Oxo-10E,12Z-octadecadienoic acid from NIST14
+ CCCCC/C=C\\C=C\\C(=O)CCCCCCCC(=O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138911
+ 5
+ 2.37751
+ Feature Node
+ N/A
+ 21
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 9-Oxo-10E,12Z-octadecadienoic acid from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1540.0","main.cluster index_upperinput":"1540.0"}
+ 2.37751
+ 3
+ CCCCC/C=C\\C=C\\C(=O)CCCCCCCC(=O)O
+ Data from Wolfender/Litaudon
+ 3
+ 295.2263
+ CCMSLIB00003138911
+ 295.2263
+ 0.0
+ Data from Wolfender/Litaudon
+ 3783448.324987889
+ qTof
+ Isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ ESI
+ Positive
+ 22.9282
+ 8
+ 0.707359
+ 0.0
+ Isolated
+ 1540
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 22.9282
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.2464
+ 7
+ 0
+ Feature Node
+ N/A
+ 5219867.298225547
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"122.0","main.cluster index_upperinput":"122.0"}
+ 122
+ 31.2464
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 813.512
+ N/A
+ 0.0
+ 813.512
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.0792
+ 9
+ 0
+ Feature Node
+ N/A
+ 5170175.729874854
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1261.0","main.cluster index_upperinput":"1261.0"}
+ 1261
+ 33.0792
+ -1
+ This Node is a Singleton
+ N/A
+ 503.3355
+ N/A
+ 0.0
+ 503.3355
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.9674
+ 6
+ 0
+ Feature Node
+ N/A
+ 3080050.372258077
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2474.0","main.cluster index_upperinput":"2474.0"}
+ 2474
+ 28.9674
+ 59
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=20&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 469.3637
+ N/A
+ 0.0
+ 469.3637
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.7742
+ 2
+ 0
+ Feature Node
+ N/A
+ 999687.1434278773
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4993.0","main.cluster index_upperinput":"4993.0"}
+ 4993
+ 19.7742
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 586.2654
+ N/A
+ 0.0
+ 586.2654
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.7716
+ 4
+ 0
+ Feature Node
+ N/A
+ 2129316.9222890674
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"22561.0","main.cluster index_upperinput":"22561.0"}
+ 22561
+ 18.7716
+ -1
+ This Node is a Singleton
+ N/A
+ 385.1642
+ N/A
+ 0.0
+ 385.1642
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4102
+ 6
+ 0
+ Feature Node
+ N/A
+ 867810.4617674882
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"418.0","main.cluster index_upperinput":"418.0"}
+ 418
+ 26.4102
+ -1
+ This Node is a Singleton
+ N/A
+ 337.075
+ N/A
+ 0.0
+ 337.075
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.5847
+ 3
+ 0
+ Feature Node
+ N/A
+ 1179488.7696451363
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4602.0","main.cluster index_upperinput":"4602.0"}
+ 4602
+ 14.5847
+ -1
+ This Node is a Singleton
+ N/A
+ 455.0945
+ N/A
+ 0.0
+ 455.0945
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 5.5482
+ 2
+ 0
+ Feature Node
+ N/A
+ 466496.6032460307
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8076.0","main.cluster index_upperinput":"8076.0"}
+ 8076
+ 5.5482
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 470.1943
+ N/A
+ 0.0
+ 470.1943
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4443
+ 6
+ 0
+ Feature Node
+ N/A
+ 1366612.4929284519
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2512.0","main.cluster index_upperinput":"2512.0"}
+ 2512
+ 26.4443
+ 65
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 119.0862
+ N/A
+ 0.0
+ 119.0862
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.8014
+ 6
+ 0
+ Feature Node
+ N/A
+ 6522364.642472192
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2490.0","main.cluster index_upperinput":"2490.0"}
+ 2490
+ 34.8014
+ -1
+ This Node is a Singleton
+ N/A
+ 613.4812
+ N/A
+ 0.0
+ 613.4812
+
+
+ 8
+ 0.794866
+ CCMSLIB00006422785
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006422785
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3
+ 0
+ Orbitrap
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3
+ 0.0
+ Eupatilin
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006422785
+ 67
+ 21.1356
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ BMDMS-NP
+ Eupatilin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7742.0","main.cluster index_upperinput":"7742.0"}
+ 21.1356
+ 1
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
+ BMDMS-NP
+ 1
+ 345.0973
+ CCMSLIB00006422785
+ 345.0973
+ 0.0
+ BMDMS-NP
+ 13801295.484932978
+ Orbitrap
+ Commercial standard
+ 0.0072937
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 22.6731
+ 8
+ 0.794866
+ 0.0
+ Commercial standard
+ 7742
+ 0.0072937
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 22.6731
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.0405
+ 5
+ 0
+ Feature Node
+ N/A
+ 3921363.1125284913
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"38.0","main.cluster index_upperinput":"38.0"}
+ 38
+ 31.0405
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 395.3655
+ N/A
+ 0.0
+ 395.3655
+
+
+ 33
+ 0.802131
+ CCMSLIB00003136883
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136883
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to Monobehenin from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136883
+ 5
+ 41.2414
+ Feature Node
+ N/A
+ 33
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Monobehenin from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2493.0","main.cluster index_upperinput":"2493.0"}
+ 41.2414
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 397.3824
+ CCMSLIB00003136883
+ 397.3824
+ 0.0
+ Data from Wolfender/Litaudon
+ 15094628.060232813
+ HCD
+ Isolated
+ 0.0163879
+ M+H-H2O
+ N/A
+ ESI
+ Positive
+ 33.3498
+ 8
+ 0.802131
+ 0.0
+ Isolated
+ 2493
+ 0.0163879
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 33.3498
+ 0.0
+ M+H-H2O
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.6721
+ 3
+ 0
+ Feature Node
+ N/A
+ 1097331.9519446734
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10278.0","main.cluster index_upperinput":"10278.0"}
+ 10278
+ 19.6721
+ -1
+ This Node is a Singleton
+ N/A
+ 475.1938
+ N/A
+ 0.0
+ 475.1938
+
+
+ 39
+ 0.881582
+ CCMSLIB00004696002
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004696002
+ InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2
+ 0
+ ESI-QFT
+ InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2
+ 0.0
+ apigenin 6,8-digalactoside
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004696002
+ 69
+ 0.205103
+ Feature Node
+ N/A
+ 39
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF004939
+ apigenin 6,8-digalactoside
+ positive
+ MoNA:VF-NPL-QEHF004939
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7931.0","main.cluster index_upperinput":"7931.0"}
+ 0.205103
+ 3
+ N/A
+ MoNA
+ 3
+ 595.1659
+ CCMSLIB00004696002
+ 595.1659
+ 0.0
+ MoNA
+ 2866018.267371926
+ ESI-QFT
+ isolated
+ 0.00012207
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 11.0864
+ 5
+ 0.881582
+ 0.0
+ isolated
+ 7931
+ 0.00012207
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=26&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 11.0864
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.03
+ 8
+ 0
+ Feature Node
+ N/A
+ 1700052.2395256157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"190.0","main.cluster index_upperinput":"190.0"}
+ 190
+ 22.03
+ -1
+ This Node is a Singleton
+ N/A
+ 255.1582
+ N/A
+ 0.0
+ 255.1582
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8502
+ 8
+ 0
+ Feature Node
+ N/A
+ 4689152.785272506
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1239.0","main.cluster index_upperinput":"1239.0"}
+ 1239
+ 21.8502
+ -1
+ This Node is a Singleton
+ N/A
+ 250.1781
+ N/A
+ 0.0
+ 250.1781
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.5754
+ 9
+ 0
+ Feature Node
+ N/A
+ 10226561.266648717
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1495.0","main.cluster index_upperinput":"1495.0"}
+ 1495
+ 27.5754
+ -1
+ This Node is a Singleton
+ N/A
+ 315.1934
+ N/A
+ 0.0
+ 315.1934
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.8053
+ 5
+ 0
+ Feature Node
+ N/A
+ 1071400.8608769071
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20637.0","main.cluster index_upperinput":"20637.0"}
+ 20637
+ 10.8053
+ 1
+ This Node is a Singleton
+ N/A
+ 412.2324
+ N/A
+ 0.0
+ 412.2324
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.363
+ 4
+ 0
+ Feature Node
+ N/A
+ 2020330.0205620434
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1520.0","main.cluster index_upperinput":"1520.0"}
+ 1520
+ 33.363
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=175&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1175.8667
+ N/A
+ 0.0
+ 1175.8667
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.729
+ 5
+ 0
+ Feature Node
+ N/A
+ 762544.6917031942
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7755.0","main.cluster index_upperinput":"7755.0"}
+ 7755
+ 19.729
+ -1
+ This Node is a Singleton
+ N/A
+ 271.1307
+ N/A
+ 0.0
+ 271.1307
+
+
+ 6
+ 0.7526510000000001
+ CCMSLIB00004693356
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693356
+ InChI=1S/C26H34O11/c1-33-17-6-5-14(10-18(17)35-26-23(32)22(31)21(30)20(12-29)36-26)24-16(11-28)15-8-13(4-3-7-27)9-19(34-2)25(15)37-24/h5-6,8-10,16,20-24,26-32H,3-4,7,11-12H2,1-2H3
+ 0
+ ESI-QFT
+ InChI=1S/C26H34O11/c1-33-17-6-5-14(10-18(17)35-26-23(32)22(31)21(30)20(12-29)36-26)24-16(11-28)15-8-13(4-3-7-27)9-19(34-2)25(15)37-24/h5-6,8-10,16,20-24,26-32H,3-4,7,11-12H2,1-2H3
+ 0.0
+ 2-(hydroxymethyl)-6-[5-[3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenoxy]oxane-3,4,5-triol
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693356
+ 75
+ 0.5648850000000001
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002293
+ 2-(hydroxymethyl)-6-[5-[3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenoxy]oxane-3,4,5-triol
+ positive
+ MoNA:VF-NPL-QEHF002293
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4670.0","main.cluster index_upperinput":"4670.0"}
+ 0.5648850000000001
+ 3
+ N/A
+ MoNA
+ 3
+ 540.2437
+ CCMSLIB00004693356
+ 540.2437
+ 0.0
+ MoNA
+ 2184297.3024828243
+ ESI-QFT
+ isolated
+ 0.000305176
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 12.9931
+ 4
+ 0.7526510000000001
+ 0.0
+ isolated
+ 4670
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=124&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 12.9931
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.4223
+ 6
+ 0
+ Feature Node
+ N/A
+ 21912680.22065202
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"12201.0","main.cluster index_upperinput":"12201.0"}
+ 12201
+ 10.4223
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2132
+ N/A
+ 0.0
+ 462.2132
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.8705
+ 9
+ 0
+ Feature Node
+ N/A
+ 12928462.035305316
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1274.0","main.cluster index_upperinput":"1274.0"}
+ 1274
+ 22.8705
+ -1
+ This Node is a Singleton
+ N/A
+ 353.2294
+ N/A
+ 0.0
+ 353.2294
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3684
+ 9
+ 0
+ Feature Node
+ N/A
+ 7808253.0728146145
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1383.0","main.cluster index_upperinput":"1383.0"}
+ 1383
+ 32.3684
+ -1
+ This Node is a Singleton
+ N/A
+ 379.2828
+ N/A
+ 0.0
+ 379.2828
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6184
+ 8
+ 0
+ Feature Node
+ N/A
+ 2736483.3134896574
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2505.0","main.cluster index_upperinput":"2505.0"}
+ 2505
+ 23.6184
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 315.0864
+ N/A
+ 0.0
+ 315.0864
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8071
+ 4
+ 0
+ Feature Node
+ N/A
+ 3293385.4205220356
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1288.0","main.cluster index_upperinput":"1288.0"}
+ 1288
+ 16.8071
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 469.2331
+ N/A
+ 0.0
+ 469.2331
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1233
+ 5
+ 0
+ Feature Node
+ N/A
+ 863455.1553997096
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1268.0","main.cluster index_upperinput":"1268.0"}
+ 1268
+ 23.1233
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=53&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 539.2098
+ N/A
+ 0.0
+ 539.2098
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.2845
+ 6
+ 0
+ Feature Node
+ N/A
+ 3418720.6409419538
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3665.0","main.cluster index_upperinput":"3665.0"}
+ 3665
+ 28.2845
+ -1
+ This Node is a Singleton
+ N/A
+ 405.2044
+ N/A
+ 0.0
+ 405.2044
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.2792
+ 6
+ 0
+ Feature Node
+ N/A
+ 2299756.9516272238
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"150.0","main.cluster index_upperinput":"150.0"}
+ 150
+ 35.2792
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=28&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3728
+ N/A
+ 0.0
+ 429.3728
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.3397
+ 7
+ 0
+ Feature Node
+ N/A
+ 9916311.435400225
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1409.0","main.cluster index_upperinput":"1409.0"}
+ 1409
+ 30.3397
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 677.3715
+ N/A
+ 0.0
+ 677.3715
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.7795
+ 6
+ 0
+ Feature Node
+ N/A
+ 2546614.7513837004
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10343.0","main.cluster index_upperinput":"10343.0"}
+ 10343
+ 4.7795
+ -1
+ This Node is a Singleton
+ N/A
+ 469.2015
+ N/A
+ 0.0
+ 469.2015
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.7859
+ 6
+ 0
+ Feature Node
+ N/A
+ 791300.0996119287
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2353.0","main.cluster index_upperinput":"2353.0"}
+ 2353
+ 8.7859
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2365
+ N/A
+ 0.0
+ 446.2365
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.2505
+ 4
+ 0
+ Feature Node
+ N/A
+ 1574037.1492890697
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3342.0","main.cluster index_upperinput":"3342.0"}
+ 3342
+ 30.2505
+ -1
+ This Node is a Singleton
+ N/A
+ 738.5482
+ N/A
+ 0.0
+ 738.5482
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0527
+ 4
+ 0
+ Feature Node
+ N/A
+ 1011593.8438341508
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3569.0","main.cluster index_upperinput":"3569.0"}
+ 3569
+ 19.0527
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 347.0757
+ N/A
+ 0.0
+ 347.0757
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.5816
+ 7
+ 0
+ Feature Node
+ N/A
+ 5871422.193224185
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1947.0","main.cluster index_upperinput":"1947.0"}
+ 1947
+ 31.5816
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 427.3575
+ N/A
+ 0.0
+ 427.3575
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.273
+ 7
+ 0
+ Feature Node
+ N/A
+ 3771352.371402735
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1509.0","main.cluster index_upperinput":"1509.0"}
+ 1509
+ 16.273
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 313.0702
+ N/A
+ 0.0
+ 313.0702
+
+
+ 28
+ 0.945888
+ CCMSLIB00005738462
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738462
+ 1S/C24H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)30-21-23(26)22-32-33(28,29)31-20-19-25(2,3)4/h23,26H,5-22H2,1-4H3
+ 0
+ qTof
+ 1S/C24H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)30-21-23(26)22-32-33(28,29)31-20-19-25(2,3)4/h23,26H,5-22H2,1-4H3
+ 0.0
+ Massbank:RP012103 PC(16:0/0:0)|Palmitoyllysolectithin|(3-hexadecanoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate
+ CCCCCCCCCCCCCCCC(=O)OCC(O)COP([O-])(=O)OCC[N+](C)(C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738462
+ 89
+ 1.5986200000000002
+ Feature Node
+ N/A
+ 28
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP012103 PC(16:0/0:0)|Palmitoyllysolectithin|(3-hexadecanoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1253.0","main.cluster index_upperinput":"1253.0"}
+ 1.5986200000000002
+ 3
+ CCCCCCCCCCCCCCCC(=O)OCC(O)COP([O-])(=O)OCC[N+](C)(C)C
+ Massbank
+ 3
+ 496.3408
+ CCMSLIB00005738462
+ 496.3408
+ 0.0
+ Massbank
+ 33160530.294679314
+ qTof
+ Isolated
+ 0.000793457
+ M+H
+ N/A
+ ESI
+ Positive
+ 30.7352
+ 9
+ 0.945888
+ 0.0
+ Isolated
+ 1253
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 30.7352
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.1012
+ 3
+ 0
+ Feature Node
+ N/A
+ 845711.1950708412
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4685.0","main.cluster index_upperinput":"4685.0"}
+ 4685
+ 20.1012
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 470.296
+ N/A
+ 0.0
+ 470.296
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.6563
+ 5
+ 0
+ Feature Node
+ N/A
+ 2091209.4667480686
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11703.0","main.cluster index_upperinput":"11703.0"}
+ 11703
+ 33.6563
+ -1
+ This Node is a Singleton
+ N/A
+ 797.5201
+ N/A
+ 0.0
+ 797.5201
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.3277
+ 2
+ 0
+ Feature Node
+ N/A
+ 586658.9455112463
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7822.0","main.cluster index_upperinput":"7822.0"}
+ 7822
+ 16.3277
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 603.2104
+ N/A
+ 0.0
+ 603.2104
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4251
+ 1
+ 0
+ Feature Node
+ N/A
+ 8683405.30966857
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13609.0","main.cluster index_upperinput":"13609.0"}
+ 13609
+ 28.4251
+ 93
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=63&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 958.5222
+ N/A
+ 0.0
+ 958.5222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9136
+ 4
+ 0
+ Feature Node
+ N/A
+ 115865.6444994486
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3653.0","main.cluster index_upperinput":"3653.0"}
+ 3653
+ 19.9136
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=56&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 625.2679
+ N/A
+ 0.0
+ 625.2679
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1972
+ 6
+ 0
+ Feature Node
+ N/A
+ 3166950.839701846
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4519.0","main.cluster index_upperinput":"4519.0"}
+ 4519
+ 16.1972
+ 2
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 433.1132
+ N/A
+ 0.0
+ 433.1132
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3567
+ 5
+ 0
+ Feature Node
+ N/A
+ 1686550.5015396692
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14391.0","main.cluster index_upperinput":"14391.0"}
+ 14391
+ 32.3567
+ -1
+ This Node is a Singleton
+ N/A
+ 347.2559
+ N/A
+ 0.0
+ 347.2559
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.3837
+ 2
+ 0
+ Feature Node
+ N/A
+ 3799942.867622849
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13648.0","main.cluster index_upperinput":"13648.0"}
+ 13648
+ 16.3837
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 464.1936
+ N/A
+ 0.0
+ 464.1936
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.7004
+ 2
+ 0
+ Feature Node
+ N/A
+ 573776.2029047015
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7799.0","main.cluster index_upperinput":"7799.0"}
+ 7799
+ 20.7004
+ -1
+ This Node is a Singleton
+ N/A
+ 429.1523
+ N/A
+ 0.0
+ 429.1523
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.3648
+ 8
+ 0
+ Feature Node
+ N/A
+ 1832658.6431269748
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9511.0","main.cluster index_upperinput":"9511.0"}
+ 9511
+ 29.3648
+ 59
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=20&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 469.3629
+ N/A
+ 0.0
+ 469.3629
+
+
+ 27
+ 0.829209
+ CCMSLIB00003139642
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139642
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 9Z,11E,13E-Octadecatrienoic acid methyl ester from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139642
+ 5
+ 1.0406799999999998
+ Feature Node
+ N/A
+ 27
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 9Z,11E,13E-Octadecatrienoic acid methyl ester from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1234.0","main.cluster index_upperinput":"1234.0"}
+ 1.0406799999999998
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 293.2467
+ CCMSLIB00003139642
+ 293.2467
+ 0.0
+ Data from Wolfender/Litaudon
+ 25796339.418756492
+ HCD
+ Isolated
+ 0.000305176
+ M+H
+ N/A
+ ESI
+ Positive
+ 33.2165
+ 9
+ 0.829209
+ 0.0
+ Isolated
+ 1234
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 33.2165
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.665
+ 1
+ 0
+ Feature Node
+ N/A
+ 672985.6030759403
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10372.0","main.cluster index_upperinput":"10372.0"}
+ 10372
+ 25.665
+ 98
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=112&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 731.3471
+ N/A
+ 0.0
+ 731.3471
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9288
+ 1
+ 0
+ Feature Node
+ N/A
+ 6781288.0921226675
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7633.0","main.cluster index_upperinput":"7633.0"}
+ 7633
+ 14.9288
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 279.0789
+ N/A
+ 0.0
+ 279.0789
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.731
+ 9
+ 0
+ Feature Node
+ N/A
+ 6909795.136533012
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2491.0","main.cluster index_upperinput":"2491.0"}
+ 2491
+ 25.731
+ 100
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 235.1688
+ N/A
+ 0.0
+ 235.1688
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.998
+ 8
+ 0
+ Feature Node
+ N/A
+ 1362950.8751596506
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4995.0","main.cluster index_upperinput":"4995.0"}
+ 4995
+ 23.998
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8904
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.6441
+ 1
+ 0
+ Feature Node
+ N/A
+ 460298.4115460711
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14059.0","main.cluster index_upperinput":"14059.0"}
+ 14059
+ 24.6441
+ -1
+ This Node is a Singleton
+ N/A
+ 253.1622
+ N/A
+ 0.0
+ 253.1622
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3332
+ 5
+ 0
+ Feature Node
+ N/A
+ 865170.8598434604
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1378.0","main.cluster index_upperinput":"1378.0"}
+ 1378
+ 22.3332
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=53&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 453.1732
+ N/A
+ 0.0
+ 453.1732
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.9208
+ 6
+ 0
+ Feature Node
+ N/A
+ 1273196.915271754
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3636.0","main.cluster index_upperinput":"3636.0"}
+ 3636
+ 26.9208
+ -1
+ This Node is a Singleton
+ N/A
+ 529.2053
+ N/A
+ 0.0
+ 529.2053
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.3002
+ 6
+ 0
+ Feature Node
+ N/A
+ 8681293.6148144
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1181.0","main.cluster index_upperinput":"1181.0"}
+ 1181
+ 31.3002
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=99&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 617.1201
+ N/A
+ 0.0
+ 617.1201
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.4689
+ 3
+ 0
+ Feature Node
+ N/A
+ 1625856.871987003
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4595.0","main.cluster index_upperinput":"4595.0"}
+ 4595
+ 13.4689
+ -1
+ This Node is a Singleton
+ N/A
+ 476.1915
+ N/A
+ 0.0
+ 476.1915
+
+
+ 19
+ 0.726846
+ CCMSLIB00000206266
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000206266
+ 1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1
+ 0
+ LC-ESI-QTOF
+ 1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1
+ 0.0
+ Massbank: Nandrolone
+ [H]OC([H])(C([H])([H])4)C(C([H])([H])[H])(C([H])([H])3)C([H])(C([H])([H])4)C([H])(C([H])([H])1)C([H])(C([H])([H])3)C([H])(C([H])([H])2)C(=C([H])C(=O)C([H])([H])2)C([H])([H])1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000206266
+ 5
+ 4.32479
+ Feature Node
+ N/A
+ 19
+ 0.0
+ 0.0
+ Massbank
+ Massbank: Nandrolone
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1679.0","main.cluster index_upperinput":"1679.0"}
+ 4.32479
+ 3
+ [H]OC([H])(C([H])([H])4)C(C([H])([H])[H])(C([H])([H])3)C([H])(C([H])([H])4)C([H])(C([H])([H])1)C([H])(C([H])([H])3)C([H])(C([H])([H])2)C(=C([H])C(=O)C([H])([H])2)C([H])([H])1
+ Putative Massbank Match
+ 3
+ 275.1998
+ CCMSLIB00000206266
+ 275.1998
+ 0.0
+ Putative Massbank Match
+ 3151076.758354351
+ LC-ESI-QTOF
+ Isolated
+ 0.00119019
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 21.8768
+ 6
+ 0.726846
+ 0.0
+ Isolated
+ 1679
+ 0.00119019
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.8768
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1412
+ 8
+ 0
+ Feature Node
+ N/A
+ 33244922.325722415
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1405.0","main.cluster index_upperinput":"1405.0"}
+ 1405
+ 32.1412
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 309.2786
+ N/A
+ 0.0
+ 309.2786
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.4759
+ 5
+ 0
+ Feature Node
+ N/A
+ 864816.1545464223
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"19733.0","main.cluster index_upperinput":"19733.0"}
+ 19733
+ 10.4759
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.232
+ N/A
+ 0.0
+ 412.232
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.1187
+ 4
+ 0
+ Feature Node
+ N/A
+ 1528041.4223983928
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7130.0","main.cluster index_upperinput":"7130.0"}
+ 7130
+ 35.1187
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=99&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 707.1713
+ N/A
+ 0.0
+ 707.1713
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5996
+ 5
+ 0
+ Feature Node
+ N/A
+ 1614792.4175686832
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10296.0","main.cluster index_upperinput":"10296.0"}
+ 10296
+ 16.5996
+ -1
+ This Node is a Singleton
+ N/A
+ 463.1939
+ N/A
+ 0.0
+ 463.1939
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.6483
+ 1
+ 0
+ Feature Node
+ N/A
+ 2677542.054172869
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10250.0","main.cluster index_upperinput":"10250.0"}
+ 10250
+ 12.6483
+ -1
+ This Node is a Singleton
+ N/A
+ 879.3981
+ N/A
+ 0.0
+ 879.3981
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.4187
+ 7
+ 0
+ Feature Node
+ N/A
+ 12942112.25669604
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3580.0","main.cluster index_upperinput":"3580.0"}
+ 3580
+ 32.4187
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 599.4301
+ N/A
+ 0.0
+ 599.4301
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.6168
+ 5
+ 0
+ Feature Node
+ N/A
+ 1043427.7988200617
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3691.0","main.cluster index_upperinput":"3691.0"}
+ 3691
+ 26.6168
+ 42
+ This Node is a Singleton
+ N/A
+ 493.2811
+ N/A
+ 0.0
+ 493.2811
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.872
+ 7
+ 0
+ Feature Node
+ N/A
+ 3313045.3349876995
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4748.0","main.cluster index_upperinput":"4748.0"}
+ 4748
+ 15.872
+ 2
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 447.0934
+ N/A
+ 0.0
+ 447.0934
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.7366
+ 7
+ 0
+ Feature Node
+ N/A
+ 1879142.2183384944
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"102.0","main.cluster index_upperinput":"102.0"}
+ 102
+ 23.7366
+ 50
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 534.2546
+ N/A
+ 0.0
+ 534.2546
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.1359
+ 7
+ 0
+ Feature Node
+ N/A
+ 9010850.106906014
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1293.0","main.cluster index_upperinput":"1293.0"}
+ 1293
+ 31.1359
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=130&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 389.2667
+ N/A
+ 0.0
+ 389.2667
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.3922
+ 4
+ 0
+ Feature Node
+ N/A
+ 2611622.572847216
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8182.0","main.cluster index_upperinput":"8182.0"}
+ 8182
+ 12.3922
+ -1
+ This Node is a Singleton
+ N/A
+ 547.215
+ N/A
+ 0.0
+ 547.215
+
+
+ 17
+ 0.8008270000000001
+ CCMSLIB00003139642
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139642
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 9Z,11E,13E-Octadecatrienoic acid methyl ester from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139642
+ 5
+ 0.0
+ Feature Node
+ N/A
+ 17
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 9Z,11E,13E-Octadecatrienoic acid methyl ester from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1221.0","main.cluster index_upperinput":"1221.0"}
+ 0.0
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 293.247
+ CCMSLIB00003139642
+ 293.247
+ 0.0
+ Data from Wolfender/Litaudon
+ 21798568.04603951
+ HCD
+ Isolated
+ 0.0
+ M+H
+ N/A
+ ESI
+ Positive
+ 29.9129
+ 9
+ 0.8008270000000001
+ 0.0
+ Isolated
+ 1221
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 29.9129
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.9754
+ 7
+ 0
+ Feature Node
+ N/A
+ 1922768.5950194749
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1187.0","main.cluster index_upperinput":"1187.0"}
+ 1187
+ 13.9754
+ 111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 359.1491
+ N/A
+ 0.0
+ 359.1491
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1591
+ 2
+ 0
+ Feature Node
+ N/A
+ 3706337.8598993635
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7635.0","main.cluster index_upperinput":"7635.0"}
+ 7635
+ 32.1591
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=96&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 641.3673
+ N/A
+ 0.0
+ 641.3673
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.2676
+ 7
+ 0
+ Feature Node
+ N/A
+ 6232294.578127155
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7708.0","main.cluster index_upperinput":"7708.0"}
+ 7708
+ 22.2676
+ -1
+ This Node is a Singleton
+ N/A
+ 337.069
+ N/A
+ 0.0
+ 337.069
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.0491
+ 1
+ 0
+ Feature Node
+ N/A
+ 2948162.718896355
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13721.0","main.cluster index_upperinput":"13721.0"}
+ 13721
+ 21.0491
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 790.3434
+ N/A
+ 0.0
+ 790.3434
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.4225
+ 8
+ 0
+ Feature Node
+ N/A
+ 2105111.6526007983
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8538.0","main.cluster index_upperinput":"8538.0"}
+ 8538
+ 12.4225
+ -1
+ This Node is a Singleton
+ N/A
+ 542.2589
+ N/A
+ 0.0
+ 542.2589
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.3785
+ 5
+ 0
+ Feature Node
+ N/A
+ 5509889.304401414
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4662.0","main.cluster index_upperinput":"4662.0"}
+ 4662
+ 11.3785
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.238
+ N/A
+ 0.0
+ 446.238
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8615
+ 2
+ 0
+ Feature Node
+ N/A
+ 145001.36983562662
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8167.0","main.cluster index_upperinput":"8167.0"}
+ 8167
+ 23.8615
+ -1
+ This Node is a Singleton
+ N/A
+ 593.2024
+ N/A
+ 0.0
+ 593.2024
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9542
+ 8
+ 0
+ Feature Node
+ N/A
+ 4982644.703698013
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8014.0","main.cluster index_upperinput":"8014.0"}
+ 8014
+ 33.9542
+ 115
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=47&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 639.2825
+ N/A
+ 0.0
+ 639.2825
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.9009
+ 7
+ 0
+ Feature Node
+ N/A
+ 389005.4033094855
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7728.0","main.cluster index_upperinput":"7728.0"}
+ 7728
+ 29.9009
+ -1
+ This Node is a Singleton
+ N/A
+ 483.3802
+ N/A
+ 0.0
+ 483.3802
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.9208
+ 5
+ 0
+ Feature Node
+ N/A
+ 7217362.1488494305
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4618.0","main.cluster index_upperinput":"4618.0"}
+ 4618
+ 17.9208
+ 117
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 396.2028
+ N/A
+ 0.0
+ 396.2028
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8922
+ 7
+ 0
+ Feature Node
+ N/A
+ 225310505.04809976
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"12784.0","main.cluster index_upperinput":"12784.0"}
+ 12784
+ 32.8922
+ 41
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 343.3389
+ N/A
+ 0.0
+ 343.3389
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.0677
+ 3
+ 0
+ Feature Node
+ N/A
+ 1148557.0800015137
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8411.0","main.cluster index_upperinput":"8411.0"}
+ 8411
+ 4.0677
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=61&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2069
+ N/A
+ 0.0
+ 478.2069
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.7018
+ 2
+ 0
+ Feature Node
+ N/A
+ 2542376.472325719
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4854.0","main.cluster index_upperinput":"4854.0"}
+ 4854
+ 9.7018
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2385
+ N/A
+ 0.0
+ 446.2385
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.5685
+ 4
+ 0
+ Feature Node
+ N/A
+ 1064813.0610407442
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5023.0","main.cluster index_upperinput":"5023.0"}
+ 5023
+ 26.5685
+ -1
+ This Node is a Singleton
+ N/A
+ 574.3248
+ N/A
+ 0.0
+ 574.3248
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.6946
+ 7
+ 0
+ Feature Node
+ N/A
+ 825549.9773699206
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8135.0","main.cluster index_upperinput":"8135.0"}
+ 8135
+ 15.6946
+ -1
+ This Node is a Singleton
+ N/A
+ 349.1256
+ N/A
+ 0.0
+ 349.1256
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.4442
+ 8
+ 0
+ Feature Node
+ N/A
+ 1316907.074332047
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1282.0","main.cluster index_upperinput":"1282.0"}
+ 1282
+ 15.4442
+ -1
+ This Node is a Singleton
+ N/A
+ 287.1257
+ N/A
+ 0.0
+ 287.1257
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.6807
+ 4
+ 0
+ Feature Node
+ N/A
+ 2350327.6692292867
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2497.0","main.cluster index_upperinput":"2497.0"}
+ 2497
+ 18.6807
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 528.2598
+ N/A
+ 0.0
+ 528.2598
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.0716
+ 4
+ 0
+ Feature Node
+ N/A
+ 19954651.248197477
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13628.0","main.cluster index_upperinput":"13628.0"}
+ 13628
+ 11.0716
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 436.1966
+ N/A
+ 0.0
+ 436.1966
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.3112
+ 4
+ 0
+ Feature Node
+ N/A
+ 6189809.810185551
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1176.0","main.cluster index_upperinput":"1176.0"}
+ 1176
+ 16.3112
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.2488
+ N/A
+ 0.0
+ 536.2488
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.0625
+ 8
+ 0
+ Feature Node
+ N/A
+ 872251.6705952093
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"178.0","main.cluster index_upperinput":"178.0"}
+ 178
+ 23.0625
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=53&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 453.1736
+ N/A
+ 0.0
+ 453.1736
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.6546
+ 5
+ 0
+ Feature Node
+ N/A
+ 21428411.443243675
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"354.0","main.cluster index_upperinput":"354.0"}
+ 354
+ 24.6546
+ -1
+ This Node is a Singleton
+ N/A
+ 351.0843
+ N/A
+ 0.0
+ 351.0843
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.6749
+ 6
+ 0
+ Feature Node
+ N/A
+ 15023234.265443355
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1454.0","main.cluster index_upperinput":"1454.0"}
+ 1454
+ 19.6749
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 606.2576
+ N/A
+ 0.0
+ 606.2576
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.1924
+ 5
+ 0
+ Feature Node
+ N/A
+ 10641491.570010342
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9700.0","main.cluster index_upperinput":"9700.0"}
+ 9700
+ 20.1924
+ -1
+ This Node is a Singleton
+ N/A
+ 385.1635
+ N/A
+ 0.0
+ 385.1635
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.9186
+ 5
+ 0
+ Feature Node
+ N/A
+ 6745616.419210746
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2479.0","main.cluster index_upperinput":"2479.0"}
+ 2479
+ 18.9186
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1223
+ N/A
+ 0.0
+ 229.1223
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9967
+ 4
+ 0
+ Feature Node
+ N/A
+ 6941327.361369176
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7632.0","main.cluster index_upperinput":"7632.0"}
+ 7632
+ 14.9967
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 297.0885
+ N/A
+ 0.0
+ 297.0885
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.1477
+ 6
+ 0
+ Feature Node
+ N/A
+ 4428535.347234422
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1203.0","main.cluster index_upperinput":"1203.0"}
+ 1203
+ 33.1477
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 850.2512
+ N/A
+ 0.0
+ 850.2512
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3942
+ 8
+ 0
+ Feature Node
+ N/A
+ 3647912.975697018
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5233.0","main.cluster index_upperinput":"5233.0"}
+ 5233
+ 22.3942
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8899
+ N/A
+ 0.0
+ 84.945
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3735
+ 8
+ 0
+ Feature Node
+ N/A
+ 1210131.499192173
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"193.0","main.cluster index_upperinput":"193.0"}
+ 193
+ 22.3735
+ -1
+ This Node is a Singleton
+ N/A
+ 242.2842
+ N/A
+ 0.0
+ 242.2842
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.0276
+ 9
+ 0
+ Feature Node
+ N/A
+ 2545638.721954119
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"97.0","main.cluster index_upperinput":"97.0"}
+ 97
+ 25.0276
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 227.1643
+ N/A
+ 0.0
+ 227.1643
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.028
+ 2
+ 0
+ Feature Node
+ N/A
+ 107521.89510910326
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4965.0","main.cluster index_upperinput":"4965.0"}
+ 4965
+ 26.028
+ -1
+ This Node is a Singleton
+ N/A
+ 789.4404
+ N/A
+ 0.0
+ 789.4404
+
+
+ 47
+ 0.9626459999999999
+ CCMSLIB00004694670
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694670
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0.0
+ arctiin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694670
+ 111
+ 1.43679
+ Feature Node
+ N/A
+ 47
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF003607
+ arctiin
+ positive
+ MoNA:VF-NPL-QEHF003607
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1521.0","main.cluster index_upperinput":"1521.0"}
+ 1.43679
+ 3
+ N/A
+ MoNA
+ 3
+ 552.2432
+ CCMSLIB00004694670
+ 552.2432
+ 0.0
+ MoNA
+ 10785461.673689043
+ ESI-QFT
+ isolated
+ 0.000793457
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 15.6267
+ 6
+ 0.9626459999999999
+ 0.0
+ isolated
+ 1521
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.6267
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.0898
+ 8
+ 0
+ Feature Node
+ N/A
+ 5500773.39476157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"24.0","main.cluster index_upperinput":"24.0"}
+ 24
+ 26.0898
+ 100
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 235.169
+ N/A
+ 0.0
+ 235.169
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.6871
+ 7
+ 0
+ Feature Node
+ N/A
+ 1829514.8975435377
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4880.0","main.cluster index_upperinput":"4880.0"}
+ 4880
+ 31.6871
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 347.3154
+ N/A
+ 0.0
+ 347.3154
+
+
+ 7
+ 0.901387
+ CCMSLIB00005738172
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738172
+ 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
+ 0
+ qTof
+ 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
+ 0.0
+ Massbank:RP019903 Dibutylphthalate|dibutyl phthalate|dibutyl benzene-1,2-dicarboxylate
+ CCCCOC(=O)c1ccccc1C(=O)OCCCC
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738172
+ 40
+ 1.0932
+ Feature Node
+ N/A
+ 7
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP019903 Dibutylphthalate|dibutyl phthalate|dibutyl benzene-1,2-dicarboxylate
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10243.0","main.cluster index_upperinput":"10243.0"}
+ 1.0932
+ 3
+ CCCCOC(=O)c1ccccc1C(=O)OCCCC
+ Massbank
+ 3
+ 279.1593
+ CCMSLIB00005738172
+ 279.1593
+ 0.0
+ Massbank
+ 10960140.698794415
+ qTof
+ Isolated
+ 0.000305176
+ M+H
+ N/A
+ ESI
+ Positive
+ 27.3205
+ 5
+ 0.901387
+ 0.0
+ Isolated
+ 10243
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=105&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 27.3205
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.6587
+ 5
+ 0
+ Feature Node
+ N/A
+ 1567881.4715333274
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4565.0","main.cluster index_upperinput":"4565.0"}
+ 4565
+ 10.6587
+ 130
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 193.0498
+ N/A
+ 0.0
+ 193.0498
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.0836
+ 6
+ 0
+ Feature Node
+ N/A
+ 1816696.9660786265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"42.0","main.cluster index_upperinput":"42.0"}
+ 42
+ 32.0836
+ -1
+ This Node is a Singleton
+ N/A
+ 449.3406
+ N/A
+ 0.0
+ 449.3406
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.5537
+ 9
+ 0
+ Feature Node
+ N/A
+ 3103097.5518360315
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1271.0","main.cluster index_upperinput":"1271.0"}
+ 1271
+ 24.5537
+ -1
+ This Node is a Singleton
+ N/A
+ 227.1641
+ N/A
+ 0.0
+ 227.1641
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.3362
+ 4
+ 0
+ Feature Node
+ N/A
+ 1214156.7007526532
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10339.0","main.cluster index_upperinput":"10339.0"}
+ 10339
+ 15.3362
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 564.2792
+ N/A
+ 0.0
+ 564.2792
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.3577
+ 9
+ 0
+ Feature Node
+ N/A
+ 4259759.203935113
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2570.0","main.cluster index_upperinput":"2570.0"}
+ 2570
+ 28.3577
+ -1
+ This Node is a Singleton
+ N/A
+ 309.2041
+ N/A
+ 0.0
+ 309.2041
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.9465
+ 5
+ 0
+ Feature Node
+ N/A
+ 583187.6048031957
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3601.0","main.cluster index_upperinput":"3601.0"}
+ 3601
+ 20.9465
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 361.0917
+ N/A
+ 0.0
+ 361.0917
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.1198
+ 7
+ 0
+ Feature Node
+ N/A
+ 4575937.329302846
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3582.0","main.cluster index_upperinput":"3582.0"}
+ 3582
+ 27.1198
+ -1
+ This Node is a Singleton
+ N/A
+ 391.2455
+ N/A
+ 0.0
+ 391.2455
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.4307
+ 9
+ 0
+ Feature Node
+ N/A
+ 1381952.1110339903
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1292.0","main.cluster index_upperinput":"1292.0"}
+ 1292
+ 1.4307
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 144.0655
+ N/A
+ 0.0
+ 144.0655
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.6147
+ 8
+ 0
+ Feature Node
+ N/A
+ 2967952.7515695747
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"43.0","main.cluster index_upperinput":"43.0"}
+ 43
+ 22.6147
+ -1
+ This Node is a Singleton
+ N/A
+ 250.1781
+ N/A
+ 0.0
+ 250.1781
+
+
+ 32
+ 0.845599
+ CCMSLIB00005778294
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005778294
+ 1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22+,23+,25-,26-/m0/s1
+ 0
+ qTof
+ 1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22+,23+,25-,26-/m0/s1
+ 0.0
+ Massbank:FIO00721 Isoschaftoside
+ Oc(c([C@H](O5)[C@@H]([C@H]([C@@H]([C@H]5CO)O)O)O)1)c([C@H](O4)[C@@H]([C@@H](O)[C@@H](O)C4)O)c(c(C2=O)c1OC(c(c3)ccc(O)c3)=C2)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005778294
+ 69
+ 1.72796
+ Feature Node
+ N/A
+ 32
+ 0.0
+ 0.0
+ Massbank
+ Massbank:FIO00721 Isoschaftoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7859.0","main.cluster index_upperinput":"7859.0"}
+ 1.72796
+ 3
+ Oc(c([C@H](O5)[C@@H]([C@H]([C@@H]([C@H]5CO)O)O)O)1)c([C@H](O4)[C@@H]([C@@H](O)[C@@H](O)C4)O)c(c(C2=O)c1OC(c(c3)ccc(O)c3)=C2)O
+ Massbank
+ 3
+ 565.156
+ CCMSLIB00005778294
+ 565.156
+ 0.0
+ Massbank
+ 5928452.88468615
+ qTof
+ Isolated
+ 0.0009765619999999999
+ M+H
+ N/A
+ ESI
+ Positive
+ 12.2992
+ 4
+ 0.845599
+ 0.0
+ Isolated
+ 7859
+ 0.0009765619999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=26&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 12.2992
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.811
+ 9
+ 0
+ Feature Node
+ N/A
+ 2077875.5549563565
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8283.0","main.cluster index_upperinput":"8283.0"}
+ 8283
+ 4.811
+ -1
+ This Node is a Singleton
+ N/A
+ 193.0859
+ N/A
+ 0.0
+ 193.0859
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.612
+ 5
+ 0
+ Feature Node
+ N/A
+ 1627732.038066816
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4585.0","main.cluster index_upperinput":"4585.0"}
+ 4585
+ 13.612
+ -1
+ This Node is a Singleton
+ N/A
+ 394.2218
+ N/A
+ 0.0
+ 394.2218
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6283
+ 4
+ 0
+ Feature Node
+ N/A
+ 5992824.41077976
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3523.0","main.cluster index_upperinput":"3523.0"}
+ 3523
+ 32.6283
+ -1
+ This Node is a Singleton
+ N/A
+ 419.2772
+ N/A
+ 0.0
+ 419.2772
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.645
+ 8
+ 0
+ Feature Node
+ N/A
+ 5604246.928276086
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2571.0","main.cluster index_upperinput":"2571.0"}
+ 2571
+ 33.645
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 568.1917
+ N/A
+ 0.0
+ 568.1917
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8036
+ 4
+ 0
+ Feature Node
+ N/A
+ 1653893.7989523215
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10297.0","main.cluster index_upperinput":"10297.0"}
+ 10297
+ 16.8036
+ 46
+ This Node is a Singleton
+ N/A
+ 552.2445
+ N/A
+ 0.0
+ 552.2445
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.7831
+ 7
+ 0
+ Feature Node
+ N/A
+ 3122347.048803833
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14891.0","main.cluster index_upperinput":"14891.0"}
+ 14891
+ 4.7831
+ -1
+ This Node is a Singleton
+ N/A
+ 395.1311
+ N/A
+ 0.0
+ 395.1311
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.2096
+ 7
+ 0
+ Feature Node
+ N/A
+ 6115501.704338637
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2744.0","main.cluster index_upperinput":"2744.0"}
+ 2744
+ 32.2096
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 510.4367
+ N/A
+ 0.0
+ 510.4367
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.829
+ 7
+ 0
+ Feature Node
+ N/A
+ 5046156.826898968
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9004.0","main.cluster index_upperinput":"9004.0"}
+ 9004
+ 34.829
+ 115
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=47&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 639.2819
+ N/A
+ 0.0
+ 639.2819
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7646
+ 4
+ 0
+ Feature Node
+ N/A
+ 622345.6872420048
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7766.0","main.cluster index_upperinput":"7766.0"}
+ 7766
+ 17.7646
+ -1
+ This Node is a Singleton
+ N/A
+ 229.1224
+ N/A
+ 0.0
+ 229.1224
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5912
+ 8
+ 0
+ Feature Node
+ N/A
+ 49376419.099483415
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3721.0","main.cluster index_upperinput":"3721.0"}
+ 3721
+ 33.5912
+ 41
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 311.3123
+ N/A
+ 0.0
+ 311.3123
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.5837
+ 9
+ 0
+ Feature Node
+ N/A
+ 5300388.506654087
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"54.0","main.cluster index_upperinput":"54.0"}
+ 54
+ 31.5837
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 630.191
+ N/A
+ 0.0
+ 630.191
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.9444
+ 7
+ 0
+ Feature Node
+ N/A
+ 7299147.455741209
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4566.0","main.cluster index_upperinput":"4566.0"}
+ 4566
+ 17.9444
+ -1
+ This Node is a Singleton
+ N/A
+ 401.158
+ N/A
+ 0.0
+ 401.158
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6988
+ 9
+ 0
+ Feature Node
+ N/A
+ 3306148.9255757104
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5984.0","main.cluster index_upperinput":"5984.0"}
+ 5984
+ 25.6988
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.986
+ 5
+ 0
+ Feature Node
+ N/A
+ 1310405.5732964026
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3725.0","main.cluster index_upperinput":"3725.0"}
+ 3725
+ 19.986
+ 143
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 558.3484
+ N/A
+ 0.0
+ 558.3484
+
+
+ 6
+ 0.759579
+ CCMSLIB00005742378
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0
+ qTof
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0.0
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 53
+ 0.0
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2703.0","main.cluster index_upperinput":"2703.0"}
+ 0.0
+ 3
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ Massbank
+ 3
+ 509.129
+ CCMSLIB00005742378
+ 509.129
+ 0.0
+ Massbank
+ 2281197.6235761913
+ qTof
+ Isolated
+ 0.0
+ M+H
+ N/A
+ ESI
+ Positive
+ 15.7808
+ 4
+ 0.759579
+ 0.0
+ Isolated
+ 2703
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.7808
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.169
+ 8
+ 0
+ Feature Node
+ N/A
+ 2907207.0638428433
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11531.0","main.cluster index_upperinput":"11531.0"}
+ 11531
+ 23.169
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8904
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.2191
+ 2
+ 0
+ Feature Node
+ N/A
+ 5348375.667601779
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7623.0","main.cluster index_upperinput":"7623.0"}
+ 7623
+ 21.2191
+ -1
+ This Node is a Singleton
+ N/A
+ 405.1085
+ N/A
+ 0.0
+ 405.1085
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.7865
+ 8
+ 0
+ Feature Node
+ N/A
+ 11703055.69420084
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1590.0","main.cluster index_upperinput":"1590.0"}
+ 1590
+ 34.7865
+ -1
+ This Node is a Singleton
+ N/A
+ 716.5672
+ N/A
+ 0.0
+ 716.5672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.783
+ 3
+ 0
+ Feature Node
+ N/A
+ 1051007.5219368057
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4686.0","main.cluster index_upperinput":"4686.0"}
+ 4686
+ 20.783
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 558.3486
+ N/A
+ 0.0
+ 558.3486
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6951
+ 5
+ 0
+ Feature Node
+ N/A
+ 206583.78931104613
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20565.0","main.cluster index_upperinput":"20565.0"}
+ 20565
+ 23.6951
+ 147
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=86&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.2797
+ N/A
+ 0.0
+ 441.2797
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.832
+ 2
+ 0
+ Feature Node
+ N/A
+ 3728207.0097804265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13647.0","main.cluster index_upperinput":"13647.0"}
+ 13647
+ 29.832
+ -1
+ This Node is a Singleton
+ N/A
+ 857.453
+ N/A
+ 0.0
+ 857.453
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3565
+ 9
+ 0
+ Feature Node
+ N/A
+ 9805830.617363598
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1423.0","main.cluster index_upperinput":"1423.0"}
+ 1423
+ 32.3565
+ -1
+ This Node is a Singleton
+ N/A
+ 303.2293
+ N/A
+ 0.0
+ 303.2293
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5783
+ 9
+ 0
+ Feature Node
+ N/A
+ 2541665.283759132
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2569.0","main.cluster index_upperinput":"2569.0"}
+ 2569
+ 16.5783
+ -1
+ This Node is a Singleton
+ N/A
+ 219.1739
+ N/A
+ 0.0
+ 219.1739
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.2043
+ 4
+ 0
+ Feature Node
+ N/A
+ 1700003.321689792
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4766.0","main.cluster index_upperinput":"4766.0"}
+ 4766
+ 15.2043
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2387
+ N/A
+ 0.0
+ 446.2387
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.2738
+ 7
+ 0
+ Feature Node
+ N/A
+ 5172630.1692460375
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1167.0","main.cluster index_upperinput":"1167.0"}
+ 1167
+ 21.2738
+ -1
+ This Node is a Singleton
+ N/A
+ 810.3558
+ N/A
+ 0.0
+ 810.3558
+
+
+ 36
+ 0.8503629999999999
+ CCMSLIB00004705627
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705627
+ InChI=1S/C19H18O7/c1-22-10-5-6-11(14(7-10)23-2)15-8-12(20)17-13(21)9-16(24-3)18(25-4)19(17)26-15/h5-9,21H,1-4H3
+ 0
+ ESI-QFT
+ InChI=1S/C19H18O7/c1-22-10-5-6-11(14(7-10)23-2)15-8-12(20)17-13(21)9-16(24-3)18(25-4)19(17)26-15/h5-9,21H,1-4H3
+ 0.0
+ 5-Hydroxy-2',4',7,8-Tetramethoxyflavone
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705627
+ -1
+ 1.10475
+ Feature Node
+ N/A
+ 36
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF014564
+ 5-Hydroxy-2',4',7,8-Tetramethoxyflavone
+ positive
+ MoNA:VF-NPL-QEHF014564
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7878.0","main.cluster index_upperinput":"7878.0"}
+ 1.10475
+ 3
+ N/A
+ MoNA
+ 3
+ 359.1134
+ CCMSLIB00004705627
+ 359.1134
+ 0.0
+ MoNA
+ 8300232.0915521635
+ ESI-QFT
+ isolated
+ 0.000396729
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 23.387
+ 6
+ 0.8503629999999999
+ 0.0
+ isolated
+ 7878
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 23.387
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.4699
+ 3
+ 0
+ Feature Node
+ N/A
+ 260131.59090840738
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2565.0","main.cluster index_upperinput":"2565.0"}
+ 2565
+ 22.4699
+ -1
+ This Node is a Singleton
+ N/A
+ 360.217
+ N/A
+ 0.0
+ 360.217
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.7642
+ 6
+ 0
+ Feature Node
+ N/A
+ 2674951.4371559597
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1479.0","main.cluster index_upperinput":"1479.0"}
+ 1479
+ 33.7642
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=96&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 653.4754
+ N/A
+ 0.0
+ 653.4754
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.9065
+ 7
+ 0
+ Feature Node
+ N/A
+ 4270006.985895708
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1166.0","main.cluster index_upperinput":"1166.0"}
+ 1166
+ 13.9065
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=35&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 543.1842
+ N/A
+ 0.0
+ 543.1842
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.622
+ 8
+ 0
+ Feature Node
+ N/A
+ 6584537.46024011
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3738.0","main.cluster index_upperinput":"3738.0"}
+ 3738
+ 33.622
+ -1
+ This Node is a Singleton
+ N/A
+ 395.3138
+ N/A
+ 0.0
+ 395.3138
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.8578
+ 6
+ 0
+ Feature Node
+ N/A
+ 1003523.9809235106
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4552.0","main.cluster index_upperinput":"4552.0"}
+ 4552
+ 33.8578
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 656.2256
+ N/A
+ 0.0
+ 656.2256
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2154
+ 3
+ 0
+ Feature Node
+ N/A
+ 6145393.172708221
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7.0","main.cluster index_upperinput":"7.0"}
+ 7
+ 33.2154
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 959.5725
+ N/A
+ 0.0
+ 959.5725
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.3122
+ 9
+ 0
+ Feature Node
+ N/A
+ 718268.1599596309
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"412.0","main.cluster index_upperinput":"412.0"}
+ 412
+ 25.3122
+ -1
+ This Node is a Singleton
+ N/A
+ 263.2215
+ N/A
+ 0.0
+ 263.2215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2669
+ 4
+ 0
+ Feature Node
+ N/A
+ 1260307.1010284186
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10311.0","main.cluster index_upperinput":"10311.0"}
+ 10311
+ 23.2669
+ -1
+ This Node is a Singleton
+ N/A
+ 531.3496
+ N/A
+ 0.0
+ 531.3496
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.4107
+ 7
+ 0
+ Feature Node
+ N/A
+ 1389743.6248976677
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1349.0","main.cluster index_upperinput":"1349.0"}
+ 1349
+ 13.4107
+ -1
+ This Node is a Singleton
+ N/A
+ 289.1407
+ N/A
+ 0.0
+ 289.1407
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0607
+ 7
+ 0
+ Feature Node
+ N/A
+ 23885185.65127536
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"17.0","main.cluster index_upperinput":"17.0"}
+ 17
+ 34.0607
+ 160
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=65&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 463.3772
+ N/A
+ 0.0
+ 463.3772
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.0567
+ 9
+ 0
+ Feature Node
+ N/A
+ 8194891.820347122
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3678.0","main.cluster index_upperinput":"3678.0"}
+ 3678
+ 32.0567
+ 161
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=182&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.2988
+ N/A
+ 0.0
+ 441.2988
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.0615
+ 9
+ 0
+ Feature Node
+ N/A
+ 2650411.082622042
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"86.0","main.cluster index_upperinput":"86.0"}
+ 86
+ 25.0615
+ -1
+ This Node is a Singleton
+ N/A
+ 267.1571
+ N/A
+ 0.0
+ 267.1571
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.964
+ 7
+ 0
+ Feature Node
+ N/A
+ 13742807.597437948
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7661.0","main.cluster index_upperinput":"7661.0"}
+ 7661
+ 0.964
+ 1
+ This Node is a Singleton
+ N/A
+ 232.1177
+ N/A
+ 0.0
+ 232.1177
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.195
+ 4
+ 0
+ Feature Node
+ N/A
+ 1026702.9907043057
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4684.0","main.cluster index_upperinput":"4684.0"}
+ 4684
+ 19.195
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=16&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.2165
+ N/A
+ 0.0
+ 607.2165
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.8289
+ 4
+ 0
+ Feature Node
+ N/A
+ 1951739.9415684207
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4568.0","main.cluster index_upperinput":"4568.0"}
+ 4568
+ 14.8289
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 243.1015
+ N/A
+ 0.0
+ 243.1015
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.5818
+ 6
+ 0
+ Feature Node
+ N/A
+ 2274765.7208027355
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10284.0","main.cluster index_upperinput":"10284.0"}
+ 10284
+ 12.5818
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.2529
+ N/A
+ 0.0
+ 496.2529
+
+
+ 54
+ 0.8506389999999999
+ CCMSLIB00004718161
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718161
+ InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3
+ 0
+ ESI-QTOF
+ InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3
+ 0.0
+ cirsimaritin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718161
+ 166
+ 1.9371
+ Feature Node
+ N/A
+ 54
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QTOF000610
+ cirsimaritin
+ positive
+ MoNA:VF-NPL-QTOF000610
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4674.0","main.cluster index_upperinput":"4674.0"}
+ 1.9371
+ 3
+ N/A
+ MoNA
+ 3
+ 315.0866
+ CCMSLIB00004718161
+ 315.0866
+ 0.0
+ MoNA
+ 29513265.39611353
+ ESI-QTOF
+ isolated
+ 0.000610352
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 22.3126
+ 6
+ 0.8506389999999999
+ 0.0
+ isolated
+ 4674
+ 0.000610352
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 22.3126
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.172
+ 3
+ 0
+ Feature Node
+ N/A
+ 274897.9891054763
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4650.0","main.cluster index_upperinput":"4650.0"}
+ 4650
+ 19.172
+ 167
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=137&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 559.195
+ N/A
+ 0.0
+ 559.195
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.2692
+ 2
+ 0
+ Feature Node
+ N/A
+ 381682.63597673544
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8032.0","main.cluster index_upperinput":"8032.0"}
+ 8032
+ 4.2692
+ 168
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 452.184
+ N/A
+ 0.0
+ 452.184
+
+
+ 10
+ 0.876085
+ CCMSLIB00000851805
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000851805
+ InChI=1S/C45H73NO15/c1-19-6-9-27-20(2)31-28(46(27)16-19)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)57-43-40(61-41-37(54)35(52)32(49)21(3)56-41)39(34(51)30(18-48)59-43)60-42-38(55)36(53)33(50)29(17-47)58-42/h7,19-21,23-43,47-55H,6,8-18H2,1-5H3/t19-,20+,21-,23?,24+,25-,26-,27+,28-,29+,30+,31-,32-,33+,34+,35+,36-,37+,38+,39-,40-,41-,42-,43+,44-,45-/m0/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C45H73NO15/c1-19-6-9-27-20(2)31-28(46(27)16-19)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)57-43-40(61-41-37(54)35(52)32(49)21(3)56-41)39(34(51)30(18-48)59-43)60-42-38(55)36(53)33(50)29(17-47)58-42/h7,19-21,23-43,47-55H,6,8-18H2,1-5H3/t19-,20+,21-,23?,24+,25-,26-,27+,28-,29+,30+,31-,32-,33+,34+,35+,36-,37+,38+,39-,40-,41-,42-,43+,44-,45-/m0/s1
+ 0.0
+ NCGC00169933-02_C45H73NO15_beta-D-Mannopyranoside, solanid-5-en-3-yl O-6-deoxy-alpha-L-mannopyranosyl-(1->2)-O-[beta-D-glucopyranosyl-(1->3)]-
+ C[C@H]1CC[C@@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5C\\C=C6\\CC(CC[C@]6(C)[C@H]5CC[C@]34C)O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@H]7O[C@@H]9O[C@@H](C)[C@H](O)[C@@H](O)[C@H]9O)N2C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000851805
+ -1
+ 0.21082800000000002
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00169933-02_C45H73NO15_beta-D-Mannopyranoside, solanid-5-en-3-yl O-6-deoxy-alpha-L-mannopyranosyl-(1->2)-O-[beta-D-glucopyranosyl-(1->3)]-
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2485.0","main.cluster index_upperinput":"2485.0"}
+ 0.21082800000000002
+ 1
+ C[C@H]1CC[C@@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5C\\C=C6\\CC(CC[C@]6(C)[C@H]5CC[C@]34C)O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@H]7O[C@@H]9O[C@@H](C)[C@H](O)[C@@H](O)[C@H]9O)N2C1
+ Jadhav/Dorrestein
+ 1
+ 868.5048
+ CCMSLIB00000851805
+ 868.5048
+ 0.0
+ Jadhav/Dorrestein
+ 4840147.189865526
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.000183105
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 18.6476
+ 3
+ 0.876085
+ 0.0
+ isolated
+ 2485
+ 0.000183105
+ This Node is a Singleton
+ 18.6476
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.567
+ 6
+ 0
+ Feature Node
+ N/A
+ 715764.5743405733
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7699.0","main.cluster index_upperinput":"7699.0"}
+ 7699
+ 29.567
+ -1
+ This Node is a Singleton
+ N/A
+ 355.2253
+ N/A
+ 0.0
+ 355.2253
+
+
+ 31
+ 0.8452850000000001
+ CCMSLIB00000847637
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847637
+ InChI=1S/C46H50N4O8/c51-39-17-5-35(6-18-39)13-25-43(55)47-29-3-33-49(45(57)27-15-37-9-21-41(53)22-10-37)31-1-2-32-50(46(58)28-16-38-11-23-42(54)24-12-38)34-4-30-48-44(56)26-14-36-7-19-40(52)20-8-36/h5-28,51-54H,1-4,29-34H2,(H,47,55)(H,48,56)/b25-13+,26-14+,27-15+,28-16+
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C46H50N4O8/c51-39-17-5-35(6-18-39)13-25-43(55)47-29-3-33-49(45(57)27-15-37-9-21-41(53)22-10-37)31-1-2-32-50(46(58)28-16-38-11-23-42(54)24-12-38)34-4-30-48-44(56)26-14-36-7-19-40(52)20-8-36/h5-28,51-54H,1-4,29-34H2,(H,47,55)(H,48,56)/b25-13+,26-14+,27-15+,28-16+
+ 0.0
+ NCGC00384571-01!(E)-3-(4-hydroxyphenyl)-N-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]amino]propyl]prop-2-enamide
+ OC1=CC=C(\\C=C\\C(=O)NCCCN(CCCCN(CCCNC(=O)\\C=C\\C2=CC=C(O)C=C2)C(=O)\\C=C\\C3=CC=C(O)C=C3)C(=O)\\C=C\\C4=CC=C(O)C=C4)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847637
+ 171
+ 0.465107
+ Feature Node
+ N/A
+ 31
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00384571-01!(E)-3-(4-hydroxyphenyl)-N-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]amino]propyl]prop-2-enamide
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2494.0","main.cluster index_upperinput":"2494.0"}
+ 0.465107
+ 1
+ OC1=CC=C(\\C=C\\C(=O)NCCCN(CCCCN(CCCNC(=O)\\C=C\\C2=CC=C(O)C=C2)C(=O)\\C=C\\C3=CC=C(O)C=C3)C(=O)\\C=C\\C4=CC=C(O)C=C4)C=C1
+ Jadhav/Dorrestein
+ 1
+ 787.3696
+ CCMSLIB00000847637
+ 787.3696
+ 0.0
+ Jadhav/Dorrestein
+ 12755329.450813219
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.00036621099999999997
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 21.2738
+ 7
+ 0.8452850000000001
+ 0.0
+ isolated
+ 2494
+ 0.00036621099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=18&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.2738
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.112
+ 7
+ 0
+ Feature Node
+ N/A
+ 5456736.956871903
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7692.0","main.cluster index_upperinput":"7692.0"}
+ 7692
+ 17.112
+ 172
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 493.135
+ N/A
+ 0.0
+ 493.135
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.6215
+ 5
+ 0
+ Feature Node
+ N/A
+ 2717865.1836542343
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4530.0","main.cluster index_upperinput":"4530.0"}
+ 4530
+ 22.6215
+ -1
+ This Node is a Singleton
+ N/A
+ 367.0794
+ N/A
+ 0.0
+ 367.0794
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.4232
+ 8
+ 0
+ Feature Node
+ N/A
+ 6982756.284753685
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2518.0","main.cluster index_upperinput":"2518.0"}
+ 2518
+ 29.4232
+ -1
+ This Node is a Singleton
+ N/A
+ 321.2402
+ N/A
+ 0.0
+ 321.2402
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.0898
+ 5
+ 0
+ Feature Node
+ N/A
+ 298193.7136136346
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4722.0","main.cluster index_upperinput":"4722.0"}
+ 4722
+ 20.0898
+ -1
+ This Node is a Singleton
+ N/A
+ 371.1491
+ N/A
+ 0.0
+ 371.1491
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4308
+ 9
+ 0
+ Feature Node
+ N/A
+ 2596993.016967828
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"344.0","main.cluster index_upperinput":"344.0"}
+ 344
+ 28.4308
+ -1
+ This Node is a Singleton
+ N/A
+ 411.0942
+ N/A
+ 0.0
+ 411.0942
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.6846
+ 6
+ 0
+ Feature Node
+ N/A
+ 1654374.939265138
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1974.0","main.cluster index_upperinput":"1974.0"}
+ 1974
+ 18.6846
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=103&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2476
+ N/A
+ 0.0
+ 462.2476
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.2261
+ 6
+ 0
+ Feature Node
+ N/A
+ 4355468.878387155
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4542.0","main.cluster index_upperinput":"4542.0"}
+ 4542
+ 31.2261
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 814.5163
+ N/A
+ 0.0
+ 814.5163
+
+
+ 43
+ 0.773093
+ CCMSLIB00005720103
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0
+ Orbitrap
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0.0
+ 22-Hydoxy-2-hopen-1-one
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ 5
+ 0.207427
+ Feature Node
+ N/A
+ 43
+ 0.0
+ 0.0
+ Damien OLIVIER
+ 22-Hydoxy-2-hopen-1-one
+ Positive
+ Damien OLIVIER
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2956.0","main.cluster index_upperinput":"2956.0"}
+ 0.207427
+ 3
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 3
+ 441.3729
+ CCMSLIB00005720103
+ 441.3729
+ 0.0
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 4555204.030046496
+ Orbitrap
+ Isolated
+ 9.15527e-05
+ [M+H]
+ N/A
+ LC-ESI
+ Positive
+ 32.7863
+ 9
+ 0.773093
+ 0.0
+ Isolated
+ 2956
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 32.7863
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.6613
+ 4
+ 0
+ Feature Node
+ N/A
+ 5683134.65175893
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4680.0","main.cluster index_upperinput":"4680.0"}
+ 4680
+ 10.6613
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=164&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 556.2747
+ N/A
+ 0.0
+ 556.2747
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1075
+ 9
+ 0
+ Feature Node
+ N/A
+ 3291453.1968384264
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5914.0","main.cluster index_upperinput":"5914.0"}
+ 5914
+ 26.1075
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.0006
+ 8
+ 0
+ Feature Node
+ N/A
+ 1163903.882840964
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7823.0","main.cluster index_upperinput":"7823.0"}
+ 7823
+ 10.0006
+ -1
+ This Node is a Singleton
+ N/A
+ 536.1658
+ N/A
+ 0.0
+ 536.1658
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.6775
+ 7
+ 0
+ Feature Node
+ N/A
+ 3527710.987980737
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4526.0","main.cluster index_upperinput":"4526.0"}
+ 4526
+ 16.6775
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 347.0765
+ N/A
+ 0.0
+ 347.0765
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.3404
+ 9
+ 0
+ Feature Node
+ N/A
+ 5305118.459268133
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"32.0","main.cluster index_upperinput":"32.0"}
+ 32
+ 30.3404
+ 56
+ This Node is a Singleton
+ N/A
+ 628.1949
+ N/A
+ 0.0
+ 628.1949
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3417
+ 7
+ 0
+ Feature Node
+ N/A
+ 2592935.7047714978
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5923.0","main.cluster index_upperinput":"5923.0"}
+ 5923
+ 26.3417
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.1504
+ 8
+ 0
+ Feature Node
+ N/A
+ 7871169.299562684
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3835.0","main.cluster index_upperinput":"3835.0"}
+ 3835
+ 33.1504
+ -1
+ This Node is a Singleton
+ N/A
+ 363.2872
+ N/A
+ 0.0
+ 363.2872
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.0315
+ 7
+ 0
+ Feature Node
+ N/A
+ 5219122.26627705
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13625.0","main.cluster index_upperinput":"13625.0"}
+ 13625
+ 24.0315
+ 10
+ This Node is a Singleton
+ N/A
+ 111.1167
+ N/A
+ 0.0
+ 111.1167
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6144
+ 3
+ 0
+ Feature Node
+ N/A
+ 712596.5031225024
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2525.0","main.cluster index_upperinput":"2525.0"}
+ 2525
+ 17.6144
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 528.2587
+ N/A
+ 0.0
+ 528.2587
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.8588
+ 1
+ 0
+ Feature Node
+ N/A
+ 2506155.2872344186
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13783.0","main.cluster index_upperinput":"13783.0"}
+ 13783
+ 13.8588
+ -1
+ This Node is a Singleton
+ N/A
+ 498.2099
+ N/A
+ 0.0
+ 498.2099
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.0591
+ 6
+ 0
+ Feature Node
+ N/A
+ 1398347.4871536682
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4578.0","main.cluster index_upperinput":"4578.0"}
+ 4578
+ 14.0591
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=51&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 544.1828
+ N/A
+ 0.0
+ 544.1828
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8248
+ 7
+ 0
+ Feature Node
+ N/A
+ 12209737.616564333
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1435.0","main.cluster index_upperinput":"1435.0"}
+ 1435
+ 32.8248
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=36&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 954.6134
+ N/A
+ 0.0
+ 954.6134
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.3256
+ 2
+ 0
+ Feature Node
+ N/A
+ 192840.99953819354
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4773.0","main.cluster index_upperinput":"4773.0"}
+ 4773
+ 20.3256
+ -1
+ This Node is a Singleton
+ N/A
+ 359.1379
+ N/A
+ 0.0
+ 359.1379
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.4786
+ 9
+ 0
+ Feature Node
+ N/A
+ 285529691.96057796
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1.0","main.cluster index_upperinput":"1.0"}
+ 1
+ 34.4786
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 776.2323
+ N/A
+ 0.0
+ 776.2323
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.3384
+ 8
+ 0
+ Feature Node
+ N/A
+ 4212243.390756721
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11306.0","main.cluster index_upperinput":"11306.0"}
+ 11306
+ 25.3384
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9453
+ N/A
+ 0.0
+ 84.9453
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9403
+ 9
+ 0
+ Feature Node
+ N/A
+ 10376569.878026046
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1191.0","main.cluster index_upperinput":"1191.0"}
+ 1191
+ 0.9403
+ -1
+ This Node is a Singleton
+ N/A
+ 116.0704
+ N/A
+ 0.0
+ 116.0704
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.6933
+ 1
+ 0
+ Feature Node
+ N/A
+ 393443.1856087807
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7854.0","main.cluster index_upperinput":"7854.0"}
+ 7854
+ 20.6933
+ -1
+ This Node is a Singleton
+ N/A
+ 424.1972
+ N/A
+ 0.0
+ 424.1972
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.4638
+ 4
+ 0
+ Feature Node
+ N/A
+ 4731714.110289918
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5385.0","main.cluster index_upperinput":"5385.0"}
+ 5385
+ 17.4638
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2432
+ N/A
+ 0.0
+ 478.2432
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.9917
+ 6
+ 0
+ Feature Node
+ N/A
+ 938486.1613927514
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4153.0","main.cluster index_upperinput":"4153.0"}
+ 4153
+ 7.9917
+ 186
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 368.2066
+ N/A
+ 0.0
+ 368.2066
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.0615
+ 1
+ 0
+ Feature Node
+ N/A
+ 6352040.590879005
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13642.0","main.cluster index_upperinput":"13642.0"}
+ 13642
+ 27.0615
+ 93
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=63&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 970.5215
+ N/A
+ 0.0
+ 970.5215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.3063
+ 5
+ 0
+ Feature Node
+ N/A
+ 24774620.25807144
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4505.0","main.cluster index_upperinput":"4505.0"}
+ 4505
+ 17.3063
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.2488
+ N/A
+ 0.0
+ 536.2488
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.5117
+ 8
+ 0
+ Feature Node
+ N/A
+ 4847054.245436737
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"35.0","main.cluster index_upperinput":"35.0"}
+ 35
+ 22.5117
+ -1
+ This Node is a Singleton
+ N/A
+ 266.1732
+ N/A
+ 0.0
+ 266.1732
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.9254
+ 6
+ 0
+ Feature Node
+ N/A
+ 1171294.262470087
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4675.0","main.cluster index_upperinput":"4675.0"}
+ 4675
+ 9.9254
+ -1
+ This Node is a Singleton
+ N/A
+ 307.1153
+ N/A
+ 0.0
+ 307.1153
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.4614
+ 9
+ 0
+ Feature Node
+ N/A
+ 3856466.3511360395
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6053.0","main.cluster index_upperinput":"6053.0"}
+ 6053
+ 24.4614
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9172
+ 7
+ 0
+ Feature Node
+ N/A
+ 11656625.75076603
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1808.0","main.cluster index_upperinput":"1808.0"}
+ 1808
+ 16.9172
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1223
+ N/A
+ 0.0
+ 229.1223
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5201
+ 7
+ 0
+ Feature Node
+ N/A
+ 16351524.544453213
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2519.0","main.cluster index_upperinput":"2519.0"}
+ 2519
+ 33.5201
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 696.5252
+ N/A
+ 0.0
+ 696.5252
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9485
+ 7
+ 0
+ Feature Node
+ N/A
+ 10304387.952404505
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4637.0","main.cluster index_upperinput":"4637.0"}
+ 4637
+ 0.9485
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 98.961
+ N/A
+ 0.0
+ 98.961
+
+
+ 24
+ 0.936716
+ CCMSLIB00005778154
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005778154
+ 1S/C21H20O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21+/m1/s1
+ 0
+ qTof
+ 1S/C21H20O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21+/m1/s1
+ 0.0
+ Massbank:FIO00751 Isovitexin
+ OC[C@H]([C@@H](O)4)O[C@H]([C@H](O)[C@@H](O)4)c(c(O)1)c(O)c(C(=O)3)c(OC(=C3)c(c2)ccc(O)c2)c1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005778154
+ 69
+ 1.1273799999999998
+ Feature Node
+ N/A
+ 24
+ 0.0
+ 0.0
+ Massbank
+ Massbank:FIO00751 Isovitexin
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2509.0","main.cluster index_upperinput":"2509.0"}
+ 1.1273799999999998
+ 3
+ OC[C@H]([C@@H](O)4)O[C@H]([C@H](O)[C@@H](O)4)c(c(O)1)c(O)c(C(=O)3)c(OC(=C3)c(c2)ccc(O)c2)c1
+ Massbank
+ 3
+ 433.1135
+ CCMSLIB00005778154
+ 433.1135
+ 0.0
+ Massbank
+ 7160666.461671267
+ qTof
+ Isolated
+ 0.00048828099999999997
+ M+H
+ N/A
+ ESI
+ Positive
+ 13.8063
+ 6
+ 0.936716
+ 0.0
+ Isolated
+ 2509
+ 0.00048828099999999997
+ This Node is a Singleton
+ 13.8063
+ 0.0
+ M+H
+
+
+ 23
+ 0.929465
+ CCMSLIB00000222011
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000222011
+ 1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H
+ 0
+ LC-ESI-QTOF
+ 1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H
+ 0.0
+ Massbank:PB000743 Luteolin|5,7,3',4'-tetrahydroxy-flavone
+ C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000222011
+ 189
+ 2.44518
+ Feature Node
+ N/A
+ 23
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PB000743 Luteolin|5,7,3',4'-tetrahydroxy-flavone
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2735.0","main.cluster index_upperinput":"2735.0"}
+ 2.44518
+ 3
+ C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O
+ Putative Massbank Match
+ 3
+ 287.0553
+ CCMSLIB00000222011
+ 287.0553
+ 0.0
+ Putative Massbank Match
+ 7095546.972243165
+ LC-ESI-QTOF
+ Isolated
+ 0.0007019039999999999
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 18.5865
+ 7
+ 0.929465
+ 0.0
+ Isolated
+ 2735
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.5865
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.6059
+ 7
+ 0
+ Feature Node
+ N/A
+ 57487825.52658472
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8341.0","main.cluster index_upperinput":"8341.0"}
+ 8341
+ 14.6059
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 476.2274
+ N/A
+ 0.0
+ 476.2274
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.4764
+ 5
+ 0
+ Feature Node
+ N/A
+ 973368.4950666378
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3575.0","main.cluster index_upperinput":"3575.0"}
+ 3575
+ 12.4764
+ 69
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=26&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 565.1552
+ N/A
+ 0.0
+ 565.1552
+
+
+ 6
+ 0.8819739999999999
+ CCMSLIB00005745975
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745975
+ 1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1
+ 0
+ qTof
+ 1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1
+ 0.0
+ Massbank:PR303098 Petunidin-3-O-beta-glucoside
+ COC1=CC(=CC(O)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C2C(O)=CC(O)=CC2=[O+]1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745975
+ 190
+ 2.29303
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303098 Petunidin-3-O-beta-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4502.0","main.cluster index_upperinput":"4502.0"}
+ 2.29303
+ 3
+ COC1=CC(=CC(O)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C2C(O)=CC(O)=CC2=[O+]1
+ Massbank
+ 3
+ 479.1191
+ CCMSLIB00005745975
+ 479.1191
+ 0.0
+ Massbank
+ 13293856.63735443
+ qTof
+ Isolated
+ 0.00109863
+ M
+ N/A
+ ESI
+ Positive
+ 16.3876
+ 4
+ 0.8819739999999999
+ 0.0
+ Isolated
+ 4502
+ 0.00109863
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.3876
+ 0.0
+ M
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.421
+ 1
+ 0
+ Feature Node
+ N/A
+ 1850856.6961663298
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13751.0","main.cluster index_upperinput":"13751.0"}
+ 13751
+ 21.421
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2173
+ N/A
+ 0.0
+ 446.2173
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.0057
+ 9
+ 0
+ Feature Node
+ N/A
+ 6309646.755972648
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1575.0","main.cluster index_upperinput":"1575.0"}
+ 1575
+ 33.0057
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 582.4578
+ N/A
+ 0.0
+ 582.4578
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.4118
+ 6
+ 0
+ Feature Node
+ N/A
+ 2427923.028202953
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10256.0","main.cluster index_upperinput":"10256.0"}
+ 10256
+ 16.4118
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=127&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 500.2253
+ N/A
+ 0.0
+ 500.2253
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.4108
+ 6
+ 0
+ Feature Node
+ N/A
+ 2460102.554366074
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4620.0","main.cluster index_upperinput":"4620.0"}
+ 4620
+ 16.4108
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1223
+ N/A
+ 0.0
+ 229.1223
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1139
+ 8
+ 0
+ Feature Node
+ N/A
+ 2524225.0256285584
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"57.0","main.cluster index_upperinput":"57.0"}
+ 57
+ 32.1139
+ -1
+ This Node is a Singleton
+ N/A
+ 427.3563
+ N/A
+ 0.0
+ 427.3563
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.3105
+ 7
+ 0
+ Feature Node
+ N/A
+ 9285442.773798835
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1391.0","main.cluster index_upperinput":"1391.0"}
+ 1391
+ 1.3105
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 396.2011
+ N/A
+ 0.0
+ 396.2011
+
+
+ 13
+ 0.8603639999999999
+ CCMSLIB00004693630
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693630
+ InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0.0
+ arctigenin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693630
+ 111
+ 1.25139
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002567
+ arctigenin
+ positive
+ MoNA:VF-NPL-QEHF002567
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4508.0","main.cluster index_upperinput":"4508.0"}
+ 1.25139
+ 3
+ N/A
+ MoNA
+ 3
+ 390.1915
+ CCMSLIB00004693630
+ 390.1915
+ 0.0
+ MoNA
+ 3887336.226240979
+ ESI-QFT
+ isolated
+ 0.00048828099999999997
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 19.4084
+ 4
+ 0.8603639999999999
+ 0.0
+ isolated
+ 4508
+ 0.00048828099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.4084
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5404
+ 1
+ 0
+ Feature Node
+ N/A
+ 1145383.3324139083
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7730.0","main.cluster index_upperinput":"7730.0"}
+ 7730
+ 16.5404
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 484.174
+ N/A
+ 0.0
+ 484.174
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7079
+ 7
+ 0
+ Feature Node
+ N/A
+ 5096993.468412326
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1207.0","main.cluster index_upperinput":"1207.0"}
+ 1207
+ 21.7079
+ -1
+ This Node is a Singleton
+ N/A
+ 266.1728
+ N/A
+ 0.0
+ 266.1728
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.197
+ 9
+ 0
+ Feature Node
+ N/A
+ 3243099.086908905
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5915.0","main.cluster index_upperinput":"5915.0"}
+ 5915
+ 25.197
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4004
+ 8
+ 0
+ Feature Node
+ N/A
+ 57031479.024112925
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1159.0","main.cluster index_upperinput":"1159.0"}
+ 1159
+ 33.4004
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 599.4273
+ N/A
+ 0.0
+ 599.4273
+
+
+ 10
+ 0.766576
+ CCMSLIB00006418726
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006418726
+ InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3
+ 0
+ Orbitrap
+ InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3
+ 0.0
+ Jaceosidin
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(O)=C(OC)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006418726
+ -1
+ 2.39656
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ BMDMS-NP
+ Jaceosidin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2489.0","main.cluster index_upperinput":"2489.0"}
+ 2.39656
+ 1
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(O)=C(OC)C3
+ BMDMS-NP
+ 1
+ 331.0812
+ CCMSLIB00006418726
+ 331.0812
+ 0.0
+ BMDMS-NP
+ 9611570.22542739
+ Orbitrap
+ Commercial standard
+ 0.000793457
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 20.4238
+ 7
+ 0.766576
+ 0.0
+ Commercial standard
+ 2489
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.4238
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.9277
+ 3
+ 0
+ Feature Node
+ N/A
+ 566383.8067679639
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10349.0","main.cluster index_upperinput":"10349.0"}
+ 10349
+ 20.9277
+ 1
+ This Node is a Singleton
+ N/A
+ 552.2796
+ N/A
+ 0.0
+ 552.2796
+
+
+ 9
+ 0.884036
+ CCMSLIB00003137888
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003137888
+ N/A
+ 0
+ Q-TOF
+ N/A
+ 0.0
+ Spectral Match to Malvidin 3-O-galactoside cation from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003137888
+ 172
+ 3.0323700000000002
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ Data deposited by daniel
+ Spectral Match to Malvidin 3-O-galactoside cation from NIST14
+ Positive
+ Data deposited by daniel
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4510.0","main.cluster index_upperinput":"4510.0"}
+ 3.0323700000000002
+ 3
+ N/A
+ Data from PC Dorrestein
+ 3
+ 493.1345
+ CCMSLIB00003137888
+ 493.1345
+ 0.0
+ Data from PC Dorrestein
+ 6638752.342707651
+ Q-TOF
+ Isolated
+ 0.00149536
+ Cat
+ N/A
+ ESI
+ Positive
+ 17.6698
+ 6
+ 0.884036
+ 0.0
+ Isolated
+ 4510
+ 0.00149536
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.6698
+ 0.0
+ Cat
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5151
+ 3
+ 0
+ Feature Node
+ N/A
+ 445656.0982643175
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7873.0","main.cluster index_upperinput":"7873.0"}
+ 7873
+ 16.5151
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.1617
+ N/A
+ 0.0
+ 430.1617
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.303
+ 2
+ 0
+ Feature Node
+ N/A
+ 1126883.1279707514
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10356.0","main.cluster index_upperinput":"10356.0"}
+ 10356
+ 10.303
+ -1
+ This Node is a Singleton
+ N/A
+ 483.2188
+ N/A
+ 0.0
+ 483.2188
+
+
+ 6
+ 0.8992
+ CCMSLIB00005738172
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738172
+ 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
+ 0
+ qTof
+ 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
+ 0.0
+ Massbank:RP019903 Dibutylphthalate|dibutyl phthalate|dibutyl benzene-1,2-dicarboxylate
+ CCCCOC(=O)c1ccccc1C(=O)OCCCC
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738172
+ 40
+ 0.327959
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP019903 Dibutylphthalate|dibutyl phthalate|dibutyl benzene-1,2-dicarboxylate
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3524.0","main.cluster index_upperinput":"3524.0"}
+ 0.327959
+ 3
+ CCCCOC(=O)c1ccccc1C(=O)OCCCC
+ Massbank
+ 3
+ 279.1589
+ CCMSLIB00005738172
+ 279.1589
+ 0.0
+ Massbank
+ 11569748.024358984
+ qTof
+ Isolated
+ 9.15527e-05
+ M+H
+ N/A
+ ESI
+ Positive
+ 27.137
+ 7
+ 0.8992
+ 0.0
+ Isolated
+ 3524
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=105&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 27.137
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.6217
+ 4
+ 0
+ Feature Node
+ N/A
+ 684873.1686872458
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5006.0","main.cluster index_upperinput":"5006.0"}
+ 5006
+ 20.6217
+ -1
+ This Node is a Singleton
+ N/A
+ 530.3538
+ N/A
+ 0.0
+ 530.3538
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1155
+ 4
+ 0
+ Feature Node
+ N/A
+ 2959397.4243693063
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"103.0","main.cluster index_upperinput":"103.0"}
+ 103
+ 23.1155
+ 12
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=9&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 376.2598
+ N/A
+ 0.0
+ 376.2598
+
+
+ 13
+ 0.715491
+ CCMSLIB00000847486
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847486
+ InChI=1S/C17H14O7/c1-22-14-7-13-15(16(21)17(14)23-2)11(20)6-12(24-13)8-3-4-9(18)10(19)5-8/h3-7,18-19,21H,1-2H3
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C17H14O7/c1-22-14-7-13-15(16(21)17(14)23-2)11(20)6-12(24-13)8-3-4-9(18)10(19)5-8/h3-7,18-19,21H,1-2H3
+ 0.0
+ NCGC00385220-01!2-(3,4-dihydroxyphenyl)-5-hydroxy-6,7-dimethoxychromen-4-one
+ COC1=C(OC)C(O)=C2C(=O)C=C(OC2=C1)C3=CC(O)=C(O)C=C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847486
+ -1
+ 0.9217559999999999
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00385220-01!2-(3,4-dihydroxyphenyl)-5-hydroxy-6,7-dimethoxychromen-4-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1177.0","main.cluster index_upperinput":"1177.0"}
+ 0.9217559999999999
+ 1
+ COC1=C(OC)C(O)=C2C(=O)C=C(OC2=C1)C3=CC(O)=C(O)C=C3
+ Jadhav/Dorrestein
+ 1
+ 331.0813
+ CCMSLIB00000847486
+ 331.0813
+ 0.0
+ Jadhav/Dorrestein
+ 4572197.215817441
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.000305176
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 20.0638
+ 5
+ 0.715491
+ 0.0
+ isolated
+ 1177
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.0638
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9206
+ 5
+ 0
+ Feature Node
+ N/A
+ 1024703.1543837361
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5276.0","main.cluster index_upperinput":"5276.0"}
+ 5276
+ 0.9206
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 408.2372
+ N/A
+ 0.0
+ 408.2372
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0463
+ 6
+ 0
+ Feature Node
+ N/A
+ 1173336.227682013
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13334.0","main.cluster index_upperinput":"13334.0"}
+ 13334
+ 19.0463
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 211.1315
+ N/A
+ 0.0
+ 211.1315
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.0729
+ 9
+ 0
+ Feature Node
+ N/A
+ 2886555.614122175
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1833.0","main.cluster index_upperinput":"1833.0"}
+ 1833
+ 20.0729
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 181.122
+ N/A
+ 0.0
+ 181.122
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.4055
+ 6
+ 0
+ Feature Node
+ N/A
+ 12981278.337961683
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13606.0","main.cluster index_upperinput":"13606.0"}
+ 13606
+ 14.4055
+ -1
+ This Node is a Singleton
+ N/A
+ 568.2389
+ N/A
+ 0.0
+ 568.2389
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6049
+ 7
+ 0
+ Feature Node
+ N/A
+ 8529090.995764965
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4518.0","main.cluster index_upperinput":"4518.0"}
+ 4518
+ 23.6049
+ -1
+ This Node is a Singleton
+ N/A
+ 353.2301
+ N/A
+ 0.0
+ 353.2301
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.0668
+ 7
+ 0
+ Feature Node
+ N/A
+ 2044598.3825406474
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1319.0","main.cluster index_upperinput":"1319.0"}
+ 1319
+ 21.0668
+ -1
+ This Node is a Singleton
+ N/A
+ 255.1581
+ N/A
+ 0.0
+ 255.1581
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.7667
+ 5
+ 0
+ Feature Node
+ N/A
+ 2921692.607312195
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1235.0","main.cluster index_upperinput":"1235.0"}
+ 1235
+ 15.7667
+ 207
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=43&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 270.0872
+ N/A
+ 0.0
+ 270.0872
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2542
+ 8
+ 0
+ Feature Node
+ N/A
+ 2661775.703572605
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5078.0","main.cluster index_upperinput":"5078.0"}
+ 5078
+ 23.2542
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8904
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.7556
+ 2
+ 0
+ Feature Node
+ N/A
+ 972431.3990810747
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4588.0","main.cluster index_upperinput":"4588.0"}
+ 4588
+ 10.7556
+ -1
+ This Node is a Singleton
+ N/A
+ 453.2376
+ N/A
+ 0.0
+ 453.2376
+
+
+ 101
+ 0.976131
+ CCMSLIB00004694670
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694670
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0.0
+ arctiin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694670
+ 111
+ 2.54201
+ Feature Node
+ N/A
+ 101
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF003607
+ arctiin
+ positive
+ MoNA:VF-NPL-QEHF003607
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4498.0","main.cluster index_upperinput":"4498.0"}
+ 2.54201
+ 3
+ N/A
+ MoNA
+ 3
+ 552.2454
+ CCMSLIB00004694670
+ 552.2454
+ 0.0
+ MoNA
+ 46467629.4673318
+ ESI-QFT
+ isolated
+ 0.00140381
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 16.4615
+ 4
+ 0.976131
+ 0.0
+ isolated
+ 4498
+ 0.00140381
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.4615
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8187
+ 3
+ 0
+ Feature Node
+ N/A
+ 1895828.1229498608
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1186.0","main.cluster index_upperinput":"1186.0"}
+ 1186
+ 16.8187
+ -1
+ This Node is a Singleton
+ N/A
+ 381.1306
+ N/A
+ 0.0
+ 381.1306
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.827
+ 6
+ 0
+ Feature Node
+ N/A
+ 4911036.320671199
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8111.0","main.cluster index_upperinput":"8111.0"}
+ 8111
+ 33.827
+ -1
+ This Node is a Singleton
+ N/A
+ 365.3029
+ N/A
+ 0.0
+ 365.3029
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.9819
+ 5
+ 0
+ Feature Node
+ N/A
+ 3450687.6425322527
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7658.0","main.cluster index_upperinput":"7658.0"}
+ 7658
+ 11.9819
+ 211
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 398.1814
+ N/A
+ 0.0
+ 398.1814
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.1778
+ 9
+ 0
+ Feature Node
+ N/A
+ 34548295.69235789
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1189.0","main.cluster index_upperinput":"1189.0"}
+ 1189
+ 29.1778
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 291.2313
+ N/A
+ 0.0
+ 291.2313
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0778
+ 9
+ 0
+ Feature Node
+ N/A
+ 9757540.602358224
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2632.0","main.cluster index_upperinput":"2632.0"}
+ 2632
+ 34.0778
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 377.3415
+ N/A
+ 0.0
+ 377.3415
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.04
+ 5
+ 0
+ Feature Node
+ N/A
+ 2616788.536023654
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4575.0","main.cluster index_upperinput":"4575.0"}
+ 4575
+ 11.04
+ 168
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 402.2276
+ N/A
+ 0.0
+ 402.2276
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.4199
+ 2
+ 0
+ Feature Node
+ N/A
+ 677199.3726923497
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7846.0","main.cluster index_upperinput":"7846.0"}
+ 7846
+ 3.4199
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=49&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 470.1949
+ N/A
+ 0.0
+ 470.1949
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4257
+ 8
+ 0
+ Feature Node
+ N/A
+ 2244039.5202071145
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"531.0","main.cluster index_upperinput":"531.0"}
+ 531
+ 26.4257
+ 213
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=92&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 223.0638
+ N/A
+ 0.0
+ 223.0638
+
+
+ 38
+ 0.832421
+ CCMSLIB00005467698
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+
+ 0
+ qTof
+
+ 0.0
+ Dihydroactinidiolide
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+ 5
+ 11.6261
+ Feature Node
+ N/A
+ 38
+ 0.0
+ 0.0
+ Armando Alcazar
+ Dihydroactinidiolide
+ Positive
+ Armando Alcazar
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1300.0","main.cluster index_upperinput":"1300.0"}
+ 11.6261
+ 3
+
+ Claudia Maier
+ 3
+ 181.1221
+ CCMSLIB00005467698
+ 181.1221
+ 0.0
+ Claudia Maier
+ 16136736.540062351
+ qTof
+ Isolated
+ 0.00210571
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 17.2973
+ 9
+ 0.832421
+ 0.0
+ Isolated
+ 1300
+ 0.00210571
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.2973
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.5694
+ 1
+ 0
+ Feature Node
+ N/A
+ 1349560.068288259
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7694.0","main.cluster index_upperinput":"7694.0"}
+ 7694
+ 20.5694
+ -1
+ This Node is a Singleton
+ N/A
+ 814.2617
+ N/A
+ 0.0
+ 814.2617
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7208
+ 9
+ 0
+ Feature Node
+ N/A
+ 965130.0282623894
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"249.0","main.cluster index_upperinput":"249.0"}
+ 249
+ 21.7208
+ -1
+ This Node is a Singleton
+ N/A
+ 199.1327
+ N/A
+ 0.0
+ 199.1327
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.8884
+ 3
+ 0
+ Feature Node
+ N/A
+ 4642998.235403888
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3901.0","main.cluster index_upperinput":"3901.0"}
+ 3901
+ 18.8884
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 520.2546
+ N/A
+ 0.0
+ 520.2546
+
+
+ 8
+ 0.794567
+ CCMSLIB00000078868
+ N/A
+ DI-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000078868
+ InChI=1S/C16H12O7/c1-22-16-14(21)13-11(20)5-8(17)6-12(13)23-15(16)7-2-3-9(18)10(19)4-7/h2-6,17-20H,1H3
+ 0
+ qTof
+ InChI=1S/C16H12O7/c1-22-16-14(21)13-11(20)5-8(17)6-12(13)23-15(16)7-2-3-9(18)10(19)4-7/h2-6,17-20H,1H3
+ 0.0
+ 3-O-methylquercetin
+ O=C1C2=C(O)C=C(O)C=C2OC(C3=CC(O)=C(O)C=C3)=C1OC
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000078868
+ 216
+ 2.2137599999999997
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Denise Silva
+ 3-O-methylquercetin
+ Positive
+ Denise Silva
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11911.0","main.cluster index_upperinput":"11911.0"}
+ 2.2137599999999997
+ 3
+ O=C1C2=C(O)C=C(O)C=C2OC(C3=CC(O)=C(O)C=C3)=C1OC
+ Norberto Lopes
+ 3
+ 317.0657
+ CCMSLIB00000078868
+ 317.0657
+ 0.0
+ Norberto Lopes
+ 1425651.660578889
+ qTof
+ Isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ DI-ESI
+ Positive
+ 20.8121
+ 9
+ 0.794567
+ 0.0
+ Isolated
+ 11911
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.8121
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.3776
+ 6
+ 0
+ Feature Node
+ N/A
+ 2651767.9711683844
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4603.0","main.cluster index_upperinput":"4603.0"}
+ 4603
+ 3.3776
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.2427
+ N/A
+ 0.0
+ 430.2427
+
+
+ 8
+ 0.789928
+ CCMSLIB00005716522
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005716522
+ N/A
+ 0
+ qTof
+ N/A
+ 0.0
+ KU002-14
+ OC1=CC(O)=C(C(CC(C2=CC=CC=C2)O3)=O)C3=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005716522
+ -1
+ 5.46059
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Oliver Gericke
+ KU002-14
+ Positive
+ Oliver Gericke
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"27.0","main.cluster index_upperinput":"27.0"}
+ 5.46059
+ 3
+ OC1=CC(O)=C(C(CC(C2=CC=CC=C2)O3)=O)C3=C1
+ Birger L. Moller
+ 3
+ 257.0814
+ CCMSLIB00005716522
+ 257.0814
+ 0.0
+ Birger L. Moller
+ 1487557.1272464946
+ qTof
+ Isolated
+ 0.00140381
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 17.716
+ 1
+ 0.789928
+ 0.0
+ Isolated
+ 27
+ 0.00140381
+ This Node is a Singleton
+ 17.716
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.9989
+ 9
+ 0
+ Feature Node
+ N/A
+ 10038028.835828776
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"129.0","main.cluster index_upperinput":"129.0"}
+ 129
+ 34.9989
+ -1
+ This Node is a Singleton
+ N/A
+ 885.3679
+ N/A
+ 0.0
+ 885.3679
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.5777
+ 5
+ 0
+ Feature Node
+ N/A
+ 1753561.8437012795
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7725.0","main.cluster index_upperinput":"7725.0"}
+ 7725
+ 9.5777
+ -1
+ This Node is a Singleton
+ N/A
+ 444.2191
+ N/A
+ 0.0
+ 444.2191
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.2481
+ 7
+ 0
+ Feature Node
+ N/A
+ 2351039.341284856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"87.0","main.cluster index_upperinput":"87.0"}
+ 87
+ 24.2481
+ -1
+ This Node is a Singleton
+ N/A
+ 277.1789
+ N/A
+ 0.0
+ 277.1789
+
+
+ 9
+ 0.8313159999999999
+ CCMSLIB00004693630
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693630
+ InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0.0
+ arctigenin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693630
+ 111
+ 0.782119
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002567
+ arctigenin
+ positive
+ MoNA:VF-NPL-QEHF002567
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2483.0","main.cluster index_upperinput":"2483.0"}
+ 0.782119
+ 3
+ N/A
+ MoNA
+ 3
+ 390.1913
+ CCMSLIB00004693630
+ 390.1913
+ 0.0
+ MoNA
+ 2068966.2681994417
+ ESI-QFT
+ isolated
+ 0.000305176
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 18.4807
+ 4
+ 0.8313159999999999
+ 0.0
+ isolated
+ 2483
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.4807
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.2349
+ 5
+ 0
+ Feature Node
+ N/A
+ 1044418.6908727069
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13829.0","main.cluster index_upperinput":"13829.0"}
+ 13829
+ 19.2349
+ -1
+ This Node is a Singleton
+ N/A
+ 470.296
+ N/A
+ 0.0
+ 470.296
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.3767
+ 4
+ 0
+ Feature Node
+ N/A
+ 303806.7589400092
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4652.0","main.cluster index_upperinput":"4652.0"}
+ 4652
+ 20.3767
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 337.1563
+ N/A
+ 0.0
+ 337.1563
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8076
+ 5
+ 0
+ Feature Node
+ N/A
+ 1336470.6128743745
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1360.0","main.cluster index_upperinput":"1360.0"}
+ 1360
+ 23.8076
+ -1
+ This Node is a Singleton
+ N/A
+ 172.1693
+ N/A
+ 0.0
+ 172.1693
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.4808
+ 2
+ 0
+ Feature Node
+ N/A
+ 3321596.794685386
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13664.0","main.cluster index_upperinput":"13664.0"}
+ 13664
+ 19.4808
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 722.3172
+ N/A
+ 0.0
+ 722.3172
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8362
+ 6
+ 0
+ Feature Node
+ N/A
+ 12197891.630365066
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1419.0","main.cluster index_upperinput":"1419.0"}
+ 1419
+ 32.8362
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 341.305
+ N/A
+ 0.0
+ 341.305
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.9772
+ 4
+ 0
+ Feature Node
+ N/A
+ 1124177.2160266032
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10336.0","main.cluster index_upperinput":"10336.0"}
+ 10336
+ 13.9772
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 510.2689
+ N/A
+ 0.0
+ 510.2689
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.1151
+ 5
+ 0
+ Feature Node
+ N/A
+ 6125625.494488411
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3535.0","main.cluster index_upperinput":"3535.0"}
+ 3535
+ 31.1151
+ -1
+ This Node is a Singleton
+ N/A
+ 433.3434
+ N/A
+ 0.0
+ 433.3434
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1537
+ 6
+ 0
+ Feature Node
+ N/A
+ 860713.9319732707
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2631.0","main.cluster index_upperinput":"2631.0"}
+ 2631
+ 26.1537
+ -1
+ This Node is a Singleton
+ N/A
+ 337.0748
+ N/A
+ 0.0
+ 337.0748
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.7108
+ 8
+ 0
+ Feature Node
+ N/A
+ 4218392.047961905
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11321.0","main.cluster index_upperinput":"11321.0"}
+ 11321
+ 24.7108
+ 10
+ This Node is a Singleton
+ N/A
+ 84.9453
+ N/A
+ 0.0
+ 84.9453
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5569
+ 8
+ 0
+ Feature Node
+ N/A
+ 14598339.191907197
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4517.0","main.cluster index_upperinput":"4517.0"}
+ 4517
+ 34.5569
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.1655
+ N/A
+ 0.0
+ 536.1655
+
+
+ 54
+ 0.864671
+ CCMSLIB00004718328
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718328
+ InChI=1S/C16H12O6/c1-21-9-4-2-8(3-5-9)12-6-10(17)14-13(22-12)7-11(18)15(19)16(14)20/h2-7,18-20H,1H3
+ 0
+ ESI-QTOF
+ InChI=1S/C16H12O6/c1-21-9-4-2-8(3-5-9)12-6-10(17)14-13(22-12)7-11(18)15(19)16(14)20/h2-7,18-20H,1H3
+ 0.0
+ Scutellarein 4'-methyl ether
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718328
+ 227
+ 1.72318
+ Feature Node
+ N/A
+ 54
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QTOF000757
+ Scutellarein 4'-methyl ether
+ positive
+ MoNA:VF-NPL-QTOF000757
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2498.0","main.cluster index_upperinput":"2498.0"}
+ 1.72318
+ 3
+ N/A
+ MoNA
+ 3
+ 301.0705
+ CCMSLIB00004718328
+ 301.0705
+ 0.0
+ MoNA
+ 54078584.63494246
+ ESI-QTOF
+ isolated
+ 0.000518799
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 20.2703
+ 9
+ 0.864671
+ 0.0
+ isolated
+ 2498
+ 0.000518799
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.2703
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.6504
+ 8
+ 0
+ Feature Node
+ N/A
+ 1748650.6649149412
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1369.0","main.cluster index_upperinput":"1369.0"}
+ 1369
+ 24.6504
+ -1
+ This Node is a Singleton
+ N/A
+ 283.1881
+ N/A
+ 0.0
+ 283.1881
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.7499
+ 7
+ 0
+ Feature Node
+ N/A
+ 1556463.735261962
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"18086.0","main.cluster index_upperinput":"18086.0"}
+ 18086
+ 7.7499
+ 21
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.2213
+ N/A
+ 0.0
+ 394.2213
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.192
+ 9
+ 0
+ Feature Node
+ N/A
+ 5288279.7183603095
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"329.0","main.cluster index_upperinput":"329.0"}
+ 329
+ 29.192
+ -1
+ This Node is a Singleton
+ N/A
+ 319.2245
+ N/A
+ 0.0
+ 319.2245
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6344
+ 7
+ 0
+ Feature Node
+ N/A
+ 2315924.0826394586
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"17228.0","main.cluster index_upperinput":"17228.0"}
+ 17228
+ 30.6344
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 481.3636
+ N/A
+ 0.0
+ 481.3636
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5837
+ 1
+ 0
+ Feature Node
+ N/A
+ 1097694.1046055048
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"44.0","main.cluster index_upperinput":"44.0"}
+ 44
+ 33.5837
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=175&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1175.8671
+ N/A
+ 0.0
+ 1175.8671
+
+
+ 7
+ 0.891589
+ CCMSLIB00003137888
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003137888
+ N/A
+ 0
+ Q-TOF
+ N/A
+ 0.0
+ Spectral Match to Malvidin 3-O-galactoside cation from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003137888
+ 172
+ 3.2799099999999997
+ Feature Node
+ N/A
+ 7
+ 0.0
+ 0.0
+ Data deposited by daniel
+ Spectral Match to Malvidin 3-O-galactoside cation from NIST14
+ Positive
+ Data deposited by daniel
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3525.0","main.cluster index_upperinput":"3525.0"}
+ 3.2799099999999997
+ 3
+ N/A
+ Data from PC Dorrestein
+ 3
+ 493.1346
+ CCMSLIB00003137888
+ 493.1346
+ 0.0
+ Data from PC Dorrestein
+ 3120782.551087007
+ Q-TOF
+ Isolated
+ 0.00161743
+ Cat
+ N/A
+ ESI
+ Positive
+ 16.7306
+ 6
+ 0.891589
+ 0.0
+ Isolated
+ 3525
+ 0.00161743
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.7306
+ 0.0
+ Cat
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.6924
+ 6
+ 0
+ Feature Node
+ N/A
+ 1206264.5178823522
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7741.0","main.cluster index_upperinput":"7741.0"}
+ 7741
+ 12.6924
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 480.2272
+ N/A
+ 0.0
+ 480.2272
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7309
+ 9
+ 0
+ Feature Node
+ N/A
+ 1054854.8050933594
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5190.0","main.cluster index_upperinput":"5190.0"}
+ 5190
+ 21.7309
+ -1
+ This Node is a Singleton
+ N/A
+ 277.1773
+ N/A
+ 0.0
+ 277.1773
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.3357
+ 6
+ 0
+ Feature Node
+ N/A
+ 352304.5993753013
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1286.0","main.cluster index_upperinput":"1286.0"}
+ 1286
+ 19.3357
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 521.1298
+ N/A
+ 0.0
+ 521.1298
+
+
+ 80
+ 0.815802
+ CCMSLIB00000076748
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000076748
+
+ 0
+ qTof
+
+ 0.0
+ Pheophorbide A
+ CCC1=C2C=C3C(=C4C(=O)C(C(=C5C(C(C(=N5)C=C6C(=C(C(=CC(=C1C)N2)N6)C=C)C)C)CCC(=O)O)C4=N3)C(=O)OC)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000076748
+ 115
+ 12.0369
+ Feature Node
+ N/A
+ 80
+ 0.0
+ 0.0
+ Jimmy Yi Zeng
+ Pheophorbide A
+ Positive
+ Jimmy Yi Zeng
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"302.0","main.cluster index_upperinput":"302.0"}
+ 12.0369
+ 3
+ CCC1=C2C=C3C(=C4C(=O)C(C(=C5C(C(C(=N5)C=C6C(=C(C(=CC(=C1C)N2)N6)C=C)C)C)CCC(=O)O)C4=N3)C(=O)OC)C
+ Pieter Dorrestein
+ 3
+ 593.2761
+ CCMSLIB00000076748
+ 593.2761
+ 0.0
+ Pieter Dorrestein
+ 144767210.4157913
+ qTof
+ Commercial
+ 0.00714111
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 34.5275
+ 8
+ 0.815802
+ 0.0
+ Commercial
+ 302
+ 0.00714111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=96&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.5275
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.0642
+ 8
+ 0
+ Feature Node
+ N/A
+ 9164586.195955452
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"37.0","main.cluster index_upperinput":"37.0"}
+ 37
+ 31.0642
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=150&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 654.3321
+ N/A
+ 0.0
+ 654.3321
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.9614
+ 9
+ 0
+ Feature Node
+ N/A
+ 3205062.25470956
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1228.0","main.cluster index_upperinput":"1228.0"}
+ 1228
+ 25.9614
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=41&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 161.0958
+ N/A
+ 0.0
+ 161.0958
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9756
+ 4
+ 0
+ Feature Node
+ N/A
+ 354250.45620691276
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3618.0","main.cluster index_upperinput":"3618.0"}
+ 3618
+ 19.9756
+ -1
+ This Node is a Singleton
+ N/A
+ 552.2798
+ N/A
+ 0.0
+ 552.2798
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.0642
+ 8
+ 0
+ Feature Node
+ N/A
+ 15770825.193772085
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14.0","main.cluster index_upperinput":"14.0"}
+ 14
+ 31.0642
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=150&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 637.3055
+ N/A
+ 0.0
+ 637.3055
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.1989
+ 3
+ 0
+ Feature Node
+ N/A
+ 9762208.555755744
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13656.0","main.cluster index_upperinput":"13656.0"}
+ 13656
+ 12.1989
+ -1
+ This Node is a Singleton
+ N/A
+ 547.2645
+ N/A
+ 0.0
+ 547.2645
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.3973
+ 6
+ 0
+ Feature Node
+ N/A
+ 3847155.892888145
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15800.0","main.cluster index_upperinput":"15800.0"}
+ 15800
+ 1.3973
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 428.2275
+ N/A
+ 0.0
+ 428.2275
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.0315
+ 5
+ 0
+ Feature Node
+ N/A
+ 1634160.9464120988
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7702.0","main.cluster index_upperinput":"7702.0"}
+ 7702
+ 12.0315
+ -1
+ This Node is a Singleton
+ N/A
+ 403.1373
+ N/A
+ 0.0
+ 403.1373
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6012
+ 6
+ 0
+ Feature Node
+ N/A
+ 2390512.5171179413
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4576.0","main.cluster index_upperinput":"4576.0"}
+ 4576
+ 23.6012
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 295.2262
+ N/A
+ 0.0
+ 295.2262
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.4642
+ 2
+ 0
+ Feature Node
+ N/A
+ 1395861.9891423066
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13809.0","main.cluster index_upperinput":"13809.0"}
+ 13809
+ 21.4642
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=42&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 474.2131
+ N/A
+ 0.0
+ 474.2131
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.7198
+ 7
+ 0
+ Feature Node
+ N/A
+ 1987223.7304709856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4109.0","main.cluster index_upperinput":"4109.0"}
+ 4109
+ 31.7198
+ -1
+ This Node is a Singleton
+ N/A
+ 501.3197
+ N/A
+ 0.0
+ 501.3197
+
+
+ 6
+ 0.8948440000000001
+ CCMSLIB00000852261
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852261
+ InChI=1S/C17H20O9/c1-25-13-6-9(2-4-10(13)18)3-5-14(21)26-15-11(19)7-17(24,16(22)23)8-12(15)20/h2-6,11-12,15,18-20,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,12-,15-,17+/m1/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C17H20O9/c1-25-13-6-9(2-4-10(13)18)3-5-14(21)26-15-11(19)7-17(24,16(22)23)8-12(15)20/h2-6,11-12,15,18-20,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,12-,15-,17+/m1/s1
+ 0.0
+ NCGC00380877-01_C17H20O9_Cyclohexanecarboxylic acid, 1,3,5-trihydroxy-4-[[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]oxy]-, (1alpha,3alpha,4alpha,5beta)-
+ COC1=CC(=CC=C1O)\\C=C\\C(=O)O[C@H]2[C@H](O)C[C@@](O)(C[C@H]2O)C(O)=O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852261
+ -1
+ 0.248031
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00380877-01_C17H20O9_Cyclohexanecarboxylic acid, 1,3,5-trihydroxy-4-[[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]oxy]-, (1alpha,3alpha,4alpha,5beta)-
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4826.0","main.cluster index_upperinput":"4826.0"}
+ 0.248031
+ 1
+ COC1=CC(=CC=C1O)\\C=C\\C(=O)O[C@H]2[C@H](O)C[C@@](O)(C[C@H]2O)C(O)=O
+ Jadhav/Dorrestein
+ 1
+ 369.1181
+ CCMSLIB00000852261
+ 369.1181
+ 0.0
+ Jadhav/Dorrestein
+ 3319893.205181988
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 9.15527e-05
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 8.992
+ 8
+ 0.8948440000000001
+ 0.0
+ isolated
+ 4826
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 8.992
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.3678
+ 9
+ 0
+ Feature Node
+ N/A
+ 3553656.36253803
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3530.0","main.cluster index_upperinput":"3530.0"}
+ 3530
+ 23.3678
+ 242
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 315.0866
+ N/A
+ 0.0
+ 315.0866
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.4163
+ 2
+ 0
+ Feature Node
+ N/A
+ 3567318.336654934
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7668.0","main.cluster index_upperinput":"7668.0"}
+ 7668
+ 9.4163
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=61&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.174
+ N/A
+ 0.0
+ 496.174
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8866
+ 6
+ 0
+ Feature Node
+ N/A
+ 6564444.393105616
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1382.0","main.cluster index_upperinput":"1382.0"}
+ 1382
+ 21.8866
+ -1
+ This Node is a Singleton
+ N/A
+ 351.2139
+ N/A
+ 0.0
+ 351.2139
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.0958
+ 4
+ 0
+ Feature Node
+ N/A
+ 5372080.866219682
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4655.0","main.cluster index_upperinput":"4655.0"}
+ 4655
+ 15.0958
+ 245
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 396.237
+ N/A
+ 0.0
+ 396.237
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.2142
+ 9
+ 0
+ Feature Node
+ N/A
+ 2186325.513152566
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2696.0","main.cluster index_upperinput":"2696.0"}
+ 2696
+ 35.2142
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=99&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 707.1713
+ N/A
+ 0.0
+ 707.1713
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.5367
+ 8
+ 0
+ Feature Node
+ N/A
+ 2615112.1738147116
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13778.0","main.cluster index_upperinput":"13778.0"}
+ 13778
+ 23.5367
+ -1
+ This Node is a Singleton
+ N/A
+ 331.1883
+ N/A
+ 0.0
+ 331.1883
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1164
+ 7
+ 0
+ Feature Node
+ N/A
+ 930880.9885549463
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4030.0","main.cluster index_upperinput":"4030.0"}
+ 4030
+ 19.1164
+ 117
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 380.2074
+ N/A
+ 0.0
+ 380.2074
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5694
+ 7
+ 0
+ Feature Node
+ N/A
+ 3130938.8455739846
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2625.0","main.cluster index_upperinput":"2625.0"}
+ 2625
+ 34.5694
+ -1
+ This Node is a Singleton
+ N/A
+ 484.3408
+ N/A
+ 0.0
+ 484.3408
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.9328
+ 6
+ 0
+ Feature Node
+ N/A
+ 33892970.87605588
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5815.0","main.cluster index_upperinput":"5815.0"}
+ 5815
+ 31.9328
+ -1
+ This Node is a Singleton
+ N/A
+ 353.2667
+ N/A
+ 0.0
+ 353.2667
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.9427
+ 8
+ 0
+ Feature Node
+ N/A
+ 3658521.8352699243
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11270.0","main.cluster index_upperinput":"11270.0"}
+ 11270
+ 25.9427
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9453
+ N/A
+ 0.0
+ 84.9453
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.691
+ 1
+ 0
+ Feature Node
+ N/A
+ 2236627.1010845983
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1174.0","main.cluster index_upperinput":"1174.0"}
+ 1174
+ 22.691
+ -1
+ This Node is a Singleton
+ N/A
+ 381.095
+ N/A
+ 0.0
+ 381.095
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.1269
+ 5
+ 0
+ Feature Node
+ N/A
+ 12748434.123675829
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2214.0","main.cluster index_upperinput":"2214.0"}
+ 2214
+ 17.1269
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.2229
+ N/A
+ 0.0
+ 430.2229
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.3128
+ 9
+ 0
+ Feature Node
+ N/A
+ 12610522.671565061
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1787.0","main.cluster index_upperinput":"1787.0"}
+ 1787
+ 29.3128
+ 89
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 518.3247
+ N/A
+ 0.0
+ 518.3247
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1845
+ 6
+ 0
+ Feature Node
+ N/A
+ 7576164.772631672
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1222.0","main.cluster index_upperinput":"1222.0"}
+ 1222
+ 16.1845
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.2223
+ N/A
+ 0.0
+ 430.2223
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.5103
+ 3
+ 0
+ Feature Node
+ N/A
+ 350217.32293116965
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7922.0","main.cluster index_upperinput":"7922.0"}
+ 7922
+ 12.5103
+ 168
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 484.2289
+ N/A
+ 0.0
+ 484.2289
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.1446
+ 4
+ 0
+ Feature Node
+ N/A
+ 670894.2988872246
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2544.0","main.cluster index_upperinput":"2544.0"}
+ 2544
+ 21.1446
+ 1
+ This Node is a Singleton
+ N/A
+ 524.2851
+ N/A
+ 0.0
+ 524.2851
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.6027
+ 1
+ 0
+ Feature Node
+ N/A
+ 13904379.93812854
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13602.0","main.cluster index_upperinput":"13602.0"}
+ 13602
+ 14.6027
+ 1
+ This Node is a Singleton
+ N/A
+ 446.2171
+ N/A
+ 0.0
+ 446.2171
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.0419
+ 3
+ 0
+ Feature Node
+ N/A
+ 2000194.232098279
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7835.0","main.cluster index_upperinput":"7835.0"}
+ 7835
+ 16.0419
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 512.2275
+ N/A
+ 0.0
+ 512.2275
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.028
+ 8
+ 0
+ Feature Node
+ N/A
+ 3558330.4142912035
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11346.0","main.cluster index_upperinput":"11346.0"}
+ 11346
+ 26.028
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9454
+ N/A
+ 0.0
+ 84.9454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.5402
+ 4
+ 0
+ Feature Node
+ N/A
+ 781710.3130786241
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10319.0","main.cluster index_upperinput":"10319.0"}
+ 10319
+ 20.5402
+ -1
+ This Node is a Singleton
+ N/A
+ 445.1838
+ N/A
+ 0.0
+ 445.1838
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1257
+ 8
+ 0
+ Feature Node
+ N/A
+ 3141622.281925241
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1687.0","main.cluster index_upperinput":"1687.0"}
+ 1687
+ 32.1257
+ -1
+ This Node is a Singleton
+ N/A
+ 331.2613
+ N/A
+ 0.0
+ 331.2613
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.4675
+ 7
+ 0
+ Feature Node
+ N/A
+ 2681399.343616149
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3743.0","main.cluster index_upperinput":"3743.0"}
+ 3743
+ 2.4675
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 326.1957
+ N/A
+ 0.0
+ 326.1957
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.9885
+ 5
+ 0
+ Feature Node
+ N/A
+ 2322328.6485726214
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5505.0","main.cluster index_upperinput":"5505.0"}
+ 5505
+ 11.9885
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=164&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 540.2795
+ N/A
+ 0.0
+ 540.2795
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.1856
+ 4
+ 0
+ Feature Node
+ N/A
+ 1381143.160632182
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13837.0","main.cluster index_upperinput":"13837.0"}
+ 13837
+ 18.1856
+ 171
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=18&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 584.2754
+ N/A
+ 0.0
+ 584.2754
+
+
+ 8
+ 0.841784
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 56
+ 1.31576
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"31.0","main.cluster index_upperinput":"31.0"}
+ 1.31576
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1015
+ CCMSLIB00003136238
+ 371.1015
+ 0.0
+ Data from Maria Maansson
+ 4809804.698145876
+ QQQ
+ Isolated
+ 0.00048828099999999997
+ M+H
+ N/A
+ ESI
+ Positive
+ 34.5922
+ 5
+ 0.841784
+ 0.0
+ Isolated
+ 31
+ 0.00048828099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.5922
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.7712
+ 6
+ 0
+ Feature Node
+ N/A
+ 470170.70136298524
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1434.0","main.cluster index_upperinput":"1434.0"}
+ 1434
+ 11.7712
+ -1
+ This Node is a Singleton
+ N/A
+ 289.1409
+ N/A
+ 0.0
+ 289.1409
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.2445
+ 6
+ 0
+ Feature Node
+ N/A
+ 8098510.334287436
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"259.0","main.cluster index_upperinput":"259.0"}
+ 259
+ 35.2445
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 702.2132
+ N/A
+ 0.0
+ 702.2132
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.1601
+ 1
+ 0
+ Feature Node
+ N/A
+ 2215797.2822535527
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7643.0","main.cluster index_upperinput":"7643.0"}
+ 7643
+ 32.1601
+ 211
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 636.4122
+ N/A
+ 0.0
+ 636.4122
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.7398
+ 7
+ 0
+ Feature Node
+ N/A
+ 105786815.56628117
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2651.0","main.cluster index_upperinput":"2651.0"}
+ 2651
+ 6.7398
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 380.2067
+ N/A
+ 0.0
+ 380.2067
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.5249
+ 3
+ 0
+ Feature Node
+ N/A
+ 10764799.246633206
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3522.0","main.cluster index_upperinput":"3522.0"}
+ 3522
+ 32.5249
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 686.1834
+ N/A
+ 0.0
+ 686.1834
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.6667
+ 4
+ 0
+ Feature Node
+ N/A
+ 4549310.098325344
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2482.0","main.cluster index_upperinput":"2482.0"}
+ 2482
+ 18.6667
+ -1
+ This Node is a Singleton
+ N/A
+ 576.39
+ N/A
+ 0.0
+ 576.39
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.4805
+ 3
+ 0
+ Feature Node
+ N/A
+ 12217940.156033816
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13590.0","main.cluster index_upperinput":"13590.0"}
+ 13590
+ 11.4805
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2128
+ N/A
+ 0.0
+ 462.2128
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.7056
+ 7
+ 0
+ Feature Node
+ N/A
+ 588356.5194734614
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7852.0","main.cluster index_upperinput":"7852.0"}
+ 7852
+ 26.7056
+ -1
+ This Node is a Singleton
+ N/A
+ 315.1936
+ N/A
+ 0.0
+ 315.1936
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.9701
+ 4
+ 0
+ Feature Node
+ N/A
+ 862333.1281018631
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4634.0","main.cluster index_upperinput":"4634.0"}
+ 4634
+ 1.9701
+ -1
+ This Node is a Singleton
+ N/A
+ 323.1603
+ N/A
+ 0.0
+ 323.1603
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0337
+ 6
+ 0
+ Feature Node
+ N/A
+ 1737428.0924940114
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14168.0","main.cluster index_upperinput":"14168.0"}
+ 14168
+ 19.0337
+ 257
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=25&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 833.2988
+ N/A
+ 0.0
+ 833.2988
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7794
+ 7
+ 0
+ Feature Node
+ N/A
+ 573332.2140608191
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10359.0","main.cluster index_upperinput":"10359.0"}
+ 10359
+ 21.7794
+ -1
+ This Node is a Singleton
+ N/A
+ 409.2201
+ N/A
+ 0.0
+ 409.2201
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.2599
+ 8
+ 0
+ Feature Node
+ N/A
+ 2378280.0212073703
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"41.0","main.cluster index_upperinput":"41.0"}
+ 41
+ 26.2599
+ 259
+ This Node is a Singleton
+ N/A
+ 299.1619
+ N/A
+ 0.0
+ 299.1619
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.5986
+ 2
+ 0
+ Feature Node
+ N/A
+ 5041541.1889748955
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10255.0","main.cluster index_upperinput":"10255.0"}
+ 10255
+ 14.5986
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=52&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 506.2748
+ N/A
+ 0.0
+ 506.2748
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.3316
+ 2
+ 0
+ Feature Node
+ N/A
+ 3900009.431098058
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10.0","main.cluster index_upperinput":"10.0"}
+ 10
+ 34.3316
+ -1
+ This Node is a Singleton
+ N/A
+ 437.3598
+ N/A
+ 0.0
+ 437.3598
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2059
+ 9
+ 0
+ Feature Node
+ N/A
+ 6881443.897551997
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"246.0","main.cluster index_upperinput":"246.0"}
+ 246
+ 33.2059
+ -1
+ This Node is a Singleton
+ N/A
+ 301.2115
+ N/A
+ 0.0
+ 301.2115
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.992
+ 9
+ 0
+ Feature Node
+ N/A
+ 7510009.54347136
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"136.0","main.cluster index_upperinput":"136.0"}
+ 136
+ 34.992
+ -1
+ This Node is a Singleton
+ N/A
+ 907.3497
+ N/A
+ 0.0
+ 907.3497
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5236
+ 9
+ 0
+ Feature Node
+ N/A
+ 21315195.76021224
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1599.0","main.cluster index_upperinput":"1599.0"}
+ 1599
+ 33.5236
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 652.4989
+ N/A
+ 0.0
+ 652.4989
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.4041
+ 9
+ 0
+ Feature Node
+ N/A
+ 4893450.9975707345
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10266.0","main.cluster index_upperinput":"10266.0"}
+ 10266
+ 25.4041
+ -1
+ This Node is a Singleton
+ N/A
+ 367.2452
+ N/A
+ 0.0
+ 367.2452
+
+
+ 11
+ 0.726224
+ CCMSLIB00006406564
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006406564
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)
+ 0
+ Orbitrap
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)
+ 0.0
+ Moupinamide
+ O=C(C=CC1=CC=C(O)C(OC)=C1)NCCC2=CC=C(O)C=C2
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006406564
+ 265
+ 2.23437
+ Feature Node
+ N/A
+ 11
+ 0.0
+ 0.0
+ BMDMS-NP
+ Moupinamide
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4514.0","main.cluster index_upperinput":"4514.0"}
+ 2.23437
+ 1
+ O=C(C=CC1=CC=C(O)C(OC)=C1)NCCC2=CC=C(O)C=C2
+ BMDMS-NP
+ 1
+ 314.1393
+ CCMSLIB00006406564
+ 314.1393
+ 0.0
+ BMDMS-NP
+ 8670308.290850414
+ Orbitrap
+ Commercial standard
+ 0.0007019039999999999
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 16.8589
+ 4
+ 0.726224
+ 0.0
+ Commercial standard
+ 4514
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.8589
+ 0.0
+ [M+H]+
+
+
+ 14
+ 0.714264
+ CCMSLIB00005467698
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+
+ 0
+ qTof
+
+ 0.0
+ Dihydroactinidiolide
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+ 5
+ 12.1315
+ Feature Node
+ N/A
+ 14
+ 0.0
+ 0.0
+ Armando Alcazar
+ Dihydroactinidiolide
+ Positive
+ Armando Alcazar
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9925.0","main.cluster index_upperinput":"9925.0"}
+ 12.1315
+ 3
+
+ Claudia Maier
+ 3
+ 181.1222
+ CCMSLIB00005467698
+ 181.1222
+ 0.0
+ Claudia Maier
+ 2252821.665392649
+ qTof
+ Isolated
+ 0.00219727
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 17.2233
+ 7
+ 0.714264
+ 0.0
+ Isolated
+ 9925
+ 0.00219727
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.2233
+ 0.0
+ M+H
+
+
+ 14
+ 0.716589
+ CCMSLIB00003138418
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138418
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to Monolinolenin (9c,12c,15c) from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138418
+ 5
+ 5.44233
+ Feature Node
+ N/A
+ 14
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Monolinolenin (9c,12c,15c) from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5818.0","main.cluster index_upperinput":"5818.0"}
+ 5.44233
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 353.2671
+ CCMSLIB00003138418
+ 353.2671
+ 0.0
+ Data from Wolfender/Litaudon
+ 10771480.543452308
+ HCD
+ Isolated
+ 0.00192261
+ M+H
+ N/A
+ ESI
+ Positive
+ 29.4981
+ 8
+ 0.716589
+ 0.0
+ Isolated
+ 5818
+ 0.00192261
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 29.4981
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9292
+ 2
+ 0
+ Feature Node
+ N/A
+ 1583678.248769511
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4567.0","main.cluster index_upperinput":"4567.0"}
+ 4567
+ 19.9292
+ 1
+ This Node is a Singleton
+ N/A
+ 540.2798
+ N/A
+ 0.0
+ 540.2798
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.0195
+ 9
+ 0
+ Feature Node
+ N/A
+ 6287067.017692467
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1610.0","main.cluster index_upperinput":"1610.0"}
+ 1610
+ 33.0195
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 626.4835
+ N/A
+ 0.0
+ 626.4835
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.6129
+ 8
+ 0
+ Feature Node
+ N/A
+ 5402568.6686104555
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7706.0","main.cluster index_upperinput":"7706.0"}
+ 7706
+ 22.6129
+ -1
+ This Node is a Singleton
+ N/A
+ 282.204
+ N/A
+ 0.0
+ 282.204
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0075
+ 5
+ 0
+ Feature Node
+ N/A
+ 7569019.175678555
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4589.0","main.cluster index_upperinput":"4589.0"}
+ 4589
+ 18.0075
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1222
+ N/A
+ 0.0
+ 229.1222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5879
+ 9
+ 0
+ Feature Node
+ N/A
+ 8541511.101834888
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2666.0","main.cluster index_upperinput":"2666.0"}
+ 2666
+ 34.5879
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.3713
+ N/A
+ 0.0
+ 441.3713
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9778
+ 6
+ 0
+ Feature Node
+ N/A
+ 3822696.4967144346
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4738.0","main.cluster index_upperinput":"4738.0"}
+ 4738
+ 14.9778
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 393.1885
+ N/A
+ 0.0
+ 393.1885
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.2093
+ 4
+ 0
+ Feature Node
+ N/A
+ 1084427.6901699018
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4616.0","main.cluster index_upperinput":"4616.0"}
+ 4616
+ 14.2093
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=51&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 574.1935
+ N/A
+ 0.0
+ 574.1935
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.2665
+ 3
+ 0
+ Feature Node
+ N/A
+ 1062466.2480869093
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5666.0","main.cluster index_upperinput":"5666.0"}
+ 5666
+ 20.2665
+ -1
+ This Node is a Singleton
+ N/A
+ 443.1687
+ N/A
+ 0.0
+ 443.1687
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4955
+ 7
+ 0
+ Feature Node
+ N/A
+ 3448498.1034955047
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4218.0","main.cluster index_upperinput":"4218.0"}
+ 4218
+ 33.4955
+ -1
+ This Node is a Singleton
+ N/A
+ 363.287
+ N/A
+ 0.0
+ 363.287
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.8783
+ 7
+ 0
+ Feature Node
+ N/A
+ 5095427.912471893
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1361.0","main.cluster index_upperinput":"1361.0"}
+ 1361
+ 25.8783
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 500.3734
+ N/A
+ 0.0
+ 500.3734
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1241
+ 7
+ 0
+ Feature Node
+ N/A
+ 2736037.8002693173
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13772.0","main.cluster index_upperinput":"13772.0"}
+ 13772
+ 26.1241
+ -1
+ This Node is a Singleton
+ N/A
+ 553.2994
+ N/A
+ 0.0
+ 553.2994
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.622
+ 8
+ 0
+ Feature Node
+ N/A
+ 1645993.5578476528
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8068.0","main.cluster index_upperinput":"8068.0"}
+ 8068
+ 31.622
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 580.4426
+ N/A
+ 0.0
+ 580.4426
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.1518
+ 8
+ 0
+ Feature Node
+ N/A
+ 220214.97247516253
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4705.0","main.cluster index_upperinput":"4705.0"}
+ 4705
+ 27.1518
+ -1
+ This Node is a Singleton
+ N/A
+ 335.1277
+ N/A
+ 0.0
+ 335.1277
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.0297
+ 7
+ 0
+ Feature Node
+ N/A
+ 1586044.829852911
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7740.0","main.cluster index_upperinput":"7740.0"}
+ 7740
+ 24.0297
+ -1
+ This Node is a Singleton
+ N/A
+ 337.0685
+ N/A
+ 0.0
+ 337.0685
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.5538
+ 6
+ 0
+ Feature Node
+ N/A
+ 838234.0329333141
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"24963.0","main.cluster index_upperinput":"24963.0"}
+ 24963
+ 27.5538
+ -1
+ This Node is a Singleton
+ N/A
+ 529.3479
+ N/A
+ 0.0
+ 529.3479
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.7126
+ 4
+ 0
+ Feature Node
+ N/A
+ 805988.746828987
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10314.0","main.cluster index_upperinput":"10314.0"}
+ 10314
+ 18.7126
+ -1
+ This Node is a Singleton
+ N/A
+ 469.2054
+ N/A
+ 0.0
+ 469.2054
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.3555
+ 9
+ 0
+ Feature Node
+ N/A
+ 37369511.71004481
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1198.0","main.cluster index_upperinput":"1198.0"}
+ 1198
+ 30.3555
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 375.2507
+ N/A
+ 0.0
+ 375.2507
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.0213
+ 5
+ 0
+ Feature Node
+ N/A
+ 1759932.8981540177
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13740.0","main.cluster index_upperinput":"13740.0"}
+ 13740
+ 22.0213
+ -1
+ This Node is a Singleton
+ N/A
+ 626.2954
+ N/A
+ 0.0
+ 626.2954
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.5369
+ 5
+ 0
+ Feature Node
+ N/A
+ 458758.89998328313
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"386.0","main.cluster index_upperinput":"386.0"}
+ 386
+ 24.5369
+ 50
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 620.2914
+ N/A
+ 0.0
+ 620.2914
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.8494
+ 6
+ 0
+ Feature Node
+ N/A
+ 1711360.5135023564
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4611.0","main.cluster index_upperinput":"4611.0"}
+ 4611
+ 13.8494
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=51&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 590.1871
+ N/A
+ 0.0
+ 590.1871
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.98
+ 8
+ 0
+ Feature Node
+ N/A
+ 14619754.574562645
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2644.0","main.cluster index_upperinput":"2644.0"}
+ 2644
+ 28.98
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 694.4015
+ N/A
+ 0.0
+ 694.4015
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.2557
+ 7
+ 0
+ Feature Node
+ N/A
+ 145317727.82460308
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7664.0","main.cluster index_upperinput":"7664.0"}
+ 7664
+ 3.2557
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 378.1912
+ N/A
+ 0.0
+ 378.1912
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.598
+ 5
+ 0
+ Feature Node
+ N/A
+ 1423176.0678384684
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4581.0","main.cluster index_upperinput":"4581.0"}
+ 4581
+ 13.598
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 426.2477
+ N/A
+ 0.0
+ 426.2477
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.3168
+ 3
+ 0
+ Feature Node
+ N/A
+ 723148.2603504458
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7811.0","main.cluster index_upperinput":"7811.0"}
+ 7811
+ 15.3168
+ 1
+ This Node is a Singleton
+ N/A
+ 446.2162
+ N/A
+ 0.0
+ 446.2162
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.5763
+ 6
+ 0
+ Feature Node
+ N/A
+ 2041634.0674261255
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5217.0","main.cluster index_upperinput":"5217.0"}
+ 5217
+ 19.5763
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1221
+ N/A
+ 0.0
+ 229.1221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.0532
+ 1
+ 0
+ Feature Node
+ N/A
+ 2498268.618522216
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13728.0","main.cluster index_upperinput":"13728.0"}
+ 13728
+ 28.0532
+ -1
+ This Node is a Singleton
+ N/A
+ 921.4678
+ N/A
+ 0.0
+ 921.4678
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.7844
+ 3
+ 0
+ Feature Node
+ N/A
+ 1125518.806913342
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13850.0","main.cluster index_upperinput":"13850.0"}
+ 13850
+ 19.7844
+ -1
+ This Node is a Singleton
+ N/A
+ 530.3531
+ N/A
+ 0.0
+ 530.3531
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.748
+ 6
+ 0
+ Feature Node
+ N/A
+ 924937.1035848656
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3551.0","main.cluster index_upperinput":"3551.0"}
+ 3551
+ 10.748
+ 168
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 402.2279
+ N/A
+ 0.0
+ 402.2279
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.2429
+ 2
+ 0
+ Feature Node
+ N/A
+ 1077111.3249234953
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4571.0","main.cluster index_upperinput":"4571.0"}
+ 4571
+ 15.2429
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 581.1506
+ N/A
+ 0.0
+ 581.1506
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.6224
+ 5
+ 0
+ Feature Node
+ N/A
+ 1208667.0377397968
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4579.0","main.cluster index_upperinput":"4579.0"}
+ 4579
+ 19.6224
+ 189
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 287.0557
+ N/A
+ 0.0
+ 287.0557
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.2862
+ 6
+ 0
+ Feature Node
+ N/A
+ 630859.3180322277
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1269.0","main.cluster index_upperinput":"1269.0"}
+ 1269
+ 15.2862
+ -1
+ This Node is a Singleton
+ N/A
+ 433.183
+ N/A
+ 0.0
+ 433.183
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.5632
+ 2
+ 0
+ Feature Node
+ N/A
+ 982600.0517985214
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13890.0","main.cluster index_upperinput":"13890.0"}
+ 13890
+ 16.5632
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 514.2428
+ N/A
+ 0.0
+ 514.2428
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.8985
+ 4
+ 0
+ Feature Node
+ N/A
+ 3955427.8862255495
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7648.0","main.cluster index_upperinput":"7648.0"}
+ 7648
+ 1.8985
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.2182
+ N/A
+ 0.0
+ 496.2182
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.1465
+ 9
+ 0
+ Feature Node
+ N/A
+ 3556689.0939797275
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5997.0","main.cluster index_upperinput":"5997.0"}
+ 5997
+ 25.1465
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.3597
+ 7
+ 0
+ Feature Node
+ N/A
+ 491199.1512686255
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8188.0","main.cluster index_upperinput":"8188.0"}
+ 8188
+ 35.3597
+ -1
+ This Node is a Singleton
+ N/A
+ 443.3879
+ N/A
+ 0.0
+ 443.3879
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.1051
+ 5
+ 0
+ Feature Node
+ N/A
+ 31034694.91166747
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13592.0","main.cluster index_upperinput":"13592.0"}
+ 13592
+ 15.1051
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 428.2066
+ N/A
+ 0.0
+ 428.2066
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.1473
+ 5
+ 0
+ Feature Node
+ N/A
+ 2641415.507361026
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10265.0","main.cluster index_upperinput":"10265.0"}
+ 10265
+ 13.1473
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 424.232
+ N/A
+ 0.0
+ 424.232
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.602
+ 6
+ 0
+ Feature Node
+ N/A
+ 1463936.4035016228
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10432.0","main.cluster index_upperinput":"10432.0"}
+ 10432
+ 8.602
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 440.2278
+ N/A
+ 0.0
+ 440.2278
+
+
+ 13
+ 0.9145399999999999
+ CCMSLIB00005769981
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005769981
+ 1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3/t8-,10-,13-,15-/m0/s1
+ 0
+ Hybrid FT
+ 1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3/t8-,10-,13-,15-/m0/s1
+ 0.0
+ Massbank:NA003103 alpha-Santonin|Santonin|(3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione
+ C[C@H]1[C@@H]2CC[C@]3(C=CC(=O)C(=C3[C@H]2OC1=O)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005769981
+ -1
+ 2.4079900000000003
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ Massbank
+ Massbank:NA003103 alpha-Santonin|Santonin|(3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1160.0","main.cluster index_upperinput":"1160.0"}
+ 2.4079900000000003
+ 3
+ C[C@H]1[C@@H]2CC[C@]3(C=CC(=O)C(=C3[C@H]2OC1=O)C)C
+ Massbank
+ 3
+ 247.1324
+ CCMSLIB00005769981
+ 247.1324
+ 0.0
+ Massbank
+ 5635157.237140418
+ Hybrid FT
+ Isolated
+ 0.000595093
+ M+H
+ N/A
+ ESI
+ Positive
+ 15.8923
+ 9
+ 0.9145399999999999
+ 0.0
+ Isolated
+ 1160
+ 0.000595093
+ This Node is a Singleton
+ 15.8923
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.9576
+ 1
+ 0
+ Feature Node
+ N/A
+ 315771.90076120663
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8131.0","main.cluster index_upperinput":"8131.0"}
+ 8131
+ 3.9576
+ -1
+ This Node is a Singleton
+ N/A
+ 398.137
+ N/A
+ 0.0
+ 398.137
+
+
+ 6
+ 0.770708
+ CCMSLIB00006443171
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006443171
+ InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3
+ 0
+ Orbitrap
+ InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3
+ 0.0
+ Chrysosplenetin B
+ O=C1C(OC)=C(OC2=CC(OC)=C(OC)C(O)=C12)C=3C=CC(O)=C(OC)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006443171
+ -1
+ 5.53223
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ BMDMS-NP
+ Chrysosplenetin B
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13731.0","main.cluster index_upperinput":"13731.0"}
+ 5.53223
+ 1
+ O=C1C(OC)=C(OC2=CC(OC)=C(OC)C(O)=C12)C=3C=CC(O)=C(OC)C3
+ BMDMS-NP
+ 1
+ 375.1079
+ CCMSLIB00006443171
+ 375.1079
+ 0.0
+ BMDMS-NP
+ 1477855.7282944683
+ Orbitrap
+ Commercial standard
+ 0.0020751999999999997
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 22.025
+ 2
+ 0.770708
+ 0.0
+ Commercial standard
+ 13731
+ 0.0020751999999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 22.025
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.7865
+ 5
+ 0
+ Feature Node
+ N/A
+ 5634330.456239888
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1580.0","main.cluster index_upperinput":"1580.0"}
+ 1580
+ 32.7865
+ 5
+ This Node is a Singleton
+ N/A
+ 613.4819
+ N/A
+ 0.0
+ 613.4819
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.4705
+ 2
+ 0
+ Feature Node
+ N/A
+ 697665.1706903478
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13805.0","main.cluster index_upperinput":"13805.0"}
+ 13805
+ 24.4705
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=111&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 222.1849
+ N/A
+ 0.0
+ 222.1849
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.8687
+ 6
+ 0
+ Feature Node
+ N/A
+ 777952.9862427624
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4452.0","main.cluster index_upperinput":"4452.0"}
+ 4452
+ 3.8687
+ 1
+ This Node is a Singleton
+ N/A
+ 442.2429
+ N/A
+ 0.0
+ 442.2429
+
+
+ 28
+ 0.780854
+ CCMSLIB00003136883
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136883
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to Monobehenin from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136883
+ 5
+ 40.5502
+ Feature Node
+ N/A
+ 28
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Monobehenin from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11.0","main.cluster index_upperinput":"11.0"}
+ 40.5502
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 397.3821
+ CCMSLIB00003136883
+ 397.3821
+ 0.0
+ Data from Wolfender/Litaudon
+ 6309755.94232601
+ HCD
+ Isolated
+ 0.016113299999999997
+ M+H-H2O
+ N/A
+ ESI
+ Positive
+ 33.6281
+ 5
+ 0.780854
+ 0.0
+ Isolated
+ 11
+ 0.016113299999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 33.6281
+ 0.0
+ M+H-H2O
+
+
+ 13
+ 0.7867149999999999
+ CCMSLIB00006388888
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006388888
+ InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3
+ 0
+ Orbitrap
+ InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3
+ 0.0
+ 5,7-dihydroxy-6-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=CC3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006388888
+ 242
+ 12.0098
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ BMDMS-NP
+ 5,7-dihydroxy-6-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5042.0","main.cluster index_upperinput":"5042.0"}
+ 12.0098
+ 1
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=CC3
+ BMDMS-NP
+ 1
+ 315.0862
+ CCMSLIB00006388888
+ 315.0862
+ 0.0
+ BMDMS-NP
+ 11875395.741594443
+ Orbitrap
+ Commercial standard
+ 0.00378418
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 24.0569
+ 9
+ 0.7867149999999999
+ 0.0
+ Commercial standard
+ 5042
+ 0.00378418
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 24.0569
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4006
+ 9
+ 0
+ Feature Node
+ N/A
+ 4806965.936633
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"39.0","main.cluster index_upperinput":"39.0"}
+ 39
+ 33.4006
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 702.2131
+ N/A
+ 0.0
+ 702.2131
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.5538
+ 8
+ 0
+ Feature Node
+ N/A
+ 25210151.04134559
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1255.0","main.cluster index_upperinput":"1255.0"}
+ 1255
+ 1.5538
+ 290
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=185&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 310.1285
+ N/A
+ 0.0
+ 310.1285
+
+
+ 64
+ 0.79115
+ CCMSLIB00004692320
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692320
+ InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9-
+ 0
+ ESI-QFT
+ InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9-
+ 0.0
+ monolinolein
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692320
+ 5
+ 2.2333
+ Feature Node
+ N/A
+ 64
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF001257
+ monolinolein
+ positive
+ MoNA:VF-NPL-QEHF001257
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1547.0","main.cluster index_upperinput":"1547.0"}
+ 2.2333
+ 3
+ N/A
+ MoNA
+ 3
+ 355.2832
+ CCMSLIB00004692320
+ 355.2832
+ 0.0
+ MoNA
+ 23338089.313483216
+ ESI-QFT
+ isolated
+ 0.000793457
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 31.2734
+ 8
+ 0.79115
+ 0.0
+ isolated
+ 1547
+ 0.000793457
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.2734
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.9898
+ 6
+ 0
+ Feature Node
+ N/A
+ 9472291.486647518
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13626.0","main.cluster index_upperinput":"13626.0"}
+ 13626
+ 29.9898
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 309.2415
+ N/A
+ 0.0
+ 309.2415
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4763
+ 8
+ 0
+ Feature Node
+ N/A
+ 449950.911581177
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4047.0","main.cluster index_upperinput":"4047.0"}
+ 4047
+ 26.4763
+ -1
+ This Node is a Singleton
+ N/A
+ 203.1791
+ N/A
+ 0.0
+ 203.1791
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.2966
+ 7
+ 0
+ Feature Node
+ N/A
+ 15309332.431120673
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2573.0","main.cluster index_upperinput":"2573.0"}
+ 2573
+ 32.2966
+ 115
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=29&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 609.2716
+ N/A
+ 0.0
+ 609.2716
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9602
+ 2
+ 0
+ Feature Node
+ N/A
+ 3765032.2483169576
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10240.0","main.cluster index_upperinput":"10240.0"}
+ 10240
+ 19.9602
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 544.2756
+ N/A
+ 0.0
+ 544.2756
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.701
+ 8
+ 0
+ Feature Node
+ N/A
+ 2793297.1361398483
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1301.0","main.cluster index_upperinput":"1301.0"}
+ 1301
+ 23.701
+ -1
+ This Node is a Singleton
+ N/A
+ 277.1784
+ N/A
+ 0.0
+ 277.1784
+
+
+ 6
+ 0.835441
+ CCMSLIB00005745975
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745975
+ 1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1
+ 0
+ qTof
+ 1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1
+ 0.0
+ Massbank:PR303098 Petunidin-3-O-beta-glucoside
+ COC1=CC(=CC(O)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C2C(O)=CC(O)=CC2=[O+]1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745975
+ 13
+ 0.254781
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303098 Petunidin-3-O-beta-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2842.0","main.cluster index_upperinput":"2842.0"}
+ 0.254781
+ 3
+ COC1=CC(=CC(O)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C2C(O)=CC(O)=CC2=[O+]1
+ Massbank
+ 3
+ 479.1179
+ CCMSLIB00005745975
+ 479.1179
+ 0.0
+ Massbank
+ 5842490.873495759
+ qTof
+ Isolated
+ 0.00012207
+ M
+ N/A
+ ESI
+ Positive
+ 15.3975
+ 7
+ 0.835441
+ 0.0
+ Isolated
+ 2842
+ 0.00012207
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.3975
+ 0.0
+ M
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6356
+ 7
+ 0
+ Feature Node
+ N/A
+ 561717.5147988731
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"398.0","main.cluster index_upperinput":"398.0"}
+ 398
+ 23.6356
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 240.0684
+ N/A
+ 0.0
+ 240.0684
+
+
+ 8
+ 0.96452
+ CCMSLIB00003138795
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138795
+ N/A
+ 0
+ Q-TOF
+ N/A
+ 0.0
+ Spectral Match to 1-Hexadecanoyl-2-octadecadienoyl-sn-glycero-3-phosphocholine from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138795
+ 89
+ 0.563226
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Data deposited by fevargas
+ Spectral Match to 1-Hexadecanoyl-2-octadecadienoyl-sn-glycero-3-phosphocholine from NIST14
+ Positive
+ Data deposited by fevargas
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1169.0","main.cluster index_upperinput":"1169.0"}
+ 0.563226
+ 3
+ N/A
+ Data from Kevin Bush
+ 3
+ 758.5694
+ CCMSLIB00003138795
+ 758.5694
+ 0.0
+ Data from Kevin Bush
+ 14429564.74490955
+ Q-TOF
+ Isolated
+ 0.000427246
+ M+H
+ N/A
+ ESI
+ Positive
+ 34.6916
+ 6
+ 0.96452
+ 0.0
+ Isolated
+ 1169
+ 0.000427246
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.6916
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.577
+ 3
+ 0
+ Feature Node
+ N/A
+ 732298.0108258808
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8579.0","main.cluster index_upperinput":"8579.0"}
+ 8579
+ 35.577
+ -1
+ This Node is a Singleton
+ N/A
+ 469.366
+ N/A
+ 0.0
+ 469.366
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.3181
+ 9
+ 0
+ Feature Node
+ N/A
+ 10643244.294594727
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5846.0","main.cluster index_upperinput":"5846.0"}
+ 5846
+ 21.3181
+ 10
+ This Node is a Singleton
+ N/A
+ 128.9514
+ N/A
+ 0.0
+ 128.9514
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.8329
+ 2
+ 0
+ Feature Node
+ N/A
+ 773527.8561918916
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14016.0","main.cluster index_upperinput":"14016.0"}
+ 14016
+ 17.8329
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.167
+ N/A
+ 0.0
+ 607.167
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.266
+ 9
+ 0
+ Feature Node
+ N/A
+ 55245058.0205451
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1202.0","main.cluster index_upperinput":"1202.0"}
+ 1202
+ 31.266
+ -1
+ This Node is a Singleton
+ N/A
+ 377.2666
+ N/A
+ 0.0
+ 377.2666
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.7493
+ 2
+ 0
+ Feature Node
+ N/A
+ 1464633.9558323517
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7724.0","main.cluster index_upperinput":"7724.0"}
+ 7724
+ 14.7493
+ 60
+ This Node is a Singleton
+ N/A
+ 564.2006
+ N/A
+ 0.0
+ 564.2006
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.7725
+ 7
+ 0
+ Feature Node
+ N/A
+ 7460217.255533516
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"73.0","main.cluster index_upperinput":"73.0"}
+ 73
+ 30.7725
+ 89
+ This Node is a Singleton
+ N/A
+ 754.5436
+ N/A
+ 0.0
+ 754.5436
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.2462
+ 6
+ 0
+ Feature Node
+ N/A
+ 2319406.6825632127
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1210.0","main.cluster index_upperinput":"1210.0"}
+ 1210
+ 32.2462
+ -1
+ This Node is a Singleton
+ N/A
+ 347.2561
+ N/A
+ 0.0
+ 347.2561
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.1079
+ 3
+ 0
+ Feature Node
+ N/A
+ 1287900.2525224832
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1348.0","main.cluster index_upperinput":"1348.0"}
+ 1348
+ 12.1079
+ -1
+ This Node is a Singleton
+ N/A
+ 451.194
+ N/A
+ 0.0
+ 451.194
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.938
+ 4
+ 0
+ Feature Node
+ N/A
+ 1084285.5748550957
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1273.0","main.cluster index_upperinput":"1273.0"}
+ 1273
+ 10.938
+ -1
+ This Node is a Singleton
+ N/A
+ 451.1935
+ N/A
+ 0.0
+ 451.1935
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.7143
+ 2
+ 0
+ Feature Node
+ N/A
+ 504022.2215230646
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4613.0","main.cluster index_upperinput":"4613.0"}
+ 4613
+ 15.7143
+ -1
+ This Node is a Singleton
+ N/A
+ 437.242
+ N/A
+ 0.0
+ 437.242
+
+
+ 21
+ 0.901824
+ CCMSLIB00006444022
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006444022
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3
+ 0
+ Orbitrap
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3
+ 0.0
+ Eupatorin
+ O=C1C=C(OC=2C=C(OC)C(OC)=C(O)C12)C=3C=CC(OC)=C(O)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006444022
+ -1
+ 7.51664
+ Feature Node
+ N/A
+ 21
+ 0.0
+ 0.0
+ BMDMS-NP
+ Eupatorin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1163.0","main.cluster index_upperinput":"1163.0"}
+ 7.51664
+ 1
+ O=C1C=C(OC=2C=C(OC)C(OC)=C(O)C12)C=3C=CC(OC)=C(O)C3
+ BMDMS-NP
+ 1
+ 345.0974
+ CCMSLIB00006444022
+ 345.0974
+ 0.0
+ BMDMS-NP
+ 5325521.054104207
+ Orbitrap
+ Commercial standard
+ 0.00259399
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 21.4952
+ 7
+ 0.901824
+ 0.0
+ Commercial standard
+ 1163
+ 0.00259399
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.4952
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.0886
+ 4
+ 0
+ Feature Node
+ N/A
+ 2536959.7966410457
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4625.0","main.cluster index_upperinput":"4625.0"}
+ 4625
+ 14.0886
+ -1
+ This Node is a Singleton
+ N/A
+ 284.1852
+ N/A
+ 0.0
+ 284.1852
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8763
+ 6
+ 0
+ Feature Node
+ N/A
+ 7126549.184635905
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4516.0","main.cluster index_upperinput":"4516.0"}
+ 4516
+ 16.8763
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 463.1228
+ N/A
+ 0.0
+ 463.1228
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8385
+ 8
+ 0
+ Feature Node
+ N/A
+ 40017536.18780566
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2526.0","main.cluster index_upperinput":"2526.0"}
+ 2526
+ 32.8385
+ 115
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=29&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 609.2714
+ N/A
+ 0.0
+ 609.2714
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.1062
+ 2
+ 0
+ Feature Node
+ N/A
+ 1140610.7665840336
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13781.0","main.cluster index_upperinput":"13781.0"}
+ 13781
+ 18.1062
+ -1
+ This Node is a Singleton
+ N/A
+ 414.1913
+ N/A
+ 0.0
+ 414.1913
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.8224
+ 5
+ 0
+ Feature Node
+ N/A
+ 1736656.1667164166
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1303.0","main.cluster index_upperinput":"1303.0"}
+ 1303
+ 22.8224
+ -1
+ This Node is a Singleton
+ N/A
+ 290.2688
+ N/A
+ 0.0
+ 290.2688
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.118
+ 5
+ 0
+ Feature Node
+ N/A
+ 12922761.737362226
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5160.0","main.cluster index_upperinput":"5160.0"}
+ 5160
+ 35.118
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 702.2134
+ N/A
+ 0.0
+ 702.2134
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.5601
+ 9
+ 0
+ Feature Node
+ N/A
+ 3444341.0405529384
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5874.0","main.cluster index_upperinput":"5874.0"}
+ 5874
+ 24.5601
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.7681
+ 2
+ 0
+ Feature Node
+ N/A
+ 1785260.3821190032
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13707.0","main.cluster index_upperinput":"13707.0"}
+ 13707
+ 25.7681
+ -1
+ This Node is a Singleton
+ N/A
+ 578.405
+ N/A
+ 0.0
+ 578.405
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.8535
+ 4
+ 0
+ Feature Node
+ N/A
+ 4105685.4145382615
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13616.0","main.cluster index_upperinput":"13616.0"}
+ 13616
+ 31.8535
+ -1
+ This Node is a Singleton
+ N/A
+ 449.3277
+ N/A
+ 0.0
+ 449.3277
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5089
+ 8
+ 0
+ Feature Node
+ N/A
+ 94506636.82947218
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9385.0","main.cluster index_upperinput":"9385.0"}
+ 9385
+ 34.5089
+ 41
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 343.339
+ N/A
+ 0.0
+ 343.339
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4826
+ 8
+ 0
+ Feature Node
+ N/A
+ 4292941.029834525
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7803.0","main.cluster index_upperinput":"7803.0"}
+ 7803
+ 33.4826
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=73&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3727
+ N/A
+ 0.0
+ 429.3727
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.1423
+ 4
+ 0
+ Feature Node
+ N/A
+ 233018.7407787448
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7928.0","main.cluster index_upperinput":"7928.0"}
+ 7928
+ 24.1423
+ -1
+ This Node is a Singleton
+ N/A
+ 531.2576
+ N/A
+ 0.0
+ 531.2576
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.717
+ 3
+ 0
+ Feature Node
+ N/A
+ 607252.2477815888
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4610.0","main.cluster index_upperinput":"4610.0"}
+ 4610
+ 11.717
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 671.1813
+ N/A
+ 0.0
+ 671.1813
+
+
+ 25
+ 0.9127639999999999
+ CCMSLIB00005747303
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005747303
+ 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
+ 0
+ qTof
+ 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
+ 0.0
+ Massbank:PR304003 Matairesinol
+ COC1=C(O)C=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005747303
+ 111
+ 0.849719
+ Feature Node
+ N/A
+ 25
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR304003 Matairesinol
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1165.0","main.cluster index_upperinput":"1165.0"}
+ 0.849719
+ 3
+ COC1=C(O)C=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)=C1
+ Massbank
+ 3
+ 359.1493
+ CCMSLIB00005747303
+ 359.1493
+ 0.0
+ Massbank
+ 4944585.622538391
+ qTof
+ Isolated
+ 0.000305176
+ M+H
+ N/A
+ ESI
+ Positive
+ 16.8198
+ 7
+ 0.9127639999999999
+ 0.0
+ Isolated
+ 1165
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.8198
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.1089
+ 6
+ 0
+ Feature Node
+ N/A
+ 2615103.016334719
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3752.0","main.cluster index_upperinput":"3752.0"}
+ 3752
+ 30.1089
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 259.205
+ N/A
+ 0.0
+ 259.205
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.574
+ 1
+ 0
+ Feature Node
+ N/A
+ 235242.08195911878
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10646.0","main.cluster index_upperinput":"10646.0"}
+ 10646
+ 21.574
+ -1
+ This Node is a Singleton
+ N/A
+ 446.2389
+ N/A
+ 0.0
+ 446.2389
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.0146
+ 3
+ 0
+ Feature Node
+ N/A
+ 3869365.9693508586
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4524.0","main.cluster index_upperinput":"4524.0"}
+ 4524
+ 16.0146
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.2323
+ N/A
+ 0.0
+ 412.2323
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6603
+ 8
+ 0
+ Feature Node
+ N/A
+ 12608022.748829301
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3400.0","main.cluster index_upperinput":"3400.0"}
+ 3400
+ 32.6603
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 379.2835
+ N/A
+ 0.0
+ 379.2835
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6717
+ 5
+ 0
+ Feature Node
+ N/A
+ 631514.8115012563
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10285.0","main.cluster index_upperinput":"10285.0"}
+ 10285
+ 32.6717
+ -1
+ This Node is a Singleton
+ N/A
+ 579.3509
+ N/A
+ 0.0
+ 579.3509
+
+
+ 6
+ 0.8458129999999999
+ CCMSLIB00000846805
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000846805
+ InChI=1S/C22H22O13/c1-32-20-10(26)2-7(3-11(20)27)19-21(16(29)14-9(25)4-8(24)5-12(14)33-19)35-22-18(31)17(30)15(28)13(6-23)34-22/h2-5,13,15,17-18,22-28,30-31H,6H2,1H3/t13-,15-,17+,18-,22+/m1/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C22H22O13/c1-32-20-10(26)2-7(3-11(20)27)19-21(16(29)14-9(25)4-8(24)5-12(14)33-19)35-22-18(31)17(30)15(28)13(6-23)34-22/h2-5,13,15,17-18,22-28,30-31H,6H2,1H3/t13-,15-,17+,18-,22+/m1/s1
+ 0.0
+ NCGC00385532-01!2-(3,5-dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+ COC1=C(O)C=C(C=C1O)C2=C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C(=O)C4=C(O)C=C(O)C=C4O2
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000846805
+ 312
+ 1.4176600000000001
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00385532-01!2-(3,5-dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4522.0","main.cluster index_upperinput":"4522.0"}
+ 1.4176600000000001
+ 1
+ COC1=C(O)C=C(C=C1O)C2=C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C(=O)C4=C(O)C=C(O)C=C4O2
+ Jadhav/Dorrestein
+ 1
+ 495.1137
+ CCMSLIB00000846805
+ 495.1137
+ 0.0
+ Jadhav/Dorrestein
+ 4479533.367906134
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 14.6014
+ 5
+ 0.8458129999999999
+ 0.0
+ isolated
+ 4522
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.6014
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.5776
+ 1
+ 0
+ Feature Node
+ N/A
+ 1058797.409177819
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7679.0","main.cluster index_upperinput":"7679.0"}
+ 7679
+ 19.5776
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 382.1867
+ N/A
+ 0.0
+ 382.1867
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.8634
+ 7
+ 0
+ Feature Node
+ N/A
+ 2055203.0081609879
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2931.0","main.cluster index_upperinput":"2931.0"}
+ 2931
+ 19.8634
+ 216
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 317.0658
+ N/A
+ 0.0
+ 317.0658
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.3024
+ 6
+ 0
+ Feature Node
+ N/A
+ 7844725.125524452
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3521.0","main.cluster index_upperinput":"3521.0"}
+ 3521
+ 33.3024
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 716.2294
+ N/A
+ 0.0
+ 716.2294
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.495
+ 9
+ 0
+ Feature Node
+ N/A
+ 28597136.092171587
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1192.0","main.cluster index_upperinput":"1192.0"}
+ 1192
+ 1.495
+ 65
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 120.0807
+ N/A
+ 0.0
+ 120.0807
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.7946
+ 7
+ 0
+ Feature Node
+ N/A
+ 3441386.0914561693
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7686.0","main.cluster index_upperinput":"7686.0"}
+ 7686
+ 33.7946
+ -1
+ This Node is a Singleton
+ N/A
+ 601.3722
+ N/A
+ 0.0
+ 601.3722
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9423
+ 3
+ 0
+ Feature Node
+ N/A
+ 750613.9973360753
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3545.0","main.cluster index_upperinput":"3545.0"}
+ 3545
+ 16.9423
+ 1
+ This Node is a Singleton
+ N/A
+ 520.2542
+ N/A
+ 0.0
+ 520.2542
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.2291
+ 3
+ 0
+ Feature Node
+ N/A
+ 546314.6723622666
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7892.0","main.cluster index_upperinput":"7892.0"}
+ 7892
+ 2.2291
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=49&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 460.1739
+ N/A
+ 0.0
+ 460.1739
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8906
+ 8
+ 0
+ Feature Node
+ N/A
+ 3046973.7429934265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11652.0","main.cluster index_upperinput":"11652.0"}
+ 11652
+ 21.8906
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8898
+ N/A
+ 0.0
+ 84.9449
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.8379
+ 6
+ 0
+ Feature Node
+ N/A
+ 3597814.05403459
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"23.0","main.cluster index_upperinput":"23.0"}
+ 23
+ 31.8379
+ -1
+ This Node is a Singleton
+ N/A
+ 629.4033
+ N/A
+ 0.0
+ 629.4033
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0297
+ 8
+ 0
+ Feature Node
+ N/A
+ 15972525.347046196
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1195.0","main.cluster index_upperinput":"1195.0"}
+ 1195
+ 34.0297
+ -1
+ This Node is a Singleton
+ N/A
+ 485.3604
+ N/A
+ 0.0
+ 485.3604
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.7826
+ 4
+ 0
+ Feature Node
+ N/A
+ 2800428.1668925975
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3543.0","main.cluster index_upperinput":"3543.0"}
+ 3543
+ 33.7826
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1099.6391
+ N/A
+ 0.0
+ 1099.6391
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.032
+ 1
+ 0
+ Feature Node
+ N/A
+ 322050.73485600174
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8261.0","main.cluster index_upperinput":"8261.0"}
+ 8261
+ 10.032
+ -1
+ This Node is a Singleton
+ N/A
+ 468.1784
+ N/A
+ 0.0
+ 468.1784
+
+
+ 22
+ 0.763972
+ CCMSLIB00005467698
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+
+ 0
+ qTof
+
+ 0.0
+ Dihydroactinidiolide
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+ 5
+ 8.84592
+ Feature Node
+ N/A
+ 22
+ 0.0
+ 0.0
+ Armando Alcazar
+ Dihydroactinidiolide
+ Positive
+ Armando Alcazar
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20624.0","main.cluster index_upperinput":"20624.0"}
+ 8.84592
+ 3
+
+ Claudia Maier
+ 3
+ 181.1216
+ CCMSLIB00005467698
+ 181.1216
+ 0.0
+ Claudia Maier
+ 2907944.289331866
+ qTof
+ Isolated
+ 0.00160217
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 18.3358
+ 7
+ 0.763972
+ 0.0
+ Isolated
+ 20624
+ 0.00160217
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.3358
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3408
+ 7
+ 0
+ Feature Node
+ N/A
+ 2621785.514080423
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11101.0","main.cluster index_upperinput":"11101.0"}
+ 11101
+ 26.3408
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9454
+ N/A
+ 0.0
+ 84.9454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.488
+ 9
+ 0
+ Feature Node
+ N/A
+ 7175450.208315823
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"19.0","main.cluster index_upperinput":"19.0"}
+ 19
+ 22.488
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 226.1803
+ N/A
+ 0.0
+ 226.1803
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.3709
+ 1
+ 0
+ Feature Node
+ N/A
+ 1418819.757994257
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7789.0","main.cluster index_upperinput":"7789.0"}
+ 7789
+ 14.3709
+ -1
+ This Node is a Singleton
+ N/A
+ 445.1476
+ N/A
+ 0.0
+ 445.1476
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.215
+ 5
+ 0
+ Feature Node
+ N/A
+ 2429545.266282058
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2516.0","main.cluster index_upperinput":"2516.0"}
+ 2516
+ 14.215
+ -1
+ This Node is a Singleton
+ N/A
+ 396.2016
+ N/A
+ 0.0
+ 396.2016
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.2507
+ 7
+ 0
+ Feature Node
+ N/A
+ 3550026.6921151914
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7691.0","main.cluster index_upperinput":"7691.0"}
+ 7691
+ 12.2507
+ -1
+ This Node is a Singleton
+ N/A
+ 399.1423
+ N/A
+ 0.0
+ 399.1423
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.8906
+ 5
+ 0
+ Feature Node
+ N/A
+ 10320111.223776337
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10427.0","main.cluster index_upperinput":"10427.0"}
+ 10427
+ 33.8906
+ -1
+ This Node is a Singleton
+ N/A
+ 485.3615
+ N/A
+ 0.0
+ 485.3615
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.0665
+ 9
+ 0
+ Feature Node
+ N/A
+ 1546797.0117324856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"109.0","main.cluster index_upperinput":"109.0"}
+ 109
+ 23.0665
+ 50
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 448.2182
+ N/A
+ 0.0
+ 448.2182
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.9073
+ 9
+ 0
+ Feature Node
+ N/A
+ 9318760.029178144
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2527.0","main.cluster index_upperinput":"2527.0"}
+ 2527
+ 27.9073
+ -1
+ This Node is a Singleton
+ N/A
+ 393.2608
+ N/A
+ 0.0
+ 393.2608
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.8724
+ 2
+ 0
+ Feature Node
+ N/A
+ 1950548.228575297
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10263.0","main.cluster index_upperinput":"10263.0"}
+ 10263
+ 18.8724
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 494.2745
+ N/A
+ 0.0
+ 494.2745
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.6984
+ 9
+ 0
+ Feature Node
+ N/A
+ 2105148.7969315094
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5889.0","main.cluster index_upperinput":"5889.0"}
+ 5889
+ 26.6984
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.7556
+ 8
+ 0
+ Feature Node
+ N/A
+ 10831470.32030061
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3546.0","main.cluster index_upperinput":"3546.0"}
+ 3546
+ 6.7556
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.2328
+ N/A
+ 0.0
+ 412.2328
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.7154
+ 7
+ 0
+ Feature Node
+ N/A
+ 26519229.18241005
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1447.0","main.cluster index_upperinput":"1447.0"}
+ 1447
+ 19.7154
+ 171
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=18&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 584.2753
+ N/A
+ 0.0
+ 584.2753
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1388
+ 4
+ 0
+ Feature Node
+ N/A
+ 610257.3833775778
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7808.0","main.cluster index_upperinput":"7808.0"}
+ 7808
+ 16.1388
+ -1
+ This Node is a Singleton
+ N/A
+ 418.1627
+ N/A
+ 0.0
+ 418.1627
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.716
+ 1
+ 0
+ Feature Node
+ N/A
+ 1003580.9013168528
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"40.0","main.cluster index_upperinput":"40.0"}
+ 40
+ 17.716
+ -1
+ This Node is a Singleton
+ N/A
+ 573.1586
+ N/A
+ 0.0
+ 573.1586
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.3711
+ 5
+ 0
+ Feature Node
+ N/A
+ 874757.1413551702
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1403.0","main.cluster index_upperinput":"1403.0"}
+ 1403
+ 13.3711
+ -1
+ This Node is a Singleton
+ N/A
+ 284.1854
+ N/A
+ 0.0
+ 284.1854
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.876
+ 9
+ 0
+ Feature Node
+ N/A
+ 8203812.43874892
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"208.0","main.cluster index_upperinput":"208.0"}
+ 208
+ 0.876
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 141.9584
+ N/A
+ 0.0
+ 141.9584
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.0685
+ 5
+ 0
+ Feature Node
+ N/A
+ 8080774.135251883
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10545.0","main.cluster index_upperinput":"10545.0"}
+ 10545
+ 12.0685
+ -1
+ This Node is a Singleton
+ N/A
+ 542.2687
+ N/A
+ 0.0
+ 542.2687
+
+
+ 7
+ 0.9586879999999999
+ CCMSLIB00003138768
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138768
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 1,2-Di-(9Z,12Z,15Z-octadecatrienoyl)-sn-glycero-3-phosphocholine from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138768
+ 89
+ 3.68468
+ Feature Node
+ N/A
+ 7
+ 0.0
+ 0.0
+ Data deposited by daniel
+ Spectral Match to 1,2-Di-(9Z,12Z,15Z-octadecatrienoyl)-sn-glycero-3-phosphocholine from NIST14
+ Positive
+ Data deposited by daniel
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3285.0","main.cluster index_upperinput":"3285.0"}
+ 3.68468
+ 3
+ N/A
+ Data from Pieter C. Dorrestein
+ 3
+ 778.5389
+ CCMSLIB00003138768
+ 778.5389
+ 0.0
+ Data from Pieter C. Dorrestein
+ 7792913.002486946
+ HCD
+ Isolated
+ 0.00286865
+ M+H
+ N/A
+ ESI
+ Positive
+ 32.3517
+ 5
+ 0.9586879999999999
+ 0.0
+ Isolated
+ 3285
+ 0.00286865
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 32.3517
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.4645
+ 5
+ 0
+ Feature Node
+ N/A
+ 1554467.8640722376
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10261.0","main.cluster index_upperinput":"10261.0"}
+ 10261
+ 23.4645
+ -1
+ This Node is a Singleton
+ N/A
+ 381.0949
+ N/A
+ 0.0
+ 381.0949
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.9509
+ 5
+ 0
+ Feature Node
+ N/A
+ 6251765.544493575
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"91.0","main.cluster index_upperinput":"91.0"}
+ 91
+ 30.9509
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=96&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.2915
+ N/A
+ 0.0
+ 607.2915
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6495
+ 8
+ 0
+ Feature Node
+ N/A
+ 2901249.5579880825
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3562.0","main.cluster index_upperinput":"3562.0"}
+ 3562
+ 30.6495
+ -1
+ This Node is a Singleton
+ N/A
+ 335.2561
+ N/A
+ 0.0
+ 335.2561
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1495
+ 6
+ 0
+ Feature Node
+ N/A
+ 1290492.1385350684
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3533.0","main.cluster index_upperinput":"3533.0"}
+ 3533
+ 19.1495
+ 190
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 521.1291
+ N/A
+ 0.0
+ 521.1291
+
+
+ 6
+ 0.9110370000000001
+ CCMSLIB00005738688
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0
+ qTof
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0.0
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 5
+ 0.6557470000000001
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1068.0","main.cluster index_upperinput":"1068.0"}
+ 0.6557470000000001
+ 3
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ Massbank
+ 3
+ 279.2318
+ CCMSLIB00005738688
+ 279.2318
+ 0.0
+ Massbank
+ 4907598.523328204
+ qTof
+ Isolated
+ 0.000183105
+ M+H
+ N/A
+ ESI
+ Positive
+ 30.6168
+ 9
+ 0.9110370000000001
+ 0.0
+ Isolated
+ 1068
+ 0.000183105
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 30.6168
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9979
+ 3
+ 0
+ Feature Node
+ N/A
+ 3456956.3880056157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10248.0","main.cluster index_upperinput":"10248.0"}
+ 10248
+ 19.9979
+ -1
+ This Node is a Singleton
+ N/A
+ 549.2309
+ N/A
+ 0.0
+ 549.2309
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5127
+ 3
+ 0
+ Feature Node
+ N/A
+ 28902390.895116795
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3.0","main.cluster index_upperinput":"3.0"}
+ 3
+ 33.5127
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 599.4298
+ N/A
+ 0.0
+ 599.4298
+
+
+ 9
+ 0.8864219999999999
+ CCMSLIB00006406564
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006406564
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)
+ 0
+ Orbitrap
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)
+ 0.0
+ Moupinamide
+ O=C(C=CC1=CC=C(O)C(OC)=C1)NCCC2=CC=C(O)C=C2
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006406564
+ 265
+ 3.8858599999999996
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ BMDMS-NP
+ Moupinamide
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4667.0","main.cluster index_upperinput":"4667.0"}
+ 3.8858599999999996
+ 1
+ O=C(C=CC1=CC=C(O)C(OC)=C1)NCCC2=CC=C(O)C=C2
+ BMDMS-NP
+ 1
+ 314.1388
+ CCMSLIB00006406564
+ 314.1388
+ 0.0
+ BMDMS-NP
+ 2092868.6019164245
+ Orbitrap
+ Commercial standard
+ 0.0012207000000000001
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 14.7321
+ 4
+ 0.8864219999999999
+ 0.0
+ Commercial standard
+ 4667
+ 0.0012207000000000001
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.7321
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.9508
+ 9
+ 0
+ Feature Node
+ N/A
+ 7003543.716786966
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3658.0","main.cluster index_upperinput":"3658.0"}
+ 3658
+ 8.9508
+ -1
+ This Node is a Singleton
+ N/A
+ 177.0546
+ N/A
+ 0.0
+ 177.0546
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4311
+ 7
+ 0
+ Feature Node
+ N/A
+ 263255.7786876307
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3172.0","main.cluster index_upperinput":"3172.0"}
+ 3172
+ 28.4311
+ -1
+ This Node is a Singleton
+ N/A
+ 395.3683
+ N/A
+ 0.0
+ 395.3683
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6519
+ 1
+ 0
+ Feature Node
+ N/A
+ 689381.0972960416
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7700.0","main.cluster index_upperinput":"7700.0"}
+ 7700
+ 25.6519
+ -1
+ This Node is a Singleton
+ N/A
+ 691.2397
+ N/A
+ 0.0
+ 691.2397
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9899
+ 7
+ 0
+ Feature Node
+ N/A
+ 1334989.6736396959
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4583.0","main.cluster index_upperinput":"4583.0"}
+ 4583
+ 19.9899
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 347.0766
+ N/A
+ 0.0
+ 347.0766
+
+
+ 12
+ 0.733911
+ CCMSLIB00004693356
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693356
+ InChI=1S/C26H34O11/c1-33-17-6-5-14(10-18(17)35-26-23(32)22(31)21(30)20(12-29)36-26)24-16(11-28)15-8-13(4-3-7-27)9-19(34-2)25(15)37-24/h5-6,8-10,16,20-24,26-32H,3-4,7,11-12H2,1-2H3
+ 0
+ ESI-QFT
+ InChI=1S/C26H34O11/c1-33-17-6-5-14(10-18(17)35-26-23(32)22(31)21(30)20(12-29)36-26)24-16(11-28)15-8-13(4-3-7-27)9-19(34-2)25(15)37-24/h5-6,8-10,16,20-24,26-32H,3-4,7,11-12H2,1-2H3
+ 0.0
+ 2-(hydroxymethyl)-6-[5-[3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenoxy]oxane-3,4,5-triol
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693356
+ 75
+ 4.63206
+ Feature Node
+ N/A
+ 12
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002293
+ 2-(hydroxymethyl)-6-[5-[3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenoxy]oxane-3,4,5-triol
+ positive
+ MoNA:VF-NPL-QEHF002293
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7719.0","main.cluster index_upperinput":"7719.0"}
+ 4.63206
+ 3
+ N/A
+ MoNA
+ 3
+ 540.2415
+ CCMSLIB00004693356
+ 540.2415
+ 0.0
+ MoNA
+ 1938809.1778773735
+ ESI-QFT
+ isolated
+ 0.00250244
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 14.4644
+ 7
+ 0.733911
+ 0.0
+ isolated
+ 7719
+ 0.00250244
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=124&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.4644
+ 0.0
+ [M+NH4]+
+
+
+ 33
+ 0.804925
+ CCMSLIB00003135173
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135173
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 6-Methoxyluteolin from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135173
+ 216
+ 7.2187
+ Feature Node
+ N/A
+ 33
+ 0.0
+ 0.0
+ Data deposited by lfnothias
+ Spectral Match to 6-Methoxyluteolin from NIST14
+ Positive
+ Data deposited by lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1581.0","main.cluster index_upperinput":"1581.0"}
+ 7.2187
+ 3
+ N/A
+ Data from Pieter Dorrestein;Ajit Jadhav
+ 3
+ 317.0657
+ CCMSLIB00003135173
+ 317.0657
+ 0.0
+ Data from Pieter Dorrestein;Ajit Jadhav
+ 24909138.866243303
+ HCD
+ Isolated
+ 0.00228882
+ M+H
+ N/A
+ ESI
+ Positive
+ 18.7482
+ 8
+ 0.804925
+ 0.0
+ Isolated
+ 1581
+ 0.00228882
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.7482
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.6812
+ 1
+ 0
+ Feature Node
+ N/A
+ 4814437.534327881
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13705.0","main.cluster index_upperinput":"13705.0"}
+ 13705
+ 12.6812
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 528.2239
+ N/A
+ 0.0
+ 528.2239
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.5676
+ 6
+ 0
+ Feature Node
+ N/A
+ 3274617.1613219967
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1401.0","main.cluster index_upperinput":"1401.0"}
+ 1401
+ 32.5676
+ -1
+ This Node is a Singleton
+ N/A
+ 453.3554
+ N/A
+ 0.0
+ 453.3554
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.4046
+ 8
+ 0
+ Feature Node
+ N/A
+ 20492889.18461853
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1474.0","main.cluster index_upperinput":"1474.0"}
+ 1474
+ 32.4046
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 327.2897
+ N/A
+ 0.0
+ 327.2897
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.2329
+ 4
+ 0
+ Feature Node
+ N/A
+ 3632871.0096798744
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1427.0","main.cluster index_upperinput":"1427.0"}
+ 1427
+ 9.2329
+ -1
+ This Node is a Singleton
+ N/A
+ 362.1959
+ N/A
+ 0.0
+ 362.1959
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.3002
+ 5
+ 0
+ Feature Node
+ N/A
+ 928920.9852521468
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7861.0","main.cluster index_upperinput":"7861.0"}
+ 7861
+ 20.3002
+ -1
+ This Node is a Singleton
+ N/A
+ 606.2581
+ N/A
+ 0.0
+ 606.2581
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.9061
+ 7
+ 0
+ Feature Node
+ N/A
+ 1861615.2573813107
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3747.0","main.cluster index_upperinput":"3747.0"}
+ 3747
+ 9.9061
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.2322
+ N/A
+ 0.0
+ 412.2322
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.5445
+ 5
+ 0
+ Feature Node
+ N/A
+ 5161166.834932342
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4693.0","main.cluster index_upperinput":"4693.0"}
+ 4693
+ 19.5445
+ -1
+ This Node is a Singleton
+ N/A
+ 443.1676
+ N/A
+ 0.0
+ 443.1676
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.3754
+ 9
+ 0
+ Feature Node
+ N/A
+ 2659849.427211669
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"142.0","main.cluster index_upperinput":"142.0"}
+ 142
+ 17.3754
+ -1
+ This Node is a Singleton
+ N/A
+ 219.1743
+ N/A
+ 0.0
+ 219.1743
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.9994
+ 2
+ 0
+ Feature Node
+ N/A
+ 5191078.638750628
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4561.0","main.cluster index_upperinput":"4561.0"}
+ 4561
+ 18.9994
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 520.2546
+ N/A
+ 0.0
+ 520.2546
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.2672
+ 6
+ 0
+ Feature Node
+ N/A
+ 337465.4015345902
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3612.0","main.cluster index_upperinput":"3612.0"}
+ 3612
+ 22.2672
+ -1
+ This Node is a Singleton
+ N/A
+ 215.1426
+ N/A
+ 0.0
+ 215.1426
+
+
+ 43
+ 0.78819
+ CCMSLIB00005720103
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0
+ Orbitrap
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0.0
+ 22-Hydoxy-2-hopen-1-one
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ 5
+ 2.21256
+ Feature Node
+ N/A
+ 43
+ 0.0
+ 0.0
+ Damien OLIVIER
+ 22-Hydoxy-2-hopen-1-one
+ Positive
+ Damien OLIVIER
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3122.0","main.cluster index_upperinput":"3122.0"}
+ 2.21256
+ 3
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 3
+ 441.372
+ CCMSLIB00005720103
+ 441.372
+ 0.0
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 2790951.1194996247
+ Orbitrap
+ Isolated
+ 0.0009765619999999999
+ [M+H]
+ N/A
+ LC-ESI
+ Positive
+ 31.6375
+ 6
+ 0.78819
+ 0.0
+ Isolated
+ 3122
+ 0.0009765619999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.6375
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.4986
+ 3
+ 0
+ Feature Node
+ N/A
+ 4343848.783345189
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13627.0","main.cluster index_upperinput":"13627.0"}
+ 13627
+ 22.4986
+ -1
+ This Node is a Singleton
+ N/A
+ 353.1356
+ N/A
+ 0.0
+ 353.1356
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.6397
+ 7
+ 0
+ Feature Node
+ N/A
+ 2974447.55311586
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1987.0","main.cluster index_upperinput":"1987.0"}
+ 1987
+ 11.6397
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 382.222
+ N/A
+ 0.0
+ 382.222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.5082
+ 8
+ 0
+ Feature Node
+ N/A
+ 9604768.690681214
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"28000.0","main.cluster index_upperinput":"28000.0"}
+ 28000
+ 27.5082
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 702.2137
+ N/A
+ 0.0
+ 702.2137
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.0889
+ 6
+ 0
+ Feature Node
+ N/A
+ 793809.2960072516
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"161.0","main.cluster index_upperinput":"161.0"}
+ 161
+ 26.0889
+ -1
+ This Node is a Singleton
+ N/A
+ 327.0783
+ N/A
+ 0.0
+ 327.0783
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 7.3851
+ 2
+ 0
+ Feature Node
+ N/A
+ 3251622.919689074
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8223.0","main.cluster index_upperinput":"8223.0"}
+ 8223
+ 7.3851
+ -1
+ This Node is a Singleton
+ N/A
+ 364.1755
+ N/A
+ 0.0
+ 364.1755
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.8702
+ 7
+ 0
+ Feature Node
+ N/A
+ 2307039.0667282287
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1338.0","main.cluster index_upperinput":"1338.0"}
+ 1338
+ 12.8702
+ 245
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.2222
+ N/A
+ 0.0
+ 394.2222
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.1825
+ 9
+ 0
+ Feature Node
+ N/A
+ 28895300.85514251
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2575.0","main.cluster index_upperinput":"2575.0"}
+ 2575
+ 34.1825
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 409.3829
+ N/A
+ 0.0
+ 409.3829
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.5269
+ 6
+ 0
+ Feature Node
+ N/A
+ 952109.7381752883
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1359.0","main.cluster index_upperinput":"1359.0"}
+ 1359
+ 14.5269
+ -1
+ This Node is a Singleton
+ N/A
+ 546.3056
+ N/A
+ 0.0
+ 546.3056
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.8806
+ 7
+ 0
+ Feature Node
+ N/A
+ 3665840.9492557035
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3107.0","main.cluster index_upperinput":"3107.0"}
+ 3107
+ 34.8806
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=28&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 609.4836
+ N/A
+ 0.0
+ 609.4836
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.1769
+ 9
+ 0
+ Feature Node
+ N/A
+ 15146603.355750648
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1310.0","main.cluster index_upperinput":"1310.0"}
+ 1310
+ 30.1769
+ 89
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 520.3407
+ N/A
+ 0.0
+ 520.3407
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.4127
+ 6
+ 0
+ Feature Node
+ N/A
+ 17071044.235387236
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7657.0","main.cluster index_upperinput":"7657.0"}
+ 7657
+ 32.4127
+ -1
+ This Node is a Singleton
+ N/A
+ 675.5529
+ N/A
+ 0.0
+ 675.5529
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1931
+ 7
+ 0
+ Feature Node
+ N/A
+ 1071089.8089379522
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5026.0","main.cluster index_upperinput":"5026.0"}
+ 5026
+ 19.1931
+ -1
+ This Node is a Singleton
+ N/A
+ 441.2454
+ N/A
+ 0.0
+ 441.2454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0833
+ 9
+ 0
+ Feature Node
+ N/A
+ 4598514.5786643615
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2577.0","main.cluster index_upperinput":"2577.0"}
+ 2577
+ 34.0833
+ -1
+ This Node is a Singleton
+ N/A
+ 347.2922
+ N/A
+ 0.0
+ 347.2922
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3629
+ 5
+ 0
+ Feature Node
+ N/A
+ 1492983.6173541099
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10307.0","main.cluster index_upperinput":"10307.0"}
+ 10307
+ 26.3629
+ -1
+ This Node is a Singleton
+ N/A
+ 553.2992
+ N/A
+ 0.0
+ 553.2992
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.0873
+ 5
+ 0
+ Feature Node
+ N/A
+ 8985261.855863284
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13641.0","main.cluster index_upperinput":"13641.0"}
+ 13641
+ 13.0873
+ 245
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 394.2213
+ N/A
+ 0.0
+ 394.2213
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.7253
+ 8
+ 0
+ Feature Node
+ N/A
+ 7000023.707290265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3625.0","main.cluster index_upperinput":"3625.0"}
+ 3625
+ 32.7253
+ -1
+ This Node is a Singleton
+ N/A
+ 667.4558
+ N/A
+ 0.0
+ 667.4558
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.2845
+ 7
+ 0
+ Feature Node
+ N/A
+ 3013826.382473879
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4790.0","main.cluster index_upperinput":"4790.0"}
+ 4790
+ 2.2845
+ -1
+ This Node is a Singleton
+ N/A
+ 444.2221
+ N/A
+ 0.0
+ 444.2221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.2301
+ 8
+ 0
+ Feature Node
+ N/A
+ 1777539.944284711
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1695.0","main.cluster index_upperinput":"1695.0"}
+ 1695
+ 30.2301
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 231.2106
+ N/A
+ 0.0
+ 231.2106
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.9143
+ 9
+ 0
+ Feature Node
+ N/A
+ 12839362.21306569
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1352.0","main.cluster index_upperinput":"1352.0"}
+ 1352
+ 31.9143
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 313.2739
+ N/A
+ 0.0
+ 313.2739
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.25
+ 5
+ 0
+ Feature Node
+ N/A
+ 1721610.2383471818
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4789.0","main.cluster index_upperinput":"4789.0"}
+ 4789
+ 16.25
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 544.2534
+ N/A
+ 0.0
+ 544.2534
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.7289
+ 4
+ 0
+ Feature Node
+ N/A
+ 1539419.5226464106
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10404.0","main.cluster index_upperinput":"10404.0"}
+ 10404
+ 4.7289
+ 85
+ This Node is a Singleton
+ N/A
+ 464.2481
+ N/A
+ 0.0
+ 464.2481
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.9698
+ 7
+ 0
+ Feature Node
+ N/A
+ 2305028.230020751
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"106.0","main.cluster index_upperinput":"106.0"}
+ 106
+ 32.9698
+ -1
+ This Node is a Singleton
+ N/A
+ 486.3563
+ N/A
+ 0.0
+ 486.3563
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.0282
+ 1
+ 0
+ Feature Node
+ N/A
+ 4952205.417006008
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13676.0","main.cluster index_upperinput":"13676.0"}
+ 13676
+ 16.0282
+ 359
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 551.2391
+ N/A
+ 0.0
+ 551.2391
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.3595
+ 9
+ 0
+ Feature Node
+ N/A
+ 2949520.374455325
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5829.0","main.cluster index_upperinput":"5829.0"}
+ 5829
+ 24.3595
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=111&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 219.1741
+ N/A
+ 0.0
+ 219.1741
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1545
+ 4
+ 0
+ Feature Node
+ N/A
+ 3017088.892387165
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4972.0","main.cluster index_upperinput":"4972.0"}
+ 4972
+ 16.1545
+ 117
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 433.1831
+ N/A
+ 0.0
+ 433.1831
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3683
+ 9
+ 0
+ Feature Node
+ N/A
+ 2437173.2318673665
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6038.0","main.cluster index_upperinput":"6038.0"}
+ 6038
+ 26.3683
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8695
+ 8
+ 0
+ Feature Node
+ N/A
+ 25350527.401867487
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1193.0","main.cluster index_upperinput":"1193.0"}
+ 1193
+ 32.8695
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=130&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 367.2822
+ N/A
+ 0.0
+ 367.2822
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.7311
+ 4
+ 0
+ Feature Node
+ N/A
+ 2700848.071744424
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"74.0","main.cluster index_upperinput":"74.0"}
+ 74
+ 16.7311
+ 207
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=43&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 270.0876
+ N/A
+ 0.0
+ 270.0876
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.8907
+ 5
+ 0
+ Feature Node
+ N/A
+ 6357134.16438157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1173.0","main.cluster index_upperinput":"1173.0"}
+ 1173
+ 10.8907
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 494.2382
+ N/A
+ 0.0
+ 494.2382
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.4991
+ 1
+ 0
+ Feature Node
+ N/A
+ 1727797.3497915638
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7653.0","main.cluster index_upperinput":"7653.0"}
+ 7653
+ 21.4991
+ 361
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 402.1679
+ N/A
+ 0.0
+ 402.1679
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.9722
+ 8
+ 0
+ Feature Node
+ N/A
+ 45851159.245654106
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1375.0","main.cluster index_upperinput":"1375.0"}
+ 1375
+ 28.9722
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 699.3566
+ N/A
+ 0.0
+ 699.3566
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.759
+ 5
+ 0
+ Feature Node
+ N/A
+ 9163819.877622504
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13633.0","main.cluster index_upperinput":"13633.0"}
+ 13633
+ 11.759
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2121
+ N/A
+ 0.0
+ 462.2121
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0897
+ 4
+ 0
+ Feature Node
+ N/A
+ 12715660.31333598
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7621.0","main.cluster index_upperinput":"7621.0"}
+ 7621
+ 18.0897
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 227.1071
+ N/A
+ 0.0
+ 227.1071
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8276
+ 8
+ 0
+ Feature Node
+ N/A
+ 1894826.1192255027
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5148.0","main.cluster index_upperinput":"5148.0"}
+ 5148
+ 23.8276
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8904
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.5649
+ 7
+ 0
+ Feature Node
+ N/A
+ 21630839.048587535
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1275.0","main.cluster index_upperinput":"1275.0"}
+ 1275
+ 1.5649
+ 290
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=185&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 328.139
+ N/A
+ 0.0
+ 328.139
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.264
+ 1
+ 0
+ Feature Node
+ N/A
+ 1011012.215739168
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13820.0","main.cluster index_upperinput":"13820.0"}
+ 13820
+ 25.264
+ -1
+ This Node is a Singleton
+ N/A
+ 432.3316
+ N/A
+ 0.0
+ 432.3316
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6462
+ 8
+ 0
+ Feature Node
+ N/A
+ 28887144.845616937
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1487.0","main.cluster index_upperinput":"1487.0"}
+ 1487
+ 30.6462
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 482.405
+ N/A
+ 0.0
+ 482.405
+
+
+ 10
+ 0.766675
+ CCMSLIB00004692205
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692205
+ InChI=1S/C24H30O4/c1-15-5-9-20-23(2,3)21(25)11-12-24(20,4)18(15)14-27-17-8-6-16-7-10-22(26)28-19(16)13-17/h6-8,10,13,18,20-21,25H,1,5,9,11-12,14H2,2-4H3
+ 0
+ ESI-QFT
+ InChI=1S/C24H30O4/c1-15-5-9-20-23(2,3)21(25)11-12-24(20,4)18(15)14-27-17-8-6-16-7-10-22(26)28-19(16)13-17/h6-8,10,13,18,20-21,25H,1,5,9,11-12,14H2,2-4H3
+ 0.0
+ 7-[(6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methoxy]chromen-2-one
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692205
+ -1
+ 3.10573
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF001142
+ 7-[(6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methoxy]chromen-2-one
+ positive
+ MoNA:VF-NPL-QEHF001142
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4997.0","main.cluster index_upperinput":"4997.0"}
+ 3.10573
+ 3
+ N/A
+ MoNA
+ 3
+ 383.2208
+ CCMSLIB00004692205
+ 383.2208
+ 0.0
+ MoNA
+ 1530831.8859131131
+ ESI-QFT
+ isolated
+ 0.00119019
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 28.2741
+ 5
+ 0.766675
+ 0.0
+ isolated
+ 4997
+ 0.00119019
+ This Node is a Singleton
+ 28.2741
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.1216
+ 2
+ 0
+ Feature Node
+ N/A
+ 2317679.3086518715
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13719.0","main.cluster index_upperinput":"13719.0"}
+ 13719
+ 28.1216
+ 93
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=63&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 916.5126
+ N/A
+ 0.0
+ 916.5126
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.2645
+ 9
+ 0
+ Feature Node
+ N/A
+ 1502999.5086203178
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1399.0","main.cluster index_upperinput":"1399.0"}
+ 1399
+ 25.2645
+ -1
+ This Node is a Singleton
+ N/A
+ 279.2312
+ N/A
+ 0.0
+ 279.2312
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.5468
+ 9
+ 0
+ Feature Node
+ N/A
+ 3242109.296301544
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1283.0","main.cluster index_upperinput":"1283.0"}
+ 1283
+ 24.5468
+ -1
+ This Node is a Singleton
+ N/A
+ 267.1572
+ N/A
+ 0.0
+ 267.1572
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7773
+ 5
+ 0
+ Feature Node
+ N/A
+ 2148752.2523002424
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4587.0","main.cluster index_upperinput":"4587.0"}
+ 4587
+ 17.7773
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 568.2754
+ N/A
+ 0.0
+ 568.2754
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.5255
+ 4
+ 0
+ Feature Node
+ N/A
+ 599471.9769923693
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4983.0","main.cluster index_upperinput":"4983.0"}
+ 4983
+ 26.5255
+ -1
+ This Node is a Singleton
+ N/A
+ 579.2803
+ N/A
+ 0.0
+ 579.2803
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.718
+ 1
+ 0
+ Feature Node
+ N/A
+ 290768.734195608
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7794.0","main.cluster index_upperinput":"7794.0"}
+ 7794
+ 32.718
+ -1
+ This Node is a Singleton
+ N/A
+ 647.3578
+ N/A
+ 0.0
+ 647.3578
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.3104
+ 9
+ 0
+ Feature Node
+ N/A
+ 1998360.324382435
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6482.0","main.cluster index_upperinput":"6482.0"}
+ 6482
+ 26.3104
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=68&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 219.1742
+ N/A
+ 0.0
+ 219.1742
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9738
+ 5
+ 0
+ Feature Node
+ N/A
+ 2308303.475101755
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7979.0","main.cluster index_upperinput":"7979.0"}
+ 7979
+ 33.9738
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 395.3144
+ N/A
+ 0.0
+ 395.3144
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.3597
+ 3
+ 0
+ Feature Node
+ N/A
+ 2635693.8706052313
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10260.0","main.cluster index_upperinput":"10260.0"}
+ 10260
+ 19.3597
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 417.188
+ N/A
+ 0.0
+ 417.188
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.3062
+ 4
+ 0
+ Feature Node
+ N/A
+ 1643267.8793584898
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4550.0","main.cluster index_upperinput":"4550.0"}
+ 4550
+ 21.3062
+ -1
+ This Node is a Singleton
+ N/A
+ 353.0633
+ N/A
+ 0.0
+ 353.0633
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.0471
+ 5
+ 0
+ Feature Node
+ N/A
+ 3639450.437306791
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"34.0","main.cluster index_upperinput":"34.0"}
+ 34
+ 30.0471
+ -1
+ This Node is a Singleton
+ N/A
+ 585.4129
+ N/A
+ 0.0
+ 585.4129
+
+
+ 6
+ 0.882178
+ CCMSLIB00006404791
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006404791
+ InChI=1S/C16H12O6/c1-21-16-14(20)13-11(19)6-10(18)7-12(13)22-15(16)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3
+ 0
+ Orbitrap
+ InChI=1S/C16H12O6/c1-21-16-14(20)13-11(19)6-10(18)7-12(13)22-15(16)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3
+ 0.0
+ Isokaempferide
+ O=C1C(OC)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=CC3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006404791
+ -1
+ 2.33137
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ BMDMS-NP
+ Isokaempferide
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1285.0","main.cluster index_upperinput":"1285.0"}
+ 2.33137
+ 1
+ O=C1C(OC)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=CC3
+ BMDMS-NP
+ 1
+ 301.0707
+ CCMSLIB00006404791
+ 301.0707
+ 0.0
+ BMDMS-NP
+ 655320.7248086032
+ Orbitrap
+ Commercial standard
+ 0.0007019039999999999
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 19.0138
+ 4
+ 0.882178
+ 0.0
+ Commercial standard
+ 1285
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.0138
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.4513
+ 6
+ 0
+ Feature Node
+ N/A
+ 1418496.1959938451
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"26328.0","main.cluster index_upperinput":"26328.0"}
+ 26328
+ 2.4513
+ 1
+ This Node is a Singleton
+ N/A
+ 430.2426
+ N/A
+ 0.0
+ 430.2426
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.2742
+ 6
+ 0
+ Feature Node
+ N/A
+ 4284383.872712078
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7663.0","main.cluster index_upperinput":"7663.0"}
+ 7663
+ 1.2742
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.1965
+ N/A
+ 0.0
+ 412.1965
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.1244
+ 5
+ 0
+ Feature Node
+ N/A
+ 6045976.79574973
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4642.0","main.cluster index_upperinput":"4642.0"}
+ 4642
+ 12.1244
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 382.2224
+ N/A
+ 0.0
+ 382.2224
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.2383
+ 6
+ 0
+ Feature Node
+ N/A
+ 3820823.5822628797
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4627.0","main.cluster index_upperinput":"4627.0"}
+ 4627
+ 25.2383
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=80&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 316.2845
+ N/A
+ 0.0
+ 316.2845
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.0109
+ 3
+ 0
+ Feature Node
+ N/A
+ 5985278.241630225
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1158.0","main.cluster index_upperinput":"1158.0"}
+ 1158
+ 19.0109
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 491.1192
+ N/A
+ 0.0
+ 491.1192
+
+
+ 8
+ 0.83391
+ CCMSLIB00006422785
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006422785
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3
+ 0
+ Orbitrap
+ InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3
+ 0.0
+ Eupatilin
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006422785
+ 67
+ 19.986
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ BMDMS-NP
+ Eupatilin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2476.0","main.cluster index_upperinput":"2476.0"}
+ 19.986
+ 1
+ O=C1C=C(OC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
+ BMDMS-NP
+ 1
+ 345.0969
+ CCMSLIB00006422785
+ 345.0969
+ 0.0
+ BMDMS-NP
+ 8122715.209299802
+ Orbitrap
+ Commercial standard
+ 0.00689697
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 21.938
+ 9
+ 0.83391
+ 0.0
+ Commercial standard
+ 2476
+ 0.00689697
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.938
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.4519
+ 6
+ 0
+ Feature Node
+ N/A
+ 4088476.904452964
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7753.0","main.cluster index_upperinput":"7753.0"}
+ 7753
+ 31.4519
+ -1
+ This Node is a Singleton
+ N/A
+ 465.335
+ N/A
+ 0.0
+ 465.335
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.8159
+ 9
+ 0
+ Feature Node
+ N/A
+ 1978029.679127257
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5975.0","main.cluster index_upperinput":"5975.0"}
+ 5975
+ 26.8159
+ 10
+ This Node is a Singleton
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 5.3896
+ 2
+ 0
+ Feature Node
+ N/A
+ 393748.126674839
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8051.0","main.cluster index_upperinput":"8051.0"}
+ 8051
+ 5.3896
+ -1
+ This Node is a Singleton
+ N/A
+ 339.0959
+ N/A
+ 0.0
+ 339.0959
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.6268
+ 4
+ 0
+ Feature Node
+ N/A
+ 685750.2713910462
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"18848.0","main.cluster index_upperinput":"18848.0"}
+ 18848
+ 19.6268
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=25&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 833.3016
+ N/A
+ 0.0
+ 833.3016
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.4659
+ 1
+ 0
+ Feature Node
+ N/A
+ 1049518.1184647232
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7786.0","main.cluster index_upperinput":"7786.0"}
+ 7786
+ 10.4659
+ -1
+ This Node is a Singleton
+ N/A
+ 538.2281
+ N/A
+ 0.0
+ 538.2281
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8063
+ 7
+ 0
+ Feature Node
+ N/A
+ 373696.74318810424
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4840.0","main.cluster index_upperinput":"4840.0"}
+ 4840
+ 23.8063
+ 147
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=86&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.2807
+ N/A
+ 0.0
+ 441.2807
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.58
+ 4
+ 0
+ Feature Node
+ N/A
+ 2797212.596411882
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2608.0","main.cluster index_upperinput":"2608.0"}
+ 2608
+ 33.58
+ -1
+ This Node is a Singleton
+ N/A
+ 1121.6228
+ N/A
+ 0.0
+ 1121.6228
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9256
+ 9
+ 0
+ Feature Node
+ N/A
+ 8450189.480120493
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1257.0","main.cluster index_upperinput":"1257.0"}
+ 1257
+ 0.9256
+ -1
+ This Node is a Singleton
+ N/A
+ 365.1055
+ N/A
+ 0.0
+ 365.1055
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.4479
+ 8
+ 0
+ Feature Node
+ N/A
+ 2287762.740179059
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11368.0","main.cluster index_upperinput":"11368.0"}
+ 11368
+ 23.4479
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8905
+ N/A
+ 0.0
+ 84.9452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8131
+ 8
+ 0
+ Feature Node
+ N/A
+ 5785825.593884494
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1214.0","main.cluster index_upperinput":"1214.0"}
+ 1214
+ 21.8131
+ -1
+ This Node is a Singleton
+ N/A
+ 282.2038
+ N/A
+ 0.0
+ 282.2038
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3928
+ 9
+ 0
+ Feature Node
+ N/A
+ 56965261.24653977
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1216.0","main.cluster index_upperinput":"1216.0"}
+ 1216
+ 32.3928
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 349.2713
+ N/A
+ 0.0
+ 349.2713
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.2021
+ 8
+ 0
+ Feature Node
+ N/A
+ 5954662.463161357
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2634.0","main.cluster index_upperinput":"2634.0"}
+ 2634
+ 34.2021
+ -1
+ This Node is a Singleton
+ N/A
+ 629.4775
+ N/A
+ 0.0
+ 629.4775
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.5199
+ 4
+ 0
+ Feature Node
+ N/A
+ 384760.1380195682
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2091.0","main.cluster index_upperinput":"2091.0"}
+ 2091
+ 17.5199
+ -1
+ This Node is a Singleton
+ N/A
+ 469.2333
+ N/A
+ 0.0
+ 469.2333
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9996
+ 4
+ 0
+ Feature Node
+ N/A
+ 49827088.486622445
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8321.0","main.cluster index_upperinput":"8321.0"}
+ 8321
+ 14.9996
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2434
+ N/A
+ 0.0
+ 478.2434
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7014
+ 6
+ 0
+ Feature Node
+ N/A
+ 8325452.36170641
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2488.0","main.cluster index_upperinput":"2488.0"}
+ 2488
+ 21.7014
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 226.1802
+ N/A
+ 0.0
+ 226.1802
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.9786
+ 5
+ 0
+ Feature Node
+ N/A
+ 5493456.712752116
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1162.0","main.cluster index_upperinput":"1162.0"}
+ 1162
+ 13.9786
+ 111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 538.2286
+ N/A
+ 0.0
+ 538.2286
+
+
+ 37
+ 0.7749520000000001
+ CCMSLIB00000848806
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000848806
+ InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3
+ 0.0
+ NCGC00169741-02!2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxychromen-4-one
+ COC1=C(OC)C(O)=C2C(=O)C(OC)=C(OC2=C1)C3=CC(O)=C(O)C=C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000848806
+ 7
+ 0.591603
+ Feature Node
+ N/A
+ 37
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00169741-02!2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxychromen-4-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2273.0","main.cluster index_upperinput":"2273.0"}
+ 0.591603
+ 1
+ COC1=C(OC)C(O)=C2C(=O)C(OC)=C(OC2=C1)C3=CC(O)=C(O)C=C3
+ Jadhav/Dorrestein
+ 1
+ 361.0918
+ CCMSLIB00000848806
+ 361.0918
+ 0.0
+ Jadhav/Dorrestein
+ 6243395.2967505725
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.000213623
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 20.3375
+ 6
+ 0.7749520000000001
+ 0.0
+ isolated
+ 2273
+ 0.000213623
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.3375
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.6686
+ 6
+ 0
+ Feature Node
+ N/A
+ 17495553.665893577
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4584.0","main.cluster index_upperinput":"4584.0"}
+ 4584
+ 12.6686
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2382
+ N/A
+ 0.0
+ 446.2382
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.3202
+ 4
+ 0
+ Feature Node
+ N/A
+ 37487238.79178417
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1156.0","main.cluster index_upperinput":"1156.0"}
+ 1156
+ 31.3202
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 612.1647
+ N/A
+ 0.0
+ 612.1647
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.0485
+ 1
+ 0
+ Feature Node
+ N/A
+ 236405.40541310442
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8536.0","main.cluster index_upperinput":"8536.0"}
+ 8536
+ 8.0485
+ -1
+ This Node is a Singleton
+ N/A
+ 531.175
+ N/A
+ 0.0
+ 531.175
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8385
+ 8
+ 0
+ Feature Node
+ N/A
+ 35695699.5713855
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1179.0","main.cluster index_upperinput":"1179.0"}
+ 1179
+ 32.8385
+ -1
+ This Node is a Singleton
+ N/A
+ 381.2982
+ N/A
+ 0.0
+ 381.2982
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.4649
+ 3
+ 0
+ Feature Node
+ N/A
+ 273986.68259055755
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5371.0","main.cluster index_upperinput":"5371.0"}
+ 5371
+ 21.4649
+ -1
+ This Node is a Singleton
+ N/A
+ 662.4321
+ N/A
+ 0.0
+ 662.4321
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.4633
+ 5
+ 0
+ Feature Node
+ N/A
+ 65357331.240921
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4537.0","main.cluster index_upperinput":"4537.0"}
+ 4537
+ 16.4633
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2434
+ N/A
+ 0.0
+ 478.2434
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.8447
+ 4
+ 0
+ Feature Node
+ N/A
+ 4055084.284626933
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4590.0","main.cluster index_upperinput":"4590.0"}
+ 4590
+ 14.8447
+ 111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 538.2282
+ N/A
+ 0.0
+ 538.2282
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.2906
+ 2
+ 0
+ Feature Node
+ N/A
+ 739138.1516001928
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13900.0","main.cluster index_upperinput":"13900.0"}
+ 13900
+ 19.2906
+ -1
+ This Node is a Singleton
+ N/A
+ 627.279
+ N/A
+ 0.0
+ 627.279
+
+
+ 35
+ 0.705094
+ CCMSLIB00004693379
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693379
+ InChI=1S/C21H34O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h12,14-15,18,22,24H,3-11,13,16H2,1-2H3/t18-/m1/s1
+ 0
+ ESI-QFT
+ InChI=1S/C21H34O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h12,14-15,18,22,24H,3-11,13,16H2,1-2H3/t18-/m1/s1
+ 0.0
+ (5R)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradecan-3-one
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004693379
+ 5
+ 2.78023
+ Feature Node
+ N/A
+ 35
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF002316
+ (5R)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradecan-3-one
+ positive
+ MoNA:VF-NPL-QEHF002316
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2287.0","main.cluster index_upperinput":"2287.0"}
+ 2.78023
+ 3
+ N/A
+ MoNA
+ 3
+ 351.252
+ CCMSLIB00004693379
+ 351.252
+ 0.0
+ MoNA
+ 5870169.9309723
+ ESI-QFT
+ isolated
+ 0.0009765619999999999
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 27.0484
+ 8
+ 0.705094
+ 0.0
+ isolated
+ 2287
+ 0.0009765619999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 27.0484
+ 0.0
+ [M+H]+
+
+
+ 11
+ 0.807477
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 56
+ 1.56247
+ Feature Node
+ N/A
+ 11
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5812.0","main.cluster index_upperinput":"5812.0"}
+ 1.56247
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1014
+ CCMSLIB00003136238
+ 371.1014
+ 0.0
+ Data from Maria Maansson
+ 8336688.669635268
+ QQQ
+ Isolated
+ 0.000579834
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.4129
+ 8
+ 0.807477
+ 0.0
+ Isolated
+ 5812
+ 0.000579834
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.4129
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.3877
+ 5
+ 0
+ Feature Node
+ N/A
+ 5475861.977536066
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1414.0","main.cluster index_upperinput":"1414.0"}
+ 1414
+ 14.3877
+ -1
+ This Node is a Singleton
+ N/A
+ 466.2413
+ N/A
+ 0.0
+ 466.2413
+
+
+ 8
+ 0.8529329999999999
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 56
+ 1.8914099999999998
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4605.0","main.cluster index_upperinput":"4605.0"}
+ 1.8914099999999998
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1013
+ CCMSLIB00003136238
+ 371.1013
+ 0.0
+ Data from Maria Maansson
+ 4049217.420641046
+ QQQ
+ Isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.842
+ 6
+ 0.8529329999999999
+ 0.0
+ Isolated
+ 4605
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.842
+ 0.0
+ M+H
+
+
+ 13
+ 0.80157
+ CCMSLIB00005724788
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005724788
+ InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3
+ 0
+ Orbitrap
+ InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3
+ 0.0
+ 2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1,4-diol
+ COc(cc(CC(CO)C(Cc(cc1)cc(OC)c1O)CO)cc1)c1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005724788
+ 111
+ 1.21265
+ Feature Node
+ N/A
+ 13
+ 0.0
+ 0.0
+ Luis Quiros-Guerrero
+ 2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1,4-diol
+ Positive
+ Luis Quiros-Guerrero
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5273.0","main.cluster index_upperinput":"5273.0"}
+ 1.21265
+ 1
+ COc(cc(CC(CO)C(Cc(cc1)cc(OC)c1O)CO)cc1)c1O
+ Wolfender
+ 1
+ 327.1594
+ CCMSLIB00005724788
+ 327.1594
+ 0.0
+ Wolfender
+ 2136568.868979859
+ Orbitrap
+ Isolated
+ 0.000396729
+ M-2H2O+H
+ N/A
+ ESI
+ Positive
+ 15.8051
+ 4
+ 0.80157
+ 0.0
+ Isolated
+ 5273
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.8051
+ 0.0
+ M-2H2O+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.2206
+ 8
+ 0
+ Feature Node
+ N/A
+ 206911174.46940643
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13598.0","main.cluster index_upperinput":"13598.0"}
+ 13598
+ 27.2206
+ -1
+ This Node is a Singleton
+ N/A
+ 301.1411
+ N/A
+ 0.0
+ 301.1411
+
+
+ 6
+ 0.955304
+ CCMSLIB00004694664
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694664
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0.0
+ arctiin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694664
+ 393
+ 0.43815699999999996
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF003601
+ arctiin
+ positive
+ MoNA:VF-NPL-QEHF003601
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1497.0","main.cluster index_upperinput":"1497.0"}
+ 0.43815699999999996
+ 3
+ N/A
+ MoNA
+ 3
+ 557.1992
+ CCMSLIB00004694664
+ 557.1992
+ 0.0
+ MoNA
+ 8356136.260282811
+ ESI-QFT
+ isolated
+ 0.00024414099999999997
+ [M+Na]+
+ N/A
+ N/A
+ positive
+ 15.6449
+ 4
+ 0.955304
+ 0.0
+ isolated
+ 1497
+ 0.00024414099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=35&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.6449
+ 0.0
+ [M+Na]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.8995
+ 5
+ 0
+ Feature Node
+ N/A
+ 1290176.2332343124
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"16227.0","main.cluster index_upperinput":"16227.0"}
+ 16227
+ 8.8995
+ -1
+ This Node is a Singleton
+ N/A
+ 561.1946
+ N/A
+ 0.0
+ 561.1946
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7937
+ 5
+ 0
+ Feature Node
+ N/A
+ 905278.2827176421
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7832.0","main.cluster index_upperinput":"7832.0"}
+ 7832
+ 17.7937
+ -1
+ This Node is a Singleton
+ N/A
+ 371.1471
+ N/A
+ 0.0
+ 371.1471
+
+
+ 24
+ 0.7912680000000001
+ CCMSLIB00005467698
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+
+ 0
+ qTof
+
+ 0.0
+ Dihydroactinidiolide
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005467698
+ 5
+ 11.0363
+ Feature Node
+ N/A
+ 24
+ 0.0
+ 0.0
+ Armando Alcazar
+ Dihydroactinidiolide
+ Positive
+ Armando Alcazar
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4559.0","main.cluster index_upperinput":"4559.0"}
+ 11.0363
+ 3
+
+ Claudia Maier
+ 3
+ 181.122
+ CCMSLIB00005467698
+ 181.122
+ 0.0
+ Claudia Maier
+ 10525073.401965298
+ qTof
+ Isolated
+ 0.0019989
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 18.487
+ 8
+ 0.7912680000000001
+ 0.0
+ Isolated
+ 4559
+ 0.0019989
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.487
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.7261
+ 8
+ 0
+ Feature Node
+ N/A
+ 3554717.7055147756
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3669.0","main.cluster index_upperinput":"3669.0"}
+ 3669
+ 22.7261
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 213.1483
+ N/A
+ 0.0
+ 213.1483
+
+
+ 10
+ 0.730635
+ CCMSLIB00003136733
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136733
+ InChI=1S/C18H30O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h3-4,6,8,11,14,17,21H,2,5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/b4-3-,8-6-,14-11+/t17-/m1/s1
+ 0
+ qTof
+ InChI=1S/C18H30O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h3-4,6,8,11,14,17,21H,2,5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/b4-3-,8-6-,14-11+/t17-/m1/s1
+ 0.0
+ Spectral Match to 9(S)-HpOTrE from NIST14
+ CC/C=C\\C/C=C\\C=C\\[C@H](CCCCCCCC(=O)O)OO
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136733
+ 5
+ 3.43466
+ Feature Node
+ N/A
+ 10
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to 9(S)-HpOTrE from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5524.0","main.cluster index_upperinput":"5524.0"}
+ 3.43466
+ 3
+ CC/C=C\\C/C=C\\C=C\\[C@H](CCCCCCCC(=O)O)OO
+ Data from Maria Maansson
+ 3
+ 293.21
+ CCMSLIB00003136733
+ 293.21
+ 0.0
+ Data from Maria Maansson
+ 2091757.305600518
+ qTof
+ Isolated
+ 0.00100708
+ M+H-H2O
+ N/A
+ ESI
+ Positive
+ 26.6121
+ 9
+ 0.730635
+ 0.0
+ Isolated
+ 5524
+ 0.00100708
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 26.6121
+ 0.0
+ M+H-H2O
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.1977
+ 9
+ 0
+ Feature Node
+ N/A
+ 16883976.533224158
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13729.0","main.cluster index_upperinput":"13729.0"}
+ 13729
+ 18.1977
+ -1
+ This Node is a Singleton
+ N/A
+ 298.0471
+ N/A
+ 0.0
+ 298.0471
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9346
+ 7
+ 0
+ Feature Node
+ N/A
+ 6394536.185904849
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9.0","main.cluster index_upperinput":"9.0"}
+ 9
+ 33.9346
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 656.2261
+ N/A
+ 0.0
+ 656.2261
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.0642
+ 8
+ 0
+ Feature Node
+ N/A
+ 12230283.985006649
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15.0","main.cluster index_upperinput":"15.0"}
+ 15
+ 31.0642
+ -1
+ This Node is a Singleton
+ N/A
+ 659.2879
+ N/A
+ 0.0
+ 659.2879
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.8173
+ 1
+ 0
+ Feature Node
+ N/A
+ 168835.95168267874
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8005.0","main.cluster index_upperinput":"8005.0"}
+ 8005
+ 20.8173
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 185.1086
+ N/A
+ 0.0
+ 185.1086
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.7824
+ 7
+ 0
+ Feature Node
+ N/A
+ 2306823.4585964587
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8355.0","main.cluster index_upperinput":"8355.0"}
+ 8355
+ 26.7824
+ -1
+ This Node is a Singleton
+ N/A
+ 369.1807
+ N/A
+ 0.0
+ 369.1807
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.4369
+ 1
+ 0
+ Feature Node
+ N/A
+ 306956.11115848785
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8314.0","main.cluster index_upperinput":"8314.0"}
+ 8314
+ 6.4369
+ -1
+ This Node is a Singleton
+ N/A
+ 502.1837
+ N/A
+ 0.0
+ 502.1837
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6017
+ 2
+ 0
+ Feature Node
+ N/A
+ 2231598.9599131006
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3527.0","main.cluster index_upperinput":"3527.0"}
+ 3527
+ 17.6017
+ 312
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 537.1237
+ N/A
+ 0.0
+ 537.1237
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.3307
+ 8
+ 0
+ Feature Node
+ N/A
+ 4271224.553671027
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2775.0","main.cluster index_upperinput":"2775.0"}
+ 2775
+ 23.3307
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 181.1219
+ N/A
+ 0.0
+ 181.1219
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.8505
+ 3
+ 0
+ Feature Node
+ N/A
+ 2471764.5460543875
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13747.0","main.cluster index_upperinput":"13747.0"}
+ 13747
+ 14.8505
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 472.2333
+ N/A
+ 0.0
+ 472.2333
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.1099
+ 6
+ 0
+ Feature Node
+ N/A
+ 6237255.447806681
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7629.0","main.cluster index_upperinput":"7629.0"}
+ 7629
+ 18.1099
+ -1
+ This Node is a Singleton
+ N/A
+ 369.1318
+ N/A
+ 0.0
+ 369.1318
+
+
+ 15
+ 0.8355459999999999
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 56
+ 0.740115
+ Feature Node
+ N/A
+ 15
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5332.0","main.cluster index_upperinput":"5332.0"}
+ 0.740115
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1017
+ CCMSLIB00003136238
+ 371.1017
+ 0.0
+ Data from Maria Maansson
+ 4433954.920384865
+ QQQ
+ Isolated
+ 0.000274658
+ M+H
+ N/A
+ ESI
+ Positive
+ 32.9244
+ 8
+ 0.8355459999999999
+ 0.0
+ Isolated
+ 5332
+ 0.000274658
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 32.9244
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.121
+ 7
+ 0
+ Feature Node
+ N/A
+ 6221664.397260188
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2761.0","main.cluster index_upperinput":"2761.0"}
+ 2761
+ 32.121
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 554.4628
+ N/A
+ 0.0
+ 554.4628
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.3025
+ 5
+ 0
+ Feature Node
+ N/A
+ 1408374.3802853352
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10318.0","main.cluster index_upperinput":"10318.0"}
+ 10318
+ 13.3025
+ 186
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 466.2431
+ N/A
+ 0.0
+ 466.2431
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.3502
+ 5
+ 0
+ Feature Node
+ N/A
+ 21242672.78246537
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2.0","main.cluster index_upperinput":"2.0"}
+ 2
+ 27.3502
+ 54
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=72&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 579.2934
+ N/A
+ 0.0
+ 579.2934
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4725
+ 6
+ 0
+ Feature Node
+ N/A
+ 1680303.7714203673
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10964.0","main.cluster index_upperinput":"10964.0"}
+ 10964
+ 26.4725
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 366.3364
+ N/A
+ 0.0
+ 366.3364
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.9527
+ 9
+ 0
+ Feature Node
+ N/A
+ 2849692.9869862446
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1232.0","main.cluster index_upperinput":"1232.0"}
+ 1232
+ 25.9527
+ 259
+ This Node is a Singleton
+ N/A
+ 299.1615
+ N/A
+ 0.0
+ 299.1615
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9665
+ 8
+ 0
+ Feature Node
+ N/A
+ 7132692.557105476
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1298.0","main.cluster index_upperinput":"1298.0"}
+ 1298
+ 0.9665
+ -1
+ This Node is a Singleton
+ N/A
+ 262.1284
+ N/A
+ 0.0
+ 262.1284
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2437
+ 3
+ 0
+ Feature Node
+ N/A
+ 1932352.5525098746
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10473.0","main.cluster index_upperinput":"10473.0"}
+ 10473
+ 33.2437
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 850.2518
+ N/A
+ 0.0
+ 850.2518
+
+
+ 9
+ 0.9565319999999999
+ CCMSLIB00004694664
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694664
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1
+ 0.0
+ arctiin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004694664
+ 393
+ 0.43815699999999996
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF003601
+ arctiin
+ positive
+ MoNA:VF-NPL-QEHF003601
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4499.0","main.cluster index_upperinput":"4499.0"}
+ 0.43815699999999996
+ 3
+ N/A
+ MoNA
+ 3
+ 557.1992
+ CCMSLIB00004694664
+ 557.1992
+ 0.0
+ MoNA
+ 24894341.05050269
+ ESI-QFT
+ isolated
+ 0.00024414099999999997
+ [M+Na]+
+ N/A
+ N/A
+ positive
+ 16.5773
+ 4
+ 0.9565319999999999
+ 0.0
+ isolated
+ 4499
+ 0.00024414099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=35&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.5773
+ 0.0
+ [M+Na]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.1378
+ 8
+ 0
+ Feature Node
+ N/A
+ 5762291.731882633
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13741.0","main.cluster index_upperinput":"13741.0"}
+ 13741
+ 24.1378
+ -1
+ This Node is a Singleton
+ N/A
+ 365.2294
+ N/A
+ 0.0
+ 365.2294
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.7211
+ 3
+ 0
+ Feature Node
+ N/A
+ 483891.3542616637
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10414.0","main.cluster index_upperinput":"10414.0"}
+ 10414
+ 20.7211
+ -1
+ This Node is a Singleton
+ N/A
+ 359.2052
+ N/A
+ 0.0
+ 359.2052
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1653
+ 3
+ 0
+ Feature Node
+ N/A
+ 1840317.698683997
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13685.0","main.cluster index_upperinput":"13685.0"}
+ 13685
+ 26.1653
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=111&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 224.2009
+ N/A
+ 0.0
+ 224.2009
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.6452
+ 3
+ 0
+ Feature Node
+ N/A
+ 1639284.1778449249
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7703.0","main.cluster index_upperinput":"7703.0"}
+ 7703
+ 13.6452
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=61&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 444.2018
+ N/A
+ 0.0
+ 444.2018
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.8712
+ 4
+ 0
+ Feature Node
+ N/A
+ 26210.618788399068
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11741.0","main.cluster index_upperinput":"11741.0"}
+ 11741
+ 6.8712
+ 408
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 354.1906
+ N/A
+ 0.0
+ 354.1906
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.1029
+ 8
+ 0
+ Feature Node
+ N/A
+ 16814660.907572143
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1295.0","main.cluster index_upperinput":"1295.0"}
+ 1295
+ 1.1029
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=185&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 276.1439
+ N/A
+ 0.0
+ 276.1439
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.5953
+ 7
+ 0
+ Feature Node
+ N/A
+ 957891.854925413
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15539.0","main.cluster index_upperinput":"15539.0"}
+ 15539
+ 9.5953
+ -1
+ This Node is a Singleton
+ N/A
+ 307.1152
+ N/A
+ 0.0
+ 307.1152
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.9576
+ 1
+ 0
+ Feature Node
+ N/A
+ 377723.8711067346
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7997.0","main.cluster index_upperinput":"7997.0"}
+ 7997
+ 3.9576
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 460.1737
+ N/A
+ 0.0
+ 460.1737
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.4552
+ 4
+ 0
+ Feature Node
+ N/A
+ 155017.4613466349
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4178.0","main.cluster index_upperinput":"4178.0"}
+ 4178
+ 6.4552
+ -1
+ This Node is a Singleton
+ N/A
+ 354.1908
+ N/A
+ 0.0
+ 354.1908
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.7091
+ 9
+ 0
+ Feature Node
+ N/A
+ 21406375.495852787
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1218.0","main.cluster index_upperinput":"1218.0"}
+ 1218
+ 34.7091
+ -1
+ This Node is a Singleton
+ N/A
+ 317.2451
+ N/A
+ 0.0
+ 317.2451
+
+
+ 9
+ 0.819171
+ CCMSLIB00005745136
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745136
+ 1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3
+ 0
+ qTof
+ 1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3
+ 0.0
+ Massbank:PR303697 Tectorigenin
+ COC1=C(O)C2=C(OC=C(C2=O)C2=CC=C(O)C=C2)C=C1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005745136
+ 227
+ 0.91227
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303697 Tectorigenin
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4513.0","main.cluster index_upperinput":"4513.0"}
+ 0.91227
+ 3
+ COC1=C(O)C2=C(OC=C(C2=O)C2=CC=C(O)C=C2)C=C1O
+ Massbank
+ 3
+ 301.0713
+ CCMSLIB00005745136
+ 301.0713
+ 0.0
+ Massbank
+ 8821837.899372188
+ qTof
+ Isolated
+ 0.000274658
+ M+H
+ N/A
+ ESI
+ Positive
+ 21.1686
+ 7
+ 0.819171
+ 0.0
+ Isolated
+ 4513
+ 0.000274658
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.1686
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.051
+ 6
+ 0
+ Feature Node
+ N/A
+ 2332894.8492009663
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1364.0","main.cluster index_upperinput":"1364.0"}
+ 1364
+ 26.051
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=44&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 343.2951
+ N/A
+ 0.0
+ 343.2951
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.5453
+ 5
+ 0
+ Feature Node
+ N/A
+ 730096.894340147
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8383.0","main.cluster index_upperinput":"8383.0"}
+ 8383
+ 6.5453
+ -1
+ This Node is a Singleton
+ N/A
+ 439.1576
+ N/A
+ 0.0
+ 439.1576
+
+
+ 24
+ 0.914941
+ CCMSLIB00005739719
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005739719
+ 1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0
+ qTof
+ 1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0.0
+ Massbank:PR303918 Arctigenin
+ COC1=C(OC)C=C(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005739719
+ 111
+ 0.24534099999999998
+ Feature Node
+ N/A
+ 24
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303918 Arctigenin
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4504.0","main.cluster index_upperinput":"4504.0"}
+ 0.24534099999999998
+ 3
+ COC1=C(OC)C=C(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)C=C1
+ Massbank
+ 3
+ 373.1651
+ CCMSLIB00005739719
+ 373.1651
+ 0.0
+ Massbank
+ 5912673.223655301
+ qTof
+ Isolated
+ 9.15527e-05
+ M+H
+ N/A
+ ESI
+ Positive
+ 19.4239
+ 7
+ 0.914941
+ 0.0
+ Isolated
+ 4504
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.4239
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.4758
+ 6
+ 0
+ Feature Node
+ N/A
+ 9027505.84605999
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4549.0","main.cluster index_upperinput":"4549.0"}
+ 4549
+ 13.4758
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 526.2637
+ N/A
+ 0.0
+ 526.2637
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.8355
+ 3
+ 0
+ Feature Node
+ N/A
+ 1151266.6802694597
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14013.0","main.cluster index_upperinput":"14013.0"}
+ 14013
+ 13.8355
+ -1
+ This Node is a Singleton
+ N/A
+ 430.2215
+ N/A
+ 0.0
+ 430.2215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.8996
+ 3
+ 0
+ Feature Node
+ N/A
+ 7681202.94481804
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13607.0","main.cluster index_upperinput":"13607.0"}
+ 13607
+ 20.8996
+ -1
+ This Node is a Singleton
+ N/A
+ 383.1467
+ N/A
+ 0.0
+ 383.1467
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.976
+ 6
+ 0
+ Feature Node
+ N/A
+ 1037646.1295271566
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1429.0","main.cluster index_upperinput":"1429.0"}
+ 1429
+ 26.976
+ -1
+ This Node is a Singleton
+ N/A
+ 310.2364
+ N/A
+ 0.0
+ 310.2364
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.9538
+ 4
+ 0
+ Feature Node
+ N/A
+ 814263.938237379
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2559.0","main.cluster index_upperinput":"2559.0"}
+ 2559
+ 17.9538
+ -1
+ This Node is a Singleton
+ N/A
+ 417.1884
+ N/A
+ 0.0
+ 417.1884
+
+
+ 9
+ 0.8853989999999999
+ CCMSLIB00004705056
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705056
+ InChI=1S/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18-,20+,21-,24-/m1/s1
+ 0
+ ESI-QFT
+ InChI=1S/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18-,20+,21-,24-/m1/s1
+ 0.0
+ Iridin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705056
+ 7
+ 0.816688
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF013993
+ Iridin
+ positive
+ MoNA:VF-NPL-QEHF013993
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3534.0","main.cluster index_upperinput":"3534.0"}
+ 0.816688
+ 3
+ N/A
+ MoNA
+ 3
+ 523.1446
+ CCMSLIB00004705056
+ 523.1446
+ 0.0
+ MoNA
+ 1131055.0315693982
+ ESI-QFT
+ isolated
+ 0.000427246
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 16.8601
+ 3
+ 0.8853989999999999
+ 0.0
+ isolated
+ 3534
+ 0.000427246
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.8601
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.385
+ 6
+ 0
+ Feature Node
+ N/A
+ 1030707.3583318568
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13935.0","main.cluster index_upperinput":"13935.0"}
+ 13935
+ 18.385
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=25&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 833.3
+ N/A
+ 0.0
+ 833.3
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0447
+ 5
+ 0
+ Feature Node
+ N/A
+ 3182049.3725127103
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1339.0","main.cluster index_upperinput":"1339.0"}
+ 1339
+ 18.0447
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 520.2535
+ N/A
+ 0.0
+ 520.2535
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.738
+ 2
+ 0
+ Feature Node
+ N/A
+ 398427.40969867
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8154.0","main.cluster index_upperinput":"8154.0"}
+ 8154
+ 2.738
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=104&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 611.2374
+ N/A
+ 0.0
+ 611.2374
+
+
+ 9
+ 0.704022
+ CCMSLIB00003135014
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135014
+ InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2
+ 0
+ qTof
+ InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2
+ 0.0
+ Spectral Match to 3-(2-Hydroxyethyl)indole from NIST14
+ C1=CC=C2C(=C1)C(=CN2)CCO
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135014
+ 422
+ 0.635425
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ Data deposited by quinnr
+ Spectral Match to 3-(2-Hydroxyethyl)indole from NIST14
+ Positive
+ Data deposited by quinnr
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"28840.0","main.cluster index_upperinput":"28840.0"}
+ 0.635425
+ 3
+ C1=CC=C2C(=C1)C(=CN2)CCO
+ Data from Dorrestein/Knight
+ 3
+ 144.0809
+ CCMSLIB00003135014
+ 144.0809
+ 0.0
+ Data from Dorrestein/Knight
+ 1054941.8180955078
+ qTof
+ Isolated
+ 9.15527e-05
+ M+H-H2O
+ N/A
+ ESI
+ Positive
+ 2.1327
+ 5
+ 0.704022
+ 0.0
+ Isolated
+ 28840
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 2.1327
+ 0.0
+ M+H-H2O
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.2595
+ 9
+ 0
+ Feature Node
+ N/A
+ 2913945.0717389337
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3581.0","main.cluster index_upperinput":"3581.0"}
+ 3581
+ 2.2595
+ -1
+ This Node is a Singleton
+ N/A
+ 188.0705
+ N/A
+ 0.0
+ 188.0705
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4946
+ 9
+ 0
+ Feature Node
+ N/A
+ 13130881.412980482
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2502.0","main.cluster index_upperinput":"2502.0"}
+ 2502
+ 28.4946
+ -1
+ This Node is a Singleton
+ N/A
+ 317.2086
+ N/A
+ 0.0
+ 317.2086
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.2163
+ 4
+ 0
+ Feature Node
+ N/A
+ 2999511.8213226944
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3567.0","main.cluster index_upperinput":"3567.0"}
+ 3567
+ 20.2163
+ -1
+ This Node is a Singleton
+ N/A
+ 323.0521
+ N/A
+ 0.0
+ 323.0521
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.5694
+ 1
+ 0
+ Feature Node
+ N/A
+ 1028965.726416392
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7737.0","main.cluster index_upperinput":"7737.0"}
+ 7737
+ 20.5694
+ -1
+ This Node is a Singleton
+ N/A
+ 819.2175
+ N/A
+ 0.0
+ 819.2175
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.1675
+ 5
+ 0
+ Feature Node
+ N/A
+ 2901436.863805427
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1523.0","main.cluster index_upperinput":"1523.0"}
+ 1523
+ 34.1675
+ -1
+ This Node is a Singleton
+ N/A
+ 437.3593
+ N/A
+ 0.0
+ 437.3593
+
+
+ 8
+ 0.794405
+ CCMSLIB00005742378
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0
+ qTof
+ 1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19+,20-,23+/m1/s1
+ 0.0
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005742378
+ 53
+ 0.77923
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR302193 Syringetin-3-O-glucoside
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3528.0","main.cluster index_upperinput":"3528.0"}
+ 0.77923
+ 3
+ COC1=CC(=CC(OC)=C1O)C1=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C2=C(O)C=C(O)C=C2O1
+ Massbank
+ 3
+ 509.1286
+ CCMSLIB00005742378
+ 509.1286
+ 0.0
+ Massbank
+ 4987730.779616318
+ qTof
+ Isolated
+ 0.000396729
+ M+H
+ N/A
+ ESI
+ Positive
+ 15.1462
+ 7
+ 0.794405
+ 0.0
+ Isolated
+ 3528
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.1462
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6327
+ 2
+ 0
+ Feature Node
+ N/A
+ 618470.9102321024
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3557.0","main.cluster index_upperinput":"3557.0"}
+ 3557
+ 17.6327
+ -1
+ This Node is a Singleton
+ N/A
+ 559.1059
+ N/A
+ 0.0
+ 559.1059
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.5403
+ 1
+ 0
+ Feature Node
+ N/A
+ 3048097.770127635
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7636.0","main.cluster index_upperinput":"7636.0"}
+ 7636
+ 31.5403
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=24&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 665.368
+ N/A
+ 0.0
+ 665.368
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.7752
+ 4
+ 0
+ Feature Node
+ N/A
+ 869463.4921827872
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5090.0","main.cluster index_upperinput":"5090.0"}
+ 5090
+ 30.7752
+ 19
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=82&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 367.318
+ N/A
+ 0.0
+ 367.318
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.5892
+ 5
+ 0
+ Feature Node
+ N/A
+ 3550715.343363897
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4661.0","main.cluster index_upperinput":"4661.0"}
+ 4661
+ 11.5892
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 512.2491
+ N/A
+ 0.0
+ 512.2491
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.307
+ 7
+ 0
+ Feature Node
+ N/A
+ 3635665.892161077
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3766.0","main.cluster index_upperinput":"3766.0"}
+ 3766
+ 3.307
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 428.2273
+ N/A
+ 0.0
+ 428.2273
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1282
+ 3
+ 0
+ Feature Node
+ N/A
+ 353996.5104109944
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3597.0","main.cluster index_upperinput":"3597.0"}
+ 3597
+ 19.1282
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 551.1389
+ N/A
+ 0.0
+ 551.1389
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.9398
+ 8
+ 0
+ Feature Node
+ N/A
+ 10764912.503532806
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2630.0","main.cluster index_upperinput":"2630.0"}
+ 2630
+ 26.9398
+ -1
+ This Node is a Singleton
+ N/A
+ 391.2452
+ N/A
+ 0.0
+ 391.2452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.703
+ 5
+ 0
+ Feature Node
+ N/A
+ 3043476.88329294
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10239.0","main.cluster index_upperinput":"10239.0"}
+ 10239
+ 23.703
+ 117
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 422.2182
+ N/A
+ 0.0
+ 422.2182
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.8137
+ 1
+ 0
+ Feature Node
+ N/A
+ 646527.9817344587
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10316.0","main.cluster index_upperinput":"10316.0"}
+ 10316
+ 22.8137
+ -1
+ This Node is a Singleton
+ N/A
+ 427.1738
+ N/A
+ 0.0
+ 427.1738
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4144
+ 9
+ 0
+ Feature Node
+ N/A
+ 3278506.2319819415
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1503.0","main.cluster index_upperinput":"1503.0"}
+ 1503
+ 33.4144
+ -1
+ This Node is a Singleton
+ N/A
+ 393.2984
+ N/A
+ 0.0
+ 393.2984
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0549
+ 8
+ 0
+ Feature Node
+ N/A
+ 4038686.4506001417
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10446.0","main.cluster index_upperinput":"10446.0"}
+ 10446
+ 34.0549
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 423.3615
+ N/A
+ 0.0
+ 423.3615
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.9541
+ 8
+ 0
+ Feature Node
+ N/A
+ 4040342.390257119
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2805.0","main.cluster index_upperinput":"2805.0"}
+ 2805
+ 32.9541
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 494.4053
+ N/A
+ 0.0
+ 494.4053
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.756
+ 8
+ 0
+ Feature Node
+ N/A
+ 12761533.132809265
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"33.0","main.cluster index_upperinput":"33.0"}
+ 33
+ 34.756
+ -1
+ This Node is a Singleton
+ N/A
+ 485.3606
+ N/A
+ 0.0
+ 485.3606
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.9271
+ 8
+ 0
+ Feature Node
+ N/A
+ 2196423.725286804
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"155.0","main.cluster index_upperinput":"155.0"}
+ 155
+ 24.9271
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=68&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 219.1743
+ N/A
+ 0.0
+ 219.1743
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.5262
+ 2
+ 0
+ Feature Node
+ N/A
+ 277649.8913123118
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7879.0","main.cluster index_upperinput":"7879.0"}
+ 7879
+ 26.5262
+ -1
+ This Node is a Singleton
+ N/A
+ 655.3818
+ N/A
+ 0.0
+ 655.3818
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.507
+ 6
+ 0
+ Feature Node
+ N/A
+ 5534117.149190869
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4539.0","main.cluster index_upperinput":"4539.0"}
+ 4539
+ 30.507
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 395.3661
+ N/A
+ 0.0
+ 395.3661
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8619
+ 4
+ 0
+ Feature Node
+ N/A
+ 487245.7375238376
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2561.0","main.cluster index_upperinput":"2561.0"}
+ 2561
+ 23.8619
+ -1
+ This Node is a Singleton
+ N/A
+ 229.1217
+ N/A
+ 0.0
+ 229.1217
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.933
+ 1
+ 0
+ Feature Node
+ N/A
+ 845581.5857207144
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7762.0","main.cluster index_upperinput":"7762.0"}
+ 7762
+ 21.933
+ -1
+ This Node is a Singleton
+ N/A
+ 762.2891
+ N/A
+ 0.0
+ 762.2891
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.3444
+ 3
+ 0
+ Feature Node
+ N/A
+ 5781141.223056713
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13724.0","main.cluster index_upperinput":"13724.0"}
+ 13724
+ 13.3444
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 472.232
+ N/A
+ 0.0
+ 472.232
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.0285
+ 8
+ 0
+ Feature Node
+ N/A
+ 7180779.93779882
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13714.0","main.cluster index_upperinput":"13714.0"}
+ 13714
+ 25.0285
+ -1
+ This Node is a Singleton
+ N/A
+ 367.245
+ N/A
+ 0.0
+ 367.245
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.4549
+ 7
+ 0
+ Feature Node
+ N/A
+ 7061768.350064984
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"284.0","main.cluster index_upperinput":"284.0"}
+ 284
+ 30.4549
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 409.3821
+ N/A
+ 0.0
+ 409.3821
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.8355
+ 4
+ 0
+ Feature Node
+ N/A
+ 496205.7560606825
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10352.0","main.cluster index_upperinput":"10352.0"}
+ 10352
+ 20.8355
+ -1
+ This Node is a Singleton
+ N/A
+ 483.2203
+ N/A
+ 0.0
+ 483.2203
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9288
+ 1
+ 0
+ Feature Node
+ N/A
+ 14538054.446879866
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7622.0","main.cluster index_upperinput":"7622.0"}
+ 7622
+ 14.9288
+ -1
+ This Node is a Singleton
+ N/A
+ 421.1029
+ N/A
+ 0.0
+ 421.1029
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1038
+ 9
+ 0
+ Feature Node
+ N/A
+ 3453109.1389056193
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5935.0","main.cluster index_upperinput":"5935.0"}
+ 5935
+ 26.1038
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9672
+ N/A
+ 0.0
+ 126.9672
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.5689
+ 7
+ 0
+ Feature Node
+ N/A
+ 12405491.94150471
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7845.0","main.cluster index_upperinput":"7845.0"}
+ 7845
+ 11.5689
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 464.2252
+ N/A
+ 0.0
+ 464.2252
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.5876
+ 8
+ 0
+ Feature Node
+ N/A
+ 3722362.60485438
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"53.0","main.cluster index_upperinput":"53.0"}
+ 53
+ 33.5876
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=73&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3726
+ N/A
+ 0.0
+ 429.3726
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.1663
+ 9
+ 0
+ Feature Node
+ N/A
+ 3849265.979198103
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1604.0","main.cluster index_upperinput":"1604.0"}
+ 1604
+ 30.1663
+ 443
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 542.3225
+ N/A
+ 0.0
+ 542.3225
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.3444
+ 7
+ 0
+ Feature Node
+ N/A
+ 2051258.8020990477
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2879.0","main.cluster index_upperinput":"2879.0"}
+ 2879
+ 31.3444
+ -1
+ This Node is a Singleton
+ N/A
+ 499.3745
+ N/A
+ 0.0
+ 499.3745
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.816
+ 7
+ 0
+ Feature Node
+ N/A
+ 8158529.929410027
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4525.0","main.cluster index_upperinput":"4525.0"}
+ 4525
+ 21.816
+ 445
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 809.3525
+ N/A
+ 0.0
+ 809.3525
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.7605
+ 9
+ 0
+ Feature Node
+ N/A
+ 10014301.679710811
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"30.0","main.cluster index_upperinput":"30.0"}
+ 30
+ 31.7605
+ -1
+ This Node is a Singleton
+ N/A
+ 360.3234
+ N/A
+ 0.0
+ 360.3234
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.2635
+ 8
+ 0
+ Feature Node
+ N/A
+ 3401344.9023944493
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"36.0","main.cluster index_upperinput":"36.0"}
+ 36
+ 24.2635
+ -1
+ This Node is a Singleton
+ N/A
+ 317.1722
+ N/A
+ 0.0
+ 317.1722
+
+
+ 11
+ 0.836585
+ CCMSLIB00006377815
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006377815
+ InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H
+ 0
+ Orbitrap
+ InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H
+ 0.0
+ Quercetin
+ O=C1C(O)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=C(O)C3
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00006377815
+ -1
+ 1.00701
+ Feature Node
+ N/A
+ 11
+ 0.0
+ 0.0
+ BMDMS-NP
+ Quercetin
+ Positive
+ BMDMS-NP
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13869.0","main.cluster index_upperinput":"13869.0"}
+ 1.00701
+ 1
+ O=C1C(O)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=C(O)C3
+ BMDMS-NP
+ 1
+ 303.0503
+ CCMSLIB00006377815
+ 303.0503
+ 0.0
+ BMDMS-NP
+ 1176644.1532411298
+ Orbitrap
+ Commercial standard
+ 0.000305176
+ [M+H]+
+ N/A
+ ESI
+ Positive
+ 15.8193
+ 3
+ 0.836585
+ 0.0
+ Commercial standard
+ 13869
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.8193
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 5.1242
+ 3
+ 0
+ Feature Node
+ N/A
+ 2850740.6247571292
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"26406.0","main.cluster index_upperinput":"26406.0"}
+ 26406
+ 5.1242
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 496.2182
+ N/A
+ 0.0
+ 496.2182
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6385
+ 8
+ 0
+ Feature Node
+ N/A
+ 5593702.528212339
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4679.0","main.cluster index_upperinput":"4679.0"}
+ 4679
+ 32.6385
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 656.5297
+ N/A
+ 0.0
+ 656.5297
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.728
+ 7
+ 0
+ Feature Node
+ N/A
+ 2294286.31350053
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4732.0","main.cluster index_upperinput":"4732.0"}
+ 4732
+ 13.728
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 229.1221
+ N/A
+ 0.0
+ 229.1221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2795
+ 7
+ 0
+ Feature Node
+ N/A
+ 5028171.3703986425
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2649.0","main.cluster index_upperinput":"2649.0"}
+ 2649
+ 33.2795
+ 115
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=47&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 625.2669
+ N/A
+ 0.0
+ 625.2669
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.688
+ 3
+ 0
+ Feature Node
+ N/A
+ 12934536.672602829
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7625.0","main.cluster index_upperinput":"7625.0"}
+ 7625
+ 24.688
+ -1
+ This Node is a Singleton
+ N/A
+ 679.1795
+ N/A
+ 0.0
+ 679.1795
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.2503
+ 8
+ 0
+ Feature Node
+ N/A
+ 78718458.26638679
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"46.0","main.cluster index_upperinput":"46.0"}
+ 46
+ 34.2503
+ -1
+ This Node is a Singleton
+ N/A
+ 413.2665
+ N/A
+ 0.0
+ 413.2665
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8795
+ 9
+ 0
+ Feature Node
+ N/A
+ 6704953.617114445
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1511.0","main.cluster index_upperinput":"1511.0"}
+ 1511
+ 32.8795
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 283.2634
+ N/A
+ 0.0
+ 283.2634
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.1098
+ 4
+ 0
+ Feature Node
+ N/A
+ 406611.9740822153
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4775.0","main.cluster index_upperinput":"4775.0"}
+ 4775
+ 12.1098
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 446.2227
+ N/A
+ 0.0
+ 446.2227
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.9491
+ 5
+ 0
+ Feature Node
+ N/A
+ 1333991.2634390246
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4831.0","main.cluster index_upperinput":"4831.0"}
+ 4831
+ 12.9491
+ -1
+ This Node is a Singleton
+ N/A
+ 331.1541
+ N/A
+ 0.0
+ 331.1541
+
+
+ 59
+ 0.712322
+ CCMSLIB00004705105
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705105
+ InChI=1S/C27H44O7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17,19-22,29-34H,6-11,13-14H2,1-5H3/t15-,17-,19+,20-,21-,22+,24+,25+,26+,27+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H44O7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17,19-22,29-34H,6-11,13-14H2,1-5H3/t15-,17-,19+,20-,21-,22+,24+,25+,26+,27+/m0/s1
+ 0.0
+ CRUSTECDYSONE
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004705105
+ -1
+ 0.824258
+ Feature Node
+ N/A
+ 59
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF014042
+ CRUSTECDYSONE
+ positive
+ MoNA:VF-NPL-QEHF014042
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13666.0","main.cluster index_upperinput":"13666.0"}
+ 0.824258
+ 3
+ N/A
+ MoNA
+ 3
+ 481.3156
+ CCMSLIB00004705105
+ 481.3156
+ 0.0
+ MoNA
+ 5610544.476596168
+ ESI-QFT
+ isolated
+ 0.000396729
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 14.8506
+ 1
+ 0.712322
+ 0.0
+ isolated
+ 13666
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=90&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.8506
+ 0.0
+ [M+H]+
+
+
+ 9
+ 0.8716709999999999
+ CCMSLIB00005738688
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0
+ qTof
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0.0
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 5
+ 0.6557470000000001
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"914.0","main.cluster index_upperinput":"914.0"}
+ 0.6557470000000001
+ 3
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ Massbank
+ 3
+ 279.2318
+ CCMSLIB00005738688
+ 279.2318
+ 0.0
+ Massbank
+ 15099986.047164313
+ qTof
+ Isolated
+ 0.000183105
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.3422
+ 9
+ 0.8716709999999999
+ 0.0
+ Isolated
+ 914
+ 0.000183105
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.3422
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.6019
+ 3
+ 0
+ Feature Node
+ N/A
+ 554957.226405934
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7810.0","main.cluster index_upperinput":"7810.0"}
+ 7810
+ 18.6019
+ 453
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 432.2018
+ N/A
+ 0.0
+ 432.2018
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.1001
+ 6
+ 0
+ Feature Node
+ N/A
+ 472047.20388648333
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7780.0","main.cluster index_upperinput":"7780.0"}
+ 7780
+ 22.1001
+ -1
+ This Node is a Singleton
+ N/A
+ 521.2715
+ N/A
+ 0.0
+ 521.2715
+
+
+ 42
+ 0.739524
+ CCMSLIB00000852963
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852963
+ InChI=1S/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h9-14,16-17H,1-5H2/t9-,10-,11+,12-,13+,14+/m0/s1
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h9-14,16-17H,1-5H2/t9-,10-,11+,12-,13+,14+/m0/s1
+ 0.0
+ NCGC00169726-02_C15H18O4_(3aR,4R,6aR,8S,9aR,9bR)-4,8-Dihydroxy-3,6,9-tris(methylene)decahydroazuleno[4,5-b]furan-2(3H)-one
+ O[C@@H]1CC(=C)[C@@H]2C[C@H](O)C(=C)[C@@H]2[C@H]3OC(=O)C(=C)[C@H]13
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852963
+ 99
+ 2.86355
+ Feature Node
+ N/A
+ 42
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00169726-02_C15H18O4_(3aR,4R,6aR,8S,9aR,9bR)-4,8-Dihydroxy-3,6,9-tris(methylene)decahydroazuleno[4,5-b]furan-2(3H)-one
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7628.0","main.cluster index_upperinput":"7628.0"}
+ 2.86355
+ 1
+ O[C@@H]1CC(=C)[C@@H]2C[C@H](O)C(=C)[C@@H]2[C@H]3OC(=O)C(=C)[C@H]13
+ Jadhav/Dorrestein
+ 1
+ 245.1177
+ CCMSLIB00000852963
+ 245.1177
+ 0.0
+ Jadhav/Dorrestein
+ 6853506.5163230095
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.0007019039999999999
+ M-H2O+H
+ N/A
+ LC-ESI
+ positive
+ 18.0626
+ 6
+ 0.739524
+ 0.0
+ isolated
+ 7628
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.0626
+ 0.0
+ M-H2O+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.8798
+ 7
+ 0
+ Feature Node
+ N/A
+ 25523743.654954515
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1246.0","main.cluster index_upperinput":"1246.0"}
+ 1246
+ 32.8798
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 959.5715
+ N/A
+ 0.0
+ 959.5715
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.5004
+ 7
+ 0
+ Feature Node
+ N/A
+ 1881702.2328941296
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2712.0","main.cluster index_upperinput":"2712.0"}
+ 2712
+ 15.5004
+ 1
+ This Node is a Singleton
+ N/A
+ 496.2529
+ N/A
+ 0.0
+ 496.2529
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2107
+ 3
+ 0
+ Feature Node
+ N/A
+ 2202693.330194623
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"48.0","main.cluster index_upperinput":"48.0"}
+ 48
+ 33.2107
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=36&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 954.6068
+ N/A
+ 0.0
+ 954.6068
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.7499
+ 9
+ 0
+ Feature Node
+ N/A
+ 4635021.944554756
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1248.0","main.cluster index_upperinput":"1248.0"}
+ 1248
+ 3.7499
+ 422
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 144.0807
+ N/A
+ 0.0
+ 144.0807
+
+
+ 9
+ 0.8904719999999999
+ CCMSLIB00000221138
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000221138
+ 1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H
+ 0
+ LC-Q-TOF/MS
+ 1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H
+ 0.0
+ ReSpect:PT103933 Apigenin|Apig|4',5,7-trihydroxyflavone|Apigenol|Chamomile|5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone|Naringenin Chalcone|5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000221138
+ 456
+ 1.46361
+ Feature Node
+ N/A
+ 9
+ 0.0
+ 0.0
+ ReSpect
+ ReSpect:PT103933 Apigenin|Apig|4',5,7-trihydroxyflavone|Apigenol|Chamomile|5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone|Naringenin Chalcone|5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ Positive
+ ReSpect
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1183.0","main.cluster index_upperinput":"1183.0"}
+ 1.46361
+ 3
+ C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
+ Putative ReSpect Match
+ 3
+ 271.0606
+ CCMSLIB00000221138
+ 271.0606
+ 0.0
+ Putative ReSpect Match
+ 5559069.247025287
+ LC-Q-TOF/MS
+ Isolated
+ 0.000396729
+ [M+H]
+ N/A
+ ESI
+ Positive
+ 20.0821
+ 7
+ 0.8904719999999999
+ 0.0
+ Isolated
+ 1183
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 20.0821
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.4786
+ 9
+ 0
+ Feature Node
+ N/A
+ 53174239.119865336
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6.0","main.cluster index_upperinput":"6.0"}
+ 6
+ 34.4786
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=99&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 781.1919
+ N/A
+ 0.0
+ 781.1919
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.4928
+ 8
+ 0
+ Feature Node
+ N/A
+ 2330368.9224305814
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"11194.0","main.cluster index_upperinput":"11194.0"}
+ 11194
+ 26.4928
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 84.9454
+ N/A
+ 0.0
+ 84.9454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.3229
+ 7
+ 0
+ Feature Node
+ N/A
+ 2859084.691543487
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3714.0","main.cluster index_upperinput":"3714.0"}
+ 3714
+ 3.3229
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 336.2164
+ N/A
+ 0.0
+ 336.2164
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.322
+ 9
+ 0
+ Feature Node
+ N/A
+ 24368158.024731725
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"779.0","main.cluster index_upperinput":"779.0"}
+ 779
+ 31.322
+ -1
+ This Node is a Singleton
+ N/A
+ 301.2136
+ N/A
+ 0.0
+ 301.2136
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.8226
+ 4
+ 0
+ Feature Node
+ N/A
+ 1455564.2563759838
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1196.0","main.cluster index_upperinput":"1196.0"}
+ 1196
+ 16.8226
+ 111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 376.1753
+ N/A
+ 0.0
+ 376.1753
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.82
+ 7
+ 0
+ Feature Node
+ N/A
+ 3683105.9045907273
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5084.0","main.cluster index_upperinput":"5084.0"}
+ 5084
+ 13.82
+ 16
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 151.0387
+ N/A
+ 0.0
+ 151.0387
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.2617
+ 5
+ 0
+ Feature Node
+ N/A
+ 1645957.1768183797
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13794.0","main.cluster index_upperinput":"13794.0"}
+ 13794
+ 13.2617
+ -1
+ This Node is a Singleton
+ N/A
+ 323.1486
+ N/A
+ 0.0
+ 323.1486
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.3451
+ 4
+ 0
+ Feature Node
+ N/A
+ 1589489.1557533476
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13816.0","main.cluster index_upperinput":"13816.0"}
+ 13816
+ 25.3451
+ 98
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=112&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 731.3459
+ N/A
+ 0.0
+ 731.3459
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.8897
+ 3
+ 0
+ Feature Node
+ N/A
+ 3659953.090500396
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7707.0","main.cluster index_upperinput":"7707.0"}
+ 7707
+ 34.8897
+ -1
+ This Node is a Singleton
+ N/A
+ 738.5493
+ N/A
+ 0.0
+ 738.5493
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.8688
+ 5
+ 0
+ Feature Node
+ N/A
+ 308045.3079436157
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3623.0","main.cluster index_upperinput":"3623.0"}
+ 3623
+ 18.8688
+ -1
+ This Node is a Singleton
+ N/A
+ 586.2648
+ N/A
+ 0.0
+ 586.2648
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.7345
+ 1
+ 0
+ Feature Node
+ N/A
+ 3113551.358743947
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7637.0","main.cluster index_upperinput":"7637.0"}
+ 7637
+ 30.7345
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=24&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 663.3528
+ N/A
+ 0.0
+ 663.3528
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.1874
+ 2
+ 0
+ Feature Node
+ N/A
+ 1270868.4108238458
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4556.0","main.cluster index_upperinput":"4556.0"}
+ 4556
+ 15.1874
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 425.2427
+ N/A
+ 0.0
+ 425.2427
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.5863
+ 8
+ 0
+ Feature Node
+ N/A
+ 2166666.0767047647
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"61.0","main.cluster index_upperinput":"61.0"}
+ 61
+ 25.5863
+ -1
+ This Node is a Singleton
+ N/A
+ 355.2454
+ N/A
+ 0.0
+ 355.2454
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.2947
+ 4
+ 0
+ Feature Node
+ N/A
+ 1876611.7328269212
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1182.0","main.cluster index_upperinput":"1182.0"}
+ 1182
+ 18.2947
+ 2
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 461.1077
+ N/A
+ 0.0
+ 461.1077
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.2416
+ 4
+ 0
+ Feature Node
+ N/A
+ 1871734.189313318
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10299.0","main.cluster index_upperinput":"10299.0"}
+ 10299
+ 13.2416
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 434.2529
+ N/A
+ 0.0
+ 434.2529
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.1891
+ 7
+ 0
+ Feature Node
+ N/A
+ 11768549.039192425
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1345.0","main.cluster index_upperinput":"1345.0"}
+ 1345
+ 11.1891
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 197.117
+ N/A
+ 0.0
+ 197.117
+
+
+ 25
+ 0.819992
+ CCMSLIB00004718161
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718161
+ InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3
+ 0
+ ESI-QTOF
+ InChI=1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3
+ 0.0
+ cirsimaritin
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004718161
+ 166
+ 1.25911
+ Feature Node
+ N/A
+ 25
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QTOF000610
+ cirsimaritin
+ positive
+ MoNA:VF-NPL-QTOF000610
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1157.0","main.cluster index_upperinput":"1157.0"}
+ 1.25911
+ 3
+ N/A
+ MoNA
+ 3
+ 315.0864
+ CCMSLIB00004718161
+ 315.0864
+ 0.0
+ MoNA
+ 5946004.116581957
+ ESI-QTOF
+ isolated
+ 0.000396729
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 21.4528
+ 6
+ 0.819992
+ 0.0
+ isolated
+ 1157
+ 0.000396729
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.4528
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.3334
+ 3
+ 0
+ Feature Node
+ N/A
+ 2451942.760257565
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10251.0","main.cluster index_upperinput":"10251.0"}
+ 10251
+ 17.3334
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 480.2583
+ N/A
+ 0.0
+ 480.2583
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9171
+ 9
+ 0
+ Feature Node
+ N/A
+ 4097035.8289681943
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2653.0","main.cluster index_upperinput":"2653.0"}
+ 2653
+ 33.9171
+ -1
+ This Node is a Singleton
+ N/A
+ 333.2765
+ N/A
+ 0.0
+ 333.2765
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.8988
+ 3
+ 0
+ Feature Node
+ N/A
+ 845097.052697124
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7795.0","main.cluster index_upperinput":"7795.0"}
+ 7795
+ 26.8988
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 514.3885
+ N/A
+ 0.0
+ 514.3885
+
+
+ 8
+ 0.918408
+ CCMSLIB00000221138
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000221138
+ 1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H
+ 0
+ LC-Q-TOF/MS
+ 1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H
+ 0.0
+ ReSpect:PT103933 Apigenin|Apig|4',5,7-trihydroxyflavone|Apigenol|Chamomile|5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone|Naringenin Chalcone|5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000221138
+ 456
+ 0.0
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ ReSpect
+ ReSpect:PT103933 Apigenin|Apig|4',5,7-trihydroxyflavone|Apigenol|Chamomile|5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone|Naringenin Chalcone|5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ Positive
+ ReSpect
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4520.0","main.cluster index_upperinput":"4520.0"}
+ 0.0
+ 3
+ C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
+ Putative ReSpect Match
+ 3
+ 271.061
+ CCMSLIB00000221138
+ 271.061
+ 0.0
+ Putative ReSpect Match
+ 3112411.1219316716
+ LC-Q-TOF/MS
+ Isolated
+ 0.0
+ [M+H]
+ N/A
+ ESI
+ Positive
+ 21.0356
+ 8
+ 0.918408
+ 0.0
+ Isolated
+ 4520
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=71&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.0356
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.0389
+ 5
+ 0
+ Feature Node
+ N/A
+ 243388.22033986507
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3634.0","main.cluster index_upperinput":"3634.0"}
+ 3634
+ 23.0389
+ -1
+ This Node is a Singleton
+ N/A
+ 427.1728
+ N/A
+ 0.0
+ 427.1728
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.918
+ 6
+ 0
+ Feature Node
+ N/A
+ 484075.12668842316
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4929.0","main.cluster index_upperinput":"4929.0"}
+ 4929
+ 22.918
+ -1
+ This Node is a Singleton
+ N/A
+ 439.2658
+ N/A
+ 0.0
+ 439.2658
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9953
+ 1
+ 0
+ Feature Node
+ N/A
+ 1945737.7136965247
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13744.0","main.cluster index_upperinput":"13744.0"}
+ 13744
+ 19.9953
+ 470
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=42&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 488.228
+ N/A
+ 0.0
+ 488.228
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7783
+ 5
+ 0
+ Feature Node
+ N/A
+ 515122.2381787443
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8851.0","main.cluster index_upperinput":"8851.0"}
+ 8851
+ 21.7783
+ -1
+ This Node is a Singleton
+ N/A
+ 353.0634
+ N/A
+ 0.0
+ 353.0634
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.7908
+ 5
+ 0
+ Feature Node
+ N/A
+ 2851063.6239308636
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3626.0","main.cluster index_upperinput":"3626.0"}
+ 3626
+ 31.7908
+ -1
+ This Node is a Singleton
+ N/A
+ 455.3366
+ N/A
+ 0.0
+ 455.3366
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.559
+ 1
+ 0
+ Feature Node
+ N/A
+ 159699.55099075413
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"264.0","main.cluster index_upperinput":"264.0"}
+ 264
+ 21.559
+ -1
+ This Node is a Singleton
+ N/A
+ 593.1866
+ N/A
+ 0.0
+ 593.1866
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.7014
+ 1
+ 0
+ Feature Node
+ N/A
+ 206617.8875694272
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8126.0","main.cluster index_upperinput":"8126.0"}
+ 8126
+ 4.7014
+ -1
+ This Node is a Singleton
+ N/A
+ 496.2008
+ N/A
+ 0.0
+ 496.2008
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.259
+ 9
+ 0
+ Feature Node
+ N/A
+ 1258650.0846197593
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1499.0","main.cluster index_upperinput":"1499.0"}
+ 1499
+ 26.259
+ -1
+ This Node is a Singleton
+ N/A
+ 259.1674
+ N/A
+ 0.0
+ 259.1674
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6907
+ 9
+ 0
+ Feature Node
+ N/A
+ 32308209.363404583
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2566.0","main.cluster index_upperinput":"2566.0"}
+ 2566
+ 30.6907
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 570.4573
+ N/A
+ 0.0
+ 570.4573
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.0682
+ 2
+ 0
+ Feature Node
+ N/A
+ 649519.5179768108
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7698.0","main.cluster index_upperinput":"7698.0"}
+ 7698
+ 29.0682
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=125&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 585.3039
+ N/A
+ 0.0
+ 585.3039
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.392
+ 2
+ 0
+ Feature Node
+ N/A
+ 10142084.553771261
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13610.0","main.cluster index_upperinput":"13610.0"}
+ 13610
+ 15.392
+ 359
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 467.2181
+ N/A
+ 0.0
+ 467.2181
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.5955
+ 5
+ 0
+ Feature Node
+ N/A
+ 13107874.820961185
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1555.0","main.cluster index_upperinput":"1555.0"}
+ 1555
+ 15.5955
+ 1
+ This Node is a Singleton
+ N/A
+ 478.2435
+ N/A
+ 0.0
+ 478.2435
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.8287
+ 4
+ 0
+ Feature Node
+ N/A
+ 996411.924837827
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1240.0","main.cluster index_upperinput":"1240.0"}
+ 1240
+ 12.8287
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 526.2639
+ N/A
+ 0.0
+ 526.2639
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.2451
+ 7
+ 0
+ Feature Node
+ N/A
+ 3217668.890262785
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1376.0","main.cluster index_upperinput":"1376.0"}
+ 1376
+ 4.2451
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 398.2167
+ N/A
+ 0.0
+ 398.2167
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.0998
+ 6
+ 0
+ Feature Node
+ N/A
+ 2458290.1741112764
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1170.0","main.cluster index_upperinput":"1170.0"}
+ 1170
+ 24.0998
+ 477
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 329.1025
+ N/A
+ 0.0
+ 329.1025
+
+
+ 16
+ 0.84259
+ CCMSLIB00005768077
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005768077
+ 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
+ 0
+ Hybrid FT
+ 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
+ 0.0
+ Massbank:NA001474 Matairesinol
+ COC1=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC=C(O)C(OC)=C2)=CC=C1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005768077
+ 111
+ 1.69944
+ Feature Node
+ N/A
+ 16
+ 0.0
+ 0.0
+ Massbank
+ Massbank:NA001474 Matairesinol
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4507.0","main.cluster index_upperinput":"4507.0"}
+ 1.69944
+ 3
+ COC1=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC=C(O)C(OC)=C2)=CC=C1O
+ Massbank
+ 3
+ 359.1496
+ CCMSLIB00005768077
+ 359.1496
+ 0.0
+ Massbank
+ 6096761.125805867
+ Hybrid FT
+ Isolated
+ 0.000610352
+ M+H
+ N/A
+ ESI
+ Positive
+ 17.7525
+ 5
+ 0.84259
+ 0.0
+ Isolated
+ 4507
+ 0.000610352
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 17.7525
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.4985
+ 3
+ 0
+ Feature Node
+ N/A
+ 760804.454121086
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5054.0","main.cluster index_upperinput":"5054.0"}
+ 5054
+ 15.4985
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 414.2473
+ N/A
+ 0.0
+ 414.2473
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.2503
+ 9
+ 0
+ Feature Node
+ N/A
+ 5855658.3397934595
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"49.0","main.cluster index_upperinput":"49.0"}
+ 49
+ 26.2503
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 277.1792
+ N/A
+ 0.0
+ 277.1792
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.1082
+ 3
+ 0
+ Feature Node
+ N/A
+ 1561522.1956955837
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4694.0","main.cluster index_upperinput":"4694.0"}
+ 4694
+ 16.1082
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.2487
+ N/A
+ 0.0
+ 536.2487
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.3709
+ 1
+ 0
+ Feature Node
+ N/A
+ 1988871.2022478841
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7690.0","main.cluster index_upperinput":"7690.0"}
+ 7690
+ 14.3709
+ 211
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 440.1919
+ N/A
+ 0.0
+ 440.1919
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.1212
+ 9
+ 0
+ Feature Node
+ N/A
+ 1952695.7375194118
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1738.0","main.cluster index_upperinput":"1738.0"}
+ 1738
+ 24.1212
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=23&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 275.1998
+ N/A
+ 0.0
+ 275.1998
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.7091
+ 4
+ 0
+ Feature Node
+ N/A
+ 1587109.978741709
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1335.0","main.cluster index_upperinput":"1335.0"}
+ 1335
+ 26.7091
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 514.3885
+ N/A
+ 0.0
+ 514.3885
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.917
+ 9
+ 0
+ Feature Node
+ N/A
+ 25071710.31461161
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1344.0","main.cluster index_upperinput":"1344.0"}
+ 1344
+ 27.917
+ -1
+ This Node is a Singleton
+ N/A
+ 317.2088
+ N/A
+ 0.0
+ 317.2088
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0117
+ 1
+ 0
+ Feature Node
+ N/A
+ 3077536.469322812
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13698.0","main.cluster index_upperinput":"13698.0"}
+ 13698
+ 18.0117
+ 60
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 526.2438
+ N/A
+ 0.0
+ 526.2438
+
+
+ 14
+ 0.8394860000000001
+ CCMSLIB00003136238
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0
+ QQQ
+ InChI=1S/C10H30O5Si5/c1-16(2)11-17(3,4)13-19(7,8)15-20(9,10)14-18(5,6)12-16/h1-10H3
+ 0.0
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003136238
+ 56
+ 1.8914099999999998
+ Feature Node
+ N/A
+ 14
+ 0.0
+ 0.0
+ Data deposited by marjo
+ Spectral Match to Cyclopentasiloxane, decamethyl- from NIST14
+ Positive
+ Data deposited by marjo
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4573.0","main.cluster index_upperinput":"4573.0"}
+ 1.8914099999999998
+ 3
+ C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
+ Data from Maria Maansson
+ 3
+ 371.1013
+ CCMSLIB00003136238
+ 371.1013
+ 0.0
+ Data from Maria Maansson
+ 11432784.806097012
+ QQQ
+ Isolated
+ 0.0007019039999999999
+ M+H
+ N/A
+ ESI
+ Positive
+ 34.4763
+ 6
+ 0.8394860000000001
+ 0.0
+ Isolated
+ 4573
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=93&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.4763
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.4123
+ 6
+ 0
+ Feature Node
+ N/A
+ 1915829.6121904906
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2824.0","main.cluster index_upperinput":"2824.0"}
+ 2824
+ 30.4123
+ -1
+ This Node is a Singleton
+ N/A
+ 483.3798
+ N/A
+ 0.0
+ 483.3798
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.0585
+ 6
+ 0
+ Feature Node
+ N/A
+ 2064226.4155160703
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1322.0","main.cluster index_upperinput":"1322.0"}
+ 1322
+ 15.0585
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 412.2324
+ N/A
+ 0.0
+ 412.2324
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.2142
+ 1
+ 0
+ Feature Node
+ N/A
+ 1786460.2964522126
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13754.0","main.cluster index_upperinput":"13754.0"}
+ 13754
+ 16.2142
+ 483
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=90&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 537.3055
+ N/A
+ 0.0
+ 537.3055
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.493
+ 2
+ 0
+ Feature Node
+ N/A
+ 1280291.7782708886
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13826.0","main.cluster index_upperinput":"13826.0"}
+ 13826
+ 17.493
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 740.3283
+ N/A
+ 0.0
+ 740.3283
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.3803
+ 9
+ 0
+ Feature Node
+ N/A
+ 8211091.962950429
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"144.0","main.cluster index_upperinput":"144.0"}
+ 144
+ 31.3803
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 554.176
+ N/A
+ 0.0
+ 554.176
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.6748
+ 4
+ 0
+ Feature Node
+ N/A
+ 647897.6109037921
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7760.0","main.cluster index_upperinput":"7760.0"}
+ 7760
+ 10.6748
+ 168
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 536.2056
+ N/A
+ 0.0
+ 536.2056
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9036
+ 7
+ 0
+ Feature Node
+ N/A
+ 7136748.895206897
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"311.0","main.cluster index_upperinput":"311.0"}
+ 311
+ 33.9036
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 425.3756
+ N/A
+ 0.0
+ 425.3756
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6034
+ 7
+ 0
+ Feature Node
+ N/A
+ 29285666.017621182
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3540.0","main.cluster index_upperinput":"3540.0"}
+ 3540
+ 30.6034
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 597.4123
+ N/A
+ 0.0
+ 597.4123
+
+
+ 8
+ 0.837822
+ CCMSLIB00005726386
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005726386
+ 1S/C19H38N2O3/c1-4-5-6-7-8-9-10-11-12-14-18(22)20-15-13-16-21(2,3)17-19(23)24/h4-17H2,1-3H3,(H-,20,22,23,24)/p+1
+ 0
+ Hybrid FT
+ 1S/C19H38N2O3/c1-4-5-6-7-8-9-10-11-12-14-18(22)20-15-13-16-21(2,3)17-19(23)24/h4-17H2,1-3H3,(H-,20,22,23,24)/p+1
+ 0.0
+ Massbank: Lauramidopropyl betaine|3-(Dodecanoylamino)propyl(carboxymethyl)dimethylammonium|carboxymethyl-[3-(dodecanoylamino)propyl]-dimethylazanium
+ CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC(O)=O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005726386
+ 5
+ 2.0446
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Massbank
+ Massbank: Lauramidopropyl betaine|3-(Dodecanoylamino)propyl(carboxymethyl)dimethylammonium|carboxymethyl-[3-(dodecanoylamino)propyl]-dimethylazanium
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"160.0","main.cluster index_upperinput":"160.0"}
+ 2.0446
+ 3
+ CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC(O)=O
+ Massbank
+ 3
+ 343.2953
+ CCMSLIB00005726386
+ 343.2953
+ 0.0
+ Massbank
+ 1652512.9267020319
+ Hybrid FT
+ Isolated
+ 0.0007019039999999999
+ M
+ N/A
+ ESI
+ Positive
+ 26.3292
+ 6
+ 0.837822
+ 0.0
+ Isolated
+ 160
+ 0.0007019039999999999
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=44&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 26.3292
+ 0.0
+ M
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.3127
+ 5
+ 0
+ Feature Node
+ N/A
+ 1638262.7100923914
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20868.0","main.cluster index_upperinput":"20868.0"}
+ 20868
+ 1.3127
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 430.1639
+ N/A
+ 0.0
+ 430.1639
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.9077
+ 3
+ 0
+ Feature Node
+ N/A
+ 3006710.3803407084
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7681.0","main.cluster index_upperinput":"7681.0"}
+ 7681
+ 1.9077
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=104&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 629.2478
+ N/A
+ 0.0
+ 629.2478
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.0595
+ 5
+ 0
+ Feature Node
+ N/A
+ 925620.7778586963
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10292.0","main.cluster index_upperinput":"10292.0"}
+ 10292
+ 21.0595
+ -1
+ This Node is a Singleton
+ N/A
+ 399.1987
+ N/A
+ 0.0
+ 399.1987
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.8005
+ 5
+ 0
+ Feature Node
+ N/A
+ 1238174.4810558478
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4536.0","main.cluster index_upperinput":"4536.0"}
+ 4536
+ 21.8005
+ 7
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 361.0927
+ N/A
+ 0.0
+ 361.0927
+
+
+ 6
+ 0.715584
+ CCMSLIB00003135173
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135173
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to 6-Methoxyluteolin from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003135173
+ 216
+ 6.6412
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Data deposited by lfnothias
+ Spectral Match to 6-Methoxyluteolin from NIST14
+ Positive
+ Data deposited by lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10324.0","main.cluster index_upperinput":"10324.0"}
+ 6.6412
+ 3
+ N/A
+ Data from Pieter Dorrestein;Ajit Jadhav
+ 3
+ 317.0659
+ CCMSLIB00003135173
+ 317.0659
+ 0.0
+ Data from Pieter Dorrestein;Ajit Jadhav
+ 2500317.3073869627
+ HCD
+ Isolated
+ 0.00210571
+ M+H
+ N/A
+ ESI
+ Positive
+ 19.7429
+ 7
+ 0.715584
+ 0.0
+ Isolated
+ 10324
+ 0.00210571
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.7429
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.1007
+ 5
+ 0
+ Feature Node
+ N/A
+ 1966459.9164168458
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13776.0","main.cluster index_upperinput":"13776.0"}
+ 13776
+ 26.1007
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=112&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 569.2947
+ N/A
+ 0.0
+ 569.2947
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.1849
+ 1
+ 0
+ Feature Node
+ N/A
+ 2309222.967759012
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7665.0","main.cluster index_upperinput":"7665.0"}
+ 7665
+ 14.1849
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 498.1893
+ N/A
+ 0.0
+ 498.1893
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.9986
+ 8
+ 0
+ Feature Node
+ N/A
+ 12893101.447830036
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1287.0","main.cluster index_upperinput":"1287.0"}
+ 1287
+ 34.9986
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=28&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 429.3727
+ N/A
+ 0.0
+ 429.3727
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.0985
+ 1
+ 0
+ Feature Node
+ N/A
+ 9611662.887105402
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13613.0","main.cluster index_upperinput":"13613.0"}
+ 13613
+ 15.0985
+ 483
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=90&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 501.2843
+ N/A
+ 0.0
+ 501.2843
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.2177
+ 7
+ 0
+ Feature Node
+ N/A
+ 2496066.8787167324
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4327.0","main.cluster index_upperinput":"4327.0"}
+ 4327
+ 2.2177
+ 422
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=108&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 144.0808
+ N/A
+ 0.0
+ 144.0808
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.8266
+ 9
+ 0
+ Feature Node
+ N/A
+ 14038481.12340129
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1244.0","main.cluster index_upperinput":"1244.0"}
+ 1244
+ 29.8266
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 309.2411
+ N/A
+ 0.0
+ 309.2411
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.3317
+ 7
+ 0
+ Feature Node
+ N/A
+ 3079919.5441019232
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10291.0","main.cluster index_upperinput":"10291.0"}
+ 10291
+ 29.3317
+ 443
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 540.3076
+ N/A
+ 0.0
+ 540.3076
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.1885
+ 7
+ 0
+ Feature Node
+ N/A
+ 12596999.115117373
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"9302.0","main.cluster index_upperinput":"9302.0"}
+ 9302
+ 35.1885
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 797.5184
+ N/A
+ 0.0
+ 797.5184
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.1892
+ 1
+ 0
+ Feature Node
+ N/A
+ 4973554.70633117
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7624.0","main.cluster index_upperinput":"7624.0"}
+ 7624
+ 21.1892
+ 361
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 400.1524
+ N/A
+ 0.0
+ 400.1524
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.3335
+ 4
+ 0
+ Feature Node
+ N/A
+ 502578.4016431629
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4914.0","main.cluster index_upperinput":"4914.0"}
+ 4914
+ 21.3335
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 646.4011
+ N/A
+ 0.0
+ 646.4011
+
+
+ 8
+ 0.815705
+ CCMSLIB00005738370
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738370
+ 1S/C17H30O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h8,10,12-15,17-19H,3-7,9,11H2,1-2H3,(H,20,21)/b10-8+
+ 0
+ qTof
+ 1S/C17H30O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h8,10,12-15,17-19H,3-7,9,11H2,1-2H3,(H,20,21)/b10-8+
+ 0.0
+ Massbank:RP010203 ascr#17|(E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid
+ CC(CCCCCC\\C=C\\C(O)=O)OC1OC(C)C(O)CC1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738370
+ -1
+ 40.4492
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP010203 ascr#17|(E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1178.0","main.cluster index_upperinput":"1178.0"}
+ 40.4492
+ 3
+ CC(CCCCCC\\C=C\\C(O)=O)OC1OC(C)C(O)CC1O
+ Massbank
+ 3
+ 331.2244
+ CCMSLIB00005738370
+ 331.2244
+ 0.0
+ Massbank
+ 31273424.036383282
+ qTof
+ Isolated
+ 0.013397200000000001
+ M+H
+ N/A
+ ESI
+ Positive
+ 29.1796
+ 9
+ 0.815705
+ 0.0
+ Isolated
+ 1178
+ 0.013397200000000001
+ This Node is a Singleton
+ 29.1796
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.193
+ 8
+ 0
+ Feature Node
+ N/A
+ 1577085.3347349574
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"320.0","main.cluster index_upperinput":"320.0"}
+ 320
+ 15.193
+ -1
+ This Node is a Singleton
+ N/A
+ 314.0419
+ N/A
+ 0.0
+ 314.0419
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.267
+ 9
+ 0
+ Feature Node
+ N/A
+ 8913591.554596208
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1461.0","main.cluster index_upperinput":"1461.0"}
+ 1461
+ 33.267
+ -1
+ This Node is a Singleton
+ N/A
+ 335.2921
+ N/A
+ 0.0
+ 335.2921
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.9857
+ 9
+ 0
+ Feature Node
+ N/A
+ 1032540.5479039823
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8150.0","main.cluster index_upperinput":"8150.0"}
+ 8150
+ 20.9857
+ -1
+ This Node is a Singleton
+ N/A
+ 233.1531
+ N/A
+ 0.0
+ 233.1531
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6448
+ 3
+ 0
+ Feature Node
+ N/A
+ 13307765.650315905
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13596.0","main.cluster index_upperinput":"13596.0"}
+ 13596
+ 17.6448
+ 453
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 432.2023
+ N/A
+ 0.0
+ 432.2023
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.2218
+ 3
+ 0
+ Feature Node
+ N/A
+ 2149163.0101193013
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13670.0","main.cluster index_upperinput":"13670.0"}
+ 13670
+ 20.2218
+ -1
+ This Node is a Singleton
+ N/A
+ 654.0462
+ N/A
+ 0.0
+ 654.0462
+
+
+ 52
+ 0.8009270000000001
+ CCMSLIB00005720103
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0
+ Orbitrap
+ """InChI=1S/C30H48O2/c1-25(2)15-14-24(31)30(8)21(25)13-18-29(7)23(30)10-9-22-27(5)16-11-19(26(3,4)32)20(27)12-17-28(22,29)6/h14-15,19-23,32H,9-13,16-18H2,1-8H3/t19-,20-,21?,22+,23-,27-,28+,29+,30-/m0/s1"""
+ 0.0
+ 22-Hydoxy-2-hopen-1-one
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005720103
+ 5
+ 0.207427
+ Feature Node
+ N/A
+ 52
+ 0.0
+ 0.0
+ Damien OLIVIER
+ 22-Hydoxy-2-hopen-1-one
+ Positive
+ Damien OLIVIER
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3771.0","main.cluster index_upperinput":"3771.0"}
+ 0.207427
+ 3
+ CC1(C)C2CC[C@]3([C@@]4(CC[C@H]5[C@H](CC[C@@]5([C@H]4CC[C@@H]3[C@@]2(C)C(=O)C=C1)C)C(C)(O)C)C)C
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 3
+ 441.3729
+ CCMSLIB00005720103
+ 441.3729
+ 0.0
+ Jean-Luc WOLFENDER Pierre-Marie ALLARD
+ 7324153.220680505
+ Orbitrap
+ Isolated
+ 9.15527e-05
+ [M+H]
+ N/A
+ LC-ESI
+ Positive
+ 34.0723
+ 9
+ 0.8009270000000001
+ 0.0
+ Isolated
+ 3771
+ 9.15527e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 34.0723
+ 0.0
+ [M+H]
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.3294
+ 7
+ 0
+ Feature Node
+ N/A
+ 2511704.27825489
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1720.0","main.cluster index_upperinput":"1720.0"}
+ 1720
+ 2.3294
+ -1
+ This Node is a Singleton
+ N/A
+ 398.2162
+ N/A
+ 0.0
+ 398.2162
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6758
+ 5
+ 0
+ Feature Node
+ N/A
+ 25540238.707606856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4500.0","main.cluster index_upperinput":"4500.0"}
+ 4500
+ 17.6758
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 426.2484
+ N/A
+ 0.0
+ 426.2484
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.4865
+ 6
+ 0
+ Feature Node
+ N/A
+ 2673341.418913299
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5194.0","main.cluster index_upperinput":"5194.0"}
+ 5194
+ 22.4865
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8903
+ N/A
+ 0.0
+ 84.9451
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.5009
+ 9
+ 0
+ Feature Node
+ N/A
+ 2701530.394294788
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"6019.0","main.cluster index_upperinput":"6019.0"}
+ 6019
+ 25.5009
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=45&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 126.9671
+ N/A
+ 0.0
+ 126.9671
+
+
+ 8
+ 0.9400649999999999
+ CCMSLIB00000852865
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852865
+ InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3/b4-3-,7-6-,10-9-
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3/b4-3-,7-6-,10-9-
+ 0.0
+ NCGC00380867-01_C27H46O9_9,12,15-Octadecatrienoic acid, 3-(hexopyranosyloxy)-2-hydroxypropyl ester, (9Z,12Z,15Z)-
+ CC\\C=C/C/C=C\\C\\C=C/CCCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852865
+ -1
+ 3.18067
+ Feature Node
+ N/A
+ 8
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00380867-01_C27H46O9_9,12,15-Octadecatrienoic acid, 3-(hexopyranosyloxy)-2-hydroxypropyl ester, (9Z,12Z,15Z)-
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1272.0","main.cluster index_upperinput":"1272.0"}
+ 3.18067
+ 1
+ CC\\C=C/C/C=C\\C\\C=C/CCCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O
+ Jadhav/Dorrestein
+ 1
+ 537.3047
+ CCMSLIB00000852865
+ 537.3047
+ 0.0
+ Jadhav/Dorrestein
+ 34892992.38277557
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.00170898
+ M+Na
+ N/A
+ LC-ESI
+ positive
+ 29.587
+ 7
+ 0.9400649999999999
+ 0.0
+ isolated
+ 1272
+ 0.00170898
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 29.587
+ 0.0
+ M+Na
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.0629
+ 5
+ 0
+ Feature Node
+ N/A
+ 1064042.4516885078
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1422.0","main.cluster index_upperinput":"1422.0"}
+ 1422
+ 22.0629
+ -1
+ This Node is a Singleton
+ N/A
+ 230.2476
+ N/A
+ 0.0
+ 230.2476
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.1145
+ 8
+ 0
+ Feature Node
+ N/A
+ 7009044.711870915
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1665.0","main.cluster index_upperinput":"1665.0"}
+ 1665
+ 34.1145
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=65&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 445.3674
+ N/A
+ 0.0
+ 445.3674
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.9405
+ 3
+ 0
+ Feature Node
+ N/A
+ 371059.3332727456
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"8193.0","main.cluster index_upperinput":"8193.0"}
+ 8193
+ 9.9405
+ -1
+ This Node is a Singleton
+ N/A
+ 450.2123
+ N/A
+ 0.0
+ 450.2123
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.5875
+ 9
+ 0
+ Feature Node
+ N/A
+ 3939310.8290627142
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"51.0","main.cluster index_upperinput":"51.0"}
+ 51
+ 34.5875
+ -1
+ This Node is a Singleton
+ N/A
+ 582.2071
+ N/A
+ 0.0
+ 582.2071
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6636
+ 8
+ 0
+ Feature Node
+ N/A
+ 8737907.425953781
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3666.0","main.cluster index_upperinput":"3666.0"}
+ 3666
+ 32.6636
+ 161
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=182&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 441.2985
+ N/A
+ 0.0
+ 441.2985
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.3034
+ 6
+ 0
+ Feature Node
+ N/A
+ 992239.6696096599
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7718.0","main.cluster index_upperinput":"7718.0"}
+ 7718
+ 23.3034
+ -1
+ This Node is a Singleton
+ N/A
+ 355.1527
+ N/A
+ 0.0
+ 355.1527
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.6186
+ 6
+ 0
+ Feature Node
+ N/A
+ 1470491.1044041764
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2692.0","main.cluster index_upperinput":"2692.0"}
+ 2692
+ 26.6186
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 515.2626
+ N/A
+ 0.0
+ 515.2626
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.354
+ 4
+ 0
+ Feature Node
+ N/A
+ 2867246.989002333
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4643.0","main.cluster index_upperinput":"4643.0"}
+ 4643
+ 11.354
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=127&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 516.2215
+ N/A
+ 0.0
+ 516.2215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.9005
+ 7
+ 0
+ Feature Node
+ N/A
+ 9926045.26405664
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"20.0","main.cluster index_upperinput":"20.0"}
+ 20
+ 33.9005
+ -1
+ This Node is a Singleton
+ N/A
+ 597.4134
+ N/A
+ 0.0
+ 597.4134
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.3714
+ 1
+ 0
+ Feature Node
+ N/A
+ 3165344.2055188264
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13660.0","main.cluster index_upperinput":"13660.0"}
+ 13660
+ 27.3714
+ 93
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=63&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1012.5329
+ N/A
+ 0.0
+ 1012.5329
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.1275
+ 6
+ 0
+ Feature Node
+ N/A
+ 2962564.4615801233
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3259.0","main.cluster index_upperinput":"3259.0"}
+ 3259
+ 34.1275
+ -1
+ This Node is a Singleton
+ N/A
+ 481.3657
+ N/A
+ 0.0
+ 481.3657
+
+
+ 15
+ 0.9066709999999999
+ CCMSLIB00004692251
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692251
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+
+ 0
+ ESI-QFT
+ InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+
+ 0.0
+ feruloyltyramine
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004692251
+ 265
+ 1.6514900000000001
+ Feature Node
+ N/A
+ 15
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF001188
+ feruloyltyramine
+ positive
+ MoNA:VF-NPL-QEHF001188
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1379.0","main.cluster index_upperinput":"1379.0"}
+ 1.6514900000000001
+ 3
+ N/A
+ MoNA
+ 3
+ 314.1385
+ CCMSLIB00004692251
+ 314.1385
+ 0.0
+ MoNA
+ 9094325.812385706
+ ESI-QFT
+ isolated
+ 0.000518799
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 15.9548
+ 4
+ 0.9066709999999999
+ 0.0
+ isolated
+ 1379
+ 0.000518799
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=19&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 15.9548
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.6732
+ 9
+ 0
+ Feature Node
+ N/A
+ 14434983.733589055
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2506.0","main.cluster index_upperinput":"2506.0"}
+ 2506
+ 28.6732
+ -1
+ This Node is a Singleton
+ N/A
+ 295.226
+ N/A
+ 0.0
+ 295.226
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1299
+ 5
+ 0
+ Feature Node
+ N/A
+ 1265453.0085276233
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1252.0","main.cluster index_upperinput":"1252.0"}
+ 1252
+ 23.1299
+ 50
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=33&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 534.2549
+ N/A
+ 0.0
+ 534.2549
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.4696
+ 8
+ 0
+ Feature Node
+ N/A
+ 1092029.5444329376
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"158.0","main.cluster index_upperinput":"158.0"}
+ 158
+ 24.4696
+ -1
+ This Node is a Singleton
+ N/A
+ 172.1694
+ N/A
+ 0.0
+ 172.1694
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.9884
+ 7
+ 0
+ Feature Node
+ N/A
+ 16381396.868072327
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1227.0","main.cluster index_upperinput":"1227.0"}
+ 1227
+ 34.9884
+ -1
+ This Node is a Singleton
+ N/A
+ 469.3652
+ N/A
+ 0.0
+ 469.3652
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.374
+ 3
+ 0
+ Feature Node
+ N/A
+ 1319815.8722936052
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10900.0","main.cluster index_upperinput":"10900.0"}
+ 10900
+ 17.374
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=16&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.216
+ N/A
+ 0.0
+ 607.216
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.1652
+ 6
+ 0
+ Feature Node
+ N/A
+ 2892873.414430489
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1449.0","main.cluster index_upperinput":"1449.0"}
+ 1449
+ 23.1652
+ 1
+ This Node is a Singleton
+ N/A
+ 662.4265
+ N/A
+ 0.0
+ 662.4265
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.9402
+ 6
+ 0
+ Feature Node
+ N/A
+ 8729881.193342445
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4410.0","main.cluster index_upperinput":"4410.0"}
+ 4410
+ 28.9402
+ -1
+ This Node is a Singleton
+ N/A
+ 597.4118
+ N/A
+ 0.0
+ 597.4118
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.5727
+ 4
+ 0
+ Feature Node
+ N/A
+ 685892.2937336279
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"14070.0","main.cluster index_upperinput":"14070.0"}
+ 14070
+ 20.5727
+ 143
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 646.3995
+ N/A
+ 0.0
+ 646.3995
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.0387
+ 7
+ 0
+ Feature Node
+ N/A
+ 3511435.968243828
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2861.0","main.cluster index_upperinput":"2861.0"}
+ 2861
+ 18.0387
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 247.1328
+ N/A
+ 0.0
+ 247.1328
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.8779
+ 8
+ 0
+ Feature Node
+ N/A
+ 3042926.1247117985
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10954.0","main.cluster index_upperinput":"10954.0"}
+ 10954
+ 31.8779
+ -1
+ This Node is a Singleton
+ N/A
+ 411.3632
+ N/A
+ 0.0
+ 411.3632
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.863
+ 2
+ 0
+ Feature Node
+ N/A
+ 513449.4742878258
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7825.0","main.cluster index_upperinput":"7825.0"}
+ 7825
+ 19.863
+ -1
+ This Node is a Singleton
+ N/A
+ 384.202
+ N/A
+ 0.0
+ 384.202
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2577
+ 2
+ 0
+ Feature Node
+ N/A
+ 700159.9941753248
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10304.0","main.cluster index_upperinput":"10304.0"}
+ 10304
+ 23.2577
+ -1
+ This Node is a Singleton
+ N/A
+ 413.2153
+ N/A
+ 0.0
+ 413.2153
+
+
+ 14
+ 0.9050600000000001
+ CCMSLIB00003139561
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139561
+ N/A
+ 0
+ QqQ
+ N/A
+ 0.0
+ Spectral Match to 1-Hexadecanoyl-sn-glycerol from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003139561
+ 5
+ 1.47391
+ Feature Node
+ N/A
+ 14
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 1-Hexadecanoyl-sn-glycerol from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"270.0","main.cluster index_upperinput":"270.0"}
+ 1.47391
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 331.2845
+ CCMSLIB00003139561
+ 331.2845
+ 0.0
+ Data from Wolfender/Litaudon
+ 14850018.304919442
+ QqQ
+ Isolated
+ 0.00048828099999999997
+ M+H
+ N/A
+ ESI
+ Positive
+ 31.9075
+ 9
+ 0.9050600000000001
+ 0.0
+ Isolated
+ 270
+ 0.00048828099999999997
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 31.9075
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.4962
+ 4
+ 0
+ Feature Node
+ N/A
+ 2143612.0087425834
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2484.0","main.cluster index_upperinput":"2484.0"}
+ 2484
+ 18.4962
+ -1
+ This Node is a Singleton
+ N/A
+ 395.1469
+ N/A
+ 0.0
+ 395.1469
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.0634
+ 2
+ 0
+ Feature Node
+ N/A
+ 1873702.7713601745
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10271.0","main.cluster index_upperinput":"10271.0"}
+ 10271
+ 15.0634
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=127&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 500.226
+ N/A
+ 0.0
+ 500.226
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.6775
+ 8
+ 0
+ Feature Node
+ N/A
+ 1750168.1159796019
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2408.0","main.cluster index_upperinput":"2408.0"}
+ 2408
+ 15.6775
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 137.0599
+ N/A
+ 0.0
+ 137.0599
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.7929
+ 1
+ 0
+ Feature Node
+ N/A
+ 2919602.1867954982
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13790.0","main.cluster index_upperinput":"13790.0"}
+ 13790
+ 21.7929
+ 470
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=42&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 488.2281
+ N/A
+ 0.0
+ 488.2281
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.4072
+ 7
+ 0
+ Feature Node
+ N/A
+ 1435538.473365185
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"115.0","main.cluster index_upperinput":"115.0"}
+ 115
+ 23.4072
+ -1
+ This Node is a Singleton
+ N/A
+ 290.2691
+ N/A
+ 0.0
+ 290.2691
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.4251
+ 1
+ 0
+ Feature Node
+ N/A
+ 11929287.21673901
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13599.0","main.cluster index_upperinput":"13599.0"}
+ 13599
+ 28.4251
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 963.4781
+ N/A
+ 0.0
+ 963.4781
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0781
+ 8
+ 0
+ Feature Node
+ N/A
+ 6161306.248223056
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2656.0","main.cluster index_upperinput":"2656.0"}
+ 2656
+ 34.0781
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 325.3096
+ N/A
+ 0.0
+ 325.3096
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.7466
+ 8
+ 0
+ Feature Node
+ N/A
+ 1093649.8866694306
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1388.0","main.cluster index_upperinput":"1388.0"}
+ 1388
+ 26.7466
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 268.1003
+ N/A
+ 0.0
+ 268.1003
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.6805
+ 6
+ 0
+ Feature Node
+ N/A
+ 9428213.539364876
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3716.0","main.cluster index_upperinput":"3716.0"}
+ 3716
+ 31.6805
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 937.5861
+ N/A
+ 0.0
+ 937.5861
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.2255
+ 8
+ 0
+ Feature Node
+ N/A
+ 1142722.8416407006
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15146.0","main.cluster index_upperinput":"15146.0"}
+ 15146
+ 35.2255
+ -1
+ This Node is a Singleton
+ N/A
+ 517.3864
+ N/A
+ 0.0
+ 517.3864
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.9649
+ 9
+ 0
+ Feature Node
+ N/A
+ 19568439.26567344
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"58.0","main.cluster index_upperinput":"58.0"}
+ 58
+ 32.9649
+ 56
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=27&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 628.1948
+ N/A
+ 0.0
+ 628.1948
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.9819
+ 2
+ 0
+ Feature Node
+ N/A
+ 896015.9608333664
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13980.0","main.cluster index_upperinput":"13980.0"}
+ 13980
+ 18.9819
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=84&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 434.2169
+ N/A
+ 0.0
+ 434.2169
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.9276
+ 2
+ 0
+ Feature Node
+ N/A
+ 23959798.14006394
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13617.0","main.cluster index_upperinput":"13617.0"}
+ 13617
+ 10.9276
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 484.1958
+ N/A
+ 0.0
+ 484.1958
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1634
+ 5
+ 0
+ Feature Node
+ N/A
+ 2744033.263284408
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4658.0","main.cluster index_upperinput":"4658.0"}
+ 4658
+ 19.1634
+ 257
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=25&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 833.2991
+ N/A
+ 0.0
+ 833.2991
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.6584
+ 6
+ 0
+ Feature Node
+ N/A
+ 21532827.336337216
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1351.0","main.cluster index_upperinput":"1351.0"}
+ 1351
+ 34.6584
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 738.5485
+ N/A
+ 0.0
+ 738.5485
+
+
+ 53
+ 0.719234
+ CCMSLIB00000852864
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852864
+ InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3/b4-3-,7-6-,10-9-
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3/b4-3-,7-6-,10-9-
+ 0.0
+ NCGC00380867-01_C27H46O9_9,12,15-Octadecatrienoic acid, 3-(hexopyranosyloxy)-2-hydroxypropyl ester, (9Z,12Z,15Z)-
+ CC\\C=C/C/C=C\\C\\C=C/CCCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000852864
+ 5
+ 3.0956200000000003
+ Feature Node
+ N/A
+ 53
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00380867-01_C27H46O9_9,12,15-Octadecatrienoic acid, 3-(hexopyranosyloxy)-2-hydroxypropyl ester, (9Z,12Z,15Z)-
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3667.0","main.cluster index_upperinput":"3667.0"}
+ 3.0956200000000003
+ 1
+ CC\\C=C/C/C=C\\C\\C=C/CCCCCCCC(=O)OCC(O)COC1OC(CO)C(O)C(O)C1O
+ Jadhav/Dorrestein
+ 1
+ 532.3497
+ CCMSLIB00000852864
+ 532.3497
+ 0.0
+ Jadhav/Dorrestein
+ 9394796.394311195
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.00164795
+ M+NH4
+ N/A
+ LC-ESI
+ positive
+ 29.5924
+ 6
+ 0.719234
+ 0.0
+ isolated
+ 3667
+ 0.00164795
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 29.5924
+ 0.0
+ M+NH4
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.1475
+ 7
+ 0
+ Feature Node
+ N/A
+ 1482899.0122477433
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"151.0","main.cluster index_upperinput":"151.0"}
+ 151
+ 25.1475
+ -1
+ This Node is a Singleton
+ N/A
+ 283.1881
+ N/A
+ 0.0
+ 283.1881
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.8991
+ 7
+ 0
+ Feature Node
+ N/A
+ 1121392.537287224
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7880.0","main.cluster index_upperinput":"7880.0"}
+ 7880
+ 29.8991
+ -1
+ This Node is a Singleton
+ N/A
+ 513.3439
+ N/A
+ 0.0
+ 513.3439
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.6672
+ 7
+ 0
+ Feature Node
+ N/A
+ 170822607.16960382
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"69.0","main.cluster index_upperinput":"69.0"}
+ 69
+ 24.6672
+ 477
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=4&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 329.1023
+ N/A
+ 0.0
+ 329.1023
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.8366
+ 9
+ 0
+ Feature Node
+ N/A
+ 5265190.313405459
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"110.0","main.cluster index_upperinput":"110.0"}
+ 110
+ 28.8366
+ -1
+ This Node is a Singleton
+ N/A
+ 425.215
+ N/A
+ 0.0
+ 425.215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.0585
+ 8
+ 0
+ Feature Node
+ N/A
+ 1146505.0204533322
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1412.0","main.cluster index_upperinput":"1412.0"}
+ 1412
+ 24.0585
+ -1
+ This Node is a Singleton
+ N/A
+ 307.2259
+ N/A
+ 0.0
+ 307.2259
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.9545
+ 8
+ 0
+ Feature Node
+ N/A
+ 1616328.0355416287
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10896.0","main.cluster index_upperinput":"10896.0"}
+ 10896
+ 26.9545
+ -1
+ This Node is a Singleton
+ N/A
+ 281.1722
+ N/A
+ 0.0
+ 281.1722
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.0209
+ 9
+ 0
+ Feature Node
+ N/A
+ 9027064.79785253
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"50.0","main.cluster index_upperinput":"50.0"}
+ 50
+ 34.0209
+ -1
+ This Node is a Singleton
+ N/A
+ 381.2985
+ N/A
+ 0.0
+ 381.2985
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.7383
+ 6
+ 0
+ Feature Node
+ N/A
+ 3162019.7043053824
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4671.0","main.cluster index_upperinput":"4671.0"}
+ 4671
+ 6.7383
+ -1
+ This Node is a Singleton
+ N/A
+ 402.1887
+ N/A
+ 0.0
+ 402.1887
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.6002
+ 9
+ 0
+ Feature Node
+ N/A
+ 4780434.483203352
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2888.0","main.cluster index_upperinput":"2888.0"}
+ 2888
+ 28.6002
+ -1
+ This Node is a Singleton
+ N/A
+ 351.2509
+ N/A
+ 0.0
+ 351.2509
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.6627
+ 9
+ 0
+ Feature Node
+ N/A
+ 31043109.454098985
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1482.0","main.cluster index_upperinput":"1482.0"}
+ 1482
+ 30.6627
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 526.4318
+ N/A
+ 0.0
+ 526.4318
+
+
+ 17
+ 0.897842
+ CCMSLIB00005738688
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0
+ qTof
+ 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
+ 0.0
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005738688
+ 5
+ 0.6557470000000001
+ Feature Node
+ N/A
+ 17
+ 0.0
+ 0.0
+ Massbank
+ Massbank:RP030403 ?-linolenic acid|linolenic acid|(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"343.0","main.cluster index_upperinput":"343.0"}
+ 0.6557470000000001
+ 3
+ CC/C=C\\C/C=C\\C/C=C\\CCCCCCCC(=O)O
+ Massbank
+ 3
+ 279.2318
+ CCMSLIB00005738688
+ 279.2318
+ 0.0
+ Massbank
+ 51006575.9753264
+ qTof
+ Isolated
+ 0.000183105
+ M+H
+ N/A
+ ESI
+ Positive
+ 28.7159
+ 9
+ 0.897842
+ 0.0
+ Isolated
+ 343
+ 0.000183105
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 28.7159
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.2757
+ 1
+ 0
+ Feature Node
+ N/A
+ 1531000.8606507885
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7752.0","main.cluster index_upperinput":"7752.0"}
+ 7752
+ 3.2757
+ -1
+ This Node is a Singleton
+ N/A
+ 496.1953
+ N/A
+ 0.0
+ 496.1953
+
+
+ 24
+ 0.833425
+ CCMSLIB00000847637
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847637
+ InChI=1S/C46H50N4O8/c51-39-17-5-35(6-18-39)13-25-43(55)47-29-3-33-49(45(57)27-15-37-9-21-41(53)22-10-37)31-1-2-32-50(46(58)28-16-38-11-23-42(54)24-12-38)34-4-30-48-44(56)26-14-36-7-19-40(52)20-8-36/h5-28,51-54H,1-4,29-34H2,(H,47,55)(H,48,56)/b25-13+,26-14+,27-15+,28-16+
+ 0
+ Maxis II HD Q-TOF Bruker
+ InChI=1S/C46H50N4O8/c51-39-17-5-35(6-18-39)13-25-43(55)47-29-3-33-49(45(57)27-15-37-9-21-41(53)22-10-37)31-1-2-32-50(46(58)28-16-38-11-23-42(54)24-12-38)34-4-30-48-44(56)26-14-36-7-19-40(52)20-8-36/h5-28,51-54H,1-4,29-34H2,(H,47,55)(H,48,56)/b25-13+,26-14+,27-15+,28-16+
+ 0.0
+ NCGC00384571-01!(E)-3-(4-hydroxyphenyl)-N-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]amino]propyl]prop-2-enamide
+ OC1=CC=C(\\C=C\\C(=O)NCCCN(CCCCN(CCCNC(=O)\\C=C\\C2=CC=C(O)C=C2)C(=O)\\C=C\\C3=CC=C(O)C=C3)C(=O)\\C=C\\C4=CC=C(O)C=C4)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000847637
+ 171
+ 0.38758899999999996
+ Feature Node
+ N/A
+ 24
+ 0.0
+ 0.0
+ lfnothias
+ NCGC00384571-01!(E)-3-(4-hydroxyphenyl)-N-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]amino]propyl]prop-2-enamide
+ positive
+ lfnothias
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4545.0","main.cluster index_upperinput":"4545.0"}
+ 0.38758899999999996
+ 1
+ OC1=CC=C(\\C=C\\C(=O)NCCCN(CCCCN(CCCNC(=O)\\C=C\\C2=CC=C(O)C=C2)C(=O)\\C=C\\C3=CC=C(O)C=C3)C(=O)\\C=C\\C4=CC=C(O)C=C4)C=C1
+ Jadhav/Dorrestein
+ 1
+ 787.3697
+ CCMSLIB00000847637
+ 787.3697
+ 0.0
+ Jadhav/Dorrestein
+ 5676125.796386943
+ Maxis II HD Q-TOF Bruker
+ isolated
+ 0.000305176
+ M+H
+ N/A
+ LC-ESI
+ positive
+ 21.8629
+ 5
+ 0.833425
+ 0.0
+ isolated
+ 4545
+ 0.000305176
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=18&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 21.8629
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.9985
+ 8
+ 0
+ Feature Node
+ N/A
+ 3419635.731342093
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4785.0","main.cluster index_upperinput":"4785.0"}
+ 4785
+ 31.9985
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 686.5413
+ N/A
+ 0.0
+ 686.5413
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 28.417
+ 9
+ 0
+ Feature Node
+ N/A
+ 2449054.5104293493
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1909.0","main.cluster index_upperinput":"1909.0"}
+ 1909
+ 28.417
+ 213
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=92&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 223.0636
+ N/A
+ 0.0
+ 223.0636
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.705
+ 2
+ 0
+ Feature Node
+ N/A
+ 452714.58544331143
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7954.0","main.cluster index_upperinput":"7954.0"}
+ 7954
+ 3.705
+ -1
+ This Node is a Singleton
+ N/A
+ 416.1475
+ N/A
+ 0.0
+ 416.1475
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.8794
+ 5
+ 0
+ Feature Node
+ N/A
+ 2838100.252386241
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2665.0","main.cluster index_upperinput":"2665.0"}
+ 2665
+ 13.8794
+ 312
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 495.1131
+ N/A
+ 0.0
+ 495.1131
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.2857
+ 8
+ 0
+ Feature Node
+ N/A
+ 2494820.860533824
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"77.0","main.cluster index_upperinput":"77.0"}
+ 77
+ 26.2857
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=41&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 161.0959
+ N/A
+ 0.0
+ 161.0959
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 27.3714
+ 1
+ 0
+ Feature Node
+ N/A
+ 5721352.514431703
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13618.0","main.cluster index_upperinput":"13618.0"}
+ 13618
+ 27.3714
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 1017.4883
+ N/A
+ 0.0
+ 1017.4883
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.9068
+ 9
+ 0
+ Feature Node
+ N/A
+ 17808991.436290592
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3693.0","main.cluster index_upperinput":"3693.0"}
+ 3693
+ 23.9068
+ -1
+ This Node is a Singleton
+ N/A
+ 239.162
+ N/A
+ 0.0
+ 239.162
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.8727
+ 7
+ 0
+ Feature Node
+ N/A
+ 21500486.41597149
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2628.0","main.cluster index_upperinput":"2628.0"}
+ 2628
+ 33.8727
+ 115
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=29&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 623.2863
+ N/A
+ 0.0
+ 623.2863
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.0455
+ 8
+ 0
+ Feature Node
+ N/A
+ 3102099.0466506965
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5175.0","main.cluster index_upperinput":"5175.0"}
+ 5175
+ 22.0455
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=21&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 168.8899
+ N/A
+ 0.0
+ 84.9449
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.0155
+ 1
+ 0
+ Feature Node
+ N/A
+ 1289195.817438995
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7732.0","main.cluster index_upperinput":"7732.0"}
+ 7732
+ 12.0155
+ 1
+ This Node is a Singleton
+ N/A
+ 516.1998
+ N/A
+ 0.0
+ 516.1998
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.0449
+ 2
+ 0
+ Feature Node
+ N/A
+ 907150.6126028959
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13694.0","main.cluster index_upperinput":"13694.0"}
+ 13694
+ 12.0449
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.213
+ N/A
+ 0.0
+ 462.213
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.0367
+ 1
+ 0
+ Feature Node
+ N/A
+ 5255373.444215419
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13624.0","main.cluster index_upperinput":"13624.0"}
+ 13624
+ 30.0367
+ -1
+ This Node is a Singleton
+ N/A
+ 899.463
+ N/A
+ 0.0
+ 899.463
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 18.3743
+ 6
+ 0
+ Feature Node
+ N/A
+ 2875307.235281382
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4597.0","main.cluster index_upperinput":"4597.0"}
+ 4597
+ 18.3743
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=16&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 607.2156
+ N/A
+ 0.0
+ 607.2156
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.4064
+ 5
+ 0
+ Feature Node
+ N/A
+ 772832.0532592804
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"15865.0","main.cluster index_upperinput":"15865.0"}
+ 15865
+ 13.4064
+ 69
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=26&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 565.1557
+ N/A
+ 0.0
+ 565.1557
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.6326
+ 8
+ 0
+ Feature Node
+ N/A
+ 2884527.155233339
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1251.0","main.cluster index_upperinput":"1251.0"}
+ 1251
+ 23.6326
+ -1
+ This Node is a Singleton
+ N/A
+ 317.1721
+ N/A
+ 0.0
+ 317.1721
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.5436
+ 7
+ 0
+ Feature Node
+ N/A
+ 4049354.2303785738
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"26.0","main.cluster index_upperinput":"26.0"}
+ 26
+ 32.5436
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 409.3301
+ N/A
+ 0.0
+ 409.3301
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 1.0951
+ 8
+ 0
+ Feature Node
+ N/A
+ 12749995.523185268
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1340.0","main.cluster index_upperinput":"1340.0"}
+ 1340
+ 1.0951
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=185&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 294.1547
+ N/A
+ 0.0
+ 294.1547
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6346
+ 4
+ 0
+ Feature Node
+ N/A
+ 1902719.2249584212
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10258.0","main.cluster index_upperinput":"10258.0"}
+ 10258
+ 17.6346
+ 85
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=13&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 560.2703
+ N/A
+ 0.0
+ 560.2703
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.9847
+ 8
+ 0
+ Feature Node
+ N/A
+ 4043983.585667048
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"258.0","main.cluster index_upperinput":"258.0"}
+ 258
+ 29.9847
+ -1
+ This Node is a Singleton
+ N/A
+ 485.1127
+ N/A
+ 0.0
+ 485.1127
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.8383
+ 1
+ 0
+ Feature Node
+ N/A
+ 747671.2868934269
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13785.0","main.cluster index_upperinput":"13785.0"}
+ 13785
+ 23.8383
+ -1
+ This Node is a Singleton
+ N/A
+ 455.3352
+ N/A
+ 0.0
+ 455.3352
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.8023
+ 5
+ 0
+ Feature Node
+ N/A
+ 5017713.699861904
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2859.0","main.cluster index_upperinput":"2859.0"}
+ 2859
+ 31.8023
+ -1
+ This Node is a Singleton
+ N/A
+ 471.3089
+ N/A
+ 0.0
+ 471.3089
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.3106
+ 9
+ 0
+ Feature Node
+ N/A
+ 4990949.473437689
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1220.0","main.cluster index_upperinput":"1220.0"}
+ 1220
+ 32.3106
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 293.247
+ N/A
+ 0.0
+ 293.247
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.655
+ 3
+ 0
+ Feature Node
+ N/A
+ 5265996.145620106
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5073.0","main.cluster index_upperinput":"5073.0"}
+ 5073
+ 23.655
+ -1
+ This Node is a Singleton
+ N/A
+ 427.1727
+ N/A
+ 0.0
+ 427.1727
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.513
+ 8
+ 0
+ Feature Node
+ N/A
+ 639890.7681331699
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7897.0","main.cluster index_upperinput":"7897.0"}
+ 7897
+ 24.513
+ -1
+ This Node is a Singleton
+ N/A
+ 239.162
+ N/A
+ 0.0
+ 239.162
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 26.8402
+ 5
+ 0
+ Feature Node
+ N/A
+ 878105.7350186895
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7683.0","main.cluster index_upperinput":"7683.0"}
+ 7683
+ 26.8402
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=64&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 515.264
+ N/A
+ 0.0
+ 515.264
+
+
+ 27
+ 0.7553270000000001
+ CCMSLIB00004711258
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004711258
+ InChI=1S/C22H28O8/c1-13-5-4-6-16(11-23)10-19-20(14(2)21(26)29-19)18(9-13)30-22(27)17(12-24)7-8-28-15(3)25/h5,7,10,18-20,23-24H,2,4,6,8-9,11-12H2,1,3H3/b13-5+,16-10-,17-7-/t18-,19+,20+/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C22H28O8/c1-13-5-4-6-16(11-23)10-19-20(14(2)21(26)29-19)18(9-13)30-22(27)17(12-24)7-8-28-15(3)25/h5,7,10,18-20,23-24H,2,4,6,8-9,11-12H2,1,3H3/b13-5+,16-10-,17-7-/t18-,19+,20+/m0/s1
+ 0.0
+ [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-4-acetyloxy-2-(hydroxymethyl)but-2-enoate
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004711258
+ 117
+ 2.5070799999999998
+ Feature Node
+ N/A
+ 27
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF020195
+ [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-4-acetyloxy-2-(hydroxymethyl)but-2-enoate
+ positive
+ MoNA:VF-NPL-QEHF020195
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10246.0","main.cluster index_upperinput":"10246.0"}
+ 2.5070799999999998
+ 3
+ N/A
+ MoNA
+ 3
+ 438.2131
+ CCMSLIB00004711258
+ 438.2131
+ 0.0
+ MoNA
+ 4106778.1487845406
+ ESI-QFT
+ isolated
+ 0.00109863
+ [M+NH4]+
+ N/A
+ N/A
+ positive
+ 19.5227
+ 3
+ 0.7553270000000001
+ 0.0
+ isolated
+ 10246
+ 0.00109863
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 19.5227
+ 0.0
+ [M+NH4]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.9772
+ 7
+ 0
+ Feature Node
+ N/A
+ 4732987.14616393
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1317.0","main.cluster index_upperinput":"1317.0"}
+ 1317
+ 30.9772
+ -1
+ This Node is a Singleton
+ N/A
+ 515.3208
+ N/A
+ 0.0
+ 515.3208
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1124
+ 5
+ 0
+ Feature Node
+ N/A
+ 1079522.7680494145
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3815.0","main.cluster index_upperinput":"3815.0"}
+ 3815
+ 19.1124
+ -1
+ This Node is a Singleton
+ N/A
+ 385.1625
+ N/A
+ 0.0
+ 385.1625
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.5907
+ 7
+ 0
+ Feature Node
+ N/A
+ 2264512.9999624
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7704.0","main.cluster index_upperinput":"7704.0"}
+ 7704
+ 23.5907
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 181.1221
+ N/A
+ 0.0
+ 181.1221
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.7586
+ 4
+ 0
+ Feature Node
+ N/A
+ 894749.74208427
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1245.0","main.cluster index_upperinput":"1245.0"}
+ 1245
+ 20.7586
+ -1
+ This Node is a Singleton
+ N/A
+ 323.0525
+ N/A
+ 0.0
+ 323.0525
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.4731
+ 3
+ 0
+ Feature Node
+ N/A
+ 1175551.920766687
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4649.0","main.cluster index_upperinput":"4649.0"}
+ 4649
+ 20.4731
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 514.3224
+ N/A
+ 0.0
+ 514.3224
+
+
+ 16
+ 0.892134
+ CCMSLIB00005739719
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005739719
+ 1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0
+ qTof
+ 1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
+ 0.0
+ Massbank:PR303918 Arctigenin
+ COC1=C(OC)C=C(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005739719
+ 111
+ 2.45341
+ Feature Node
+ N/A
+ 16
+ 0.0
+ 0.0
+ Massbank
+ Massbank:PR303918 Arctigenin
+ Positive
+ Massbank
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2478.0","main.cluster index_upperinput":"2478.0"}
+ 2.45341
+ 3
+ COC1=C(OC)C=C(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)C=C1
+ Massbank
+ 3
+ 373.1641
+ CCMSLIB00005739719
+ 373.1641
+ 0.0
+ Massbank
+ 3618928.2210599985
+ qTof
+ Isolated
+ 0.000915527
+ M+H
+ N/A
+ ESI
+ Positive
+ 18.4965
+ 6
+ 0.892134
+ 0.0
+ Isolated
+ 2478
+ 0.000915527
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 18.4965
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6786
+ 9
+ 0
+ Feature Node
+ N/A
+ 700451.7257199598
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1326.0","main.cluster index_upperinput":"1326.0"}
+ 1326
+ 25.6786
+ -1
+ This Node is a Singleton
+ N/A
+ 325.2346
+ N/A
+ 0.0
+ 325.2346
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2382
+ 3
+ 0
+ Feature Node
+ N/A
+ 1319784.723544864
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7667.0","main.cluster index_upperinput":"7667.0"}
+ 7667
+ 23.2382
+ 99
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 227.1069
+ N/A
+ 0.0
+ 227.1069
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.9302
+ 5
+ 0
+ Feature Node
+ N/A
+ 2344425.0616729814
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4548.0","main.cluster index_upperinput":"4548.0"}
+ 4548
+ 15.9302
+ 45
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 595.1663
+ N/A
+ 0.0
+ 595.1663
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.5617
+ 6
+ 0
+ Feature Node
+ N/A
+ 1570664.1746289209
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13800.0","main.cluster index_upperinput":"13800.0"}
+ 13800
+ 23.5617
+ -1
+ This Node is a Singleton
+ N/A
+ 465.1189
+ N/A
+ 0.0
+ 465.1189
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9847
+ 4
+ 0
+ Feature Node
+ N/A
+ 1199727.4230490352
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"22.0","main.cluster index_upperinput":"22.0"}
+ 22
+ 0.9847
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 178.9461
+ N/A
+ 0.0
+ 178.9461
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.1456
+ 7
+ 0
+ Feature Node
+ N/A
+ 1981904.425281821
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4829.0","main.cluster index_upperinput":"4829.0"}
+ 4829
+ 14.1456
+ -1
+ This Node is a Singleton
+ N/A
+ 289.1412
+ N/A
+ 0.0
+ 289.1412
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.9887
+ 7
+ 0
+ Feature Node
+ N/A
+ 4076907.9954415904
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1217.0","main.cluster index_upperinput":"1217.0"}
+ 1217
+ 24.9887
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=55&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 254.0837
+ N/A
+ 0.0
+ 254.0837
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.248
+ 2
+ 0
+ Feature Node
+ N/A
+ 2623670.973610177
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7639.0","main.cluster index_upperinput":"7639.0"}
+ 7639
+ 25.248
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=125&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 699.2061
+ N/A
+ 0.0
+ 699.2061
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.0693
+ 8
+ 0
+ Feature Node
+ N/A
+ 5528466.66711173
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2783.0","main.cluster index_upperinput":"2783.0"}
+ 2783
+ 32.0693
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 598.4885
+ N/A
+ 0.0
+ 598.4885
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9983
+ 4
+ 0
+ Feature Node
+ N/A
+ 3945561.505261169
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4532.0","main.cluster index_upperinput":"4532.0"}
+ 4532
+ 16.9983
+ -1
+ This Node is a Singleton
+ N/A
+ 501.1009
+ N/A
+ 0.0
+ 501.1009
+
+
+ 25
+ 0.938098
+ CCMSLIB00003134510
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134510
+ InChI=1S/C24H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)30-21-23(26)22-32-33(28,29)31-20-19-25(2,3)4/h23,26H,5-22H2,1-4H3/t23-/m1/s1
+ 0
+ qTof
+ InChI=1S/C24H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)30-21-23(26)22-32-33(28,29)31-20-19-25(2,3)4/h23,26H,5-22H2,1-4H3/t23-/m1/s1
+ 0.0
+ Spectral Match to 1-Hexadecanoyl-sn-glycero-3-phosphocholine from NIST14
+ CCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134510
+ 443
+ 1.0598
+ Feature Node
+ N/A
+ 25
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to 1-Hexadecanoyl-sn-glycero-3-phosphocholine from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1395.0","main.cluster index_upperinput":"1395.0"}
+ 1.0598
+ 3
+ CCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O
+ Data from Wolfender/Litaudon
+ 3
+ 518.3226
+ CCMSLIB00003134510
+ 518.3226
+ 0.0
+ Data from Wolfender/Litaudon
+ 10916464.725525787
+ qTof
+ Isolated
+ 0.000549316
+ M+Na
+ N/A
+ ESI
+ Positive
+ 30.731
+ 8
+ 0.938098
+ 0.0
+ Isolated
+ 1395
+ 0.000549316
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=2&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 30.731
+ 0.0
+ M+Na
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.6026
+ 6
+ 0
+ Feature Node
+ N/A
+ 3188641.028032116
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13737.0","main.cluster index_upperinput":"13737.0"}
+ 13737
+ 16.6026
+ 1
+ This Node is a Singleton
+ N/A
+ 905.4157
+ N/A
+ 0.0
+ 453.2079
+
+
+ 17
+ 0.8093520000000001
+ CCMSLIB00003134993
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134993
+ InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17+,18-/m0/s1
+ 0
+ qTof
+ InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17+,18-/m0/s1
+ 0.0
+ Spectral Match to Phytosphingosine from NIST14
+ CCCCCCCCCCCCCC[C@H]([C@H]([C@H](CO)N)O)O
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003134993
+ 5
+ 0.671137
+ Feature Node
+ N/A
+ 17
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Phytosphingosine from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1201.0","main.cluster index_upperinput":"1201.0"}
+ 0.671137
+ 3
+ CCCCCCCCCCCCCC[C@H]([C@H]([C@H](CO)N)O)O
+ Data from Wolfender/Litaudon
+ 3
+ 318.3002
+ CCMSLIB00003134993
+ 318.3002
+ 0.0
+ Data from Wolfender/Litaudon
+ 6726891.828490719
+ qTof
+ Isolated
+ 0.000213623
+ M+H
+ N/A
+ ESI
+ Positive
+ 25.8315
+ 9
+ 0.8093520000000001
+ 0.0
+ Isolated
+ 1201
+ 0.000213623
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=80&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 25.8315
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.4269
+ 2
+ 0
+ Feature Node
+ N/A
+ 22375.50644502794
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5414.0","main.cluster index_upperinput":"5414.0"}
+ 5414
+ 19.4269
+ 167
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=137&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 559.1951
+ N/A
+ 0.0
+ 559.1951
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.9414
+ 6
+ 0
+ Feature Node
+ N/A
+ 1645409.6360419078
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1954.0","main.cluster index_upperinput":"1954.0"}
+ 1954
+ 16.9414
+ -1
+ This Node is a Singleton
+ N/A
+ 401.1586
+ N/A
+ 0.0
+ 401.1586
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 13.1645
+ 5
+ 0
+ Feature Node
+ N/A
+ 995359.8572263932
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2541.0","main.cluster index_upperinput":"2541.0"}
+ 2541
+ 13.1645
+ 1
+ This Node is a Singleton
+ N/A
+ 464.2278
+ N/A
+ 0.0
+ 464.2278
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.2532
+ 4
+ 0
+ Feature Node
+ N/A
+ 319758.70394855225
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2678.0","main.cluster index_upperinput":"2678.0"}
+ 2678
+ 23.2532
+ -1
+ This Node is a Singleton
+ N/A
+ 760.3316
+ N/A
+ 0.0
+ 760.3316
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 16.6571
+ 5
+ 0
+ Feature Node
+ N/A
+ 10815739.532277834
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1164.0","main.cluster index_upperinput":"1164.0"}
+ 1164
+ 16.6571
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 426.2486
+ N/A
+ 0.0
+ 426.2486
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 10.3345
+ 6
+ 0
+ Feature Node
+ N/A
+ 666568.4729110928
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4334.0","main.cluster index_upperinput":"4334.0"}
+ 4334
+ 10.3345
+ 130
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=38&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 193.0495
+ N/A
+ 0.0
+ 193.0495
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.9288
+ 5
+ 0
+ Feature Node
+ N/A
+ 209513.23934563954
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3675.0","main.cluster index_upperinput":"3675.0"}
+ 3675
+ 19.9288
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=37&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 567.2698
+ N/A
+ 0.0
+ 567.2698
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.2659
+ 6
+ 0
+ Feature Node
+ N/A
+ 9961733.739554685
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2513.0","main.cluster index_upperinput":"2513.0"}
+ 2513
+ 21.2659
+ 445
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=34&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 809.352
+ N/A
+ 0.0
+ 809.352
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.7223
+ 8
+ 0
+ Feature Node
+ N/A
+ 6526776.047611578
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2726.0","main.cluster index_upperinput":"2726.0"}
+ 2726
+ 32.7223
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 612.5031
+ N/A
+ 0.0
+ 612.5031
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.358
+ 5
+ 0
+ Feature Node
+ N/A
+ 8543954.560071927
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1297.0","main.cluster index_upperinput":"1297.0"}
+ 1297
+ 22.358
+ 12
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=9&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 376.2593
+ N/A
+ 0.0
+ 376.2593
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 11.6411
+ 7
+ 0
+ Feature Node
+ N/A
+ 8204935.198247491
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4546.0","main.cluster index_upperinput":"4546.0"}
+ 4546
+ 11.6411
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 197.117
+ N/A
+ 0.0
+ 197.117
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.5276
+ 3
+ 0
+ Feature Node
+ N/A
+ 1649564.1312077802
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13777.0","main.cluster index_upperinput":"13777.0"}
+ 13777
+ 15.5276
+ 111
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 582.2568
+ N/A
+ 0.0
+ 582.2568
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.9021
+ 4
+ 0
+ Feature Node
+ N/A
+ 741533.258466238
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1307.0","main.cluster index_upperinput":"1307.0"}
+ 1307
+ 12.9021
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 426.2478
+ N/A
+ 0.0
+ 426.2478
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6519
+ 1
+ 0
+ Feature Node
+ N/A
+ 978485.4853071215
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7678.0","main.cluster index_upperinput":"7678.0"}
+ 7678
+ 25.6519
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=125&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 713.2216
+ N/A
+ 0.0
+ 713.2216
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.068
+ 7
+ 0
+ Feature Node
+ N/A
+ 1608779.9360603692
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"25587.0","main.cluster index_upperinput":"25587.0"}
+ 25587
+ 35.068
+ 5
+ This Node is a Singleton
+ N/A
+ 613.48
+ N/A
+ 0.0
+ 613.48
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 32.6003
+ 7
+ 0
+ Feature Node
+ N/A
+ 79167996.215047
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3700.0","main.cluster index_upperinput":"3700.0"}
+ 3700
+ 32.6003
+ 41
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 311.3123
+ N/A
+ 0.0
+ 311.3123
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 0.9236
+ 4
+ 0
+ Feature Node
+ N/A
+ 1233575.6815463016
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"25.0","main.cluster index_upperinput":"25.0"}
+ 25
+ 0.9236
+ 10
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=88&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 134.9562
+ N/A
+ 0.0
+ 134.9562
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.4991
+ 1
+ 0
+ Feature Node
+ N/A
+ 1893273.5448573981
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7650.0","main.cluster index_upperinput":"7650.0"}
+ 7650
+ 21.4991
+ -1
+ This Node is a Singleton
+ N/A
+ 407.1237
+ N/A
+ 0.0
+ 407.1237
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.6928
+ 5
+ 0
+ Feature Node
+ N/A
+ 5407660.164732529
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3770.0","main.cluster index_upperinput":"3770.0"}
+ 3770
+ 25.6928
+ 5
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 364.3207
+ N/A
+ 0.0
+ 364.3207
+
+
+ 6
+ 0.817516
+ CCMSLIB00004706475
+ N/A
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004706475
+ InChI=1S/C27H30O15/c1-9-17(32)20(35)21(36)26(38-9)41-24-18(33)15(8-28)40-27(22(24)37)42-25-19(34)16-13(31)6-12(30)7-14(16)39-23(25)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,24,26-33,35-37H,8H2,1H3/t9-,15+,17-,18+,20+,21+,22+,24-,26-,27-/m0/s1
+ 0
+ ESI-QFT
+ InChI=1S/C27H30O15/c1-9-17(32)20(35)21(36)26(38-9)41-24-18(33)15(8-28)40-27(22(24)37)42-25-19(34)16-13(31)6-12(30)7-14(16)39-23(25)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,24,26-33,35-37H,8H2,1H3/t9-,15+,17-,18+,20+,21+,22+,24-,26-,27-/m0/s1
+ 0.0
+ 3-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00004706475
+ -1
+ 0.102551
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ MoNA:VF-NPL-QEHF015412
+ 3-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
+ positive
+ MoNA:VF-NPL-QEHF015412
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7751.0","main.cluster index_upperinput":"7751.0"}
+ 0.102551
+ 3
+ N/A
+ MoNA
+ 3
+ 595.1661
+ CCMSLIB00004706475
+ 595.1661
+ 0.0
+ MoNA
+ 1403008.89923215
+ ESI-QFT
+ isolated
+ 6.10352e-05
+ [M+H]+
+ N/A
+ N/A
+ positive
+ 14.6236
+ 4
+ 0.817516
+ 0.0
+ isolated
+ 7751
+ 6.10352e-05
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=8&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 14.6236
+ 0.0
+ [M+H]+
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.6702
+ 1
+ 0
+ Feature Node
+ N/A
+ 355940.8376845406
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1296.0","main.cluster index_upperinput":"1296.0"}
+ 1296
+ 17.6702
+ 1
+ This Node is a Singleton
+ N/A
+ 332.1318
+ N/A
+ 0.0
+ 332.1318
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.4992
+ 5
+ 0
+ Feature Node
+ N/A
+ 16179522.597552754
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1967.0","main.cluster index_upperinput":"1967.0"}
+ 1967
+ 14.4992
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 478.2429
+ N/A
+ 0.0
+ 478.2429
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 25.2594
+ 9
+ 0
+ Feature Node
+ N/A
+ 2108652.3930513016
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1256.0","main.cluster index_upperinput":"1256.0"}
+ 1256
+ 25.2594
+ -1
+ This Node is a Singleton
+ N/A
+ 355.2452
+ N/A
+ 0.0
+ 355.2452
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.3877
+ 5
+ 0
+ Feature Node
+ N/A
+ 7239473.826819501
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13637.0","main.cluster index_upperinput":"13637.0"}
+ 13637
+ 14.3877
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=35&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 573.1945
+ N/A
+ 0.0
+ 573.1945
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.3671
+ 5
+ 0
+ Feature Node
+ N/A
+ 9667652.848631147
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1270.0","main.cluster index_upperinput":"1270.0"}
+ 1270
+ 22.3671
+ 12
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=9&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 393.2859
+ N/A
+ 0.0
+ 393.2859
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 12.9502
+ 7
+ 0
+ Feature Node
+ N/A
+ 1679802.625915169
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4987.0","main.cluster index_upperinput":"4987.0"}
+ 4987
+ 12.9502
+ -1
+ This Node is a Singleton
+ N/A
+ 401.157
+ N/A
+ 0.0
+ 401.157
+
+
+ 44
+ 0.876872
+ CCMSLIB00003138418
+ N/A
+ ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138418
+ N/A
+ 0
+ HCD
+ N/A
+ 0.0
+ Spectral Match to Monolinolenin (9c,12c,15c) from NIST14
+ N/A
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00003138418
+ 5
+ 4.578469999999999
+ Feature Node
+ N/A
+ 44
+ 0.0
+ 0.0
+ Data deposited by pmallard
+ Spectral Match to Monolinolenin (9c,12c,15c) from NIST14
+ Positive
+ Data deposited by pmallard
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7731.0","main.cluster index_upperinput":"7731.0"}
+ 4.578469999999999
+ 3
+ N/A
+ Data from Wolfender/Litaudon
+ 3
+ 353.2674
+ CCMSLIB00003138418
+ 353.2674
+ 0.0
+ Data from Wolfender/Litaudon
+ 25938389.320386942
+ HCD
+ Isolated
+ 0.00161743
+ M+H
+ N/A
+ ESI
+ Positive
+ 30.3973
+ 9
+ 0.876872
+ 0.0
+ Isolated
+ 7731
+ 0.00161743
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 30.3973
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 24.8955
+ 7
+ 0
+ Feature Node
+ N/A
+ 5637365.989495093
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1417.0","main.cluster index_upperinput":"1417.0"}
+ 1417
+ 24.8955
+ -1
+ This Node is a Singleton
+ N/A
+ 478.3374
+ N/A
+ 0.0
+ 478.3374
+
+
+ 6
+ 0.793813
+ CCMSLIB00005724039
+ N/A
+ LC-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005724039
+
+ 0
+ qTof
+
+ 0.0
+ Aminobacteriohopanetriol
+
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00005724039
+ -1
+ 2.01035
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ AMarshall
+ Aminobacteriohopanetriol
+ Positive
+ AMarshall
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4563.0","main.cluster index_upperinput":"4563.0"}
+ 2.01035
+ 3
+
+ ECarlson
+ 3
+ 546.4881
+ CCMSLIB00005724039
+ 546.4881
+ 0.0
+ ECarlson
+ 6951383.034211076
+ qTof
+ Crude
+ 0.00109863
+ M+H
+ N/A
+ LC-ESI
+ Positive
+ 31.0883
+ 7
+ 0.793813
+ 0.0
+ Crude
+ 4563
+ 0.00109863
+ This Node is a Singleton
+ 31.0883
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.7844
+ 5
+ 0
+ Feature Node
+ N/A
+ 1062059.4863244041
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"26810.0","main.cluster index_upperinput":"26810.0"}
+ 26810
+ 3.7844
+ 186
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 368.2065
+ N/A
+ 0.0
+ 368.2065
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 29.9358
+ 9
+ 0
+ Feature Node
+ N/A
+ 20598863.270406745
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1188.0","main.cluster index_upperinput":"1188.0"}
+ 1188
+ 29.9358
+ -1
+ This Node is a Singleton
+ N/A
+ 333.2398
+ N/A
+ 0.0
+ 333.2398
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.0769
+ 6
+ 0
+ Feature Node
+ N/A
+ 3027539.8041400616
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2682.0","main.cluster index_upperinput":"2682.0"}
+ 2682
+ 30.0769
+ -1
+ This Node is a Singleton
+ N/A
+ 651.4595
+ N/A
+ 0.0
+ 651.4595
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.9478
+ 6
+ 0
+ Feature Node
+ N/A
+ 1552712.6328308177
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4622.0","main.cluster index_upperinput":"4622.0"}
+ 4622
+ 15.9478
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=85&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 331.1535
+ N/A
+ 0.0
+ 331.1535
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.9551
+ 6
+ 0
+ Feature Node
+ N/A
+ 2597322.8055982315
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2486.0","main.cluster index_upperinput":"2486.0"}
+ 2486
+ 15.9551
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 510.2689
+ N/A
+ 0.0
+ 510.2689
+
+
+ 6
+ 0.7844810000000001
+ CCMSLIB00000081737
+ N/A
+ DI-ESI
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000081737
+ InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3
+ 0
+ qTof
+ InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3
+ 0.0
+ Quercetin 3,7-dimethyl ether
+ OC1=C(O)C=C(C2=C(OC)C(C3=C(O)C=C(OC)C=C3O2)=O)C=C1
+ http://gnps.ucsd.edu/ProteoSAFe/gnpslibraryspectrum.jsp?SpectrumID=CCMSLIB00000081737
+ -1
+ 16.0388
+ Feature Node
+ N/A
+ 6
+ 0.0
+ 0.0
+ Gobbo Neto
+ Quercetin 3,7-dimethyl ether
+ Positive
+ Gobbo Neto
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7774.0","main.cluster index_upperinput":"7774.0"}
+ 16.0388
+ 3
+ OC1=C(O)C=C(C2=C(OC)C(C3=C(O)C=C(OC)C=C3O2)=O)C=C1
+ Norberto Lopes
+ 3
+ 331.0813
+ CCMSLIB00000081737
+ 331.0813
+ 0.0
+ Norberto Lopes
+ 1490311.7783124517
+ qTof
+ Isolated
+ 0.00531006
+ M+H
+ N/A
+ DI-ESI
+ Positive
+ 16.4649
+ 3
+ 0.7844810000000001
+ 0.0
+ Isolated
+ 7774
+ 0.00531006
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ 16.4649
+ 0.0
+ M+H
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 23.9579
+ 3
+ 0
+ Feature Node
+ N/A
+ 414929.0471389856
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2558.0","main.cluster index_upperinput":"2558.0"}
+ 2558
+ 23.9579
+ -1
+ This Node is a Singleton
+ N/A
+ 369.1673
+ N/A
+ 0.0
+ 369.1673
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.6868
+ 3
+ 0
+ Feature Node
+ N/A
+ 903081.2263049826
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13806.0","main.cluster index_upperinput":"13806.0"}
+ 13806
+ 21.6868
+ -1
+ This Node is a Singleton
+ N/A
+ 433.1835
+ N/A
+ 0.0
+ 433.1835
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.2513
+ 9
+ 0
+ Feature Node
+ N/A
+ 3093211.6042451914
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3804.0","main.cluster index_upperinput":"3804.0"}
+ 3804
+ 31.2513
+ -1
+ This Node is a Singleton
+ N/A
+ 541.3721
+ N/A
+ 0.0
+ 541.3721
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 17.7032
+ 6
+ 0
+ Feature Node
+ N/A
+ 3704244.759637276
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1223.0","main.cluster index_upperinput":"1223.0"}
+ 1223
+ 17.7032
+ 1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=103&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 462.2483
+ N/A
+ 0.0
+ 462.2483
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 8.7689
+ 2
+ 0
+ Feature Node
+ N/A
+ 1157828.6897580242
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10301.0","main.cluster index_upperinput":"10301.0"}
+ 10301
+ 8.7689
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 382.2215
+ N/A
+ 0.0
+ 382.2215
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 20.6559
+ 7
+ 0
+ Feature Node
+ N/A
+ 342060.5246044051
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10608.0","main.cluster index_upperinput":"10608.0"}
+ 10608
+ 20.6559
+ -1
+ This Node is a Singleton
+ N/A
+ 407.2043
+ N/A
+ 0.0
+ 407.2043
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 31.1238
+ 6
+ 0
+ Feature Node
+ N/A
+ 813126.7204450044
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7715.0","main.cluster index_upperinput":"7715.0"}
+ 7715
+ 31.1238
+ -1
+ This Node is a Singleton
+ N/A
+ 511.3745
+ N/A
+ 0.0
+ 511.3745
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 35.3398
+ 5
+ 0
+ Feature Node
+ N/A
+ 2501149.9867495717
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"70.0","main.cluster index_upperinput":"70.0"}
+ 70
+ 35.3398
+ -1
+ This Node is a Singleton
+ N/A
+ 469.3654
+ N/A
+ 0.0
+ 469.3654
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.1118
+ 3
+ 0
+ Feature Node
+ N/A
+ 443645.41711594426
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3571.0","main.cluster index_upperinput":"3571.0"}
+ 3571
+ 19.1118
+ -1
+ This Node is a Singleton
+ N/A
+ 543.1111
+ N/A
+ 0.0
+ 543.1111
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 3.0884
+ 6
+ 0
+ Feature Node
+ N/A
+ 1351569.1633841472
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1505.0","main.cluster index_upperinput":"1505.0"}
+ 1505
+ 3.0884
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 336.2165
+ N/A
+ 0.0
+ 336.2165
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.2183
+ 9
+ 0
+ Feature Node
+ N/A
+ 36803762.31630709
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1185.0","main.cluster index_upperinput":"1185.0"}
+ 1185
+ 33.2183
+ -1
+ This Node is a Singleton
+ N/A
+ 315.2295
+ N/A
+ 0.0
+ 315.2295
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.3795
+ 4
+ 0
+ Feature Node
+ N/A
+ 854247.8285742884
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"13972.0","main.cluster index_upperinput":"13972.0"}
+ 13972
+ 19.3795
+ -1
+ This Node is a Singleton
+ N/A
+ 486.3269
+ N/A
+ 0.0
+ 486.3269
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 6.6522
+ 5
+ 0
+ Feature Node
+ N/A
+ 733297.7244499301
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"5168.0","main.cluster index_upperinput":"5168.0"}
+ 5168
+ 6.6522
+ 408
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=3&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 354.1911
+ N/A
+ 0.0
+ 354.1911
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 21.803
+ 7
+ 0
+ Feature Node
+ N/A
+ 3356661.4701652788
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7767.0","main.cluster index_upperinput":"7767.0"}
+ 7767
+ 21.803
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=32&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 331.0813
+ N/A
+ 0.0
+ 331.0813
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 30.5993
+ 8
+ 0
+ Feature Node
+ N/A
+ 23656414.003031906
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"1653.0","main.cluster index_upperinput":"1653.0"}
+ 1653
+ 30.5993
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=15&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 438.3791
+ N/A
+ 0.0
+ 438.3791
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 2.4207
+ 3
+ 0
+ Feature Node
+ N/A
+ 103114778.12487909
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7710.0","main.cluster index_upperinput":"7710.0"}
+ 7710
+ 2.4207
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=104&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 577.2749
+ N/A
+ 0.0
+ 577.2749
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 19.3464
+ 5
+ 0
+ Feature Node
+ N/A
+ 3945604.6216868428
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"2487.0","main.cluster index_upperinput":"2487.0"}
+ 2487
+ 19.3464
+ 117
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=81&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 380.2071
+ N/A
+ 0.0
+ 380.2071
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 4.5739
+ 7
+ 0
+ Feature Node
+ N/A
+ 4097931.75506004
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"3674.0","main.cluster index_upperinput":"3674.0"}
+ 3674
+ 4.5739
+ 186
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 368.2066
+ N/A
+ 0.0
+ 368.2066
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 33.4467
+ 6
+ 0
+ Feature Node
+ N/A
+ 2539573.2604580563
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7882.0","main.cluster index_upperinput":"7882.0"}
+ 7882
+ 33.4467
+ 36
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=7&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 432.3684
+ N/A
+ 0.0
+ 432.3684
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 14.9515
+ 3
+ 0
+ Feature Node
+ N/A
+ 26850131.026373304
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7620.0","main.cluster index_upperinput":"7620.0"}
+ 7620
+ 14.9515
+ 361
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=11&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 416.1486
+ N/A
+ 0.0
+ 416.1486
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 9.1249
+ 3
+ 0
+ Feature Node
+ N/A
+ 659679.68837183
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"7881.0","main.cluster index_upperinput":"7881.0"}
+ 7881
+ 9.1249
+ -1
+ This Node is a Singleton
+ N/A
+ 536.2036
+ N/A
+ 0.0
+ 536.2036
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 15.3692
+ 2
+ 0
+ Feature Node
+ N/A
+ 462832.78886316693
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"10333.0","main.cluster index_upperinput":"10333.0"}
+ 10333
+ 15.3692
+ -1
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=10&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 480.2572
+ N/A
+ 0.0
+ 480.2572
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 34.7739
+ 7
+ 0
+ Feature Node
+ N/A
+ 4039107.807104065
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"66.0","main.cluster index_upperinput":"66.0"}
+ 66
+ 34.7739
+ 160
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?view=network_displayer&componentindex=65&task=b47430d7801f42eaa9089739417f3aa1&show=true
+ N/A
+ 463.3775
+ N/A
+ 0.0
+ 463.3775
+
+
+ 0.0
+ 0.0
+ 0.0
+ 0.0
+ 22.6028
+ 9
+ 0
+ Feature Node
+ N/A
+ 6453017.313569223
+ 0.0
+ https://gnps.ucsd.edu/ProteoSAFe/result.jsp?task=b47430d7801f42eaa9089739417f3aa1&view=view_all_clusters_withID&show=true#{"main.cluster index_lowerinput":"4527.0","main.cluster index_upperinput":"4527.0"}
+ 4527
+ 22.6028
+ -1
+ This Node is a Singleton
+ N/A
+ 351.2144
+ N/A
+ 0.0
+ 351.2144
+
+
+ 5304
+ 4537
+ 30.01249999999999
+ 5304
+ 0.7344144520464302
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7344144520464302
+ Cosine
+
+
+ 5304
+ 4581
+ -21.98320000000001
+ 5304
+ 0.7709442303346912
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7709442303346912
+ Cosine
+
+
+ 5304
+ 1967
+ 30.012
+ 5304
+ 0.7353733016999827
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7353733016999827
+ Cosine
+
+
+ 5304
+ 1555
+ 30.012599999999964
+ 5304
+ 0.7480948695933904
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7480948695933904
+ Cosine
+
+
+ 5304
+ 2651
+ -68.02420000000001
+ 5304
+ 0.749614292792464
+ 5304.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.749614292792464
+ Cosine
+
+
+ 4748
+ 2753
+ -0.001099999999951251
+ 4748
+ 0.8204940194451813
+ 4748.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8204940194451813
+ Cosine
+
+
+ 2753
+ 1182
+ 14.0154
+ 2753
+ 0.8918886163415309
+ 2753.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8918886163415309
+ Cosine
+
+
+ 4519
+ 2753
+ 13.979100000000017
+ 4519
+ 0.8183387963054145
+ 4519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8183387963054145
+ Cosine
+
+
+ 1405
+ 28
+ 29.063500000000033
+ 1405
+ 0.7022474111030708
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7022474111030708
+ Cosine
+
+
+ 2632
+ 28
+ -38.99939999999998
+ 2632
+ 0.7213324806314514
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7213324806314514
+ Cosine
+
+
+ 2656
+ 28
+ 13.032500000000027
+ 2656
+ 0.7979632908778675
+ 2656.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7979632908778675
+ Cosine
+
+
+ 4503
+ 3534
+ -0.0008000000000265572
+ 4503
+ 0.8448660601832343
+ 4503.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8448660601832343
+ Cosine
+
+
+ 4536
+ 4503
+ 162.05270000000002
+ 4536
+ 0.7016558603828067
+ 4536.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7016558603828067
+ Cosine
+
+
+ 2121
+ 38
+ -34.00619999999998
+ 2121
+ 0.715891953921592
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.715891953921592
+ Cosine
+
+
+ 2666
+ 2121
+ -11.999600000000044
+ 2666
+ 0.7182680466550031
+ 2666.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7182680466550031
+ Cosine
+
+
+ 2121
+ 11
+ -31.989599999999996
+ 2121
+ 0.773780667202226
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.773780667202226
+ Cosine
+
+
+ 2121
+ 284
+ -19.989599999999996
+ 2121
+ 0.7086509031950268
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7086509031950268
+ Cosine
+
+
+ 2121
+ 311
+ -3.996099999999956
+ 2121
+ 0.7371743185974848
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7371743185974848
+ Cosine
+
+
+ 2121
+ 1547
+ -74.08849999999995
+ 2121
+ 0.7135389090967328
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7135389090967328
+ Cosine
+
+
+ 2121
+ 1947
+ -2.01419999999996
+ 2121
+ 0.707424531038481
+ 2121.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.707424531038481
+ Cosine
+
+
+ 2493
+ 2121
+ 31.989299999999957
+ 2493
+ 0.7435587260240298
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7435587260240298
+ Cosine
+
+
+ 2575
+ 2121
+ 19.98879999999997
+ 2575
+ 0.7469756502393592
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7469756502393592
+ Cosine
+
+
+ 2644
+ 2121
+ -265.0298000000001
+ 2644
+ 0.7124412375964764
+ 2644.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7124412375964764
+ Cosine
+
+
+ 2956
+ 2121
+ -12.00120000000004
+ 2956
+ 0.8338778216676173
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8338778216676173
+ Cosine
+
+
+ 3122
+ 2121
+ -12.000300000000038
+ 3122
+ 0.814911173387197
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.814911173387197
+ Cosine
+
+
+ 3667
+ 2121
+ -102.97800000000001
+ 3667
+ 0.7576906197877284
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7576906197877284
+ Cosine
+
+
+ 3771
+ 2121
+ -12.00120000000004
+ 3771
+ 0.8206134372281456
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8206134372281456
+ Cosine
+
+
+ 4539
+ 2121
+ 34.00559999999996
+ 4539
+ 0.7131588092708339
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131588092708339
+ Cosine
+
+
+ 10446
+ 2121
+ 6.0101999999999975
+ 10446
+ 0.7187331176677412
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7187331176677412
+ Cosine
+
+
+ 22481
+ 2121
+ 19.98939999999999
+ 22481
+ 0.7898804535681174
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7898804535681174
+ Cosine
+
+
+ 3602
+ 3546
+ -30.01030000000003
+ 3602
+ 0.7985464255994978
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7985464255994978
+ Cosine
+
+
+ 3602
+ 2692
+ 73.0195
+ 3602
+ 0.7349970377187728
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7349970377187728
+ Cosine
+
+
+ 7732
+ 3602
+ -73.95669999999996
+ 7732
+ 0.7787348005769381
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7787348005769381
+ Cosine
+
+
+ 4537
+ 3602
+ -36.00029999999998
+ 4537
+ 0.7530586718810084
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7530586718810084
+ Cosine
+
+
+ 3602
+ 1322
+ -30.010700000000043
+ 3602
+ 0.8652391427617447
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8652391427617447
+ Cosine
+
+
+ 4581
+ 3602
+ 15.995400000000018
+ 4581
+ 0.8018179626488671
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8018179626488671
+ Cosine
+
+
+ 4603
+ 3602
+ 12.000400000000013
+ 4603
+ 0.7159604528971741
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7159604528971741
+ Cosine
+
+
+ 3602
+ 1376
+ -44.026400000000024
+ 3602
+ 0.765652584880001
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765652584880001
+ Cosine
+
+
+ 4500
+ 3602
+ 15.994700000000023
+ 4500
+ 0.8315600697016436
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8315600697016436
+ Cosine
+
+
+ 7811
+ 3602
+ -3.973099999999988
+ 7811
+ 0.7822858393694567
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7822858393694567
+ Cosine
+
+
+ 3602
+ 1164
+ -15.994500000000016
+ 3602
+ 0.8276067727743148
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8276067727743148
+ Cosine
+
+
+ 3602
+ 1967
+ 35.99979999999999
+ 3602
+ 0.7473944258766461
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7473944258766461
+ Cosine
+
+
+ 4505
+ 3602
+ -94.00569999999993
+ 4505
+ 0.7901933139922511
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7901933139922511
+ Cosine
+
+
+ 3901
+ 3602
+ -78.01149999999996
+ 3901
+ 0.7319785641553663
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7319785641553663
+ Cosine
+
+
+ 3602
+ 1307
+ -15.995300000000043
+ 3602
+ 0.8367714867162924
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367714867162924
+ Cosine
+
+
+ 8341
+ 3602
+ -33.98429999999996
+ 8341
+ 0.7283969191852452
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7283969191852452
+ Cosine
+
+
+ 3602
+ 1361
+ 58.13029999999998
+ 3602
+ 0.8173617371707375
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8173617371707375
+ Cosine
+
+
+ 4587
+ 3602
+ -126.03229999999996
+ 4587
+ 0.7508417973727177
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7508417973727177
+ Cosine
+
+
+ 15800
+ 3602
+ 14.015600000000006
+ 15800
+ 0.7911426964658828
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7911426964658828
+ Cosine
+
+
+ 4452
+ 3602
+ 0.0002000000000066393
+ 4452
+ 0.7656196965925893
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7656196965925893
+ Cosine
+
+
+ 7795
+ 3602
+ -72.1454
+ 7795
+ 0.8041297132580842
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8041297132580842
+ Cosine
+
+
+ 3602
+ 2544
+ 82.04200000000003
+ 3602
+ 0.7373155525962454
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7373155525962454
+ Cosine
+
+
+ 4549
+ 3602
+ -84.02059999999994
+ 4549
+ 0.75565519404953
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.75565519404953
+ Cosine
+
+
+ 3602
+ 1173
+ 51.99509999999998
+ 3602
+ 0.7381882236695442
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7381882236695442
+ Cosine
+
+
+ 3766
+ 3602
+ 14.015800000000013
+ 3766
+ 0.8460905928259282
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8460905928259282
+ Cosine
+
+
+ 26406
+ 3602
+ -53.9751
+ 26406
+ 0.8350216906245809
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8350216906245809
+ Cosine
+
+
+ 11220
+ 3602
+ -19.97049999999996
+ 11220
+ 0.7387078332144256
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7387078332144256
+ Cosine
+
+
+ 3602
+ 1391
+ -46.04200000000003
+ 3602
+ 0.8040962263396993
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8040962263396993
+ Cosine
+
+
+ 3602
+ 1240
+ 84.02080000000001
+ 3602
+ 0.7326416456606066
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7326416456606066
+ Cosine
+
+
+ 13633
+ 3602
+ -19.968999999999994
+ 13633
+ 0.8028427979587769
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8028427979587769
+ Cosine
+
+
+ 4680
+ 3602
+ -114.03160000000003
+ 4680
+ 0.8174858307021338
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8174858307021338
+ Cosine
+
+
+ 7663
+ 3602
+ 30.046600000000012
+ 7663
+ 0.8059331725037213
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8059331725037213
+ Cosine
+
+
+ 3602
+ 1449
+ 220.1834
+ 3602
+ 0.7612844474722413
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7612844474722413
+ Cosine
+
+
+ 7741
+ 3602
+ -37.984099999999955
+ 7741
+ 0.7585643694755902
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7585643694755902
+ Cosine
+
+
+ 7665
+ 3602
+ -55.946199999999976
+ 7665
+ 0.813628047161999
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.813628047161999
+ Cosine
+
+
+ 3602
+ 1296
+ -110.11130000000003
+ 3602
+ 0.7785635665712465
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785635665712465
+ Cosine
+
+
+ 3602
+ 1176
+ 94.00569999999993
+ 3602
+ 0.7646671945046897
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7646671945046897
+ Cosine
+
+
+ 10432
+ 3602
+ 2.0153000000000247
+ 10432
+ 0.807623339502634
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.807623339502634
+ Cosine
+
+
+ 3602
+ 2486
+ 68.02579999999995
+ 3602
+ 0.7557720827692351
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7557720827692351
+ Cosine
+
+
+ 13590
+ 3602
+ -19.96969999999999
+ 13590
+ 0.7785143573206562
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785143573206562
+ Cosine
+
+
+ 4561
+ 3602
+ -78.01149999999996
+ 4561
+ 0.7785887655572539
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785887655572539
+ Cosine
+
+
+ 3602
+ 1335
+ 72.1454
+ 3602
+ 0.7765906610866784
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765906610866784
+ Cosine
+
+
+ 3602
+ 2651
+ -62.036400000000015
+ 3602
+ 0.8060747729664385
+ 3602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8060747729664385
+ Cosine
+
+
+ 4524
+ 3602
+ 30.010800000000017
+ 4524
+ 0.8697149380399049
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8697149380399049
+ Cosine
+
+
+ 4661
+ 3602
+ -70.00599999999997
+ 4661
+ 0.8084880862988078
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8084880862988078
+ Cosine
+
+
+ 5505
+ 3602
+ -98.03639999999996
+ 5505
+ 0.7531784820932602
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7531784820932602
+ Cosine
+
+
+ 7664
+ 3602
+ 64.05190000000005
+ 7664
+ 0.7756918955625833
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7756918955625833
+ Cosine
+
+
+ 8321
+ 3602
+ -36.00029999999998
+ 8321
+ 0.7735948576777987
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7735948576777987
+ Cosine
+
+
+ 20868
+ 3602
+ 12.079200000000014
+ 20868
+ 0.8047357193112071
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8047357193112071
+ Cosine
+
+
+ 26328
+ 3602
+ 12.000500000000045
+ 26328
+ 0.7485283835876764
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7485283835876764
+ Cosine
+
+
+ 5175
+ 5172
+ 0.00019999999999242846
+ 5175
+ 1.0000000000000002
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11101
+ 5172
+ -0.00030000000000995897
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11306
+ 5172
+ -0.0002000000000066393
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11368
+ 5172
+ -0.00010000000000331966
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5172
+ 4995
+ 0.00010000000000331966
+ 5172
+ 1.0000000000000002
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5172
+ 208
+ 57.013300000000015
+ 5172
+ 0.7720262431782003
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 11531
+ 5172
+ -0.00010000000000331966
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11194
+ 5172
+ -0.00030000000000995897
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 5172
+ 25
+ 50.0111
+ 5172
+ 0.7765014360319091
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 5172
+ 4637
+ 14.015900000000002
+ 5172
+ 0.7465660405620628
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 5172
+ 5078
+ 0.00010000000000331966
+ 5172
+ 1.0000000000000002
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5172
+ 5148
+ 0.00010000000000331966
+ 5172
+ 1.0000000000000002
+ 5172.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5194
+ 5172
+ 0.0
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5233
+ 5172
+ 0.00010000000000331966
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11270
+ 5172
+ -0.0002000000000066393
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11321
+ 5172
+ -0.0002000000000066393
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 11346
+ 5172
+ -0.00030000000000995897
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11652
+ 5172
+ 0.00019999999999242846
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 27744
+ 7665
+ 1.9703000000000088
+ 27744
+ 0.7215513523947923
+ 27744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7215513523947923
+ Cosine
+
+
+ 1297
+ 81
+ 17.027199999999993
+ 1297
+ 0.8043731510806602
+ 1297.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8043731510806602
+ Cosine
+
+
+ 103
+ 81
+ 17.026700000000005
+ 103
+ 0.767833132696352
+ 103.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.767833132696352
+ Cosine
+
+
+ 1270
+ 81
+ 0.0005999999999630745
+ 1270
+ 0.8794548674300747
+ 1270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8794548674300747
+ Cosine
+
+
+ 2946
+ 2842
+ 0.00010000000003174137
+ 2946
+ 0.7365359880841337
+ 2946.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7365359880841337
+ Cosine
+
+
+ 5084
+ 2528
+ 0.00010000000000331966
+ 5084
+ 0.8285334913215109
+ 5084.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8285334913215109
+ Cosine
+
+
+ 5090
+ 243
+ 0.00010000000003174137
+ 5090
+ 1.0
+ 5090.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 18086
+ 5046
+ 0.0004999999999881766
+ 18086
+ 1.0
+ 18086.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 3026
+ 1221
+ -74.03559999999999
+ 3026
+ 0.7656581721414648
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7656581721414648
+ Cosine
+
+
+ 10964
+ 3026
+ 0.9461999999999762
+ 10964
+ 0.7046110636144964
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7046110636144964
+ Cosine
+
+
+ 3026
+ 914
+ -88.05079999999998
+ 3026
+ 0.7212610527029386
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7212610527029386
+ Cosine
+
+
+ 3026
+ 1234
+ -74.03590000000003
+ 3026
+ 0.7480613906195074
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7480613906195074
+ Cosine
+
+
+ 3026
+ 1419
+ -25.977599999999995
+ 3026
+ 0.7898130712808873
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7898130712808873
+ Cosine
+
+
+ 3026
+ 343
+ -88.05079999999998
+ 3026
+ 0.7418153348902734
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7418153348902734
+ Cosine
+
+
+ 3026
+ 1405
+ -58.00400000000002
+ 3026
+ 0.7403268109935597
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7403268109935597
+ Cosine
+
+
+ 7731
+ 3026
+ 14.015199999999993
+ 7731
+ 0.7110382290764712
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7110382290764712
+ Cosine
+
+
+ 3026
+ 1547
+ -11.99939999999998
+ 3026
+ 0.8246942180329755
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8246942180329755
+ Cosine
+
+
+ 3026
+ 1220
+ -74.03559999999999
+ 3026
+ 0.717339101887424
+ 3026.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.717339101887424
+ Cosine
+
+
+ 1206
+ 208
+ -19.030999999999977
+ 1206
+ 0.8516239373079879
+ 1206.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8516239373079879
+ Cosine
+
+
+ 1206
+ 25
+ -26.033199999999994
+ 1206
+ 0.8021791482364236
+ 1206.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8021791482364236
+ Cosine
+
+
+ 4637
+ 1206
+ 62.02839999999999
+ 4637
+ 0.7671475246064894
+ 4637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7671475246064894
+ Cosine
+
+
+ 22481
+ 11
+ -12.000200000000007
+ 22481
+ 0.7117852294237987
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7117852294237987
+ Cosine
+
+
+ 22481
+ 284
+ -0.0002000000000066393
+ 22481
+ 0.83507174349074
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.83507174349074
+ Cosine
+
+
+ 22481
+ 311
+ 15.993300000000033
+ 22481
+ 0.7141981870664138
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7141981870664138
+ Cosine
+
+
+ 22481
+ 1547
+ -54.099099999999964
+ 22481
+ 0.7598623189403694
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7598623189403694
+ Cosine
+
+
+ 22481
+ 2493
+ -11.999899999999968
+ 22481
+ 0.7131831039629489
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131831039629489
+ Cosine
+
+
+ 22481
+ 2575
+ 0.0006000000000199179
+ 22481
+ 0.9014871128968096
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9014871128968096
+ Cosine
+
+
+ 22481
+ 2632
+ -32.04079999999999
+ 22481
+ 0.7075182285879547
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7075182285879547
+ Cosine
+
+
+ 22481
+ 2956
+ 31.99060000000003
+ 22481
+ 0.7961935028838072
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7961935028838072
+ Cosine
+
+
+ 22481
+ 3122
+ 31.989700000000028
+ 22481
+ 0.720104678294849
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.720104678294849
+ Cosine
+
+
+ 22481
+ 3667
+ 122.9674
+ 22481
+ 0.7429403695993747
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7429403695993747
+ Cosine
+
+
+ 22481
+ 3771
+ 31.99060000000003
+ 22481
+ 0.7952370556969728
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7952370556969728
+ Cosine
+
+
+ 22481
+ 4539
+ -14.01619999999997
+ 22481
+ 0.7034516013595979
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7034516013595979
+ Cosine
+
+
+ 22481
+ 7731
+ -56.11489999999998
+ 22481
+ 0.7322124168190203
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7322124168190203
+ Cosine
+
+
+ 22481
+ 10446
+ 13.979199999999992
+ 22481
+ 0.8883701398963231
+ 22481.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8883701398963231
+ Cosine
+
+
+ 1419
+ 1184
+ -25.020399999999995
+ 1419
+ 0.704156815818768
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.704156815818768
+ Cosine
+
+
+ 1201
+ 1184
+ -2.0156000000000063
+ 1201
+ 0.8079753208225399
+ 1201.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8079753208225399
+ Cosine
+
+
+ 2519
+ 1574
+ -88.05140000000006
+ 2519
+ 0.8986601742934771
+ 2519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8986601742934771
+ Cosine
+
+
+ 1610
+ 1574
+ -18.009700000000066
+ 1610
+ 0.713530538396776
+ 1610.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.713530538396776
+ Cosine
+
+
+ 1599
+ 1574
+ -44.025100000000066
+ 1599
+ 0.8741372470664268
+ 1599.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8741372470664268
+ Cosine
+
+
+ 7882
+ 1574
+ 176.10539999999997
+ 7882
+ 0.7344341512901172
+ 7882.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7344341512901172
+ Cosine
+
+
+ 3524
+ 2495
+ 112.12559999999996
+ 3524
+ 0.8239440208846887
+ 3524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8239440208846887
+ Cosine
+
+
+ 10243
+ 2495
+ 112.1252
+ 10243
+ 0.8644149402252541
+ 10243.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8644149402252541
+ Cosine
+
+
+ 9484
+ 3721
+ -32.02679999999998
+ 9484
+ 0.7772851018319281
+ 9484.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7772851018319281
+ Cosine
+
+
+ 12784
+ 9484
+ 0.0001999999999497959
+ 12784
+ 0.9325281450932503
+ 12784.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9325281450932503
+ Cosine
+
+
+ 9484
+ 3700
+ -32.02679999999998
+ 9484
+ 0.7772851018319281
+ 9484.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7772851018319281
+ Cosine
+
+
+ 9484
+ 9385
+ -9.999999997489795e-05
+ 9484
+ 0.949656969954427
+ 9484.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.949656969954427
+ Cosine
+
+
+ 7783
+ 3691
+ -0.005300000000033833
+ 7783
+ 0.7332277678406319
+ 7783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7332277678406319
+ Cosine
+
+
+ 2087
+ 1300
+ 0.0
+ 2087
+ 0.7577200355370418
+ 2087.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7577200355370418
+ Cosine
+
+
+ 2087
+ 1833
+ -9.999999997489795e-05
+ 2087
+ 0.7809809953373239
+ 2087.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7809809953373239
+ Cosine
+
+
+ 2775
+ 2087
+ 0.0001999999999782176
+ 2775
+ 0.7865512955137142
+ 2775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7865512955137142
+ Cosine
+
+
+ 7704
+ 2087
+ 0.0
+ 7704
+ 0.7131482618763827
+ 7704.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131482618763827
+ Cosine
+
+
+ 20624
+ 2087
+ 0.0004999999999881766
+ 20624
+ 0.7188923080634381
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7188923080634381
+ Cosine
+
+
+ 3695
+ 3546
+ 0.0362999999999829
+ 3695
+ 0.7594931247845949
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7594931247845949
+ Cosine
+
+
+ 4537
+ 3695
+ -66.0469
+ 4537
+ 0.7474900347695507
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7474900347695507
+ Cosine
+
+
+ 4581
+ 3695
+ -14.051199999999994
+ 4581
+ 0.7247769931745209
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7247769931745209
+ Cosine
+
+
+ 3695
+ 1164
+ 14.052099999999996
+ 3695
+ 0.7611344679452916
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7611344679452916
+ Cosine
+
+
+ 3695
+ 1967
+ 66.0464
+ 3695
+ 0.7450240656523828
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7450240656523828
+ Cosine
+
+
+ 4505
+ 3695
+ -124.05229999999995
+ 4505
+ 0.7440808548110834
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7440808548110834
+ Cosine
+
+
+ 3901
+ 3695
+ -108.05809999999997
+ 3901
+ 0.7230743583425419
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7230743583425419
+ Cosine
+
+
+ 8341
+ 3695
+ -64.03089999999997
+ 8341
+ 0.7175588163536286
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7175588163536286
+ Cosine
+
+
+ 3695
+ 1361
+ 88.17689999999999
+ 3695
+ 0.731487073396109
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.731487073396109
+ Cosine
+
+
+ 4587
+ 3695
+ -156.07889999999998
+ 4587
+ 0.706447085218658
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.706447085218658
+ Cosine
+
+
+ 15800
+ 3695
+ -16.031000000000006
+ 15800
+ 0.7384915981875756
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7384915981875756
+ Cosine
+
+
+ 4549
+ 3695
+ -114.06719999999996
+ 4549
+ 0.7237593716818591
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7237593716818591
+ Cosine
+
+
+ 3695
+ 1173
+ 82.04169999999999
+ 3695
+ 0.714123738218702
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.714123738218702
+ Cosine
+
+
+ 3695
+ 1176
+ 124.05229999999995
+ 3695
+ 0.7205754330538594
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7205754330538594
+ Cosine
+
+
+ 3695
+ 1391
+ -15.995400000000018
+ 3695
+ 0.780480313563672
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.780480313563672
+ Cosine
+
+
+ 3695
+ 1555
+ 66.04699999999997
+ 3695
+ 0.7218531159722177
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218531159722177
+ Cosine
+
+
+ 3695
+ 2651
+ -31.989800000000002
+ 3695
+ 0.7342227427741025
+ 3695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7342227427741025
+ Cosine
+
+
+ 4524
+ 3695
+ -0.035799999999994725
+ 4524
+ 0.7533797400122287
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7533797400122287
+ Cosine
+
+
+ 4661
+ 3695
+ -100.05259999999998
+ 4661
+ 0.7400961071444431
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400961071444431
+ Cosine
+
+
+ 7663
+ 3695
+ 0.0
+ 7663
+ 0.7650848089932543
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7650848089932543
+ Cosine
+
+
+ 7664
+ 3695
+ 34.005300000000034
+ 7664
+ 0.7712080429316863
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7712080429316863
+ Cosine
+
+
+ 10432
+ 3695
+ -28.031299999999987
+ 10432
+ 0.7101417699957217
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101417699957217
+ Cosine
+
+
+ 11220
+ 3695
+ -50.01709999999997
+ 11220
+ 0.7228321366196182
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7228321366196182
+ Cosine
+
+
+ 13590
+ 3695
+ -50.0163
+ 13590
+ 0.7514827293805988
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7514827293805988
+ Cosine
+
+
+ 13633
+ 3695
+ -50.015600000000006
+ 13633
+ 0.7769157736841388
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7769157736841388
+ Cosine
+
+
+ 20868
+ 3695
+ -17.967399999999998
+ 20868
+ 0.736670375381745
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.736670375381745
+ Cosine
+
+
+ 1263
+ 1158
+ 27.995199999999954
+ 1263
+ 0.8670808822264087
+ 1263.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8670808822264087
+ Cosine
+
+
+ 4516
+ 1263
+ 0.0012000000000398359
+ 4516
+ 0.8872880757667982
+ 4516.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8872880757667982
+ Cosine
+
+
+ 4548
+ 1263
+ -132.04229999999995
+ 4548
+ 0.8184404598151797
+ 4548.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8184404598151797
+ Cosine
+
+
+ 10297
+ 5391
+ -14.016300000000001
+ 10297
+ 0.7032473978230875
+ 10297.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7032473978230875
+ Cosine
+
+
+ 11220
+ 3546
+ -49.98079999999999
+ 11220
+ 0.8047136156164197
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8047136156164197
+ Cosine
+
+
+ 11220
+ 4537
+ 16.029800000000023
+ 11220
+ 0.7849124600594989
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7849124600594989
+ Cosine
+
+
+ 11220
+ 1322
+ -49.9812
+ 11220
+ 0.741457963817032
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741457963817032
+ Cosine
+
+
+ 11220
+ 4581
+ -35.965899999999976
+ 11220
+ 0.7205527910192036
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7205527910192036
+ Cosine
+
+
+ 11220
+ 1376
+ -63.99689999999998
+ 11220
+ 0.7174897589780398
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7174897589780398
+ Cosine
+
+
+ 11220
+ 4500
+ -35.96519999999998
+ 11220
+ 0.7754894255033702
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7754894255033702
+ Cosine
+
+
+ 11220
+ 1164
+ -35.964999999999975
+ 11220
+ 0.7731868524671952
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7731868524671952
+ Cosine
+
+
+ 11220
+ 1967
+ 16.029300000000035
+ 11220
+ 0.8030271188696427
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8030271188696427
+ Cosine
+
+
+ 11220
+ 4505
+ 74.03519999999997
+ 11220
+ 0.7957405464998357
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7957405464998357
+ Cosine
+
+
+ 13602
+ 11220
+ 15.996499999999969
+ 13602
+ 0.7133132859170419
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7133132859170419
+ Cosine
+
+
+ 11220
+ 3901
+ 58.041
+ 11220
+ 0.7286249780507655
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7286249780507655
+ Cosine
+
+
+ 11220
+ 1307
+ -35.9658
+ 11220
+ 0.7281238456256796
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7281238456256796
+ Cosine
+
+
+ 11220
+ 8341
+ 14.013800000000003
+ 11220
+ 0.885983515317287
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.885983515317287
+ Cosine
+
+
+ 11220
+ 4587
+ 106.0618
+ 11220
+ 0.7357933193155615
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7357933193155615
+ Cosine
+
+
+ 15800
+ 11220
+ 33.986099999999965
+ 15800
+ 0.7297968247394834
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7297968247394834
+ Cosine
+
+
+ 11220
+ 7795
+ 52.17490000000004
+ 11220
+ 0.7013774437777829
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013774437777829
+ Cosine
+
+
+ 11220
+ 4549
+ 64.05009999999999
+ 11220
+ 0.7337668592508626
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7337668592508626
+ Cosine
+
+
+ 11220
+ 1173
+ 32.02460000000002
+ 11220
+ 0.7373294060477242
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7373294060477242
+ Cosine
+
+
+ 11220
+ 7648
+ 34.00460000000004
+ 11220
+ 0.8031320440636947
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8031320440636947
+ Cosine
+
+
+ 26406
+ 11220
+ -34.00460000000004
+ 26406
+ 0.769426162382709
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.769426162382709
+ Cosine
+
+
+ 11220
+ 1176
+ 74.03519999999997
+ 11220
+ 0.7549181770630964
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7549181770630964
+ Cosine
+
+
+ 11220
+ 1335
+ 52.17490000000004
+ 11220
+ 0.7105837649410915
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7105837649410915
+ Cosine
+
+
+ 11220
+ 1391
+ -66.01249999999999
+ 11220
+ 0.7350733595079555
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7350733595079555
+ Cosine
+
+
+ 11220
+ 1449
+ 200.21290000000005
+ 11220
+ 0.7011820137878435
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7011820137878435
+ Cosine
+
+
+ 11220
+ 1555
+ 16.029899999999998
+ 11220
+ 0.718934939367385
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.718934939367385
+ Cosine
+
+
+ 11220
+ 2651
+ -82.00689999999997
+ 11220
+ 0.809082073301524
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.809082073301524
+ Cosine
+
+
+ 11220
+ 4524
+ -49.981299999999976
+ 11220
+ 0.7801130496733726
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7801130496733726
+ Cosine
+
+
+ 11220
+ 4561
+ 58.041
+ 11220
+ 0.7615003492401238
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7615003492401238
+ Cosine
+
+
+ 11220
+ 4661
+ 50.03550000000001
+ 11220
+ 0.7256229482441166
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7256229482441166
+ Cosine
+
+
+ 11220
+ 4680
+ 94.06110000000007
+ 11220
+ 0.7400936427643684
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400936427643684
+ Cosine
+
+
+ 11220
+ 7663
+ -50.01709999999997
+ 11220
+ 0.7274103558351996
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7274103558351996
+ Cosine
+
+
+ 11220
+ 7664
+ -84.0224
+ 11220
+ 0.8082237730808561
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8082237730808561
+ Cosine
+
+
+ 11220
+ 7665
+ 35.97570000000002
+ 11220
+ 0.7505165201278037
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7505165201278037
+ Cosine
+
+
+ 11220
+ 8321
+ 16.029800000000023
+ 11220
+ 0.7695176607233686
+ 11220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7695176607233686
+ Cosine
+
+
+ 12201
+ 11220
+ 0.0004000000000132786
+ 12201
+ 0.8609303611555306
+ 12201.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8609303611555306
+ Cosine
+
+
+ 13590
+ 11220
+ 0.0007999999999697138
+ 13590
+ 0.9072490955914636
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9072490955914636
+ Cosine
+
+
+ 13633
+ 11220
+ 0.0014999999999645297
+ 13633
+ 0.9431305295297964
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9431305295297964
+ Cosine
+
+
+ 13737
+ 11220
+ 9.00569999999999
+ 13737
+ 0.7840869821541714
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7840869821541714
+ Cosine
+
+
+ 20868
+ 11220
+ 32.04969999999997
+ 20868
+ 0.7506359487646915
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7506359487646915
+ Cosine
+
+
+ 1294
+ 386
+ 172.07369999999997
+ 1294
+ 0.8488490598740466
+ 1294.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8488490598740466
+ Cosine
+
+
+ 1294
+ 102
+ 86.0369
+ 1294
+ 0.8057301168898261
+ 1294.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8057301168898261
+ Cosine
+
+
+ 1294
+ 109
+ 0.00050000000004502
+ 1294
+ 0.7903383365204155
+ 1294.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7903383365204155
+ Cosine
+
+
+ 1294
+ 1252
+ 86.03720000000004
+ 1294
+ 0.7988622867642146
+ 1294.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7988622867642146
+ Cosine
+
+
+ 10586
+ 3528
+ -0.0011999999999829924
+ 10586
+ 0.8439330202256786
+ 10586.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8439330202256786
+ Cosine
+
+
+ 10586
+ 2703
+ -0.0007999999999697138
+ 10586
+ 0.8663458868059664
+ 10586.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8663458868059664
+ Cosine
+
+
+ 1154
+ 2
+ 0.0012000000000398359
+ 1154
+ 0.8705589146777352
+ 1154.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8705589146777352
+ Cosine
+
+
+ 1203
+ 1155
+ -208.04050000000007
+ 1203
+ 0.8655778433180707
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8655778433180707
+ Cosine
+
+
+ 10473
+ 1155
+ -208.04110000000003
+ 10473
+ 0.8655778433180707
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8655778433180707
+ Cosine
+
+
+ 28000
+ 1155
+ -60.00300000000004
+ 28000
+ 0.9209023933261088
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9209023933261088
+ Cosine
+
+
+ 4605
+ 1155
+ 271.1094
+ 4605
+ 0.705543334949455
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.705543334949455
+ Cosine
+
+
+ 1155
+ 1
+ 134.02160000000003
+ 1155
+ 0.9133645871855882
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9133645871855882
+ Cosine
+
+
+ 1155
+ 9
+ 14.0154
+ 1155
+ 0.9175099853208153
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9175099853208153
+ Cosine
+
+
+ 2571
+ 1155
+ 74.019
+ 2571
+ 0.8435889684931681
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8435889684931681
+ Cosine
+
+
+ 4517
+ 1155
+ 106.04520000000002
+ 4517
+ 0.7829182708250284
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7829182708250284
+ Cosine
+
+
+ 1155
+ 259
+ 60.002500000000055
+ 1155
+ 0.9109755838344882
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9109755838344882
+ Cosine
+
+
+ 7635
+ 1155
+ 0.8433999999999742
+ 7635
+ 0.8062979877508201
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8062979877508201
+ Cosine
+
+
+ 3521
+ 1155
+ -74.01870000000008
+ 3521
+ 0.9679154544162896
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9679154544162896
+ Cosine
+
+
+ 4552
+ 1155
+ -14.014900000000011
+ 4552
+ 0.9031236616837173
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9031236616837173
+ Cosine
+
+
+ 3522
+ 1155
+ -43.97270000000003
+ 3522
+ 0.8899739195012284
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8899739195012284
+ Cosine
+
+
+ 1155
+ 6
+ 138.98120000000006
+ 1155
+ 0.7553129678930819
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553129678930819
+ Cosine
+
+
+ 1155
+ 31
+ -271.1092
+ 1155
+ 0.7011623773848672
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7011623773848672
+ Cosine
+
+
+ 1155
+ 39
+ 60.00240000000008
+ 1155
+ 0.8910706180253997
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8910706180253997
+ Cosine
+
+
+ 1155
+ 54
+ -12.019699999999943
+ 1155
+ 0.8329363578319362
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8329363578319362
+ Cosine
+
+
+ 1155
+ 58
+ -14.015899999999988
+ 1155
+ 0.8688179184439764
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8688179184439764
+ Cosine
+
+
+ 1155
+ 144
+ -88.03469999999993
+ 1155
+ 0.849850900184079
+ 1155.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.849850900184079
+ Cosine
+
+
+ 1156
+ 1155
+ 30.045999999999935
+ 1156
+ 0.8195488854450933
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8195488854450933
+ Cosine
+
+
+ 1479
+ 1155
+ -11.264700000000062
+ 1479
+ 0.853347145918151
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.853347145918151
+ Cosine
+
+
+ 5160
+ 1155
+ -60.002700000000004
+ 5160
+ 0.9262146392460844
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9262146392460844
+ Cosine
+
+
+ 5332
+ 1155
+ 271.109
+ 5332
+ 0.7665554082962938
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7665554082962938
+ Cosine
+
+
+ 1540
+ 1244
+ 14.014800000000037
+ 1540
+ 0.7267995672116246
+ 1540.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7267995672116246
+ Cosine
+
+
+ 4576
+ 1540
+ 9.999999997489795e-05
+ 4576
+ 0.7051646493776003
+ 4576.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7051646493776003
+ Cosine
+
+
+ 9511
+ 2474
+ 0.0007999999999697138
+ 9511
+ 1.0
+ 9511.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 4993
+ 2214
+ -156.04250000000002
+ 4993
+ 0.814915655945658
+ 4993.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.814915655945658
+ Cosine
+
+
+ 13592
+ 4993
+ 158.05880000000002
+ 13592
+ 0.7458700364923894
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7458700364923894
+ Cosine
+
+
+ 4993
+ 4789
+ -42.011999999999944
+ 4993
+ 0.7531977192939415
+ 4993.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7531977192939415
+ Cosine
+
+
+ 4993
+ 2497
+ -58.00559999999996
+ 4993
+ 0.7874303041617772
+ 4993.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7874303041617772
+ Cosine
+
+
+ 4993
+ 2525
+ -58.00670000000002
+ 4993
+ 0.7712089288434372
+ 4993.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7712089288434372
+ Cosine
+
+
+ 13698
+ 4993
+ 60.021600000000035
+ 13698
+ 0.7300814843190786
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7300814843190786
+ Cosine
+
+
+ 2512
+ 1192
+ 0.994499999999988
+ 2512
+ 0.807651398132234
+ 2512.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.807651398132234
+ Cosine
+
+
+ 7742
+ 2476
+ -0.0004000000000132786
+ 7742
+ 0.9098741536617603
+ 7742.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9098741536617603
+ Cosine
+
+
+ 38
+ 11
+ 2.0165999999999826
+ 38
+ 0.7947227214684931
+ 38.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7947227214684931
+ Cosine
+
+
+ 2493
+ 38
+ -2.016900000000021
+ 2493
+ 0.7750782350751233
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7750782350751233
+ Cosine
+
+
+ 3771
+ 38
+ -46.00740000000002
+ 3771
+ 0.7136202564816345
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7136202564816345
+ Cosine
+
+
+ 4539
+ 38
+ -0.0006000000000199179
+ 4539
+ 0.8606687441950156
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8606687441950156
+ Cosine
+
+
+ 7731
+ 38
+ 42.09809999999999
+ 7731
+ 0.7031069988199695
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7031069988199695
+ Cosine
+
+
+ 4539
+ 2493
+ 2.016300000000001
+ 4539
+ 0.8241835400517588
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8241835400517588
+ Cosine
+
+
+ 2493
+ 11
+ -0.0003000000000383807
+ 2493
+ 0.9108787174159405
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9108787174159405
+ Cosine
+
+
+ 2493
+ 1419
+ -56.07740000000001
+ 2493
+ 0.7306633632828473
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7306633632828473
+ Cosine
+
+
+ 2493
+ 1547
+ -42.099199999999996
+ 2493
+ 0.7194645854692416
+ 2493.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7194645854692416
+ Cosine
+
+
+ 2575
+ 2493
+ -12.000499999999988
+ 2575
+ 0.7101988126060368
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101988126060368
+ Cosine
+
+
+ 7931
+ 2509
+ -162.05239999999998
+ 7931
+ 0.7182440326604289
+ 7931.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7182440326604289
+ Cosine
+
+
+ 7931
+ 3575
+ -30.01069999999993
+ 7931
+ 0.8830255386645163
+ 7931.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8830255386645163
+ Cosine
+
+
+ 7931
+ 7859
+ -30.009900000000016
+ 7931
+ 0.9278006426634611
+ 7931.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9278006426634611
+ Cosine
+
+
+ 15865
+ 7931
+ 30.01019999999994
+ 15865
+ 0.8911228507098409
+ 15865.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8911228507098409
+ Cosine
+
+
+ 20637
+ 1322
+ 0.0
+ 20637
+ 0.7437381098280345
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7437381098280345
+ Cosine
+
+
+ 20637
+ 1173
+ 82.00580000000002
+ 20637
+ 0.7326390798031415
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7326390798031415
+ Cosine
+
+
+ 20637
+ 1307
+ 14.0154
+ 20637
+ 0.715695640062288
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.715695640062288
+ Cosine
+
+
+ 20637
+ 4661
+ 100.01670000000001
+ 20637
+ 0.7206767677751681
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206767677751681
+ Cosine
+
+
+ 20637
+ 7663
+ -0.03589999999996962
+ 20637
+ 0.7273917897225644
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7273917897225644
+ Cosine
+
+
+ 20637
+ 15800
+ 15.995100000000036
+ 20637
+ 0.7172744488815417
+ 20637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7172744488815417
+ Cosine
+
+
+ 20868
+ 20637
+ -17.931500000000028
+ 20868
+ 0.7186533346122039
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7186533346122039
+ Cosine
+
+
+ 7719
+ 4670
+ 0.002200000000016189
+ 7719
+ 0.7332963011021447
+ 7719.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7332963011021447
+ Cosine
+
+
+ 12201
+ 8341
+ 14.014200000000017
+ 12201
+ 0.7827025212907195
+ 12201.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7827025212907195
+ Cosine
+
+
+ 12201
+ 7648
+ 34.00500000000005
+ 12201
+ 0.707541949648786
+ 12201.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.707541949648786
+ Cosine
+
+
+ 13633
+ 12201
+ 0.001099999999951251
+ 13633
+ 0.7867328189125501
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7867328189125501
+ Cosine
+
+
+ 13590
+ 12201
+ 0.0003999999999564352
+ 13590
+ 0.7717597822116571
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7717597822116571
+ Cosine
+
+
+ 4766
+ 2353
+ -0.002200000000016189
+ 4766
+ 0.7942440930131931
+ 4766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7942440930131931
+ Cosine
+
+
+ 4854
+ 2353
+ -0.0020000000000095497
+ 4854
+ 0.7596247135461998
+ 4854.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7596247135461998
+ Cosine
+
+
+ 10240
+ 2353
+ -98.03910000000008
+ 10240
+ 0.7064613282440434
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7064613282440434
+ Cosine
+
+
+ 10404
+ 2353
+ -18.011600000000044
+ 10404
+ 0.7146276246276508
+ 10404.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7146276246276508
+ Cosine
+
+
+ 2956
+ 1947
+ -14.0154
+ 2956
+ 0.7005013221740003
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7005013221740003
+ Cosine
+
+
+ 3771
+ 1947
+ -14.0154
+ 3771
+ 0.703032174475851
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.703032174475851
+ Cosine
+
+
+ 1787
+ 1253
+ -21.983900000000006
+ 1787
+ 0.9200705326458943
+ 1787.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9200705326458943
+ Cosine
+
+
+ 1310
+ 1253
+ -23.99989999999997
+ 1310
+ 0.9330399167729522
+ 1310.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9330399167729522
+ Cosine
+
+
+ 3285
+ 1253
+ -282.1981
+ 3285
+ 0.8467668155037447
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8467668155037447
+ Cosine
+
+
+ 1253
+ 1169
+ 262.2286
+ 1253
+ 0.8487356590849324
+ 1253.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8487356590849324
+ Cosine
+
+
+ 13642
+ 13609
+ -11.999299999999948
+ 13642
+ 0.8278357652854851
+ 13642.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8278357652854851
+ Cosine
+
+
+ 13660
+ 13609
+ -54.01070000000004
+ 13660
+ 0.8233073997097531
+ 13660.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8233073997097531
+ Cosine
+
+
+ 13719
+ 13609
+ 42.00959999999998
+ 13719
+ 0.8402373439354043
+ 13719.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8402373439354043
+ Cosine
+
+
+ 4748
+ 4519
+ -13.980199999999968
+ 4748
+ 0.7766496308471901
+ 4748.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7766496308471901
+ Cosine
+
+
+ 4519
+ 1182
+ 27.994500000000016
+ 4519
+ 0.8114501274770394
+ 4519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8114501274770394
+ Cosine
+
+
+ 1234
+ 1221
+ 0.0003000000000383807
+ 1234
+ 0.9227094492700184
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9227094492700184
+ Cosine
+
+
+ 5818
+ 1234
+ -60.02040000000005
+ 5818
+ 0.7670934226937828
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7670934226937828
+ Cosine
+
+
+ 2632
+ 1234
+ -84.09480000000002
+ 2632
+ 0.7768095731207301
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7768095731207301
+ Cosine
+
+
+ 10964
+ 1234
+ -73.08970000000005
+ 10964
+ 0.8192428076481593
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8192428076481593
+ Cosine
+
+
+ 1234
+ 1068
+ -14.014899999999955
+ 1234
+ 0.8145852786029653
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8145852786029653
+ Cosine
+
+
+ 1234
+ 914
+ -14.014899999999955
+ 1234
+ 0.9046146790469793
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9046146790469793
+ Cosine
+
+
+ 1234
+ 343
+ -14.014899999999955
+ 1234
+ 0.9446122263062846
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9446122263062846
+ Cosine
+
+
+ 1234
+ 1220
+ 0.0003000000000383807
+ 1234
+ 0.8232620548712922
+ 1234.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8232620548712922
+ Cosine
+
+
+ 1405
+ 1234
+ -16.031900000000007
+ 1405
+ 0.7415746491495357
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7415746491495357
+ Cosine
+
+
+ 1419
+ 1234
+ -48.05830000000003
+ 1419
+ 0.8132201225889226
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8132201225889226
+ Cosine
+
+
+ 1547
+ 1234
+ -62.036500000000046
+ 1547
+ 0.8713447233562852
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713447233562852
+ Cosine
+
+
+ 3770
+ 1234
+ -71.07400000000001
+ 3770
+ 0.712767831352374
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.712767831352374
+ Cosine
+
+
+ 7731
+ 1234
+ -60.02070000000003
+ 7731
+ 0.8388270539136374
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8388270539136374
+ Cosine
+
+
+ 13816
+ 10372
+ 0.001199999999926149
+ 13816
+ 0.7471154676079341
+ 13816.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7471154676079341
+ Cosine
+
+
+ 7633
+ 7632
+ 18.009600000000034
+ 7633
+ 0.8326859751306808
+ 7633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8326859751306808
+ Cosine
+
+
+ 7633
+ 7628
+ -33.96119999999996
+ 7633
+ 0.7811289690078043
+ 7633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7811289690078043
+ Cosine
+
+
+ 7633
+ 4589
+ -49.956699999999984
+ 7633
+ 0.7101020216018803
+ 7633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101020216018803
+ Cosine
+
+
+ 2491
+ 24
+ 0.0002000000000066393
+ 2491
+ 0.7047198629324718
+ 2491.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7047198629324718
+ Cosine
+
+
+ 5175
+ 4995
+ 0.0002999999999957481
+ 5175
+ 1.0000000000000002
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11101
+ 4995
+ -0.0002000000000066393
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11306
+ 4995
+ -0.00010000000000331966
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11368
+ 4995
+ 0.0
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 4995
+ 25
+ 50.010999999999996
+ 4995
+ 0.7765014360319091
+ 4995.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 4995
+ 208
+ 57.01320000000001
+ 4995
+ 0.7720262431782003
+ 4995.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 4995
+ 4637
+ 14.015799999999999
+ 4995
+ 0.7465660405620628
+ 4995.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 5078
+ 4995
+ 0.0
+ 5078
+ 1.0000000000000002
+ 5078.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5148
+ 4995
+ 0.0
+ 5148
+ 1.0000000000000002
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5194
+ 4995
+ 0.00010000000000331966
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5233
+ 4995
+ 0.0002000000000066393
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11194
+ 4995
+ -0.0002000000000066393
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11270
+ 4995
+ -0.00010000000000331966
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11321
+ 4995
+ -0.00010000000000331966
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 11346
+ 4995
+ -0.0002000000000066393
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11531
+ 4995
+ 0.0
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11652
+ 4995
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 3752
+ 1679
+ 15.994799999999998
+ 3752
+ 0.7171517351157293
+ 3752.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7171517351157293
+ Cosine
+
+
+ 2287
+ 1679
+ -76.05220000000003
+ 2287
+ 0.7059824339548566
+ 2287.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7059824339548566
+ Cosine
+
+
+ 1474
+ 1405
+ -18.0111
+ 1474
+ 0.7853542886820077
+ 1474.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7853542886820077
+ Cosine
+
+
+ 1405
+ 1244
+ -0.037499999999965894
+ 1405
+ 0.7134390387660311
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7134390387660311
+ Cosine
+
+
+ 1405
+ 1221
+ -16.03159999999997
+ 1405
+ 0.7227141359260585
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7227141359260585
+ Cosine
+
+
+ 2632
+ 1405
+ -68.06290000000001
+ 2632
+ 0.7812110136276462
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7812110136276462
+ Cosine
+
+
+ 1405
+ 270
+ 22.005899999999997
+ 1405
+ 0.7848299475800582
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7848299475800582
+ Cosine
+
+
+ 10964
+ 1405
+ -57.05780000000004
+ 10964
+ 0.8017282432903488
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8017282432903488
+ Cosine
+
+
+ 1405
+ 914
+ -30.046799999999962
+ 1405
+ 0.7045338768361806
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7045338768361806
+ Cosine
+
+
+ 1419
+ 1405
+ -32.026400000000024
+ 1419
+ 0.8708279395733682
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8708279395733682
+ Cosine
+
+
+ 1405
+ 343
+ -30.046799999999962
+ 1405
+ 0.7278045857560856
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7278045857560856
+ Cosine
+
+
+ 1405
+ 1352
+ 3.995300000000043
+ 1405
+ 0.7878786501325126
+ 1405.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7878786501325126
+ Cosine
+
+
+ 1547
+ 1405
+ -46.00460000000004
+ 1547
+ 0.8114856622627353
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8114856622627353
+ Cosine
+
+
+ 19733
+ 3546
+ 0.0007999999999697138
+ 19733
+ 0.7802608152888822
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7802608152888822
+ Cosine
+
+
+ 19733
+ 1164
+ 14.016599999999983
+ 19733
+ 0.7806719873157493
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7806719873157493
+ Cosine
+
+
+ 19733
+ 1307
+ 14.015799999999956
+ 19733
+ 0.7109625276765146
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7109625276765146
+ Cosine
+
+
+ 19733
+ 3747
+ 0.0001999999999497959
+ 19733
+ 0.7603828728366142
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7603828728366142
+ Cosine
+
+
+ 19733
+ 4500
+ 14.016399999999976
+ 19733
+ 0.7967805564690362
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7967805564690362
+ Cosine
+
+
+ 19733
+ 4549
+ 114.03169999999994
+ 19733
+ 0.7195390650854484
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7195390650854484
+ Cosine
+
+
+ 19733
+ 4603
+ 18.010699999999986
+ 19733
+ 0.7217810792832124
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7217810792832124
+ Cosine
+
+
+ 19733
+ 4661
+ 100.01709999999997
+ 19733
+ 0.7509848409336357
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7509848409336357
+ Cosine
+
+
+ 19733
+ 7664
+ -34.04080000000005
+ 19733
+ 0.7271957359005612
+ 19733.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7271957359005612
+ Cosine
+
+
+ 26328
+ 19733
+ -18.010599999999954
+ 26328
+ 0.7531096055436386
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7531096055436386
+ Cosine
+
+
+ 7130
+ 6
+ 74.02060000000006
+ 7130
+ 0.7114586408169032
+ 7130.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7114586408169032
+ Cosine
+
+
+ 7130
+ 2696
+ 0.0
+ 7130
+ 0.7066319339722262
+ 7130.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7066319339722262
+ Cosine
+
+
+ 4748
+ 1182
+ 14.014300000000048
+ 4748
+ 0.8631775019966819
+ 4748.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8631775019966819
+ Cosine
+
+
+ 386
+ 102
+ -86.03679999999997
+ 386
+ 0.8240485506661712
+ 386.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8240485506661712
+ Cosine
+
+
+ 109
+ 102
+ 86.03639999999996
+ 109
+ 0.7590772324092623
+ 109.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7590772324092623
+ Cosine
+
+
+ 1252
+ 102
+ -0.0003000000000383807
+ 1252
+ 0.8175805505167573
+ 1252.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8175805505167573
+ Cosine
+
+
+ 1221
+ 343
+ -14.015199999999993
+ 1221
+ 0.9205357085318602
+ 1221.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9205357085318602
+ Cosine
+
+
+ 1221
+ 914
+ -14.015199999999993
+ 1221
+ 0.8611351626496024
+ 1221.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8611351626496024
+ Cosine
+
+
+ 1221
+ 1068
+ -14.015199999999993
+ 1221
+ 0.793949614376015
+ 1221.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.793949614376015
+ Cosine
+
+
+ 1221
+ 1220
+ 0.0
+ 1221
+ 0.8089668077239309
+ 1221.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8089668077239309
+ Cosine
+
+
+ 1419
+ 1221
+ -48.05799999999999
+ 1419
+ 0.775293609346556
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.775293609346556
+ Cosine
+
+
+ 1547
+ 1221
+ -62.03620000000001
+ 1547
+ 0.8554217733194884
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8554217733194884
+ Cosine
+
+
+ 2632
+ 1221
+ -84.09449999999998
+ 2632
+ 0.7777354925858587
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7777354925858587
+ Cosine
+
+
+ 3770
+ 1221
+ -71.07369999999997
+ 3770
+ 0.7012291355150512
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7012291355150512
+ Cosine
+
+
+ 5818
+ 1221
+ -60.02010000000001
+ 5818
+ 0.752946558278959
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.752946558278959
+ Cosine
+
+
+ 7731
+ 1221
+ -60.020399999999995
+ 7731
+ 0.8198281074348206
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8198281074348206
+ Cosine
+
+
+ 10964
+ 1221
+ -73.08940000000001
+ 10964
+ 0.7876213832319938
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7876213832319938
+ Cosine
+
+
+ 5273
+ 1187
+ 31.98969999999997
+ 5273
+ 0.7364154404766117
+ 5273.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7364154404766117
+ Cosine
+
+
+ 4504
+ 1187
+ -14.01600000000002
+ 4504
+ 0.8250658965975559
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8250658965975559
+ Cosine
+
+
+ 1187
+ 1162
+ 179.07950000000005
+ 1187
+ 0.7872214730685516
+ 1187.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872214730685516
+ Cosine
+
+
+ 2483
+ 1187
+ -31.042200000000037
+ 2483
+ 0.7602874186073685
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7602874186073685
+ Cosine
+
+
+ 4507
+ 1187
+ -0.00050000000004502
+ 4507
+ 0.883384932825698
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.883384932825698
+ Cosine
+
+
+ 1187
+ 1165
+ 0.0002000000000066393
+ 1187
+ 0.9272971101558853
+ 1187.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9272971101558853
+ Cosine
+
+
+ 2478
+ 1187
+ -14.015000000000043
+ 2478
+ 0.7771681970792208
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7771681970792208
+ Cosine
+
+
+ 1196
+ 1187
+ -17.026200000000017
+ 1196
+ 0.8944782577371233
+ 1196.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8944782577371233
+ Cosine
+
+
+ 4508
+ 1187
+ -31.042400000000043
+ 4508
+ 0.7962817192880156
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7962817192880156
+ Cosine
+
+
+ 7635
+ 1203
+ 208.88390000000004
+ 7635
+ 0.7184506527315702
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7184506527315702
+ Cosine
+
+
+ 10473
+ 7635
+ -208.8845
+ 10473
+ 0.7184506527315702
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7184506527315702
+ Cosine
+
+
+ 28000
+ 7635
+ -60.84640000000002
+ 28000
+ 0.7424720167874623
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7424720167874623
+ Cosine
+
+
+ 7635
+ 1
+ 134.865
+ 7635
+ 0.7303282455265786
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7303282455265786
+ Cosine
+
+
+ 7635
+ 9
+ 14.858799999999974
+ 7635
+ 0.7302285988581841
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7302285988581841
+ Cosine
+
+
+ 7635
+ 2571
+ -73.17560000000003
+ 7635
+ 0.7823808867954816
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7823808867954816
+ Cosine
+
+
+ 7635
+ 259
+ 60.84590000000003
+ 7635
+ 0.7408988662766178
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408988662766178
+ Cosine
+
+
+ 7635
+ 39
+ 60.845800000000054
+ 7635
+ 0.7314639216106239
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7314639216106239
+ Cosine
+
+
+ 7635
+ 58
+ -13.172500000000014
+ 7635
+ 0.7234029085690521
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7234029085690521
+ Cosine
+
+
+ 7635
+ 144
+ -87.19129999999996
+ 7635
+ 0.7093357653572645
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7093357653572645
+ Cosine
+
+
+ 7635
+ 1479
+ 12.108100000000036
+ 7635
+ 0.7432482422786832
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7432482422786832
+ Cosine
+
+
+ 7635
+ 3521
+ 74.86210000000005
+ 7635
+ 0.8038517853523826
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8038517853523826
+ Cosine
+
+
+ 7635
+ 3522
+ 44.816100000000006
+ 7635
+ 0.7394313902138818
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7394313902138818
+ Cosine
+
+
+ 7635
+ 4552
+ 14.858299999999986
+ 7635
+ 0.7398416947305744
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7398416947305744
+ Cosine
+
+
+ 7635
+ 5160
+ 60.84609999999998
+ 7635
+ 0.742947525937506
+ 7635.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.742947525937506
+ Cosine
+
+
+ 13721
+ 13664
+ -68.02620000000002
+ 13721
+ 0.727679155184577
+ 13721.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.727679155184577
+ Cosine
+
+
+ 10258
+ 4662
+ -114.03230000000002
+ 10258
+ 0.7399714234788617
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7399714234788617
+ Cosine
+
+
+ 4775
+ 4662
+ 0.015300000000024738
+ 4775
+ 0.8494154600297876
+ 4775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8494154600297876
+ Cosine
+
+
+ 4662
+ 4584
+ 0.0002000000000066393
+ 4662
+ 0.8849451317291723
+ 4662.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8849451317291723
+ Cosine
+
+
+ 10240
+ 4662
+ -98.03760000000005
+ 10240
+ 0.8141655199342035
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8141655199342035
+ Cosine
+
+
+ 8014
+ 2526
+ -30.011100000000056
+ 8014
+ 0.7996052967992242
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7996052967992242
+ Cosine
+
+
+ 8014
+ 2649
+ -14.015600000000063
+ 8014
+ 0.707912501867658
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.707912501867658
+ Cosine
+
+
+ 8014
+ 302
+ -46.006399999999985
+ 8014
+ 0.7096719242269933
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7096719242269933
+ Cosine
+
+
+ 8014
+ 2628
+ -15.996200000000044
+ 8014
+ 0.727453932430398
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.727453932430398
+ Cosine
+
+
+ 8014
+ 2573
+ -30.010899999999992
+ 8014
+ 0.7889100787821206
+ 8014.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7889100787821206
+ Cosine
+
+
+ 9004
+ 8014
+ 0.0006000000000767614
+ 9004
+ 0.7872509704571251
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872509704571251
+ Cosine
+
+
+ 10239
+ 4618
+ -26.0154
+ 10239
+ 0.7698876711824088
+ 10239.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7698876711824088
+ Cosine
+
+
+ 4618
+ 2487
+ -15.9957
+ 4618
+ 0.7426747379947732
+ 4618.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7426747379947732
+ Cosine
+
+
+ 10246
+ 4618
+ -42.01029999999997
+ 10246
+ 0.8418240294098023
+ 10246.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8418240294098023
+ Cosine
+
+
+ 4972
+ 4618
+ -36.9803
+ 4972
+ 0.7115894389163602
+ 4972.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7115894389163602
+ Cosine
+
+
+ 4618
+ 4030
+ -15.995400000000018
+ 4618
+ 0.806132715252391
+ 4618.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.806132715252391
+ Cosine
+
+
+ 12784
+ 3721
+ -32.02660000000003
+ 12784
+ 0.7519522857955085
+ 12784.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7519522857955085
+ Cosine
+
+
+ 12784
+ 3700
+ -32.02660000000003
+ 12784
+ 0.7519522857955085
+ 12784.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7519522857955085
+ Cosine
+
+
+ 12784
+ 9385
+ 9.999999997489795e-05
+ 12784
+ 0.9479861906585321
+ 12784.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9479861906585321
+ Cosine
+
+
+ 4854
+ 4584
+ -0.00029999999998153726
+ 4854
+ 0.7326617053443288
+ 4854.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7326617053443288
+ Cosine
+
+
+ 4854
+ 4766
+ 0.0002000000000066393
+ 4854
+ 0.7948434693111972
+ 4854.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7948434693111972
+ Cosine
+
+
+ 10240
+ 4854
+ -98.03710000000007
+ 10240
+ 0.7704457441925701
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7704457441925701
+ Cosine
+
+
+ 7835
+ 2497
+ 16.032300000000077
+ 7835
+ 0.7161804600098588
+ 7835.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7161804600098588
+ Cosine
+
+
+ 2497
+ 2214
+ -98.03690000000006
+ 2497
+ 0.7788081273143392
+ 2497.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7788081273143392
+ Cosine
+
+
+ 13890
+ 2497
+ 14.017000000000053
+ 13890
+ 0.7108054804293422
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7108054804293422
+ Cosine
+
+
+ 13592
+ 2497
+ 100.05320000000006
+ 13592
+ 0.7819052246509179
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7819052246509179
+ Cosine
+
+
+ 4789
+ 2497
+ -15.993600000000015
+ 4789
+ 0.7067973705044224
+ 4789.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7067973705044224
+ Cosine
+
+
+ 2497
+ 1222
+ -98.03750000000002
+ 2497
+ 0.760117464427726
+ 2497.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.760117464427726
+ Cosine
+
+
+ 2525
+ 2497
+ 0.001100000000064938
+ 2525
+ 0.7158659841207365
+ 2525.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7158659841207365
+ Cosine
+
+
+ 13698
+ 2497
+ 2.0160000000000764
+ 13698
+ 0.7598164868006287
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7598164868006287
+ Cosine
+
+
+ 3546
+ 1176
+ 124.01599999999996
+ 3546
+ 0.8044876531551107
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8044876531551107
+ Cosine
+
+
+ 7732
+ 1176
+ 20.048999999999978
+ 7732
+ 0.7444370840000086
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7444370840000086
+ Cosine
+
+
+ 1339
+ 1176
+ 15.99529999999993
+ 1339
+ 0.7567351827295026
+ 1339.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7567351827295026
+ Cosine
+
+
+ 4537
+ 1176
+ 58.00539999999995
+ 4537
+ 0.8474304743698234
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8474304743698234
+ Cosine
+
+
+ 4581
+ 1176
+ 110.00109999999995
+ 4581
+ 0.8000654004907126
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8000654004907126
+ Cosine
+
+
+ 1376
+ 1176
+ 138.03209999999996
+ 1376
+ 0.7771139269294767
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7771139269294767
+ Cosine
+
+
+ 4500
+ 1176
+ 110.00039999999996
+ 4500
+ 0.8304947515484594
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8304947515484594
+ Cosine
+
+
+ 2541
+ 1176
+ 72.02099999999996
+ 2541
+ 0.7191671863807276
+ 2541.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7191671863807276
+ Cosine
+
+
+ 1176
+ 1164
+ -110.00019999999995
+ 1176
+ 0.7985222060492583
+ 1176.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7985222060492583
+ Cosine
+
+
+ 1967
+ 1176
+ 58.00589999999994
+ 1967
+ 0.8379170701289205
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8379170701289205
+ Cosine
+
+
+ 4505
+ 1176
+ 0.0
+ 4505
+ 0.8995182630677155
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8995182630677155
+ Cosine
+
+
+ 3901
+ 1176
+ 15.994199999999978
+ 3901
+ 0.8413782414451614
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8413782414451614
+ Cosine
+
+
+ 1361
+ 1176
+ 35.875399999999956
+ 1361
+ 0.7860326766884633
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7860326766884633
+ Cosine
+
+
+ 4587
+ 1176
+ -32.02660000000003
+ 4587
+ 0.7822251394887034
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7822251394887034
+ Cosine
+
+
+ 15800
+ 1176
+ 108.02129999999994
+ 15800
+ 0.7550060523724507
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7550060523724507
+ Cosine
+
+
+ 4452
+ 1176
+ 94.00589999999994
+ 4452
+ 0.739776770529118
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.739776770529118
+ Cosine
+
+
+ 7795
+ 1176
+ 21.86029999999994
+ 7795
+ 0.7395961405664504
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7395961405664504
+ Cosine
+
+
+ 2544
+ 1176
+ 11.963699999999903
+ 2544
+ 0.7272134469520044
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7272134469520044
+ Cosine
+
+
+ 4549
+ 1176
+ 9.985099999999989
+ 4549
+ 0.7817631336621229
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7817631336621229
+ Cosine
+
+
+ 1176
+ 1173
+ -42.010599999999954
+ 1176
+ 0.847460253072218
+ 1176.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.847460253072218
+ Cosine
+
+
+ 3766
+ 1176
+ 108.02149999999995
+ 3766
+ 0.7832285653186108
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7832285653186108
+ Cosine
+
+
+ 26406
+ 1176
+ 40.030599999999936
+ 26406
+ 0.7484772000558009
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7484772000558009
+ Cosine
+
+
+ 1391
+ 1176
+ 140.04769999999996
+ 1391
+ 0.7966281553448001
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7966281553448001
+ Cosine
+
+
+ 1240
+ 1176
+ 9.984899999999925
+ 1240
+ 0.7174790333632869
+ 1240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7174790333632869
+ Cosine
+
+
+ 13633
+ 1176
+ 74.03669999999994
+ 13633
+ 0.8126637741947831
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8126637741947831
+ Cosine
+
+
+ 13826
+ 1176
+ -204.07950000000005
+ 13826
+ 0.7256156562560675
+ 13826.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7256156562560675
+ Cosine
+
+
+ 4680
+ 1176
+ -20.025900000000092
+ 4680
+ 0.7858405997570472
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7858405997570472
+ Cosine
+
+
+ 7663
+ 1176
+ 124.05229999999995
+ 7663
+ 0.7411005868072673
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7411005868072673
+ Cosine
+
+
+ 1449
+ 1176
+ -126.17770000000007
+ 1449
+ 0.7464847632892815
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7464847632892815
+ Cosine
+
+
+ 4694
+ 1176
+ 9.999999997489795e-05
+ 4694
+ 0.8020818762764994
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8020818762764994
+ Cosine
+
+
+ 7665
+ 1176
+ 38.05949999999996
+ 7665
+ 0.775512866003261
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.775512866003261
+ Cosine
+
+
+ 1223
+ 1176
+ 74.00049999999999
+ 1223
+ 0.7560051816277469
+ 1223.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7560051816277469
+ Cosine
+
+
+ 1335
+ 1176
+ 21.86029999999994
+ 1335
+ 0.7538903887165387
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7538903887165387
+ Cosine
+
+
+ 1555
+ 1176
+ 58.00529999999998
+ 1555
+ 0.8003816795112269
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8003816795112269
+ Cosine
+
+
+ 2486
+ 1176
+ 25.979899999999986
+ 2486
+ 0.7638680492540586
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7638680492540586
+ Cosine
+
+
+ 2651
+ 1176
+ 156.04209999999995
+ 2651
+ 0.8344471671822231
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8344471671822231
+ Cosine
+
+
+ 3747
+ 1176
+ 124.01659999999998
+ 3747
+ 0.7332609330277406
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7332609330277406
+ Cosine
+
+
+ 4524
+ 1176
+ 124.01649999999995
+ 4524
+ 0.8179818912802685
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8179818912802685
+ Cosine
+
+
+ 4561
+ 1176
+ 15.994199999999978
+ 4561
+ 0.8444571612087117
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8444571612087117
+ Cosine
+
+
+ 4661
+ 1176
+ 23.99969999999996
+ 4661
+ 0.8013944435228462
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8013944435228462
+ Cosine
+
+
+ 5385
+ 1176
+ 58.00559999999996
+ 5385
+ 0.7885443070355609
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7885443070355609
+ Cosine
+
+
+ 5505
+ 1176
+ -4.030700000000024
+ 5505
+ 0.7333762784567808
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7333762784567808
+ Cosine
+
+
+ 7664
+ 1176
+ 158.05759999999998
+ 7664
+ 0.7502616305824035
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7502616305824035
+ Cosine
+
+
+ 8321
+ 1176
+ 58.00539999999995
+ 8321
+ 0.8587536704223167
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8587536704223167
+ Cosine
+
+
+ 13590
+ 1176
+ 74.03599999999994
+ 13590
+ 0.8309887285300477
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8309887285300477
+ Cosine
+
+
+ 13737
+ 1176
+ 83.04089999999997
+ 13737
+ 0.7558985067291744
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7558985067291744
+ Cosine
+
+
+ 20868
+ 1176
+ 106.08489999999995
+ 20868
+ 0.7301333508338642
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7301333508338642
+ Cosine
+
+
+ 4732
+ 2479
+ 0.0002000000000066393
+ 4732
+ 0.8067345080184596
+ 4732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8067345080184596
+ Cosine
+
+
+ 5217
+ 2479
+ 0.0002000000000066393
+ 5217
+ 0.7648545462302034
+ 5217.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7648545462302034
+ Cosine
+
+
+ 2479
+ 1808
+ 0.0
+ 2479
+ 0.7553209482850833
+ 2479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553209482850833
+ Cosine
+
+
+ 4589
+ 2479
+ 0.00010000000000331966
+ 4589
+ 0.8074842248975349
+ 4589.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8074842248975349
+ Cosine
+
+
+ 7667
+ 2479
+ 2.0153999999999996
+ 7667
+ 0.704494208975565
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.704494208975565
+ Cosine
+
+
+ 7632
+ 7628
+ -51.9708
+ 7632
+ 0.7386943007863611
+ 7632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7386943007863611
+ Cosine
+
+
+ 1203
+ 1
+ -74.01890000000003
+ 1203
+ 0.9642751441502224
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9642751441502224
+ Cosine
+
+
+ 1203
+ 6
+ -69.05930000000001
+ 1203
+ 0.8083294471916564
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8083294471916564
+ Cosine
+
+
+ 1203
+ 9
+ -194.02510000000007
+ 1203
+ 0.8750385558484055
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8750385558484055
+ Cosine
+
+
+ 1203
+ 39
+ -148.0381
+ 1203
+ 0.9005206716379817
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9005206716379817
+ Cosine
+
+
+ 1203
+ 54
+ -220.0602
+ 1203
+ 0.8174700451821512
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8174700451821512
+ Cosine
+
+
+ 1203
+ 58
+ -222.05640000000005
+ 1203
+ 0.8613979483011278
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8613979483011278
+ Cosine
+
+
+ 1203
+ 144
+ -296.0752
+ 1203
+ 0.7824093927514792
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7824093927514792
+ Cosine
+
+
+ 1203
+ 259
+ -148.038
+ 1203
+ 0.9303156766492804
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9303156766492804
+ Cosine
+
+
+ 1203
+ 1156
+ -238.0865
+ 1203
+ 0.8334072070031415
+ 1203.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8334072070031415
+ Cosine
+
+
+ 1479
+ 1203
+ 196.7758
+ 1479
+ 0.8454167968235824
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8454167968235824
+ Cosine
+
+
+ 2571
+ 1203
+ 282.05950000000007
+ 2571
+ 0.7208213942070807
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7208213942070807
+ Cosine
+
+
+ 3521
+ 1203
+ 134.02179999999998
+ 3521
+ 0.8758029209484876
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8758029209484876
+ Cosine
+
+
+ 3522
+ 1203
+ 164.06780000000003
+ 3522
+ 0.8962861204492923
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8962861204492923
+ Cosine
+
+
+ 4517
+ 1203
+ 314.0857000000001
+ 4517
+ 0.7192267163672981
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7192267163672981
+ Cosine
+
+
+ 4552
+ 1203
+ 194.02560000000005
+ 4552
+ 0.8748516885126687
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8748516885126687
+ Cosine
+
+
+ 5160
+ 1203
+ 148.03780000000006
+ 5160
+ 0.9474182676741132
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9474182676741132
+ Cosine
+
+
+ 10473
+ 1203
+ -0.0005999999999630745
+ 10473
+ 0.9999999999999994
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999994
+ Cosine
+
+
+ 28000
+ 1203
+ 148.03750000000002
+ 28000
+ 0.9360036525586622
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9360036525586622
+ Cosine
+
+
+ 5233
+ 5175
+ -9.99999999891088e-05
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11101
+ 5233
+ -0.0004000000000132786
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11306
+ 5233
+ -0.00030000000000995897
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11368
+ 5233
+ -0.0002000000000066393
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5233
+ 208
+ 57.01340000000002
+ 5233
+ 0.7720262431782003
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 11531
+ 5233
+ -0.0002000000000066393
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11194
+ 5233
+ -0.0004000000000132786
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11652
+ 5233
+ 9.99999999891088e-05
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5233
+ 5194
+ 0.00010000000000331966
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5233
+ 25
+ 50.0112
+ 5233
+ 0.7765014360319091
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 5233
+ 5078
+ 0.0002000000000066393
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11346
+ 5233
+ -0.0004000000000132786
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11270
+ 5233
+ -0.00030000000000995897
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 5233
+ 4637
+ 14.016000000000005
+ 5233
+ 0.7465660405620628
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 5233
+ 5148
+ 0.0002000000000066393
+ 5233
+ 1.0000000000000002
+ 5233.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11321
+ 5233
+ -0.00030000000000995897
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 13777
+ 1521
+ -30.013599999999997
+ 13777
+ 0.7075152022423374
+ 13777.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7075152022423374
+ Cosine
+
+
+ 4504
+ 1521
+ 179.0781
+ 4504
+ 0.8613054571646633
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8613054571646633
+ Cosine
+
+
+ 1521
+ 1162
+ -14.014599999999973
+ 1521
+ 0.79809564832877
+ 1521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.79809564832877
+ Cosine
+
+
+ 2483
+ 1521
+ 162.0519
+ 2483
+ 0.8808578303300459
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8808578303300459
+ Cosine
+
+
+ 1521
+ 1165
+ -193.09390000000002
+ 1521
+ 0.7278662695152889
+ 1521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7278662695152889
+ Cosine
+
+
+ 2478
+ 1521
+ 179.07909999999998
+ 2478
+ 0.8582609406748869
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8582609406748869
+ Cosine
+
+
+ 4498
+ 1521
+ -0.002200000000016189
+ 4498
+ 0.9569705693127243
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9569705693127243
+ Cosine
+
+
+ 4508
+ 1521
+ 162.05169999999998
+ 4508
+ 0.8688212945633231
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8688212945633231
+ Cosine
+
+
+ 4880
+ 270
+ -16.03090000000003
+ 4880
+ 0.7240697964050307
+ 4880.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7240697964050307
+ Cosine
+
+
+ 10243
+ 3524
+ -0.0003999999999564352
+ 10243
+ 0.9532720221749758
+ 10243.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9532720221749758
+ Cosine
+
+
+ 4565
+ 4334
+ -0.00030000000000995897
+ 4565
+ 0.8771198899569488
+ 4565.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8771198899569488
+ Cosine
+
+
+ 3601
+ 2273
+ 9.999999997489795e-05
+ 3601
+ 0.7328172155565831
+ 3601.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7328172155565831
+ Cosine
+
+
+ 4536
+ 3601
+ -0.0009999999999763531
+ 4536
+ 0.7271179098619855
+ 4536.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7271179098619855
+ Cosine
+
+
+ 1292
+ 208
+ -2.107099999999974
+ 1292
+ 0.7032759991199617
+ 1292.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7032759991199617
+ Cosine
+
+
+ 7859
+ 2509
+ -132.04249999999996
+ 7859
+ 0.7132526009100867
+ 7859.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7132526009100867
+ Cosine
+
+
+ 7859
+ 3575
+ -0.0007999999999128704
+ 7859
+ 0.8517916300770556
+ 7859.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8517916300770556
+ Cosine
+
+
+ 15865
+ 7859
+ 0.00029999999992469384
+ 15865
+ 0.866538765324294
+ 15865.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.866538765324294
+ Cosine
+
+
+ 10473
+ 2571
+ -282.06010000000003
+ 10473
+ 0.7208213942070807
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7208213942070807
+ Cosine
+
+
+ 28000
+ 2571
+ -134.02200000000005
+ 28000
+ 0.7547707044582108
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7547707044582108
+ Cosine
+
+
+ 2571
+ 1
+ 208.04060000000004
+ 2571
+ 0.7371618767548243
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7371618767548243
+ Cosine
+
+
+ 2571
+ 9
+ 88.0344
+ 2571
+ 0.7540562167498943
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7540562167498943
+ Cosine
+
+
+ 2571
+ 39
+ 134.02140000000009
+ 2571
+ 0.7318855820294969
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7318855820294969
+ Cosine
+
+
+ 2571
+ 54
+ 61.99930000000006
+ 2571
+ 0.7416790055364615
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7416790055364615
+ Cosine
+
+
+ 2571
+ 58
+ 60.00310000000002
+ 2571
+ 0.7239657642585398
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7239657642585398
+ Cosine
+
+
+ 2571
+ 144
+ -14.015699999999924
+ 2571
+ 0.7299623496731551
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7299623496731551
+ Cosine
+
+
+ 2571
+ 259
+ 134.02150000000006
+ 2571
+ 0.7502737723068095
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7502737723068095
+ Cosine
+
+
+ 2571
+ 1479
+ 85.28370000000007
+ 2571
+ 0.7491507406602997
+ 2571.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7491507406602997
+ Cosine
+
+
+ 3521
+ 2571
+ -148.0377000000001
+ 3521
+ 0.8165389890979667
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8165389890979667
+ Cosine
+
+
+ 3522
+ 2571
+ -117.99170000000004
+ 3522
+ 0.7676146998110744
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7676146998110744
+ Cosine
+
+
+ 4552
+ 2571
+ -88.03390000000002
+ 4552
+ 0.7744121684673706
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7744121684673706
+ Cosine
+
+
+ 5160
+ 2571
+ -134.0217
+ 5160
+ 0.7493176962697334
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7493176962697334
+ Cosine
+
+
+ 5332
+ 2571
+ 197.08999999999997
+ 5332
+ 0.7258496458165189
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7258496458165189
+ Cosine
+
+
+ 2744
+ 1653
+ -72.05759999999998
+ 2744
+ 0.7150388708536548
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7150388708536548
+ Cosine
+
+
+ 4785
+ 2744
+ -176.1046
+ 4785
+ 0.7218116059010269
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218116059010269
+ Cosine
+
+
+ 2783
+ 2744
+ -88.05180000000007
+ 2783
+ 0.7512775810688698
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7512775810688698
+ Cosine
+
+
+ 2744
+ 1487
+ -28.0317
+ 2744
+ 0.7408177973172402
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408177973172402
+ Cosine
+
+
+ 2744
+ 2566
+ 60.02060000000006
+ 2744
+ 0.7154742872555986
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7154742872555986
+ Cosine
+
+
+ 4679
+ 2744
+ -146.09300000000007
+ 4679
+ 0.7009833121227512
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7009833121227512
+ Cosine
+
+
+ 2761
+ 2744
+ -44.02610000000004
+ 2761
+ 0.7210223019702795
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7210223019702795
+ Cosine
+
+
+ 2744
+ 1482
+ 15.99509999999998
+ 2744
+ 0.7323444487361321
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7323444487361321
+ Cosine
+
+
+ 2744
+ 2726
+ 102.06640000000004
+ 2744
+ 0.741247004643866
+ 2744.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741247004643866
+ Cosine
+
+
+ 9004
+ 2526
+ -30.01049999999998
+ 9004
+ 0.8194890271557977
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8194890271557977
+ Cosine
+
+
+ 9004
+ 2649
+ -14.014999999999986
+ 9004
+ 0.7254086656447492
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7254086656447492
+ Cosine
+
+
+ 9004
+ 2628
+ -15.995599999999968
+ 9004
+ 0.7249770014386758
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7249770014386758
+ Cosine
+
+
+ 9004
+ 2573
+ -30.010299999999916
+ 9004
+ 0.7770538357929329
+ 9004.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7770538357929329
+ Cosine
+
+
+ 3721
+ 3700
+ 0.0
+ 3721
+ 1.0
+ 3721.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 9385
+ 3721
+ -32.026700000000005
+ 9385
+ 0.741200267986588
+ 9385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741200267986588
+ Cosine
+
+
+ 10473
+ 54
+ -220.06079999999997
+ 10473
+ 0.8174700451821512
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8174700451821512
+ Cosine
+
+
+ 28000
+ 54
+ -72.02269999999999
+ 28000
+ 0.8713679239404047
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713679239404047
+ Cosine
+
+
+ 4573
+ 54
+ 259.08970000000005
+ 4573
+ 0.7176325702530064
+ 4573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7176325702530064
+ Cosine
+
+
+ 4605
+ 54
+ 259.08970000000005
+ 4605
+ 0.7107504112769489
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7107504112769489
+ Cosine
+
+
+ 54
+ 1
+ 146.04129999999998
+ 54
+ 0.8600493838242864
+ 54.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8600493838242864
+ Cosine
+
+
+ 54
+ 9
+ 26.035099999999943
+ 54
+ 0.8255190064801081
+ 54.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8255190064801081
+ Cosine
+
+
+ 259
+ 54
+ -72.0222
+ 259
+ 0.8720518924709727
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8720518924709727
+ Cosine
+
+
+ 3521
+ 54
+ -86.03840000000002
+ 3521
+ 0.8132745102218348
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8132745102218348
+ Cosine
+
+
+ 4552
+ 54
+ -26.034599999999955
+ 4552
+ 0.8399131376257327
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8399131376257327
+ Cosine
+
+
+ 3522
+ 54
+ -55.992399999999975
+ 3522
+ 0.8837696154446519
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8837696154446519
+ Cosine
+
+
+ 54
+ 32
+ -1.9961000000000695
+ 54
+ 0.7335715439955501
+ 54.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7335715439955501
+ Cosine
+
+
+ 54
+ 39
+ 72.02210000000002
+ 54
+ 0.8568703158602033
+ 54.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8568703158602033
+ Cosine
+
+
+ 58
+ 54
+ 1.9962000000000444
+ 58
+ 0.8902519124015384
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8902519124015384
+ Cosine
+
+
+ 144
+ 54
+ 76.01499999999999
+ 144
+ 0.8683935933895748
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8683935933895748
+ Cosine
+
+
+ 1156
+ 54
+ 18.026299999999992
+ 1156
+ 0.8872350593035759
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8872350593035759
+ Cosine
+
+
+ 1479
+ 54
+ -23.284400000000005
+ 1479
+ 0.8400716405546794
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8400716405546794
+ Cosine
+
+
+ 5160
+ 54
+ -72.02239999999995
+ 5160
+ 0.8737875553979852
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8737875553979852
+ Cosine
+
+
+ 5332
+ 54
+ 259.08930000000004
+ 5332
+ 0.7377905260981082
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7377905260981082
+ Cosine
+
+
+ 5984
+ 5846
+ 1.9842000000000013
+ 5984
+ 0.7218154561616537
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 5984
+ 5874
+ -0.00010000000000331966
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5984
+ 5889
+ 0.0
+ 5984
+ 0.8713460865906011
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 5984
+ 5914
+ -0.00010000000000331966
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5984
+ 5915
+ 0.0
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5984
+ 5923
+ -0.00010000000000331966
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5984
+ 5935
+ 0.0
+ 5984
+ 0.9999999999999993
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5984
+ 5975
+ 0.0
+ 5984
+ 0.8840320085106907
+ 5984.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 5997
+ 5984
+ 0.0
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6019
+ 5984
+ 0.00010000000000331966
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6038
+ 5984
+ 0.0
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6053
+ 5984
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 14070
+ 3725
+ -88.05110000000002
+ 14070
+ 0.7314355824337173
+ 14070.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7314355824337173
+ Cosine
+
+
+ 3528
+ 2703
+ 0.0004000000000132786
+ 3528
+ 0.7139551108853466
+ 3528.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7139551108853466
+ Cosine
+
+
+ 11531
+ 5175
+ -0.0002999999999957481
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11531
+ 11101
+ 0.0002000000000066393
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11531
+ 11306
+ 0.00010000000000331966
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11531
+ 11368
+ 0.0
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11531
+ 208
+ 57.01320000000001
+ 11531
+ 0.7720262431782003
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 11531
+ 25
+ 50.010999999999996
+ 11531
+ 0.7765014360319091
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 11531
+ 4637
+ 14.015799999999999
+ 11531
+ 0.7465660405620628
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 11531
+ 5078
+ 0.0
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11531
+ 5148
+ 0.0
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11531
+ 5194
+ -0.00010000000000331966
+ 11531
+ 1.0000000000000002
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11531
+ 11194
+ 0.0002000000000066393
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11531
+ 11270
+ 0.00010000000000331966
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11531
+ 11321
+ 0.00010000000000331966
+ 11531
+ 0.9750631616472476
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 11531
+ 11346
+ 0.0002000000000066393
+ 11531
+ 0.9087915697477342
+ 11531.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11652
+ 11531
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 20565
+ 4840
+ 0.0010000000000331966
+ 20565
+ 1.0000000000000004
+ 20565.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000004
+ Cosine
+
+
+ 10258
+ 4766
+ -114.03160000000003
+ 10258
+ 0.7375804166558343
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7375804166558343
+ Cosine
+
+
+ 4775
+ 4766
+ 0.016000000000019554
+ 4775
+ 0.7131392959241057
+ 4775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131392959241057
+ Cosine
+
+
+ 4766
+ 4584
+ -0.0004999999999881766
+ 4766
+ 0.7885006937241503
+ 4766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7885006937241503
+ Cosine
+
+
+ 10240
+ 4766
+ -98.03690000000006
+ 10240
+ 0.8182410879440081
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8182410879440081
+ Cosine
+
+
+ 10404
+ 4766
+ -18.009400000000028
+ 10404
+ 0.762398435480709
+ 10404.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.762398435480709
+ Cosine
+
+
+ 10473
+ 1479
+ -196.77639999999997
+ 10473
+ 0.8454167968235824
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8454167968235824
+ Cosine
+
+
+ 28000
+ 1479
+ -48.73829999999998
+ 28000
+ 0.894383117588947
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.894383117588947
+ Cosine
+
+
+ 1479
+ 1
+ 122.75689999999997
+ 1479
+ 0.883918230203027
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.883918230203027
+ Cosine
+
+
+ 1479
+ 9
+ 2.750699999999938
+ 1479
+ 0.8730086166578087
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8730086166578087
+ Cosine
+
+
+ 4517
+ 1479
+ 117.30990000000008
+ 4517
+ 0.7632326422726833
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7632326422726833
+ Cosine
+
+
+ 1479
+ 259
+ 48.73779999999999
+ 1479
+ 0.8892067896656892
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8892067896656892
+ Cosine
+
+
+ 3521
+ 1479
+ -62.75400000000002
+ 3521
+ 0.8409396755570241
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8409396755570241
+ Cosine
+
+
+ 4552
+ 1479
+ -2.75019999999995
+ 4552
+ 0.887645861600632
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.887645861600632
+ Cosine
+
+
+ 3522
+ 1479
+ -32.70799999999997
+ 3522
+ 0.8523829166647449
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8523829166647449
+ Cosine
+
+
+ 5160
+ 1479
+ -48.73799999999994
+ 5160
+ 0.8869999185549157
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8869999185549157
+ Cosine
+
+
+ 1479
+ 32
+ -25.280500000000075
+ 1479
+ 0.7018764455936631
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7018764455936631
+ Cosine
+
+
+ 1479
+ 1156
+ -41.3107
+ 1479
+ 0.7923950103404355
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7923950103404355
+ Cosine
+
+
+ 1479
+ 39
+ 48.73770000000002
+ 1479
+ 0.8775357929156127
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8775357929156127
+ Cosine
+
+
+ 1479
+ 58
+ -25.28060000000005
+ 1479
+ 0.8510026739707366
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8510026739707366
+ Cosine
+
+
+ 1479
+ 144
+ -99.29939999999999
+ 1479
+ 0.8173652956889834
+ 1479.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8173652956889834
+ Cosine
+
+
+ 5332
+ 1479
+ 282.37370000000004
+ 5332
+ 0.7027296305220124
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7027296305220124
+ Cosine
+
+
+ 10473
+ 4552
+ -194.02620000000002
+ 10473
+ 0.8748516885126687
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8748516885126687
+ Cosine
+
+
+ 28000
+ 4552
+ -45.98810000000003
+ 28000
+ 0.9259825825008555
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9259825825008555
+ Cosine
+
+
+ 4605
+ 4552
+ 285.1243
+ 4605
+ 0.7013994719346371
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013994719346371
+ Cosine
+
+
+ 4552
+ 1
+ 120.00670000000002
+ 4552
+ 0.9219763654232143
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9219763654232143
+ Cosine
+
+
+ 4552
+ 9
+ 0.0004999999999881766
+ 4552
+ 0.9240642648860251
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9240642648860251
+ Cosine
+
+
+ 4552
+ 4517
+ -120.06010000000003
+ 4552
+ 0.7700678348161261
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7700678348161261
+ Cosine
+
+
+ 4552
+ 259
+ 45.98760000000004
+ 4552
+ 0.9281858308123327
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9281858308123327
+ Cosine
+
+
+ 4552
+ 3521
+ 60.00380000000007
+ 4552
+ 0.8835358923622343
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8835358923622343
+ Cosine
+
+
+ 4552
+ 6
+ 124.96630000000005
+ 4552
+ 0.7826734537901732
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7826734537901732
+ Cosine
+
+
+ 4552
+ 32
+ -28.030700000000024
+ 4552
+ 0.7510486539948836
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7510486539948836
+ Cosine
+
+
+ 4552
+ 39
+ 45.98750000000007
+ 4552
+ 0.9187737807676389
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9187737807676389
+ Cosine
+
+
+ 4552
+ 58
+ -28.0308
+ 4552
+ 0.8957365529041382
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8957365529041382
+ Cosine
+
+
+ 4552
+ 144
+ -102.04959999999994
+ 4552
+ 0.8541223296011362
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8541223296011362
+ Cosine
+
+
+ 4552
+ 1156
+ -44.06089999999995
+ 4552
+ 0.8313528976678792
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8313528976678792
+ Cosine
+
+
+ 4552
+ 3522
+ 29.95780000000002
+ 4552
+ 0.909395745447392
+ 4552.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.909395745447392
+ Cosine
+
+
+ 5160
+ 4552
+ -45.98779999999999
+ 5160
+ 0.9356827400842365
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9356827400842365
+ Cosine
+
+
+ 5332
+ 4552
+ 285.1239
+ 5332
+ 0.7240060190205946
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7240060190205946
+ Cosine
+
+
+ 66
+ 17
+ -0.00029999999998153726
+ 66
+ 0.7334579289692975
+ 66.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7334579289692975
+ Cosine
+
+
+ 3678
+ 3666
+ -0.0003000000000383807
+ 3678
+ 0.9999999999999993
+ 3678.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 7661
+ 1296
+ 100.01409999999998
+ 7661
+ 0.7017712844232444
+ 7661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7017712844232444
+ Cosine
+
+
+ 4674
+ 1157
+ -0.0001999999999497959
+ 4674
+ 0.9502862836605377
+ 4674.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9502862836605377
+ Cosine
+
+
+ 5414
+ 4650
+ -9.999999997489795e-05
+ 5414
+ 1.0
+ 5414.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 8032
+ 7760
+ 84.02159999999998
+ 8032
+ 0.8085707126699289
+ 8032.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8085707126699289
+ Cosine
+
+
+ 8032
+ 3551
+ -49.95610000000005
+ 8032
+ 0.8157050843609397
+ 8032.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8157050843609397
+ Cosine
+
+
+ 8032
+ 4575
+ -49.95640000000003
+ 8032
+ 0.8591317267743624
+ 8032.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8591317267743624
+ Cosine
+
+
+ 8032
+ 7922
+ 32.044899999999984
+ 8032
+ 0.8339546907104021
+ 8032.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8339546907104021
+ Cosine
+
+
+ 2494
+ 1447
+ -203.09429999999998
+ 2494
+ 0.7092056383648428
+ 2494.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7092056383648428
+ Cosine
+
+
+ 4545
+ 2494
+ -9.999999997489795e-05
+ 4545
+ 0.9676092085480853
+ 4545.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9676092085480853
+ Cosine
+
+
+ 7692
+ 3525
+ -0.0004000000000132786
+ 7692
+ 0.7876852642121439
+ 7692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7876852642121439
+ Cosine
+
+
+ 3546
+ 1974
+ 50.01479999999998
+ 3546
+ 0.7274443514727357
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7274443514727357
+ Cosine
+
+
+ 4537
+ 1974
+ -15.995800000000031
+ 4537
+ 0.7527947147544318
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7527947147544318
+ Cosine
+
+
+ 1974
+ 1223
+ 0.0006999999999948159
+ 1974
+ 0.7592455208993265
+ 1974.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7592455208993265
+ Cosine
+
+
+ 1974
+ 1967
+ 15.995300000000043
+ 1974
+ 0.7277851264425972
+ 1974.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7277851264425972
+ Cosine
+
+
+ 4561
+ 1974
+ -58.007000000000005
+ 4561
+ 0.7302927978407447
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7302927978407447
+ Cosine
+
+
+ 4694
+ 1974
+ -74.00110000000001
+ 4694
+ 0.7348902837294414
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7348902837294414
+ Cosine
+
+
+ 8321
+ 1974
+ -15.995800000000031
+ 8321
+ 0.7547173181397864
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7547173181397864
+ Cosine
+
+
+ 2956
+ 1580
+ 172.10899999999998
+ 2956
+ 0.7225258071301324
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7225258071301324
+ Cosine
+
+
+ 2956
+ 2666
+ -0.001599999999996271
+ 2956
+ 0.7475354419199686
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7475354419199686
+ Cosine
+
+
+ 4539
+ 2956
+ 46.0068
+ 4539
+ 0.7187834315658752
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7187834315658752
+ Cosine
+
+
+ 2956
+ 2644
+ 253.02860000000004
+ 2956
+ 0.7731512753829964
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7731512753829964
+ Cosine
+
+
+ 2956
+ 284
+ -31.990800000000036
+ 2956
+ 0.7139539659215133
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7139539659215133
+ Cosine
+
+
+ 3667
+ 2956
+ -90.97679999999997
+ 3667
+ 0.8020821809738519
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8020821809738519
+ Cosine
+
+
+ 2956
+ 11
+ -43.990800000000036
+ 2956
+ 0.7162702576955093
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7162702576955093
+ Cosine
+
+
+ 2956
+ 311
+ -15.997299999999996
+ 2956
+ 0.7873579042970584
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7873579042970584
+ Cosine
+
+
+ 2956
+ 1547
+ -86.0897
+ 2956
+ 0.7070815204908488
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7070815204908488
+ Cosine
+
+
+ 2956
+ 2575
+ -31.99000000000001
+ 2956
+ 0.742931592465763
+ 2956.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.742931592465763
+ Cosine
+
+
+ 3122
+ 2956
+ 0.0009000000000014552
+ 3122
+ 0.8061278686144449
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8061278686144449
+ Cosine
+
+
+ 3771
+ 2956
+ 0.0
+ 3771
+ 0.8948147837867757
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8948147837867757
+ Cosine
+
+
+ 7731
+ 2956
+ 88.1055
+ 7731
+ 0.7056543299168478
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7056543299168478
+ Cosine
+
+
+ 10446
+ 2956
+ 18.011400000000037
+ 10446
+ 0.7601737289579666
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7601737289579666
+ Cosine
+
+
+ 4680
+ 3546
+ -144.04190000000006
+ 4680
+ 0.7800016057558642
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7800016057558642
+ Cosine
+
+
+ 4680
+ 2692
+ -41.01210000000003
+ 4680
+ 0.7138484718047005
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7138484718047005
+ Cosine
+
+
+ 7732
+ 4680
+ 40.07490000000007
+ 7732
+ 0.7158089049934495
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7158089049934495
+ Cosine
+
+
+ 4680
+ 4537
+ -78.03130000000004
+ 4680
+ 0.770210669515678
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.770210669515678
+ Cosine
+
+
+ 4680
+ 1322
+ -144.04230000000007
+ 4680
+ 0.775404853196002
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.775404853196002
+ Cosine
+
+
+ 4680
+ 4581
+ -130.02700000000004
+ 4680
+ 0.7568285840208935
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7568285840208935
+ Cosine
+
+
+ 4680
+ 4603
+ -126.03200000000004
+ 4680
+ 0.7402541629406818
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7402541629406818
+ Cosine
+
+
+ 4680
+ 1376
+ -158.05800000000005
+ 4680
+ 0.7091981593174528
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7091981593174528
+ Cosine
+
+
+ 4680
+ 4500
+ -130.02630000000005
+ 4680
+ 0.817512513516292
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.817512513516292
+ Cosine
+
+
+ 7811
+ 4680
+ 110.05850000000004
+ 7811
+ 0.7053544307641921
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7053544307641921
+ Cosine
+
+
+ 4680
+ 1164
+ -130.02610000000004
+ 4680
+ 0.8044084869940756
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8044084869940756
+ Cosine
+
+
+ 4680
+ 1967
+ -78.03180000000003
+ 4680
+ 0.7672848263809584
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7672848263809584
+ Cosine
+
+
+ 4680
+ 4505
+ -20.025900000000092
+ 4680
+ 0.8017851597715531
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8017851597715531
+ Cosine
+
+
+ 4680
+ 3901
+ -36.02010000000007
+ 4680
+ 0.7553858664626851
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553858664626851
+ Cosine
+
+
+ 4680
+ 1307
+ -130.02690000000007
+ 4680
+ 0.7229940261971953
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7229940261971953
+ Cosine
+
+
+ 8341
+ 4680
+ 80.04730000000006
+ 8341
+ 0.7216366301111956
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7216366301111956
+ Cosine
+
+
+ 4680
+ 1361
+ -55.90130000000005
+ 4680
+ 0.7620720044510663
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7620720044510663
+ Cosine
+
+
+ 4680
+ 4587
+ 12.000699999999938
+ 4680
+ 0.7872820857711293
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872820857711293
+ Cosine
+
+
+ 15800
+ 4680
+ 128.04720000000003
+ 15800
+ 0.7548066428301936
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7548066428301936
+ Cosine
+
+
+ 7795
+ 4680
+ 41.88620000000003
+ 7795
+ 0.7687114935340048
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7687114935340048
+ Cosine
+
+
+ 4680
+ 2544
+ -31.989599999999996
+ 4680
+ 0.7816575074035013
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7816575074035013
+ Cosine
+
+
+ 4680
+ 4549
+ -30.01100000000008
+ 4680
+ 0.7572857629544469
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7572857629544469
+ Cosine
+
+
+ 4680
+ 1173
+ -62.036500000000046
+ 4680
+ 0.7441128689219894
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7441128689219894
+ Cosine
+
+
+ 4680
+ 3766
+ -128.04740000000004
+ 4680
+ 0.7672855768223454
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7672855768223454
+ Cosine
+
+
+ 26406
+ 4680
+ 60.05650000000003
+ 26406
+ 0.8003448023100057
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8003448023100057
+ Cosine
+
+
+ 4680
+ 1391
+ -160.07360000000006
+ 4680
+ 0.7723934465060225
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7723934465060225
+ Cosine
+
+
+ 13633
+ 4680
+ 94.06260000000003
+ 13633
+ 0.7823364938917945
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7823364938917945
+ Cosine
+
+
+ 4680
+ 1335
+ -41.88620000000003
+ 4680
+ 0.750078707927228
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.750078707927228
+ Cosine
+
+
+ 4680
+ 1449
+ 106.15179999999998
+ 4680
+ 0.7419474268401081
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7419474268401081
+ Cosine
+
+
+ 4680
+ 2486
+ -46.00580000000008
+ 4680
+ 0.7251648086881755
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7251648086881755
+ Cosine
+
+
+ 4680
+ 2651
+ -176.06800000000004
+ 4680
+ 0.7641313596375523
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7641313596375523
+ Cosine
+
+
+ 4680
+ 4524
+ -144.04240000000004
+ 4680
+ 0.8403819892597301
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8403819892597301
+ Cosine
+
+
+ 4680
+ 4561
+ -36.02010000000007
+ 4680
+ 0.7749847999209447
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7749847999209447
+ Cosine
+
+
+ 4680
+ 4661
+ -44.025600000000054
+ 4680
+ 0.7464250376310991
+ 4680.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7464250376310991
+ Cosine
+
+
+ 4694
+ 4680
+ 20.026000000000067
+ 4694
+ 0.7187932819429804
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7187932819429804
+ Cosine
+
+
+ 5385
+ 4680
+ 78.03150000000005
+ 5385
+ 0.70736754719684
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.70736754719684
+ Cosine
+
+
+ 5505
+ 4680
+ 15.995200000000068
+ 5505
+ 0.8443061802025436
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8443061802025436
+ Cosine
+
+
+ 7663
+ 4680
+ 144.07820000000004
+ 7663
+ 0.7409404939031106
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7409404939031106
+ Cosine
+
+
+ 7664
+ 4680
+ 178.08350000000007
+ 7664
+ 0.7401707146724892
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7401707146724892
+ Cosine
+
+
+ 7665
+ 4680
+ 58.08540000000005
+ 7665
+ 0.7738361465998609
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738361465998609
+ Cosine
+
+
+ 7741
+ 4680
+ 76.04750000000007
+ 7741
+ 0.7246156813601827
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7246156813601827
+ Cosine
+
+
+ 8321
+ 4680
+ 78.03130000000004
+ 8321
+ 0.8013857434419305
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8013857434419305
+ Cosine
+
+
+ 10349
+ 4680
+ 3.995100000000093
+ 10349
+ 0.7123452792320526
+ 10349.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7123452792320526
+ Cosine
+
+
+ 10432
+ 4680
+ 116.04690000000005
+ 10432
+ 0.7231269930056997
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7231269930056997
+ Cosine
+
+
+ 13590
+ 4680
+ 94.06190000000004
+ 13590
+ 0.7803908193414621
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7803908193414621
+ Cosine
+
+
+ 13737
+ 4680
+ 103.06680000000006
+ 13737
+ 0.744109400153339
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.744109400153339
+ Cosine
+
+
+ 20868
+ 4680
+ 126.11080000000004
+ 20868
+ 0.7684270096335556
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7684270096335556
+ Cosine
+
+
+ 5923
+ 5914
+ 0.0
+ 5923
+ 0.9999999999999993
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5914
+ 5874
+ 0.0
+ 5914
+ 0.9999999999999993
+ 5914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5914
+ 5846
+ 1.9843000000000046
+ 5914
+ 0.7218154561616537
+ 5914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 5915
+ 5914
+ -0.00010000000000331966
+ 5915
+ 0.9999999999999993
+ 5915.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5997
+ 5914
+ -0.00010000000000331966
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6053
+ 5914
+ 0.0
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5975
+ 5914
+ -0.00010000000000331966
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 6038
+ 5914
+ -0.00010000000000331966
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6019
+ 5914
+ 0.0
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5935
+ 5914
+ -0.00010000000000331966
+ 5935
+ 0.9999999999999993
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5914
+ 5889
+ 0.00010000000000331966
+ 5914
+ 0.8713460865906011
+ 5914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 28000
+ 32
+ -74.01880000000006
+ 28000
+ 0.7445432530598621
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7445432530598621
+ Cosine
+
+
+ 32
+ 1
+ 148.03740000000005
+ 32
+ 0.7205336097758785
+ 32.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7205336097758785
+ Cosine
+
+
+ 32
+ 9
+ 28.031200000000013
+ 32
+ 0.7497690939603564
+ 32.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7497690939603564
+ Cosine
+
+
+ 259
+ 32
+ -74.01830000000007
+ 259
+ 0.7599450079285094
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7599450079285094
+ Cosine
+
+
+ 3522
+ 32
+ -57.988500000000045
+ 3522
+ 0.7933622742976667
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7933622742976667
+ Cosine
+
+
+ 5160
+ 32
+ -74.01850000000002
+ 5160
+ 0.749779306177957
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.749779306177957
+ Cosine
+
+
+ 39
+ 32
+ -74.01820000000009
+ 39
+ 0.759282716193409
+ 39.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.759282716193409
+ Cosine
+
+
+ 58
+ 32
+ 9.999999997489795e-05
+ 58
+ 0.8195833344377808
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8195833344377808
+ Cosine
+
+
+ 144
+ 32
+ 74.01889999999992
+ 144
+ 0.7620865529510146
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7620865529510146
+ Cosine
+
+
+ 5923
+ 5846
+ 1.9843000000000046
+ 5923
+ 0.7218154561616537
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 5923
+ 5874
+ 0.0
+ 5923
+ 0.9999999999999993
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5923
+ 5889
+ 0.00010000000000331966
+ 5923
+ 0.8713460865906011
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 5923
+ 5915
+ 0.00010000000000331966
+ 5923
+ 0.9999999999999993
+ 5923.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5935
+ 5923
+ -0.00010000000000331966
+ 5935
+ 0.9999999999999993
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5975
+ 5923
+ -0.00010000000000331966
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 5997
+ 5923
+ -0.00010000000000331966
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6019
+ 5923
+ 0.0
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6038
+ 5923
+ -0.00010000000000331966
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6053
+ 5923
+ 0.0
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 13625
+ 25
+ 23.8395
+ 13625
+ 0.7199434499407491
+ 13625.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7199434499407491
+ Cosine
+
+
+ 13625
+ 4637
+ -12.155699999999996
+ 13625
+ 0.7188255563622192
+ 13625.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7188255563622192
+ Cosine
+
+
+ 2525
+ 2214
+ -98.0358
+ 2525
+ 0.7711449255876844
+ 2525.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7711449255876844
+ Cosine
+
+
+ 13592
+ 2525
+ 100.0521
+ 13592
+ 0.729076151064606
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729076151064606
+ Cosine
+
+
+ 4789
+ 2525
+ -15.99470000000008
+ 4789
+ 0.7107772520926079
+ 4789.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7107772520926079
+ Cosine
+
+
+ 2525
+ 1222
+ -98.03639999999996
+ 2525
+ 0.7101055290946323
+ 2525.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101055290946323
+ Cosine
+
+
+ 1580
+ 1435
+ 341.13149999999996
+ 1580
+ 0.7951619449453317
+ 1580.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7951619449453317
+ Cosine
+
+
+ 1435
+ 48
+ -0.00659999999993488
+ 1435
+ 0.8679959638953401
+ 1435.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8679959638953401
+ Cosine
+
+
+ 2644
+ 1435
+ 260.2118999999999
+ 2644
+ 0.7666867230930828
+ 2644.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666867230930828
+ Cosine
+
+
+ 10473
+ 1
+ -74.0195
+ 10473
+ 0.9642751441502224
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9642751441502224
+ Cosine
+
+
+ 28000
+ 1
+ 74.01859999999999
+ 28000
+ 0.9776162616438893
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9776162616438893
+ Cosine
+
+
+ 6
+ 1
+ -4.959600000000023
+ 6
+ 0.8340203808876114
+ 6.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8340203808876114
+ Cosine
+
+
+ 9
+ 1
+ 120.00620000000004
+ 9
+ 0.9106738456124996
+ 9.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9106738456124996
+ Cosine
+
+
+ 39
+ 1
+ 74.01919999999996
+ 39
+ 0.9426245615577298
+ 39.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9426245615577298
+ Cosine
+
+
+ 58
+ 1
+ 148.03750000000002
+ 58
+ 0.9157658265037045
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9157658265037045
+ Cosine
+
+
+ 144
+ 1
+ 222.05629999999996
+ 144
+ 0.85638792660978
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.85638792660978
+ Cosine
+
+
+ 259
+ 1
+ 74.01909999999998
+ 259
+ 0.9703689371875461
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9703689371875461
+ Cosine
+
+
+ 1156
+ 1
+ 164.06759999999997
+ 1156
+ 0.877569159180295
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.877569159180295
+ Cosine
+
+
+ 3521
+ 1
+ 60.002899999999954
+ 3521
+ 0.9075036901710403
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9075036901710403
+ Cosine
+
+
+ 3522
+ 1
+ 90.0489
+ 3522
+ 0.9339784069050829
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9339784069050829
+ Cosine
+
+
+ 4517
+ 1
+ 240.06680000000006
+ 4517
+ 0.7814613767487939
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7814613767487939
+ Cosine
+
+
+ 5160
+ 1
+ 74.01890000000003
+ 5160
+ 0.9869944594660539
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9869944594660539
+ Cosine
+
+
+ 11306
+ 5175
+ -0.00039999999999906777
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11306
+ 11101
+ 0.00010000000000331966
+ 11306
+ 1.0
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11306
+ 25
+ 50.01089999999999
+ 11306
+ 0.7738824635537842
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+ Cosine
+
+
+ 11306
+ 208
+ 57.01310000000001
+ 11306
+ 0.702129081776425
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+ Cosine
+
+
+ 11306
+ 5078
+ -0.00010000000000331966
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11306
+ 5148
+ -0.00010000000000331966
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11306
+ 5194
+ -0.0002000000000066393
+ 11306
+ 0.9087915697477342
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11306
+ 11194
+ 0.00010000000000331966
+ 11306
+ 1.0
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11306
+ 11270
+ 0.0
+ 11306
+ 1.0
+ 11306.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11321
+ 11306
+ 0.0
+ 11321
+ 0.8985381262898586
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+ Cosine
+
+
+ 11346
+ 11306
+ -0.00010000000000331966
+ 11346
+ 1.0
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11368
+ 11306
+ 0.00010000000000331966
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11652
+ 11306
+ 0.00039999999999906777
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 5385
+ 3546
+ -66.0104
+ 5385
+ 0.7545931194580238
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7545931194580238
+ Cosine
+
+
+ 5385
+ 1339
+ 42.01030000000003
+ 5385
+ 0.7621143376677103
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7621143376677103
+ Cosine
+
+
+ 5385
+ 4537
+ 0.0002000000000066393
+ 5385
+ 0.870214408545168
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.870214408545168
+ Cosine
+
+
+ 5385
+ 4581
+ -51.99549999999999
+ 5385
+ 0.7500529061321639
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7500529061321639
+ Cosine
+
+
+ 5385
+ 4500
+ -51.9948
+ 5385
+ 0.7678295595384088
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7678295595384088
+ Cosine
+
+
+ 5385
+ 1967
+ -0.00029999999998153726
+ 5385
+ 0.8638974835062689
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8638974835062689
+ Cosine
+
+
+ 5385
+ 4505
+ 58.00559999999996
+ 5385
+ 0.8189058787485979
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8189058787485979
+ Cosine
+
+
+ 13602
+ 5385
+ 32.026099999999985
+ 13602
+ 0.7339270649248313
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7339270649248313
+ Cosine
+
+
+ 5385
+ 3901
+ 42.01139999999998
+ 5385
+ 0.8682952590070558
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8682952590070558
+ Cosine
+
+
+ 5385
+ 4587
+ 90.03219999999999
+ 5385
+ 0.7271957615648585
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7271957615648585
+ Cosine
+
+
+ 5385
+ 4549
+ 48.02049999999997
+ 5385
+ 0.7589154732591672
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7589154732591672
+ Cosine
+
+
+ 5385
+ 1173
+ 15.995000000000005
+ 5385
+ 0.7948260281415064
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7948260281415064
+ Cosine
+
+
+ 7845
+ 5385
+ 14.018000000000029
+ 7845
+ 0.743077728262811
+ 7845.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.743077728262811
+ Cosine
+
+
+ 5385
+ 1391
+ -82.0421
+ 5385
+ 0.7482434230454644
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7482434230454644
+ Cosine
+
+
+ 5385
+ 4694
+ 58.005499999999984
+ 5385
+ 0.7409655399191836
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7409655399191836
+ Cosine
+
+
+ 5385
+ 2486
+ 32.02569999999997
+ 5385
+ 0.7203011664386312
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7203011664386312
+ Cosine
+
+
+ 13590
+ 5385
+ 16.030399999999986
+ 13590
+ 0.7964751130510149
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7964751130510149
+ Cosine
+
+
+ 5385
+ 4561
+ 42.01139999999998
+ 5385
+ 0.8399301017751086
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8399301017751086
+ Cosine
+
+
+ 5385
+ 1335
+ 36.14530000000002
+ 5385
+ 0.7129054141365812
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7129054141365812
+ Cosine
+
+
+ 5385
+ 1555
+ 0.00029999999998153726
+ 5385
+ 0.8238089265441233
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8238089265441233
+ Cosine
+
+
+ 5385
+ 1223
+ -15.99490000000003
+ 5385
+ 0.7225189170777
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7225189170777
+ Cosine
+
+
+ 5385
+ 2651
+ -98.03649999999999
+ 5385
+ 0.8289296747478798
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8289296747478798
+ Cosine
+
+
+ 5385
+ 4661
+ 34.0059
+ 5385
+ 0.7424911177238644
+ 5385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7424911177238644
+ Cosine
+
+
+ 5505
+ 5385
+ -62.03629999999998
+ 5505
+ 0.7071457402935462
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7071457402935462
+ Cosine
+
+
+ 8321
+ 5385
+ -0.0002000000000066393
+ 8321
+ 0.8965633623383651
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8965633623383651
+ Cosine
+
+
+ 4153
+ 3674
+ 0.0
+ 4153
+ 0.7020630784223871
+ 4153.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7020630784223871
+ Cosine
+
+
+ 13660
+ 13642
+ -42.011400000000094
+ 13660
+ 0.7590793634226061
+ 13660.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7590793634226061
+ Cosine
+
+
+ 13719
+ 13642
+ 54.008899999999926
+ 13719
+ 0.8936541160535001
+ 13719.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8936541160535001
+ Cosine
+
+
+ 4505
+ 3546
+ -124.01599999999996
+ 4505
+ 0.8184436845434377
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8184436845434377
+ Cosine
+
+
+ 7732
+ 4505
+ 20.048999999999978
+ 7732
+ 0.7512800364839523
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7512800364839523
+ Cosine
+
+
+ 4505
+ 1339
+ -15.99529999999993
+ 4505
+ 0.7820620281045852
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7820620281045852
+ Cosine
+
+
+ 4537
+ 4505
+ 58.00539999999995
+ 4537
+ 0.9045818371454345
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9045818371454345
+ Cosine
+
+
+ 4505
+ 1322
+ -124.01639999999998
+ 4505
+ 0.7739517366768146
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7739517366768146
+ Cosine
+
+
+ 4581
+ 4505
+ 110.00109999999995
+ 4581
+ 0.8181567233131046
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8181567233131046
+ Cosine
+
+
+ 4505
+ 1376
+ -138.03209999999996
+ 4505
+ 0.7849737594756034
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7849737594756034
+ Cosine
+
+
+ 4505
+ 4500
+ -110.00039999999996
+ 4505
+ 0.8586919663520093
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8586919663520093
+ Cosine
+
+
+ 4505
+ 1164
+ -110.00019999999995
+ 4505
+ 0.8274661087472317
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8274661087472317
+ Cosine
+
+
+ 4505
+ 1967
+ -58.00589999999994
+ 4505
+ 0.9030674030152854
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9030674030152854
+ Cosine
+
+
+ 4505
+ 1173
+ -42.010599999999954
+ 4505
+ 0.8706006993744732
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8706006993744732
+ Cosine
+
+
+ 4505
+ 1223
+ -74.00049999999999
+ 4505
+ 0.764881748955613
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.764881748955613
+ Cosine
+
+
+ 4505
+ 1240
+ -9.984899999999925
+ 4505
+ 0.761094384828431
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.761094384828431
+ Cosine
+
+
+ 4505
+ 1335
+ -21.86029999999994
+ 4505
+ 0.7859407345387118
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7859407345387118
+ Cosine
+
+
+ 4505
+ 1361
+ -35.875399999999956
+ 4505
+ 0.8083618986430136
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8083618986430136
+ Cosine
+
+
+ 4505
+ 1391
+ -140.04769999999996
+ 4505
+ 0.7912915061928949
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7912915061928949
+ Cosine
+
+
+ 4505
+ 1449
+ 126.17770000000007
+ 4505
+ 0.7373213225695963
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7373213225695963
+ Cosine
+
+
+ 4505
+ 1555
+ -58.00529999999998
+ 4505
+ 0.8020247607563531
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8020247607563531
+ Cosine
+
+
+ 4505
+ 2486
+ -25.979899999999986
+ 4505
+ 0.7711989656464305
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7711989656464305
+ Cosine
+
+
+ 4505
+ 2544
+ -11.963699999999903
+ 4505
+ 0.7350881308437993
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7350881308437993
+ Cosine
+
+
+ 4505
+ 2651
+ -156.04209999999995
+ 4505
+ 0.8723769290274772
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8723769290274772
+ Cosine
+
+
+ 4505
+ 3766
+ -108.02149999999995
+ 4505
+ 0.8129591766460029
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8129591766460029
+ Cosine
+
+
+ 4505
+ 3901
+ -15.994199999999978
+ 4505
+ 0.8934456726983816
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8934456726983816
+ Cosine
+
+
+ 4505
+ 4452
+ -94.00589999999994
+ 4505
+ 0.7438375122453602
+ 4505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7438375122453602
+ Cosine
+
+
+ 4524
+ 4505
+ 124.01649999999995
+ 4524
+ 0.8366510413626045
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8366510413626045
+ Cosine
+
+
+ 4549
+ 4505
+ 9.985099999999989
+ 4549
+ 0.8245601839914916
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8245601839914916
+ Cosine
+
+
+ 4561
+ 4505
+ 15.994199999999978
+ 4561
+ 0.8875347397670992
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8875347397670992
+ Cosine
+
+
+ 4587
+ 4505
+ -32.02660000000003
+ 4587
+ 0.7965585119392344
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7965585119392344
+ Cosine
+
+
+ 4661
+ 4505
+ 23.99969999999996
+ 4661
+ 0.8393598070738519
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8393598070738519
+ Cosine
+
+
+ 4694
+ 4505
+ 9.999999997489795e-05
+ 4694
+ 0.8275306387288315
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8275306387288315
+ Cosine
+
+
+ 5505
+ 4505
+ -4.030700000000024
+ 5505
+ 0.7431941501769138
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7431941501769138
+ Cosine
+
+
+ 7663
+ 4505
+ 124.05229999999995
+ 7663
+ 0.7637474997494679
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7637474997494679
+ Cosine
+
+
+ 7664
+ 4505
+ 158.05759999999998
+ 7664
+ 0.7921975368015186
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7921975368015186
+ Cosine
+
+
+ 7665
+ 4505
+ 38.05949999999996
+ 7665
+ 0.7965623850055321
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7965623850055321
+ Cosine
+
+
+ 8321
+ 4505
+ 58.00539999999995
+ 8321
+ 0.9163043839149274
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9163043839149274
+ Cosine
+
+
+ 8341
+ 4505
+ 60.02139999999997
+ 8341
+ 0.7649845927272073
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7649845927272073
+ Cosine
+
+
+ 10432
+ 4505
+ 96.02099999999996
+ 10432
+ 0.749425318948823
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.749425318948823
+ Cosine
+
+
+ 13590
+ 4505
+ 74.03599999999994
+ 13590
+ 0.854482768277046
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.854482768277046
+ Cosine
+
+
+ 13602
+ 4505
+ 90.03169999999994
+ 13602
+ 0.7521639437848847
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7521639437848847
+ Cosine
+
+
+ 13633
+ 4505
+ 74.03669999999994
+ 13633
+ 0.8432467740636854
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8432467740636854
+ Cosine
+
+
+ 13737
+ 4505
+ 83.04089999999997
+ 13737
+ 0.7716096562402666
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7716096562402666
+ Cosine
+
+
+ 15800
+ 4505
+ 108.02129999999994
+ 15800
+ 0.768032409903071
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.768032409903071
+ Cosine
+
+
+ 20868
+ 4505
+ 106.08489999999995
+ 20868
+ 0.7616962811885368
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7616962811885368
+ Cosine
+
+
+ 26406
+ 4505
+ 40.030599999999936
+ 26406
+ 0.8005887554245333
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8005887554245333
+ Cosine
+
+
+ 6053
+ 5874
+ 0.0
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6053
+ 5846
+ 1.9843000000000046
+ 6053
+ 0.7218154561616537
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 6053
+ 5915
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6053
+ 5997
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6053
+ 5889
+ 0.00010000000000331966
+ 6053
+ 0.8713460865906011
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 6053
+ 5935
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6053
+ 5975
+ 0.00010000000000331966
+ 6053
+ 0.8840320085106907
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 6053
+ 6019
+ 0.0
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6053
+ 6038
+ 0.00010000000000331966
+ 6053
+ 0.9999999999999993
+ 6053.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 4732
+ 1808
+ 0.0002000000000066393
+ 4732
+ 0.7546122826917636
+ 4732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7546122826917636
+ Cosine
+
+
+ 5217
+ 1808
+ 0.0002000000000066393
+ 5217
+ 0.75584360963952
+ 5217.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.75584360963952
+ Cosine
+
+
+ 4589
+ 1808
+ 0.00010000000000331966
+ 4589
+ 0.7589707294525772
+ 4589.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7589707294525772
+ Cosine
+
+
+ 7667
+ 1808
+ 2.0153999999999996
+ 7667
+ 0.7715785562959148
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7715785562959148
+ Cosine
+
+
+ 2519
+ 1482
+ -170.0934000000001
+ 2519
+ 0.703711911912945
+ 2519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.703711911912945
+ Cosine
+
+
+ 2519
+ 1599
+ -44.02629999999999
+ 2519
+ 0.9238704997918817
+ 2519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9238704997918817
+ Cosine
+
+
+ 2519
+ 1610
+ -70.04169999999999
+ 2519
+ 0.7274457168237762
+ 2519.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7274457168237762
+ Cosine
+
+
+ 2566
+ 2519
+ 126.06790000000001
+ 2566
+ 0.7276326465032978
+ 2566.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7276326465032978
+ Cosine
+
+
+ 5175
+ 4637
+ 14.016099999999994
+ 5175
+ 0.7465660405620628
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 11368
+ 4637
+ 14.015799999999999
+ 11368
+ 0.7465660405620628
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 4637
+ 208
+ 42.99740000000001
+ 4637
+ 0.871356075801677
+ 4637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.871356075801677
+ Cosine
+
+
+ 11652
+ 4637
+ 14.016099999999994
+ 11652
+ 0.7465660405620628
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 5194
+ 4637
+ 14.015900000000002
+ 5194
+ 0.7465660405620628
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 4637
+ 25
+ 35.9952
+ 4637
+ 0.8774727995922598
+ 4637.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8774727995922598
+ Cosine
+
+
+ 5078
+ 4637
+ 14.015799999999999
+ 5078
+ 0.7465660405620628
+ 5078.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 5148
+ 4637
+ 14.015799999999999
+ 5148
+ 0.7465660405620628
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465660405620628
+ Cosine
+
+
+ 11321
+ 4637
+ 14.015699999999995
+ 11321
+ 0.7268821477567455
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7268821477567455
+ Cosine
+
+
+ 3575
+ 2509
+ -132.04170000000005
+ 3575
+ 0.7033245909625492
+ 3575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7033245909625492
+ Cosine
+
+
+ 15865
+ 2509
+ -132.04220000000004
+ 15865
+ 0.7276068594160687
+ 15865.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7276068594160687
+ Cosine
+
+
+ 4579
+ 2735
+ -0.0004000000000132786
+ 4579
+ 0.792165344203428
+ 4579.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.792165344203428
+ Cosine
+
+
+ 8341
+ 3546
+ -63.99459999999999
+ 8341
+ 0.7759270901915414
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7759270901915414
+ Cosine
+
+
+ 8341
+ 7732
+ 39.97239999999999
+ 8341
+ 0.7136253180097863
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7136253180097863
+ Cosine
+
+
+ 8341
+ 4537
+ 2.0160000000000196
+ 8341
+ 0.7489470127608895
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7489470127608895
+ Cosine
+
+
+ 8341
+ 1322
+ -63.995000000000005
+ 8341
+ 0.7515175135872368
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7515175135872368
+ Cosine
+
+
+ 8341
+ 4581
+ -49.97969999999998
+ 8341
+ 0.7400667306197957
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400667306197957
+ Cosine
+
+
+ 8341
+ 1967
+ 2.0155000000000314
+ 8341
+ 0.7771101434990049
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7771101434990049
+ Cosine
+
+
+ 13602
+ 8341
+ 30.010299999999972
+ 13602
+ 0.7013052097788057
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013052097788057
+ Cosine
+
+
+ 8341
+ 3901
+ 44.02719999999999
+ 8341
+ 0.7229945485715048
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7229945485715048
+ Cosine
+
+
+ 8341
+ 1307
+ -49.979600000000005
+ 8341
+ 0.7253802735397481
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7253802735397481
+ Cosine
+
+
+ 8341
+ 1335
+ 38.16110000000003
+ 8341
+ 0.7367161736731382
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7367161736731382
+ Cosine
+
+
+ 8341
+ 1361
+ 24.146000000000015
+ 8341
+ 0.7269405161428262
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7269405161428262
+ Cosine
+
+
+ 8341
+ 1391
+ -80.02629999999999
+ 8341
+ 0.7317178577702568
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7317178577702568
+ Cosine
+
+
+ 8341
+ 1555
+ 2.0160999999999945
+ 8341
+ 0.7118420686808837
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7118420686808837
+ Cosine
+
+
+ 8341
+ 2651
+ -96.02069999999998
+ 8341
+ 0.7970069756725413
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7970069756725413
+ Cosine
+
+
+ 8341
+ 3766
+ -48.000099999999975
+ 8341
+ 0.7427551341361719
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7427551341361719
+ Cosine
+
+
+ 8341
+ 4524
+ -63.99509999999998
+ 8341
+ 0.7598337334837384
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7598337334837384
+ Cosine
+
+
+ 8341
+ 4549
+ 50.03629999999998
+ 8341
+ 0.7356743868601239
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7356743868601239
+ Cosine
+
+
+ 8341
+ 4561
+ 44.02719999999999
+ 8341
+ 0.745941374157076
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.745941374157076
+ Cosine
+
+
+ 8341
+ 5505
+ 64.0521
+ 8341
+ 0.7106661180464238
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7106661180464238
+ Cosine
+
+
+ 8341
+ 7648
+ 19.990800000000036
+ 8341
+ 0.7012459251589551
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7012459251589551
+ Cosine
+
+
+ 8341
+ 7664
+ -98.03620000000001
+ 8341
+ 0.7462514134256624
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7462514134256624
+ Cosine
+
+
+ 8341
+ 7665
+ 21.961900000000014
+ 8341
+ 0.7541050805070624
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7541050805070624
+ Cosine
+
+
+ 8341
+ 8321
+ 2.0160000000000196
+ 8341
+ 0.7674660397558335
+ 8341.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7674660397558335
+ Cosine
+
+
+ 10432
+ 8341
+ 35.99959999999999
+ 10432
+ 0.7042929821254559
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7042929821254559
+ Cosine
+
+
+ 13590
+ 8341
+ 14.014599999999973
+ 13590
+ 0.8485996815456796
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8485996815456796
+ Cosine
+
+
+ 13633
+ 8341
+ 14.015299999999968
+ 13633
+ 0.8597752055099311
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8597752055099311
+ Cosine
+
+
+ 13737
+ 8341
+ 23.019499999999994
+ 13737
+ 0.775057774010899
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.775057774010899
+ Cosine
+
+
+ 13747
+ 8341
+ 3.994100000000003
+ 13747
+ 0.724360857013356
+ 13747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.724360857013356
+ Cosine
+
+
+ 15800
+ 8341
+ 47.99989999999997
+ 15800
+ 0.7186309373984334
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7186309373984334
+ Cosine
+
+
+ 26406
+ 8341
+ -19.990800000000036
+ 26406
+ 0.7532714569335062
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7532714569335062
+ Cosine
+
+
+ 15865
+ 3575
+ -0.0004999999999881766
+ 15865
+ 0.872070712590737
+ 15865.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.872070712590737
+ Cosine
+
+
+ 4502
+ 3533
+ 42.00999999999999
+ 4502
+ 0.7532660745485535
+ 4502.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7532660745485535
+ Cosine
+
+
+ 1610
+ 1575
+ -44.02570000000003
+ 1610
+ 0.7786367526493108
+ 1610.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7786367526493108
+ Cosine
+
+
+ 2805
+ 1575
+ 88.05250000000001
+ 2805
+ 0.7495674296437889
+ 2805.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7495674296437889
+ Cosine
+
+
+ 4620
+ 4589
+ -0.00010000000000331966
+ 4620
+ 0.7700578915328313
+ 4620.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7700578915328313
+ Cosine
+
+
+ 3546
+ 1391
+ -16.0317
+ 3546
+ 0.800765151074984
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.800765151074984
+ Cosine
+
+
+ 7732
+ 1391
+ -119.99869999999999
+ 7732
+ 0.7236139816059086
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7236139816059086
+ Cosine
+
+
+ 4537
+ 1391
+ -82.04230000000001
+ 4537
+ 0.7881234709369317
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7881234709369317
+ Cosine
+
+
+ 1391
+ 1322
+ 16.031299999999987
+ 1391
+ 0.7728901130523147
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7728901130523147
+ Cosine
+
+
+ 4581
+ 1391
+ -30.046600000000012
+ 4581
+ 0.7672293294154924
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7672293294154924
+ Cosine
+
+
+ 1391
+ 1376
+ 2.0156000000000063
+ 1391
+ 0.7551991777537019
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7551991777537019
+ Cosine
+
+
+ 4500
+ 1391
+ -30.047300000000007
+ 4500
+ 0.8147937057617602
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8147937057617602
+ Cosine
+
+
+ 1391
+ 1164
+ 30.047500000000014
+ 1391
+ 0.8096042696218257
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8096042696218257
+ Cosine
+
+
+ 1967
+ 1391
+ -82.04180000000002
+ 1967
+ 0.7833756364338588
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7833756364338588
+ Cosine
+
+
+ 13602
+ 1391
+ -50.01600000000002
+ 13602
+ 0.7247169056535181
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7247169056535181
+ Cosine
+
+
+ 3901
+ 1391
+ -124.05349999999999
+ 3901
+ 0.7637065187114895
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7637065187114895
+ Cosine
+
+
+ 1391
+ 1307
+ 30.046699999999987
+ 1391
+ 0.740794408918305
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.740794408918305
+ Cosine
+
+
+ 1391
+ 1361
+ 104.1723
+ 1391
+ 0.7926932806653672
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7926932806653672
+ Cosine
+
+
+ 15800
+ 1391
+ -32.026400000000024
+ 15800
+ 0.7861577137215938
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7861577137215938
+ Cosine
+
+
+ 4452
+ 1391
+ -46.04180000000002
+ 4452
+ 0.7683817378950843
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7683817378950843
+ Cosine
+
+
+ 7795
+ 1391
+ -118.18740000000003
+ 7795
+ 0.779097713027
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.779097713027
+ Cosine
+
+
+ 2544
+ 1391
+ -128.08400000000006
+ 2544
+ 0.7127679451672815
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7127679451672815
+ Cosine
+
+
+ 4549
+ 1391
+ -130.06259999999997
+ 4549
+ 0.7408028173330308
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408028173330308
+ Cosine
+
+
+ 1391
+ 1173
+ 98.03710000000001
+ 1391
+ 0.7662214408356346
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7662214408356346
+ Cosine
+
+
+ 3766
+ 1391
+ -32.02620000000002
+ 3766
+ 0.7898003375293212
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7898003375293212
+ Cosine
+
+
+ 26406
+ 1391
+ -100.01710000000003
+ 26406
+ 0.7663593050700345
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7663593050700345
+ Cosine
+
+
+ 1391
+ 1240
+ 130.06280000000004
+ 1391
+ 0.7352927237600451
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7352927237600451
+ Cosine
+
+
+ 1391
+ 1296
+ -64.0693
+ 1391
+ 0.7729868692779378
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7729868692779378
+ Cosine
+
+
+ 1391
+ 1335
+ 118.18740000000003
+ 1391
+ 0.7351269585457871
+ 1391.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7351269585457871
+ Cosine
+
+
+ 1555
+ 1391
+ -82.04239999999999
+ 1555
+ 0.7272837365357119
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7272837365357119
+ Cosine
+
+
+ 2486
+ 1391
+ -114.06779999999998
+ 2486
+ 0.7600574899643697
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7600574899643697
+ Cosine
+
+
+ 2651
+ 1391
+ 15.994399999999985
+ 2651
+ 0.8293801689330615
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8293801689330615
+ Cosine
+
+
+ 4524
+ 1391
+ -16.031200000000013
+ 4524
+ 0.8240858306782582
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8240858306782582
+ Cosine
+
+
+ 4561
+ 1391
+ -124.05349999999999
+ 4561
+ 0.7598518348712169
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7598518348712169
+ Cosine
+
+
+ 4661
+ 1391
+ -116.048
+ 4661
+ 0.7867755109532587
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7867755109532587
+ Cosine
+
+
+ 4694
+ 1391
+ -140.0476
+ 4694
+ 0.753160938682554
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.753160938682554
+ Cosine
+
+
+ 5505
+ 1391
+ -144.0784
+ 5505
+ 0.71471325254805
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.71471325254805
+ Cosine
+
+
+ 7663
+ 1391
+ -15.995400000000018
+ 7663
+ 0.8059550302887314
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8059550302887314
+ Cosine
+
+
+ 7664
+ 1391
+ 18.009900000000016
+ 7664
+ 0.7611561018922539
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7611561018922539
+ Cosine
+
+
+ 7665
+ 1391
+ -101.9882
+ 7665
+ 0.8020819876255036
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8020819876255036
+ Cosine
+
+
+ 7741
+ 1391
+ -84.02609999999999
+ 7741
+ 0.7078341044897148
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7078341044897148
+ Cosine
+
+
+ 8321
+ 1391
+ -82.04230000000001
+ 8321
+ 0.8246562068791139
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8246562068791139
+ Cosine
+
+
+ 10432
+ 1391
+ -44.026700000000005
+ 10432
+ 0.7639380922233755
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7639380922233755
+ Cosine
+
+
+ 13590
+ 1391
+ -66.01170000000002
+ 13590
+ 0.7717348669665606
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7717348669665606
+ Cosine
+
+
+ 13633
+ 1391
+ -66.01100000000002
+ 13633
+ 0.7931333114375944
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7931333114375944
+ Cosine
+
+
+ 13737
+ 1391
+ -57.0068
+ 13737
+ 0.7363553517722539
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7363553517722539
+ Cosine
+
+
+ 20868
+ 1391
+ -33.962800000000016
+ 20868
+ 0.7941066986588861
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7941066986588861
+ Cosine
+
+
+ 4508
+ 4504
+ -17.026400000000024
+ 4508
+ 0.9285892017216034
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9285892017216034
+ Cosine
+
+
+ 4508
+ 1162
+ 148.0371
+ 4508
+ 0.8067044145330626
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8067044145330626
+ Cosine
+
+
+ 4508
+ 2483
+ -0.0002000000000066393
+ 4508
+ 0.9199811810374714
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9199811810374714
+ Cosine
+
+
+ 4508
+ 4507
+ -31.0419
+ 4508
+ 0.8125404047040253
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8125404047040253
+ Cosine
+
+
+ 4508
+ 1165
+ -31.042200000000037
+ 4508
+ 0.850497281703251
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.850497281703251
+ Cosine
+
+
+ 4508
+ 2478
+ -17.0274
+ 4508
+ 0.9121955697825159
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9121955697825159
+ Cosine
+
+
+ 4508
+ 4498
+ 162.0539
+ 4508
+ 0.8816337404572681
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8816337404572681
+ Cosine
+
+
+ 4508
+ 1196
+ -14.016200000000026
+ 4508
+ 0.8202991636270559
+ 4508.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8202991636270559
+ Cosine
+
+
+ 5915
+ 5874
+ -0.00010000000000331966
+ 5915
+ 0.9999999999999993
+ 5915.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5915
+ 5846
+ 1.9842000000000013
+ 5915
+ 0.7218154561616537
+ 5915.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 5915
+ 5889
+ 0.0
+ 5915
+ 0.8713460865906011
+ 5915.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 5935
+ 5915
+ 0.0
+ 5935
+ 0.9999999999999993
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5975
+ 5915
+ 0.0
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 5997
+ 5915
+ 0.0
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6019
+ 5915
+ 0.00010000000000331966
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6038
+ 5915
+ 0.0
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 10349
+ 4561
+ -32.02499999999998
+ 10349
+ 0.7415498445588087
+ 10349.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7415498445588087
+ Cosine
+
+
+ 10349
+ 5505
+ -12.000099999999975
+ 10349
+ 0.7355534082886129
+ 10349.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7355534082886129
+ Cosine
+
+
+ 4510
+ 3525
+ 9.999999997489795e-05
+ 4510
+ 0.774157733279498
+ 4510.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.774157733279498
+ Cosine
+
+
+ 1297
+ 103
+ 0.0004999999999881766
+ 1297
+ 0.8627554293869262
+ 1297.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8627554293869262
+ Cosine
+
+
+ 1270
+ 103
+ -17.026100000000042
+ 1270
+ 0.8017754365568209
+ 1270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8017754365568209
+ Cosine
+
+
+ 1833
+ 1300
+ 9.999999997489795e-05
+ 1833
+ 0.728547024706825
+ 1833.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.728547024706825
+ Cosine
+
+
+ 2775
+ 1833
+ 0.00010000000000331966
+ 2775
+ 0.7459060570818405
+ 2775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7459060570818405
+ Cosine
+
+
+ 1235
+ 74
+ 0.0004000000000132786
+ 1235
+ 0.786055797481689
+ 1235.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.786055797481689
+ Cosine
+
+
+ 5175
+ 5078
+ 0.0002999999999957481
+ 5175
+ 1.0000000000000002
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11101
+ 5078
+ -0.0002000000000066393
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11368
+ 5078
+ 0.0
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5078
+ 208
+ 57.01320000000001
+ 5078
+ 0.7720262431782003
+ 5078.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 11194
+ 5078
+ -0.0002000000000066393
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11652
+ 5078
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5194
+ 5078
+ 0.00010000000000331966
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5078
+ 25
+ 50.010999999999996
+ 5078
+ 0.7765014360319091
+ 5078.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 5148
+ 5078
+ 0.0
+ 5148
+ 1.0000000000000002
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11270
+ 5078
+ -0.00010000000000331966
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11321
+ 5078
+ -0.00010000000000331966
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 11346
+ 5078
+ -0.0002000000000066393
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 4504
+ 4498
+ 179.08030000000002
+ 4504
+ 0.8453577566491115
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8453577566491115
+ Cosine
+
+
+ 4498
+ 1162
+ -14.01679999999999
+ 4498
+ 0.790398340203869
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.790398340203869
+ Cosine
+
+
+ 4498
+ 2483
+ -162.0541
+ 4498
+ 0.8563098078958857
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8563098078958857
+ Cosine
+
+
+ 4498
+ 1165
+ -193.09610000000004
+ 4498
+ 0.7259250361147604
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7259250361147604
+ Cosine
+
+
+ 4498
+ 2478
+ -179.0813
+ 4498
+ 0.844114743035717
+ 4498.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.844114743035717
+ Cosine
+
+
+ 7690
+ 7658
+ -42.01049999999998
+ 7690
+ 0.7575286975743138
+ 7690.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7575286975743138
+ Cosine
+
+
+ 1300
+ 1189
+ 110.10919999999999
+ 1300
+ 0.7179919872004763
+ 1300.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7179919872004763
+ Cosine
+
+
+ 1695
+ 1189
+ 60.02069999999998
+ 1695
+ 0.7640836799372503
+ 1695.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7640836799372503
+ Cosine
+
+
+ 2287
+ 1189
+ -60.02070000000003
+ 2287
+ 0.8097158234639181
+ 2287.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8097158234639181
+ Cosine
+
+
+ 3770
+ 1189
+ -73.08940000000001
+ 3770
+ 0.7720521965223384
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720521965223384
+ Cosine
+
+
+ 4559
+ 1189
+ 110.10929999999996
+ 4559
+ 0.7444484452052896
+ 4559.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7444484452052896
+ Cosine
+
+
+ 5818
+ 1189
+ -62.03580000000005
+ 5818
+ 0.7077613971170813
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7077613971170813
+ Cosine
+
+
+ 7731
+ 1189
+ -62.03610000000003
+ 7731
+ 0.7411565177869064
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7411565177869064
+ Cosine
+
+
+ 9925
+ 1189
+ 110.10909999999998
+ 9925
+ 0.7636424072720185
+ 9925.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7636424072720185
+ Cosine
+
+
+ 20624
+ 1189
+ 110.10969999999998
+ 20624
+ 0.7102586743729451
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7102586743729451
+ Cosine
+
+
+ 3400
+ 2632
+ -1.9420000000000073
+ 3400
+ 0.7191438317803823
+ 3400.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7191438317803823
+ Cosine
+
+
+ 5818
+ 2632
+ 24.07439999999997
+ 5818
+ 0.7810921428747585
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7810921428747585
+ Cosine
+
+
+ 2632
+ 343
+ -98.10969999999998
+ 2632
+ 0.7519081238951925
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7519081238951925
+ Cosine
+
+
+ 2632
+ 914
+ -98.10969999999998
+ 2632
+ 0.7133047921176153
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7133047921176153
+ Cosine
+
+
+ 2632
+ 1193
+ -10.059300000000007
+ 2632
+ 0.7731979098723929
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7731979098723929
+ Cosine
+
+
+ 2632
+ 1419
+ -36.03649999999999
+ 2632
+ 0.7656849912009569
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7656849912009569
+ Cosine
+
+
+ 2632
+ 1547
+ -22.058299999999974
+ 2632
+ 0.8078769875644698
+ 2632.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8078769875644698
+ Cosine
+
+
+ 3667
+ 2632
+ -155.0082
+ 3667
+ 0.7446562498688012
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7446562498688012
+ Cosine
+
+
+ 3770
+ 2632
+ 13.020800000000008
+ 3770
+ 0.81386597831897
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.81386597831897
+ Cosine
+
+
+ 7731
+ 2632
+ 24.074099999999987
+ 7731
+ 0.8550201321703159
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8550201321703159
+ Cosine
+
+
+ 10446
+ 2632
+ -46.01999999999998
+ 10446
+ 0.7001928679023722
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7001928679023722
+ Cosine
+
+
+ 10964
+ 2632
+ 11.00509999999997
+ 10964
+ 0.8231739921866272
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8231739921866272
+ Cosine
+
+
+ 7760
+ 4575
+ -133.978
+ 7760
+ 0.8048112641820719
+ 7760.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8048112641820719
+ Cosine
+
+
+ 4575
+ 3551
+ 0.00029999999998153726
+ 4575
+ 0.8050693777109803
+ 4575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8050693777109803
+ Cosine
+
+
+ 7922
+ 4575
+ -82.00130000000001
+ 7922
+ 0.7964475888619336
+ 7922.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7964475888619336
+ Cosine
+
+
+ 1909
+ 531
+ 0.0001999999999782176
+ 1909
+ 0.8564530361506346
+ 1909.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8564530361506346
+ Cosine
+
+
+ 2775
+ 1300
+ 0.0001999999999782176
+ 2775
+ 0.7267130312621488
+ 2775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7267130312621488
+ Cosine
+
+
+ 4559
+ 1300
+ 9.999999997489795e-05
+ 4559
+ 0.8890369144572587
+ 4559.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8890369144572587
+ Cosine
+
+
+ 9925
+ 1300
+ -0.00010000000000331966
+ 9925
+ 0.8515014347282472
+ 9925.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8515014347282472
+ Cosine
+
+
+ 20624
+ 1300
+ 0.0004999999999881766
+ 20624
+ 0.8921126397905124
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8921126397905124
+ Cosine
+
+
+ 3901
+ 3546
+ -108.02179999999998
+ 3901
+ 0.7986267785785048
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7986267785785048
+ Cosine
+
+
+ 7732
+ 3901
+ 4.0548
+ 7732
+ 0.720263780558529
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.720263780558529
+ Cosine
+
+
+ 3901
+ 1339
+ -0.001099999999951251
+ 3901
+ 0.7829124925167454
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7829124925167454
+ Cosine
+
+
+ 4537
+ 3901
+ 42.011199999999974
+ 4537
+ 0.9123102206161919
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9123102206161919
+ Cosine
+
+
+ 3901
+ 3545
+ -0.0004000000000132786
+ 3901
+ 0.7069664844692359
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7069664844692359
+ Cosine
+
+
+ 3901
+ 1322
+ -108.0222
+ 3901
+ 0.716720762642518
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.716720762642518
+ Cosine
+
+
+ 4581
+ 3901
+ 94.00689999999997
+ 4581
+ 0.7881883118219735
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7881883118219735
+ Cosine
+
+
+ 3901
+ 1376
+ -122.03789999999998
+ 3901
+ 0.7393354804793056
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7393354804793056
+ Cosine
+
+
+ 4500
+ 3901
+ 94.00619999999998
+ 4500
+ 0.8098481159473523
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8098481159473523
+ Cosine
+
+
+ 3901
+ 1164
+ -94.00599999999997
+ 3901
+ 0.7727759370364564
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7727759370364564
+ Cosine
+
+
+ 3901
+ 1967
+ -42.01169999999996
+ 3901
+ 0.8851038475254405
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8851038475254405
+ Cosine
+
+
+ 13602
+ 3901
+ 74.03749999999997
+ 13602
+ 0.7349957461672803
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7349957461672803
+ Cosine
+
+
+ 3901
+ 1173
+ -26.016399999999976
+ 3901
+ 0.8542667557915937
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8542667557915937
+ Cosine
+
+
+ 3901
+ 1223
+ -58.00630000000001
+ 3901
+ 0.7337991707265805
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7337991707265805
+ Cosine
+
+
+ 3901
+ 1240
+ 6.009300000000053
+ 3901
+ 0.7440381301325522
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7440381301325522
+ Cosine
+
+
+ 3901
+ 1335
+ -5.86609999999996
+ 3901
+ 0.7570301306976719
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7570301306976719
+ Cosine
+
+
+ 3901
+ 1361
+ -19.88119999999998
+ 3901
+ 0.7692795352087685
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7692795352087685
+ Cosine
+
+
+ 3901
+ 1449
+ 142.17190000000005
+ 3901
+ 0.711180924261321
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.711180924261321
+ Cosine
+
+
+ 3901
+ 1555
+ -42.0111
+ 3901
+ 0.7791223271828416
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7791223271828416
+ Cosine
+
+
+ 3901
+ 2486
+ -9.985700000000008
+ 3901
+ 0.7665400699425919
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7665400699425919
+ Cosine
+
+
+ 3901
+ 2651
+ -140.04789999999997
+ 3901
+ 0.8693346212411143
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8693346212411143
+ Cosine
+
+
+ 3901
+ 3747
+ -108.0224
+ 3901
+ 0.7153905336534034
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7153905336534034
+ Cosine
+
+
+ 3901
+ 3766
+ -92.02729999999997
+ 3901
+ 0.7699170989840913
+ 3901.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7699170989840913
+ Cosine
+
+
+ 4524
+ 3901
+ 108.02229999999997
+ 4524
+ 0.7693985851447038
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7693985851447038
+ Cosine
+
+
+ 4549
+ 3901
+ -6.0090999999999894
+ 4549
+ 0.7886323424252911
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7886323424252911
+ Cosine
+
+
+ 4561
+ 3901
+ 0.0
+ 4561
+ 0.8882423334298266
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8882423334298266
+ Cosine
+
+
+ 4587
+ 3901
+ -48.02080000000001
+ 4587
+ 0.7600984691470813
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7600984691470813
+ Cosine
+
+
+ 4661
+ 3901
+ 8.005499999999984
+ 4661
+ 0.8278706122504864
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8278706122504864
+ Cosine
+
+
+ 4694
+ 3901
+ -15.994100000000003
+ 4694
+ 0.7912988771866627
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7912988771866627
+ Cosine
+
+
+ 5505
+ 3901
+ -20.024900000000002
+ 5505
+ 0.7458144163706382
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7458144163706382
+ Cosine
+
+
+ 7664
+ 3901
+ 142.0634
+ 7664
+ 0.7215929468073363
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7215929468073363
+ Cosine
+
+
+ 7665
+ 3901
+ 22.06529999999998
+ 7665
+ 0.7373184087005229
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7373184087005229
+ Cosine
+
+
+ 7795
+ 3901
+ 5.86609999999996
+ 7795
+ 0.7076032232410082
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7076032232410082
+ Cosine
+
+
+ 8321
+ 3901
+ 42.011199999999974
+ 8321
+ 0.9161173594539591
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9161173594539591
+ Cosine
+
+
+ 13590
+ 3901
+ 58.04179999999997
+ 13590
+ 0.8004474993985049
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8004474993985049
+ Cosine
+
+
+ 13633
+ 3901
+ 58.04249999999996
+ 13633
+ 0.785928832559867
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.785928832559867
+ Cosine
+
+
+ 13737
+ 3901
+ 67.04669999999999
+ 13737
+ 0.7162572525487072
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7162572525487072
+ Cosine
+
+
+ 15800
+ 3901
+ 92.02709999999996
+ 15800
+ 0.7284490405209969
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7284490405209969
+ Cosine
+
+
+ 26406
+ 3901
+ 24.036399999999958
+ 26406
+ 0.7170483262935357
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7170483262935357
+ Cosine
+
+
+ 11911
+ 1581
+ 0.0
+ 11911
+ 0.7217929561095331
+ 11911.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7217929561095331
+ Cosine
+
+
+ 4603
+ 3546
+ -18.009900000000016
+ 4603
+ 0.769910019185847
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.769910019185847
+ Cosine
+
+
+ 4603
+ 2692
+ 85.0199
+ 4603
+ 0.7101103934153072
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101103934153072
+ Cosine
+
+
+ 4603
+ 4537
+ 48.000699999999995
+ 4603
+ 0.7533581588476521
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7533581588476521
+ Cosine
+
+
+ 4603
+ 1322
+ -18.01030000000003
+ 4603
+ 0.7455364355137896
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7455364355137896
+ Cosine
+
+
+ 4603
+ 1164
+ -3.994100000000003
+ 4603
+ 0.7553121313311235
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553121313311235
+ Cosine
+
+
+ 4603
+ 1173
+ 63.99549999999999
+ 4603
+ 0.7097322326931039
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7097322326931039
+ Cosine
+
+
+ 4603
+ 1240
+ 96.02120000000002
+ 4603
+ 0.7002528089721138
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7002528089721138
+ Cosine
+
+
+ 4603
+ 1307
+ -3.9949000000000296
+ 4603
+ 0.7520863987187125
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7520863987187125
+ Cosine
+
+
+ 4603
+ 1967
+ 48.00020000000001
+ 4603
+ 0.7584250669985092
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7584250669985092
+ Cosine
+
+
+ 4603
+ 2651
+ -50.036
+ 4603
+ 0.74751870858087
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.74751870858087
+ Cosine
+
+
+ 4603
+ 4500
+ -3.9943000000000097
+ 4603
+ 0.7765163533604051
+ 4603.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765163533604051
+ Cosine
+
+
+ 4661
+ 4603
+ -82.00639999999999
+ 4661
+ 0.7564681621816383
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7564681621816383
+ Cosine
+
+
+ 7795
+ 4603
+ -84.14580000000001
+ 7795
+ 0.7217796352579398
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7217796352579398
+ Cosine
+
+
+ 13633
+ 4603
+ -31.969400000000007
+ 13633
+ 0.7408589644445308
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408589644445308
+ Cosine
+
+
+ 15800
+ 4603
+ 2.015199999999993
+ 15800
+ 0.7170282264819776
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7170282264819776
+ Cosine
+
+
+ 20868
+ 4603
+ 0.07880000000000109
+ 20868
+ 0.7291606401977068
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7291606401977068
+ Cosine
+
+
+ 4504
+ 2483
+ 17.026200000000017
+ 4504
+ 0.9200994886020961
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9200994886020961
+ Cosine
+
+
+ 2483
+ 1162
+ 148.03730000000002
+ 2483
+ 0.7620590205240438
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7620590205240438
+ Cosine
+
+
+ 2483
+ 1165
+ -31.04200000000003
+ 2483
+ 0.8183562385544039
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8183562385544039
+ Cosine
+
+
+ 2483
+ 1196
+ -14.01600000000002
+ 2483
+ 0.7714586040613065
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7714586040613065
+ Cosine
+
+
+ 2483
+ 2478
+ -17.027199999999993
+ 2483
+ 0.9164696257744831
+ 2483.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9164696257744831
+ Cosine
+
+
+ 4507
+ 2483
+ 31.04169999999999
+ 4507
+ 0.7734535188194261
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7734535188194261
+ Cosine
+
+
+ 13826
+ 13664
+ -18.011100000000056
+ 13826
+ 0.7078627454436122
+ 13826.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7078627454436122
+ Cosine
+
+
+ 1474
+ 1419
+ 14.015300000000025
+ 1474
+ 0.8565647796733781
+ 1474.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8565647796733781
+ Cosine
+
+
+ 1419
+ 270
+ -10.020500000000027
+ 1419
+ 0.7459953716298615
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7459953716298615
+ Cosine
+
+
+ 10964
+ 1419
+ -25.03140000000002
+ 10964
+ 0.7999423683421758
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7999423683421758
+ Cosine
+
+
+ 1419
+ 1068
+ -62.073199999999986
+ 1419
+ 0.713936690854152
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.713936690854152
+ Cosine
+
+
+ 1419
+ 914
+ -62.073199999999986
+ 1419
+ 0.7586938342891549
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7586938342891549
+ Cosine
+
+
+ 1419
+ 11
+ 56.07709999999997
+ 1419
+ 0.7066325985269599
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7066325985269599
+ Cosine
+
+
+ 1419
+ 343
+ -62.073199999999986
+ 1419
+ 0.7888130845071628
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7888130845071628
+ Cosine
+
+
+ 1419
+ 1220
+ -48.05799999999999
+ 1419
+ 0.7168813973290207
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7168813973290207
+ Cosine
+
+
+ 1419
+ 1352
+ -28.03109999999998
+ 1419
+ 0.7400977642379214
+ 1419.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400977642379214
+ Cosine
+
+
+ 1547
+ 1419
+ -13.978200000000015
+ 1547
+ 0.923673342484428
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.923673342484428
+ Cosine
+
+
+ 7731
+ 1419
+ -11.962400000000002
+ 7731
+ 0.7408775165622947
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7408775165622947
+ Cosine
+
+
+ 11321
+ 5175
+ -0.00039999999999906777
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 11321
+ 11101
+ 0.00010000000000331966
+ 11321
+ 0.8985381262898586
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+ Cosine
+
+
+ 11368
+ 11321
+ 0.00010000000000331966
+ 11368
+ 0.9750631616472476
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 11321
+ 208
+ 57.01310000000001
+ 11321
+ 0.765852343141411
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765852343141411
+ Cosine
+
+
+ 11321
+ 11194
+ 0.00010000000000331966
+ 11321
+ 0.8985381262898586
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+ Cosine
+
+
+ 11652
+ 11321
+ 0.00039999999999906777
+ 11652
+ 0.9750631616472476
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 11321
+ 5194
+ -0.0002000000000066393
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 11321
+ 25
+ 50.01089999999999
+ 11321
+ 0.7632544416367313
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7632544416367313
+ Cosine
+
+
+ 11346
+ 11321
+ -0.00010000000000331966
+ 11346
+ 0.8985381262898586
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+ Cosine
+
+
+ 11321
+ 11270
+ 0.0
+ 11321
+ 0.8985381262898586
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8985381262898586
+ Cosine
+
+
+ 11321
+ 5148
+ -0.00010000000000331966
+ 11321
+ 0.9750631616472476
+ 11321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9750631616472476
+ Cosine
+
+
+ 10473
+ 4517
+ -314.08630000000005
+ 10473
+ 0.7192267163672981
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7192267163672981
+ Cosine
+
+
+ 28000
+ 4517
+ -166.04820000000007
+ 28000
+ 0.7902931798827844
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7902931798827844
+ Cosine
+
+
+ 4517
+ 9
+ 120.06060000000002
+ 4517
+ 0.8134920806291412
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8134920806291412
+ Cosine
+
+
+ 4517
+ 39
+ 166.0476000000001
+ 4517
+ 0.7874462262392017
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7874462262392017
+ Cosine
+
+
+ 4517
+ 144
+ 18.010500000000093
+ 4517
+ 0.7248717465870864
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7248717465870864
+ Cosine
+
+
+ 4517
+ 259
+ 166.04770000000008
+ 4517
+ 0.7780783658879453
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7780783658879453
+ Cosine
+
+
+ 4517
+ 3521
+ 180.0639000000001
+ 4517
+ 0.7678698025249613
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7678698025249613
+ Cosine
+
+
+ 4517
+ 3522
+ 150.01790000000005
+ 4517
+ 0.7162157061890282
+ 4517.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7162157061890282
+ Cosine
+
+
+ 5160
+ 4517
+ -166.04790000000003
+ 5160
+ 0.7824695418046577
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7824695418046577
+ Cosine
+
+
+ 5332
+ 4517
+ 165.06379999999996
+ 5332
+ 0.7135941911087034
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7135941911087034
+ Cosine
+
+
+ 4513
+ 2498
+ -0.0008000000000265572
+ 4513
+ 0.9181613526554788
+ 4513.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9181613526554788
+ Cosine
+
+
+ 17228
+ 1653
+ -42.984500000000025
+ 17228
+ 0.8054636093133574
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8054636093133574
+ Cosine
+
+
+ 17228
+ 4785
+ 205.17769999999996
+ 17228
+ 0.7319036112564217
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7319036112564217
+ Cosine
+
+
+ 17228
+ 2783
+ 117.12490000000003
+ 17228
+ 0.818234410634913
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.818234410634913
+ Cosine
+
+
+ 17228
+ 1487
+ 1.0413999999999533
+ 17228
+ 0.8244885250961219
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8244885250961219
+ Cosine
+
+
+ 17228
+ 2566
+ 89.09370000000001
+ 17228
+ 0.8349277107414067
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8349277107414067
+ Cosine
+
+
+ 17228
+ 1482
+ 45.06819999999993
+ 17228
+ 0.8299794040545694
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8299794040545694
+ Cosine
+
+
+ 17228
+ 2726
+ 131.1395
+ 17228
+ 0.7720964080014941
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720964080014941
+ Cosine
+
+
+ 17228
+ 2761
+ 73.0992
+ 17228
+ 0.766699813305034
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.766699813305034
+ Cosine
+
+
+ 17228
+ 4679
+ 175.16610000000003
+ 17228
+ 0.70612944744713
+ 17228.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.70612944744713
+ Cosine
+
+
+ 7741
+ 3546
+ -67.99439999999998
+ 7741
+ 0.7386097227949636
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7386097227949636
+ Cosine
+
+
+ 7741
+ 1322
+ -67.9948
+ 7741
+ 0.7805901968315092
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7805901968315092
+ Cosine
+
+
+ 7741
+ 1376
+ -82.01049999999998
+ 7741
+ 0.7177993174563163
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7177993174563163
+ Cosine
+
+
+ 7741
+ 4500
+ -53.97879999999998
+ 7741
+ 0.7611910379321922
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7611910379321922
+ Cosine
+
+
+ 7741
+ 1164
+ -53.97859999999997
+ 7741
+ 0.7725419088013727
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7725419088013727
+ Cosine
+
+
+ 7741
+ 1307
+ -53.9794
+ 7741
+ 0.7062213270874391
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7062213270874391
+ Cosine
+
+
+ 7741
+ 1361
+ 20.14620000000002
+ 7741
+ 0.7496258867626713
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7496258867626713
+ Cosine
+
+
+ 7741
+ 4587
+ 88.04820000000001
+ 7741
+ 0.7016257270130307
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7016257270130307
+ Cosine
+
+
+ 15800
+ 7741
+ 51.99969999999996
+ 15800
+ 0.729078952754635
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729078952754635
+ Cosine
+
+
+ 7741
+ 4452
+ -37.98429999999996
+ 7741
+ 0.7401356438768415
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7401356438768415
+ Cosine
+
+
+ 7795
+ 7741
+ -34.16130000000004
+ 7795
+ 0.7286391437550137
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7286391437550137
+ Cosine
+
+
+ 7741
+ 4549
+ 46.03649999999999
+ 7741
+ 0.7154371818821299
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7154371818821299
+ Cosine
+
+
+ 7741
+ 3766
+ -51.99989999999997
+ 7741
+ 0.74114820663649
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.74114820663649
+ Cosine
+
+
+ 26406
+ 7741
+ -15.991000000000042
+ 26406
+ 0.7104716171156424
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7104716171156424
+ Cosine
+
+
+ 13633
+ 7741
+ 18.01509999999996
+ 13633
+ 0.7495427659800147
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7495427659800147
+ Cosine
+
+
+ 7741
+ 7663
+ -68.03069999999997
+ 7741
+ 0.7573029837951863
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7573029837951863
+ Cosine
+
+
+ 7741
+ 1449
+ 182.19930000000005
+ 7741
+ 0.7407467081063229
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7407467081063229
+ Cosine
+
+
+ 7741
+ 4524
+ -67.99489999999997
+ 7741
+ 0.7669785024341733
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7669785024341733
+ Cosine
+
+
+ 7741
+ 5505
+ 60.0523
+ 7741
+ 0.7293527236137134
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7293527236137134
+ Cosine
+
+
+ 7741
+ 7664
+ -102.036
+ 7741
+ 0.7491937023293509
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7491937023293509
+ Cosine
+
+
+ 7741
+ 7665
+ 17.96210000000002
+ 7741
+ 0.745626563152205
+ 7741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.745626563152205
+ Cosine
+
+
+ 10432
+ 7741
+ 39.99939999999998
+ 10432
+ 0.7267417563890028
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7267417563890028
+ Cosine
+
+
+ 20868
+ 7741
+ 50.06329999999997
+ 20868
+ 0.7666512184092706
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666512184092706
+ Cosine
+
+
+ 2526
+ 302
+ -15.99529999999993
+ 2526
+ 0.8483241543578606
+ 2526.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8483241543578606
+ Cosine
+
+
+ 2573
+ 302
+ -15.995499999999993
+ 2573
+ 0.8485105842401559
+ 2573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8485105842401559
+ Cosine
+
+
+ 2628
+ 302
+ -30.01019999999994
+ 2628
+ 0.7916821797360637
+ 2628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7916821797360637
+ Cosine
+
+
+ 15800
+ 3546
+ -15.994700000000023
+ 15800
+ 0.7817084441334194
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7817084441334194
+ Cosine
+
+
+ 15800
+ 2692
+ 87.0351
+ 15800
+ 0.7393912663577968
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7393912663577968
+ Cosine
+
+
+ 15800
+ 4537
+ 50.01589999999999
+ 15800
+ 0.7719323952478938
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7719323952478938
+ Cosine
+
+
+ 15800
+ 1322
+ -15.995100000000036
+ 15800
+ 0.8172255859271971
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8172255859271971
+ Cosine
+
+
+ 15800
+ 4581
+ -1.9798000000000116
+ 15800
+ 0.760378185180544
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.760378185180544
+ Cosine
+
+
+ 15800
+ 1376
+ -30.010800000000017
+ 15800
+ 0.7609240137616035
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7609240137616035
+ Cosine
+
+
+ 15800
+ 4500
+ -1.9791000000000167
+ 15800
+ 0.8232978691252866
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8232978691252866
+ Cosine
+
+
+ 15800
+ 1164
+ -1.97890000000001
+ 15800
+ 0.8431164492693155
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8431164492693155
+ Cosine
+
+
+ 15800
+ 1967
+ 50.0154
+ 15800
+ 0.7564190073277763
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7564190073277763
+ Cosine
+
+
+ 15800
+ 1307
+ -1.9797000000000367
+ 15800
+ 0.7573371015885881
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7573371015885881
+ Cosine
+
+
+ 15800
+ 1361
+ 72.14589999999998
+ 15800
+ 0.8009784565091245
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8009784565091245
+ Cosine
+
+
+ 15800
+ 4587
+ 140.04789999999997
+ 15800
+ 0.7132426437238941
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7132426437238941
+ Cosine
+
+
+ 15800
+ 1173
+ 66.01069999999999
+ 15800
+ 0.7690282771788319
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7690282771788319
+ Cosine
+
+
+ 15800
+ 1240
+ 98.03640000000001
+ 15800
+ 0.7642349615903177
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7642349615903177
+ Cosine
+
+
+ 15800
+ 1296
+ -96.09570000000002
+ 15800
+ 0.7447257044525522
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7447257044525522
+ Cosine
+
+
+ 15800
+ 1335
+ 86.161
+ 15800
+ 0.7618111101612669
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7618111101612669
+ Cosine
+
+
+ 15800
+ 1449
+ 234.199
+ 15800
+ 0.7553252759054714
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553252759054714
+ Cosine
+
+
+ 15800
+ 2486
+ 82.04139999999995
+ 15800
+ 0.7530954520468246
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7530954520468246
+ Cosine
+
+
+ 15800
+ 2544
+ 96.05760000000004
+ 15800
+ 0.7548864073299639
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7548864073299639
+ Cosine
+
+
+ 15800
+ 2651
+ -48.02080000000001
+ 15800
+ 0.7856431270312557
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7856431270312557
+ Cosine
+
+
+ 15800
+ 3766
+ -0.0002000000000066393
+ 15800
+ 0.8113217027065613
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8113217027065613
+ Cosine
+
+
+ 15800
+ 4452
+ 14.0154
+ 15800
+ 0.7568661996005069
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7568661996005069
+ Cosine
+
+
+ 15800
+ 4524
+ -15.995200000000011
+ 15800
+ 0.819855384328007
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.819855384328007
+ Cosine
+
+
+ 15800
+ 4549
+ 98.03619999999995
+ 15800
+ 0.7460012191930722
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7460012191930722
+ Cosine
+
+
+ 15800
+ 4561
+ 92.02709999999996
+ 15800
+ 0.7922908474958144
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7922908474958144
+ Cosine
+
+
+ 15800
+ 4661
+ 84.02159999999998
+ 15800
+ 0.7775160588686607
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7775160588686607
+ Cosine
+
+
+ 15800
+ 4694
+ 108.02119999999996
+ 15800
+ 0.7160817571688121
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7160817571688121
+ Cosine
+
+
+ 15800
+ 5505
+ 112.05199999999996
+ 15800
+ 0.7170221579319435
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7170221579319435
+ Cosine
+
+
+ 15800
+ 7663
+ -16.031000000000006
+ 15800
+ 0.8049762074567792
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8049762074567792
+ Cosine
+
+
+ 15800
+ 7664
+ -50.03630000000004
+ 15800
+ 0.8028375099881336
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8028375099881336
+ Cosine
+
+
+ 15800
+ 7665
+ 69.96179999999998
+ 15800
+ 0.7889903226174295
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7889903226174295
+ Cosine
+
+
+ 15800
+ 7795
+ 86.161
+ 15800
+ 0.7845781413894442
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7845781413894442
+ Cosine
+
+
+ 15800
+ 8321
+ 50.01589999999999
+ 15800
+ 0.7948691325691517
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7948691325691517
+ Cosine
+
+
+ 15800
+ 10432
+ 12.000299999999982
+ 15800
+ 0.7798997990375811
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7798997990375811
+ Cosine
+
+
+ 15800
+ 13590
+ 33.985299999999995
+ 15800
+ 0.8213964988253492
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8213964988253492
+ Cosine
+
+
+ 15800
+ 13633
+ 33.9846
+ 15800
+ 0.8087240378103366
+ 15800.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8087240378103366
+ Cosine
+
+
+ 20868
+ 15800
+ -1.936399999999992
+ 20868
+ 0.8181347275502544
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8181347275502544
+ Cosine
+
+
+ 26406
+ 15800
+ -67.9907
+ 26406
+ 0.7639985801589267
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7639985801589267
+ Cosine
+
+
+ 5042
+ 3530
+ 0.0003999999999564352
+ 5042
+ 0.7976533641382213
+ 5042.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7976533641382213
+ Cosine
+
+
+ 13641
+ 4655
+ 2.015700000000038
+ 13641
+ 0.7199269967173689
+ 13641.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7199269967173689
+ Cosine
+
+
+ 4030
+ 2487
+ -0.00029999999998153726
+ 4030
+ 0.785609653760605
+ 4030.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.785609653760605
+ Cosine
+
+
+ 11270
+ 5175
+ -0.00039999999999906777
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11270
+ 11101
+ 0.00010000000000331966
+ 11270
+ 1.0
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11368
+ 11270
+ 0.00010000000000331966
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11270
+ 208
+ 57.01310000000001
+ 11270
+ 0.702129081776425
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+ Cosine
+
+
+ 11270
+ 11194
+ 0.00010000000000331966
+ 11270
+ 1.0
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11652
+ 11270
+ 0.00039999999999906777
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11270
+ 5194
+ -0.0002000000000066393
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11270
+ 25
+ 50.01089999999999
+ 11270
+ 0.7738824635537842
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+ Cosine
+
+
+ 11346
+ 11270
+ -0.00010000000000331966
+ 11346
+ 1.0
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11270
+ 5148
+ -0.00010000000000331966
+ 11270
+ 0.9087915697477342
+ 11270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 7835
+ 2214
+ -82.00459999999998
+ 7835
+ 0.7180987417961967
+ 7835.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7180987417961967
+ Cosine
+
+
+ 7724
+ 2214
+ -133.97770000000003
+ 7724
+ 0.7009794374884741
+ 7724.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7009794374884741
+ Cosine
+
+
+ 2214
+ 1222
+ -0.0005999999999630745
+ 2214
+ 0.8014134160565736
+ 2214.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8014134160565736
+ Cosine
+
+
+ 4789
+ 2214
+ -114.03050000000007
+ 4789
+ 0.7791600208727472
+ 4789.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7791600208727472
+ Cosine
+
+
+ 13592
+ 2214
+ 2.016300000000001
+ 13592
+ 0.8167228591886702
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8167228591886702
+ Cosine
+
+
+ 13698
+ 2214
+ -96.02089999999998
+ 13698
+ 0.7635908547626653
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7635908547626653
+ Cosine
+
+
+ 1787
+ 1169
+ 240.24469999999997
+ 1787
+ 0.8089668976663382
+ 1787.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8089668976663382
+ Cosine
+
+
+ 1787
+ 1310
+ 2.0159999999999627
+ 1787
+ 0.9252442424948043
+ 1787.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9252442424948043
+ Cosine
+
+
+ 3285
+ 1787
+ -260.2142
+ 3285
+ 0.7920565288964205
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7920565288964205
+ Cosine
+
+
+ 7835
+ 1222
+ -82.00519999999995
+ 7835
+ 0.709539557581635
+ 7835.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.709539557581635
+ Cosine
+
+
+ 13890
+ 1222
+ -84.02049999999997
+ 13890
+ 0.7156837067327453
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7156837067327453
+ Cosine
+
+
+ 13592
+ 1222
+ 2.015700000000038
+ 13592
+ 0.7477499036312675
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7477499036312675
+ Cosine
+
+
+ 13698
+ 1222
+ -96.02149999999995
+ 13698
+ 0.7271309009405365
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7271309009405365
+ Cosine
+
+
+ 7922
+ 7760
+ 51.976699999999994
+ 7922
+ 0.7493273355129844
+ 7922.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7493273355129844
+ Cosine
+
+
+ 7922
+ 3551
+ -82.00100000000003
+ 7922
+ 0.7298147378155309
+ 7922.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7298147378155309
+ Cosine
+
+
+ 4537
+ 2544
+ 46.04170000000005
+ 4537
+ 0.7380919239026524
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7380919239026524
+ Cosine
+
+
+ 4567
+ 2544
+ -15.994699999999966
+ 4567
+ 0.704477122684575
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.704477122684575
+ Cosine
+
+
+ 2544
+ 1322
+ -112.05270000000007
+ 2544
+ 0.7489921009280045
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7489921009280045
+ Cosine
+
+
+ 4581
+ 2544
+ 98.03740000000005
+ 4581
+ 0.7214398478219913
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7214398478219913
+ Cosine
+
+
+ 4500
+ 2544
+ 98.03670000000005
+ 4500
+ 0.8551008002614906
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8551008002614906
+ Cosine
+
+
+ 2544
+ 1164
+ -98.03650000000005
+ 2544
+ 0.8585229058312428
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8585229058312428
+ Cosine
+
+
+ 2544
+ 1967
+ -46.04220000000004
+ 2544
+ 0.7284826966974305
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7284826966974305
+ Cosine
+
+
+ 2544
+ 1307
+ -98.03730000000007
+ 2544
+ 0.7633955088376531
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7633955088376531
+ Cosine
+
+
+ 2544
+ 1361
+ -23.911700000000053
+ 2544
+ 0.7570740316140101
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7570740316140101
+ Cosine
+
+
+ 4452
+ 2544
+ 82.04220000000004
+ 4452
+ 0.7213103171032356
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7213103171032356
+ Cosine
+
+
+ 7795
+ 2544
+ 9.896600000000035
+ 7795
+ 0.7363897619908474
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7363897619908474
+ Cosine
+
+
+ 2544
+ 1335
+ -9.896600000000035
+ 2544
+ 0.7277026380379605
+ 2544.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7277026380379605
+ Cosine
+
+
+ 3747
+ 2544
+ 112.05290000000008
+ 3747
+ 0.7061651010380983
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7061651010380983
+ Cosine
+
+
+ 3766
+ 2544
+ 96.05780000000004
+ 3766
+ 0.7582101984061722
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7582101984061722
+ Cosine
+
+
+ 4524
+ 2544
+ 112.05280000000005
+ 4524
+ 0.8062708443350486
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8062708443350486
+ Cosine
+
+
+ 4549
+ 2544
+ -1.9785999999999149
+ 4549
+ 0.7101893059577633
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101893059577633
+ Cosine
+
+
+ 4561
+ 2544
+ 4.030500000000075
+ 4561
+ 0.7478422360696972
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7478422360696972
+ Cosine
+
+
+ 5505
+ 2544
+ -15.994399999999928
+ 5505
+ 0.7197778369345904
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7197778369345904
+ Cosine
+
+
+ 7663
+ 2544
+ 112.08860000000004
+ 7663
+ 0.7116160179163658
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7116160179163658
+ Cosine
+
+
+ 7664
+ 2544
+ 146.09390000000008
+ 7664
+ 0.7109969803049567
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7109969803049567
+ Cosine
+
+
+ 7665
+ 2544
+ 26.095800000000054
+ 7665
+ 0.7368547245943449
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7368547245943449
+ Cosine
+
+
+ 8321
+ 2544
+ 46.04170000000005
+ 8321
+ 0.7424776185651933
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7424776185651933
+ Cosine
+
+
+ 10432
+ 2544
+ 84.05730000000005
+ 10432
+ 0.7179667346358121
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7179667346358121
+ Cosine
+
+
+ 20868
+ 2544
+ 94.12120000000004
+ 20868
+ 0.7413723397345189
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7413723397345189
+ Cosine
+
+
+ 26406
+ 2544
+ 28.066900000000032
+ 26406
+ 0.7033336176859568
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7033336176859568
+ Cosine
+
+
+ 13602
+ 1967
+ 32.025800000000004
+ 13602
+ 0.7568093433097334
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7568093433097334
+ Cosine
+
+
+ 13602
+ 1173
+ 48.02109999999999
+ 13602
+ 0.7192679648615851
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7192679648615851
+ Cosine
+
+
+ 13602
+ 1335
+ 68.1714
+ 13602
+ 0.7048439651102361
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7048439651102361
+ Cosine
+
+
+ 13602
+ 2651
+ -66.0104
+ 13602
+ 0.7473287193669091
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7473287193669091
+ Cosine
+
+
+ 13602
+ 4561
+ 74.03749999999997
+ 13602
+ 0.7517028681517817
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7517028681517817
+ Cosine
+
+
+ 13602
+ 4694
+ 90.03159999999997
+ 13602
+ 0.7077281953175483
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7077281953175483
+ Cosine
+
+
+ 13602
+ 8321
+ 32.02629999999999
+ 13602
+ 0.7587088605025054
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7587088605025054
+ Cosine
+
+
+ 13602
+ 13590
+ 15.9957
+ 13602
+ 0.7369496786181469
+ 13602.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7369496786181469
+ Cosine
+
+
+ 13633
+ 13602
+ -15.995000000000005
+ 13633
+ 0.7459414766950121
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7459414766950121
+ Cosine
+
+
+ 13592
+ 7835
+ 84.02089999999998
+ 13592
+ 0.736481821868582
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.736481821868582
+ Cosine
+
+
+ 13698
+ 7835
+ -14.016300000000001
+ 13698
+ 0.7578997074075979
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7578997074075979
+ Cosine
+
+
+ 13890
+ 7835
+ -2.0153000000000247
+ 13890
+ 0.7365717636569858
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7365717636569858
+ Cosine
+
+
+ 11346
+ 5175
+ -0.0005000000000023874
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11346
+ 11101
+ 0.0
+ 11346
+ 1.0
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11368
+ 11346
+ 0.0002000000000066393
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11346
+ 208
+ 57.013000000000005
+ 11346
+ 0.702129081776425
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+ Cosine
+
+
+ 11346
+ 11194
+ 0.0
+ 11346
+ 1.0
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11652
+ 11346
+ 0.0005000000000023874
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11346
+ 5194
+ -0.00030000000000995897
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11346
+ 25
+ 50.01079999999999
+ 11346
+ 0.7738824635537842
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+ Cosine
+
+
+ 11346
+ 5148
+ -0.0002000000000066393
+ 11346
+ 0.9087915697477342
+ 11346.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 7732
+ 5505
+ 24.079700000000003
+ 7732
+ 0.7074424704280009
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7074424704280009
+ Cosine
+
+
+ 5505
+ 1322
+ -128.0471
+ 5505
+ 0.7178175153518717
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7178175153518717
+ Cosine
+
+
+ 5505
+ 4581
+ -114.03179999999998
+ 5505
+ 0.7354887266585726
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7354887266585726
+ Cosine
+
+
+ 5505
+ 1361
+ -39.90609999999998
+ 5505
+ 0.7442508097541658
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7442508097541658
+ Cosine
+
+
+ 5505
+ 4587
+ 27.995900000000006
+ 5505
+ 0.7048213922072288
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7048213922072288
+ Cosine
+
+
+ 7795
+ 5505
+ 25.890999999999963
+ 7795
+ 0.7128781011073293
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7128781011073293
+ Cosine
+
+
+ 5505
+ 4549
+ -14.015800000000013
+ 5505
+ 0.728465657121335
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.728465657121335
+ Cosine
+
+
+ 5505
+ 1173
+ -46.04129999999998
+ 5505
+ 0.7104731823627322
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7104731823627322
+ Cosine
+
+
+ 5505
+ 3766
+ -112.05219999999997
+ 5505
+ 0.744497373587699
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.744497373587699
+ Cosine
+
+
+ 26406
+ 5505
+ 44.06129999999996
+ 26406
+ 0.7064145740776412
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7064145740776412
+ Cosine
+
+
+ 13633
+ 5505
+ 78.06739999999996
+ 13633
+ 0.7393173941571789
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7393173941571789
+ Cosine
+
+
+ 5505
+ 1449
+ 122.14700000000005
+ 5505
+ 0.7435029818295574
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7435029818295574
+ Cosine
+
+
+ 7665
+ 5505
+ 42.09019999999998
+ 7665
+ 0.7300539674084
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7300539674084
+ Cosine
+
+
+ 13590
+ 5505
+ 78.06669999999997
+ 13590
+ 0.7419163021891946
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7419163021891946
+ Cosine
+
+
+ 5505
+ 4561
+ -20.024900000000002
+ 5505
+ 0.7851440633438795
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7851440633438795
+ Cosine
+
+
+ 5505
+ 1335
+ -25.890999999999963
+ 5505
+ 0.7075849672525388
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7075849672525388
+ Cosine
+
+
+ 5505
+ 1555
+ -62.036
+ 5505
+ 0.7048616280388553
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7048616280388553
+ Cosine
+
+
+ 5505
+ 4524
+ -128.04719999999998
+ 5505
+ 0.7667207769494101
+ 5505.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7667207769494101
+ Cosine
+
+
+ 8321
+ 5505
+ 62.036099999999976
+ 8321
+ 0.7585235715091996
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7585235715091996
+ Cosine
+
+
+ 13837
+ 1447
+ -9.999999997489795e-05
+ 13837
+ 0.8418061362151604
+ 13837.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8418061362151604
+ Cosine
+
+
+ 5812
+ 31
+ 9.999999997489795e-05
+ 5812
+ 0.8088103418118395
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8088103418118395
+ Cosine
+
+
+ 4573
+ 31
+ 0.0002000000000066393
+ 4573
+ 0.8525644493026685
+ 4573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8525644493026685
+ Cosine
+
+
+ 4605
+ 31
+ 0.0002000000000066393
+ 4605
+ 0.8654175321593224
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8654175321593224
+ Cosine
+
+
+ 144
+ 31
+ -183.07450000000006
+ 144
+ 0.7466063258671614
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7466063258671614
+ Cosine
+
+
+ 5332
+ 31
+ -0.0002000000000066393
+ 5332
+ 0.9038893217453352
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9038893217453352
+ Cosine
+
+
+ 10473
+ 259
+ -148.03859999999997
+ 10473
+ 0.9303156766492804
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9303156766492804
+ Cosine
+
+
+ 28000
+ 259
+ -0.0004999999999881766
+ 28000
+ 0.9688601617875283
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9688601617875283
+ Cosine
+
+
+ 259
+ 9
+ -45.987100000000055
+ 259
+ 0.9094629015767763
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9094629015767763
+ Cosine
+
+
+ 259
+ 6
+ 78.9787
+ 259
+ 0.8014320567830068
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8014320567830068
+ Cosine
+
+
+ 259
+ 39
+ -9.999999997489795e-05
+ 259
+ 0.9320185669648622
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9320185669648622
+ Cosine
+
+
+ 259
+ 58
+ -74.01840000000004
+ 259
+ 0.9231424352876622
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9231424352876622
+ Cosine
+
+
+ 259
+ 144
+ -148.03719999999998
+ 259
+ 0.8894556703011156
+ 259.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8894556703011156
+ Cosine
+
+
+ 1156
+ 259
+ 90.04849999999999
+ 1156
+ 0.8744187177089171
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8744187177089171
+ Cosine
+
+
+ 3521
+ 259
+ -14.016200000000026
+ 3521
+ 0.8887614710882479
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8887614710882479
+ Cosine
+
+
+ 3522
+ 259
+ 16.029800000000023
+ 3522
+ 0.9379852161625506
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9379852161625506
+ Cosine
+
+
+ 5160
+ 259
+ -0.0001999999999497959
+ 5160
+ 0.9764810735522207
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9764810735522207
+ Cosine
+
+
+ 5332
+ 259
+ 331.11150000000004
+ 5332
+ 0.7243173610498788
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7243173610498788
+ Cosine
+
+
+ 7690
+ 7643
+ 196.2203
+ 7690
+ 0.7519810960809139
+ 7690.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7519810960809139
+ Cosine
+
+
+ 3546
+ 2651
+ -32.026099999999985
+ 3546
+ 0.8808349437480676
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8808349437480676
+ Cosine
+
+
+ 7732
+ 2651
+ -135.99309999999997
+ 7732
+ 0.74121828904961
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.74121828904961
+ Cosine
+
+
+ 4537
+ 2651
+ -98.0367
+ 4537
+ 0.9033965552683112
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9033965552683112
+ Cosine
+
+
+ 2651
+ 1322
+ 32.02569999999997
+ 2651
+ 0.7953512722010212
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7953512722010212
+ Cosine
+
+
+ 4581
+ 2651
+ -46.041
+ 4581
+ 0.8284110892248467
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8284110892248467
+ Cosine
+
+
+ 2651
+ 1376
+ 18.00999999999999
+ 2651
+ 0.7888766189924247
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7888766189924247
+ Cosine
+
+
+ 4500
+ 2651
+ -46.04169999999999
+ 4500
+ 0.8505058423377839
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8505058423377839
+ Cosine
+
+
+ 2651
+ 1164
+ 46.0419
+ 2651
+ 0.8393083375672916
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8393083375672916
+ Cosine
+
+
+ 2651
+ 1967
+ 98.03620000000001
+ 2651
+ 0.8990655282270313
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8990655282270313
+ Cosine
+
+
+ 2651
+ 1307
+ 46.04109999999997
+ 2651
+ 0.7820144490221412
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7820144490221412
+ Cosine
+
+
+ 2651
+ 1361
+ 120.16669999999999
+ 2651
+ 0.8005374901845411
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8005374901845411
+ Cosine
+
+
+ 4587
+ 2651
+ -188.06869999999998
+ 4587
+ 0.7596284364956462
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7596284364956462
+ Cosine
+
+
+ 7795
+ 2651
+ -134.1818
+ 7795
+ 0.7613546055814798
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7613546055814798
+ Cosine
+
+
+ 4549
+ 2651
+ -146.05699999999996
+ 4549
+ 0.8240907410764096
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8240907410764096
+ Cosine
+
+
+ 2651
+ 1173
+ 114.0315
+ 2651
+ 0.8433366828124125
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8433366828124125
+ Cosine
+
+
+ 3766
+ 2651
+ -48.0206
+ 3766
+ 0.8094555287107692
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8094555287107692
+ Cosine
+
+
+ 26406
+ 2651
+ -116.01150000000001
+ 26406
+ 0.7877225539190854
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7877225539190854
+ Cosine
+
+
+ 2651
+ 1240
+ 146.05720000000002
+ 2651
+ 0.7539953306178886
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7539953306178886
+ Cosine
+
+
+ 13633
+ 2651
+ -82.00540000000001
+ 13633
+ 0.8478312154403914
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8478312154403914
+ Cosine
+
+
+ 7663
+ 2651
+ -31.989800000000002
+ 7663
+ 0.7785434241988556
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785434241988556
+ Cosine
+
+
+ 4694
+ 2651
+ -156.04199999999997
+ 4694
+ 0.7842413249915663
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7842413249915663
+ Cosine
+
+
+ 7665
+ 2651
+ -117.98259999999999
+ 7665
+ 0.7962448899259598
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7962448899259598
+ Cosine
+
+
+ 10432
+ 2651
+ -60.02109999999999
+ 10432
+ 0.7428840754214225
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7428840754214225
+ Cosine
+
+
+ 2651
+ 2486
+ 130.06219999999996
+ 2651
+ 0.791436045752686
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.791436045752686
+ Cosine
+
+
+ 13590
+ 2651
+ -82.0061
+ 13590
+ 0.8608089673709161
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8608089673709161
+ Cosine
+
+
+ 4561
+ 2651
+ -140.04789999999997
+ 4561
+ 0.8504358592722726
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8504358592722726
+ Cosine
+
+
+ 2651
+ 1335
+ 134.1818
+ 2651
+ 0.7457281536467055
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7457281536467055
+ Cosine
+
+
+ 2651
+ 1555
+ 98.03679999999997
+ 2651
+ 0.8018020849655252
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8018020849655252
+ Cosine
+
+
+ 7664
+ 2651
+ 2.0155000000000314
+ 7664
+ 0.8088380321705324
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8088380321705324
+ Cosine
+
+
+ 20868
+ 2651
+ -49.9572
+ 20868
+ 0.7864505385279323
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7864505385279323
+ Cosine
+
+
+ 2651
+ 1223
+ 82.04159999999996
+ 2651
+ 0.7698929772729828
+ 2651.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7698929772729828
+ Cosine
+
+
+ 3747
+ 2651
+ -32.025499999999965
+ 3747
+ 0.7413662410182501
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7413662410182501
+ Cosine
+
+
+ 4524
+ 2651
+ -32.0256
+ 4524
+ 0.8267091592822178
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8267091592822178
+ Cosine
+
+
+ 4661
+ 2651
+ -132.0424
+ 4661
+ 0.8265321511561059
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8265321511561059
+ Cosine
+
+
+ 8321
+ 2651
+ -98.0367
+ 8321
+ 0.9058132096131649
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9058132096131649
+ Cosine
+
+
+ 13737
+ 2651
+ -73.00119999999998
+ 13737
+ 0.8105628134115304
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8105628134115304
+ Cosine
+
+
+ 10473
+ 3522
+ -164.0684
+ 10473
+ 0.8962861204492923
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8962861204492923
+ Cosine
+
+
+ 28000
+ 3522
+ -16.03030000000001
+ 28000
+ 0.9348537887921984
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9348537887921984
+ Cosine
+
+
+ 4605
+ 3522
+ 315.0821
+ 4605
+ 0.7234965796979789
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7234965796979789
+ Cosine
+
+
+ 3522
+ 9
+ -29.957300000000032
+ 3522
+ 0.907042598815542
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.907042598815542
+ Cosine
+
+
+ 3522
+ 3521
+ 30.04600000000005
+ 3522
+ 0.8646445338991484
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8646445338991484
+ Cosine
+
+
+ 3522
+ 6
+ 95.00850000000003
+ 3522
+ 0.7698400094191002
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7698400094191002
+ Cosine
+
+
+ 3522
+ 39
+ 16.029700000000048
+ 3522
+ 0.9046002136490963
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9046002136490963
+ Cosine
+
+
+ 3522
+ 58
+ -57.98860000000002
+ 3522
+ 0.935735963021777
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.935735963021777
+ Cosine
+
+
+ 3522
+ 144
+ -132.00739999999996
+ 3522
+ 0.9045970545028876
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9045970545028876
+ Cosine
+
+
+ 3522
+ 1156
+ -74.01869999999997
+ 3522
+ 0.909033707816147
+ 3522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.909033707816147
+ Cosine
+
+
+ 5160
+ 3522
+ -16.029999999999973
+ 5160
+ 0.9474264366025622
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9474264366025622
+ Cosine
+
+
+ 5332
+ 3522
+ 315.0817
+ 5332
+ 0.7252414990129397
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7252414990129397
+ Cosine
+
+
+ 13590
+ 3546
+ -49.98000000000002
+ 13590
+ 0.8344522861432693
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8344522861432693
+ Cosine
+
+
+ 13590
+ 4537
+ 16.030599999999993
+ 13590
+ 0.857368746319674
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.857368746319674
+ Cosine
+
+
+ 13590
+ 1322
+ -49.98040000000003
+ 13590
+ 0.7780518560807901
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7780518560807901
+ Cosine
+
+
+ 13590
+ 4581
+ -35.96510000000001
+ 13590
+ 0.7936386031506033
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7936386031506033
+ Cosine
+
+
+ 13590
+ 1376
+ -63.99610000000001
+ 13590
+ 0.7644296370344311
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7644296370344311
+ Cosine
+
+
+ 13590
+ 4500
+ -35.96440000000001
+ 13590
+ 0.8348099103416968
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8348099103416968
+ Cosine
+
+
+ 13590
+ 1164
+ -35.964200000000005
+ 13590
+ 0.8173556480419866
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8173556480419866
+ Cosine
+
+
+ 13590
+ 1967
+ 16.030100000000004
+ 13590
+ 0.851204878753612
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.851204878753612
+ Cosine
+
+
+ 13590
+ 1307
+ -35.96500000000003
+ 13590
+ 0.7697677399280218
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7697677399280218
+ Cosine
+
+
+ 13590
+ 1361
+ 38.16059999999999
+ 13590
+ 0.7857357848215171
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7857357848215171
+ Cosine
+
+
+ 13590
+ 4587
+ 106.06259999999997
+ 13590
+ 0.7640736501407912
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7640736501407912
+ Cosine
+
+
+ 13590
+ 4452
+ -19.969899999999996
+ 13590
+ 0.734722507727239
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.734722507727239
+ Cosine
+
+
+ 13590
+ 7795
+ 52.175700000000006
+ 13590
+ 0.7746049153248122
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7746049153248122
+ Cosine
+
+
+ 13590
+ 4549
+ 64.05089999999996
+ 13590
+ 0.7832270446301923
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7832270446301923
+ Cosine
+
+
+ 13590
+ 1173
+ 32.02539999999999
+ 13590
+ 0.816188578822395
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.816188578822395
+ Cosine
+
+
+ 13590
+ 3766
+ -33.9855
+ 13590
+ 0.7888734289210702
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7888734289210702
+ Cosine
+
+
+ 13590
+ 7648
+ 34.00540000000001
+ 13590
+ 0.7377680751894156
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7377680751894156
+ Cosine
+
+
+ 26406
+ 13590
+ -34.00540000000001
+ 26406
+ 0.7876574927549467
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7876574927549467
+ Cosine
+
+
+ 13590
+ 7845
+ 2.012399999999957
+ 13590
+ 0.7674883905150506
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7674883905150506
+ Cosine
+
+
+ 13590
+ 1240
+ 64.05110000000002
+ 13590
+ 0.7403976883610626
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7403976883610626
+ Cosine
+
+
+ 13633
+ 13590
+ 0.0006999999999948159
+ 13633
+ 0.9366845971618206
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9366845971618206
+ Cosine
+
+
+ 13590
+ 7663
+ -50.0163
+ 13590
+ 0.7697707395625655
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7697707395625655
+ Cosine
+
+
+ 13590
+ 1449
+ 200.21370000000002
+ 13590
+ 0.7638953908791284
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7638953908791284
+ Cosine
+
+
+ 13590
+ 4694
+ 74.03589999999997
+ 13590
+ 0.75296029744039
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.75296029744039
+ Cosine
+
+
+ 13590
+ 7665
+ 35.97649999999999
+ 13590
+ 0.8081089457413406
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8081089457413406
+ Cosine
+
+
+ 13590
+ 10432
+ -21.985000000000014
+ 13590
+ 0.7382416487526563
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7382416487526563
+ Cosine
+
+
+ 13590
+ 1335
+ 52.175700000000006
+ 13590
+ 0.7525388519500529
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7525388519500529
+ Cosine
+
+
+ 13590
+ 1555
+ 16.030699999999968
+ 13590
+ 0.768892312640731
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.768892312640731
+ Cosine
+
+
+ 13590
+ 4524
+ -49.980500000000006
+ 13590
+ 0.8177195750848526
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8177195750848526
+ Cosine
+
+
+ 13590
+ 4561
+ 58.04179999999997
+ 13590
+ 0.8263460053535412
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8263460053535412
+ Cosine
+
+
+ 13590
+ 4661
+ 50.03629999999998
+ 13590
+ 0.7729029924091716
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7729029924091716
+ Cosine
+
+
+ 13590
+ 7664
+ -84.02160000000003
+ 13590
+ 0.8266195687418578
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8266195687418578
+ Cosine
+
+
+ 13590
+ 8321
+ 16.030599999999993
+ 13590
+ 0.8508893407757119
+ 13590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8508893407757119
+ Cosine
+
+
+ 13737
+ 13590
+ 9.00490000000002
+ 13737
+ 0.8072242235825025
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8072242235825025
+ Cosine
+
+
+ 20868
+ 13590
+ 32.0489
+ 20868
+ 0.7743642344827837
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7743642344827837
+ Cosine
+
+
+ 14168
+ 4658
+ 0.00029999999992469384
+ 14168
+ 1.0000000000000009
+ 14168.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000009
+ Cosine
+
+
+ 1232
+ 41
+ 0.0004000000000132786
+ 1232
+ 0.7009207500114989
+ 1232.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7009207500114989
+ Cosine
+
+
+ 4667
+ 4514
+ 0.0004999999999881766
+ 4667
+ 0.8029935162095299
+ 4667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8029935162095299
+ Cosine
+
+
+ 4514
+ 1379
+ -0.0007999999999697138
+ 4514
+ 0.8478609132663604
+ 4514.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8478609132663604
+ Cosine
+
+
+ 9925
+ 1695
+ 50.08840000000001
+ 9925
+ 0.7121348928919904
+ 9925.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7121348928919904
+ Cosine
+
+
+ 9925
+ 4559
+ -0.0001999999999782176
+ 9925
+ 0.8879823377698481
+ 9925.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8879823377698481
+ Cosine
+
+
+ 20624
+ 9925
+ 0.0005999999999914962
+ 20624
+ 0.8472380350510349
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8472380350510349
+ Cosine
+
+
+ 5818
+ 343
+ -74.0353
+ 5818
+ 0.7289099726032551
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7289099726032551
+ Cosine
+
+
+ 5818
+ 1547
+ 2.0160999999999945
+ 5818
+ 0.7420371866678575
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7420371866678575
+ Cosine
+
+
+ 5818
+ 3667
+ 179.08259999999996
+ 5818
+ 0.7253822493843919
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7253822493843919
+ Cosine
+
+
+ 5818
+ 3770
+ 11.05359999999996
+ 5818
+ 0.7683860667302015
+ 5818.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7683860667302015
+ Cosine
+
+
+ 7731
+ 5818
+ -0.00029999999998153726
+ 7731
+ 0.8813712679628389
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8813712679628389
+ Cosine
+
+
+ 10964
+ 5818
+ -13.069299999999998
+ 10964
+ 0.7108028466907734
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7108028466907734
+ Cosine
+
+
+ 4567
+ 1164
+ -114.03120000000001
+ 4567
+ 0.7557383876898784
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7557383876898784
+ Cosine
+
+
+ 4567
+ 1361
+ -39.90640000000002
+ 4567
+ 0.7289775025275822
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7289775025275822
+ Cosine
+
+
+ 4567
+ 4452
+ -98.0369
+ 4567
+ 0.7167064449779637
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7167064449779637
+ Cosine
+
+
+ 4567
+ 4500
+ -114.03140000000002
+ 4567
+ 0.7666678596412394
+ 4567.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666678596412394
+ Cosine
+
+
+ 7663
+ 4567
+ 128.0833
+ 7663
+ 0.715787662952265
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.715787662952265
+ Cosine
+
+
+ 2805
+ 1610
+ 132.07820000000004
+ 2805
+ 0.8044029605805212
+ 2805.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8044029605805212
+ Cosine
+
+
+ 4732
+ 4589
+ 0.00010000000000331966
+ 4732
+ 0.8224674300914043
+ 4732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8224674300914043
+ Cosine
+
+
+ 5217
+ 4589
+ 0.00010000000000331966
+ 5217
+ 0.7984725679490471
+ 5217.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7984725679490471
+ Cosine
+
+
+ 7628
+ 4589
+ -15.995500000000021
+ 7628
+ 0.7280720081356262
+ 7628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7280720081356262
+ Cosine
+
+
+ 7667
+ 4589
+ 2.0152999999999963
+ 7667
+ 0.7553433544395592
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7553433544395592
+ Cosine
+
+
+ 3122
+ 2666
+ -0.0006999999999948159
+ 3122
+ 0.7143324562878193
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7143324562878193
+ Cosine
+
+
+ 3771
+ 2666
+ -0.001599999999996271
+ 3771
+ 0.780506940774978
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.780506940774978
+ Cosine
+
+
+ 3546
+ 1361
+ 88.1406
+ 3546
+ 0.8171648337460478
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8171648337460478
+ Cosine
+
+
+ 2692
+ 1361
+ -14.889200000000017
+ 2692
+ 0.7685058917689218
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7685058917689218
+ Cosine
+
+
+ 7732
+ 1361
+ -15.826399999999978
+ 7732
+ 0.7692230930133516
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7692230930133516
+ Cosine
+
+
+ 4537
+ 1361
+ 22.129999999999995
+ 4537
+ 0.7872982681773756
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872982681773756
+ Cosine
+
+
+ 1361
+ 1322
+ -88.14100000000002
+ 1361
+ 0.8280554500397646
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8280554500397646
+ Cosine
+
+
+ 4581
+ 1361
+ 74.1257
+ 4581
+ 0.7882761945446888
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7882761945446888
+ Cosine
+
+
+ 1376
+ 1361
+ 102.1567
+ 1376
+ 0.7681425900759741
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7681425900759741
+ Cosine
+
+
+ 4500
+ 1361
+ 74.125
+ 4500
+ 0.8609898405346869
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8609898405346869
+ Cosine
+
+
+ 1361
+ 1164
+ -74.1248
+ 1361
+ 0.8400146564105676
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8400146564105676
+ Cosine
+
+
+ 1967
+ 1361
+ 22.130499999999984
+ 1967
+ 0.7670066516485374
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7670066516485374
+ Cosine
+
+
+ 1361
+ 1307
+ -74.12560000000002
+ 1361
+ 0.7665011952582076
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7665011952582076
+ Cosine
+
+
+ 1361
+ 1173
+ -6.1351999999999975
+ 1361
+ 0.7691196647941445
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7691196647941445
+ Cosine
+
+
+ 1361
+ 1223
+ -38.12510000000003
+ 1361
+ 0.7283479472364986
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7283479472364986
+ Cosine
+
+
+ 1361
+ 1240
+ 25.89050000000003
+ 1361
+ 0.7283329292894407
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7283329292894407
+ Cosine
+
+
+ 1361
+ 1296
+ -168.2416
+ 1361
+ 0.7878574368252342
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7878574368252342
+ Cosine
+
+
+ 1361
+ 1335
+ 14.015100000000018
+ 1361
+ 0.8263573753022082
+ 1361.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8263573753022082
+ Cosine
+
+
+ 1449
+ 1361
+ -162.05310000000003
+ 1449
+ 0.7590247492034078
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7590247492034078
+ Cosine
+
+
+ 1555
+ 1361
+ 22.12990000000002
+ 1555
+ 0.7322694253234081
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7322694253234081
+ Cosine
+
+
+ 2486
+ 1361
+ -9.89549999999997
+ 2486
+ 0.7917933963768189
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7917933963768189
+ Cosine
+
+
+ 3766
+ 1361
+ 72.14609999999999
+ 3766
+ 0.8523598473015355
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8523598473015355
+ Cosine
+
+
+ 4452
+ 1361
+ 58.130499999999984
+ 4452
+ 0.7919966964994016
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7919966964994016
+ Cosine
+
+
+ 4524
+ 1361
+ 88.1411
+ 4524
+ 0.8687251868683437
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8687251868683437
+ Cosine
+
+
+ 4549
+ 1361
+ -25.890299999999968
+ 4549
+ 0.7978714786176437
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7978714786176437
+ Cosine
+
+
+ 4561
+ 1361
+ -19.88119999999998
+ 4561
+ 0.8259302481829909
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8259302481829909
+ Cosine
+
+
+ 4587
+ 1361
+ -67.90199999999999
+ 4587
+ 0.7477006346067226
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7477006346067226
+ Cosine
+
+
+ 4661
+ 1361
+ -11.875699999999995
+ 4661
+ 0.8162380166036378
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8162380166036378
+ Cosine
+
+
+ 7663
+ 1361
+ 88.17689999999999
+ 7663
+ 0.7794907921102421
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7794907921102421
+ Cosine
+
+
+ 7664
+ 1361
+ 122.18220000000002
+ 7664
+ 0.7708254372848087
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7708254372848087
+ Cosine
+
+
+ 7665
+ 1361
+ 2.184100000000001
+ 7665
+ 0.8276028043031578
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8276028043031578
+ Cosine
+
+
+ 7795
+ 1361
+ -14.015100000000018
+ 7795
+ 0.7725851203264391
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7725851203264391
+ Cosine
+
+
+ 8321
+ 1361
+ 22.129999999999995
+ 8321
+ 0.8122197321330149
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8122197321330149
+ Cosine
+
+
+ 10432
+ 1361
+ 60.1456
+ 10432
+ 0.8138202756597728
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8138202756597728
+ Cosine
+
+
+ 13633
+ 1361
+ 38.16129999999998
+ 13633
+ 0.7904789435507433
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7904789435507433
+ Cosine
+
+
+ 20868
+ 1361
+ 70.20949999999999
+ 20868
+ 0.8133477983147582
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8133477983147582
+ Cosine
+
+
+ 26406
+ 1361
+ 4.155199999999979
+ 26406
+ 0.8064789432267667
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8064789432267667
+ Cosine
+
+
+ 386
+ 109
+ -172.07319999999993
+ 386
+ 0.787220924688909
+ 386.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.787220924688909
+ Cosine
+
+
+ 1252
+ 386
+ 86.03649999999993
+ 1252
+ 0.8820530753149793
+ 1252.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8820530753149793
+ Cosine
+
+
+ 2644
+ 1580
+ -80.91960000000006
+ 2644
+ 0.7364023872362708
+ 2644.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7364023872362708
+ Cosine
+
+
+ 2644
+ 48
+ 260.20529999999997
+ 2644
+ 0.7461710528841996
+ 2644.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7461710528841996
+ Cosine
+
+
+ 3122
+ 2644
+ 253.02950000000004
+ 3122
+ 0.7243893796662125
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7243893796662125
+ Cosine
+
+
+ 3667
+ 2644
+ 162.05180000000007
+ 3667
+ 0.8382022229079875
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8382022229079875
+ Cosine
+
+
+ 3771
+ 2644
+ 253.02860000000004
+ 3771
+ 0.7578413811572691
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7578413811572691
+ Cosine
+
+
+ 7664
+ 3546
+ 34.04160000000002
+ 7664
+ 0.8318901206495266
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8318901206495266
+ Cosine
+
+
+ 7664
+ 4537
+ 100.05220000000003
+ 7664
+ 0.7991949669838369
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7991949669838369
+ Cosine
+
+
+ 7664
+ 1322
+ 34.0412
+ 7664
+ 0.7946985931633762
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7946985931633762
+ Cosine
+
+
+ 7664
+ 4581
+ 48.05650000000003
+ 7664
+ 0.7808853803358683
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7808853803358683
+ Cosine
+
+
+ 7664
+ 1376
+ 20.025500000000022
+ 7664
+ 0.7872655706389096
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872655706389096
+ Cosine
+
+
+ 7664
+ 4500
+ 48.05720000000002
+ 7664
+ 0.8420003838852146
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8420003838852146
+ Cosine
+
+
+ 7664
+ 1164
+ 48.05740000000003
+ 7664
+ 0.8554967544108696
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8554967544108696
+ Cosine
+
+
+ 7664
+ 1967
+ 100.05170000000004
+ 7664
+ 0.8052878873413405
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8052878873413405
+ Cosine
+
+
+ 7664
+ 1307
+ 48.0566
+ 7664
+ 0.7854153455823205
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7854153455823205
+ Cosine
+
+
+ 7664
+ 4587
+ 190.0842
+ 7664
+ 0.7704647636627133
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7704647636627133
+ Cosine
+
+
+ 7664
+ 4452
+ 64.05170000000004
+ 7664
+ 0.729157668015004
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729157668015004
+ Cosine
+
+
+ 7795
+ 7664
+ -136.19730000000004
+ 7795
+ 0.765070499173973
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765070499173973
+ Cosine
+
+
+ 7664
+ 4549
+ 148.0725
+ 7664
+ 0.7736837679369405
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7736837679369405
+ Cosine
+
+
+ 7664
+ 1173
+ 116.04700000000003
+ 7664
+ 0.7477243618057747
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7477243618057747
+ Cosine
+
+
+ 7664
+ 3766
+ 50.03610000000003
+ 7664
+ 0.7556447500271066
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7556447500271066
+ Cosine
+
+
+ 26406
+ 7664
+ -118.02700000000004
+ 26406
+ 0.7752004279143812
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7752004279143812
+ Cosine
+
+
+ 7664
+ 1240
+ 148.07270000000005
+ 7664
+ 0.7494321685890581
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7494321685890581
+ Cosine
+
+
+ 13633
+ 7664
+ -84.02090000000004
+ 13633
+ 0.840908849046024
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.840908849046024
+ Cosine
+
+
+ 7664
+ 7663
+ 34.005300000000034
+ 7664
+ 0.8070592841748541
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8070592841748541
+ Cosine
+
+
+ 7664
+ 4694
+ 158.0575
+ 7664
+ 0.7131576718315292
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7131576718315292
+ Cosine
+
+
+ 7665
+ 7664
+ -119.99810000000002
+ 7665
+ 0.7737220277174359
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7737220277174359
+ Cosine
+
+
+ 7664
+ 1296
+ -46.05939999999998
+ 7664
+ 0.715994246767248
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.715994246767248
+ Cosine
+
+
+ 10432
+ 7664
+ -62.03660000000002
+ 10432
+ 0.7387152346076689
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7387152346076689
+ Cosine
+
+
+ 7664
+ 2486
+ 132.0777
+ 7664
+ 0.7030493638695241
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7030493638695241
+ Cosine
+
+
+ 7664
+ 4561
+ 142.0634
+ 7664
+ 0.7728092691432258
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7728092691432258
+ Cosine
+
+
+ 7664
+ 1335
+ 136.19730000000004
+ 7664
+ 0.7350382485226502
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7350382485226502
+ Cosine
+
+
+ 7664
+ 1555
+ 100.0523
+ 7664
+ 0.725153344586166
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.725153344586166
+ Cosine
+
+
+ 26328
+ 7664
+ -52.0514
+ 26328
+ 0.7112450173633448
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7112450173633448
+ Cosine
+
+
+ 7664
+ 3747
+ 34.041
+ 7664
+ 0.7110766565590068
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7110766565590068
+ Cosine
+
+
+ 7664
+ 4524
+ 34.04110000000003
+ 7664
+ 0.8229096549140043
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8229096549140043
+ Cosine
+
+
+ 7664
+ 4661
+ 134.05790000000002
+ 7664
+ 0.7550091000431389
+ 7664.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7550091000431389
+ Cosine
+
+
+ 8321
+ 7664
+ -100.05220000000003
+ 8321
+ 0.7767489606757378
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7767489606757378
+ Cosine
+
+
+ 13737
+ 7664
+ -75.01670000000001
+ 13737
+ 0.7164096305867623
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7164096305867623
+ Cosine
+
+
+ 20868
+ 7664
+ -51.97270000000003
+ 20868
+ 0.8269622619962195
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8269622619962195
+ Cosine
+
+
+ 4581
+ 3546
+ -14.014900000000011
+ 4581
+ 0.8231759443384052
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8231759443384052
+ Cosine
+
+
+ 4581
+ 2692
+ 89.01490000000001
+ 4581
+ 0.7679769742484848
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7679769742484848
+ Cosine
+
+
+ 7732
+ 4581
+ -89.95209999999997
+ 7732
+ 0.7577198720980131
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7577198720980131
+ Cosine
+
+
+ 4581
+ 4537
+ 51.9957
+ 4581
+ 0.7862130256746303
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7862130256746303
+ Cosine
+
+
+ 4581
+ 1322
+ -14.015300000000025
+ 4581
+ 0.8026526235497524
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8026526235497524
+ Cosine
+
+
+ 4581
+ 1164
+ 0.0009000000000014552
+ 4581
+ 0.8319828843555295
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8319828843555295
+ Cosine
+
+
+ 4581
+ 1173
+ 67.9905
+ 4581
+ 0.781687542894947
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.781687542894947
+ Cosine
+
+
+ 4581
+ 1296
+ -94.11590000000001
+ 4581
+ 0.7216421614779343
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7216421614779343
+ Cosine
+
+
+ 4581
+ 1307
+ 9.999999997489795e-05
+ 4581
+ 0.7828413681020232
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7828413681020232
+ Cosine
+
+
+ 4581
+ 1335
+ 88.14080000000001
+ 4581
+ 0.7870432242141118
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7870432242141118
+ Cosine
+
+
+ 4581
+ 1376
+ -28.031000000000006
+ 4581
+ 0.7291106603049144
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7291106603049144
+ Cosine
+
+
+ 4581
+ 1449
+ 236.17880000000002
+ 4581
+ 0.738148506310631
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.738148506310631
+ Cosine
+
+
+ 4581
+ 1555
+ 51.995799999999974
+ 4581
+ 0.7623125846284046
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7623125846284046
+ Cosine
+
+
+ 4581
+ 1967
+ 51.99520000000001
+ 4581
+ 0.817622370066687
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.817622370066687
+ Cosine
+
+
+ 4581
+ 2486
+ 84.02119999999996
+ 4581
+ 0.7722998889642271
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7722998889642271
+ Cosine
+
+
+ 4581
+ 2541
+ 37.98009999999999
+ 4581
+ 0.7186515874440732
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7186515874440732
+ Cosine
+
+
+ 4581
+ 3747
+ -14.015500000000031
+ 4581
+ 0.7556089755347806
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7556089755347806
+ Cosine
+
+
+ 4581
+ 3766
+ 1.979600000000005
+ 4581
+ 0.8202170382200697
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8202170382200697
+ Cosine
+
+
+ 4581
+ 4500
+ 0.0006999999999948159
+ 4581
+ 0.8379502358167299
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8379502358167299
+ Cosine
+
+
+ 4581
+ 4524
+ -14.0154
+ 4581
+ 0.8381863845599669
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8381863845599669
+ Cosine
+
+
+ 4581
+ 4549
+ 100.01599999999996
+ 4581
+ 0.7859074732898833
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7859074732898833
+ Cosine
+
+
+ 4581
+ 4561
+ 94.00689999999997
+ 4581
+ 0.7922611253991393
+ 4581.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7922611253991393
+ Cosine
+
+
+ 4661
+ 4581
+ -86.00139999999999
+ 4661
+ 0.7786524353119546
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7786524353119546
+ Cosine
+
+
+ 4694
+ 4581
+ -110.00099999999998
+ 4694
+ 0.758534878542366
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.758534878542366
+ Cosine
+
+
+ 7663
+ 4581
+ 14.051199999999994
+ 7663
+ 0.7831903486775904
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7831903486775904
+ Cosine
+
+
+ 7665
+ 4581
+ -71.9416
+ 7665
+ 0.7885793717295513
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7885793717295513
+ Cosine
+
+
+ 7795
+ 4581
+ -88.14080000000001
+ 7795
+ 0.781492890949427
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.781492890949427
+ Cosine
+
+
+ 8321
+ 4581
+ -51.9957
+ 8321
+ 0.827488185408775
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.827488185408775
+ Cosine
+
+
+ 10432
+ 4581
+ -13.980099999999993
+ 10432
+ 0.7579277293284082
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7579277293284082
+ Cosine
+
+
+ 13633
+ 4581
+ -35.96440000000001
+ 13633
+ 0.7945291422001121
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7945291422001121
+ Cosine
+
+
+ 20868
+ 4581
+ -3.9162000000000035
+ 20868
+ 0.7837196583215753
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7837196583215753
+ Cosine
+
+
+ 26406
+ 4581
+ -69.97050000000002
+ 26406
+ 0.7846355791306435
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7846355791306435
+ Cosine
+
+
+ 7811
+ 1322
+ -33.98380000000003
+ 7811
+ 0.7397234663827941
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7397234663827941
+ Cosine
+
+
+ 7811
+ 1376
+ -47.99950000000001
+ 7811
+ 0.734282344348196
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.734282344348196
+ Cosine
+
+
+ 7811
+ 3766
+ -17.9889
+ 7811
+ 0.7472857571605862
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7472857571605862
+ Cosine
+
+
+ 7811
+ 4524
+ -33.983900000000006
+ 7811
+ 0.7832726734441438
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7832726734441438
+ Cosine
+
+
+ 7811
+ 7795
+ 68.1723
+ 7811
+ 0.7106377265045603
+ 7811.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7106377265045603
+ Cosine
+
+
+ 10432
+ 7811
+ 5.988400000000013
+ 10432
+ 0.7307086938140607
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7307086938140607
+ Cosine
+
+
+ 20868
+ 7811
+ 16.052300000000002
+ 20868
+ 0.741172357027142
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741172357027142
+ Cosine
+
+
+ 5217
+ 4732
+ 0.0
+ 5217
+ 0.7345777407422028
+ 5217.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7345777407422028
+ Cosine
+
+
+ 7667
+ 5217
+ 2.015199999999993
+ 7667
+ 0.7338379215757613
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7338379215757613
+ Cosine
+
+
+ 13890
+ 13592
+ -86.03620000000001
+ 13890
+ 0.755609446510469
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.755609446510469
+ Cosine
+
+
+ 13890
+ 13698
+ 12.000999999999976
+ 13890
+ 0.7472274076915648
+ 13890.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7472274076915648
+ Cosine
+
+
+ 13633
+ 7648
+ 34.0061
+ 13633
+ 0.7779826197662838
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7779826197662838
+ Cosine
+
+
+ 13737
+ 7648
+ 43.01030000000003
+ 13737
+ 0.716578852217014
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.716578852217014
+ Cosine
+
+
+ 5997
+ 5874
+ -0.00010000000000331966
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5997
+ 5846
+ 1.9842000000000013
+ 5997
+ 0.7218154561616537
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 5997
+ 5889
+ 0.0
+ 5997
+ 0.8713460865906011
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 5997
+ 5935
+ 0.0
+ 5997
+ 0.9999999999999993
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5997
+ 5975
+ 0.0
+ 5997
+ 0.8840320085106907
+ 5997.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 6019
+ 5997
+ 0.00010000000000331966
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6038
+ 5997
+ 0.0
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 13592
+ 7724
+ 135.99400000000003
+ 13592
+ 0.7433277454961199
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7433277454961199
+ Cosine
+
+
+ 13592
+ 4789
+ 116.04680000000008
+ 13592
+ 0.7459585145759681
+ 13592.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7459585145759681
+ Cosine
+
+
+ 13698
+ 13592
+ -98.03719999999998
+ 13698
+ 0.8294730962660306
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8294730962660306
+ Cosine
+
+
+ 10432
+ 3546
+ -27.995000000000005
+ 10432
+ 0.7800294577095632
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7800294577095632
+ Cosine
+
+
+ 10432
+ 2692
+ 75.03480000000002
+ 10432
+ 0.7504259074683242
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7504259074683242
+ Cosine
+
+
+ 10432
+ 7732
+ 75.97199999999998
+ 10432
+ 0.7182422122216472
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7182422122216472
+ Cosine
+
+
+ 10432
+ 4537
+ 38.015600000000006
+ 10432
+ 0.743297873001513
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.743297873001513
+ Cosine
+
+
+ 10432
+ 1322
+ -27.995400000000018
+ 10432
+ 0.8360368078578365
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8360368078578365
+ Cosine
+
+
+ 10432
+ 1376
+ -42.0111
+ 10432
+ 0.7668835802937255
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7668835802937255
+ Cosine
+
+
+ 10432
+ 4500
+ -13.979399999999998
+ 10432
+ 0.7938872586506811
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7938872586506811
+ Cosine
+
+
+ 10432
+ 1164
+ -13.979199999999992
+ 10432
+ 0.8157201140382684
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8157201140382684
+ Cosine
+
+
+ 10432
+ 1307
+ -13.980000000000018
+ 10432
+ 0.802712904013203
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.802712904013203
+ Cosine
+
+
+ 10432
+ 4587
+ 128.0476
+ 10432
+ 0.7259218685188313
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7259218685188313
+ Cosine
+
+
+ 10432
+ 4452
+ 2.015100000000018
+ 10432
+ 0.7307902938064268
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7307902938064268
+ Cosine
+
+
+ 10432
+ 7795
+ 74.16070000000002
+ 10432
+ 0.7841609028504847
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7841609028504847
+ Cosine
+
+
+ 10432
+ 4549
+ 86.03589999999997
+ 10432
+ 0.70653631172389
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.70653631172389
+ Cosine
+
+
+ 10432
+ 3766
+ -12.000499999999988
+ 10432
+ 0.831534889680259
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.831534889680259
+ Cosine
+
+
+ 26406
+ 10432
+ -55.99040000000002
+ 26406
+ 0.776802803585593
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.776802803585593
+ Cosine
+
+
+ 13633
+ 10432
+ -21.98430000000002
+ 13633
+ 0.7663081269078061
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7663081269078061
+ Cosine
+
+
+ 10432
+ 7663
+ -28.031299999999987
+ 10432
+ 0.7680697334030612
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7680697334030612
+ Cosine
+
+
+ 10432
+ 1449
+ 222.19870000000003
+ 10432
+ 0.7451911421485573
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7451911421485573
+ Cosine
+
+
+ 10432
+ 4694
+ 96.02089999999998
+ 10432
+ 0.7164599640017755
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7164599640017755
+ Cosine
+
+
+ 10432
+ 7665
+ 57.9615
+ 10432
+ 0.8002128417720337
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8002128417720337
+ Cosine
+
+
+ 10432
+ 1296
+ -108.096
+ 10432
+ 0.7833979394241086
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7833979394241086
+ Cosine
+
+
+ 10432
+ 1335
+ 74.16070000000002
+ 10432
+ 0.7330413905540722
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7330413905540722
+ Cosine
+
+
+ 10432
+ 2486
+ 70.04109999999997
+ 10432
+ 0.763470342041401
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.763470342041401
+ Cosine
+
+
+ 10432
+ 4524
+ -27.995499999999993
+ 10432
+ 0.8211058457805318
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8211058457805318
+ Cosine
+
+
+ 10432
+ 4561
+ 80.02679999999998
+ 10432
+ 0.7537950697607304
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7537950697607304
+ Cosine
+
+
+ 10432
+ 4661
+ 72.0213
+ 10432
+ 0.7875069371714507
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7875069371714507
+ Cosine
+
+
+ 10432
+ 8321
+ 38.015600000000006
+ 10432
+ 0.7531431992071737
+ 10432.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7531431992071737
+ Cosine
+
+
+ 20868
+ 10432
+ 10.06389999999999
+ 20868
+ 0.8151760932215513
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8151760932215513
+ Cosine
+
+
+ 1580
+ 48
+ 341.1249
+ 1580
+ 0.778336930769878
+ 1580.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.778336930769878
+ Cosine
+
+
+ 1580
+ 311
+ -188.10629999999998
+ 1580
+ 0.7152694178476485
+ 1580.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7152694178476485
+ Cosine
+
+
+ 3122
+ 1580
+ 172.10989999999998
+ 3122
+ 0.7380435073334306
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7380435073334306
+ Cosine
+
+
+ 3667
+ 1580
+ 81.13220000000001
+ 3667
+ 0.7456173656608622
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7456173656608622
+ Cosine
+
+
+ 3771
+ 1580
+ 172.10899999999998
+ 3771
+ 0.7858113611939106
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7858113611939106
+ Cosine
+
+
+ 4452
+ 3546
+ -30.010100000000023
+ 4452
+ 0.7698087052034195
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7698087052034195
+ Cosine
+
+
+ 4452
+ 2692
+ 73.0197
+ 4452
+ 0.7169479390641451
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7169479390641451
+ Cosine
+
+
+ 4452
+ 1322
+ -30.010500000000036
+ 4452
+ 0.763665284992833
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.763665284992833
+ Cosine
+
+
+ 4452
+ 1376
+ -44.02620000000002
+ 4452
+ 0.7053367136416187
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7053367136416187
+ Cosine
+
+
+ 4500
+ 4452
+ 15.994500000000016
+ 4500
+ 0.7883756460519822
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7883756460519822
+ Cosine
+
+
+ 4452
+ 1164
+ -15.99430000000001
+ 4452
+ 0.7997197887545953
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7997197887545953
+ Cosine
+
+
+ 4452
+ 1307
+ -15.995100000000036
+ 4452
+ 0.7109773573289969
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7109773573289969
+ Cosine
+
+
+ 4452
+ 1240
+ 84.02100000000002
+ 4452
+ 0.7002212742104246
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7002212742104246
+ Cosine
+
+
+ 4452
+ 1296
+ -110.11110000000002
+ 4452
+ 0.7219922955841758
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7219922955841758
+ Cosine
+
+
+ 4452
+ 1335
+ 72.1456
+ 4452
+ 0.7404435380373051
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7404435380373051
+ Cosine
+
+
+ 4452
+ 1449
+ 220.1836
+ 4452
+ 0.7043535533077931
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7043535533077931
+ Cosine
+
+
+ 4452
+ 3766
+ -14.015600000000006
+ 4452
+ 0.7478053322709437
+ 4452.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7478053322709437
+ Cosine
+
+
+ 4524
+ 4452
+ 30.01060000000001
+ 4524
+ 0.780104592449151
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.780104592449151
+ Cosine
+
+
+ 7663
+ 4452
+ 30.046400000000006
+ 7663
+ 0.7532935202501063
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7532935202501063
+ Cosine
+
+
+ 7665
+ 4452
+ -55.94639999999998
+ 7665
+ 0.7942091103279474
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7942091103279474
+ Cosine
+
+
+ 7795
+ 4452
+ -72.1456
+ 7795
+ 0.7370779717117724
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7370779717117724
+ Cosine
+
+
+ 13633
+ 4452
+ -19.9692
+ 13633
+ 0.7574644019031742
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7574644019031742
+ Cosine
+
+
+ 20868
+ 4452
+ 12.079000000000008
+ 20868
+ 0.7748789104923365
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7748789104923365
+ Cosine
+
+
+ 26406
+ 4452
+ -53.975300000000004
+ 26406
+ 0.7732940560875348
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7732940560875348
+ Cosine
+
+
+ 7979
+ 11
+ 2.067700000000002
+ 7979
+ 0.7206564776894646
+ 7979.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206564776894646
+ Cosine
+
+
+ 4539
+ 11
+ 2.0159999999999627
+ 4539
+ 0.8378790961652245
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8378790961652245
+ Cosine
+
+
+ 3667
+ 11
+ -134.9676
+ 3667
+ 0.7038183969668554
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7038183969668554
+ Cosine
+
+
+ 3771
+ 11
+ -43.990800000000036
+ 3771
+ 0.7133850001344928
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7133850001344928
+ Cosine
+
+
+ 1547
+ 11
+ 42.09889999999996
+ 1547
+ 0.7343324286248336
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7343324286248336
+ Cosine
+
+
+ 3122
+ 11
+ -43.989900000000034
+ 3122
+ 0.7034548687446786
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7034548687446786
+ Cosine
+
+
+ 7731
+ 11
+ 44.11469999999997
+ 7731
+ 0.7012606554256817
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7012606554256817
+ Cosine
+
+
+ 10473
+ 39
+ -148.03869999999995
+ 10473
+ 0.9005206716379817
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9005206716379817
+ Cosine
+
+
+ 28000
+ 39
+ -0.0005999999999630745
+ 28000
+ 0.947019197557845
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.947019197557845
+ Cosine
+
+
+ 39
+ 9
+ -45.98700000000008
+ 39
+ 0.9094719150125461
+ 39.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9094719150125461
+ Cosine
+
+
+ 3521
+ 39
+ -14.016300000000001
+ 3521
+ 0.8938549746348798
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8938549746348798
+ Cosine
+
+
+ 5160
+ 39
+ -0.00029999999992469384
+ 5160
+ 0.9501235294786219
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9501235294786219
+ Cosine
+
+
+ 39
+ 6
+ 78.97879999999998
+ 39
+ 0.7949506854742541
+ 39.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7949506854742541
+ Cosine
+
+
+ 1156
+ 39
+ 90.04840000000002
+ 1156
+ 0.8472027927046718
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8472027927046718
+ Cosine
+
+
+ 58
+ 39
+ 74.01830000000007
+ 58
+ 0.9034518644888905
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9034518644888905
+ Cosine
+
+
+ 144
+ 39
+ 148.0371
+ 144
+ 0.8409521677005969
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8409521677005969
+ Cosine
+
+
+ 1275
+ 1255
+ -18.010500000000036
+ 1275
+ 0.840841262832233
+ 1275.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.840841262832233
+ Cosine
+
+
+ 1547
+ 1474
+ -27.99350000000004
+ 1547
+ 0.7855350897988105
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7855350897988105
+ Cosine
+
+
+ 3667
+ 1547
+ -177.06649999999996
+ 3667
+ 0.7184844576850267
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7184844576850267
+ Cosine
+
+
+ 10964
+ 1547
+ -11.053200000000004
+ 10964
+ 0.8146634401978005
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8146634401978005
+ Cosine
+
+
+ 1547
+ 1068
+ -76.0514
+ 1547
+ 0.7136944426789613
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7136944426789613
+ Cosine
+
+
+ 1547
+ 914
+ -76.0514
+ 1547
+ 0.8149847224196799
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8149847224196799
+ Cosine
+
+
+ 1547
+ 343
+ -76.0514
+ 1547
+ 0.8484821256387172
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8484821256387172
+ Cosine
+
+
+ 10446
+ 1547
+ -68.07829999999996
+ 10446
+ 0.7462147237942737
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7462147237942737
+ Cosine
+
+
+ 3770
+ 1547
+ -9.037499999999966
+ 3770
+ 0.7050694420053412
+ 3770.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7050694420053412
+ Cosine
+
+
+ 2575
+ 1547
+ -54.099699999999984
+ 2575
+ 0.7664665737547884
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7664665737547884
+ Cosine
+
+
+ 7731
+ 1547
+ 2.015800000000013
+ 7731
+ 0.840921789945926
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.840921789945926
+ Cosine
+
+
+ 1547
+ 1220
+ -62.03620000000001
+ 1547
+ 0.7239945726436752
+ 1547.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7239945726436752
+ Cosine
+
+
+ 13626
+ 1244
+ -0.0003999999999564352
+ 13626
+ 0.8890215278311255
+ 13626.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8890215278311255
+ Cosine
+
+
+ 13626
+ 5524
+ -16.031499999999994
+ 13626
+ 0.7140866836709849
+ 13626.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7140866836709849
+ Cosine
+
+
+ 2573
+ 2526
+ -0.00020000000006348273
+ 2573
+ 0.9674734186781916
+ 2573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9674734186781916
+ Cosine
+
+
+ 2628
+ 2573
+ -14.014699999999948
+ 2628
+ 0.8796890853500932
+ 2628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8796890853500932
+ Cosine
+
+
+ 10258
+ 10240
+ -15.994699999999966
+ 10258
+ 0.8482118260962055
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8482118260962055
+ Cosine
+
+
+ 10240
+ 4775
+ -98.05290000000008
+ 10240
+ 0.784567695841486
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.784567695841486
+ Cosine
+
+
+ 10240
+ 4584
+ -98.03740000000005
+ 10240
+ 0.8913556173779417
+ 10240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8913556173779417
+ Cosine
+
+
+ 1310
+ 1169
+ 238.2287
+ 1310
+ 0.8169155911780275
+ 1310.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8169155911780275
+ Cosine
+
+
+ 1169
+ 73
+ -4.025800000000004
+ 1169
+ 0.8066861025543268
+ 1169.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8066861025543268
+ Cosine
+
+
+ 3285
+ 1169
+ -19.96950000000004
+ 3285
+ 0.9869130873391039
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9869130873391039
+ Cosine
+
+
+ 5846
+ 208
+ 13.007000000000005
+ 5846
+ 0.7000361364435104
+ 5846.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7000361364435104
+ Cosine
+
+
+ 5874
+ 5846
+ 1.9843000000000046
+ 5874
+ 0.7218154561616537
+ 5874.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 5846
+ 25
+ 6.004799999999989
+ 5846
+ 0.7461204215352448
+ 5846.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7461204215352448
+ Cosine
+
+
+ 5889
+ 5846
+ 1.9842000000000013
+ 5889
+ 0.8116818213763026
+ 5889.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8116818213763026
+ Cosine
+
+
+ 5935
+ 5846
+ 1.9842000000000013
+ 5935
+ 0.7218154561616537
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 5975
+ 5846
+ 1.9842000000000013
+ 5975
+ 0.7055845086886054
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7055845086886054
+ Cosine
+
+
+ 6019
+ 5846
+ 1.9843000000000046
+ 6019
+ 0.7218154561616537
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 6038
+ 5846
+ 1.9842000000000013
+ 6038
+ 0.7218154561616537
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7218154561616537
+ Cosine
+
+
+ 3285
+ 73
+ -23.995300000000043
+ 3285
+ 0.8024511008845483
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8024511008845483
+ Cosine
+
+
+ 4516
+ 1158
+ 27.996399999999994
+ 4516
+ 0.9092425255126506
+ 4516.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9092425255126506
+ Cosine
+
+
+ 4548
+ 4516
+ -132.0435
+ 4548
+ 0.8276041447912992
+ 4548.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8276041447912992
+ Cosine
+
+
+ 2628
+ 2526
+ -14.014900000000011
+ 2628
+ 0.8925010926543242
+ 2628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8925010926543242
+ Cosine
+
+
+ 10473
+ 5160
+ -148.03840000000002
+ 10473
+ 0.9474182676741132
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9474182676741132
+ Cosine
+
+
+ 28000
+ 5160
+ -0.0003000000000383807
+ 28000
+ 0.9807375043674307
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9807375043674307
+ Cosine
+
+
+ 5160
+ 9
+ -45.987300000000005
+ 5160
+ 0.923601850330019
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.923601850330019
+ Cosine
+
+
+ 5160
+ 3521
+ 14.016000000000076
+ 5160
+ 0.9117410813495535
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9117410813495535
+ Cosine
+
+
+ 5160
+ 6
+ 78.97850000000005
+ 5160
+ 0.8234686033894387
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8234686033894387
+ Cosine
+
+
+ 5160
+ 58
+ -74.01859999999999
+ 5160
+ 0.9298566999766009
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9298566999766009
+ Cosine
+
+
+ 5160
+ 144
+ -148.03739999999993
+ 5160
+ 0.8926616243891328
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8926616243891328
+ Cosine
+
+
+ 5160
+ 1156
+ -90.04869999999994
+ 5160
+ 0.8908592618992064
+ 5160.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8908592618992064
+ Cosine
+
+
+ 5332
+ 5160
+ 331.1117
+ 5332
+ 0.7147297591000332
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7147297591000332
+ Cosine
+
+
+ 5889
+ 5874
+ -0.00010000000000331966
+ 5889
+ 0.8713460865906011
+ 5889.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 5935
+ 5874
+ -0.00010000000000331966
+ 5935
+ 0.9999999999999993
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 5975
+ 5874
+ -0.00010000000000331966
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 6019
+ 5874
+ 0.0
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6038
+ 5874
+ -0.00010000000000331966
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 9385
+ 3700
+ -32.026700000000005
+ 9385
+ 0.741200267986588
+ 9385.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.741200267986588
+ Cosine
+
+
+ 5273
+ 1165
+ 31.989899999999977
+ 5273
+ 0.7716626598358503
+ 5273.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7716626598358503
+ Cosine
+
+
+ 4504
+ 1165
+ -14.015800000000013
+ 4504
+ 0.8679075054113705
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8679075054113705
+ Cosine
+
+
+ 1165
+ 1162
+ 179.07930000000005
+ 1165
+ 0.8486082288748873
+ 1165.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8486082288748873
+ Cosine
+
+
+ 4507
+ 1165
+ -0.0003000000000383807
+ 4507
+ 0.9217442025600888
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9217442025600888
+ Cosine
+
+
+ 1196
+ 1165
+ -17.02600000000001
+ 1196
+ 0.894385633991355
+ 1196.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.894385633991355
+ Cosine
+
+
+ 2478
+ 1165
+ -14.014800000000037
+ 2478
+ 0.8454304090256399
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8454304090256399
+ Cosine
+
+
+ 4524
+ 3546
+ 0.0004999999999881766
+ 4524
+ 0.8526162530338657
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8526162530338657
+ Cosine
+
+
+ 4524
+ 2692
+ 103.03030000000001
+ 4524
+ 0.7592621530411521
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7592621530411521
+ Cosine
+
+
+ 7732
+ 4524
+ -103.96749999999997
+ 7732
+ 0.7659931904879267
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7659931904879267
+ Cosine
+
+
+ 4537
+ 4524
+ -66.0111
+ 4537
+ 0.8025287383376064
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8025287383376064
+ Cosine
+
+
+ 4524
+ 1322
+ 9.999999997489795e-05
+ 4524
+ 0.8609097183501437
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8609097183501437
+ Cosine
+
+
+ 4524
+ 1376
+ -14.015600000000006
+ 4524
+ 0.7819135910509369
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7819135910509369
+ Cosine
+
+
+ 4524
+ 4500
+ 14.016099999999994
+ 4524
+ 0.8940489178711453
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8940489178711453
+ Cosine
+
+
+ 4524
+ 1164
+ 14.016300000000001
+ 4524
+ 0.8836221442183508
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8836221442183508
+ Cosine
+
+
+ 4524
+ 1967
+ 66.01060000000001
+ 4524
+ 0.8002907267611696
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8002907267611696
+ Cosine
+
+
+ 4524
+ 1307
+ 14.015499999999975
+ 4524
+ 0.7828746858469581
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7828746858469581
+ Cosine
+
+
+ 4587
+ 4524
+ -156.04309999999998
+ 4587
+ 0.7996173966243616
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7996173966243616
+ Cosine
+
+
+ 7795
+ 4524
+ -102.15620000000001
+ 7795
+ 0.8328203085201809
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8328203085201809
+ Cosine
+
+
+ 4549
+ 4524
+ -114.03139999999996
+ 4549
+ 0.8231046078027471
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8231046078027471
+ Cosine
+
+
+ 4524
+ 1173
+ 82.0059
+ 4524
+ 0.7928927940532007
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7928927940532007
+ Cosine
+
+
+ 4524
+ 3766
+ 15.995000000000005
+ 4524
+ 0.8690750294209248
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8690750294209248
+ Cosine
+
+
+ 26406
+ 4524
+ -83.98590000000002
+ 26406
+ 0.8570752791224555
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8570752791224555
+ Cosine
+
+
+ 13633
+ 4524
+ -49.97980000000001
+ 13633
+ 0.8344660722616974
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8344660722616974
+ Cosine
+
+
+ 7663
+ 4524
+ 0.035799999999994725
+ 7663
+ 0.818986218991886
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.818986218991886
+ Cosine
+
+
+ 4524
+ 1449
+ 250.19420000000002
+ 4524
+ 0.7748279491969332
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7748279491969332
+ Cosine
+
+
+ 7665
+ 4524
+ -85.957
+ 7665
+ 0.8459820377728133
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8459820377728133
+ Cosine
+
+
+ 4524
+ 1296
+ -80.10050000000001
+ 4524
+ 0.7906543683310474
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7906543683310474
+ Cosine
+
+
+ 4524
+ 2486
+ 98.03659999999996
+ 4524
+ 0.7732261000303422
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7732261000303422
+ Cosine
+
+
+ 4561
+ 4524
+ -108.02229999999997
+ 4561
+ 0.7990905614665766
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7990905614665766
+ Cosine
+
+
+ 4524
+ 1335
+ 102.15620000000001
+ 4524
+ 0.8241617876651458
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8241617876651458
+ Cosine
+
+
+ 20868
+ 4524
+ -17.931600000000003
+ 20868
+ 0.8692609279917556
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8692609279917556
+ Cosine
+
+
+ 13737
+ 4524
+ -40.975599999999986
+ 13737
+ 0.7820742092996067
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7820742092996067
+ Cosine
+
+
+ 4524
+ 3747
+ -0.00010000000003174137
+ 4524
+ 0.7431549228848245
+ 4524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7431549228848245
+ Cosine
+
+
+ 4661
+ 4524
+ -100.01679999999999
+ 4661
+ 0.8167678735678996
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8167678735678996
+ Cosine
+
+
+ 8321
+ 4524
+ -66.0111
+ 8321
+ 0.8096289076753352
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8096289076753352
+ Cosine
+
+
+ 4522
+ 2665
+ -0.0006000000000199179
+ 4522
+ 0.8002020487684565
+ 4522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8002020487684565
+ Cosine
+
+
+ 4522
+ 3527
+ 42.00999999999999
+ 4522
+ 0.7393882462638258
+ 4522.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7393882462638258
+ Cosine
+
+
+ 2931
+ 1581
+ -0.00010000000003174137
+ 2931
+ 0.7988154807483048
+ 2931.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7988154807483048
+ Cosine
+
+
+ 10324
+ 2931
+ -9.999999997489795e-05
+ 10324
+ 0.7201283644248563
+ 10324.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7201283644248563
+ Cosine
+
+
+ 10473
+ 3521
+ -134.02239999999995
+ 10473
+ 0.8758029209484876
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8758029209484876
+ Cosine
+
+
+ 28000
+ 3521
+ 14.015700000000038
+ 28000
+ 0.9024803365749979
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9024803365749979
+ Cosine
+
+
+ 3521
+ 9
+ -60.00330000000008
+ 3521
+ 0.8999161402653517
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8999161402653517
+ Cosine
+
+
+ 3521
+ 6
+ 64.96249999999998
+ 3521
+ 0.7526595077304954
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7526595077304954
+ Cosine
+
+
+ 3521
+ 58
+ -88.03460000000007
+ 3521
+ 0.8367123751742471
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367123751742471
+ Cosine
+
+
+ 3521
+ 144
+ -162.0534
+ 3521
+ 0.8059475603021353
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8059475603021353
+ Cosine
+
+
+ 3521
+ 1156
+ -104.06470000000002
+ 3521
+ 0.7911781187179483
+ 3521.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7911781187179483
+ Cosine
+
+
+ 11652
+ 5175
+ 0.0
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11652
+ 11101
+ 0.0005000000000023874
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11652
+ 11368
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11652
+ 208
+ 57.01350000000001
+ 11652
+ 0.7720262431782003
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 11652
+ 11194
+ 0.0005000000000023874
+ 11652
+ 0.9087915697477342
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11652
+ 25
+ 50.01129999999999
+ 11652
+ 0.7765014360319091
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 11652
+ 5148
+ 0.0002999999999957481
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11652
+ 5194
+ 0.00019999999999242846
+ 11652
+ 1.0000000000000002
+ 11652.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 20624
+ 1345
+ 15.99539999999999
+ 20624
+ 0.7071714136634972
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7071714136634972
+ Cosine
+
+
+ 20624
+ 1695
+ 50.089
+ 20624
+ 0.7020258104803418
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7020258104803418
+ Cosine
+
+
+ 20624
+ 2775
+ 0.00030000000000995897
+ 20624
+ 0.7121988528052141
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7121988528052141
+ Cosine
+
+
+ 20624
+ 4559
+ 0.0004000000000132786
+ 20624
+ 0.8995527314951952
+ 20624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8995527314951952
+ Cosine
+
+
+ 11101
+ 5175
+ -0.0005000000000023874
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11101
+ 25
+ 50.01079999999999
+ 11101
+ 0.7738824635537842
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+ Cosine
+
+
+ 11101
+ 208
+ 57.013000000000005
+ 11101
+ 0.702129081776425
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+ Cosine
+
+
+ 11101
+ 5148
+ -0.0002000000000066393
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11101
+ 5194
+ -0.00030000000000995897
+ 11101
+ 0.9087915697477342
+ 11101.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11194
+ 11101
+ 0.0
+ 11194
+ 1.0
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0
+ Cosine
+
+
+ 11368
+ 11101
+ 0.0002000000000066393
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 914
+ 19
+ -53.05150000000003
+ 914
+ 0.7062934837448891
+ 914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7062934837448891
+ Cosine
+
+
+ 1252
+ 109
+ -86.0367
+ 1252
+ 0.7404795946299525
+ 1252.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7404795946299525
+ Cosine
+
+
+ 5975
+ 5889
+ 0.0
+ 5975
+ 0.8838615477489413
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8838615477489413
+ Cosine
+
+
+ 6038
+ 5889
+ 0.0
+ 6038
+ 0.8713460865906011
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 6019
+ 5889
+ 0.00010000000000331966
+ 6019
+ 0.8713460865906011
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 5935
+ 5889
+ 0.0
+ 5935
+ 0.8713460865906011
+ 5935.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8713460865906011
+ Cosine
+
+
+ 3546
+ 1164
+ 14.015800000000013
+ 3546
+ 0.8793244992033116
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8793244992033116
+ Cosine
+
+
+ 3546
+ 1173
+ 82.00540000000001
+ 3546
+ 0.7828830741744861
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7828830741744861
+ Cosine
+
+
+ 3546
+ 1223
+ 50.015499999999975
+ 3546
+ 0.7535990988683806
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7535990988683806
+ Cosine
+
+
+ 3546
+ 1296
+ -80.101
+ 3546
+ 0.7457712449142684
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7457712449142684
+ Cosine
+
+
+ 3546
+ 1307
+ 14.014999999999986
+ 3546
+ 0.7794251735135853
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7794251735135853
+ Cosine
+
+
+ 3546
+ 1322
+ -0.0004000000000132786
+ 3546
+ 0.8074125004101471
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8074125004101471
+ Cosine
+
+
+ 3546
+ 1335
+ 102.15570000000002
+ 3546
+ 0.7689090461140327
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7689090461140327
+ Cosine
+
+
+ 3546
+ 1376
+ -14.016099999999994
+ 3546
+ 0.8246352450749646
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8246352450749646
+ Cosine
+
+
+ 3546
+ 1555
+ 66.01069999999999
+ 3546
+ 0.7526626748294611
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7526626748294611
+ Cosine
+
+
+ 3546
+ 1967
+ 66.01010000000002
+ 3546
+ 0.8526461861122617
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8526461861122617
+ Cosine
+
+
+ 3546
+ 2486
+ 98.03609999999998
+ 3546
+ 0.7904804724736056
+ 3546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7904804724736056
+ Cosine
+
+
+ 3766
+ 3546
+ -15.994500000000016
+ 3766
+ 0.8099019127616017
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8099019127616017
+ Cosine
+
+
+ 4500
+ 3546
+ -14.015600000000006
+ 4500
+ 0.8630023041655128
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8630023041655128
+ Cosine
+
+
+ 4537
+ 3546
+ -66.01060000000001
+ 4537
+ 0.8481722280147458
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8481722280147458
+ Cosine
+
+
+ 4549
+ 3546
+ -114.03089999999997
+ 4549
+ 0.8121775679710831
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8121775679710831
+ Cosine
+
+
+ 4561
+ 3546
+ -108.02179999999998
+ 4561
+ 0.8111615965640255
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8111615965640255
+ Cosine
+
+
+ 4587
+ 3546
+ -156.0426
+ 4587
+ 0.79355114911454
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.79355114911454
+ Cosine
+
+
+ 4661
+ 3546
+ -100.0163
+ 4661
+ 0.8137976430006446
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8137976430006446
+ Cosine
+
+
+ 4694
+ 3546
+ -124.01589999999999
+ 4694
+ 0.7725949549250163
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7725949549250163
+ Cosine
+
+
+ 7663
+ 3546
+ 0.0362999999999829
+ 7663
+ 0.7887662259513708
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7887662259513708
+ Cosine
+
+
+ 7665
+ 3546
+ -85.9565
+ 7665
+ 0.7843396546425048
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7843396546425048
+ Cosine
+
+
+ 7795
+ 3546
+ -102.15570000000002
+ 7795
+ 0.7868784873004675
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7868784873004675
+ Cosine
+
+
+ 8321
+ 3546
+ -66.01060000000001
+ 8321
+ 0.8367023894267491
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367023894267491
+ Cosine
+
+
+ 13633
+ 3546
+ -49.97930000000002
+ 13633
+ 0.8461478630894581
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8461478630894581
+ Cosine
+
+
+ 13737
+ 3546
+ -40.9751
+ 13737
+ 0.762793049010119
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.762793049010119
+ Cosine
+
+
+ 20868
+ 3546
+ -17.931100000000015
+ 20868
+ 0.8189549112428063
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8189549112428063
+ Cosine
+
+
+ 26406
+ 3546
+ -83.98540000000003
+ 26406
+ 0.7844611924289386
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7844611924289386
+ Cosine
+
+
+ 5175
+ 208
+ 57.01350000000001
+ 5175
+ 0.7720262431782003
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 11368
+ 208
+ 57.01320000000001
+ 11368
+ 0.7720262431782003
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 208
+ 25
+ -7.002200000000016
+ 208
+ 0.8645323434684491
+ 208.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8645323434684491
+ Cosine
+
+
+ 5148
+ 208
+ 57.01320000000001
+ 5148
+ 0.7720262431782003
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 5194
+ 208
+ 57.013300000000015
+ 5194
+ 0.7720262431782003
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720262431782003
+ Cosine
+
+
+ 11194
+ 208
+ 57.013000000000005
+ 11194
+ 0.702129081776425
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702129081776425
+ Cosine
+
+
+ 3285
+ 1310
+ -258.19820000000004
+ 3285
+ 0.8079383683448043
+ 3285.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8079383683448043
+ Cosine
+
+
+ 1068
+ 343
+ 0.0
+ 1068
+ 0.7753395167412889
+ 1068.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7753395167412889
+ Cosine
+
+
+ 1068
+ 914
+ 0.0
+ 1068
+ 0.7692111344591185
+ 1068.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7692111344591185
+ Cosine
+
+
+ 1220
+ 1068
+ -14.015199999999993
+ 1220
+ 0.7052110063147057
+ 1220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7052110063147057
+ Cosine
+
+
+ 4667
+ 1379
+ -0.00029999999998153726
+ 4667
+ 0.8854597982233787
+ 4667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8854597982233787
+ Cosine
+
+
+ 10324
+ 1581
+ -0.0002000000000066393
+ 10324
+ 0.8027235562039201
+ 10324.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8027235562039201
+ Cosine
+
+
+ 10964
+ 1474
+ -39.046700000000044
+ 10964
+ 0.73346424023061
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.73346424023061
+ Cosine
+
+
+ 4500
+ 3747
+ -14.016200000000026
+ 4500
+ 0.8203846738344488
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8203846738344488
+ Cosine
+
+
+ 3747
+ 1164
+ 14.016400000000033
+ 3747
+ 0.790755948993533
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.790755948993533
+ Cosine
+
+
+ 4587
+ 3747
+ -156.0432
+ 4587
+ 0.7293753961686953
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7293753961686953
+ Cosine
+
+
+ 4549
+ 3747
+ -114.0315
+ 4549
+ 0.7530296002010514
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7530296002010514
+ Cosine
+
+
+ 3747
+ 1173
+ 82.00600000000003
+ 3747
+ 0.7124140725007002
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7124140725007002
+ Cosine
+
+
+ 3766
+ 3747
+ -15.995100000000036
+ 3766
+ 0.7466153835685401
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7466153835685401
+ Cosine
+
+
+ 3747
+ 1240
+ 114.03170000000006
+ 3747
+ 0.7520528028432132
+ 3747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7520528028432132
+ Cosine
+
+
+ 7663
+ 3747
+ 0.035699999999962984
+ 7663
+ 0.7219842678792172
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7219842678792172
+ Cosine
+
+
+ 13737
+ 3747
+ -40.97570000000002
+ 13737
+ 0.7128012963017345
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7128012963017345
+ Cosine
+
+
+ 8321
+ 3747
+ -66.01120000000003
+ 8321
+ 0.7613911289766184
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7613911289766184
+ Cosine
+
+
+ 4661
+ 3747
+ -100.01690000000002
+ 4661
+ 0.7324993267104507
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7324993267104507
+ Cosine
+
+
+ 7732
+ 4561
+ 4.0548
+ 7732
+ 0.7400288395718368
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7400288395718368
+ Cosine
+
+
+ 4561
+ 1339
+ -0.001099999999951251
+ 4561
+ 0.8031253345881758
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8031253345881758
+ Cosine
+
+
+ 4561
+ 4537
+ -42.011199999999974
+ 4561
+ 0.8730652696074992
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8730652696074992
+ Cosine
+
+
+ 4561
+ 1322
+ -108.0222
+ 4561
+ 0.763896298877169
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.763896298877169
+ Cosine
+
+
+ 4561
+ 1376
+ -122.03789999999998
+ 4561
+ 0.7909365165516298
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7909365165516298
+ Cosine
+
+
+ 4561
+ 4500
+ -94.00619999999998
+ 4561
+ 0.8290107577505195
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8290107577505195
+ Cosine
+
+
+ 4561
+ 1164
+ -94.00599999999997
+ 4561
+ 0.815028020152927
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.815028020152927
+ Cosine
+
+
+ 4561
+ 1967
+ -42.01169999999996
+ 4561
+ 0.8678754084093439
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8678754084093439
+ Cosine
+
+
+ 4587
+ 4561
+ -48.02080000000001
+ 4587
+ 0.7644778742682641
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7644778742682641
+ Cosine
+
+
+ 4561
+ 4549
+ 6.0090999999999894
+ 4561
+ 0.7884462394566427
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7884462394566427
+ Cosine
+
+
+ 4561
+ 1173
+ -26.016399999999976
+ 4561
+ 0.8546126865823311
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8546126865823311
+ Cosine
+
+
+ 4561
+ 3766
+ -92.02729999999997
+ 4561
+ 0.8161044974570639
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8161044974570639
+ Cosine
+
+
+ 26406
+ 4561
+ 24.036399999999958
+ 26406
+ 0.7310222474771313
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7310222474771313
+ Cosine
+
+
+ 4561
+ 1240
+ 6.009300000000053
+ 4561
+ 0.7456117577406673
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7456117577406673
+ Cosine
+
+
+ 13633
+ 4561
+ 58.04249999999996
+ 13633
+ 0.8147788470350186
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8147788470350186
+ Cosine
+
+
+ 7663
+ 4561
+ 108.05809999999997
+ 7663
+ 0.7555495191707877
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7555495191707877
+ Cosine
+
+
+ 4561
+ 1449
+ 142.17190000000005
+ 4561
+ 0.747594835793248
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.747594835793248
+ Cosine
+
+
+ 4694
+ 4561
+ -15.994100000000003
+ 4694
+ 0.7991811245600994
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7991811245600994
+ Cosine
+
+
+ 7665
+ 4561
+ 22.06529999999998
+ 7665
+ 0.7806767931699561
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7806767931699561
+ Cosine
+
+
+ 4561
+ 2486
+ -9.985700000000008
+ 4561
+ 0.81311898979567
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.81311898979567
+ Cosine
+
+
+ 4561
+ 1223
+ -58.00630000000001
+ 4561
+ 0.7697152410206597
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7697152410206597
+ Cosine
+
+
+ 4561
+ 1335
+ -5.86609999999996
+ 4561
+ 0.7861196361542652
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7861196361542652
+ Cosine
+
+
+ 4561
+ 1555
+ -42.0111
+ 4561
+ 0.8242999059246818
+ 4561.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8242999059246818
+ Cosine
+
+
+ 4661
+ 4561
+ 8.005499999999984
+ 4661
+ 0.8295646851644539
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8295646851644539
+ Cosine
+
+
+ 8321
+ 4561
+ 42.011199999999974
+ 8321
+ 0.8857558419453324
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8857558419453324
+ Cosine
+
+
+ 13737
+ 4561
+ 67.04669999999999
+ 13737
+ 0.7370392080685323
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7370392080685323
+ Cosine
+
+
+ 20868
+ 4561
+ 90.09069999999997
+ 20868
+ 0.7675090267448648
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7675090267448648
+ Cosine
+
+
+ 3667
+ 3122
+ -90.97769999999997
+ 3667
+ 0.7477037577406106
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7477037577406106
+ Cosine
+
+
+ 3771
+ 3122
+ -0.0009000000000014552
+ 3771
+ 0.8413372190471624
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8413372190471624
+ Cosine
+
+
+ 3122
+ 311
+ -15.996399999999994
+ 3122
+ 0.7023889373262369
+ 3122.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7023889373262369
+ Cosine
+
+
+ 28000
+ 10473
+ 148.0381
+ 28000
+ 0.9360036525586622
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9360036525586622
+ Cosine
+
+
+ 28000
+ 6
+ 78.97820000000002
+ 28000
+ 0.8160764092297264
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8160764092297264
+ Cosine
+
+
+ 28000
+ 9
+ -45.98760000000004
+ 28000
+ 0.9215371878356318
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9215371878356318
+ Cosine
+
+
+ 28000
+ 58
+ -74.01890000000003
+ 28000
+ 0.9212909515919987
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9212909515919987
+ Cosine
+
+
+ 28000
+ 144
+ -148.03769999999997
+ 28000
+ 0.8799573303757411
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8799573303757411
+ Cosine
+
+
+ 28000
+ 1156
+ -90.04899999999998
+ 28000
+ 0.8732979202981104
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8732979202981104
+ Cosine
+
+
+ 28000
+ 5332
+ -331.112
+ 28000
+ 0.7113625195049174
+ 28000.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7113625195049174
+ Cosine
+
+
+ 13641
+ 1338
+ 0.0009000000000014552
+ 13641
+ 0.7980033802458849
+ 13641.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7980033802458849
+ Cosine
+
+
+ 2575
+ 284
+ -0.0008000000000265572
+ 2575
+ 0.8164531603319137
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8164531603319137
+ Cosine
+
+
+ 3667
+ 2575
+ -122.96679999999998
+ 3667
+ 0.7253705487219619
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7253705487219619
+ Cosine
+
+
+ 3771
+ 2575
+ -31.99000000000001
+ 3771
+ 0.7251102524133266
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7251102524133266
+ Cosine
+
+
+ 2575
+ 311
+ 15.992700000000013
+ 2575
+ 0.7062406701299218
+ 2575.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7062406701299218
+ Cosine
+
+
+ 10446
+ 2575
+ -13.978599999999972
+ 10446
+ 0.8999753679531999
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8999753679531999
+ Cosine
+
+
+ 7731
+ 2575
+ 56.1155
+ 7731
+ 0.7169488062873204
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7169488062873204
+ Cosine
+
+
+ 4559
+ 1695
+ 50.088599999999985
+ 4559
+ 0.7170509324806612
+ 4559.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7170509324806612
+ Cosine
+
+
+ 1352
+ 270
+ 18.010599999999954
+ 1352
+ 0.8563378078396177
+ 1352.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8563378078396177
+ Cosine
+
+
+ 13698
+ 4789
+ 18.00960000000009
+ 13698
+ 0.7309049034230997
+ 13698.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7309049034230997
+ Cosine
+
+
+ 13676
+ 13610
+ -84.02100000000002
+ 13676
+ 0.7810920039377021
+ 13676.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7810920039377021
+ Cosine
+
+
+ 6038
+ 5975
+ 0.0
+ 6038
+ 0.8840320085106907
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 6038
+ 5935
+ 0.0
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 6038
+ 6019
+ -0.00010000000000331966
+ 6038
+ 0.9999999999999993
+ 6038.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 10964
+ 1193
+ 0.9457999999999629
+ 10964
+ 0.7171219059323268
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7171219059323268
+ Cosine
+
+
+ 7731
+ 1193
+ 14.01479999999998
+ 7731
+ 0.7014124112761397
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7014124112761397
+ Cosine
+
+
+ 1339
+ 1173
+ -26.015300000000025
+ 1339
+ 0.8066641559490045
+ 1339.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8066641559490045
+ Cosine
+
+
+ 4537
+ 1173
+ 15.994799999999998
+ 4537
+ 0.8564001559018828
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8564001559018828
+ Cosine
+
+
+ 1322
+ 1173
+ 82.00580000000002
+ 1322
+ 0.7370539191821087
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7370539191821087
+ Cosine
+
+
+ 1376
+ 1173
+ 96.0215
+ 1376
+ 0.7535949038696292
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7535949038696292
+ Cosine
+
+
+ 4500
+ 1173
+ 67.9898
+ 4500
+ 0.8392533735358628
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8392533735358628
+ Cosine
+
+
+ 2541
+ 1173
+ 30.010400000000004
+ 2541
+ 0.7101292434838536
+ 2541.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101292434838536
+ Cosine
+
+
+ 1173
+ 1164
+ -67.9896
+ 1173
+ 0.7720170935236409
+ 1173.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720170935236409
+ Cosine
+
+
+ 1967
+ 1173
+ 15.995299999999986
+ 1967
+ 0.8527043882889677
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8527043882889677
+ Cosine
+
+
+ 4587
+ 1173
+ -74.03719999999998
+ 4587
+ 0.7430226083893596
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7430226083893596
+ Cosine
+
+
+ 7795
+ 1173
+ -20.150300000000016
+ 7795
+ 0.7474656625550722
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7474656625550722
+ Cosine
+
+
+ 4549
+ 1173
+ -32.025499999999965
+ 4549
+ 0.77698747812405
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.77698747812405
+ Cosine
+
+
+ 1223
+ 1173
+ 31.989900000000034
+ 1223
+ 0.7350632353801019
+ 1223.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7350632353801019
+ Cosine
+
+
+ 1240
+ 1173
+ -32.02570000000003
+ 1240
+ 0.7481440078358288
+ 1240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7481440078358288
+ Cosine
+
+
+ 1335
+ 1173
+ -20.150300000000016
+ 1335
+ 0.7433682408351929
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7433682408351929
+ Cosine
+
+
+ 1449
+ 1173
+ -168.18830000000003
+ 1449
+ 0.7206087939452487
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206087939452487
+ Cosine
+
+
+ 1555
+ 1173
+ 15.994700000000023
+ 1555
+ 0.7909494753245667
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7909494753245667
+ Cosine
+
+
+ 2486
+ 1173
+ -16.030699999999968
+ 2486
+ 0.7835363647356086
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7835363647356086
+ Cosine
+
+
+ 3766
+ 1173
+ 66.01089999999999
+ 3766
+ 0.7766122485197371
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7766122485197371
+ Cosine
+
+
+ 4661
+ 1173
+ -18.010899999999992
+ 4661
+ 0.8250227213882504
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8250227213882504
+ Cosine
+
+
+ 4694
+ 1173
+ -42.01049999999998
+ 4694
+ 0.7868649521346712
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7868649521346712
+ Cosine
+
+
+ 7663
+ 1173
+ 82.04169999999999
+ 7663
+ 0.7415522669540509
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7415522669540509
+ Cosine
+
+
+ 7665
+ 1173
+ -3.9510999999999967
+ 7665
+ 0.7359749425183681
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7359749425183681
+ Cosine
+
+
+ 8321
+ 1173
+ 15.994799999999998
+ 8321
+ 0.874888952943055
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.874888952943055
+ Cosine
+
+
+ 13633
+ 1173
+ 32.026099999999985
+ 13633
+ 0.8025136343081888
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8025136343081888
+ Cosine
+
+
+ 13737
+ 1173
+ 41.03030000000001
+ 13737
+ 0.7299415400310498
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7299415400310498
+ Cosine
+
+
+ 20868
+ 1173
+ 64.0743
+ 20868
+ 0.7353894236462689
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7353894236462689
+ Cosine
+
+
+ 26406
+ 1173
+ -1.9800000000000182
+ 26406
+ 0.7206619892436839
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206619892436839
+ Cosine
+
+
+ 7653
+ 7620
+ 13.980700000000013
+ 7653
+ 0.7445894888430411
+ 7653.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7445894888430411
+ Cosine
+
+
+ 7653
+ 7624
+ -2.0154999999999745
+ 7653
+ 0.7774040833823059
+ 7653.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7774040833823059
+ Cosine
+
+
+ 13633
+ 2692
+ 53.0505
+ 13633
+ 0.7458115466778921
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7458115466778921
+ Cosine
+
+
+ 13633
+ 4537
+ 16.031299999999987
+ 13633
+ 0.845664359251163
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.845664359251163
+ Cosine
+
+
+ 13633
+ 1322
+ -49.97970000000004
+ 13633
+ 0.8043030834172109
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8043030834172109
+ Cosine
+
+
+ 13633
+ 1376
+ -63.99540000000002
+ 13633
+ 0.7687686269218474
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7687686269218474
+ Cosine
+
+
+ 13633
+ 4500
+ -35.96370000000002
+ 13633
+ 0.8364552663707707
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8364552663707707
+ Cosine
+
+
+ 13633
+ 1164
+ -35.96350000000001
+ 13633
+ 0.8321570633161148
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8321570633161148
+ Cosine
+
+
+ 13633
+ 1967
+ 16.0308
+ 13633
+ 0.840266026704837
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.840266026704837
+ Cosine
+
+
+ 13633
+ 1307
+ -35.96430000000004
+ 13633
+ 0.784098407055699
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.784098407055699
+ Cosine
+
+
+ 13633
+ 4587
+ 106.06329999999997
+ 13633
+ 0.7727052855957943
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7727052855957943
+ Cosine
+
+
+ 13633
+ 7795
+ 52.1764
+ 13633
+ 0.7783756541354353
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7783756541354353
+ Cosine
+
+
+ 13633
+ 4549
+ 64.05159999999995
+ 13633
+ 0.7741017917459859
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7741017917459859
+ Cosine
+
+
+ 13633
+ 3766
+ -33.98480000000001
+ 13633
+ 0.8002918228341831
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8002918228341831
+ Cosine
+
+
+ 26406
+ 13633
+ -34.0061
+ 26406
+ 0.8271753716584815
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8271753716584815
+ Cosine
+
+
+ 13633
+ 1240
+ 64.05180000000001
+ 13633
+ 0.7465009965158613
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7465009965158613
+ Cosine
+
+
+ 13633
+ 1335
+ 52.1764
+ 13633
+ 0.7709303014100878
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7709303014100878
+ Cosine
+
+
+ 13633
+ 1449
+ 200.2144
+ 13633
+ 0.7801012401104481
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7801012401104481
+ Cosine
+
+
+ 13633
+ 1555
+ 16.031399999999962
+ 13633
+ 0.7651013678110163
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7651013678110163
+ Cosine
+
+
+ 13633
+ 4661
+ 50.03699999999998
+ 13633
+ 0.7948445040574719
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7948445040574719
+ Cosine
+
+
+ 13633
+ 7663
+ -50.015600000000006
+ 13633
+ 0.806759523302935
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.806759523302935
+ Cosine
+
+
+ 13633
+ 7665
+ 35.97719999999998
+ 13633
+ 0.8367766085666717
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367766085666717
+ Cosine
+
+
+ 13633
+ 8321
+ 16.031299999999987
+ 13633
+ 0.8311150501288278
+ 13633.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8311150501288278
+ Cosine
+
+
+ 13737
+ 13633
+ 9.004200000000026
+ 13737
+ 0.8134557016391082
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8134557016391082
+ Cosine
+
+
+ 20868
+ 13633
+ 32.04820000000001
+ 20868
+ 0.8288663928104931
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8288663928104931
+ Cosine
+
+
+ 7628
+ 7621
+ -18.01060000000001
+ 7628
+ 0.8097593920769901
+ 7628.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8097593920769901
+ Cosine
+
+
+ 7667
+ 7621
+ 0.0002000000000066393
+ 7667
+ 0.7939764597013956
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7939764597013956
+ Cosine
+
+
+ 5175
+ 5148
+ 0.0002999999999957481
+ 5175
+ 1.0000000000000002
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11368
+ 5148
+ 0.0
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11194
+ 5148
+ -0.0002000000000066393
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 5194
+ 5148
+ 0.00010000000000331966
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5148
+ 25
+ 50.010999999999996
+ 5148
+ 0.7765014360319091
+ 5148.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 1653
+ 1487
+ 44.02589999999998
+ 1653
+ 0.9093249798306463
+ 1653.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9093249798306463
+ Cosine
+
+
+ 4785
+ 1487
+ -204.1363
+ 4785
+ 0.848268947250483
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.848268947250483
+ Cosine
+
+
+ 2783
+ 1487
+ -116.08350000000007
+ 2783
+ 0.8846281446851625
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8846281446851625
+ Cosine
+
+
+ 1487
+ 1482
+ 44.02679999999998
+ 1487
+ 0.9248756168839098
+ 1487.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9248756168839098
+ Cosine
+
+
+ 2566
+ 1487
+ -88.05230000000006
+ 2566
+ 0.9399910711194035
+ 2566.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9399910711194035
+ Cosine
+
+
+ 2726
+ 1487
+ -130.09810000000004
+ 2726
+ 0.8259030434209769
+ 2726.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8259030434209769
+ Cosine
+
+
+ 2761
+ 1487
+ -72.05780000000004
+ 2761
+ 0.8022317071646724
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8022317071646724
+ Cosine
+
+
+ 4679
+ 1487
+ -174.12470000000008
+ 4679
+ 0.7791128526481546
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7791128526481546
+ Cosine
+
+
+ 13719
+ 13660
+ 96.02030000000002
+ 13719
+ 0.7388131895529652
+ 13719.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7388131895529652
+ Cosine
+
+
+ 4587
+ 4537
+ -90.03199999999998
+ 4587
+ 0.7842098749446971
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7842098749446971
+ Cosine
+
+
+ 4587
+ 1322
+ -156.043
+ 4587
+ 0.7467146970290905
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7467146970290905
+ Cosine
+
+
+ 4587
+ 1376
+ -170.0587
+ 4587
+ 0.742367766289796
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.742367766289796
+ Cosine
+
+
+ 4587
+ 4500
+ -142.027
+ 4587
+ 0.8186249150040003
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8186249150040003
+ Cosine
+
+
+ 4587
+ 1164
+ -142.02679999999998
+ 4587
+ 0.8093157865557121
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8093157865557121
+ Cosine
+
+
+ 4587
+ 1967
+ -90.03249999999997
+ 4587
+ 0.7684988355766591
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7684988355766591
+ Cosine
+
+
+ 4587
+ 1240
+ -42.011499999999955
+ 4587
+ 0.718885372343228
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.718885372343228
+ Cosine
+
+
+ 4587
+ 1335
+ -53.88689999999997
+ 4587
+ 0.7551841126614868
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7551841126614868
+ Cosine
+
+
+ 4587
+ 1449
+ 94.15110000000004
+ 4587
+ 0.7137709838086508
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7137709838086508
+ Cosine
+
+
+ 4587
+ 1555
+ -90.03190000000001
+ 4587
+ 0.7002214613669502
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7002214613669502
+ Cosine
+
+
+ 4587
+ 3766
+ -140.04809999999998
+ 4587
+ 0.7594446463336337
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7594446463336337
+ Cosine
+
+
+ 4587
+ 4549
+ -42.01170000000002
+ 4587
+ 0.8217179048871404
+ 4587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8217179048871404
+ Cosine
+
+
+ 4661
+ 4587
+ 56.02629999999999
+ 4661
+ 0.7666240310740251
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666240310740251
+ Cosine
+
+
+ 7663
+ 4587
+ 156.07889999999998
+ 7663
+ 0.7226337643803658
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7226337643803658
+ Cosine
+
+
+ 8321
+ 4587
+ 90.03199999999998
+ 8321
+ 0.7911197984051381
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7911197984051381
+ Cosine
+
+
+ 20868
+ 4587
+ 138.11149999999998
+ 20868
+ 0.7265904816272102
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7265904816272102
+ Cosine
+
+
+ 26406
+ 4587
+ 72.05719999999997
+ 26406
+ 0.7403551920670073
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7403551920670073
+ Cosine
+
+
+ 26328
+ 1322
+ -18.010199999999998
+ 26328
+ 0.7302993927916551
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7302993927916551
+ Cosine
+
+
+ 26328
+ 4500
+ -3.994199999999978
+ 26328
+ 0.7956793964208981
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7956793964208981
+ Cosine
+
+
+ 26328
+ 1164
+ -3.9939999999999714
+ 26328
+ 0.7545050882923094
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7545050882923094
+ Cosine
+
+
+ 26328
+ 1307
+ -3.994799999999998
+ 26328
+ 0.7003012388315275
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7003012388315275
+ Cosine
+
+
+ 26328
+ 7795
+ 84.14590000000004
+ 26328
+ 0.7016671106469226
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7016671106469226
+ Cosine
+
+
+ 26328
+ 3766
+ -2.015299999999968
+ 26328
+ 0.7454426580307357
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7454426580307357
+ Cosine
+
+
+ 26328
+ 7663
+ -18.046099999999967
+ 26328
+ 0.7215279459717998
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7215279459717998
+ Cosine
+
+
+ 26328
+ 4661
+ 82.00650000000002
+ 26328
+ 0.7298374829207233
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7298374829207233
+ Cosine
+
+
+ 26328
+ 20868
+ -0.07869999999996935
+ 26328
+ 0.7161158715281237
+ 26328.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7161158715281237
+ Cosine
+
+
+ 7663
+ 2692
+ 103.0661
+ 7663
+ 0.7236128216761095
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7236128216761095
+ Cosine
+
+
+ 7732
+ 7663
+ -104.00329999999997
+ 7732
+ 0.729794047573183
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729794047573183
+ Cosine
+
+
+ 7663
+ 4537
+ 66.0469
+ 7663
+ 0.7375342580690634
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7375342580690634
+ Cosine
+
+
+ 7681
+ 7663
+ -217.05129999999997
+ 7681
+ 0.7121563463400618
+ 7681.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7121563463400618
+ Cosine
+
+
+ 7663
+ 1322
+ 0.03589999999996962
+ 7663
+ 0.8209335754702527
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8209335754702527
+ Cosine
+
+
+ 7663
+ 1376
+ -13.979800000000012
+ 7663
+ 0.7980512050447385
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7980512050447385
+ Cosine
+
+
+ 7663
+ 4500
+ 14.05189999999999
+ 7663
+ 0.825952919003377
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.825952919003377
+ Cosine
+
+
+ 7663
+ 1164
+ 14.052099999999996
+ 7663
+ 0.8383852890236886
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8383852890236886
+ Cosine
+
+
+ 7663
+ 1967
+ 66.0464
+ 7663
+ 0.7504339693632678
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7504339693632678
+ Cosine
+
+
+ 7663
+ 1307
+ 14.05129999999997
+ 7663
+ 0.7611343986167387
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7611343986167387
+ Cosine
+
+
+ 7795
+ 7663
+ -102.19200000000001
+ 7795
+ 0.7617069382187817
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7617069382187817
+ Cosine
+
+
+ 7663
+ 4549
+ 114.06719999999996
+ 7663
+ 0.7284060608847098
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7284060608847098
+ Cosine
+
+
+ 7663
+ 3766
+ 16.0308
+ 7663
+ 0.8121756419301319
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8121756419301319
+ Cosine
+
+
+ 26406
+ 7663
+ -84.02170000000001
+ 26406
+ 0.8281027724705226
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8281027724705226
+ Cosine
+
+
+ 7663
+ 1240
+ 114.06740000000002
+ 7663
+ 0.7992944859524869
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7992944859524869
+ Cosine
+
+
+ 7663
+ 1296
+ -80.06470000000002
+ 7663
+ 0.7975146736211863
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7975146736211863
+ Cosine
+
+
+ 7663
+ 1335
+ 102.19200000000001
+ 7663
+ 0.7185627395516155
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7185627395516155
+ Cosine
+
+
+ 7663
+ 1449
+ 250.23000000000002
+ 7663
+ 0.7163799117536901
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7163799117536901
+ Cosine
+
+
+ 7663
+ 2486
+ 98.07239999999996
+ 7663
+ 0.7225843174813046
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7225843174813046
+ Cosine
+
+
+ 7663
+ 4661
+ 100.05259999999998
+ 7663
+ 0.7811667883586639
+ 7663.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7811667883586639
+ Cosine
+
+
+ 7665
+ 7663
+ -85.99279999999999
+ 7665
+ 0.7836590812669706
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7836590812669706
+ Cosine
+
+
+ 8321
+ 7663
+ -66.0469
+ 8321
+ 0.765860955411227
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765860955411227
+ Cosine
+
+
+ 20868
+ 7663
+ -17.967399999999998
+ 20868
+ 0.8602342917868183
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8602342917868183
+ Cosine
+
+
+ 4548
+ 1158
+ -104.0471
+ 4548
+ 0.8938556962070379
+ 4548.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8938556962070379
+ Cosine
+
+
+ 5975
+ 5935
+ 0.0
+ 5975
+ 0.8840320085106907
+ 5975.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 6019
+ 5975
+ 0.00010000000000331966
+ 6019
+ 0.8840320085106907
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8840320085106907
+ Cosine
+
+
+ 11368
+ 5175
+ -0.0002999999999957481
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11368
+ 25
+ 50.010999999999996
+ 11368
+ 0.7765014360319091
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 11368
+ 5194
+ -0.00010000000000331966
+ 11368
+ 1.0000000000000002
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 11368
+ 11194
+ 0.0002000000000066393
+ 11368
+ 0.9087915697477342
+ 11368.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 8321
+ 1339
+ 42.01010000000002
+ 8321
+ 0.7999373012314828
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7999373012314828
+ Cosine
+
+
+ 8321
+ 4537
+ 0.0
+ 8321
+ 0.9511165265710031
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9511165265710031
+ Cosine
+
+
+ 8321
+ 1322
+ -66.01100000000002
+ 8321
+ 0.7873383933138107
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7873383933138107
+ Cosine
+
+
+ 8321
+ 1376
+ -80.0267
+ 8321
+ 0.7684349266352615
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7684349266352615
+ Cosine
+
+
+ 8321
+ 4500
+ -51.995000000000005
+ 8321
+ 0.8755536332425305
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8755536332425305
+ Cosine
+
+
+ 8321
+ 1164
+ -51.9948
+ 8321
+ 0.8306840231912003
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8306840231912003
+ Cosine
+
+
+ 8321
+ 1967
+ -0.0004999999999881766
+ 8321
+ 0.9267915671837754
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9267915671837754
+ Cosine
+
+
+ 8321
+ 1307
+ -51.995600000000024
+ 8321
+ 0.7423090585274036
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7423090585274036
+ Cosine
+
+
+ 8321
+ 7795
+ 36.14510000000001
+ 8321
+ 0.7653176906710635
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7653176906710635
+ Cosine
+
+
+ 8321
+ 4549
+ 48.02029999999996
+ 8321
+ 0.8224640029896837
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8224640029896837
+ Cosine
+
+
+ 8321
+ 3766
+ -50.016099999999994
+ 8321
+ 0.8080120075402827
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8080120075402827
+ Cosine
+
+
+ 26406
+ 8321
+ -17.974800000000016
+ 26406
+ 0.7752441633128537
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7752441633128537
+ Cosine
+
+
+ 8321
+ 1240
+ 48.02050000000003
+ 8321
+ 0.7636996275599084
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7636996275599084
+ Cosine
+
+
+ 8321
+ 4694
+ 58.00529999999998
+ 8321
+ 0.829013640395701
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.829013640395701
+ Cosine
+
+
+ 8321
+ 7665
+ 19.945899999999995
+ 8321
+ 0.7755061074969237
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7755061074969237
+ Cosine
+
+
+ 8321
+ 2486
+ 32.025499999999965
+ 8321
+ 0.8027958957327685
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8027958957327685
+ Cosine
+
+
+ 8321
+ 1335
+ 36.14510000000001
+ 8321
+ 0.7695492527558442
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7695492527558442
+ Cosine
+
+
+ 8321
+ 1555
+ 9.999999997489795e-05
+ 8321
+ 0.8357012072601446
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8357012072601446
+ Cosine
+
+
+ 20868
+ 8321
+ 48.079499999999996
+ 20868
+ 0.7662607782657829
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7662607782657829
+ Cosine
+
+
+ 13737
+ 8321
+ 25.035500000000013
+ 13737
+ 0.7632308904928097
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7632308904928097
+ Cosine
+
+
+ 8321
+ 1223
+ -15.995100000000036
+ 8321
+ 0.7741744314954162
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7741744314954162
+ Cosine
+
+
+ 8321
+ 4661
+ 34.00569999999999
+ 8321
+ 0.8554031193941803
+ 8321.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8554031193941803
+ Cosine
+
+
+ 4504
+ 1162
+ 165.06350000000003
+ 4504
+ 0.8164098517514803
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8164098517514803
+ Cosine
+
+
+ 4590
+ 1162
+ 0.0004000000000132786
+ 4590
+ 0.8074986227408434
+ 4590.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8074986227408434
+ Cosine
+
+
+ 1196
+ 1162
+ 162.05330000000004
+ 1196
+ 0.8217489893110046
+ 1196.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8217489893110046
+ Cosine
+
+
+ 2478
+ 1162
+ 165.0645
+ 2478
+ 0.7808714634023075
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7808714634023075
+ Cosine
+
+
+ 4507
+ 1162
+ 179.079
+ 4507
+ 0.820700883141278
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.820700883141278
+ Cosine
+
+
+ 4536
+ 2273
+ -0.0009000000000014552
+ 4536
+ 0.7715091972008596
+ 4536.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7715091972008596
+ Cosine
+
+
+ 10258
+ 4584
+ -114.03210000000001
+ 10258
+ 0.7976338031004642
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7976338031004642
+ Cosine
+
+
+ 4775
+ 4584
+ 0.015500000000031378
+ 4775
+ 0.8403666147440325
+ 4775.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8403666147440325
+ Cosine
+
+
+ 10473
+ 1156
+ -238.08709999999996
+ 10473
+ 0.8334072070031415
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8334072070031415
+ Cosine
+
+
+ 1156
+ 9
+ 44.061399999999935
+ 1156
+ 0.8155978017294079
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8155978017294079
+ Cosine
+
+
+ 1156
+ 6
+ 169.0272
+ 1156
+ 0.7173136451001267
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7173136451001267
+ Cosine
+
+
+ 1156
+ 58
+ 16.030099999999948
+ 1156
+ 0.90607076925165
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.90607076925165
+ Cosine
+
+
+ 1156
+ 144
+ -57.988699999999994
+ 1156
+ 0.876683552820863
+ 1156.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.876683552820863
+ Cosine
+
+
+ 4537
+ 1339
+ 42.01010000000002
+ 4537
+ 0.7882247339707944
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7882247339707944
+ Cosine
+
+
+ 4537
+ 1164
+ -51.9948
+ 4537
+ 0.8228342017021323
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8228342017021323
+ Cosine
+
+
+ 4537
+ 1223
+ -15.995100000000036
+ 4537
+ 0.7630024039120842
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7630024039120842
+ Cosine
+
+
+ 4537
+ 1240
+ 48.02050000000003
+ 4537
+ 0.7599221196352439
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7599221196352439
+ Cosine
+
+
+ 4537
+ 1307
+ -51.995600000000024
+ 4537
+ 0.7402014018615574
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7402014018615574
+ Cosine
+
+
+ 4537
+ 1322
+ -66.01100000000002
+ 4537
+ 0.7573240595511265
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7573240595511265
+ Cosine
+
+
+ 4537
+ 1335
+ 36.14510000000001
+ 4537
+ 0.7564223987300519
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7564223987300519
+ Cosine
+
+
+ 4537
+ 1376
+ -80.0267
+ 4537
+ 0.7748272828257107
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7748272828257107
+ Cosine
+
+
+ 4537
+ 1555
+ 9.999999997489795e-05
+ 4537
+ 0.8367246409662303
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8367246409662303
+ Cosine
+
+
+ 4537
+ 1967
+ -0.0004999999999881766
+ 4537
+ 0.9371939457025606
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9371939457025606
+ Cosine
+
+
+ 4537
+ 2486
+ 32.025499999999965
+ 4537
+ 0.7785511411540855
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7785511411540855
+ Cosine
+
+
+ 4537
+ 3766
+ -50.016099999999994
+ 4537
+ 0.7900813177791646
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7900813177791646
+ Cosine
+
+
+ 4537
+ 4500
+ -51.995000000000005
+ 4537
+ 0.8526305182950509
+ 4537.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8526305182950509
+ Cosine
+
+
+ 4549
+ 4537
+ -48.02029999999996
+ 4549
+ 0.8174961398405545
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8174961398405545
+ Cosine
+
+
+ 4661
+ 4537
+ -34.00569999999999
+ 4661
+ 0.8479208109484992
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8479208109484992
+ Cosine
+
+
+ 4694
+ 4537
+ -58.00529999999998
+ 4694
+ 0.8240362969921723
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8240362969921723
+ Cosine
+
+
+ 7665
+ 4537
+ -19.945899999999995
+ 7665
+ 0.7705656656271879
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7705656656271879
+ Cosine
+
+
+ 7795
+ 4537
+ -36.14510000000001
+ 7795
+ 0.760055747504465
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.760055747504465
+ Cosine
+
+
+ 13737
+ 4537
+ 25.035500000000013
+ 13737
+ 0.7654923294937866
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7654923294937866
+ Cosine
+
+
+ 20868
+ 4537
+ 48.079499999999996
+ 20868
+ 0.759816580087185
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.759816580087185
+ Cosine
+
+
+ 26406
+ 4537
+ -17.974800000000016
+ 26406
+ 0.7628269024321406
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7628269024321406
+ Cosine
+
+
+ 7731
+ 2287
+ -2.0153999999999996
+ 7731
+ 0.7247547561216621
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7247547561216621
+ Cosine
+
+
+ 5812
+ 58
+ 257.0934
+ 5812
+ 0.7273160695115695
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7273160695115695
+ Cosine
+
+
+ 5812
+ 144
+ 183.07460000000003
+ 5812
+ 0.7529330453870031
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7529330453870031
+ Cosine
+
+
+ 5812
+ 4573
+ -0.00010000000003174137
+ 5812
+ 0.8303858599274045
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8303858599274045
+ Cosine
+
+
+ 5812
+ 4605
+ -0.00010000000003174137
+ 5812
+ 0.8533317817398547
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8533317817398547
+ Cosine
+
+
+ 5812
+ 5332
+ 0.00029999999998153726
+ 5812
+ 0.8569097419651501
+ 5812.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8569097419651501
+ Cosine
+
+
+ 4605
+ 4573
+ 0.0
+ 4605
+ 0.8833028749504108
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8833028749504108
+ Cosine
+
+
+ 4605
+ 58
+ 257.0935
+ 4605
+ 0.7515619218514578
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7515619218514578
+ Cosine
+
+
+ 4605
+ 144
+ 183.07470000000006
+ 4605
+ 0.7804921257315742
+ 4605.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7804921257315742
+ Cosine
+
+
+ 5332
+ 4605
+ -0.0004000000000132786
+ 5332
+ 0.8938796872213203
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8938796872213203
+ Cosine
+
+
+ 5273
+ 1196
+ 49.01589999999999
+ 5273
+ 0.7067572392413318
+ 5273.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7067572392413318
+ Cosine
+
+
+ 5273
+ 4507
+ 31.990200000000016
+ 5273
+ 0.7121755450743515
+ 5273.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7121755450743515
+ Cosine
+
+
+ 4499
+ 1497
+ 0.0
+ 4499
+ 0.8555254726413463
+ 4499.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8555254726413463
+ Cosine
+
+
+ 4559
+ 2775
+ -0.00010000000000331966
+ 4559
+ 0.7140217909411135
+ 4559.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7140217909411135
+ Cosine
+
+
+ 5524
+ 1244
+ 16.031100000000038
+ 5524
+ 0.7600417942029223
+ 5524.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7600417942029223
+ Cosine
+
+
+ 10473
+ 9
+ -194.02570000000003
+ 10473
+ 0.8750385558484055
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8750385558484055
+ Cosine
+
+
+ 9
+ 6
+ 124.96580000000006
+ 9
+ 0.7638891547042874
+ 9.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7638891547042874
+ Cosine
+
+
+ 58
+ 9
+ 28.031299999999987
+ 58
+ 0.8733909880214258
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8733909880214258
+ Cosine
+
+
+ 144
+ 9
+ 102.05009999999993
+ 144
+ 0.8610953796284533
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8610953796284533
+ Cosine
+
+
+ 5332
+ 9
+ 285.1244
+ 5332
+ 0.7406248209262456
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7406248209262456
+ Cosine
+
+
+ 3527
+ 2665
+ -42.01060000000001
+ 3527
+ 0.7344276268577485
+ 3527.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7344276268577485
+ Cosine
+
+
+ 7704
+ 2775
+ -0.0001999999999782176
+ 7704
+ 0.7395826901335367
+ 7704.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7395826901335367
+ Cosine
+
+
+ 13747
+ 13724
+ -0.0012999999999578904
+ 13747
+ 0.76576533769383
+ 13747.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.76576533769383
+ Cosine
+
+
+ 5332
+ 4573
+ -0.0004000000000132786
+ 5332
+ 0.9055815784788334
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9055815784788334
+ Cosine
+
+
+ 5332
+ 58
+ 257.0931
+ 5332
+ 0.7366849880216451
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7366849880216451
+ Cosine
+
+
+ 5332
+ 144
+ 183.07430000000005
+ 5332
+ 0.8121110723552849
+ 5332.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8121110723552849
+ Cosine
+
+
+ 2761
+ 1653
+ -116.08370000000002
+ 2761
+ 0.7694090339092938
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7694090339092938
+ Cosine
+
+
+ 4785
+ 2761
+ -132.07849999999996
+ 4785
+ 0.7511859473786051
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7511859473786051
+ Cosine
+
+
+ 2783
+ 2761
+ -44.02570000000003
+ 2783
+ 0.7864313164561963
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7864313164561963
+ Cosine
+
+
+ 2761
+ 2566
+ 15.994500000000016
+ 2761
+ 0.805492302230625
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.805492302230625
+ Cosine
+
+
+ 4679
+ 2761
+ -102.06690000000003
+ 4679
+ 0.7063628387013188
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7063628387013188
+ Cosine
+
+
+ 2761
+ 1482
+ -28.031000000000063
+ 2761
+ 0.8098172256149058
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8098172256149058
+ Cosine
+
+
+ 2761
+ 2726
+ 58.0403
+ 2761
+ 0.7688360741741032
+ 2761.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7688360741741032
+ Cosine
+
+
+ 10318
+ 3674
+ -98.03650000000005
+ 10318
+ 0.700397164355981
+ 10318.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.700397164355981
+ Cosine
+
+
+ 10964
+ 343
+ -87.1046
+ 10964
+ 0.7818532876744582
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7818532876744582
+ Cosine
+
+
+ 10964
+ 914
+ -87.1046
+ 10964
+ 0.7665749885551236
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7665749885551236
+ Cosine
+
+
+ 10964
+ 1220
+ -73.08940000000001
+ 10964
+ 0.7206720094300136
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7206720094300136
+ Cosine
+
+
+ 10964
+ 3770
+ -2.015700000000038
+ 10964
+ 0.7284802710588062
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7284802710588062
+ Cosine
+
+
+ 10964
+ 7731
+ -13.069000000000017
+ 10964
+ 0.7777073105488517
+ 10964.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7777073105488517
+ Cosine
+
+
+ 10473
+ 6
+ -69.05989999999997
+ 10473
+ 0.8083294471916564
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8083294471916564
+ Cosine
+
+
+ 10473
+ 58
+ -222.05700000000002
+ 10473
+ 0.8613979483011278
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8613979483011278
+ Cosine
+
+
+ 10473
+ 144
+ -296.07579999999996
+ 10473
+ 0.7824093927514792
+ 10473.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7824093927514792
+ Cosine
+
+
+ 11741
+ 5168
+ 0.0004999999999881766
+ 11741
+ 0.9999999999999996
+ 11741.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999996
+ Cosine
+
+
+ 4504
+ 1196
+ 3.0101999999999975
+ 4504
+ 0.8297765773143058
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8297765773143058
+ Cosine
+
+
+ 4504
+ 2478
+ -0.0009999999999763531
+ 4504
+ 0.9347224640063869
+ 4504.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9347224640063869
+ Cosine
+
+
+ 4507
+ 4504
+ 14.015499999999975
+ 4507
+ 0.8391059596061563
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8391059596061563
+ Cosine
+
+
+ 4549
+ 2712
+ -30.01079999999996
+ 4549
+ 0.7287640203784882
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7287640203784882
+ Cosine
+
+
+ 4549
+ 1322
+ -114.03129999999999
+ 4549
+ 0.7600449791445076
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7600449791445076
+ Cosine
+
+
+ 4549
+ 1376
+ -128.04699999999997
+ 4549
+ 0.7137383048352939
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7137383048352939
+ Cosine
+
+
+ 4549
+ 4500
+ -100.01529999999997
+ 4549
+ 0.8175702995310199
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8175702995310199
+ Cosine
+
+
+ 4549
+ 1164
+ -100.01509999999996
+ 4549
+ 0.8153558038279359
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8153558038279359
+ Cosine
+
+
+ 4549
+ 1967
+ -48.02079999999995
+ 4549
+ 0.8045527309998968
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8045527309998968
+ Cosine
+
+
+ 4549
+ 1223
+ -64.0154
+ 4549
+ 0.7395512062440517
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7395512062440517
+ Cosine
+
+
+ 4549
+ 1240
+ 0.00020000000006348273
+ 4549
+ 0.766608611936314
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.766608611936314
+ Cosine
+
+
+ 4549
+ 1335
+ -11.87519999999995
+ 4549
+ 0.781380174091065
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.781380174091065
+ Cosine
+
+
+ 4549
+ 1449
+ 136.16280000000006
+ 4549
+ 0.702182889984132
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.702182889984132
+ Cosine
+
+
+ 4549
+ 1555
+ -48.02019999999999
+ 4549
+ 0.7587473642143105
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7587473642143105
+ Cosine
+
+
+ 4549
+ 2486
+ -15.994799999999998
+ 4549
+ 0.7344509679691511
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7344509679691511
+ Cosine
+
+
+ 4549
+ 3766
+ -98.03639999999996
+ 4549
+ 0.815778757831426
+ 4549.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.815778757831426
+ Cosine
+
+
+ 4661
+ 4549
+ 14.014599999999973
+ 4661
+ 0.8045999808486788
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8045999808486788
+ Cosine
+
+
+ 4694
+ 4549
+ -9.985000000000014
+ 4694
+ 0.7177092645080119
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7177092645080119
+ Cosine
+
+
+ 7665
+ 4549
+ 28.07439999999997
+ 7665
+ 0.7443063423447049
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7443063423447049
+ Cosine
+
+
+ 13737
+ 4549
+ 73.05579999999998
+ 13737
+ 0.7610102512520416
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7610102512520416
+ Cosine
+
+
+ 20868
+ 4549
+ 96.09979999999996
+ 20868
+ 0.7370339263867569
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7370339263867569
+ Cosine
+
+
+ 26406
+ 4549
+ 30.045499999999947
+ 26406
+ 0.7526911360538338
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7526911360538338
+ Cosine
+
+
+ 1555
+ 1339
+ 42.01000000000005
+ 1555
+ 0.7281893504060184
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7281893504060184
+ Cosine
+
+
+ 1967
+ 1339
+ 42.01060000000001
+ 1967
+ 0.7606271858773201
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7606271858773201
+ Cosine
+
+
+ 2486
+ 1339
+ 9.984600000000057
+ 2486
+ 0.7293311152581581
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7293311152581581
+ Cosine
+
+
+ 4694
+ 1339
+ -15.995199999999954
+ 4694
+ 0.7314273164370435
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7314273164370435
+ Cosine
+
+
+ 28840
+ 1248
+ -0.0002000000000066393
+ 28840
+ 0.8597570112527155
+ 28840.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8597570112527155
+ Cosine
+
+
+ 28840
+ 4327
+ -0.00010000000000331966
+ 28840
+ 0.9230244810858703
+ 28840.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9230244810858703
+ Cosine
+
+
+ 4661
+ 2692
+ 3.013500000000022
+ 4661
+ 0.7299220493640461
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7299220493640461
+ Cosine
+
+
+ 4661
+ 1322
+ -100.01670000000001
+ 4661
+ 0.7996710822332747
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7996710822332747
+ Cosine
+
+
+ 4661
+ 1376
+ -114.0324
+ 4661
+ 0.761982528156744
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.761982528156744
+ Cosine
+
+
+ 4661
+ 4500
+ -86.0007
+ 4661
+ 0.8372669624014374
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8372669624014374
+ Cosine
+
+
+ 4661
+ 1164
+ -86.00049999999999
+ 4661
+ 0.8078080832175779
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8078080832175779
+ Cosine
+
+
+ 4661
+ 1967
+ -34.00619999999998
+ 4661
+ 0.8211259228578475
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8211259228578475
+ Cosine
+
+
+ 4661
+ 1307
+ -86.00130000000001
+ 4661
+ 0.7394180283183406
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7394180283183406
+ Cosine
+
+
+ 7795
+ 4661
+ -2.1394000000000233
+ 7795
+ 0.7516580255418412
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7516580255418412
+ Cosine
+
+
+ 4661
+ 3766
+ -84.02179999999998
+ 4661
+ 0.8419973276588826
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8419973276588826
+ Cosine
+
+
+ 26406
+ 4661
+ 16.030899999999974
+ 26406
+ 0.7655498713402991
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7655498713402991
+ Cosine
+
+
+ 4661
+ 1240
+ 14.014800000000037
+ 4661
+ 0.8081079954170991
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8081079954170991
+ Cosine
+
+
+ 4661
+ 1449
+ 150.17740000000003
+ 4661
+ 0.7454503310412346
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7454503310412346
+ Cosine
+
+
+ 4694
+ 4661
+ -23.999599999999987
+ 4694
+ 0.7800256254252864
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7800256254252864
+ Cosine
+
+
+ 7665
+ 4661
+ 14.059799999999996
+ 7665
+ 0.7495002132485028
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7495002132485028
+ Cosine
+
+
+ 4661
+ 1296
+ -180.1173
+ 4661
+ 0.7567145054322356
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7567145054322356
+ Cosine
+
+
+ 4661
+ 2486
+ -1.9802000000000248
+ 4661
+ 0.7738088816802413
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738088816802413
+ Cosine
+
+
+ 4661
+ 1335
+ 2.1394000000000233
+ 4661
+ 0.7733534459799833
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7733534459799833
+ Cosine
+
+
+ 4661
+ 1555
+ -34.005600000000015
+ 4661
+ 0.7323906962064897
+ 4661.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7323906962064897
+ Cosine
+
+
+ 20868
+ 4661
+ 82.08519999999999
+ 20868
+ 0.78700954842966
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.78700954842966
+ Cosine
+
+
+ 3766
+ 2692
+ 87.0353
+ 3766
+ 0.754578026801175
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.754578026801175
+ Cosine
+
+
+ 7732
+ 3766
+ -87.97249999999997
+ 7732
+ 0.7639382778499226
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7639382778499226
+ Cosine
+
+
+ 3766
+ 1322
+ -15.99490000000003
+ 3766
+ 0.8470876542950243
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8470876542950243
+ Cosine
+
+
+ 3766
+ 1376
+ -30.01060000000001
+ 3766
+ 0.7839049503571097
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7839049503571097
+ Cosine
+
+
+ 4500
+ 3766
+ 1.97890000000001
+ 4500
+ 0.8569018834232668
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8569018834232668
+ Cosine
+
+
+ 3766
+ 1164
+ -1.9787000000000035
+ 3766
+ 0.8521339902552261
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8521339902552261
+ Cosine
+
+
+ 3766
+ 1967
+ 50.015600000000006
+ 3766
+ 0.7761308631054887
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7761308631054887
+ Cosine
+
+
+ 3766
+ 1307
+ -1.97950000000003
+ 3766
+ 0.7840447191869013
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7840447191869013
+ Cosine
+
+
+ 7795
+ 3766
+ -86.16120000000001
+ 7795
+ 0.7843934598373515
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7843934598373515
+ Cosine
+
+
+ 3766
+ 1240
+ 98.03660000000002
+ 3766
+ 0.7797876496350051
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7797876496350051
+ Cosine
+
+
+ 3766
+ 1296
+ -96.09550000000002
+ 3766
+ 0.7693534892218841
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7693534892218841
+ Cosine
+
+
+ 3766
+ 1335
+ 86.16120000000001
+ 3766
+ 0.8118126872873841
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8118126872873841
+ Cosine
+
+
+ 3766
+ 1449
+ 234.19920000000002
+ 3766
+ 0.7824983638834143
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7824983638834143
+ Cosine
+
+
+ 3766
+ 2486
+ 82.04159999999996
+ 3766
+ 0.8031131651260015
+ 3766.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8031131651260015
+ Cosine
+
+
+ 4694
+ 3766
+ -108.02139999999997
+ 4694
+ 0.7335510467062633
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7335510467062633
+ Cosine
+
+
+ 7665
+ 3766
+ -69.96199999999999
+ 7665
+ 0.8271184113305441
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8271184113305441
+ Cosine
+
+
+ 20868
+ 3766
+ -1.9365999999999985
+ 20868
+ 0.8182810964439488
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8182810964439488
+ Cosine
+
+
+ 26406
+ 3766
+ -67.99090000000001
+ 26406
+ 0.7934361596333377
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7934361596333377
+ Cosine
+
+
+ 10446
+ 284
+ -13.979399999999998
+ 10446
+ 0.8231431925469747
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8231431925469747
+ Cosine
+
+
+ 10446
+ 3667
+ 108.9882
+ 10446
+ 0.7013731424213507
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013731424213507
+ Cosine
+
+
+ 10446
+ 3771
+ 18.011400000000037
+ 10446
+ 0.7674937919319259
+ 10446.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7674937919319259
+ Cosine
+
+
+ 4539
+ 311
+ 30.009500000000003
+ 4539
+ 0.736800521392811
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.736800521392811
+ Cosine
+
+
+ 4539
+ 3667
+ 136.98359999999997
+ 4539
+ 0.7037384727274302
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7037384727274302
+ Cosine
+
+
+ 4539
+ 3771
+ 46.0068
+ 4539
+ 0.7155343538547397
+ 4539.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7155343538547397
+ Cosine
+
+
+ 6019
+ 5935
+ 0.00010000000000331966
+ 6019
+ 0.9999999999999993
+ 6019.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9999999999999993
+ Cosine
+
+
+ 1604
+ 1395
+ -23.999900000000025
+ 1604
+ 0.77006655272486
+ 1604.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.77006655272486
+ Cosine
+
+
+ 4525
+ 2513
+ -0.0004999999999881766
+ 4525
+ 0.941353246702249
+ 4525.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.941353246702249
+ Cosine
+
+
+ 26406
+ 2692
+ 19.044399999999996
+ 26406
+ 0.7694329722061235
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7694329722061235
+ Cosine
+
+
+ 26406
+ 7732
+ 19.981599999999958
+ 26406
+ 0.740963364564245
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.740963364564245
+ Cosine
+
+
+ 26406
+ 7681
+ 133.02959999999996
+ 26406
+ 0.7421771058411704
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7421771058411704
+ Cosine
+
+
+ 26406
+ 1322
+ -83.98580000000004
+ 26406
+ 0.8709551528021924
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8709551528021924
+ Cosine
+
+
+ 26406
+ 1376
+ -98.00150000000002
+ 26406
+ 0.7216100233358241
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7216100233358241
+ Cosine
+
+
+ 26406
+ 4500
+ -69.96980000000002
+ 26406
+ 0.8313967055731342
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8313967055731342
+ Cosine
+
+
+ 26406
+ 1164
+ -69.96960000000001
+ 26406
+ 0.7970604391265663
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7970604391265663
+ Cosine
+
+
+ 26406
+ 1967
+ -17.975300000000004
+ 26406
+ 0.7677301876855243
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7677301876855243
+ Cosine
+
+
+ 26406
+ 1307
+ -69.97040000000004
+ 26406
+ 0.7711044013193507
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7711044013193507
+ Cosine
+
+
+ 26406
+ 7795
+ 18.170299999999997
+ 26406
+ 0.7512511853016856
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7512511853016856
+ Cosine
+
+
+ 26406
+ 1240
+ 30.04570000000001
+ 26406
+ 0.7114364181836041
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7114364181836041
+ Cosine
+
+
+ 26406
+ 1296
+ -164.08640000000003
+ 26406
+ 0.7382379550237833
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7382379550237833
+ Cosine
+
+
+ 26406
+ 1335
+ 18.170299999999997
+ 26406
+ 0.7569061264823211
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7569061264823211
+ Cosine
+
+
+ 26406
+ 1449
+ 166.2083
+ 26406
+ 0.7224541626137382
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7224541626137382
+ Cosine
+
+
+ 26406
+ 1555
+ -17.97470000000004
+ 26406
+ 0.7207561319602911
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7207561319602911
+ Cosine
+
+
+ 26406
+ 2486
+ 14.05069999999995
+ 26406
+ 0.7064040308918483
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7064040308918483
+ Cosine
+
+
+ 26406
+ 7665
+ 1.9710999999999785
+ 26406
+ 0.8359818775999965
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8359818775999965
+ Cosine
+
+
+ 26406
+ 13737
+ -43.01030000000003
+ 26406
+ 0.7332192314147685
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7332192314147685
+ Cosine
+
+
+ 26406
+ 20868
+ -66.05430000000001
+ 26406
+ 0.8319535586918527
+ 26406.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8319535586918527
+ Cosine
+
+
+ 4679
+ 1653
+ -218.15060000000005
+ 4679
+ 0.7517045603340821
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7517045603340821
+ Cosine
+
+
+ 4785
+ 4679
+ -30.01159999999993
+ 4785
+ 0.7639185618930265
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7639185618930265
+ Cosine
+
+
+ 4679
+ 2783
+ -58.0412
+ 4679
+ 0.7832832988428708
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7832832988428708
+ Cosine
+
+
+ 4679
+ 2566
+ -86.07240000000002
+ 4679
+ 0.8025062027680925
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8025062027680925
+ Cosine
+
+
+ 4679
+ 1482
+ -130.0979000000001
+ 4679
+ 0.7741177270955443
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7741177270955443
+ Cosine
+
+
+ 4679
+ 2726
+ -44.02660000000003
+ 4679
+ 0.7804574401981137
+ 4679.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7804574401981137
+ Cosine
+
+
+ 7667
+ 4732
+ 2.015199999999993
+ 7667
+ 0.7252108652588771
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7252108652588771
+ Cosine
+
+
+ 1511
+ 270
+ 48.02109999999999
+ 1511
+ 0.7601368551757222
+ 1511.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7601368551757222
+ Cosine
+
+
+ 10258
+ 4775
+ -114.04760000000005
+ 10258
+ 0.728447873223556
+ 10258.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.728447873223556
+ Cosine
+
+
+ 914
+ 343
+ 0.0
+ 914
+ 0.9044059409483214
+ 914.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9044059409483214
+ Cosine
+
+
+ 1220
+ 914
+ -14.015199999999993
+ 1220
+ 0.7648067548917283
+ 1220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7648067548917283
+ Cosine
+
+
+ 7731
+ 914
+ -74.03559999999999
+ 7731
+ 0.7446438351732421
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7446438351732421
+ Cosine
+
+
+ 13596
+ 7810
+ -0.0004999999999881766
+ 13596
+ 0.7183885055241073
+ 13596.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7183885055241073
+ Cosine
+
+
+ 7667
+ 7628
+ 18.010800000000017
+ 7667
+ 0.7327776314829841
+ 7667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7327776314829841
+ Cosine
+
+
+ 4327
+ 1248
+ -0.00010000000000331966
+ 4327
+ 0.7574619904103219
+ 4327.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7574619904103219
+ Cosine
+
+
+ 4520
+ 1183
+ -0.0003999999999564352
+ 4520
+ 0.7853227760134743
+ 4520.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7853227760134743
+ Cosine
+
+
+ 58
+ 6
+ 152.99710000000005
+ 58
+ 0.7310805342297133
+ 58.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7310805342297133
+ Cosine
+
+
+ 11194
+ 5175
+ -0.0005000000000023874
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 11194
+ 25
+ 50.01079999999999
+ 11194
+ 0.7738824635537842
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7738824635537842
+ Cosine
+
+
+ 11194
+ 5194
+ -0.00030000000000995897
+ 11194
+ 0.9087915697477342
+ 11194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9087915697477342
+ Cosine
+
+
+ 4507
+ 1196
+ 17.025699999999972
+ 4507
+ 0.8647189816035392
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8647189816035392
+ Cosine
+
+
+ 2478
+ 1196
+ 3.011199999999974
+ 2478
+ 0.7918143968620416
+ 2478.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7918143968620416
+ Cosine
+
+
+ 4546
+ 1345
+ 0.0
+ 4546
+ 0.8206900618221651
+ 4546.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8206900618221651
+ Cosine
+
+
+ 7795
+ 2692
+ 0.8740999999999985
+ 7795
+ 0.7046384402100274
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7046384402100274
+ Cosine
+
+
+ 7795
+ 1322
+ -102.15610000000004
+ 7795
+ 0.7696498660638114
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7696498660638114
+ Cosine
+
+
+ 7795
+ 1376
+ -116.17180000000002
+ 7795
+ 0.7541647769910891
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7541647769910891
+ Cosine
+
+
+ 7795
+ 4500
+ -88.14010000000002
+ 7795
+ 0.8286106228280599
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8286106228280599
+ Cosine
+
+
+ 7795
+ 1164
+ -88.13990000000001
+ 7795
+ 0.8075784595832387
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8075784595832387
+ Cosine
+
+
+ 7795
+ 1967
+ -36.1456
+ 7795
+ 0.747074901877226
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.747074901877226
+ Cosine
+
+
+ 7795
+ 1307
+ -88.14070000000004
+ 7795
+ 0.7933181855897649
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7933181855897649
+ Cosine
+
+
+ 7795
+ 1240
+ 11.875400000000013
+ 7795
+ 0.7005075121434275
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7005075121434275
+ Cosine
+
+
+ 7795
+ 1296
+ -182.25670000000002
+ 7795
+ 0.7135762576531047
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7135762576531047
+ Cosine
+
+
+ 7795
+ 1335
+ 0.0
+ 7795
+ 0.7585331345833688
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7585331345833688
+ Cosine
+
+
+ 7795
+ 1449
+ 148.038
+ 7795
+ 0.7365534214562421
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7365534214562421
+ Cosine
+
+
+ 7795
+ 2486
+ -4.119600000000048
+ 7795
+ 0.7261215131126089
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7261215131126089
+ Cosine
+
+
+ 7795
+ 4694
+ 21.860199999999963
+ 7795
+ 0.7134592731505741
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7134592731505741
+ Cosine
+
+
+ 7795
+ 7665
+ -16.19920000000002
+ 7795
+ 0.7569625927332879
+ 7795.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7569625927332879
+ Cosine
+
+
+ 20868
+ 7795
+ 84.22460000000001
+ 20868
+ 0.8266232299790689
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8266232299790689
+ Cosine
+
+
+ 13790
+ 13744
+ -9.999999997489795e-05
+ 13790
+ 0.8012232629029546
+ 13790.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8012232629029546
+ Cosine
+
+
+ 2566
+ 1653
+ -132.07820000000004
+ 2566
+ 0.8846606792194505
+ 2566.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8846606792194505
+ Cosine
+
+
+ 4785
+ 2566
+ -116.08399999999995
+ 4785
+ 0.8551412833770435
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8551412833770435
+ Cosine
+
+
+ 2783
+ 2566
+ -28.031200000000013
+ 2783
+ 0.8843382233771084
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8843382233771084
+ Cosine
+
+
+ 2566
+ 1482
+ -44.02550000000008
+ 2566
+ 0.9407334877751925
+ 2566.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9407334877751925
+ Cosine
+
+
+ 2726
+ 2566
+ -42.045799999999986
+ 2726
+ 0.8497385009371045
+ 2726.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8497385009371045
+ Cosine
+
+
+ 1555
+ 1376
+ -80.02679999999998
+ 1555
+ 0.7024193837352215
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7024193837352215
+ Cosine
+
+
+ 4500
+ 1555
+ 51.99509999999998
+ 4500
+ 0.7723423924571776
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7723423924571776
+ Cosine
+
+
+ 1555
+ 1164
+ -51.99489999999997
+ 1555
+ 0.746271146897007
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.746271146897007
+ Cosine
+
+
+ 1967
+ 1555
+ 0.0005999999999630745
+ 1967
+ 0.8390195724644736
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8390195724644736
+ Cosine
+
+
+ 4694
+ 1555
+ -58.0052
+ 4694
+ 0.7343963218290284
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7343963218290284
+ Cosine
+
+
+ 7665
+ 1555
+ -19.94580000000002
+ 7665
+ 0.7297593959545514
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7297593959545514
+ Cosine
+
+
+ 1555
+ 1335
+ 36.14500000000004
+ 1555
+ 0.7101123824580223
+ 1555.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7101123824580223
+ Cosine
+
+
+ 13737
+ 1555
+ 25.035599999999988
+ 13737
+ 0.7084176195321624
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7084176195321624
+ Cosine
+
+
+ 1322
+ 1240
+ 114.03150000000005
+ 1322
+ 0.747141032642104
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.747141032642104
+ Cosine
+
+
+ 1376
+ 1240
+ 128.04720000000003
+ 1376
+ 0.7226335520468117
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7226335520468117
+ Cosine
+
+
+ 4500
+ 1240
+ 100.01550000000003
+ 4500
+ 0.7822436628771736
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7822436628771736
+ Cosine
+
+
+ 1240
+ 1164
+ -100.01530000000002
+ 1240
+ 0.7872140874571354
+ 1240.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7872140874571354
+ Cosine
+
+
+ 1967
+ 1240
+ 48.021000000000015
+ 1967
+ 0.751236825363835
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.751236825363835
+ Cosine
+
+
+ 20868
+ 1240
+ 96.10000000000002
+ 20868
+ 0.7601679422730914
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7601679422730914
+ Cosine
+
+
+ 1376
+ 1322
+ 14.015699999999981
+ 1376
+ 0.7517979220665135
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7517979220665135
+ Cosine
+
+
+ 1376
+ 1164
+ 28.031900000000007
+ 1376
+ 0.8168375504441131
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8168375504441131
+ Cosine
+
+
+ 1376
+ 1296
+ -66.0849
+ 1376
+ 0.7303227583978665
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7303227583978665
+ Cosine
+
+
+ 1376
+ 1335
+ 116.17180000000002
+ 1376
+ 0.7104922244190991
+ 1376.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7104922244190991
+ Cosine
+
+
+ 1967
+ 1376
+ -80.02620000000002
+ 1967
+ 0.7775443555570605
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7775443555570605
+ Cosine
+
+
+ 2486
+ 1376
+ -112.05219999999997
+ 2486
+ 0.7675851474166064
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7675851474166064
+ Cosine
+
+
+ 4500
+ 1376
+ -28.0317
+ 4500
+ 0.8108368286050882
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8108368286050882
+ Cosine
+
+
+ 4694
+ 1376
+ -138.03199999999998
+ 4694
+ 0.7329059327273093
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7329059327273093
+ Cosine
+
+
+ 7665
+ 1376
+ -99.9726
+ 7665
+ 0.7186670773968943
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7186670773968943
+ Cosine
+
+
+ 20868
+ 1376
+ -31.94720000000001
+ 20868
+ 0.7906294442491173
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7906294442491173
+ Cosine
+
+
+ 1170
+ 69
+ -0.0002000000000066393
+ 1170
+ 0.9301843579
+ 1170.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9301843579
+ Cosine
+
+
+ 4507
+ 2478
+ 14.014499999999998
+ 4507
+ 0.808934390784182
+ 4507.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.808934390784182
+ Cosine
+
+
+ 4694
+ 4500
+ -110.00029999999998
+ 4694
+ 0.7628576836893292
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7628576836893292
+ Cosine
+
+
+ 4694
+ 1967
+ -58.005799999999965
+ 4694
+ 0.7941437971340921
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7941437971340921
+ Cosine
+
+
+ 4694
+ 1307
+ -110.0009
+ 4694
+ 0.7161695363740572
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7161695363740572
+ Cosine
+
+
+ 4694
+ 1223
+ -74.00040000000001
+ 4694
+ 0.7244913667806309
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7244913667806309
+ Cosine
+
+
+ 4694
+ 1335
+ -21.860199999999963
+ 4694
+ 0.7214309685012016
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7214309685012016
+ Cosine
+
+
+ 4694
+ 2486
+ -25.97980000000001
+ 4694
+ 0.7690960920900176
+ 4694.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7690960920900176
+ Cosine
+
+
+ 7665
+ 4694
+ 38.05939999999998
+ 7665
+ 0.7229782167436878
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7229782167436878
+ Cosine
+
+
+ 2692
+ 1335
+ -0.8740999999999985
+ 2692
+ 0.7671774056073459
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7671774056073459
+ Cosine
+
+
+ 7732
+ 1335
+ -1.8112999999999602
+ 7732
+ 0.7192575937943765
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7192575937943765
+ Cosine
+
+
+ 1335
+ 1322
+ -102.15610000000004
+ 1335
+ 0.7794273300366701
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7794273300366701
+ Cosine
+
+
+ 4500
+ 1335
+ 88.14010000000002
+ 4500
+ 0.8253669799859673
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8253669799859673
+ Cosine
+
+
+ 2541
+ 1335
+ 50.16070000000002
+ 2541
+ 0.7188611386825592
+ 2541.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7188611386825592
+ Cosine
+
+
+ 1335
+ 1164
+ -88.13990000000001
+ 1335
+ 0.7862339773317886
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7862339773317886
+ Cosine
+
+
+ 1967
+ 1335
+ 36.1456
+ 1967
+ 0.769603314008003
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.769603314008003
+ Cosine
+
+
+ 1335
+ 1307
+ -88.14070000000004
+ 1335
+ 0.7293753672666943
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7293753672666943
+ Cosine
+
+
+ 1449
+ 1335
+ -148.038
+ 1449
+ 0.75446627470522
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.75446627470522
+ Cosine
+
+
+ 7665
+ 1335
+ 16.19920000000002
+ 7665
+ 0.7977469248244918
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7977469248244918
+ Cosine
+
+
+ 2486
+ 1335
+ 4.119600000000048
+ 2486
+ 0.7314787625687822
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7314787625687822
+ Cosine
+
+
+ 1335
+ 1223
+ -52.14020000000005
+ 1335
+ 0.7159080868333447
+ 1335.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7159080868333447
+ Cosine
+
+
+ 20868
+ 1335
+ 84.22460000000001
+ 20868
+ 0.7699151342189468
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7699151342189468
+ Cosine
+
+
+ 4573
+ 58
+ 257.0935
+ 4573
+ 0.706935411581155
+ 4573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.706935411581155
+ Cosine
+
+
+ 4573
+ 144
+ 183.07470000000006
+ 4573
+ 0.7306575001900386
+ 4573.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7306575001900386
+ Cosine
+
+
+ 2692
+ 1322
+ -103.03020000000004
+ 2692
+ 0.8037237935765797
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8037237935765797
+ Cosine
+
+
+ 7732
+ 1322
+ -103.9674
+ 7732
+ 0.7447465954502637
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7447465954502637
+ Cosine
+
+
+ 1322
+ 1164
+ 14.016200000000026
+ 1322
+ 0.8599688757297299
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8599688757297299
+ Cosine
+
+
+ 1322
+ 1296
+ -80.10059999999999
+ 1322
+ 0.7676739600785963
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7676739600785963
+ Cosine
+
+
+ 1322
+ 1307
+ 14.0154
+ 1322
+ 0.864784470439568
+ 1322.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.864784470439568
+ Cosine
+
+
+ 1449
+ 1322
+ -250.19410000000005
+ 1449
+ 0.7720104998939465
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7720104998939465
+ Cosine
+
+
+ 1967
+ 1322
+ -66.01050000000004
+ 1967
+ 0.7541416163138596
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7541416163138596
+ Cosine
+
+
+ 2486
+ 1322
+ -98.03649999999999
+ 2486
+ 0.7743683143934724
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7743683143934724
+ Cosine
+
+
+ 4500
+ 1322
+ -14.01600000000002
+ 4500
+ 0.8529575372097665
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8529575372097665
+ Cosine
+
+
+ 7665
+ 1322
+ -85.95690000000002
+ 7665
+ 0.8149620201454973
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8149620201454973
+ Cosine
+
+
+ 20868
+ 1322
+ -17.931500000000028
+ 20868
+ 0.820874081309024
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.820874081309024
+ Cosine
+
+
+ 13754
+ 13613
+ -36.02120000000008
+ 13754
+ 0.7922081919739075
+ 13754.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7922081919739075
+ Cosine
+
+
+ 13826
+ 7681
+ -111.08050000000003
+ 13826
+ 0.7433325161166867
+ 13826.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7433325161166867
+ Cosine
+
+
+ 13826
+ 1449
+ -77.90179999999998
+ 13826
+ 0.7138967438535335
+ 13826.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7138967438535335
+ Cosine
+
+
+ 144
+ 58
+ 74.01879999999994
+ 144
+ 0.9059964421265759
+ 144.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9059964421265759
+ Cosine
+
+
+ 3667
+ 311
+ -106.97409999999996
+ 3667
+ 0.729061707323615
+ 3667.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.729061707323615
+ Cosine
+
+
+ 3771
+ 311
+ -15.997299999999996
+ 3771
+ 0.7845694238665184
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7845694238665184
+ Cosine
+
+
+ 270
+ 160
+ 12.010800000000017
+ 270
+ 0.7241078154133718
+ 270.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7241078154133718
+ Cosine
+
+
+ 20868
+ 2692
+ 85.09870000000001
+ 20868
+ 0.7787500818087499
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7787500818087499
+ Cosine
+
+
+ 20868
+ 7732
+ 86.03589999999997
+ 20868
+ 0.7234752674501574
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7234752674501574
+ Cosine
+
+
+ 20868
+ 7681
+ 199.08389999999997
+ 20868
+ 0.7248908224870868
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7248908224870868
+ Cosine
+
+
+ 20868
+ 4500
+ -3.9155000000000086
+ 20868
+ 0.8468056052169505
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8468056052169505
+ Cosine
+
+
+ 20868
+ 1164
+ -3.915300000000002
+ 20868
+ 0.8385704810654367
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8385704810654367
+ Cosine
+
+
+ 20868
+ 1967
+ 48.07900000000001
+ 20868
+ 0.765975452274393
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.765975452274393
+ Cosine
+
+
+ 20868
+ 1307
+ -3.9161000000000286
+ 20868
+ 0.7891937493682792
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7891937493682792
+ Cosine
+
+
+ 20868
+ 1449
+ 232.26260000000002
+ 20868
+ 0.732703409851635
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.732703409851635
+ Cosine
+
+
+ 20868
+ 7665
+ 68.02539999999999
+ 20868
+ 0.8401956933492667
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8401956933492667
+ Cosine
+
+
+ 20868
+ 1296
+ -98.03210000000001
+ 20868
+ 0.7955996313035669
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7955996313035669
+ Cosine
+
+
+ 20868
+ 2486
+ 80.10499999999996
+ 20868
+ 0.759322934591776
+ 20868.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.759322934591776
+ Cosine
+
+
+ 7681
+ 1449
+ 33.17870000000005
+ 7681
+ 0.707636380233894
+ 7681.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.707636380233894
+ Cosine
+
+
+ 7681
+ 7665
+ -131.05849999999998
+ 7681
+ 0.7570436998465625
+ 7681.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7570436998465625
+ Cosine
+
+
+ 7665
+ 2692
+ 17.073300000000017
+ 7665
+ 0.7635829200286655
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7635829200286655
+ Cosine
+
+
+ 7732
+ 7665
+ -18.01049999999998
+ 7732
+ 0.8169616154115102
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8169616154115102
+ Cosine
+
+
+ 7665
+ 4500
+ -71.9409
+ 7665
+ 0.8244621507842091
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8244621507842091
+ Cosine
+
+
+ 7665
+ 1164
+ -71.94069999999999
+ 7665
+ 0.8086314183206176
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8086314183206176
+ Cosine
+
+
+ 7665
+ 1967
+ -19.946399999999983
+ 7665
+ 0.7565935573311073
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7565935573311073
+ Cosine
+
+
+ 7665
+ 1307
+ -71.94150000000002
+ 7665
+ 0.7671314492813278
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7671314492813278
+ Cosine
+
+
+ 7665
+ 1449
+ 164.23720000000003
+ 7665
+ 0.7480574224077419
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7480574224077419
+ Cosine
+
+
+ 7665
+ 1296
+ -166.0575
+ 7665
+ 0.7353197669312269
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7353197669312269
+ Cosine
+
+
+ 7665
+ 2486
+ 12.07959999999997
+ 7665
+ 0.7409569964360518
+ 7665.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7409569964360518
+ Cosine
+
+
+ 13737
+ 7665
+ 44.98140000000001
+ 13737
+ 0.7577152170860092
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7577152170860092
+ Cosine
+
+
+ 10291
+ 1395
+ -21.985000000000014
+ 10291
+ 0.7178795767128796
+ 10291.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7178795767128796
+ Cosine
+
+
+ 7624
+ 7620
+ 15.996199999999988
+ 7624
+ 0.7871534101893296
+ 7624.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7871534101893296
+ Cosine
+
+
+ 3771
+ 3667
+ 90.97679999999997
+ 3771
+ 0.7991555312519071
+ 3771.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7991555312519071
+ Cosine
+
+
+ 25587
+ 3771
+ -172.1071
+ 25587
+ 0.7013988842172946
+ 25587.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7013988842172946
+ Cosine
+
+
+ 7731
+ 3771
+ 88.1055
+ 7731
+ 0.7308237095596543
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7308237095596543
+ Cosine
+
+
+ 4500
+ 1164
+ 0.0002000000000066393
+ 4500
+ 0.9235102377308329
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.9235102377308329
+ Cosine
+
+
+ 4500
+ 1307
+ -0.0006000000000199179
+ 4500
+ 0.8344800226211502
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8344800226211502
+ Cosine
+
+
+ 4500
+ 1449
+ 236.17810000000003
+ 4500
+ 0.7714002330920218
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7714002330920218
+ Cosine
+
+
+ 4500
+ 1967
+ 51.994500000000016
+ 4500
+ 0.8582728033464271
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8582728033464271
+ Cosine
+
+
+ 4500
+ 2486
+ 84.02049999999997
+ 4500
+ 0.7897263266772947
+ 4500.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7897263266772947
+ Cosine
+
+
+ 5194
+ 5175
+ -0.00019999999999242846
+ 5194
+ 1.0000000000000002
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 1.0000000000000002
+ Cosine
+
+
+ 5194
+ 25
+ 50.0111
+ 5194
+ 0.7765014360319091
+ 5194.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 2692
+ 1164
+ -89.01400000000001
+ 2692
+ 0.7526547952040179
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7526547952040179
+ Cosine
+
+
+ 2692
+ 1307
+ -89.01480000000004
+ 2692
+ 0.7244014068297405
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7244014068297405
+ Cosine
+
+
+ 2692
+ 1449
+ 147.1639
+ 2692
+ 0.7215763112128273
+ 2692.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7215763112128273
+ Cosine
+
+
+ 7732
+ 2692
+ -0.9371999999999616
+ 7732
+ 0.7041795924909788
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7041795924909788
+ Cosine
+
+
+ 1449
+ 1164
+ -236.17790000000002
+ 1449
+ 0.7574059084406363
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7574059084406363
+ Cosine
+
+
+ 1449
+ 1307
+ -236.17870000000005
+ 1449
+ 0.7142434858760744
+ 1449.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7142434858760744
+ Cosine
+
+
+ 7731
+ 3667
+ 179.08229999999998
+ 7731
+ 0.8393159151728491
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8393159151728491
+ Cosine
+
+
+ 1653
+ 1482
+ 88.05269999999996
+ 1653
+ 0.889803375072796
+ 1653.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.889803375072796
+ Cosine
+
+
+ 4785
+ 1482
+ -160.10950000000003
+ 4785
+ 0.8560244789575602
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8560244789575602
+ Cosine
+
+
+ 2783
+ 1482
+ -72.05670000000009
+ 2783
+ 0.8750686816709272
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8750686816709272
+ Cosine
+
+
+ 2726
+ 1482
+ -86.07130000000006
+ 2726
+ 0.8451853914117339
+ 2726.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8451853914117339
+ Cosine
+
+
+ 1220
+ 343
+ -14.015199999999993
+ 1220
+ 0.8485677609267931
+ 1220.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8485677609267931
+ Cosine
+
+
+ 7731
+ 343
+ -74.03559999999999
+ 7731
+ 0.8103733437255778
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8103733437255778
+ Cosine
+
+
+ 4785
+ 1653
+ -248.16219999999998
+ 4785
+ 0.8006292822939076
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8006292822939076
+ Cosine
+
+
+ 4785
+ 2726
+ -74.03819999999996
+ 4785
+ 0.8346810212301915
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8346810212301915
+ Cosine
+
+
+ 4785
+ 2783
+ -88.05279999999993
+ 4785
+ 0.8554814016674146
+ 4785.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8554814016674146
+ Cosine
+
+
+ 5175
+ 25
+ 50.01129999999999
+ 5175
+ 0.7765014360319091
+ 5175.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7765014360319091
+ Cosine
+
+
+ 7732
+ 2486
+ -5.930900000000008
+ 7732
+ 0.71852824293517
+ 7732.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.71852824293517
+ Cosine
+
+
+ 25
+ 22
+ 43.989900000000006
+ 25
+ 0.7413654149145841
+ 25.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7413654149145841
+ Cosine
+
+
+ 2783
+ 1653
+ -160.10940000000005
+ 2783
+ 0.8495209354306571
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8495209354306571
+ Cosine
+
+
+ 2783
+ 2726
+ 14.014599999999973
+ 2783
+ 0.8660101192935002
+ 2783.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8660101192935002
+ Cosine
+
+
+ 13737
+ 1967
+ 25.035000000000025
+ 13737
+ 0.7525488722971712
+ 13737.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7525488722971712
+ Cosine
+
+
+ 2541
+ 1223
+ -1.97950000000003
+ 2541
+ 0.7050199860534161
+ 2541.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7050199860534161
+ Cosine
+
+
+ 1307
+ 1164
+ 0.0008000000000265572
+ 1307
+ 0.8229714951102252
+ 1307.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8229714951102252
+ Cosine
+
+
+ 1967
+ 1164
+ -51.99430000000001
+ 1967
+ 0.8192930619368571
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8192930619368571
+ Cosine
+
+
+ 2486
+ 1164
+ -84.02029999999996
+ 2486
+ 0.7846481744200678
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7846481744200678
+ Cosine
+
+
+ 2726
+ 1653
+ -174.12400000000002
+ 2726
+ 0.82344307100337
+ 2726.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.82344307100337
+ Cosine
+
+
+ 1297
+ 1270
+ 17.02660000000003
+ 1297
+ 0.8351029425806448
+ 1297.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8351029425806448
+ Cosine
+
+
+ 1967
+ 1307
+ -51.995100000000036
+ 1967
+ 0.7374725081175358
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7374725081175358
+ Cosine
+
+
+ 2486
+ 1307
+ -84.02109999999999
+ 2486
+ 0.7096972935586895
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7096972935586895
+ Cosine
+
+
+ 7731
+ 3770
+ 11.053299999999979
+ 7731
+ 0.8045708020018703
+ 7731.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.8045708020018703
+ Cosine
+
+
+ 1967
+ 1223
+ -15.994600000000048
+ 1967
+ 0.7666061714426515
+ 1967.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7666061714426515
+ Cosine
+
+
+ 2486
+ 1967
+ -32.025999999999954
+ 2486
+ 0.7522370090304027
+ 2486.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7522370090304027
+ Cosine
+
+
+ 26810
+ 3674
+ 9.999999997489795e-05
+ 26810
+ 0.7575734214212644
+ 26810.0
+ -1
+ Spec2Vec
+ Spec2Vec
+ 0.7575734214212644
+ Cosine
+
+
\ No newline at end of file
diff --git a/spec2vec/tools/spec2vec/create_graphml.py b/spec2vec/tools/spec2vec/create_graphml.py
index 331487ad..9560e753 100644
--- a/spec2vec/tools/spec2vec/create_graphml.py
+++ b/spec2vec/tools/spec2vec/create_graphml.py
@@ -57,6 +57,16 @@ def main():
output_pairs = os.path.join(args.output_folder, "filtered_pairs.tsv")
molecular_network_filtering_library.output_graph_with_headers(G, output_pairs)
+ # Reset component index based on the new network topology
+ component_index = 0
+ for component in nx.connected_components(G):
+ component_index += 1
+ for node in component:
+ if len(component) == 1:
+ G.node[node]['componentindex'] = "-1"
+ else:
+ G.node[node]['componentindex'] = str(component_index)
+
nx.write_graphml(G, output_graphml)
if __name__ == "__main__":