From fa6fc62e0a4816938d52a5673b982b5110a40e5e Mon Sep 17 00:00:00 2001 From: kaikato Date: Thu, 17 Jul 2025 21:10:49 +0000 Subject: [PATCH] v2.0.0 SDK --- .devcontainer/Dockerfile | 9 + .devcontainer/devcontainer.json | 43 + .github/workflows/ci.yml | 83 + .gitignore | 16 +- .pre-commit-config.yaml | 19 - .python-version | 1 + .stats.yml | 4 + Brewfile | 2 + CHANGELOG.md | 4 + CONTRIBUTING.md | 128 ++ LICENSE | 2 +- MIGRATING.md | 257 +++ README.md | 402 +++- SECURITY.md | 27 + api.md | 41 + bin/publish-pypi | 6 + demo/.env.example | 7 - demo/.gitignore | 2 - demo/convert.py | 22 - demo/create_voice.py | 24 - demo/hackathon-template/.gitignore | 2 - demo/hackathon-template/README.md | 52 - demo/hackathon-template/config/config.yaml | 15 - demo/hackathon-template/requirements.txt | 4 - demo/hackathon-template/scripts/lmnt_agent.py | 275 --- demo/sample-audio-input.mp3 | Bin 131937 -> 0 bytes demo/stream.py | 55 - demo/synthesize.py | 32 - examples/.keep | 4 + examples/create-voice.py | 13 + examples/generate.py | 26 + examples/generate_async.py | 36 + examples/speech_session.py | 41 + mypy.ini | 50 + noxfile.py | 9 + pyproject.toml | 223 +- requirements-dev.lock | 137 ++ requirements.lock | 74 + scripts/bootstrap | 19 + scripts/format | 8 + scripts/lint | 11 + scripts/mock | 41 + scripts/test | 61 + scripts/utils/ruffen-docs.py | 167 ++ setup.py | 30 - src/lmnt/__init__.py | 90 + src/lmnt/_base_client.py | 1992 +++++++++++++++++ src/lmnt/_client.py | 410 ++++ src/lmnt/_compat.py | 219 ++ src/lmnt/_constants.py | 14 + src/lmnt/_exceptions.py | 108 + src/lmnt/_files.py | 123 + src/lmnt/_models.py | 808 +++++++ src/lmnt/_qs.py | 150 ++ src/lmnt/_resource.py | 43 + src/lmnt/_response.py | 830 +++++++ src/lmnt/_streaming.py | 333 +++ src/lmnt/_types.py | 219 ++ src/lmnt/_utils/__init__.py | 57 + src/lmnt/_utils/_logs.py | 25 + src/lmnt/_utils/_proxy.py | 65 + src/lmnt/_utils/_reflection.py | 42 + src/lmnt/_utils/_resources_proxy.py | 24 + src/lmnt/_utils/_streams.py | 12 + src/lmnt/_utils/_sync.py | 86 + src/lmnt/_utils/_transform.py | 447 ++++ src/lmnt/_utils/_typing.py | 151 ++ src/lmnt/_utils/_utils.py | 422 ++++ src/lmnt/_version.py | 4 + src/lmnt/api.py | 502 ----- src/lmnt/lib/.keep | 4 + src/lmnt/lib/__init__.py | 3 + src/lmnt/lib/websocket_streaming.py | 147 ++ src/lmnt/py.typed | 0 src/lmnt/resources/__init__.py | 49 + src/lmnt/resources/accounts.py | 135 ++ src/lmnt/resources/sessions.py | 43 + src/lmnt/resources/speech.py | 845 +++++++ src/lmnt/resources/voices.py | 628 ++++++ src/lmnt/types/__init__.py | 16 + src/lmnt/types/account_retrieve_response.py | 40 + src/lmnt/types/speech_convert_params.py | 75 + .../types/speech_generate_detailed_params.py | 99 + .../speech_generate_detailed_response.py | 41 + src/lmnt/types/speech_generate_params.py | 96 + src/lmnt/types/voice.py | 40 + src/lmnt/types/voice_create_params.py | 37 + src/lmnt/types/voice_delete_response.py | 9 + src/lmnt/types/voice_list_params.py | 15 + src/lmnt/types/voice_list_response.py | 10 + src/lmnt/types/voice_update_params.py | 21 + src/lmnt/types/voice_update_response.py | 11 + test/README.md | 8 - test/filename.wav | Bin 42044 -> 0 bytes test/integration/smoke_test.py | 268 --- test/unit/test_speech.py | 165 -- test/unit/test_voice.py | 185 -- tests/__init__.py | 1 + tests/api_resources/__init__.py | 1 + tests/api_resources/test_accounts.py | 74 + tests/api_resources/test_speech.py | 386 ++++ tests/api_resources/test_voices.py | 449 ++++ tests/conftest.py | 84 + tests/sample_file.txt | 1 + tests/test_client.py | 1688 ++++++++++++++ tests/test_deepcopy.py | 58 + tests/test_extract_files.py | 64 + tests/test_files.py | 51 + tests/test_models.py | 936 ++++++++ tests/test_qs.py | 78 + tests/test_required_args.py | 111 + tests/test_response.py | 277 +++ tests/test_streaming.py | 248 ++ tests/test_transform.py | 453 ++++ tests/test_utils/test_proxy.py | 34 + tests/test_utils/test_typing.py | 73 + tests/utils.py | 159 ++ 117 files changed, 16162 insertions(+), 1714 deletions(-) create mode 100644 .devcontainer/Dockerfile create mode 100644 .devcontainer/devcontainer.json create mode 100644 .github/workflows/ci.yml delete mode 100644 .pre-commit-config.yaml create mode 100644 .python-version create mode 100644 .stats.yml create mode 100644 Brewfile create mode 100644 CONTRIBUTING.md create mode 100644 MIGRATING.md create mode 100644 SECURITY.md create mode 100644 api.md create mode 100644 bin/publish-pypi delete mode 100644 demo/.env.example delete mode 100644 demo/.gitignore delete mode 100644 demo/convert.py delete mode 100644 demo/create_voice.py delete mode 100644 demo/hackathon-template/.gitignore delete mode 100644 demo/hackathon-template/README.md delete mode 100644 demo/hackathon-template/config/config.yaml delete mode 100644 demo/hackathon-template/requirements.txt delete mode 100644 demo/hackathon-template/scripts/lmnt_agent.py delete mode 100644 demo/sample-audio-input.mp3 delete mode 100644 demo/stream.py delete mode 100644 demo/synthesize.py create mode 100644 examples/.keep create mode 100644 examples/create-voice.py create mode 100644 examples/generate.py create mode 100644 examples/generate_async.py create mode 100644 examples/speech_session.py create mode 100644 mypy.ini create mode 100644 noxfile.py create mode 100644 requirements-dev.lock create mode 100644 requirements.lock create mode 100755 scripts/bootstrap create mode 100755 scripts/format create mode 100755 scripts/lint create mode 100755 scripts/mock create mode 100755 scripts/test create mode 100644 scripts/utils/ruffen-docs.py delete mode 100644 setup.py create mode 100644 src/lmnt/__init__.py create mode 100644 src/lmnt/_base_client.py create mode 100644 src/lmnt/_client.py create mode 100644 src/lmnt/_compat.py create mode 100644 src/lmnt/_constants.py create mode 100644 src/lmnt/_exceptions.py create mode 100644 src/lmnt/_files.py create mode 100644 src/lmnt/_models.py create mode 100644 src/lmnt/_qs.py create mode 100644 src/lmnt/_resource.py create mode 100644 src/lmnt/_response.py create mode 100644 src/lmnt/_streaming.py create mode 100644 src/lmnt/_types.py create mode 100644 src/lmnt/_utils/__init__.py create mode 100644 src/lmnt/_utils/_logs.py create mode 100644 src/lmnt/_utils/_proxy.py create mode 100644 src/lmnt/_utils/_reflection.py create mode 100644 src/lmnt/_utils/_resources_proxy.py create mode 100644 src/lmnt/_utils/_streams.py create mode 100644 src/lmnt/_utils/_sync.py create mode 100644 src/lmnt/_utils/_transform.py create mode 100644 src/lmnt/_utils/_typing.py create mode 100644 src/lmnt/_utils/_utils.py create mode 100644 src/lmnt/_version.py delete mode 100644 src/lmnt/api.py create mode 100644 src/lmnt/lib/.keep create mode 100644 src/lmnt/lib/__init__.py create mode 100644 src/lmnt/lib/websocket_streaming.py create mode 100644 src/lmnt/py.typed create mode 100644 src/lmnt/resources/__init__.py create mode 100644 src/lmnt/resources/accounts.py create mode 100644 src/lmnt/resources/sessions.py create mode 100644 src/lmnt/resources/speech.py create mode 100644 src/lmnt/resources/voices.py create mode 100644 src/lmnt/types/__init__.py create mode 100644 src/lmnt/types/account_retrieve_response.py create mode 100644 src/lmnt/types/speech_convert_params.py create mode 100644 src/lmnt/types/speech_generate_detailed_params.py create mode 100644 src/lmnt/types/speech_generate_detailed_response.py create mode 100644 src/lmnt/types/speech_generate_params.py create mode 100644 src/lmnt/types/voice.py create mode 100644 src/lmnt/types/voice_create_params.py create mode 100644 src/lmnt/types/voice_delete_response.py create mode 100644 src/lmnt/types/voice_list_params.py create mode 100644 src/lmnt/types/voice_list_response.py create mode 100644 src/lmnt/types/voice_update_params.py create mode 100644 src/lmnt/types/voice_update_response.py delete mode 100644 test/README.md delete mode 100644 test/filename.wav delete mode 100644 test/integration/smoke_test.py delete mode 100644 test/unit/test_speech.py delete mode 100644 test/unit/test_voice.py create mode 100644 tests/__init__.py create mode 100644 tests/api_resources/__init__.py create mode 100644 tests/api_resources/test_accounts.py create mode 100644 tests/api_resources/test_speech.py create mode 100644 tests/api_resources/test_voices.py create mode 100644 tests/conftest.py create mode 100644 tests/sample_file.txt create mode 100644 tests/test_client.py create mode 100644 tests/test_deepcopy.py create mode 100644 tests/test_extract_files.py create mode 100644 tests/test_files.py create mode 100644 tests/test_models.py create mode 100644 tests/test_qs.py create mode 100644 tests/test_required_args.py create mode 100644 tests/test_response.py create mode 100644 tests/test_streaming.py create mode 100644 tests/test_transform.py create mode 100644 tests/test_utils/test_proxy.py create mode 100644 tests/test_utils/test_typing.py create mode 100644 tests/utils.py diff --git a/.devcontainer/Dockerfile b/.devcontainer/Dockerfile new file mode 100644 index 0000000..ff261ba --- /dev/null +++ b/.devcontainer/Dockerfile @@ -0,0 +1,9 @@ +ARG VARIANT="3.9" +FROM mcr.microsoft.com/vscode/devcontainers/python:0-${VARIANT} + +USER vscode + +RUN curl -sSf https://rye.astral.sh/get | RYE_VERSION="0.44.0" RYE_INSTALL_OPTION="--yes" bash +ENV PATH=/home/vscode/.rye/shims:$PATH + +RUN echo "[[ -d .venv ]] && source .venv/bin/activate || export PATH=\$PATH" >> /home/vscode/.bashrc diff --git a/.devcontainer/devcontainer.json b/.devcontainer/devcontainer.json new file mode 100644 index 0000000..c17fdc1 --- /dev/null +++ b/.devcontainer/devcontainer.json @@ -0,0 +1,43 @@ +// For format details, see https://aka.ms/devcontainer.json. For config options, see the +// README at: https://github.com/devcontainers/templates/tree/main/src/debian +{ + "name": "Debian", + "build": { + "dockerfile": "Dockerfile", + "context": ".." + }, + + "postStartCommand": "rye sync --all-features", + + "customizations": { + "vscode": { + "extensions": [ + "ms-python.python" + ], + "settings": { + "terminal.integrated.shell.linux": "/bin/bash", + "python.pythonPath": ".venv/bin/python", + "python.defaultInterpreterPath": ".venv/bin/python", + "python.typeChecking": "basic", + "terminal.integrated.env.linux": { + "PATH": "/home/vscode/.rye/shims:${env:PATH}" + } + } + } + }, + "features": { + "ghcr.io/devcontainers/features/node:1": {} + } + + // Features to add to the dev container. More info: https://containers.dev/features. + // "features": {}, + + // Use 'forwardPorts' to make a list of ports inside the container available locally. + // "forwardPorts": [], + + // Configure tool-specific properties. + // "customizations": {}, + + // Uncomment to connect as root instead. More info: https://aka.ms/dev-containers-non-root. + // "remoteUser": "root" +} diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml new file mode 100644 index 0000000..600325f --- /dev/null +++ b/.github/workflows/ci.yml @@ -0,0 +1,83 @@ +name: CI +on: + push: + branches-ignore: + - 'generated' + - 'codegen/**' + - 'integrated/**' + - 'stl-preview-head/**' + - 'stl-preview-base/**' + pull_request: + branches-ignore: + - 'stl-preview-head/**' + - 'stl-preview-base/**' + +jobs: + lint: + timeout-minutes: 10 + name: lint + runs-on: ${{ github.repository == 'stainless-sdks/lmnt-com-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + if: github.event_name == 'push' || github.event.pull_request.head.repo.fork + steps: + - uses: actions/checkout@v4 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Install dependencies + run: rye sync --all-features + + - name: Run lints + run: ./scripts/lint + + build: + if: github.repository == 'stainless-sdks/lmnt-com-python' && (github.event_name == 'push' || github.event.pull_request.head.repo.fork) + timeout-minutes: 10 + name: build + permissions: + contents: read + id-token: write + runs-on: depot-ubuntu-24.04 + steps: + - uses: actions/checkout@v4 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Install dependencies + run: rye sync --all-features + + - name: Run build + run: rye build + + test: + timeout-minutes: 10 + name: test + runs-on: ${{ github.repository == 'stainless-sdks/lmnt-com-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + if: github.event_name == 'push' || github.event.pull_request.head.repo.fork + steps: + - uses: actions/checkout@v4 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Bootstrap + run: ./scripts/bootstrap + + - name: Run tests + run: ./scripts/test diff --git a/.gitignore b/.gitignore index c14b1f1..8779740 100644 --- a/.gitignore +++ b/.gitignore @@ -1,2 +1,16 @@ -*.egg-info +.prism.log +.vscode +_dev + __pycache__ +.mypy_cache + +dist + +.venv +.idea + +.env +.envrc +codegen.log +Brewfile.lock.json diff --git a/.pre-commit-config.yaml b/.pre-commit-config.yaml deleted file mode 100644 index 00c9453..0000000 --- a/.pre-commit-config.yaml +++ /dev/null @@ -1,19 +0,0 @@ -repos: - - repo: https://github.com/astral-sh/ruff-pre-commit - # Ruff version. - rev: v0.4.4 - hooks: - - id: ruff - args: ['--preview'] - - - repo: https://github.com/pre-commit/pre-commit-hooks - rev: v4.4.0 - hooks: - - id: check-merge-conflict - - id: end-of-file-fixer - - id: trailing-whitespace - - - repo: https://github.com/hhatto/autopep8 - rev: v2.0.4 - hooks: - - id: autopep8 diff --git a/.python-version b/.python-version new file mode 100644 index 0000000..43077b2 --- /dev/null +++ b/.python-version @@ -0,0 +1 @@ +3.9.18 diff --git a/.stats.yml b/.stats.yml new file mode 100644 index 0000000..e54602e --- /dev/null +++ b/.stats.yml @@ -0,0 +1,4 @@ +configured_endpoints: 9 +openapi_spec_url: https://storage.googleapis.com/stainless-sdk-openapi-specs/lmnt-kaikato-aryp6r%2Flmnt-com-bb5e3ea3764ab85fa5197dccdc44d6761afd3527e2e7357e151855321df90f11.yml +openapi_spec_hash: de11240efa6269c031db88972128b35d +config_hash: ad76a808facacf5f53e58d591653bac6 diff --git a/Brewfile b/Brewfile new file mode 100644 index 0000000..492ca37 --- /dev/null +++ b/Brewfile @@ -0,0 +1,2 @@ +brew "rye" + diff --git a/CHANGELOG.md b/CHANGELOG.md index f80ca3c..65322a4 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -1,3 +1,7 @@ +# 2.0.0 +July 17, 2025 +- **BREAKING CHANGES**: The new v2 SDK provides more streaming functionality, a more modern, type-safe interface with better error handling, and improved performance. To migrate from the legacy v1 SDK, please update your code to use the new behavior or pin to a previous version if preferred. More details in the [migration guide](./MIGRATING.md). + # 1.1.0 Jan 3, 2024 - `synthesize_streaming` will now return a `buffer_empty` boolean when extras are requested. This can be used to determine when the server has no more audio to send after the client has sent a `flush` message. diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md new file mode 100644 index 0000000..d473a16 --- /dev/null +++ b/CONTRIBUTING.md @@ -0,0 +1,128 @@ +## Setting up the environment + +### With Rye + +We use [Rye](https://rye.astral.sh/) to manage dependencies because it will automatically provision a Python environment with the expected Python version. To set it up, run: + +```sh +$ ./scripts/bootstrap +``` + +Or [install Rye manually](https://rye.astral.sh/guide/installation/) and run: + +```sh +$ rye sync --all-features +``` + +You can then run scripts using `rye run python script.py` or by activating the virtual environment: + +```sh +# Activate the virtual environment - https://docs.python.org/3/library/venv.html#how-venvs-work +$ source .venv/bin/activate + +# now you can omit the `rye run` prefix +$ python script.py +``` + +### Without Rye + +Alternatively if you don't want to install `Rye`, you can stick with the standard `pip` setup by ensuring you have the Python version specified in `.python-version`, create a virtual environment however you desire and then install dependencies using this command: + +```sh +$ pip install -r requirements-dev.lock +``` + +## Modifying/Adding code + +Most of the SDK is generated code. Modifications to code will be persisted between generations, but may +result in merge conflicts between manual patches and changes from the generator. The generator will never +modify the contents of the `src/lmnt/lib/` and `examples/` directories. + +## Adding and running examples + +All files in the `examples/` directory are not modified by the generator and can be freely edited or added to. + +```py +# add an example to examples/.py + +#!/usr/bin/env -S rye run python +… +``` + +```sh +$ chmod +x examples/.py +# run the example against your api +$ ./examples/.py +``` + +## Using the repository from source + +If you’d like to use the repository from source, you can either install from git or link to a cloned repository: + +To install via git: + +```sh +$ pip install git+ssh://git@github.com/stainless-sdks/lmnt-com-python.git +``` + +Alternatively, you can build from source and install the wheel file: + +Building this package will create two files in the `dist/` directory, a `.tar.gz` containing the source files and a `.whl` that can be used to install the package efficiently. + +To create a distributable version of the library, all you have to do is run this command: + +```sh +$ rye build +# or +$ python -m build +``` + +Then to install: + +```sh +$ pip install ./path-to-wheel-file.whl +``` + +## Running tests + +Most tests require you to [set up a mock server](https://github.com/stoplightio/prism) against the OpenAPI spec to run the tests. + +```sh +# you will need npm installed +$ npx prism mock path/to/your/openapi.yml +``` + +```sh +$ ./scripts/test +``` + +## Linting and formatting + +This repository uses [ruff](https://github.com/astral-sh/ruff) and +[black](https://github.com/psf/black) to format the code in the repository. + +To lint: + +```sh +$ ./scripts/lint +``` + +To format and fix all ruff issues automatically: + +```sh +$ ./scripts/format +``` + +## Publishing and releases + +Changes made to this repository via the automated release PR pipeline should publish to PyPI automatically. If +the changes aren't made through the automated pipeline, you may want to make releases manually. + +### Publish with a GitHub workflow + +You can release to package managers by using [the `Publish PyPI` GitHub action](https://www.github.com/stainless-sdks/lmnt-com-python/actions/workflows/publish-pypi.yml). This requires a setup organization or repository secret to be set up. + +### Publish manually + +If you need to manually release a package, you can run the `bin/publish-pypi` script with a `PYPI_TOKEN` set on +the environment. diff --git a/LICENSE b/LICENSE index 7d263e8..cc61166 100644 --- a/LICENSE +++ b/LICENSE @@ -186,7 +186,7 @@ same "printed page" as the copyright notice for easier identification within third-party archives. - Copyright 2023 LMNT, Inc. + Copyright 2025 Lmnt Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/MIGRATING.md b/MIGRATING.md new file mode 100644 index 0000000..45e488e --- /dev/null +++ b/MIGRATING.md @@ -0,0 +1,257 @@ +# Migrating from lmnt-python to lmnt-com-python + +This guide helps you migrate from the legacy v1 SDK to the new v2 SDK. The new SDK provides more streaming functionality, a more modern, type-safe interface with better error handling, and improved performance. + +## Installation + +```bash +# Remove the old SDK +pip uninstall lmnt + +# Install the new SDK +pip install lmnt +``` + +## Key Changes + +### Client Initialization + +```python +# Old SDK (lmnt-python) +import asyncio +from lmnt.api import Speech + +async def main(): + async with Speech('your-api-key') as speech: + # Use speech client + pass + +# New SDK (lmnt-com-python) +from lmnt import Lmnt, AsyncLmnt + +# Synchronous client +client = Lmnt() # Uses LMNT_API_KEY environment variable + +# Async client +async def main(): + client = AsyncLmnt() # Uses LMNT_API_KEY environment variable + # Use client +``` + +### Speech Synthesis + +```python +# Old SDK +async with Speech('your-api-key') as speech: + result = await speech.synthesize('Hello world', 'voice-id') + # result: {'audio': bytes, 'durations': [...], 'seed': 123} + with open('output.mp3', 'wb') as f: + f.write(result['audio']) + +# New SDK - Synchronous +client = Lmnt() +response = client.speech.generate( + text='Hello world', + voice='voice-id', +) +# response: BinaryAPIResponse +with open('output.mp3', 'wb') as f: + f.write(response.read()) + +# New SDK - Async +async def main(): + client = AsyncLmnt() + response = await client.speech.generate( + text='Hello world', + voice='voice-id', + ) + # response: AsyncBinaryAPIResponse + with open('output.mp3', 'wb') as f: + f.write(await response.read()) +``` + +### Streaming Speech Synthesis + +```python +# Old SDK +async with Speech('your-api-key') as speech: + conn = await speech.synthesize_streaming('voice-id', return_extras=True) + await conn.append_text('Hello world') + await conn.finish() + + async for chunk in conn: + # chunk: {'audio': bytes, 'durations': [...], 'warning': '...'} + print(f"Received {len(chunk['audio'])} bytes") + +# New SDK - WebSocket Sessions +async def main(): + client = AsyncLmnt() + session = await client.speech.sessions.create( + voice='voice-id', + return_extras=True + ) + + await session.append_text('Hello world') + await session.finish() + + async for message in session: + # message: SpeechSessionResponse + print(f"Received {len(message.audio)} bytes") + if message.durations: + print(f"Durations: {message.durations}") + +# New SDK - HTTP Streaming +client = Lmnt() +with client.speech.with_streaming_response.generate( + text='Hello world', + voice='voice-id', +) as response: + for chunk in response.iter_bytes(): + print(f"Received {len(chunk)} bytes") +``` + +### Voice Management + +```python +# Old SDK +async with Speech('your-api-key') as speech: + voices = await speech.list_voices(starred=True) + voice = await speech.voice_info('voice-id') + await speech.update_voice('voice-id', name='New Name') + await speech.delete_voice('voice-id') + await speech.create_voice('voice-name', False, ['file1.wav', 'file2.wav']) + +# New SDK - Synchronous +client = Lmnt() +voices = client.voices.list(starred=True) +voice = client.voices.retrieve('voice-id') +client.voices.update('voice-id', name='New Name') +client.voices.delete('voice-id') +client.voices.create( + name='voice-name', + enhance=False, + files=[Path('file1.wav'), Path('file2.wav')] +) + +# New SDK - Async +async def main(): + client = AsyncLmnt() + voices = await client.voices.list(starred=True) + voice = await client.voices.retrieve('voice-id') + await client.voices.update('voice-id', name='New Name') + await client.voices.delete('voice-id') + await client.voices.create( + name='voice-name', + enhance=False, + files=[Path('file1.wav'), Path('file2.wav')] + ) +``` + +### Account Information + +```python +# Old SDK +async with Speech('your-api-key') as speech: + account = await speech.account_info() + +# New SDK +client = Lmnt() +account = client.accounts.retrieve() +``` + +### Error Handling + +```python +# Old SDK +from lmnt.api import SpeechError + +try: + async with Speech('your-api-key') as speech: + result = await speech.synthesize('Hello', 'invalid-voice') +except SpeechError as e: + print(f"Error: {e.message}") + +# New SDK +from lmnt import NotFoundError, AuthenticationError, APIError + +try: + client = Lmnt() + response = client.speech.generate(text='Hello', voice='invalid-voice') +except NotFoundError as e: + print(f"Voice not found: {e}") +except AuthenticationError as e: + print(f"Authentication failed: {e}") +except APIError as e: + print(f"API error: {e}") +``` + +## Advanced Features + +### Response Streaming + +```python +# New SDK - Stream to file +client = Lmnt() +with client.speech.with_streaming_response.generate( + text='Long text here...', + voice='voice-id' +) as response: + response.stream_to_file('output.mp3') + +# Async version +async def main(): + client = AsyncLmnt() + async with client.speech.with_streaming_response.generate( + text='Long text here...', + voice='voice-id' + ) as response: + await response.stream_to_file('output.mp3') +``` + +### Raw Response Access + +```python +# New SDK - Access raw HTTP response +client = Lmnt() +response = client.with_raw_response.speech.generate( + text='Hello world', + voice='voice-id' +) +print(f"Status: {response.status_code}") +print(f"Headers: {response.headers}") +audio_data = response.read() +``` + +### Custom Configuration + +```python +# New SDK - Custom client configuration - Use AioHttp client for improved performance +from lmnt import DefaultAioHttpClient +from lmnt import AsyncLmnt + +async with AsyncLmnt( + api_key='your-api-key', + base_url='https://api.lmnt.com', + timeout=30.0, + max_retries=3, + http_client=DefaultAioHttpClient() +) as client: +``` + +## Migration Checklist + +- [ ] Update import statements +- [ ] Replace `Speech` class with `Lmnt` or `AsyncLmnt` +- [ ] Update method calls to use new resource-based API +- [ ] Handle response objects instead of dictionaries +- [ ] Update error handling to use specific exception types +- [ ] Test streaming functionality with new session API +- [ ] Update file handling to use `Path` objects +- [ ] Remove context manager usage if not needed + +## Need Help? + +If you encounter issues during migration, please: +1. Check the [API documentation](https://docs.lmnt.com) +2. Review the [examples](examples/) in the new SDK +3. Open an issue on the [GitHub repository](https://github.com/lmnt-python) diff --git a/README.md b/README.md index 7a43767..f8b0901 100644 --- a/README.md +++ b/README.md @@ -1,50 +1,406 @@ -# LMNT Python Library -The LMNT Python library provides convenient access to the LMNT API from applications written in the Python language. +> **Note:** +> We released version 2.0 of this SDK in July 2025. To migrate from version 1.x, see the [migration guide](./MIGRATING.md). -[[Documentation]](https://docs.lmnt.com/sdk/python/introduction) +# Lmnt Python API library + + +[![PyPI version](https://img.shields.io/pypi/v/lmnt.svg?label=pypi%20(stable))](https://pypi.org/project/lmnt/) + +The Lmnt Python library provides convenient access to the Lmnt REST API from any Python 3.8+ +application. The library includes type definitions for all request params and response fields, +and offers both synchronous and asynchronous clients powered by [httpx](https://github.com/encode/httpx). + +It is generated with [Stainless](https://www.stainless.com/). + +## Documentation + +The REST API documentation can be found on [docs.lmnt.com](https://docs.lmnt.com). The full API of this library can be found in [api.md](api.md). ## Installation -Installing from PyPI is the quickest way to get started: ```sh -pip install --upgrade lmnt +pip install lmnt ``` -Install from source with: +> [!NOTE] +> Once this package is [published to PyPI](https://www.stainless.com/docs/guides/publish), this will become: `pip install --pre lmnt` -```sh -python setup.py install +## Usage + +The full API of this library can be found in [api.md](api.md). + +```python +import os +from lmnt import Lmnt + +client = Lmnt( + api_key=os.environ.get("LMNT_API_KEY"), # This is the default and can be omitted +) + +response = client.speech.generate( + text="hello world.", + voice="ava", +) ``` -## Getting started +While you can provide an `api_key` keyword argument, +we recommend using [python-dotenv](https://pypi.org/project/python-dotenv/) +to add `LMNT_API_KEY="My API Key"` to your `.env` file +so that your API Key is not stored in source control. -The most common operation you'll perform is a `synthesize` request. Given some text and a voice, it will return an audio -file that you can play back. Take a look at our [documentation](https://docs.lmnt.com/sdk/python/introduction) for a deeper dive into the SDK. +## Async usage + +Simply import `AsyncLmnt` instead of `Lmnt` and use `await` with each API call: ```python +import os import asyncio +from lmnt import AsyncLmnt + +client = AsyncLmnt( + api_key=os.environ.get("LMNT_API_KEY"), # This is the default and can be omitted +) + + +async def main() -> None: + response = await client.speech.generate( + text="hello world.", + voice="ava", + ) + + +asyncio.run(main()) +``` + +Functionality between the synchronous and asynchronous clients is otherwise identical. -from lmnt.api import Speech +### With aiohttp +By default, the async client uses `httpx` for HTTP requests. However, for improved concurrency performance you may also use `aiohttp` as the HTTP backend. -LMNT_API_KEY = ... # fill in your API key here +You can enable this by installing `aiohttp`: +```sh +pip install lmnt[aiohttp] +``` + +Then you can enable it by instantiating the client with `http_client=DefaultAioHttpClient()`: + +```python +import asyncio +from lmnt import DefaultAioHttpClient +from lmnt import AsyncLmnt -async def main(): - async with Speech(LMNT_API_KEY) as speech: - synthesis = await speech.synthesize('Hello, world.', voice='lily', format='wav') - with open('output.wav', 'wb') as f: - f.write(synthesis['audio']) + +async def main() -> None: + async with AsyncLmnt( + api_key="My API Key", + http_client=DefaultAioHttpClient(), + ) as client: + response = await client.speech.generate( + text="hello world.", + voice="ava", + ) asyncio.run(main()) ``` -While you can provide an `api_key` argument, we recommend using `python-dotenv` to add `LMNT_API_KEY="My API Key"` to your `.env` file so that your API key is not stored in source control. +## Using types + +Nested request parameters are [TypedDicts](https://docs.python.org/3/library/typing.html#typing.TypedDict). Responses are [Pydantic models](https://docs.pydantic.dev) which also provide helper methods for things like: + +- Serializing back into JSON, `model.to_json()` +- Converting to a dictionary, `model.to_dict()` + +Typed requests and responses provide autocomplete and documentation within your editor. If you would like to see type errors in VS Code to help catch bugs earlier, set `python.analysis.typeCheckingMode` to `basic`. + +## File uploads + +Request parameters that correspond to file uploads can be passed as `bytes`, or a [`PathLike`](https://docs.python.org/3/library/os.html#os.PathLike) instance or a tuple of `(filename, contents, media type)`. + +```python +from pathlib import Path +from lmnt import Lmnt + +client = Lmnt() + +client.speech.convert( + audio=Path("/path/to/file"), + voice="ava", +) +``` + +The async client uses the exact same interface. If you pass a [`PathLike`](https://docs.python.org/3/library/os.html#os.PathLike) instance, the file contents will be read asynchronously automatically. + +## Handling errors + +When the library is unable to connect to the API (for example, due to network connection problems or a timeout), a subclass of `lmnt.APIConnectionError` is raised. + +When the API returns a non-success status code (that is, 4xx or 5xx +response), a subclass of `lmnt.APIStatusError` is raised, containing `status_code` and `response` properties. + +All errors inherit from `lmnt.APIError`. + +```python +import lmnt +from lmnt import Lmnt + +client = Lmnt() + +try: + client.speech.generate( + text="hello world.", + voice="ava", + ) +except lmnt.APIConnectionError as e: + print("The server could not be reached") + print(e.__cause__) # an underlying Exception, likely raised within httpx. +except lmnt.RateLimitError as e: + print("A 429 status code was received; we should back off a bit.") +except lmnt.APIStatusError as e: + print("Another non-200-range status code was received") + print(e.status_code) + print(e.response) +``` + +Error codes are as follows: + +| Status Code | Error Type | +| ----------- | -------------------------- | +| 400 | `BadRequestError` | +| 401 | `AuthenticationError` | +| 403 | `PermissionDeniedError` | +| 404 | `NotFoundError` | +| 422 | `UnprocessableEntityError` | +| 429 | `RateLimitError` | +| >=500 | `InternalServerError` | +| N/A | `APIConnectionError` | + +### Retries + +Certain errors are automatically retried 2 times by default, with a short exponential backoff. +Connection errors (for example, due to a network connectivity problem), 408 Request Timeout, 409 Conflict, +429 Rate Limit, and >=500 Internal errors are all retried by default. + +You can use the `max_retries` option to configure or disable retry settings: + +```python +from lmnt import Lmnt + +# Configure the default for all requests: +client = Lmnt( + # default is 2 + max_retries=0, +) + +# Or, configure per-request: +client.with_options(max_retries=5).speech.generate( + text="hello world.", + voice="ava", +) +``` + +### Timeouts + +By default requests time out after 1 minute. You can configure this with a `timeout` option, +which accepts a float or an [`httpx.Timeout`](https://www.python-httpx.org/advanced/timeouts/#fine-tuning-the-configuration) object: + +```python +from lmnt import Lmnt + +# Configure the default for all requests: +client = Lmnt( + # 20 seconds (default is 1 minute) + timeout=20.0, +) + +# More granular control: +client = Lmnt( + timeout=httpx.Timeout(60.0, read=5.0, write=10.0, connect=2.0), +) + +# Override per-request: +client.with_options(timeout=5.0).speech.generate( + text="hello world.", + voice="ava", +) +``` + +On timeout, an `APITimeoutError` is thrown. + +Note that requests that time out are [retried twice by default](#retries). + +## Advanced + +### Logging + +We use the standard library [`logging`](https://docs.python.org/3/library/logging.html) module. + +You can enable logging by setting the environment variable `LMNT_LOG` to `info`. + +```shell +$ export LMNT_LOG=info +``` + +Or to `debug` for more verbose logging. + +### How to tell whether `None` means `null` or missing + +In an API response, a field may be explicitly `null`, or missing entirely; in either case, its value is `None` in this library. You can differentiate the two cases with `.model_fields_set`: + +```py +if response.my_field is None: + if 'my_field' not in response.model_fields_set: + print('Got json like {}, without a "my_field" key present at all.') + else: + print('Got json like {"my_field": null}.') +``` + +### Accessing raw response data (e.g. headers) + +The "raw" Response object can be accessed by prefixing `.with_raw_response.` to any HTTP method call, e.g., + +```py +from lmnt import Lmnt + +client = Lmnt() +response = client.speech.with_raw_response.generate( + text="hello world.", + voice="ava", +) +print(response.headers.get('X-My-Header')) + +speech = response.parse() # get the object that `speech.generate()` would have returned +print(speech) +``` + +These methods return an [`APIResponse`](https://github.com/stainless-sdks/lmnt-com-python/tree/main/src/lmnt/_response.py) object. + +The async client returns an [`AsyncAPIResponse`](https://github.com/stainless-sdks/lmnt-com-python/tree/main/src/lmnt/_response.py) with the same structure, the only difference being `await`able methods for reading the response content. + +#### `.with_streaming_response` + +The above interface eagerly reads the full response body when you make the request, which may not always be what you want. + +To stream the response body, use `.with_streaming_response` instead, which requires a context manager and only reads the response body once you call `.read()`, `.text()`, `.json()`, `.iter_bytes()`, `.iter_text()`, `.iter_lines()` or `.parse()`. In the async client, these are async methods. + +```python +with client.speech.with_streaming_response.generate( + text="hello world.", + voice="ava", +) as response: + print(response.headers.get("X-My-Header")) + + for line in response.iter_lines(): + print(line) +``` + +The context manager is required so that the response will reliably be closed. + +### Making custom/undocumented requests + +This library is typed for convenient access to the documented API. + +If you need to access undocumented endpoints, params, or response properties, the library can still be used. + +#### Undocumented endpoints + +To make requests to undocumented endpoints, you can make requests using `client.get`, `client.post`, and other +http verbs. Options on the client will be respected (such as retries) when making this request. + +```py +import httpx + +response = client.post( + "/foo", + cast_to=httpx.Response, + body={"my_param": True}, +) + +print(response.headers.get("x-foo")) +``` + +#### Undocumented request params + +If you want to explicitly send an extra param, you can do so with the `extra_query`, `extra_body`, and `extra_headers` request +options. + +#### Undocumented response properties + +To access undocumented response properties, you can access the extra fields like `response.unknown_prop`. You +can also get all the extra fields on the Pydantic model as a dict with +[`response.model_extra`](https://docs.pydantic.dev/latest/api/base_model/#pydantic.BaseModel.model_extra). + +### Configuring the HTTP client + +You can directly override the [httpx client](https://www.python-httpx.org/api/#client) to customize it for your use case, including: + +- Support for [proxies](https://www.python-httpx.org/advanced/proxies/) +- Custom [transports](https://www.python-httpx.org/advanced/transports/) +- Additional [advanced](https://www.python-httpx.org/advanced/clients/) functionality + +```python +import httpx +from lmnt import Lmnt, DefaultHttpxClient + +client = Lmnt( + # Or use the `LMNT_BASE_URL` env var + base_url="http://my.test.server.example.com:8083", + http_client=DefaultHttpxClient( + proxy="http://my.test.proxy.example.com", + transport=httpx.HTTPTransport(local_address="0.0.0.0"), + ), +) +``` + +You can also customize the client on a per-request basis by using `with_options()`: + +```python +client.with_options(http_client=DefaultHttpxClient(...)) +``` + +### Managing HTTP resources + +By default the library closes underlying HTTP connections whenever the client is [garbage collected](https://docs.python.org/3/reference/datamodel.html#object.__del__). You can manually close the client using the `.close()` method if desired, or with a context manager that closes when exiting. + +```py +from lmnt import Lmnt + +with Lmnt() as client: + # make requests here + ... + +# HTTP client is now closed +``` + +## Versioning + +This package generally follows [SemVer](https://semver.org/spec/v2.0.0.html) conventions, though certain backwards-incompatible changes may be released as minor versions: + +1. Changes that only affect static types, without breaking runtime behavior. +2. Changes to library internals which are technically public but not intended or documented for external use. _(Please open a GitHub issue to let us know if you are relying on such internals.)_ +3. Changes that we do not expect to impact the vast majority of users in practice. + +We take backwards-compatibility seriously and work hard to ensure you can rely on a smooth upgrade experience. + +We are keen for your feedback; please open an [issue](https://www.github.com/stainless-sdks/lmnt-com-python/issues) with questions, bugs, or suggestions. + +### Determining the installed version + +If you've upgraded to the latest version but aren't seeing any new features you were expecting then your python environment is likely still using an older version. + +You can determine the version that is being used at runtime with: + +```py +import lmnt +print(lmnt.__version__) +``` + +## Requirements -## More examples +Python 3.8 or higher. -You can find more examples in the [demo](demo) directory. +## Contributing -## License -[Apache 2.0](LICENSE) +See [the contributing documentation](./CONTRIBUTING.md). diff --git a/SECURITY.md b/SECURITY.md new file mode 100644 index 0000000..528554d --- /dev/null +++ b/SECURITY.md @@ -0,0 +1,27 @@ +# Security Policy + +## Reporting Security Issues + +This SDK is generated by [Stainless Software Inc](http://stainless.com). Stainless takes security seriously, and encourages you to report any security vulnerability promptly so that appropriate action can be taken. + +To report a security issue, please contact the Stainless team at security@stainless.com. + +## Responsible Disclosure + +We appreciate the efforts of security researchers and individuals who help us maintain the security of +SDKs we generate. If you believe you have found a security vulnerability, please adhere to responsible +disclosure practices by allowing us a reasonable amount of time to investigate and address the issue +before making any information public. + +## Reporting Non-SDK Related Security Issues + +If you encounter security issues that are not directly related to SDKs but pertain to the services +or products provided by Lmnt, please follow the respective company's security reporting guidelines. + +### Lmnt Terms and Policies + +Please contact feedback@lmnt.com for any questions or concerns regarding the security of our services. + +--- + +Thank you for helping us keep the SDKs and systems they interact with secure. diff --git a/api.md b/api.md new file mode 100644 index 0000000..3656087 --- /dev/null +++ b/api.md @@ -0,0 +1,41 @@ +# Speech + +Types: + +```python +from lmnt.types import SpeechGenerateDetailedResponse +``` + +Methods: + +- client.speech.convert(\*\*params) -> BinaryAPIResponse +- client.speech.generate(\*\*params) -> BinaryAPIResponse +- client.speech.generate_detailed(\*\*params) -> SpeechGenerateDetailedResponse + +# Accounts + +Types: + +```python +from lmnt.types import AccountRetrieveResponse +``` + +Methods: + +- client.accounts.retrieve() -> AccountRetrieveResponse + +# Voices + +Types: + +```python +from lmnt.types import Voice, VoiceUpdateResponse, VoiceListResponse, VoiceDeleteResponse +``` + +Methods: + +- client.voices.create(\*\*params) -> Voice +- client.voices.retrieve(id) -> Voice +- client.voices.update(id, \*\*params) -> VoiceUpdateResponse +- client.voices.list(\*\*params) -> VoiceListResponse +- client.voices.delete(id) -> VoiceDeleteResponse diff --git a/bin/publish-pypi b/bin/publish-pypi new file mode 100644 index 0000000..826054e --- /dev/null +++ b/bin/publish-pypi @@ -0,0 +1,6 @@ +#!/usr/bin/env bash + +set -eux +mkdir -p dist +rye build --clean +rye publish --yes --token=$PYPI_TOKEN diff --git a/demo/.env.example b/demo/.env.example deleted file mode 100644 index 9c91e6e..0000000 --- a/demo/.env.example +++ /dev/null @@ -1,7 +0,0 @@ -# Your account-specific LMNT API key. Generate one via the LMNT -# account page at https://app.lmnt.com/account -LMNT_API_KEY=XXXXX - -# Your OpenAI API key. Generate one via the OpenAI account page at -# https://platform.openai.com/account/api-keys -OPENAI_API_KEY=XXXXX diff --git a/demo/.gitignore b/demo/.gitignore deleted file mode 100644 index a3a3435..0000000 --- a/demo/.gitignore +++ /dev/null @@ -1,2 +0,0 @@ -.env -output.mp3 diff --git a/demo/convert.py b/demo/convert.py deleted file mode 100644 index cd8bf3e..0000000 --- a/demo/convert.py +++ /dev/null @@ -1,22 +0,0 @@ -import argparse -import asyncio -from lmnt.api import Speech - - -async def main(args): - async with Speech() as s: - with open(args.audio, 'rb') as f: - audio = f.read() - - converted_audio = await s.convert(audio=audio, voice=args.voice) - with open('output.mp3', 'wb') as f: - f.write(converted_audio) - print('Done.') - - -if __name__ == '__main__': - parser = argparse.ArgumentParser(description='Convert speech to a different voice') - parser.add_argument('-a', '--audio', required=True, help='Filename of audio to convert') - parser.add_argument('-v', '--voice', required=True, help='Voice to use') - args = parser.parse_args() - asyncio.run(main(args)) diff --git a/demo/create_voice.py b/demo/create_voice.py deleted file mode 100644 index bff0bbd..0000000 --- a/demo/create_voice.py +++ /dev/null @@ -1,24 +0,0 @@ -import argparse -import asyncio -import os -from dotenv import load_dotenv -from lmnt.api import Speech - -load_dotenv() # Don't forget to add your LMNT API key to .env. - - -async def main(args): - async with Speech(os.getenv('LMNT_API_KEY')) as speech: - # Get the list of available voices. - voices = await speech.list_voices() - print(voices) - - # Create a voice. Once completed, it will be available in your list of voices. - create_voice = await speech.create_voice('Demo voice', True, args.input_files) - print(create_voice) - -if __name__ == '__main__': - parser = argparse.ArgumentParser(description='Create a voice using LMNT API') - parser.add_argument('-i', '--input_files', nargs='+', required=False, default=['sample-audio-input.mp3'], help='Input file path') - args = parser.parse_args() - asyncio.run(main(args)) diff --git a/demo/hackathon-template/.gitignore b/demo/hackathon-template/.gitignore deleted file mode 100644 index c14b1f1..0000000 --- a/demo/hackathon-template/.gitignore +++ /dev/null @@ -1,2 +0,0 @@ -*.egg-info -__pycache__ diff --git a/demo/hackathon-template/README.md b/demo/hackathon-template/README.md deleted file mode 100644 index e1b5305..0000000 --- a/demo/hackathon-template/README.md +++ /dev/null @@ -1,52 +0,0 @@ -# Hackathon Template - -We’re excited to see you using LMNT during the hackathon! To make your experience seamless, we have created this quick onboarding template. - -This template includes a simple agent that uses LMNT to synthesize audio. If whisper audio transcription and an llm are configured, the agent does the following: - -1. Accepts as input an audio file or a text prompt -2. Whisper transcribes the audio file to extract text from the spoken input -3. The transcribed text prompt is sent to the LLM and the text response is streamed back -4. The text is streamed to LMNT and the synthesized audio is streamed back - -You can change the configuration/input to skip certain steps. For example, you can pass text straight to LMNT by disabling whisper and the llm. - -## Installation - -To get started, follow these steps: - -1. Ensure you're using Python 3.6 or higher, but less than 3.12. - -2. Set up your api keys as environment variables. You can get your api keys from the [LMNT website](https://app.lmnt.com/account). - - ```bash - export LMNT_API_KEY= - ``` - - If you are using Mistral, set up your Mistral api key as well. - - ```bash - export MISTRAL_API_KEY= - ``` - -3. **Install dependencies:** - - ```bash - pip install -r requirements.txt - ``` - -4. **Basic Usage** - -After installing the dependencies, you can run the script. - - ```bash - python scripts/lmnt_agent.py --config config/config.yaml - ``` - -Checkout our [documentation](https://docs.lmnt.com/introduction) for exploring more of our model's capabilities. - -## Contributing - -We welcome contributions! If you have any ideas, bug fixes, or improvements, please submit a pull request. - -Happy hacking! diff --git a/demo/hackathon-template/config/config.yaml b/demo/hackathon-template/config/config.yaml deleted file mode 100644 index caeafdc..0000000 --- a/demo/hackathon-template/config/config.yaml +++ /dev/null @@ -1,15 +0,0 @@ -lmnt_api: - api_key: "" # API key for the LMNT API, Recommend setting this in the environment variable LMNT_API_KEY e.g. export LMNT_API_KEY = "your_api_key" - default_voice: "lily" - model: "aurora" # 'aurora' for low latency. 'blizzard' for high quality. Note that streaming is only supported for 'aurora' model. - -whisper: - enabled: true # Whisper is enabled to process input audio - model: "base" # {'base', 'small', 'medium', 'large'} - -llm: - enabled: true # Pass input text / transcribed text to the LLM model - api_key: "" # API key for the LLM model, Recommend setting this in the environment variable e.g. export MISTRAL_API_KEY = "your_api - model: "mistral-tiny" # {'mistral': ['mistral-tiny', 'mistral-large-latest']} - prompt: "" # Optional prompt to be passed to initialize the LLM stream - provider: "mistral" # Supported providers: "mistral" diff --git a/demo/hackathon-template/requirements.txt b/demo/hackathon-template/requirements.txt deleted file mode 100644 index e0e4da4..0000000 --- a/demo/hackathon-template/requirements.txt +++ /dev/null @@ -1,4 +0,0 @@ -lmnt -MistralAI -openai -openai-whisper diff --git a/demo/hackathon-template/scripts/lmnt_agent.py b/demo/hackathon-template/scripts/lmnt_agent.py deleted file mode 100644 index e86f556..0000000 --- a/demo/hackathon-template/scripts/lmnt_agent.py +++ /dev/null @@ -1,275 +0,0 @@ -import asyncio -import os -import yaml -import whisper - -from lmnt.api import Speech -from typing import Optional -from openai import AsyncOpenAI -from mistralai import Mistral - - -class LMNTStream: - """ - Handles LMNT API for text-to-speech streaming. - """ - - def __init__(self, api_key: Optional[str] = None, model: str = 'blizzard', voice_id: str = 'lily'): - """ - Initialize the LMNTHandler. - Args: - api_key (str): The LMNT API key. Defaults to the LMNT_API_KEY environment variable. - voice_id (str): The ID of the voice to use for LMNT TTS. - output_file (str): File to save the audio output. - """ - self.api_key = api_key or os.environ.get('LMNT_API_KEY') - self.voice_id = voice_id - self.model = model - self.output_file = 'output.mp3' - - async def __call__(self, text_stream): - """ - Streams text to LMNT API and saves audio output. - Args: - text_stream (async generator): Stream of text chunks to send to LMNT. - """ - async with Speech(self.api_key) as speech: - connection = await speech.synthesize_streaming(self.voice_id) - reader_task = asyncio.create_task(self._reader_task(connection)) - writer_task = asyncio.create_task(self._writer_task(connection, text_stream)) - await asyncio.gather(reader_task, writer_task) - - async def _reader_task(self, connection): - """Reads audio data from LMNT and writes to a file.""" - with open(self.output_file, 'wb') as f: - async for message in connection: - f.write(message['audio']) - - async def _writer_task(self, connection, text_stream): - """Streams text to LMNT.""" - async for text in text_stream: - await connection.append_text(text) - await connection.flush() - - -class LMNTtts: - def __init__(self, api_key: Optional[str] = None, model: str = 'blizzard', voice_id: str = 'lily'): - """ - Initialize the LMNTHandler. - Args: - api_key (str): The LMNT API key. Defaults to the LMNT_API_KEY environment variable. - voice_id (str): The ID of the voice to use for LMNT TTS. - output_file (str): File to save the audio output. - """ - self.api_key = api_key or os.environ.get('LMNT_API_KEY') - self.voice_id = voice_id - self.model = model - self.output_file = 'output.mp3' - - async def synthesize(self, text): - """ - Synthesize text using the LMNT API. - Args: - text (str): The text to synthesize. - Returns: - bytes: The synthesized audio. - """ - async with Speech(self.api_key) as speech: - synthesis = await speech.synthesize(text, self.voice_id, model=self.model) - with open(self.output_file, 'wb') as f: - f.write(synthesis['audio']) - - -class MistralStream: - """ - Handles text generation using Mistral - """ - - def __init__(self, api_key: Optional[str] = None, model: str = 'mistral-tiny', prompt: str = ''): - """ - Initialize the LLMHandler. - Args: - model (str): The LLM model to use. - prompt (str): The default text generation prompt. - """ - self.api_key = api_key or os.environ.get('MISTRAL_API_KEY') - self.model = model - self._set_prompt(prompt) - - def _set_prompt(self, prompt: str = ''): - """Set the text generation prompt.""" - if prompt: - with Mistral(api_key=self.api_key) as client: - chat_response = client.chat.complete( - model=self.model, - messages=[{'role': 'system', 'content': prompt}], - ) - print(chat_response.choices[0].message.content) - - async def __call__(self, query_text: str): - """ - Generates text from the LLM and streams it as chunks. - Returns: - async generator: Stream of text chunks. - """ - with Mistral(api_key=self.api_key) as client: - response = await client.chat.stream_async( - model=self.model, - messages=[{'role': 'user', 'content': query_text}], - ) - async for chunk in response: - if chunk.data.choices[0].delta.content is not None: - yield chunk.data.choices[0].delta.content - - -class OpenAIStream: - """ - Handles text generation using an LLM (e.g., OpenAI GPT). - """ - - def __init__(self, api_key=None, model='gpt-3.5-turbo', prompt=None): - """ - Initialize the LLMHandler. - Args: - model (str): The LLM model to use. - prompt (str): The default text generation prompt. - """ - self.api_key = api_key or os.environ.get('OPENAI_API_KEY') - self.model = model - self.client = AsyncOpenAI(api_key=api_key) - self._set_prompt(prompt) - - def _set_prompt(self, prompt=None): - """Set the text generation prompt.""" - if prompt is not None: - chat_response = self.client.chat.complete( - model=self.model, - messages=[{'role': 'system', 'content': prompt}], - ) - print(chat_response.choices[0].message.content) - - async def __call__(self, query_text): - """ - Generates text from the LLM and streams it as chunks. - Returns: - async generator: Stream of text chunks. - """ - response = await self.client.chat.completions.create( - model=self.model, - messages=[{'role': 'user', 'content': self.prompt}], - stream=True, - ) - - async for chunk in response: - if ( - chunk.choices - and chunk.choices[0].delta - and chunk.choices[0].delta.content - ): - yield chunk.choices[0].delta.content - - -class LMNTAgent: - def __init__(self, config_path: Optional[str] = None): - """ - Initialize the LMNTAgent with a configuration file. - Args: - config (dict): Configuration dictionary. - """ - if config_path is None: - config_path = 'config.yaml' - with open(config_path, 'r') as f: - config = yaml.safe_load(f) - - self.config = config - self._whisper = None - self._llm = None - self._init_lmnt() - self._init_whisper() - self._init_llm() - - def _init_lmnt(self): - """Initialize the LMNT API handler.""" - lmnt_config = self.config['lmnt_api'] - api_key = lmnt_config.get('api_key', None) - model = lmnt_config.get('model', 'blizzard') - voice = lmnt_config.get('voice', 'lily') - self.lmnt_stream = LMNTStream(api_key, model, voice) - - def _init_whisper(self): - """Initialize the Whisper transcription handler.""" - whisper_config = self.config.get('whisper', {}) - if not whisper_config.get('enabled', False): - self._whisper = None - return - model = whisper_config.get('model') - self._whisper = whisper.load_model(model) - - def _init_llm(self): - """Initialize the LLM handler.""" - llm_config = self.config.get('llm', {}) - if not llm_config.get('enabled', False): - self._llm = None - return - model = llm_config['model'] - api_key = llm_config.get('api_key', None) - prompt = llm_config.get('prompt', None) - self._llm = MistralStream(api_key, model, prompt) - - def transcribe_audio(self, audio_bytes: bytes) -> str: - """ - Transcribe audio bytes using the Whisper API. - Args: - audio_bytes (bytes): - Returns - str: Transcribed text. - """ - assert self._whisper is not None, 'Whisper mode is not enabled.' - return self._whisper.transcribe(audio_bytes) - - async def run(self, input_data: str | bytes): - """ - Run the agent based on the detected mode. - Args: - input_data: Input data (text or audio bytes). - """ - - # Transcribe audio if input is bytes - if isinstance(input_data, bytes): - try: - text = self.transcribe_audio(input_data) - print(f'Transcribed text: {text}') - except Exception as e: - print(f'Error transcribing audio: {e}') - return - else: - text = input_data - - # Process text with LLM if enabled - if self._llm: - try: - text = self._llm(text) - except Exception as e: - print(f'Error processing text: {e}') - return - - # Synthesize audio - try: - await self.lmnt_stream(text) - except Exception as e: - print(f'Error synthesizing audio: {e}') - return - - -# Example Usage -if __name__ == '__main__': - import argparse - import yaml - - parser = argparse.ArgumentParser() - parser.add_argument('--config', type=str, default='config.yaml', help='Path to configuration file.') - args = parser.parse_args() - - agent = LMNTAgent(args.config) - input_data = 'Give me a list of the best restuarants in Berlin?' - asyncio.run(agent.run(input_data)) diff --git a/demo/sample-audio-input.mp3 b/demo/sample-audio-input.mp3 deleted file mode 100644 index ed3754f295b0fa42a084154fdd93fb3916128764..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 131937 zcmeFYWl)@5x31f`H3WBer_tcfdS^|RdU-{_D zDDsn}W{v~+rP%hzAYIs5)$Hm&re~-0+^@u@u3D(#!ywJ=_u1`wZS2(|zQ4)P-~rhu zN2v9bl^I)>kXznjQiDvBNsvC~!(dRbf5$v6 z5vWB>6^ufFE-}v`e;PsHfJeNnAAEV`qoiuc?{Bi%4`8s0K$E<({K9)?4L-pOu2Hye z4rXV>n<9|?TCkKQz}RT$ZC^Yo72m`iH%_RaBkRR)KlfCqAfv5= zrhcd+GAsD=2{M%b^FcFbD5=v|L7@CnzVUIS-Gv_!T0#VSMn|1p%E6#Em-~#*QlM(- zfz>E~)^N!CDePPd)Nu2gmL}QzrN_qI#5m}8pZ8F*5^Wfp6-oFVQ}1xN12MlxpCAEz#Lk2ZFa{ntI zQl4hUI_(7|FF+dQ@5Xrmb+>EsoHPciF`iXmV}-W?xgCLunC2YwGl|UIb)*@r`0hiV zx9^WF-=N_D3J=R5`l$Ml&1Nf>7OU#&wYN^gSnjH#4wf^W#=S;c+8@-UDvI2oHL~Mz zrSJ-QHn159vSic5)7RV5lPe+V=i8U!ckO;5d|#L1c>0Inf4NCVC<82vFg1f@R*o;U z^|Sjf!t)m@vKT1q_fKx}v3`ipEAb0;diW$upI)|ipeGpdBz|h(1tduV-@+vl(<9=y zKIQDR68OF?sSJk2h_WKkHO5AO4P9iD3HmzCniCX=4HA;p)Ibg%#fLH-kT?3qW2)T( zMWtT9C^mZw<)f!V_`zKJ1!QA2sO9x#=9Q1O@&Ugiv);DuW$VxfFDGMC4reqP5TyBd&`FwMkD&Rr;Jg(fP@KCUD(~#SDC}O zo(LG?Hsm|~ zJ2x%|-;gRA2~kBL04Agq4C_#{AWm73sSYTwJs3;dM4E`Hf!RutM zS3WGlAsn`(SGt)|OzXuYTO{TZs%rKO!dbw$`FEEA%%f++7Ioce;)#b=oNI#JTB8P1Vsf6pB-9;?qb^||Sl~>9-Fwva;7SkOHv8rHaJ|Etx!ywOYv$Irwai=_x+NiEc-FeBO2$Z?S3Bs5baJ*qlk!>A z`#jWUO1pPNQ%u2TL!o8m+W%f@sia*aZaSDls$UBomYD;}bt#rK4GMo>g_0zQ;$!YI zB_HL5kw-&!LnFqOTObLIi0a9S*zA;qXmIB%A8D2njtS!-^z#fBbn?P-28lVXl0Atr zKMD$(w|x;mWV^|N6!#b}zs&ADsvJE$-(xE_oID_@L;99gSC4LiihY>j&>``uIB1ed z2N1g*{}i!!h>@np^WASC$;gKjkeBG!dtMgGp>f`z5Cp`*nGcHvs$((ET;|9C`t42}N-EOYQ zj#oZKD$V?(#xtZZxD{k4atPF(n&}oPayTK)Z^PV@m?mO-%-()3U3xpA-^j^aY*@Z& ze%TOO`MDZRcF|dT49RlXDth$&uf}=@tdXGG(@bI2AADS_K<0@sZi0joR`_4--|(%I z?Ag~+EsU6mGc;`IO9b%Xw@Iv~r5`ty$;pu@_KH}F3@_NJ7?SDrUJg>(U;*$@f>0Q> zvIf8q0#D7H*fA&s>nuR};ag(6*$H_Z{1%IeM9IaY$W>Jw!Jqt2-rkqqa4_x)_=&oS z9F-*SUM$v$9wo^wqgR-?TmGx{g zWfrl|F&%k7S5lVb$X-EewMF(J5XgPj3K8V$m5(ZGx>>yCp z|FOp2VVMS|{ZhGTBI_XAoQj@=QGa=Z`SOtIZx{^LW1Oqda%FA9C#avfd~y;%svMQJ1T6c@iM0xn}9 z0aYYa4*P)e1~VWmpde7G4r?ag2B; zOn3rvMKnZEzpA+rPEk(&ptTH9k{mtDXtm)Z_>*jz8fHcX;vFm$Y_O>)j5WKc06!lI zY~wa=hXupW3U@V{U&t9#8e?{gUl9gIV1O}-`baPUAP^f087eRk-CRHFRX-4mZhlFI z+%Euw88x~qU9qm%kzMAp&1`W?;a5f(a@NDzXUw4QQMN_z4iyAF{6(h|U+(e-bB2PN_EO=&eAV zBxjiL zB$R^ZHeq$%(wRVRitQPk$HT@ul_|V`X-%R_g>>Nao@Q>6l68Sb_K+jhy+e%;Y##9# zgka?*wdS~$WkM1}<9+zRy79{AlY$}7j7i2gbcATq=N`t+GMauJj*2aA5#Z=%x43&t zezgLh0Cjn8jBdst7W9OPj@SJb*JHaTM`VIv0Y%W6UJ?) z@!xv2$aKWs61GoY>B;yDh4dy(X8Fm8T2{pd8_3{m@i}ZX2qvc!0B0~haL9W zG4yISMijFIN9e|ps|k)5pe3{B$y%{EbY+Lz-^e|$fzYt%NIzv#m0F+4F3U_->m$-e z)kICjMwg{#Wasg)Tj41g))xtBk5zSQ3u*MMw2+siH7oN)9>l0iIh&Wh^08%%o|q(C zvxOq8*|t8(OvXLUUbG}L`r}c(!FgvMFI@$}iRX=uQFc9= znREuF8br$tmG7*b3Y?9Vs{Vr)0iYDz63A1C@q?vvI*;e|aS86i*)s@Eu*pS>SwXT~ zJtJ1%O4;LE*4`m~Xv3dc#&ecX`Js=6LDRxQz}nJQ7OvLlyLY(E$LXBN4K|#}hwi)HhlQb?9Esn^bIUaj1+jw@vBJrlX5YjxRO$n5#YV-Q>() z%y)?IgJeB_J|d8VFDj~LaPklzTq&EV8se^rimJl)Fadg1RYBw%YO3ZuUHczxzpL5{ zd}>M5u;mwgXKO*pus0ShgoU?W>YK($IIa>D;ix|H=IyiQ~5yJ0&Q0F0lPS(6*w!D^UgV0Exi zv_DpN3ua!d^GHuIK9H+GC{L^Ch_oB3<*#M(Y*McCxpGeKlAG+^8t1Q8W?rFmQ1-AV zxx>P|_Vntqueh5u{US?|5W-lg$WlhztV)Khmw zv7*Ddqani~#8XjLqY|;3iNekxB{Q>-l6dR8!m!K#sDzRn#BDzef)A9cY}}zn2QdVb z3x*L`fi%9GiBVu*^IGcHtI`8J%{Y~elCE}8NSXK8akSmD3+mA9I{ar;cpU1Gy$C;u zGrTEdcTdixOss5@z#xd|ZX^h#(pUh0oJ6(*wtu7Qp4@jY8zYj{{?g^ORcY;{YS6y2 z_dRmb<$!P8{jz65r@K&Qx6K#xh}!|xT}Sy^U7>ijT1i>IxYl@EsIQBtk8PDE`=SZ) zx88H|MwkVL&5Xa*a*AjQJBdMAdA#mu*iN;}D<6nT3QreVRzCp6x9{7bfzMJ-Nkd5E zW!I0KoX;+TFLbDVjaNe|G14+Dag!wBXK(qxuSV#NlC^Md)h%b#?hZQlHZDo`oVVKl zbFKa2@@x{X;+lYVF1iKr1x~ous|^o)m4w0XKCxv7#gK+D((6UcnzrsBgzGw(6r~z? z9_-aoK(8CfPAjDIXu%>?1SB6tr4hey6g& z)I1Ae3KePpsT&i?v@0>e8{4I&H+AeOrG2=PlA#&LYfU(#yBpvSle-Pil^<(Qx1Y~en^~mgMSe|PFbg-m^6B8@;&0U1k_Gr+5>3VE~a3*-~5k)Esz}BYyt7$Fuh-#(Uoq(_ylx|QOMp9LLosR0pkf1x#B81 z7;Dc!2n$zXh~gHJjFjsXTTqe4f|b##=DcHsYm$FD-a1y(F5}d_t25~Ng=*w15xi70 zH8rMCMnq~m>=&6;v1=O&p5_nc=S;XttCzu5XGK8_acXdv3%1L!oTq3Mn=kVI#%f>z zK8HY_{&?uK@h@}jP-{KG%9bytRSKiU&>zcY!52krLe8jdDAwg}`LWik;LSoO_IPJ~ z)kb*Iv`P=2SgmI%M9IRBuk2wbQj@t&S^98&cj4PH z3OMU474({mnphV+a(4%Huy%;gb7?+0&aB0%(@k3zPiBlSa^)$kXg1_-r%E_<`L20v zC0p~MT96R6Ymn~ayF{fci$pxHKF3==$d2+&)%uq_vB-$%}9itl` zx+qc%O{Q+BS2t;gjq^~aXJGq2U7Hgi0)gCZxHBewrlUD>nK@I^jU#lr)JgG<&4)N$ zZ`$O@G5h>DP#dkBsO4q!m!4;Qjjwvp1>r#Ngc2bQXKqz*(*q@DOtwjuw1Jo{j%Lf> ze6;>gH8VM@*bbKa&4w5JSjTcZr{r((g(LhX=jvJo1&_c@wzI!GjWO$Ka zL@g>dg6Vp>cm#UU;X7##^b%N-mSsCxObH!n(?J(hdQ`%PnKFrsu4 zfAiaAa`=@`E;EpF#duH^qVd>Gpf4$v!2dxF6A}|7CM`btFT~fs(~2m8VFQ?YWwUmQ zy_5MJiLGYu8qhoea}8TnbYoOY{v;kgpj0_aOtw5VK@x7eXkoESyZER33bsji!)TfT zrgHjGkVNtzdrDfIuX~z~ecI8UhF?LEqe`}#Nqzb0L19rr^thxYWh4dFrv*8__pQ@| z4g=y0Bc9X|yQIRRqTSG8Jm{-SFU!hg5C~*<>LL58-0%JgU5WW-$>Cr&A#~b1^+wd` z-S%M{mS-A84&E{+z7a+;fo+Dp#_%M$G(C~)08G^M?FnmM8EPSOFtRx5E1v~EP5uqz z1-(`ri%{Awy8<_L>{P`Ldu6TK__Nd-(u^7~iW?1isp8Cy+@8KSq) z>Q{$M9In-M^^$iCxy|_D`8uKAbR78~$F289P1Mj0#|7T_d9RYJ zXTrnY!m!P5v3{<2dD4Rn9FD7ahH0_f|nFJlf4+WHa z8?%qOig^Iyf~IF%?lGIBw=`AHPB{IuTVu5os13^uH?9?KgS=#a^jk=_`|t*Z$>^~t zMyRc7USU_*y0*G>{hcxI#8Ff*DmreDSs^M>l{wHF^Tfr_+k=mLxx=V)FfZ~LZ*J%8 zn`xzC^VY?-bPs9D8L)I&_G#iLL7S~T68#ZfEx!hUDhBH0`xQ> z1p%~18K7hDK%fkh4qgHT(MktJ|04K+92jkvyF$WRSZ8#>wxWZ!bZ2E2=6oWX$GxHB z;(ez%tM<;!J}wG6=?LRRH$?>}PW1tehheLD6U2@;O`Vms68d3*(p-+E>_h+f3p8YLjQfiyLJ2<=2ZyH<47_&k-YBqccHXbh9Ci_`%VgO6j>{ z7n!DxQv*%~MSCB}ir?k~L(WaCz;66#l2c}vz z@G9$*$$Lr17FW(tUUZ9^5t_b<>=IT!w)ZQXQDNfYd`gB-Y>rxq`$)}l#>Kmq58Mo1 zx@#F@IIK9{Np)tKxarU=wNlnVP0VIot15oD0S!kp0R=4}`6i#C4q1E^zH$sj?QBcq z{c4QT!=q`D7bLf#OGOQ$%sqYhYFW4K<{Y{4LP3K@1-G-2j+=Hx@uVs z^2E6kTnr0i2?mqH%vV0XR0h5yy@T>AjMLA}JfBXH$O#e?k#gTL!?{1(D}odX3J`)t z0|&6Vr_6~;mP}0*u|JLXU&v2|DLxJfGE5;1{vIMHRRlm)48S5_3Za!j^&xsdgXIr-qsnSTADQCixZLMSM2w8xclFYX{X-Ty=&(2}YEzAu zbM8Flyv*;WXr+HBiu%dy_c>K({dVPv3=#4<7nJKu~gXEYI}6P#a}dlYaUbGspW`Qv_85oV&5W zy99lqU}NR;JY(_hVN)|FXBLI90Znn_>ywUq#^;#LN60?2``$NZC_dcd!z!Zo0pE`x+^xmyX<5J`e>>o;pZIKj7?nCSO1^|1G7D<;x4NE6a($7DeBiKJ@2b z^#acfvxM#bKiyy2x->+l&i5_S&;GWie^(*?!|qQ>oQCy}zs3(iIGXrMyx;fHiIlT6 zF!00@(4#IW;H7Yte0~_AFWXdFi_CSj>fdI=4+4pavT9^Ac*X0?ZH2LR>?7zvLIkl# zT~TPuVk>fb!m$cq>%h1|vBK(1S;pg3+`3y&)V!e>b(A*?2s<~vG}1?>xe8iz$79}d zycJ94x~d(8_E)MKtk?OFZL(XF&MTI*k7EScd^%ejwxFlBR3Q$pLAHu$h*n*7bZm}e z`793R&kqgAWv_g?IJ=R1O*VC*rniP@FOPkCeIm;Tb}D^yF>olA0G{x$Sz3fptaBBr z!^*dhbb-SffWV+&tZflgkQx_x^RzNnRA#6=JQjSqYvK?0VtQCnQ&YR(i7^qCP^d|e zr@b@#moLOsSTt`4`d`p^0)r`3ZDHX-P$+?t&=TZ?F{Bt0-{?!)5TPvC2L{DU5rFd< zK{@K5Kj5Cx6mZveBb}_S!4fCzs}HV;`NQS%udvF2s0*TyYYW{n_P*QIDMaKe@uhEP zy63?GOlBm?_8AE^cUYjXqAVAvq!945l*fX!o1LtXLc-8e_{Uv%yh)4Ag3IhLyp9zA zoSSb1Q!{y_w=OCJF}RtF^Yd45L%XjYSGOs9l9{hS$*~iE>Bo$i-T-L9Fl#pFMvG*PE!H5Zt=^01l$xn7U-2>ISFvif5Aztm2aI8by7c36P zVJ~JrN?;L3u6Pz$_68U8mwp3#mllP+*-?Hua~hw8H{qh%la>t1FPd6*ly>SXV2z$s`X|#fMCTd->d>ei^pcrY_YJ03|p|I-7 zqLgIsV-#qRb@S1{$rz{Aj?VWJiKrJbCi;&bLe0MKCBv1{Ny%JArxg$r+z*Ew>CZXr zw1Snts*;iP{I&la%eTcpDm;l*MURnF^jUz<=T`t^76O^*Yrp?xOhf4XytRC6%MV9* z(crG6Go70K?RvJM%p}u}HhNdC`D5$u@td(03WL%*f?l20f8#N_7hMUMteKpHG zm2%D4)#tVUu1xqB($(LuMA{D7%NRB)h@=qeVrHCQhs(|*y5+#zi|G?VvyelU>{V!s zl$Yh$T{ThO5^}DYa+0A|$zY6)o>}0ySY0PReO2&=RmOM+S7)kc08)YnS6p}u4bbs!uRe~KfyE>bsNS* z$PXC-2Ib?u6|xatkX^zQgxVt=+?J3i<)aM4_g)y0qP4n6P)8>yNnxf4!~Nl|=t}o8 zU)AT!`isfkzh?MTyEIiGro~c0bFyMchFFbxP7yQtqLd?$N5CKXw*p#`RD}~9g53%6 z22g(2zt3^{Jd8us$MdBP;l`+pc!g9OFsy3CyH7EwAL}iJ*1=}bAwZk=ktUHrSLZ`Y zWa!Z5n9U#&6!|?JMPYG$T3oBs%VTHE;THA*X^**9gmRJm^@a`K!;P=sF&!Q4tw^$B z))=wfZs_v(%3G_k6AD6CdpSc{rXt6Lz{>t4YNn)FGv0_hk^GuVCpFF1#<=WEQU#z9 zu(_49!AIDE_?@is2VTKYv!TD@OUjY|1N0FAX8bXa|LysXgw+QV6i02WyC2qw6^Hws z|FRGNLv#Mu1|xNYW5Fyd3R70VXS#CME~`8uIUyi9a(KPnMobWG+g-70uRZjq(<^?4 zTl<5C8$)q39+U`-8nAwerMb+;6ONT(NAqH_Sm8aJR$l2D{-@T$iXI$?M9Mr$Z2U&S zD&&R8%mO!KSo%w zOVr%VhD(UYk8 zx>_l(ijAy6AW>AxL;!rLeU^99wa7fuC;I79s$i5-`l~~)j9c-P#e-WK_(sdscx4~G#NjT*KJ7{Eu6Ol_u}p?dVwhjahKI7vk)I;hH5 zQW1Z@{t>o?1V39-y`MfZG#e&IEbye!j5Z=EUeqk`lLSDGLxGCaj;o>xnFb_E#jXe{ zY~E+>H#0|R`h?xiS-dDC!cV_%;-&<{zyX53#Rd?*fkQ(MOuyVSp?|~eR*z57laTdc z-~uJLQyvRW5^A8o2!@Q8R3r8+_Gg9m65;DiFjOI2#<=K&S^_WP z4z+1crnO?l@KZ8V7UopUSpHgnK};|BjU=+x07*J2*O^vvIBdIp0xB~%3@e@Bm9B3M zTWMsl^n0x}cfYfuoQ=5)_3lzeO|l%XC6w$D0_`|W*`^L-m&TBy6n{Fi8|yGn;tQ*p zZyz0{SB}<^*iZxEtE#yA2tO&qK=VkIi?&SCcdz*d@_Sjt0R`0eQx5t+;}AKZ2jno2 zu(UaA5L{yAX9tNQ!r~sB0)P)#-hxBqoJW|aV9vPl`j|kr2?t4x!iZTw;;2~gDpW29 zo~(s(1_&M?i_gmi2uut#H!OGi0t!y#PHco>#yJ5La*@Z9TV#*RvZo@Og%^WEgj4B> zL&n7BY%UT~Frqc}K^%!eWpX~E>0as_G>!R)v}ok2eA=aFQ=WlHrv`ccAegQ8Ne)~ zTXTNPM^sH;ZFZvej>f>kcAJb6+K~1X**wPnw>9IhMSE_}4oCCSI#q+@&BH%ym0IGT zk)DL}8?mP+Lg!u=_fJp$5SRU!*3azaJ9k~#V*!wKk&A`f>_yY4#bFyFYBtwybw;HCD3u(PkQjw+%f9_uNTbnlcfbMY4QQt7CI0OYFpylX}k=@uh= zib<6k)ooBWMo>ku04i3)p`KSh3aTkQbphFP(8fx9Qo0_w^w!^o6-S!|kYg;w=?cu9 z^$$Ome#cAnD2I_P2$&{Z#6h=5gkordwu%IuU)P`lrFVNih`@@b!C;gcNT|CY((`Jf z+G%z^_3tZm5Vna?q$oq`XqXY<6V8pi>K{nVwkidOt4OajciEOZRGeKhbta6XT!bBz z{D!~&dP`B-c|9_oMlh?@WI)KGw0Zm%GVO7vV=|*OvT>lnLxEkc8|zL#L&eH((FW;R zSl`aGiYe=3(vA&y>Da#h)?mYW_$#w*v$KAGQ6jGEWR<+E!wZCOexl>hvufqo>&pg7 ztG2qY^og0~`IgyZ-;!C~mRbsJiKZ7UfeMf$p*K9JgN|JoBsvY(#$b+JeC0#Lvqc+6 zwe}urwzct$k2sFDlPjJ}@PG@>bsix6R@4GVEF+m2Ie9?eXiGVClP7z5P7fz5Bqx&T zUWOO-p+xpZn>y-A>vupsshvmAIER)nx_IqcqeAMYBk$YdvWvntQWjH`SRnqXdHpDd|xdtp+(x{|| zm5k}11)vfiCK|J~OjsdW?=^adt=@EzSa96-y-^cR|7Dm(ipD(a(nHYd!Chp7JIX5~ z%OIr*u_N4ke)AgmJ!i@Iyx{H>y z!_lI`&mT`dN-CVUU0Mzh$o2Y;O~8nT$;H&jE1w#+CB`h_P2l?t6;?Z}Jak5O$k-I~ z3ib$%yzjrh2>lC!mt2iwtoO@=Ahc&TLAacZSw&{Mx2Y(-tK?Yp5KSbI6de>{I!s>w zl}g#)Y!MzNfk*cnI&^+bxhDfl0|A!&iE0M%_Tj#eYiG=euF8zHmz4HqTr17p`^-=a zyFw0Pf5md^G$L(d(Y6({GXYq`{%A$+Zo?H6m=<DT&b1 z?xrHa4l4=*oqCQ4;Xqc4T{gBHn!yu=_-;vF#V0 z4mN%}XQGs<#`O6-8S9nLJRde?p7H*|HjyH&8pkvy9VM^%>6=gqIAa;4|Go2_|4AsX zkD^pmZmC2Kr6ST-5z}xZbZbEpYDw0M#GPbBZIvzP#*EBK3ANnKJP2H(EtGiSq_>vmW+a^J%7<;Tx{0nNGKC_;^ zFnQkzAbZW)fd!Xx8}!;{X+yf+S9A!`Awwg2QdA88s>8}*k%K@mTK*JMJcIOzL?0I zC4=0NDyKRAiOEmy4N(MG{mi#bZsj zf1%CBv|D&k+DTWcfAIFE0ghOcN$0XosO4tYYnBm)QH;s+SJ^Yb6oKl&bCMif6bd!n zxRX_q^e96Q>Qi(rh7&vU)ZK-*xzf!mABf~{MqlwG z-JZ@W@Hn`QWm4vw9^*T-cyhy^X&k`+egTOxIIc7oC-GI+1_r8MmoQ0Qijj(mk`l2a zezbQJB^jP;UB==`Gus|T^+XKfV~t4Wswj;_jf{1Jr&P3XqT`P?Z~WFPn8dzdFNDXc zz8H1@Dg59O+76UUM~TT*pUtelSG^0Pv>qkK+)sJ(rpxzx6$|7bbNUVacej00e$#JW zpG1cvO^J{YfQYbe3%K>ajZ^aS;34Q+T3$?Xwf?n?b(Giq2SnJs+OK?S*na=HA3mst zr8M{PJ99WDstdipRt!5OFxz8X>Tf*%Ez2%dc3tam-<{rd`}sOmtevfiUU;qF!#XvG zmY`~Cj9O8grcGgZ2d<&*%}HuTY3N*(kD!!X#G+YXtPMR5pQ;OhJXaMj zM`E{On7Yl7Bhmqd$z6kSiC~e|N0CO@)o_=rq)H@*jg}8fCMT&T1%cpH4QjQjS3V8w zf{b0HgK8vrJEL0j$Xutp(R_(x)jC$o^NUk|^ZBp2%YT?1!gJUPX1!P7?MHW&<-ED? zUoD%VL;-uj!*DSHZewWY%Fh zH2$l2X5gAz4^z&5zvbAfg)0_XV=@}?NMW#PX@QB1wgZ<)@G@?(Y`An&h4zFnw_&rw zF_Cw*azzWtUgzqCwXC$oIeaCxm7)IFS#H|F;MVwj+y6>`V`De##lX<{naK;%0e<_+ zr<$z0iPeUvGB2n{YdGHfSh6gDhkP~5oztR{ew45SzXi$9nyXsPmb`PAw0 z-MWFl`C=rYa@(|Z3;>N;RMnI|6pH;8w=BuoSWR#V-0Zr8R%a2kGn3s0R3`a;wsF!*Gp}rl zcv|&;n|JyY8vr@%u$=y=dl=`}-A_lO__dQ8Ol_XT{A-j!r}(jhngbthtm0E$(UX!? zQH`yyNjZgw5@KLnpe2jl8`}s#Yh^|tgOFt1Pp(6^zG@PQ4MDvVkRnkuAeVuP)|qQL z4;D^z5ffbVEsP-nfE34%SU<03@u^ms@tCnb0$EM0V%#02`V9^t=^M?#J@FzMOzJZ# zwGlM@nx3|Jv8X6|(=SQ%-%ZKqDfUAU`65$7ieF8NZ)VTg(@-pRX=?5Q z_%&WKZ8m0P1Ru9LbSmxLMvR6{Kg|t77wHwCqbWA#|PWjy|gWigP#p>wo^GnyVv)Q*FPR6mPq`gTEYU~7vp<@Fz_I-MQM?>x$sn8l zT6RP<4w-N0uqB2obId6^T&Q9gPbXL(P|+(AK?`u#6y6Isb+T*r&Xr~@!3~0NnN(F@ z!uK`Y6pg8mOjY@j)P80(XkTQ^{ia2NMNO{Jg3_-Be{SAbDC_LRBxJs*@K9DyyN}9c z(|7nCQl7c)Z}r_^nLwkBJh?C`Hoep!I~!;^cS+!-*EwPpx~EN>G@zH&VZd~ECVT9& zu2DfCrp;-kp)1M9n%QHl0V}%HN;9)en9{fGsI+7^NM2^=m7|Z(-e%4~{MY|aA;wGm zQh8VPma=d`^cCyLaiuk9)Qw05S{NBE#EtEJB3fc&Gzo2i8}yCYLZAF=#L z)HVOl>+fu+qbpA$M<~itS>x*0Es|aq#w$*WlsSip;>5nGA9-y|d^fJSYe|&=UD)p{ z2O8R}TZZriMRFWntrw}F5E@S+?+ip~R#pMH!@_pYTblbu2?5q<1Yu6!rN0%?ir~R( zMvtavNTb6ah`EIX3PjY7_un(9azQ&ya;4QuCG;_aCv+U^w>gy6k!y@Hf|s!~a>GC! zj2a3hYBS+fOSSSaEe(+BD^Ocap3#sSN&co`npn!w0RI$eGzV z&O6oFs>>Q&$46T#Ka0DvY9~rPUgIlGewbfs*XTWfC>tgQg?fX?*f>6)BEmnVF$4M5 zuYAvlaiLDBTDvg)nC=?8KBb&056$`xxuZcMQXs1|Hkxr|cp<7i{tlPfPe&tXc6pwr zq$67D(B4}bemRD*SOHfn&2}?t(pvY&a7)ziSNI3ZSa_l``n4eq!L>;)gv%uHn9rVN z8jL&L9`Ap=WRk|l<$Xl5yR_d%d{OF2IFi+5;EF;+!HFJUFy}_^6mz#-vmPi=%KKwy#$Bum@-oc3Rbn8s26bEj@MPTS(S)(l@kN0rV-bKiwKmBp0|4|;E?#G#Su!)6 zg5_<3=Tbure`MgE>mWA9S5dnJLi6y2MR`6MGi*Yu!?^=xu0>c_bkw|l@}R%=pZ!&v z`QuEo=Aapl*gWnVh!v*98LqyvH&MfaQT1s7J`NVQ8<#bX@+G)NlhbB7vRD|wI_Bt; zPhzMII1XBPO_>f^L-|wnO}=_RlA_-f8+Pv*Us8>3D5-K{bEqwSSJHD-xA^wzevn;A z2Zj_^!sIcx*$+2%yTr%tw|LD%7R*QcEI!3`NtKhjilryctZk5&r`^>D!P{%l>PsJD zcagiE1lzmowLYK%$&}ONl>*BI9sRDIptaY$Th|-;eRVoq4T>;2Jx>yU72n`Dx2_a~ zZsSBS*1YYd9)o(s$zPTj2~*5N!j*(am62EoN1(D}$f1TtLAu{DRT1$s)Cby$$OHHI zg!P$H!^zbpbZyby3jwr)rvPHISN$lzHQtrZ+g{gby>T82_huP{20}GwF-7$hck#{&3v!smZVzy z26G9gjZ`>(5uq|T^DWphGi-jH8?zKAO@rpx{9>B$1QDOH*;sj$Sm$@l8TViQ^NHP& zvC@A+#s~5e@DlKD*T9y{1_?{IJDx2l|qUb{b8GF6E4ytS>Fqz;W#apMJgzim^_RSP2ah7B=s<5 z-S0tD#Y=EJ$wlx$jPz=c9q?wWeC+ox;((_`_cCj#QE{Xn(aG#lm$Aj1QynwO2YE(p zoUi)vr~Y)bAv_TFt2_}xR$=(!Q;3*1bP*+iY;ErKZwH_HLC9&y1m;c(^c5%M;-gEh zgoCWSXe0rd(YD3*!fAU`A<*k5KZ^OVVKbnej3^k`^IN-6J6WQ*%G}G|QHC2Gho%p& z>PHO~i35fP3Xx$Y+?M#cEA^w>W{I9euwy#YzUZtFhf}ltS}ZOhS&e$i`DuJU>0q??s&y9bqe73(DyZ^iD`+>HdhJ3r;v8gnsDS4?+U5#CViMb+*g1WDK?!`lRBL6H^D!{`PYe^~IBR7eUPjH0Pyc0_D zi~n8_g(0x57oxD}h6t|2PzNX(yfT4+%oN1Y>{0(tQX7^w*dl1V4Ni4jK~%ZD`ai~} z5zB0Vbw^QVr%sQ=m!eWrc@rfD+HkiVMo-BJmc;}VObZonm~;HnBf7<@zZ_CoY=0I} zit`HNtHbg(MyV6r-g!vF2?1wff=&u~%>cT&=UlcVbT}2VlH+RF8LFM)r=Unwv~sB> zIME4M@d8HpEX##&@0QB!LKtdsbYrNh@%7*?TlXj}q;?e$<5j%I)zYbP4&L#?sZP8B z+~>+fHGXa6-V8>>$iZqfG>Rybk33)oPiM)=u*3S? zSVyl*QgtHCc&GVkS)zll*6VLR|EbdO|80`p=-2~s(xl6>^I$Wjm7tq9%t?~jvs9*1h%JOu3fF)5!} zZk8(yel*y>cY4%wtUx*aZ{ZV5yRfvC)IpdM>6@trePHkiI~wL=?<>@(Pu|{yi4Nir z`UFkQpS7-!-Byw!iv6Ya!&3>=H+fPLnECCy?(_~sccw&*B5&pln=SG5FZ6rjuKihp zsi8xa)W5&nz?D2QhMATnuu53@@~*ha=D0?ykNjX1QGRfdE>mCT!e-!3TeB+t+z|J3 zXClX-6|!AD+}vntdv*DnPt*1ryMyE!x%f7lQG2;GU+@YB>Qh#~t!9$trNW0z1%+2W zotzpwqr!_o2z*&>EM4QrCSjFX>L}`|7BccJt$&@5866;^;^>zNQDE|K){(M1+ft|}+`2JZt zqvg``3QnH-uc3EY1rmll-M;m~WUjLas+)pJ>Ys`#jqPD&v=%PJ`z8)C5biAfBe!IJT3qFL>d$flSw+Ew_pW)gryRWH4;xXfz3rP?=0 zQDK>S7~MI@fGGH^wf2Smh{zzbw#2MpAGY9AjmYPuf|&QUD5;MSNKl+j2AM#Y%1P65z>`ZA2#@VbXZY!~za5x&e3O!8e8mde}HK<*qHlO8ee{q(; znJtLd^PtDgrjv1a-fyflDYxz|K_Omr3a1XZ2fcs18L@N$Pqu7)n7Wuc_g-)dN`;cGm?B_OB`2kWGCy6^@hK-$>7SSoLyg=-^8GaSUWVsunT^gM~{tB zt0`Y*X{=0;y1nDC{bz`jCjWcb9sD0!^oQ(ZUd5~(T#Bu$hFx<@=hC$Nm;dE0`ajuy zKmv09uyHj+ALtv>zE+qPNI)yS2|Cs%e3y%Nc=yiYHhp(>g3vYVt{pCCf=augNt;tU z&FcAou=mzMac$eeFVex?f@|aMPH<`5o#5^kBq6v3cXzkon&9p1E(X*=(|jdTvScLCOdU&H z<}05y0X@E&EZId-;$##VsZQcUmc}|H9VJadcw_ND?N6W~q5vUE%GiQMUaBu7OjAf& zg@ECCGjJ42Ed(#@OOf+?bT&C02o|N3954xlYA_w2Bo}gt$wK(LW@!i#b4bvVFNvms zr%BxqX5$kLl74zi;f8`)TF-(@%8j7nHx*iyYh=#yCp(G;D7yRvpq@V>*-9 zdQwKy^QX!?4}{~W+mqYQ^SgtsHmP*+Vu$9H8pxhmZDfrJH#T!GgUm|XQ#-R?9%W@! z%J84h==9nf{D4*%-4Q>pn-%2TBwzXb5>4Q9W!S_0W~xMXstAbh7r#m>Wzd~s`_8xU zCm)u7=c@nnwZ5Wt3fT(!jZt6n6=KUJ59m4{c}s0QwrgMBW4$D`&;?Dy|yzN-usBXnsD)UQU6b#mX) z?HQuvm35XZ_#$UMKRYn}>aN;M{J}SwHr_`8JhhxKLJZ8Sm@0YY)66zQ*N`*zX2oo_m~2BVEjcfvhPSEr$|6ZSyh9Jr4upcXZL zEGM*0CnRIq!IzxX9c5DDaHtLK^Tlp4MKAtqw8t_}e3eLTQw@?GnWE4H zW>)3yf7hQlPsU{3Z;i9|J-BJrbW;H`3!itP!u+EcE^M>!HJtBT6j?ocq4_MGMLtXo zCoeUgwXm4z#DWKHI#`Pey(+%KJ7{l@h7VQDXISVq?AvAncg;1+`*rSvhLDd;WC*X3 zMYYiOEb#gdf>0=nD+gW8=k#mn>tGnLj<^7&H!3QY+51y@Gu~t}hlWl3dUXmT*nRz& zSbIl7-Iwi=U-=Q4Uub;2S!wC3e!zbh-IqXf!M7)b%!OkThANF|#(U#KtKhN)rSE6Z zcyT`>>$6ea*Y~wNRx~JOI7tUo8;cb;Ypk(}MGYWhfWv@!@t#4y>bL%Fub&bORNfPEk(%L5oTy!C&cz zv=OBV(crxzHEQj7`VuAEMMel38HB^ah3BjcI)~J~)(AHom={)sOf3~(`CMqN@Yx%j z8LS}rFMvaGy&?wiG_2^ux)Lq=z2z_DdKh7(n!wOB57qvDjH0ZGq z`k-~b!e4zYU8lt-rKeO(x{|jW8~vTKV@7)5cff-^Iy!{mo-b9tIDK%rAUlF@n}pe* z`(j8C#2N4SEs{}?)qQ80Ng-HmtpqrNQGlZgcyhT9k(5M8+%QPtB?Dr90g@yA&ag1V zggiOs8#$9*xI+zj<(5V=t)0Ih0%6j$au=#Mgbg?$RS{1dGSA^CNqvck8`vj55}1UkUMYOO|7s^O{;5UJTLii`xn4wGjp& z%L7v$KJkp|{KRj|T`=R&GJWNfqsPE!2sk^Ji*w4UG9N)%RT>B@WBFj!Ez6g1cFMHW zizzp6$o-~L=B(qTn3z&0mP*JyJ$0s^3ESDq_dC_4qBcciLF8$vb!w+aUrLNS3MOIW z)(}<5CCwPZ?YswOX~;Itp!;Xe{#jRcE%YWEGzMs=kwVY1!S^?vr{JD5EGpP>j;o=~ z+Z|pR%A)aW_PrmyZy(in(UV#oALQe?JwvS)avT=OqXj~5{0FHaA=C{4f((pB`kt|Z z?wkXjn%w3(k@g-mbc9Pl4higq{I?RxnU5bzm;Irre%9~F@KuW-oHrkQMB_POR%84a zgTRFW#p_cn17ddjz$@0%MnA=^-eSUohUHGsP4gqwX5&CM}(ii2f$43ekIY(RbV}A^H&~bPP^S}r!M(glF~t(B2i$IIyGtNLR0Sj&1A(L$ccw`Z*^)!R3zxs`iH zvSwu7u-kG`7QX)XFRmSqLK-?48afyoE?AKP)(dEuGdNgZ(8*6akXzlGl};ahHOHcwfN`|0WJ-|Ip%eQz0@i?<0?GOTy)IR)&F z-N#RxuOG~8q|CA8U%C@ND%mHYW}^MraAP7D%e21#^sVug&$G5IpHaul`SLv5?FrT?h)z7~ zEs^(cPC<=%k0+^&q_baB%~O(RkJE}16ZU5WD!<#IYILW5{B!e0i0UJ?7FrNgI0K2QW_JPBI3T;C1);4u!=%4qE@vL}(@s zZiZQV%g+-Zo8W)?4T_0O41MPVkTE>u4myvN_0Tm3DL))?XTZk|jFa zzy8{gbo|PvLY;vxk|ezo!fh`%D`HeVv3k#@oh*d;sz-waG#5qG-rQB{X}@2FK3q!krI=l zb>D1b+g;fl(+t};z|?%HC1$VkV=j_O$|PZ))@a1#0_2g!u`oLv&L~5YIOt7LkQpv| zcu~WcWF#@d4&D#8{@JkQQ!X!AaCu~o z&JV|B?fgPxE<&bdJZZx~I3>5_=Dhwx)8sVL&qx?MLa%(Rh2_Xy#g;uF2YhR&Hge_g z3-2H7a+ZMFgoLUdj*_(NqT%()ar}F?inWW<=c&~Lcxk9<6bHWw-u+5H{_+0#^m)F& z?s3y@C5~;k6gR2oC#_zonc2qz{^TUREMrF9EFpf3a;AMxhm@ILb#CMujJZPA5l@Se z_&R-ITAbDzWs}!xk|mC&GhT}i_x;~EC8%a_)#v-NB?AJoS<$Scr=g#qZ`a-Q$w45AKH@DZ<#w4HEgcOF0x>pikk%+uAMsK-_4BjNnHlLF zQBYYbQd1rg!Ydzd8UZS>fj2^XWTow=FV`x_vUIeGRrO*#q5eEcp3X6Tvn-*GCglvr zqVSO-=;MF-n}4JD%o?A59L}OTKTd(@o z_ljbNxM9(}?5!IGU!`SV$BQ4nXRS+YT(xYaXl4Aie*73K=k@ND&u3uU*-L(k64d;v zg~?`kg4;FEWzgh2e$E9}#PlGG5~~}#Gk@c}jA=2<9#<&?g1?#$DGu#qtZgD-lvg{s zHlh?DP6fqQfovtix?p>RoBGB*2iquUDf0Ble>o&Oe%0Dhqwdi`0ULwyzi} zsB&MNbem^|lgo7PjKtXb!f>bJTz}x^(!>6B$KDuQru z>EJpFza@y!r=GAKLh zSTG#e2~PzqXpgW2%)E_gZq9Y>frnTgaJ(@#>&B?w#8A$`)Cz1#^NZ;FB3}(L64@Jo zFg%Uc=ih^b#33@~p0*GOM>yC|%5iKJKyKC~X*LTfvn+k&QFXngE9{S_ddjtf4e>Uf zI^#QHOu4faCwIeAy7feXdUGSgt|P-wRI*gx^t*i=2~<{1FI|C^KhAeH4LJDp-exR7 z49naKy_Jan8Fx_9@uxcJ8~`QeJ~QuE+PHcNgJwsgI?D&IVMzb< z#KxmBi9w2J64$)^z%0rK7>L03GBb4fkgAuIj4HC-h~WzPX?;$TSt4Yv!~w%INDmKxoG)!`Lz65{BnyU(a%A_ zGdpLT!6dl~<(mnMp0bpknyy-wGSEK5VcQ4wS=_a(^>Xz_@k>Va%$#8{;$B0?Uj5hk zrgph zvSynk_y$6Me_phO3H1m-TQXPW(i1jQ1q?3ig}5iHm1+gZM_{DIJrAdN^R+xvEF!yF z68XnYU=>+9HhT^k_gG86OMmh>a}cTK8Upi^7cuJ`oQ{>3a+7aZu2t>vmu4OF8Z$pJ zc~lu7A1j_V;m;IMii1qUU-`7M%kd@pfR(L7RVYHm`e?pwVg!;YV?$5gas&SJ{``Oa z=%G{~xOOAkly5fP67it*eURWFqePL@KTYv66N9e6i=}aQr=U4P>tWC*?GhyozDjD; zKDwBn^Ww%gXEVD)^jYD-(1qfr*@*$+Ye|lIw#a$w|^I10l~XwL*(y@KMz>Jio|edRsT)ky@kcog^()b|k;uDhU6I zWh>BnlP|+aSU$cKii<(zB>q`QUg*QI&+gTo{;#8n^9h4XhLMur&w?Wl&kv>hR>7}) zMtJ~Su~};>J_J?=nDNdcFOpahjND7guD0~_KlSIoa`+#TknYWx(VN{2typEDIa7Np zi5p6a?DrF=2W07oMfPGY8P0<^xgk@%`*#S*S5 z`=5)SOmsUYOLMbNEr_RYx}p!drcO z<Cx9f|XCCHjBH{-~?_xlt&M2*jDtWl}os(teR9 zDzWDj1KMc(7%{HT#!eg|#ihX0GY)5D@~Z@U%|$C%n@lJjoCuMqqe_V%CmaRmIhz|c z$u^so2IlluyBB|tYFG)<&-%O>e$Li|IWY2td8c=G|Def%ea#CwIwlLv7+yWF+i;-( z0ip{c#S6m7O58<1$?F3W1Oz~0Ez5)`3;-kOkv1t%`%bx$Ajf94S$HDw9@$Fl?0s0!H(I|&d+E&0ElpTW-CBg zd{5<`W3P7yEVj_B>{0Lz`;!^kRo%;}F#jZy-CYOSuqrEg#IP0Rf@Gmf)C>WAIOo=3 z=c7vA^#H5q7*iq3{lzHagbHSbS93;X@q|LEXPhW!vy2ge%mndh(2|-nDDVk8u_Ufm zHOM|y3S%kjTOfreP3t|n6`h0=ocJbOYt1>iD9I=SaDyD#U&VTpl1wfWJ;6!^88{8D z5nzhsMI&OSv|4F7*ik2iH>nwsjgTU5*+$S6)W~Y*WIv7CBp%TQz7S4XWP_1eHi9~slDM7tQYj9_rFppANk@Z78Xn~6_%j(MO;a~wg|!LLDGl}}3;ZR9G}E){Lm$#2g6%cP7Jgwd$Q_~gGQ zMoI@{JR6Ern;^lM{t-X_ED7YY5|$;_5^h9Iw07OL*0P0z+&04U(L=jD5mH)^*?;rz ztaM58hf6Ed=-5I7=fr4Ai_uvb0Hj}XB}JF2w4>wvw15W0HpT{ROflPr1%}AESU)~e zY~h4czrGAlGZ5B4(yaPNa8P_tr#p(DJ2C8*+@KDXjVdowie9~|jO09Uq_OGX4V&Ng zo-PZW7&Cfk=(Q@l0R1Nd?hqXtOmT~RKlmVA0Ar~9y@{RaSdM6fh)obW43xjWv6Apn zXf6U`3=qhRN7el_nuiu&FtsF|s6<_D@MbJz$-%7O8L~ zYk+lJgx|$miu|UY#LF!nC~%JoyaY#XeF6pwsvlOJ9M{XH{tjnWp+G!E^sjgBVx~td z#Bb}NA--zbuXB*D;W7$VmJlc7{ zaUnvBTvGYmv>P~Pm73FDED@w`)jC-jK3r+KgZrJ)j3?*gHL~qmHkHz@u9%K;JO9C` z6J}Yrc$GS9mENX+>Hu>CcL)|PqI*q2s(8Lh4L)7OcTMTFOy8By{ssTb{)qFrLU@zd z`V`|u(i%2=EobQM_bHFKQg2b)1^$_aY#pZ@q$N5nuN`)E>5oGRYA^n%t}ds!%B~f` zROI~odrYrU*gFMP9gA`)RSu@(FR6Q=kP@F1miVt4Q(}QvWRQA%ieL=aMmp6Y%McFt zJ(|<11Zh_@>_tN+lw#oF$X3G`2Ei<%E0+|f?ZtI}+(i&em8 z`_EU{Ka;;$d{xj0!knX`xRs09MUt9jr%UrQ1j>uSl%iKf#N`IB?icJdQ>e2qx={K6CPLm_#j1C{#siMLI6Fi{cM@oZ%3j3zdPxyeGrvj?yoHHU% z#5SHL8Xh)Rt{uoCS_NZEcfg5YHR8?6ClF=~j2fBCQ1Pc%|?EhUt+_3BQkOeecU3$nfAGnY&ha1C^R(5 z64?uTT9--MR0+WlE+*?eY>d zV%(hZ2C0>16mX=BN=Bva%7rE7ru7jG!%)kF)?Wb)G8-OH9n_Kpr4d|$eFjQ=0}cvp zAp*$kVw&7)<^v7slNkqXpuz=nYRDEt3Y`O|^mB)c8XJt}>@d{msg5A;@^agRpX3T6 zd-Mfv!Qw-WruXbssi!eBt(mzPKgJR#?aVP zgfZ1C-k>TXhe?en1}4T}3>fkeM-_%hTUsEXL`MZC(n+ZteEWn`$?MMrzwlkSaKn@c zJ4PiGILrB`%Ke+AH6)G017jnXsWbHOsIi%yoApBSr(}Jn84D`vYQYdH7Cb3EeFE96 z*>Zi~;n+%PPOk1NDhmo? zE6gyUN!<>_|J#^5A*B)(95rUURni0OTYFD{5uwZC;LB?#os;FKYad<%3rd7`25Am+T)tf3f(x(La3tj>=!MfB5{x z;_pWP@cBC`f64yg^B0T18~wxQ@2LDG`-jh8EdFlv51+rI@|WySK9ItHzyI^hQk_7- zze!Pv`K%R;j|1Ri%YA=^2+O=AEA{SoFGO?1B(hgEvhwp&(fLoF_mErRRS;oFAL|%g zaBw>S{s}L=l3y~Fo)3L0>?vjXNq2;!`0#>I*cR0xAuJG#-oQh=<$t~Y{3L@FDpPn- zGQzAMeXPhP!j6C#tPcU7D;)Mxqg2+AZa`_zN*wX?ANM{#*YCkW$@jbAPMPB6+7Ku( z{~`}_=Lr^s@I^FLo&>lUKqicK^_2qr^#G#$SHc%Ln8|;<@nwJPSv8P%0Wy6M;{X0j zHmnbyA^V07M@V&tpn8e~7%+It2E`7Z{9Wn&=LAp$4lC}GCbf*d#r{@fDT9%q@-Q|6 z;3AfQ6Kn%+j3J{oP;8M9#9BFVM2nWJxEYgV7@l&KGHRw9I7!@Yx-~(cIF-wD5QyWN zUNU^78OAhCTPg*SYB&)?hY5mOqr}YxW^{jk^|EL9#2}WrXMpDEBkJ^Tf?&zh=xZA|+~;=q z8fl5>r(IDi0CT4F=w#pq<`J&y@FiT=X%(bQU$z21_D~qffZAftrVy+^^}5!mEByrS zGY&Vm`jX0Dulm!gR?kQI{iQ#MO5NpU^P~X6KDGaVhBTd+1V*^T8f}_}CuN=ed$$r< z3g_m4@ezv)za@(Ig~{DJRTYfIby@^mQmDgA8V)ms!&Yp?n!rWPAc37#sH}|9}-<3y7Dzb-^SIxEEKoz53ml6)MX{ zwtv$4IdvJ=AGb0nVRw3BGuW9Qe9J`IDm={s{p3&2{elkOQ#+y4D@U$v zwT2r7J3?4qs@Uo*)0j<$t~8Q)#o6zapJ@&JYJYw{&R$_KGyZjjI@d6IV*j4qC-XT$ zD=S>LM)CRU{qNoOjQGM@J z$l|&HFnGzht+cg(Y>tZ_WCTcPPE2(ImK=^xC=HLx!pQ`g{umT z9{chHoz!&s;>~=>)Ql$+BMU7aEd{bDp0PsbTDQYv5~WiZ4&(;GNV==*#{OG+q|x}= z&JgsUaO=AFt4-1~{iI7ME-(OXr%xk#8a596b5~S_^J6|vFHz4E#m~jwRlCtV#rc6NS8?=di4L_=5$DKX%jHAap?qiK|~;oHvwWU$Pm0DTtbTA(0bpd zc^*}^%+*GWR5u(~N5Eh%T}OLHp2!d({*yw)vLO5eqKr7_uN7y___48YbX85;f|;r# zU0RNKOHFFnlAEUOn zDP&seJUH9sM!J$Hljza1@IhwIiL9(7@`@JERG!~UXK`1C?jG&KhQ6lGo1z zIv9`}-khA>Rqs1_j3*6;TT7ef`!;)2BOrnT+E3V#%c|5j6W9qC0mlNd#-@Y<2Qh`# z$%Zx-|B=T+MoUWx6^Zk?P}&ZzP!g}U}rL}j!cz6k%FCU23is(!D(ak_R_L!OzS4^j7y|u9A0rY!>qFUP@F)l=Gq*Tw zOaMcw>FpMxtpc6D%$&Iz%Wpwc5m3o_&tl_iI3R(u(P>@ zYi|}=YV=?N?;=Zsvqx#Uvm<>@#3GRB#9A~Oq1C*P;-<367OjWTBiB;dtC{_y$Rgob zjw<(b=k0#D5XD5A!w>vd{mB(YV#|3VUW5I&g!PfTvSa?6msIfz zY~t z2!vftfZfUE<|BaFd&nGk@|B^D4J_MSan3v`m1p#79&|t1& z3rpRXrOe&(cInblo(lb$N2bN`l#s`R^%qcwLK#`%vl(MJF$s|jD&-&j9m-$gdu!T< zN$P)rinxd8m9QVIXD9;wLoRuF##}NV__G`<^MC7i5JhIY{QF?Czm}bUH_Drs+AHU+ zx?giQrlRGM^+^g%@pN=kLqa;Ylr>m;$6SfdLh9+w9I{UP(e5^xYdWTPr%Hyw=91?p z#x1xsub8n>aDjor(xLI1W!)p@tXw3Pr7hiPLsSY@ z)7>uENCLsQ5jDJ)JW2@{cHf@oU)Og}@Alghqilw2eg;jI1m&j%qSmXxD!6_uP(C}4 zsPpc8XteE9I^ai@M`!RfLHi@W=_Njst=p$tndcA|;ehhXqt|e|p&+7jL%z!!6>H>R zFWn0=(h{mY+5=l36+B}}OQ)Q6Q+M1eGJzzkSfp%WQC}K*fUZavBmbA0BKbCkQn|}y zZJ+e=@6;aqDJJVgPI;B#+X=siwixX?qiIWnA?61q0^f-azhQt1AO;}e@L@BH^aKXN z6QJPNtI%eA!(s}`$R40Gs?lk0`NYq0h^xR%m_kB>`cu_;MHL-hzA$NtbmrcgXP#*Y z9+EK7Np85mk1j|uu7N&WcU}Dj!q?~9iMzgc&+JoIT;t5*mr`Y}sW;e+MlL5=zin{z zZ9inc4`yXN?m+;u2RB?-^=j!|jqt)v$cTv^$KqJorZtzp=M}YVENnnI{9pD*yn^o| z>GWcirwn;Y_Dy1vlo~R>aKg%GsWg4$KmFIg3O4ZNNfG*K)23Ik;Hza=Xh#ndb$%;? z=I9g)ob`_d&2-QmmyzH0#svvu+{s$Zx^Od>-Pj!KNbdCJ|ESz6nl*7aW)*f)GKxTh z1C&8^saNWvYjbOapU29kUd4@4Aa@C?End4D0do^Ft6T>#+=!U@wkxrfL0c+_Bi7=m zVbnm@oh$qU95Nnr83UeX!L%r2h&QkVwlct)v)=iqIg35>&uOR64{M*BX`kT8JpfV4 zKP~sAYZSuC_^sctl708nk@hzqq0sn2Q#-|uWN}f|njcO?CtpU1H2};0M}GI3Kp(2l#82SgPHm zU9uV+*(SIr6p14#lyi5CXpAI{mEw1ajXE((Ab}jI@?U!rch{diQ_acWjl>nJAgC{_5SR6 z38MJ*98oCvJTg9DR(QDb>$6{N<%!~3HN=KLWbKCEPd*1xLS%@7+z!DRr<$wWsi^sr z&v?E^dXy>Ml?Yrmgbh56)Em-`a&pltZ}L43u3JBhQJeqqWB2av9ovANp>rxXPb(|< za;Bwil}nVLvHz#Z7&dn?mc`0}f%#jasITnTNAL79gTEYo*Q2p4I~_m2_=rewSx=?+ zyA7INX?&CAmCtXnQ9e(Ny_6XsGGm&0S|x)Ihsei9+s#6{z_b6oKFNPiBmTT=kiD}7 zSjl^f0PO{1N}ErwDCuuBE1dpaT4^Vh?l?69oh)YE5grgPW$UW!Yv@G%<3#BBn+Aib z)0;|Vxq;bTY$|MYfA$A;%14c-ei+xZ_?WF56;3_@aqT*$bf!T<&D+p}!-nHdXM(bM zB&^KNz?TwrG$+x-V&PmMlSzi_{vP&2F>|cauQ$)X`<&iAm&865O69p%aqCIA@EtV? zCFV8FbTxc8=PG(PX+e7mYH!`blIQzyel8}Uz@@fw51Z))-Sx_+j|+*ZGHd#+gOR{# zGE?eaF9`D7H7d@kPac{4RevPdnOIp^{>~-+56OapG6Gx7mRhXcC5-g3&=Hs3V}!hC zY=`kMD*r-A$Ob5ZN&bEbJTvNmFs+79Sq-3ZDU+w zA>4#pV27CGfD~spYSWCHhqKmI?SSw@dJ4@W3K?3RJOGg6K`B#%Sz+_;`LUxcAJ^*b zu^1m8e#FJ)FI5mqnw4hC*C!+EhRTCrHeB6neAZV!>GZwi;|9a14hI}9QZuc9=XYBvpaE}7ZCQ?a7KJra$h`q^2z7uUx<7y}Abkb~@&-$Ytxm>_wvGe0I?emy55 zF0kUZ=RS@Ree4!rkLiOO+RNP=L~CobbKfvnXem#Lq}qj*n0%-GONx9AjKa!Ca zZ;HP18Q`ktD@+=h#`$y;I<`!m-i3ZB5~}u_OIiA&)&Ae}DGt($Y^z+CrTb)5hCa6x z7KmPeOWmMk`93l*3-;SD(5DNX4uS}BENARMKQzrsN&}(E)xpH;#(B!gS*W@)Yt0Ah z&AsT4r8h;b?RfWGtRL`vd2LoV;`MFW;R5}aHhEH%N?BO#d2&T6FXHB?gz1OTzIPHNE8#* z!v}-KWqPLSlha+x15NZUv~j2wd9uwdyRfnw9kQk1vhL513#P=wB%u;aZ5~fpdvmGj8MSJEwIUj!Vd@w=f^M8s zT}nU{!97XH738iB-43VXyYiI&ZAiQu`3`tj=aF*26hEL}Kbgyc-eYb551iOFXIxZD zCl?o8k>=7`k6N4?n$vvgM1C|(pq}Ig)Rnp6wi%=EEqYSCHY=K{?o?j4Az}@`SeGHq zkTwsQ)f5Lwz_~85?*gnOm`2M2OPpsRhH!s2j- zKZ@O@mh3Z4)0sVX)R&*_)8XkD(*9(zWLBkVfAD!$%;3v27+I{^+%}6HA<#E-$iU4r z`^eJk@x44>hLUYaV93g4QpZAFOw3Jcd7A>Gw$W?=ZPE4GrHEVsuA*tD;Ar@#PX~dz zU+=@*45)s6PN>zlhQtdUs1(4bJo6q9QwAdUr$6c~V!|IVMm%M!YAOp-Sl<<|H&Dy7 zS4VM1W0BryeTRar?Zh**aU}!KyPz0=bz%V>H@FA<8aa!}s#C-a54da ziABHa&$Om3U$D@~1)&I+HF;n;!n?{e>0K#xzKjhBEXW-@75NjJa)`q59T0&*#F@76 zI5D-+a;DR|nO*Qo+vytA2hyM}{Irh-k{*YZ9zLW;l4f8zi&a?kReLby;ClZdNt4|| zI9p;Rx)r$5{f zl5Sqn^v)du!;lT43+wOdbSXNViQPhbb%f%5dfC3Z1h!3{0fX&iax}~1@Jz!ofPX{Y zQCx|g^3E=6tp0q|W#uYCiJQdf(-cPLZBD?#Mz8x-d1fljt9 zPe^_nC1rWuApzLGZGO1ukOy&Ip+tO?gcv$W+%h%k-GA#yz0*| zw=JLBhEXaHPq6s*Wy@4h6zZ4$gutSy6WDm7muD6}0GV=(SbO6gE#a6|z428;!(r=> zcq#6Hl6a&RY(l3llXt6tEH;JaNHq}x5Ea@%JNVpGA^}77MFJ*l=#gqLiQro|UOGw< zkTJp~S(i_xG60suvu$PPZcHV!U!%)f3R18b@Bq&fTq)*2DwI~0yqjn#S1u}`qRYf4 zMN0YJt#>&kqg#rFLHeU#a^JPwR}S>2>{!Br zYrV1ugG{D}wB$1q;1bEdZxswMMbC}(1EBPYMU;Mu`UYeiC=EI??@pP%6xUY*>siM6 z_h#5?sj()z@`gU!DrG4R=5BeG9Tfl3U+=frZ$2ksZxXE?bTS)#+MdA16gvFQ?>Y1q zdYu0st4T4fnN)VD;LSAeU{{Kf!+GmFE$@_iC>DANoIhViw4gp{7Y&6?yO^>CK4EHJOtBuopDl5iAg zj?0K^=$THV1uo{B4Gipd#u}x@!J8JU_Eg?^Jws#BIoERlMl3hGRbRlSzbU+z zidk@~OKkOqAD(Y2m29sX?LJjBE}N^mj`>m5o33E|O*n?5P-lE$C8bZ4;L%PdMs>$ zMjAi~t?Ew6zNe~T4U39XPse1FE-4K*^&^M4=vJ~Cibn_ykb_ej(?NEXTSV-nku-oY zHray;B}}QAx&xvg?isyQ|Up?0NiwiGNX#9eQj-g z=UQ`vH1d9Lm+mtqm?xu5`<2hL<_e!0#6%+;Q>aE}>3fggd0!B}bysFso#&+#22;d; zb(3i#3g|$Qm9fAuv(-9lTU%Mo|*BoWW=r*yH?P+?oAVQD@$*+1z`fHPq5OL_vS_QL+ z?@QBOY<>=enILSAc`iGy`$+UA2OeAsYNc3KF~(g|3NDlQP=G(1t5^P{M?Q$2M@hc` zwVlO3e$AYE`#EFCAlJ&g%S--aA91RrlQ$l>t>R)RFJ}y5p}{hVmrw2=`KPrU5#-$l z!}6M*ApaOaCgW%tHmeljc`g2LqD#L%+&;Dw>c}ti8yzC3n_>f_7Mbo}T7W}f6O$Bh z;~b&n+aqVx(qqbNlqNpqwwcY@q}6{fFZd-#teD0>|J3B-Hk8hg+lCVm%L|mm270}R z31IRj5u0$S>+AW?)NP!JNPgv+EjNeY+H+zOv>RNuwJ=t0wEig%I6?(~MS z1o?J%lF4uN6Pt$8@KnESUMTe+Y{p6=AwfwBzw~<7=9pubR)F)c%BkOBF)Lh_W`*ET zL;^670t5xM!DL@GuVD|-h;xuKEvvR5B7yxdqQ-Y-pbyAx3X9G&zqRi~2Gsrd;mtdg zRzn~H*)Ue9MSWRdi3zmGg|}Yy=Tg~~Z^^(QyS8(L<_^i}JxOnGO(|07z+r!eLUHyP z?UQswEQ?BhK(3J0OA5Ic{}3N(45qs7g@BZ80^t|B>53CaeL-`TXr0Iwtq7B-N1h7T zl@VeIp{7Ro>{A%F1V&LV2$@o3c+#TF+L2}lV#Z4SwDYxZh6NsosRZeG3^}}*($=L0 zpUQsr7u379tEf2`Mf9&?Oj>SBAN}t4Ih5S%)>>5C`Y2DQ{22J9g}N<5cZ`?%cU^XYS6{uD(dGq*B%U({s8{pVOz?o7W^bm` zrt7gPK1;nwFeBwTcaKm7~30Zsfqd7n7SiZ9%=+$GHG=Aa7;_#5Xjko3hdI?s$Ih|f4M z+5M>q!^Oo^$<&r)LMS1E)k45w;EzITkf?&Fb5b(gaiI`7wV@wS94Kbx{n5%R#L?-& zRFH!E>rnQ;pkm2m5rgIRP%4U{v(iQoqZp043XUUH=Fh74OjsgmBVzhOQd0I|!&ySv zDkec9WFhEpC`-Tyv$Eki^o*xu2M$Fkr|uB0E%;?WP*j+Y>t0v%+fxeATh$TjS1;Q| z4~_5TG;*~gK_(XqFF2Q=nkvNS`-)*p>LnfTd$GHXuIx0@hlx~idt744W`%}m0{45S zMf68d;u&_G^q$EZ2!N8fEiw|~dJE#yk21%c8p%4VWEQW|Wf*_zvl+4gsQUn33Iv)h zn$0@&d)yU8ir3=jeWHN`>zIUT;Rm0cA*B2|@4Tbcv(y^OR zs{M+}*G+=^Gda3Vp_}ek-aP{+|G;?hMPLLtMvWC^Cx&#g!Hq_WY>KC35`k^zDVd*0 zULJcBuAQ4Zk4~07luXEcd z^q#+ep1i1CL3-$c;sS9Jylg|%Dbt5s`IC9KL=INQ;=&|;^>BsTwnGT*jKtPf6E|Bt z`zx&?4Fe0Dl*{zlL2SjE@6AM4jf*R5ujC}(J?|wQa=Pmr_g^-HOY2|VeY;kR<6mDl zoYPiIIqVL7fB4^F`%W^=2jd}>o@I1 zH^1WHLHTJ~prf*Gky?(Wf;r&XVgzw6#UNvBL5r7R+94<+8ds}IG7pBM5;scB1P43R zNRh^ghq)$lHIgP024w*@ISJE6Qu~a~4Y(?S4qu19yoJATY}Pumr|P6-0!{K7FXC-CRd#pH}0x4OP{qzVZ1b+r*!qbC4tJ zVGF(PFRh40&y&*7g<)2gfrW};Wf`~G%-`jZg~H*{w!J%#F^l+6U(l`}@K-SLKVBq@ zGw+h2v|^YJR_CCtVT|?^c2UJ%$8jsT(y^_u=fbIWgD!8kqk~4Ko|ES#s)GncWj;1x zqeMjfz{K=U+|(R0Jp+^N5@H}C9Ff!~vmnFw+ejBzo2{)A+0r(eGC`SGsD}@cbicO8 zEK~s6%$$S}PKCoc6gnaFe%?YTfde09k{0nuyk*9 zVOmZfD>0isPE^S)73Jmd9wWxSK$Sf9eRg4}k)1SqBw>#5q`K!uls?uu2&@WJB@5Zf z&z1-I(aUACA;_J<2fmJJ$&!{I`_bsCiv5y715J}N6O69p96mZ{C7Q>&+1d5|e%c&l zJ-txFifwz6DN6L2euX$cwNBLx*b^E#c-VjU4#9zi67(}dNL-fCOI&-M>E}J!oYjaj z9j#mE}x<(B-O10(ED|BF{sN`6(o-}SXp5<4k^%%a`b(I`p+Ul|U8r*dU1DM!^gnJ} z@Z!2>wWSW$Qcj5yt+iOXbzAJux@f#ur05;D&&upa>C9YLdK2T);f{5$vseTI8fPNw2A=Od3jcJxINRji57W;&}8zw z%ED?1x1wo-*v#RUQCpOHtg_3?&ho`$L9lQO1N6MH- zV_*>$q4`O_3;dkq(IL8zklPS%;7_wuCbyGUfx0Je3Z>f1d_&u zGQrvyks@?fKmkxMHg#<{!CUtRz$#Vj+j&VpFD!NGNiut5GJJ^QaGE(7-ZZ>hG@RPp z99L$OnrS78+Go@ql~|XU-&`rr$q?dN)fcdmt1vY=n2Vm3;k_7fA?D20oz_*CvzAw+ zDNE7ITRIt?nS8fUlwPtQJ^bW2gb@)nIX-$wK7qRRq*JgU_ESokQ>TV)UVno#VoqgP zRYVRdWvj9bHBlA6R$O<0zgFM5|Kb!lyjef)%N$Bh&ZEcxs6suE+f+{^e9tOzCAob< zt<=GBa*App5bdKEo7oehD;g|gyIsa*dp}F<{`zS(iao~YN1SwBW-5jVnerAIlH&s! z4gxCw8=qvR%$?qxengT1)vB_AhDC9{geH@EZ-a4B5bcga(-eISIV1<=A=WQ}h<|33 z+c2#72x9gZJb>qHmgVq>aY#S>U8af?LQ6mKvUf1`YltL6mirVyXF{Zj^@J7evboh_ zIZZita*0 zpNk$8Hpd**Hf=2*e(%+FYo~h%H?;xqvemV{_1)crdt5hl{dt^C^6;7K8*Ckf zv??hgQbqfmjpV2V&;;!0m^G#m3p?IZo$E7k`m~jN@6i@BE2VNm7_Uh|Wc~1+jI3Kv zOndQ-&pbckNzt$IrPW2>kHZ({pmQPXu|ON)FVg<1!SjC+`DZ=`MrOUw-Qq;<+y2Gt%g@z2J3@W~6ak#5U6Fj+GR9A&w|gC zo<5H(@eA{zkDi}LrEb3sCcrD+U&Nn4F}*K; zIz3It!)6S%uTw#$VZ2P}+%jmWK*} zY4{1`{`~opakHGf`Q00z3Ga;xnIOYj?b~rEX>~6jW(!^ zVHI-v)z4q~0!}cpkgS&>hk%01OFjBgYOR}K9Bh& zXT-sJ1I1jWZ&j5Hd;UHn8t28k;fKO)|0IHt>l z=A=xVIgh(LbuyPnQ^|~uw)^Bir-(WH%2@4YaVHE*5@47;x|ARZ@qXj;s`||D-<>uB z!CVpo{MeCR`p)h~V0G~U#kkyznrPGES2x}R_30)Uh_f0?)~gmt7ZvxZsopOoN<14y zE~hfiR58Ur#3#|ErTY&(NQe23IFdz=;*f=l$WcVrd@y9xB5eSz5k7E(N3E z+h+iYu(H@(0GpZx6u6V;8<qKtDhI2TlcOy~QD#UG@xFi%(oqC^8HxlDJ6rx>r2! z@V5N-u1khq+AdBvzO(URh-iE)MoSJw4~O3>u7}mdGdVJ0?ekCFR%y%2FIN^33mKP) zK+yGIrQA2LSxd4+HGtbFHk&p$r>bmI!FD9lytQ@K{&^m$V@(bY75B#HmpG8$BTv>* zknQ*wOE1cQ5h~paMeldL#s~BE)B;rK_!Ckk|HyN-N42guld6y?i7jh+w1jnVZu7tQIA!A_X>yH-- z${JX+S%Yi@%h|f!SWrjvGbX$Y@j|sg#aFgWjjs?YT;_*J{H)d>^&N2N$@pVjY4}8= z88Sf(S4rg*eLp%;C|%0Rk7{1DN1ZmydYE(L?#7uAUnkLxQL(@Z*i_LLG|ZGgsb$e) zkQb!0<{$N8YZ%G5|1OX7#^+gVj^9(*#8JC`A|Dco<>s*j_&mO{+YUB@H)Z{oecsTw zQqg<=K@oDS`%;ZZKdrLuC=aa;K`?bErX6ecE~7u-@qEN_3r0tXzEz1bN{S?`vKu@( z$q$#mkxI-Yh<l5f8d4zx>sj+|y%1~Mlp|O2*WTYPfXLJQaO7TeLYG`68 zH_!R+zzh+sdF2uVR^-F$6UzAD9n+j*lkzH=72u{37->0N-}u~%0{A0X`wRtnD{-Mm z?xJEnx;fejGUwtk9Weg~`7Qs-Jm5cmx4bNJewcb?fXLm`lGf&Hbl7BYcwD8ni3TSY zJU{d=Z4PjQ5o{+;nh+7iiCxPea#d4lDHRg&AB_u5AC4mJ?8_OyGk;rniZbn@b5o_Z z$3CZ|f1l-Awwjz>3@+88kL;G5OjRtaS#l@U{8^SPtMbUEXfvbu^vN^Ijn4eD7=!Pa zYO-7ApZ%{;>MV$kUwz_tAd_#CTcLEK;Z3w~sdW}zdl~Bjzk#8A38pr$PcsVZ z8@e%>RDea}gaB9$S>f=`NlzL(GowWr#c^Iq${8;_TVAIgUdCBgN|1LrXXTeB1P zt%O3tXB-@I^>N{!+T!KKP@*s9tH3*wQ5nsZrD9ZM%^W&o?Jv!aLv~5qo_hP~hC{{4 zhI>v8DH?4`G$1V2IaQ~`bpwh$I*Q$)QTE=DpgNRA@(c8cw;pv zsorn?Z~EC3tYWuIIZ#dJkV?Ib$*|KQ_XOsIq*z&YsM!YpHNO7iU;KaRo#`IH7oDb- zqB%HTV5*#e{aml`Cc2fs!|u2mTr)CkqP24R;(;M=E%S6DbyQ0Ak#*YdR1_8Z-@V?j z>?Y7;moNS0b+Qvn2~$^=8X8V#l!Ko_%THCD;0Jq4(kLisqzV!Z?sVJNlpG<}#pTw| zm(D4EPZtl5Uq2I=fb<($_%@U)z*oE`ZYoQ;7QKPA5M>NltOl72pt(sNm)dk)h|}u#A2~3{WMw3^09i2htFd z?;t~%qC+0zB_YA6!J^Im%MN(pje6+32+6f@`{-~#Af}~QqzjYwiGYa&_o(=7VSY92 zQI_o_yKk8^`_?~*JQpYQk?B20q9zUJOTA9A9HAt`a4@lSrc;Tr=anEmgUi(mfk_*$ zj!Sg~TW~lAd1yzvEVK1Ky+4v>o3OfMMYTTB?vM64h0pH{HlOWRS{fhZEfx)bp1MZA zbUy1&hbRb%VJSuTSjvJzVh<-yTVoO?EOZLoNjW3UnOLoRO+(6B7!Jal<8qexJ)wLN zDrIT;$7ST(t*!DnH^Qwqs;qV6v9K&7)#k<`KV{^1)tipkq8pE5)yPZ zO-sAxD=N+@|GkcD7LowpfJP2O>b-Q11t-xz;!o~!5)*@%`fcn3N8LW`OnYd zjQrZ%r^{F$+LabmuKQ!yq;=TBDJ|k!=Li?x9Q@xU*eT~h4XE?d<7HGIrIF%kr7x!!-a+G0|E}@<6tmBAK>BeBbofb`p$8o zI3l5B!w4C$gC!pP$>|v1K}D=7G3KNq)Fh(Cn))q3j+IBw=3)?16LM>{1D?khR^V1E z`g%yUnBW4)fKIWuQ6N{OX6xXZZ6>_Y{R4qp3PHSO+RNsAa(%GcU+A}JuH>_%u0Z7kd|R?&2$-;x9a~eKK-XADvvVE{?z=! zj{O%Jk_P6Yv}(1%87T~k7epTp_7H9f_mO_{>`OptWg6jYZv;Gi8`k^91rJ`R7FJ4( z`0zoIx)ph)@GuGUWjt<5=&*N20iGB>*G~<9+3X>0Md$Ot;QJ z&g3E@mdABvxn{A_>uV~@A}Vj1SbcQg`q@XYyqYslayx?lEwkJ75`B_|0K@*cOUf?AjZgjO&K>e z8b<2diO(mOiTTRP-rHaM!(++^N?TON8d)>9ZtbJK{l_~<2FG%%rA(cs`m@nBKXF02 zSm>nsm|8~Hc*Yb*bjB7n%dMlM`i0Qb`1g~(r8{>0;85^s$w_U;bMmz@7h+W_?q zO>G1t`?%^3i-##&Q2!{&Jc|yc-c!4C`1#u&pFY)ofAttqenfW?Rq^p#DojM9FYmjU zN0m8zxHx=x_{c!<`%r66*FDpR_0K1nD-|PkE8#M3$8Y-ioxl3lUk{TTpdV_h0zWzv z?!rhO4)wS$-W2`s=Rbk;;(^E_v&~`@?}RxJf&w`l10e%@93+ispCQ1JpdcaoWa0uG zaEZ{tLlBZajv9f7&LCVHezPX!HYOXJ^PoZrV9S@!$7E)T#!VQ0jL2t$jJkv{37!MT zhk#HrS*obu&Of%sfJ!5sE|%`}^9v0g)`3`{Ldj>0qb$whWO1I5JxeH0z~Nz(AH=$mJ6E1O0mqzsn@jjWE1MC^VEii++szMKj#as zMQr(vATCl`n)^=J)XJ+fh$k|XO?-1z@9QgPpuo1!j{1TJHZA;mi~xOcXA7^Co+^;g z=IHS-G~h5)L6WFQAw@99Ti^upXkbd9y)Wq5%yXYD zyf$2)H(yV)PG6o*PxU6d1fLq2w!|m$+g&(kS;|D5X5tPVgbebp&eDlSfvQ1!5#5xM z9#RYpj6~bdGB=)C<&-~LTUt9m(=1T@@n5o(zw;9=a=xv!=YBj0W(itlChebFG;Z{U z@;Lhv@a_9Zg-18asSJKyr~W`xc_N#@6TDv!c-lKZ^boK%f;G7GFfc~kl3c!Ax(eLW zKu`ZX$h0Ext58i zS-T6GVGPtP6JjEig+JiisilA5GQ^-}**5q&nLmB|zW09NAoQJjN!`*ehYjE~{O22= zW3?iFVYmn4PrzPnUeQZLV>L8_Lqw=6OlXilyhz`B@Nb@k`(*U|B|1{%3PGpCOO}Dy z`{y5F6gVVC9x3AoBRp8NH5k#z&rh29@39(q zTKfa#dn0ve`Sud@Td!Yrfr+rvwW45wS6HB_fM!XwB`eJ0bbb^3JSt>8MHDV`rg9)$ ztwTqsRx-WpZe--Ckpkr0ySy`x`cAT;PBIZTUwGXKeUh8HJ(uAQeJ)^%0!eSLDPvpL zyg6?(EveHr{(i7UDY}fta+<7!eQ8?!E^h!Fruy4r;_CplQ5doR4xS_+Gz!XJ+m959 zkd_`F=9G*qylk?-F=UX&EeEJO^*Qg2Pc_F||L%UYUjvzpH*Lm4RY3LQHSMs%0TC>* zv<~ff^7j4dSuf>$S5jzzUAtNJ$}R(ZxHK#*O*}XV3W6&f=z;&@FHYGr;?XKT5DrEw z2owv0<3@o_L!$)HZm}ZNE`eBs%6=~hfMo_`GcSGJMbTG+YDdx}im0PWH%d`6HXf#( zGNnRAQ6Iyxkf$N5LlfIt1{6&7uU}hfc2x@|#%;s~As`)yEyd-JRg1s7G|WKZU`+*@ z7Pl7nY9PtSl&3Lv`Oy1ln4u23;$D;vhpePFF)T{$iv7?%gI&I;%zfRj-MFiqN#Oa? z7lZOnT4g{lW`Hp`fHm7PdLD_BHb#Svj?4l8bUUy#@#)`Lxfy?-2>+RA+l}h#jn9p& zE&nHj-DQI(>6potLX`4Pv1Hs)&mg}Z=@4~bLoj;Z@TiK-RX}Nz5RG5JX;;BQu0h!k zMS2Km)h3Ohyb5tVv-s88`|oaGL;xqLX{-DyA)VvEyd+T+WJ<&ZX$pF$cdGS_bKSQ7wnFz`LQ7_4!eJ4i-DEW)h6 zUj0Z3@8#0~TG$iGNymfs51mVF;>>t}rF*LzW?lf#88?GhI{X$Lu048d<( zHO=rkXL7q5Qpy3)9&tlj#tMk#4F6!x`0qUXKezy|C@v{-l4H5__na{|2!h0&j*xZj z{bVZ7RWfd?U?`NLHcOkaNFy7+)7&oMrrYQA(dC28IHSINsDz0V`mVxGJAbt~h-sxc z_#Chuoh1+f!kiH)tI;84Pa6jmy?@T^w{Bmo6!Lr%=3~cK3_h!N37cK&hJQOB_YZFR|I1rI1;QE` zyOx!?P(Nq~Cp*o-OTy$@ZG4L&2Y7luvx;(3iTb0+tal9*|zHL86#sA^Y!-M3l-;;5bwocJfA1ZRJb3!OEO7I491^M z{^YmVllmY;7J$}&Y- zSA!zsPg#fHHD5+{W=Y*xJ622w`3DSj)HIB4;)>zEkk<`K0wUG>;V(TCp$_J%khS!? z?P1whywE?{u}~KCw?wOA4q&?U-6bbnUcpF5EXqoR)@ns|_=kgrv=!57oD^NStmH$P zm^1U5hgN=CF{tn-P$m+Vo)Ro|3trwTa-b);ou%DKs)+2BbGF0t7Q_FbYzNCqzOqBY z*1>~N>&FS93uhBw6m9#-#O{gQ)Vb5lDaHV^L5`dI*_!@g2zLCAGOM|$m~Kr&7B1{S zlzmK4rATt#iRj~-ehxnjuoHdlpLr=@jP~!}+MTl>(a{zekxdh?;5_<=e2_=ZGhf_V zq`#1UgS_lyP>(^2(O_>*yXn`t9Z8cWYOKd-rF14r9+y8WZjZOy1MsB}J|8k+hO3pi zG<*pN_daF*IaP$3#6{ms8sJlU0$VTlv_l`2OKLRvNWde*m7guz*MF2_UWBr;w*q(iQSXINiy{trhygRsl1%1Kk|1m-0RIEx1 z?j(%yOhB5}a8QZfB39q@(;4bK!ch)~VM*aiE+^1V^}S=%#!LOPrT4`3wu~uN{zzB~ z)9z;9;QnAGY*kAcW#a=}ebK_NH$EpqLG;`PpGZVp4vMily3X&`>RoF#T&t88vYh^{ z=JDU@=fAqd;G7&AqqRUwFmV}Rw!&2+YpAqtC{<^s(y=!&vsDw6C7ERrWUjcQ z=)d}%dLY5HTyNO&IO$#iTfrb(9pCy(Ki{f3FQ8s>KoxuP(M3(0Jw5XfmiX$+v*b#U zj6Y0q10u$)OhUdntZ-eFgY=TGIhG4Tin5P`%M64?A$5C$KaCDt2{KQysgfRy3ML|1 z0?zjf@3K9uS9=bt%*DK*k#sS5CGyG2_ErmZ>PX$}mPQgaPr_AD$3k4g$@z!st1otM ze1^G;`1uXIbbQttx2WVAnd%$8uwn~?+F}8peFy)ce*QTeWF5Ozz2@YW$858!HFtyh zQQe>od!ZdH*~VxWP?nzk7w0H(T`KXUFn!o~<(`=lC5#h`S=u#{83G%&?J@x~3#sPG z$3bu8cr57WL%$V$hwpU5D-J##IT+=_W5f7t+EsIuU-Sk|X1>$Mt=`*k{yxEE6VOyO z(<0g=Xdc%bNrluUwF3?Mzxez&jWLRz+ZU@E$I|}kxC~-w_`y)Ja9RQ!5L96ur82CPSfjsX z5C@^Ss&Ux;1B6I+Iu9e<;X5W81$aF0U9@edR)i25v5rAdPt@|Y@di%3P>>0mdXTbz zJZVSWp%ll@tZXL=WI(c3haoG2mo;X%Ma1M>E1rCl69Z-0Xq9RsbtUz??n%v>kh@@_ zPjcxbL|hoN`(IysSE`3OP^4DBXmFO^OMDiyh?#78C|a&0qMr>RY*OlG0ll6vDQZ%c z<;Ap)+uw_|?t5zKtu$KNA-wUK;!Wb`Hk3C4J7qXf@my?v8MSVSw9y1ao32M%V}t=i zrJ*4Fi@-kP5A+6(2FzD!eHsmmrRNTF5={2u8aLGt{*vbcxDS((axc!orsI!DT zDEsZlq5NUIsWbTC%sJshVLg9odznt4LdjJb=dpzb!4RQl5@vj)2akyNIGk|K%kR(9 z5318JQWjo;o#l>=azJG>ChXrarN}*7h*FxL>@gBm9LN3{@A^5T-RWaJT_M5{fB<(+ z*LWMEb^N&0Dca25D~B+(#QXAl$8Az-ACkEu2{^2X$`Kr)xLnAh$2W^+*JOa*zM&v% zC5!pxUf1Sa^SHZspgAD|8Z;~fMbCW~D7jx=jYov=4)pWsWk2=MUFRg@jnAv$8NW<+ z<`$R^ZJeIxc39D1hL4Q|c|02$xOk5k8oJ;h_%6JE6elS;60RSTk)x%<1Stp#4$ZFz z?8>P1H0$;I>-V3plb>Ec3%wiCk}~+Eo?2dI7K3f%jhRs#nI?=yjsOm}BjV0QGF{he zM3%Qj3quHv7!W0opty&v7FWhOK#Cov@7IR&l0-ok0A-nAo(-RNCT&GwoJU(qrGuZ9 z1g`P>@DT!B8W0zFRqh8S{7qTi!6fe~Eae$jf(=b$T=NDpKy|-}Mi)b8ln-`$!7aBk zq%4$njcLTn_ga)kLmo~pUepyl%n|ovLuhHiL)D}$Xq*v#ZezI`zFIJ!eSD{SP%?+b zcBW2)F7?}a=$BaVW_f#dB8jIrJ_(X@{4tAb9$=7=2`B_mG}M;d0~RqX=2|q#^`u`# zNUCeMbvf-HcqXr6f3-$^&e)J{Uue3=0-i*#QepvlZL4gVZDXMP%Y%B&%;mT`%|JBK z>5)1natbHVg&!UB+D+9DxYS;u!mj&4RrO~@DvP7bH{9XYqSW2(XDOQ9%7@My+DzmnO z5c9g4s(u_!CCtf31?7m2w~E$EraS*g%51T13}4efHPu7EU0tan$o*Y0ZTyW-IEN2= z%ZFKX5|BavOR$l)9}Z044qG3Zj*M|hOuV|WWqqmkIOU3FTY;BJMsbs)X4Opkql!us zL-E2uaXvrS`AWZza#hcAi$Nzq79>F2pznTd7Yy8lu&ZXT;F21_l3c=7 zro;G3bExkzH~YNXZ0Wh+ZbT6_YAtQ^QAg{X%cm|Z?CT85MT*k{I=;TD> zxz8<9f9fX$QSDBS8T5(&@{*qzzdNrqOgTzK2+2)D4_ac6_`i3%{~LrKPO{x<^{5`H zLD`<^nO<8(;d-^)_#;hA^{JM#91aVvE#2+Ja=%#+9};UQ{*WDNDZu&!Uos^j+Y2Lo zi|7MA5ec(3Cn$`Hi6rT(kB)SddJRrQcxq0|+rD#PKXHT5p02;4i=ZwPpMXmjol zd=go6)t#-y%-j!(tAE0GLF3z5zAN5UChG; zG9XcQO7gayh~X1jnRHk%#N*4uL9a|0JXk|$>rmJTUWg>z7uvr|=8U1I@aGr~2~DKMgLX|oIzhc%$kh(E}rBoPq@kC5uH&7D6D~q#ljT#pmFO!Y{vw~nG7_F4ch!!F+JPUcKR{0-kCx11A z{Kr{McO|CZ`OJ6dx16>-O_-|?lgxfQh~6EXA$+{Z8JKBxDE>5z@|0tF`HODX z`_yaW%GPq{^3DnOdo4-g$5q@xF_M~JXrVMDXcJ%fzxN3xaR^!3+3UZ?K8hglsLNvx zZA(1pI)tCotXbXa-rnW7n!NDq}s4(!bTu-$H=+Ufi}T4yy6rfXrx-I(eok&Myn@cW@4=R2me*hJM-j z)>_K9Ftk==t!eD(FT4x`vspiZ-0yEY0HuJTsFEJwO{${G%TBVfFtW#&J-?H5uVkuZ?qw=#&Wbr+=>2*yc78(|H1mBu3{MlzDkKWp{DhxB+*rx zxI1$}WA>8KD>`Nf+YmUF81*E7MmVcJ!ajRuKX@_HG=|vgCm1kXand*a{Eol)<8!aa}+yQYCWB^#6np?YX)N?_N~kr==d1aeMr{Hay%JX5JVWs0@E< z;^kFFr+657m;m+QcJw6arWs8zw0=&wGDbd5xLBrWQwHz0Z2=X^A*+j@qoT|3!x|Ce zP!#!aXM;UyN1oJWlD*@YMmAUy#Rj*M^xJf#>#Q%~;kDi^WSFf?s^~VWY|_BdNSFokf*|9s^z@5DUZ^xuDMW9)Ni7usrl3x{l@3$ z!yJEv!A6=O9y8!}smhlLvsSFOKcDt#ejzIPKjHJYQu=@Jx`;DD_0)b*mytt}#RI{6 z5hH%Ti-L458A-qIritL2984{iiTxS-8m4CFF*EN&HxyZBEWk1(IH(BC`txY<0c!M|cF>s9}o{V%XGTy$`MHouXpzEW*b zUvu6A{Td#tZXJ~sE1cYVDeJFax(FU?Ij;&w#<_A?O_2obz0rR!4LKEO#B&gH6)4~x zU%coLk}D=$hAdxy=k-_fygSuw%Aq3^z_`!XLpV}iPs2$Unpx-mu$(mxdi|ty&Js5r zoS)Z8B#YEi?=p)hiKx%}#eJXKrxxn4vDw`G`n;uEPstwCi@h3|c{)*f-S4<+r`xZI z!|LY##^+8HiCD1I#>D@*e!wPnGv8C5l)+6Zp)P0V z32rnhL!W#t!$09mD#^0kVjloX4WGR zEWewt(>=yJi=b=7Ilo0iYa9c1(+8~5Uw?> zER+PSMj9|K$5!b#NAn#Kr>Dqwx-gU-em}jJ+$ebrBDNP8FUH)-HkQ+9=`m^ZyDkSvO9cQU3ihuU%5EQ)k8IHFM;`9 zW@eMcTlVyq{rOi1%>Uu{d&#R;^*UFcb=aW$sYjHjZRq$*i(AyboHd6|njj0C31Wpp z8x0}poy5B^j^R5zWfX;{;^pm1WWvc|wyTA=RoEyHNK>3Qki|3hdJ$u$svFLv-(2oP zL)NUx6mNL#gSawn-TD=L<0Fn`+dalVKe??-`@vcI3;(X8hGuzX?6CD9(w!!JuVf~> z++!4ujTPdqBX`IsUMR4%n4+z#{Ll89ErgO{%-i@#KkbYy z=6KO4eC(xl@ZD6uh0Jj*tZ`^PmH5hWbP;!t$!5KcuUCn${0^UXX90eGyJKVCaD}SN z6ok;Snbhw)*2X~5NLl}yhJu0mE$z-JyPVS6Xybxp*q&!_S66cQH&>O{vr1LQc{@FOWPkiXLz9f6r;#k63kMz`-~~WJ;nHH5yr>hX zhI|afb0zr`QV3N%&?ia2r~x zlv;1Ayc5inCmdR_e&aL2EB+@xL6IXXs{#g7bQ`LFtf@04T-DpQF!8^^rn)XO(Z>G4 zj`M3zEFqwIn34AA(j|;kg3z=NUa6TI->?7%osbG?uLb4{bZ6_sS1}rQd3W7RwdxJqSm}-FVD?<)EH#4!uk$#0 zVPNSSpEZF!{vm_$S%ZUwKAGk)FG0a8F{wRYUtlhIu-AWs&)-`bf6mMV>HP*h`Q<1M zshHdmc*tmgiPRGm85C;-zGNa(M0K;6kO_40!+}IlMhVA&8@}GMH`b-~o|SpKgGcm>Q+2-Kq66hggChaH8TuP*zVeLh*LTvf)q zhgU?SAAq3Zn>Y+tcGOBa=Em2T&u^5n4+Anp$SLxs;W&}~C+|Z?BhA z9x|B_N{lOj%MJEqXpeiWlPl)o#9O&)g>)c0)cyo~c{wibK1cJAoE$OyNS_&nacAnzNWM=?Tr2gTi`yCtc9-gJ+7&-Fz!Krlk2+@wdEwMU4Ek=Rvz=>ZB1^dPlK zbvh+RwP{6wvW&k-2^k(0D0KG0pbwVn3I#e3#eoA}kk?wZD(y|GtdVKI+kh{y;dG>K@c4*S- zrTN#@FW0EgBpXVeD>rOD%mp9FC&6=!=u+mJKMLvCI#DE-py$av7?r1_nqlK^h>A(Cc3FHTY?atO^uv?vk&FF=J zilUDa2@PKE;?etPk2&0h6f6FAm>GfdZy{g+u2XQ++Aot4q4R{th+$$fmN?r+1_29B zCUgB5d3l1z-DL@TpO;yf?|IUY`g%A@G<8SK6&*_{)gE~fU_ z{5tE&lTM5A!{hn_EamgT<59AnvE;8-O*kgI%emT68VS7oD|;gDsI`{?$a9V_WoL8NulEbyIDfW`0al(N^Vxklh z?QM&(W7b+txX{hBQ9dD7(NrpJ{unHZ7Kg{7pd0+yy@pm z7>fK8_v-BXpj8!gn5l&LnVYgn3svD|_@v|IzXkL6hUUMz9{l`EFPwI#fdY&bFTq0C z0+^>CMhr6sZ(l5?8yRctHsqFSzdMZFo}4Ff_vsl=PF2M)@kYHvW)Mi>Nf_TPzLy^m zGJsF-H6vb7H92oo4%x$YA7QXCqysdhyS}Q)Ol|Xolb=wY>Q_@!5ka?(u*m5Au8Yjz z+A28K{ksVMm&>T`WLXSjh{8Tmt7N6|I3Nu)U&LWu+s~Ex#!8O$%!TUoDp0-7#`juP z!SzD<_hG&kW~G-2I9TBW9Q}JZtAN$eH$MGbS-hdoZUg?z_e(ZeB_ifq9hbe<>UznC7aWd1Y}ht zvtt$OM_Mrf;T&*dsA&(coU}M}ZVs0xnZop147z*Ye+PkXE8jpa>C0I1bUd@7y|eBo?)=9@lPt2@mjOY&h#Z) zt~!3|+}fCTdwM;fHhZ-BJaL>qEg-IZ(BiPs+#Fw5kv$RAR;ZXqXnC5WdE@gSTEq{~ z((?dY2-L1MVQ9!U8_X54*OIEjwr(+lDzR&k-*Bc2XwYFyU{`TGy2WEIWTj?Ahp4`- z$Dn0J`&M=w4py3;oSFoWZ!ukw*d`C3g$M(V<}ii4)imqZt}uP>Q>v#Ayc`72`2fub zj-gAv0a8q#CD# z9oGhEVrpvcbsWh~RgQUl=Qiq%&#ML@e~Dq{G{k(L?&MD>^J+!W8Lin<$QE;t3bdD1 zu4a=LJ*^r^rq%M;kK-(--Ch$vaaiU;>BqMpB_iZ}8d=V|5(fOM+EmizetbF3(zfP; zVDYeLE$15+niiX5Nk7}BeP@%7tnHmb}B7TBxqE6xUPlR z?3Q6E6Oi?e)s)}Z!KXk)2?lvGjvjW>pE7t!_gVck6OETK_ z)X@(cV}_Kjx;bW| zO1Y$(6mvQyRBueXglm{2kayHBdY!3T5p_=s$nt z9cGolASA}(lyecEU!I44UvGWwYN@DbuSgr5R#a4BaFu6ra*J+5 zh21OcI?!!VA9(*E=jma^v&O1K$LyH@%NJH}8YO1tv^Ks!=L^;a1=-E)y_boSG2e^j z7PgpKi#2JvxSAd2M2~a+mvRB8vpTkG=kDl{P?@<5fN)qsri0`DzDvF- z$DCZWUL`D%W0Y`o(j6_7Zttlt;Ht);j!#F2PhW7Tqmp(is92GmkVg^KW<r!!Yf0lsLjy z`}!ha1`&iAjJFaF8x(Gs5*oCd*34Kb* zNd7#uQGcJ4=$qRbp=N(>lWy^M{ow?&Qzv-i@a9~h&r`;mV%dJ3FEqZHwhhJPuzA%F zwArTq5-b`C)x<>SykWVPJ^NlO$5n{mStYOc&&eCmn2QiwR z6WO9Eb2-QoD89{Sfo(x_lP|hI?jRBsO(}f73X{{ooa%#II&jhpV9L~`@S%xzI!NER z!zYVWHsx0pgq}pk;;tXuR}!X!EO`SQlpyx19s+6usxa&)FNxWR+0g^96>z47y~i1QFucm}CZ}@_?1rp4-Zt@)Kc(w?Zat63XKu~G^@0*-<S_Lmv!QxOZ zTDikHzLU!QypuO%Tm*rODXq9Mc#D{qi~DgOOThZJe7rNO?2-dxD<9k-@3T44O^Auo#1{zJK#(92?YrB7u&;NoCdCj6@ z;zu(d)}3GK;QKS``c+LJ(J>=TS|e-MlRGZfl`}iR4#?KzoGRVj;+JeAnZECKL^DNuEdn4K{~YQX}eeD-qp zU>%qM98@Oa)P~6z6YrjEp5atF$<|sIC}7v@DMAm`aAqL?z~Xq?Enl}B$Oq2e`uSXf zWhZ6xb)5IBg>NZq>ht6s+RXy1Cdc3TL@n%5FZqXF@`4%`{BL@L5OEN3K8F;4de53D zZ}6Y+@Bfp1A+=C@opU)BFDoL?+43i16YV5=#D3us1Vv*1NmS1qmy!}q`Yg_hO*lZ& z6;{`rZdusYzflL#46n7fnCrBh!#D?WANC8T^aDeH)L z=4i5Lbs;?L8KFu@&m&_B&$voiC8Cqt`^UC*E(UVu`OM7q?ze_Xqy%fDN3Bj1!NA~8 zn=Lm})#j|#g|)D?=#~^tz48fCwSs2yCsK57Q^f4CilZai?}K79`q z!#+{oD~ap%vA%R{+`oP@4BX_xkzs`MV2s~~IKf3h@DGQwu5>`0@5RJ2BZ>B-9Xe!q zlFe4X3C)1Z&N6Y42B`xm#bozc1^r9}AhA{Bbs0O$X}T%_&UCx3ln+BZh7Xp5e9)Z^_bZozuA1tAA#Ql?8CJp*nMijwlHlwPJ=(&5v$u;6SMw;(ZHFl`e{g(n?rqw_4_a|xr(_Gb$ zA2WQqbh%#nywop)2s*tZFIl~1H%1-P zMLtIC4*xEhcI5ei!sB!2gQ=4bA*j-noq_s(d;%Q|w7B+7B#;K@PXpk}bB%scjokeC6{j5ybZ-J^c;}ChUo|W}1G5 z$G;iEsBGrYKCGy)EpTTF(?Kvsa9VG6a65puKU&wGt3gG zIyr1)p4=$cxkBBCvnhc&x%H7?)i2&eL?8t^H7A^qHd;HIlwniAh~xem$zLBeBpAZV z3SYpN-j5u9i*;AUpBlBK52GcU?5XhwAwh|NN&zgCRF{*EnM)8H$P|NW0XwWM@dze) zN+G66Y}_amcY&Vm!rvCd48tzJ7GE#_rCZR7;gC>K->qS#i1P_5iF{lNrV0e&z7F%& zb*d}q%BQ=v@S42a-3Kv9pWTeLYn7RAn)*&*db_FJaOeq$(59Q4cPkBaUK^9Df~D7{sf-ndxDxE1wsXvB?`MU9x6S#afd3)WeM))IJBJ**{$JUP|u zkuZ|rDqse`67}Fqm#Bb85}YGl?a7vFX{jc@L3INgUivfJUwM0*;)U&fHoWci`r*9x)J+kv>vZ1B zlWN}JRPJXV2PMTA1y-I2r5WYeA`F_k?zc<^A0pV*%JKjLP0Fp4_IDz+IxIiYkOpax z-Lkq#;imwy>qodTZCbdYCSPlf1>lF2eha8YkD7+Rth7>e5zegw1anw}9y%JQh>F4d z`3KGksJe+NMOp95K9fv{h84h%uQwx8euN)GT?`FWc9bT|r0pS=- z+{{{v&x)dIz_O`%mw}nJQq9nZ`XXMs+5@Pjp@_Cn*|F>?`Xnby5-_CB!zM9aOTT`7O={|2Jl=&t{p_}M_?=3 zu-Msov;h;o9>2!gTj(yO308PsKVtzar^0OoI9i_aEwkE`?@4PI@oQKyEY>`!*_FBe zlBrBC;gi+`#tcsV`9&dWrj8OSjUzjIn_`LG@wi5CmdQ!%Y_%mO)MAy=F$G(g)HHnT z?66g766E-f1LfM>0$L1-cyWpaO&YYy2-qHK3Un!G7SQbp?--ouE0y&-t)vWl=Pg;v z8uhUD9W}&bzQ>J_$A@>`=R5gUqApjVGPY2BbqU zxpV>$&i->KPc$8zKVBsLRq&f6S^=lxFue@+*?#rX5mS?lOIz;vVL89~VLbc8b!6o} zGBsR^bt)bI+i}^5d!H}7AZmR1Qx|v{(aeaMUKLxLFYL3_->*v{1_XE>;(4|c>J&LD zc-&!PY?nA&QB7~KW)tGl>0FwiRJ#Gm7#!x!Teb;&^JP0~w0P-HK7CN}@O>lB2~&Au zZ~(3=i@0$)3>Z)0s>WpGPfKSLg^&s9XLBbt{pN(R@;b!68D*aII)ylY10F*6nECR# zC{IXqlsTWfChi>tS{YT8xNSRS-Y|1SlYpqcQe10LK3QHcp4+zNWkB9v|Ly|;g9r@< zu6!Os4ndaw3bSi*WwWkgfQs4UcN4ZACL)ZuHYrZY8}BSy|Jdp^S7gr3g*krb z&ZEXS5`%y9%t?y92&(+J>OXH=AWB6Oa8v<7af^KB-3zC3CFZ18$dT!=jZm}PR;zZ| zIr-ABS=X;}Xu;M(FjdC6Jjd!$A!yoi;Jem?b#Vyi6}R8D%J05T(?Xk9yH%O8)bpN4 zFI)J2Jz0L9w+3!+)uNJ;VZAt?Si9Lm>SGhULW63?UWG^i<;13kcz{^cG-4+C0#r!& zLPi->1Y!PXK%Xp5A+%1j?ErhZnWe$FK|GxpWS>l+CCijG73{Gkn!vg9`=c_;u=Aa2 zxXzWDyFj6HJ7tV)6XF3?>{0EUR{Hxy2k@+dhQupdD_*{sq>PoHW!t{6fZi_WLWN8a*h)F z4hb0ri`glgBdQ9C;~?GkbCIQj)q2fkI#l$w)#6I&k&pmlO)jyfOY>FA==*(M>?P7} zVe%Ow2&u7UQji>SGR_z{dHcboiCd0?C3=phOm!-eh2`3kgGh-YZw=+OSNpPii4T&z z?td~F1DJkMu8D8Do>D(NtT|{Kk~q~p z{PHB<)-Rxmk}^UfkLdcws!ejS06^CVAZEzhKuTd4P(Y4-S5H8H)kFg4MY$r+&P!3k zLs?KPOwDNBX8*BW_D0`57^FThy9 z%(#;SZ~1wjf{g8rXhCUbc%_3^KDm5@3Q-jj03m&nEw1g0$rSzmP zgA2-E=vWN`_;1H8tCr_`T&6{lIa7Y+{O(}?@WyDgPriiz&5rdi#}p3l!k3Xk%daV& z@K!0Lfk32PCb!uN5*IG=de#OJ5eob>)%2(limG?xk$y!sK|!pe+t?(~nP^H{3A`!= zKEZxw7bTUHMyQ3=VpuJlH;Mg2{?X|jx%A99r-MSl zo8-pmi0||7k>XG6S#sIeQpRX@88?|l$SFcQ^YEp1#Os*LrE}C zs-!I3tN~xvIpcM6O|R+tWpHq9?`Y~i@mg@e|DzEHFWC8IH@Z;Qt!f|EZqf>&U zwg(7m%MH4>+_CqT&ZK1;`)uro#NWJzj;WH=Rn@OdNiW{U&BBfQZ#AYj>$JWs z3XlxTu7hYLn#e0~Iv;0+A|UgW1)@!{i;R$oU41e#=~+)qtE&gTz<)e>myizR8IBzL1^0Z88 zvM000>0r>ZlZMj;fn;g>4HdQ)+*r1 z3Dk-NpxlMuHQQo18MtYMM>M+lw~DSdbm7=rsQ=?!$9#rs|H|h?=z^WR(|h&zwR;xsQ`}PX8iAaRI7HpC z@M_b^Y!QfjMkZ6V4jl1TzVxqE!!(!U8aKBgu?>f7-yvRnq>rHGSJI#dOT?9x@0wZe zR022I6#hUq+85R0%V`PDELg+S%)Ryg?KbGzo>0x5KCm5G!Gd#XEz z$7ICG2+TVwD<8wGK1=K5>7}bv7-Kl;ST-{it6vsI&1=hmtdqlnu*cOK8Yzz%b1vap z%Bep@Z7NPU(&;Bd;5STy8B4LzVS@A{aPy?wsK?a2i8zMjuVApL@QeA#c(a_2{-6Ax zXO&I9C*Z`@g%aT;Qn}gh9aPIjt{A^3%|?Bl(7e$U_5Eyt1rn!U2SG!hHO5!7c@)Si zR=0|agKGCxQ{{3}?B(4;)LFuLG)Z(1feROd+tSM~rAGf7;r)|kvS?GaNFO@Ft@`QH z)SBVo5xqkv(Fv|y{C=_Ks}O5enOhqW{zHq3S=j%UC$yk+vG)vDg1XY0*1(4Dt!-WBUoVRRC#de>K5<}?$9>k@hH4=sn(!`E2C55tetz!wXo7I1!VB)Aq4~v>aBw!D^O9MbT6GeGv)p`WJDMNTNpY zXrj}cU>Tw?oCp|4j8lua7*kz+2l239VkAwmaDt^4MiB{;6%?YBdl4ZB!&vy})G+2H z`a?SsNR{^L@YQ#mpR_lz%1GWQAmK|(*49t3gnZRa$+fS)Eli#j#~9FxI#Po%k|V0f z#|Bctz}CWG248JseqHr@r}4dcNQh?Jh7qDkbBc*EJ+`L}6u|=E_;WHLJ~}RYAsIDe z1#!v`pyfjg=*%R%Q4HQOOf~-X%I8@v3S?n0L3)r+=I=os3WF~_C~z)MV#k2^)9;!n z_@>E}f?2IZ9G~K{u1TX)kNA4}BNO8Sg8yuR=GVw3VxGxV&AemX1Ge}h13LEA+yz+w zKfDzAL!A@vyWTP2+BHsFF|Fe6nxVsmlq??z4+*OT4RfmnX2!OMw=cuE4I^ z>z@Ut8S(0f^U>((v;z>72z~&K7O%U)KH^+MrAuQwHJ9;)gX>9OnmuV2MnsR=#KOZ1+zO)k(U zY=AKiyQ1`cBDPLN1hQ|ql+p#bo;X2I)4b{NsK_48qI;hBStKJ}WZ>|l#S1y+3nx~q zat{=w*i2m_U6%E`b?+|w41Qa$8pf@5yAL`NS=YP`-NsJB2g%nHo5W{LhKaT6;;EjK zV6jmIOfo|jAQ>Vq^85-L9^wED6dRin87yni9=k3MEL5);&>86l=PHxU3)UH4Bpql0 z&w-ez&*p~!i)^e2tUz3V2VTJB z-^PW`@D}dJ6@n0Z)y$=bnzGh)2@zwE|1SCCl)(yF!gNs5@dLO13GRknM_@fwm&6HxSFI-Ds5)tWwPqiLQ8E#Q^Loju&lRCB0WpPD(&B* zilK-gf&0NS0@R`iYXWA9sPuJVMJ57GGU%M>n#Y#{5ed^mY8 z7|K#6aBU|2f9K|GWiO>n%L&hNJj|!zrtA&dX%y>Eeb7wFpq)qx`g_6nH65^L9Mvm-IiUDpW?p&ZJJIk!Q!B_#lST z?3?<;H$CO`H(~a<=W=CtAbzFX;qY@jd)Jj5p8E=tCS|p1yAz9{;GKx}PHY z+EYaEGuogE24vt3eTUqbibh+2$X1%*75W5f~?7 zy+_lokga940I9d`I$M>Nde*v$&T6ytrCskdaF?5Ep69q$B(ht+0=(#084ayTkM^CW z8;w0uxb-=(w-st)A|~`io|dmPIxiiAHhRWU#i#fnWe-{%QjTw zU4~=dK{I&vs;IY|f{Jx*1=6GyDoCcC@gF-GaqibSvdi8c>_itgL1ibM;8?evwefoDtf*Y-fX zTRn!);GFj88ZG&0C6mATy_X_XAiYoe9#HH*HHPRjAZNIe+uHh{wS<*yEDoVi$*_>% zCHSN{;hZ`mNVXOpogkTKC^+s*3 zJ%v^4o|;+FJ}TZo_#wX~@SZ+$)K3weVS)HI65j~A^vJIkKp#Y92LGy`XM;{|*PhH- zn842k*|ztFnl-CMM;^QGhM?c|-Z=M<_4g#Sd^vc$ro-u`!KQK^iAZE{t&>R1xuOMV z(9(iC&?pYcD5wwLZaSBH?k9Wx)ChkTW_@(%Sl)NR97I<9nD{w_=RjquXgwmWmK7FB z{Q7qutfJdU0H334obI?5j&U^;Y+4g7bbM<uhCan}_5dUj|!KHp%r z(f!2yV|h6vTh}>L{r4bO)hnM=*2Q=IhHF|-cJ_`9*5uPmY0~Rj_h-A)`kp~;`&*6! zS)MCAJia+D;D)fE=u}Wd`9F;Ae+eW1w_f;*RU93(kCB47cRFgX5<)>z=!nW>ZNTyh zx1BJ#vx?zha|6VYU*rBKNoUSa0py%1e25t%xikT*`LX;qkFtz5TNT`;Kdrqww7=A( zedS20-}}+&SHf;*eJAHIf*pRx7B-89MCM3|fsSnr?@`jWhmY@h7h+CiBe#_R1DCD}U=RV|D8! zE;i|Ry69=qaBi=CY>YR@_g?y#3rj)%GuevH%)LlkWqq=%vxR%AKGbI7&%Miy&3Hnz zn(V>J%Q(Yurz>Y!;Umvan$OQQH`>D?D+L-S;QBndVHbBLxqyD0X-$Ow2z#|x{lwFw z#;hCkOK7~*$i|$hB13S_olW{<&6*Gh3;z#GB>45DSjeYwR`dtc^6R?AITs<0kM6QkI@gKz$1zi{b%|C&4ZzIqfNh zH|=)y*wm8EulCDVjExAT&aH#lOU7#=XNAGbri6e&|2QTpUkL%7HeKKY&qGJe=bs;* zpa0yfmD!reIOjO-d6pE$vZG^2lVz3_ZO_RRz==R%iKgSo^O1!Flg5I3d<1p4A1L4Gdye%z`FR16#wc$G(jC~U>(#(cjyLB@Q z`h}+%7m^QV8k)E)cvc$k8~REwhFpaDb`x4H0K^!61sVPq126Vv_f9L$Bg}Q91IjFgcuX}sr!`>A-bWdqagkkdhH6?B$H zQ1!kAP_p)6Hq+9{QuLKi5eqTlxX=LBbE#&GO}$C3Z`Iw1FF%O@`q+J*>p%GX+gJNf zpWs8lg;w7A>JC0qhk_WT0Yh_tk~>zo-_c(n?_De1YasyY{xdeu@t~N&w`{4 zJzh+he-~;r*eQsNR^hCGwvy^Hu~D|Bv*w(rgKi_?C$i`7LCY$|NEu&m zxaisqDRfPxuzuN#?dfwLT7|VOUZ+ezsX+7~@kHU%dQD%0-AEfB?I#7D4YV|^6pB4g zzH*@tKk|u7mJv%ha!4VH|JZJaXgRswM?vUIcxaQ=3&W=Lx~eo9oE2`7O;WsM(8RGv zu4(1H5`8B;RGrgok_)dHP~FdepX(j65PaR@=G84sPyDLM=z4DO%I8_Z45VV1F$>i| zSLl^aZNHXVl&m}b^Aq7#Teq}ph3*Q^(>E^Fs~L^9Y5o49h)kaXpI`;eUtK4iiS32M zq!arwhf98Fkz9;Y=z-B`CX#jcZG?^p2u@fzPzcQ7Jr=}1aH~jfWn9AeYEf* zatUz-(<2$eK?t%0qt=1U@mNT`S+HXB1{|bx&?1C!C$O#O$fA9DN;^pGYg`1>Y|6z^ z`EqFy2Qz4BVMz1n@ED^nQ|O3*bK-~yK%g9V?Hq zSwYIr0}F+^W<#wPqAG0yTTF?AICgmxLc;op9Ois+@$znVDE zV(NwsC4ciLYl{y^A^x3@wyJx9^Eo&9E4F;=(B&|rHQWp> zh4d4I3`N`9!FI~Gm_F;0%6@9qq+`gnIawUXvrKcG(iu?uM1r{-JJ>>ZuUA4~qFxDC z=Lg@bw|5Jo(`dlO6!C-kC07!V&InV%fby|EMU_t!mXQ--B`@V7S2@g4_a!I=|Dxx+ zGRi4gMW+Z8eU|7^1IAyHRr98D>-qt=_1c`7J1C?QlmpaK$VXr6sc{{TC&d%?50vRH zjv`AHNTS{_E!LiRn8p1PK@TW-iy;xX4=W^p@3Ip7PxQ4}9W!1}(YPxtYZxggwRRzUs%DJ_#YcXHo>( zF=sH;B7o^?I5ulAsx%vKh~vxZ|VIn zzEj{7iyotz+Q<%gOz&#@-I{T|>))Q~bs8Cs5=4C(fJ(+rlG!4|r>Mgwy~3)fat~DU zN1gq&T43LdtbCJb<-|AEybwqPA2bHmWctv+l`hi08l!op-Pk=q4H`eWJ;F_;CX;Mv zPuG6F=3v&V4wki#6dix@_N(zm^>vGK!K&zNJB*Prn3IR#HGZ}=%aKo>b4W+ZJQU%7 z`-f*THlkD;tV5n>gTzpj6&Tb&*e&8&p*Xf&lj}KICI=}t{JPqC>aaN6?+}cNK|)?( zvJa@CUo`6VTD*9-;>AdkHa!czj{p29XUPLlQ}-AAFF3du7D^~f=+FcnB2a!i zgO*HTj!4MxG&{Fyg`>AHWgSF7v`jgkM^3Frha~M|MNMsL7u3{PIXT#04cD) z$ezf;EG|@|h{;LQYwBMAg4r-?euei?S$RK;*HIi0@>U=ac9)z?!W@@;G2`<2d43Ip zhBu<_tX?NL6Llh~D*1}RJ>?KzEJSeJ^_zJugWnKL`R7heYuMmWlrVX+ehqL8fP(#G zZvgkMX7j0fx6d{wSxlv3{?)!_cnd-E27TJ&{BIV;#iCcZv#L2LEPYcuoHQB71ved~y!es4D8L2?H(BmQ z++-0D^TC(xZm_>jz>5&APXjL&QL4mF$fR6P;XskbgfnP;P#8vv1}ZHsI^Hfhp1~>H zY|t<*T?mwab2rHlRoFLvVIaiBVZE(B#*$5uxn8AOwgESNWbk*q!~0@8pe$p}gltiK z*qD*_Dnw2sV6Kr*L6~@XeaR7U_A&jrKe1#}!%a|nNMEue-HKTq*#vKbgCnwp-dJVe zZ~f^U9~yU6$^xzsCHPjx*)<}+%dOPaWWfn!>T2~L?4O}cDcPwWE&n9hM%Hon#w&5P zJT!W7vGi!FSIBmJDnN{nMCi|S$8O!6aJ8~^ByhfKdeUv2S|oUM!Zx=TzYu-=V~eZz zexkh$4M_aAU8mLph5+KSpAjMT{jQ<|4BfB>*lzU`JG$i(A z`Z<)Tnp+dOx$eTSuL+`j@M~jAMukqew5ME-lRo+qPDYpO#d7voJSN@Fz0TkN#!q2JsOrHYgG{T)oV1>0^k~J} zR*u)lDNT5Ukp6EL5Aj9Umz3pSU+yay7`0am8kGB*_3g4JTWpsb^jdrinocc`ADMo9 zSYd3`xm*^{YHB!~hykR0B!Fa8U4S%e~GuzTT1u;(B6s`lz3REMT8lutwBkP^1C^BTC)Zif+g=jcW zWX)7lC0E*gfK*&M&JQsyGu)H2-GC4I!6;=878U4s97O7R3lVIawV&uT46{znG}6=u zyWVAo6OW4HN$cTC-wVt*18#)V@sEU7{^qYfibsKp^(;ttG>n1y^2^c2R@M_(&6ORk zbyj=jaw|5!n;wu80&^#i#LQil08HTxqeF~u-CRcFYIi1OU@2Td>_3OKJw2B6&#f}p zJ1$APj@Za!xQXQ+fN zQ}86QbOE`I(0Kv>!)-q{$q)A2bQ>S>xS4IIg>MRX{vMZRcU)4HQE^(^4eDs-F-K!K zlGDV(m6xDCCrs4j@BXBN~@}&^!?=^slLK?jrjZpbQ{%@;MPROteN^MF$ZFZ zsw0YVHbhqbXrN4^#L&x$F|IhZd{Eg=jv*2SFl|!?sF7Q&n4ik}E;v1qYm~uIaC(dD zu%i8TL^QxGl1)E3mOy1s!H=oZ2%INVc9LCGiW%UvBBOwtL)CCCIZe44eUGJospZ z#86Uw`n-xsa+xQ`nHAk340$WxV-K?{%AE-zCuX-|Nj8)xspOEA(qdJYltFPBh{)N8 zY@I5Wp|B&q*yjD!4k)t{Bi7Mt6|+=h3}CM-1r!bJHPZ#8J7zEkl%x`yScWm~Vjmg) z%I6O_2owYKCLQfBRwpf%eJQza6PfORVBYk`$Z7wFTmPq1=|4ZN2idodr3~S=cINdD z*E#s)NX31JW8=hj28aN!RNta%j*<1QX8t7l?6T>mDKG)(%M!2dsQn{U!+{@Ha6p1^ zdFP}uR3i~P{>s`gaTEs5vB8HJV4vvBOB*3O?2Vhg=^kWZMR=1d)D2nr8f+%IIX z`N6I@&B(^%>Lf3Zb8)bSM{%DlT|E81Y?zN)T`S_+GQ7Iuh{feTC-XtHiv&B#pZr1;U&wp`G{BM6AU;JcW-MU$eL(TTEd37La zM<0_xqotKmX=1`5>MA86`IZ1bOw5Gsq*gF7z|Tk|NnI=o2*-k_WJG|gw!}L%ycEyP zNCJn<=YQ$JCXl~;KWQ(I>p4Q4zVFk~Q12GLZw=)%J@~?clIMEo2dGxek%L z0AYHSz==o}701#-M9!jUyr)0_U#WL*`!a5Er^!&yC_MDyCMQvoq^7q;dC1==WWT!(~jBS+Oj`IDsXTB zr5RB1Z|ArcOFhKimLIim6j`rCiZTrq^u!HVXwl?M(C%IFI$<+qmwxY?^I*3y*kCl- zvm>f!C|r1i9!#D9SlI*G_34#CR<Ev(&prz&Zv6R>xNr|mJA_GYMy;PmbI z!5XK8Sj&()z1G^A99Z^O38d0g*qr-~g4mfJhS3QEzVv`!YUt??XMf`FG_U$`5sTu^ zj-T;>nl@^6A}s_4MCN{R(V&9?sWp-yc{xsKZ);0nn z&mITQo#gPm#G^#39STiZ%)8RjV&cv1KIX8Fm^2QV3zIZReJu7et(2=8FPAB~(lRY~ znxLxIn!`9mwzt&Eh-vEc6aApw56!_ zo!U0$EgdA9RI1J0R+Evc@Ych=^6}vaJnPn3z{aU_&;bql8yzS~x;UvzG*hW9zYCZ` z7@>34XNp+f!1dAN&}OkNV_>jGiO7&HEo+n;o@6>Gqo}~C(Bt4Nzkn=oIIK|=z-Js4 zCi=>kdRRYL@4_=F=p@RI>J4hp*s_<10J%)DI0gK1$d!;(Y1F3CsU*!TvKBB2>(ff0 z`X<6_vazf(LUxA-A~yZEo6g~9I;)?2wTa<8)acC$zBS|-$TOv%Dm%!;I~1sLyTKbo zjgEmBarn!vV4(2k0NkN+QtSu-9@{F4u++TxWa+RGl$@kR^+_!gdVsdzGxYA84Bm63wxI=X7|3@!? z{yIC+{DhPi*A<@tKh?QXWna=tNnAKdXeyI<=|xyr49*C46g)GvKMCA1(9}93@M3B( z0x*&ao;MuiRH6x&YK|1zGMd)qkK@!eOjg9tH{}&`&PUee5!99Rq=|G#g|U~0^#;yO zpI%}-8_##@J#|?yvE@8;Yg7&LR9)Md0tvd0TrJQ1O~TJJNscXbOGoaL&yR9{^P^t! z?kL*2z2syYEv4yXI}c@wGmA1LiRv~RwNNhq;otvx!}BjZLlsdb$hs!X^n`F-^;t>? zG&4W$`tDht}}r% zH>Y`p? zEiix$^haLB-QEp6nkz#qCTwmN=FH3&p2bsk-a*`*EWd|2vZzy9$~;EQf4i1&8Aq}b z3~+OK5`X<$AJ@Q^#bDQ?BMrS^cc4~2Dug?}oFE0yuIqJs&}8ioMTXOhU8_emqC6gO z1d$vMGATY&u*4}2TBf99i|4%Iadr+x?Qj#Y1A-}a}&o9a!Bb||qEB&kD+B+IYB*$WHMKwlsVi`L#zxf z4=Yw|WXY$r#*(;W_wUI*9#Kbib9Tpf+bKf%ukpD>1_Vyz4TvXIQ5{WCGeknjPY{Bu zXXnqDb>79SqzuusOq?3G{rsxTr;>Pj`LywDU)i%0M&tB}ntvWIrU zM{>})_s6P&E4%$8qLEkrtuh4RlX+zNkN1iVLGAfIKP@s;|3CdLdS+!)xDQe`0>Sd6 zpgejo79$Q?|4$@3#+3vz#Df{noj3ZTFQbed3liVqzz?RC?NbiL`JHn4o{SqOF-Uuc zV_=}83VF9F$5%unRXm^F-Y|qnmu-IxD}?~USkD+QOpbBj57lGCxyv&}ae;{$Iv~Zd=D%)V>B{z;g--gt3i%uvl06#@ z5b01B!-jt}X3Xa;QrGyI5>j6GDt%zScUMA# z1Ep7$8|N@-6{Aa$LI#&kI}ZYgp_#IWve&_)=;Kn&(U;jM@w9-#`gxf*c3?U=29HrI zToqbET&O%OaFVL#zCh{A^oi%1ZzIpYS4w5nSj20o)!_Rt5#&tY6H^ihx>xqge<`o_ zy-sTJ>9*LU)~)v{?D?Smlk}-j6F)6foZ@wT9^&Q%RpkuKe}Qq)W{|0>s^p=xR0&71 zEtgG=l>gWH{JRU(*k~LJ|bOF~$QtGL+_G zEQA`YQ4{4c+qbaDQP>z$HS}pII|`@w42NDO@3nu_$j-%@U29^t&X0byMhT7|2WpAq z04$lY(<{t#Zo+wAE~>2u>Gx`s5hKn*=Su@jCG?I)#z$UM(o?eTz*$b`5S7o13r{vG z4JR7;t{EqEe|5qu!Y0Q=vZPYi@JZ*1l}hA+BjR}Xl}{~j6Q$o^0;^+3M=ClqCPa#h zEnF&XAUaSH_~HL>e!{<<%Kn{CL8G%Qmoz`V<$w$D-df0_JO8SK)(_RqOP7JCQW&f{ z+lFSq5>iyL?9!Ovr{Y(pL~5@ z&b0ex%{T`#{HF3A@0Cvy{UT`EU;v}tIff0x4qLAP>0mW%Z^nfST{ZOo7N217EW0kv zS3BP4uqc$MV^KLq{oO^fi2+vmOiU;}bg>He&=SYGPD>J<<)WwWR7cpzSwW#*)k}l| zamy`|^x1q%*%nLUkI#qt?OTdk@J4qbPV>?i#|2OjnbKgqWuG1buQ9114_|5)spz6I z^o+}C!x!;9|9tsrFbXf2r^ixPLN0N~=Q=&R%HH_&8;N#?oq@AVW^;VP-%24}Al&`! z!_8dB-}xY=EQ{p$dv%*QV;-xq(#%4&52rMyL&z?5OstoL*_ zIuHnFr);Xjl{yK6kpqTXKh$-xpMP}Ov|uw?m_Iq|$L9BSjcMjW3`-;>Z`M}YkjEp|HdNJ^FN4t%cwY@CEpi!cXy|8Z`|G8oj@bOg9mq~ad&r@ z;BLVkf(J_ongqQhv*x@r@1D6c@7;CR{Y10-6TekeyQtdruNTYHFABL4bOnf5l5;DN z)J%M&wW-STw25jeX+VV-$63$Rq2ey}+O@BS0uFcU3^|4El9OBamD@GiRf>8J3V-Zp zim!w!OJotB+<5de6R&sUIZv_8{qQ!|Ld)FTLsavqRY^06oy zd1sHHMA>X!$c{qWH7cn;6ns{GTF7ti50?6|zXN*?9DcrVwa;Zv?U^jn(@UKDrD#Nn zP5SA$Uboh5LOIE_M*lY=l|#kJTHzm4IqEgk+|EkH3N2{B9ginyB=8dVODg)mR>E5I#}*qil!ZzC@aM=A1olRt+p$7NcWoVG8Sishj9F6q zE7_m=k4Dfhi$~*-aE&ab?LgeRl_5jz%-S8Of@BD+fy3fnbCbAVMrwWhVJtbx+g-Ia{Pvq;q?CQr5TZ~ zBXYQ{o_m`S)7HMZCL*`Gsl>Y~zA3X+&vZ{JMzs%`xQt10%|BxF<>36|7jU)X{m5cI z0y@m3)E_>#;uk<;_wyMe@3cCNP)zzJ3k(*14u8}T4N2QDGsL=Nd#9^!7XFFo@~kQ8 z&T`uteDVTd{m!ItyCx>kcs`zmct&O!4M{8m4>l?S=SAVkvtPWeB$2w~yQD@AVSs{L zveh+DQo$`N9U>J=8RUw^5Fa&vXKPi)@(-&IQ1)prJNW=7ID-Z!W|U-w^!IMUn(OX4 zgLS&j#7t$_5J8Es1oTMiIs`O&mz+9;OCZgt&^el;1e!P#`DmQI75#*!{GP} z8Q%7ugELNJI5ecZ8KL1MEGh`C_?~C7 zF-CKGpu`qeh7ySe&kP#MLR*PQ%I{D5?IL+uClJhGY{Kr54e~LJN4#+@vZAWoL4Q7LyKEw`c zk0)iigg4+*WyK?x6B}|@Gn-GW5nK8mf+^H4^wcSuy*`*kBA%Av~+>s9Q(NT*Y=!nVhiS*Tq1?e|XW0x_9v#RMZQ>S3xBy+ocl>Ni! zO&^;#E^la&gh~?EJ%pkdZ@iX<>N)<*+{Db zOi&D0th4r8a8q&67Q(z6Zl22SB-M+bmb9*>>ZHiBkikTv76@^@%>oR6kjs1$pO2Ag^7{&GD08~ARXE0dNLR(GqD@3k)J=^nowBR` zrhY|NOOz>dBR^c^TM`O6xmNnV@b(eaA>vVcFW}0d$V!e{pJ2AN*#a4?;9crR~ z>t9rbLQtkJqB!qds%LS0 z1f@5A0kZh(vvD9b9VzT+=@^lKG6MW1ipH}#dQyX@s@8&*u$JKGC<&eD1>KX}ZIQur zD&Jya$?z572P9U%O(+yNpCr@9M_f(}>=T%zeC63(9xZ5R(3%{tVHBVpp{IOylVgs+)^Oe>HB*0(`r z&cdpK5s}~7x^5M9mU3f|>a#1u2EEux!CrKG6JCiJ@NNu}oS3en~#T zKpIv5`4L6y>Mjcq}l|nq-dQI6@XojVnAX5!C_2JoT87yI*|^RpobL&p-zvpPmy@i!2V%W%pRG$1+-Fia=Gj{AF=Dnm%C`rcc_)SNAn^M3ri38P;i~vSyLIwCL-dkQieAS zk_bWm`r&5mQ)UGa51dz$Vof9x=dPbgXrO7}s; zVNjdJO3@?76bKCgqSH0(RZxZ+W4qt#39n#2k*(&*s=c;BX#Pp(s4}O9ZDrpCvzXfb=q*_XbFug z*(%!_{xXBD4BRW{s;YKKl_Dp4tJ*=idF98CI&oNi*A>@fF6RBt&4+-o!_#k?-Z~aI zR#U`!u0YrjAs5a&%@6O*twRzFN-;4SNY<6ix>qZ=ZxzXEqGl`0a5*vxZ%Wp$6wzmlTWmAQClcg?l z$yu(GJC#NrDF!x)V^oKl-AK*A4_s$HPfpd1Thdwa+X9RFx-kn}g;h&J$r_SCkucU9 zmgqw3J#4RPHu@enzy7G5H$h>gAVPRpK7q&OR4uP43_DycqWsLYiMgrWTkFlWrl&v8 z`aL@)ZjujItyh1r+U;`QoJ3zo&6EUPt=~_MEp<2l*nWB(oT=5%;$h95?rlU&>1w?) z=19!D!nqinAs4m&`#y7uuZ1eJcZEQ?*M|?G?WguWnbV6^YZSvLPVHZu|KIpPV=?GP zcpgS|_DzuJ*|TXKHKz5LBUOBdLX_6R@<)?QPgubPR`gU7qT%q=Rl#58e4)Gmi43n) z>kesBM%sKC=fjM@!rg>CA~txpJB=Bnh#=`*z3rD>dZSMW1 z6$6OXDNE@IQly~yWbS=Od}wuqNWkjkYkSwf8dkwDjTd)r3^u)Pv;h@+_lqVz(l6*(vFNv5`^T)sD z1xPrn$%YpE5ocf$g*G>gbX0-rQp{N8Y{y%vuy5+IZ6$4rzcFyR=~Lfcx6q8IjtQg} zO2k=hIyaOyQqdvLgklKRuqrnutHE&qM3*ZWruogiJNcp?R+J>m>-_DapT1nGmss2Q zM#iF4{G?l-yOj(s>^RclkPw|`OBqX4fX@^bnV|_L2vnnpHYiaDq^)W%Bl4Hpg5ifu zf&-hSp%Pp(K+7%3SCOoxBBJ2%Z}BTg&`meXBk3%0Ys_I+AqAI_-0kJ`%oOI(r9#qH1rTbx%DXtmsYo_n@7Fvcs3HBJ@~#>h&BYt zHblX4!2JQ-IAs6hscu;)bH%UV-O-lI-}_x{`t5zD;tj9qW4-3&qgW!Sy%hnsLDurS zP_16lb)(DDOi00?L8Z@9$o8mB$!6D2Z|;WEjvVYgt(add9oTM*8+9Jv2>tiy>ZEG3r594Mw;6X zOhbODtccaa6gc2>7}}#HS$i|1>lXD)*Be`EpxsFkz2f}bgv&W&EQ3xQq5hB`4!X9F z;xuSs0;&dD%>fw5&P0Ga@m98))HA3(6Qy9R75Kd1*~t*ULkEGd6q`~$7hABuc4A(p z_LUIPilxJ-z=h%{#`AOfzE?r$wA2(%rkGshPqboZ_766iVg@{5JY1#RC4oBbKDa-8 zW_4wt=nHM6oC}K zA~?z+fJ`sG!BT50X{DJciy5EWT0-bcu&0e&5Kv^K(E$i8SaZO>EK~6mMsEMZvC}BKK!mm5jz7z*&_MnmAaAMLZ)g|d)bxiz>c=!K5KoEyF`13LKTiQ))#Qt)#J z1W7vrXKeIp93Fdl2-W9&<5UqV66KK=h0NjTlv=N+sS!tO0$*|FVY3u4T4w{kRIO$9 zURaZLXRFKQB55Y>Pg*~LyVU>i@uxxF*m$sz`IwgfPE@$_O3cj9Iw{yX^lNJ8Et8Li z@*=@#Kw_ir9xI`F)=9SiCVdm{+_MG@Cfj95`@OJvN{JZTZ^mr8>rr(Ufrn=xf9+)s z`vJ62kRZ9v3v3Kn6z6?D!LYvga$#6eC=4jIb zCL@nA!xVLJBFXo3YZ;RWQf|mKRCWrQ5m;Jr^`lUV)OBzJv&5`XQv$f>o8ySakTFy0D69Ux0kBos8^ZO0%6|_WxJK_1`bKu5fEs z4rV!MBT8|X7__o&@tkG~D`dM~-Q#ZkOqdo6b@6PZaDHTLL}VJXeyozJBq)I#dW*Yo zt6QqX#8U6zv0b6AK3QIe!yk7Qi1VyMuJPxU)<>TvIz!H9c}|eofA!8<;hMVLDK=-- zZcIWIJV_-R3?<$Q;J#(lb->(cyk6)M7wz!tDg}Y;@MRF2cBi;yE1x|sZmmaCeBZOi zs=mQW)?P2q!G=|mR$uDt!yi7494J^tPX`#E@B||#c=pA@I}Z0I7iDt7d(*nSVDRUW`% z#K?Gp!HAVeGU^RlOBol*Gk=lVKBcNutMq{`hH4V+Rk)QPcn-61-or`cH zmX+50FX=&!#;9qyRC*Y^X*4np3feYgNXei|t#vJ=n~q;XU*%(BSoBTOaCk(@t!#D( zY1K(>K^Xn1J`<=YqQr?Kl0?x`9AcH0zyrFijffEHueXay0POwUr^&^UK7)of*D}zY z1*6z1dRQpBfoDL~Yz`taiL`<5SJ3??5ILMzw24_xw?o*-$g0{x18{ z@#Q`=yodHUDLU?hl>Wx>QIoCfB|)&Uv+JTwPXJDdR*w$q_hrKE+1tx&%zFq0kr zx?VOzwLH(TsHbr}Ub0+1x7xjA#dDHGtRg*nn0MZ2u|NV32`(a^d+{z-HncMJ zr7q9#+QJxJx!eSd!!xB}(?VfU>{%uBiMf%O(1jXD@^Xt!Em_C#tX7?6aJ2AKVh(bp zC%68FG7gc{j9&Bp{%nt`*QIVw1szr+-nf7kbMbT7#F?L%S_{ojL2L&m=*XU2>BGhx zgl6`3g5P9pvzC>v!=Yfh%roV+EE#GENu2w-*B1PPRY7NuaPa=3-yWWYF%9+_} zf8&n^3@|Lm_r^r|t9MQJ=Toml@94HmWIFaZb_-mTPgQs{Oe^s%?XGqS<%-m$vd$b~ z$P{w6)_TUb@a2Q^=BkDU&bk|u9_p>=xn9ZrBWAEr|1i3Lk30XxPg`h1bz_=1>@v!0 z>Z=3mXwBC$AWK8XP$U_Y%tl4X8p(8YR=+*Bva9k z0g?l0cmKEzY=Mc`qBv6-E_=*Fm(hS@h9Ume(wAH@du;n0wS-g(gvo25T93!E^I)ah zpI;7sJWD&d?3pJ>VpAD(Pr$R*DAhWfq-%>9KfGpioc9ktrM3=qaF3NImmiAK zLnZAfj;>YHi&qv%&CJ8Xsa251ZrVnw_+VBtER^YHp4^ogarAfUFLUV_H4FDKv zTt9fp6&n`+EQnHPKv9__vIVe%7}P*;%i3UBCE-$o*^ZbuFVf^Wich3z;3pi? zR(x=}#_M^r5@==4ucxwa95LO7<)&wlR$6u=Mdp!F>GI@Dpo)&wjet|EW|_Kw-*5bs z=mE-UoG(1tSBtOYEub^?zPPFR;QDibAW z^m<(*%00dL&f7x<`6vDv7JxsC6@`KFFV>j9z z&j_fe)(jGbh=GJKRcsWWfDnPoGMOVf7@au!Q=F}d(BJ}Eq{v+y8ziqj>4=LpX974^ zO2#pCK1$}gqjo|{)PQ|D7L?0PNU$Ce63kR1dwLxu>!5OU49A{%XkmRL5G5BLPH9|p z)b-6Ro)l8nZic|4{xF)!l-_z-r0LEi7^R zmkm3E!>9z&;!`{7+)hr@tEk4~;vz@PQn)@wh8czB(0nR#*#v)nsf2?RN2U_JJYdo? z9=Fqf;=`g*oM|;vx~G0vH&|fu-bP%$ef}%6c*brbEJDUF1atOmDlR>mA+Z$37^Sqo z?+;%sTYwChIlB=4R{WaA)#5(PET2qVm35n@aMD;;TjL&oRxK>;AS&$>F#s%`e}_Yb z8<1k4DHTz2WEg=-%-=Ewh=BrX5_psXBr^1SP@DG@>)LkB+1CI=3ogq})9p>X+8Y!W z)9!ekpAqyIAAT2O!axoU*RiWXJ|aN{4nmVd2U6%(A}=jcQs{dSP_k13rXopD9FqnD zQFOErARy1^nDDV^NyPl1*%ykD^52{iQnvU`VhBzd4N@0{w3`4Y$jydABZ{Z|w`G^p zdNh{B7z(mRJBU1S#D=rgMNfaVDlinKikc)i3~FNx?5ary$fR^m>STz7C=h0`M(0v? zv8+MzG-mPyi<@i8u`+;(2XMXM0()JL{?1p1=(k`+C1uS)_G70}{F0;hV4VpdXkc8j z#2~Sesidq`0pY+(QpyLzok2knY!q6EF-%{u5)oOeVq-a6RQ9H*X1JM2jG;hSECK-p zD01qt5W!N_k`NfB(YSgT6flfoZ)4&zVeA@T!@7G%b_N5U4KZ%31$jo}2@)BgSs<+z ztguM=W0s&WwwIY57Uoz!%F>&i!|vFzH7mLsk85g~epa%3C>?yhuwOqy-FAKDi?ue? zX#yE}Ep0arq~s)UPgskNZXp>i#I&2O1n+@79wOI+D-OBvD(GJn72{Z@MfLq1_YzjC z1dGQ{k#~cJlfY_ojMLTzZ6vJ`aeFwKKy;4rX>`|;4=f+P_47b{n-$JXl^5hLyX z#Ah}MKcKtvmKVfg^67~zsnS{Kb!2Bl9hl*!Tq)YhO~d#aRk#DN(99ugX6aLC z>DMqw+t91qMV;2r;`H{1oq`v;zGn%2Yr9l-?f4_G@PKORnTmw5t8uj0d)M+gtU}9` zJ+x)d-`4Q_y5a@@upM;eKA|zif`v?DF#CrOKkd!nq{%=GR{16Aao_Xa5$-gF@}v9s zNwRd{E>~+V(dGR-W+RkfM|Bay-riNvPYr1JC94JO*VnhnF`nEBAa1T}Zbs>%yNGbFp3If!0ZHJ@YDyEd5@!TSRhZNL!)u zhfgz?{X(+I;@mUUrdXT<6X#IUm;k4hF(6$@hI2Wt{fQRm^8cyE{1+MF|N86EZkEQf z11BjX3d+MtX;Q9GBr895GskQs7rpu}5G_xT}n^wJeAhW#Gw5VeM zO#mvYkX~{`bOu|F-TlQ2Q1q>j(HAo&g|I*ZqYQ63OsPP?pNvRKwR*6tLzji>S(4*j zmp&qL>6?#^7Jm>=gpbwu_kM5UaG+}Kox*r|n;~n`yJ4wFEFMV3eto(I7EE8mY01fu z*)Yf+8bI|4R5qy2XD4T@%xBV&5a`Dt#V67$JSVry^bDmNaaPSmq-jlk(c>kFlCUjS z5rX%P%;`oX|rVD8r68ASYky z+HDZMZV~%CGstniW(=Ec75OaG4RPOBQms#TY(eQzV5#<4{u#D01DqOLdFybp)RZc zp~G~GT)im90#jNy3)9H!S@l!<>u0rwKDk|0TKgCwR^ zb#-DR1fyx&gXS(LekBSl_yJ(xAO4BPNTDgYMVXmJ(=W+I-YEcHQjf-k!Sik~GFaIK zyb3)g)v1kNF0B0Flf($1^6nj!>GL+7iLs6?%%fBdUgdChOYiXEuT>I9TQ9|f7{SD{ z@C?te2!e+?5;N86fPhq-zjI^NGtcEtXG!cqHs1=X#x^!uSXn>GNL1t3z)!VRB$0&^ zB#P1$o?9OOCRF(|BKM&t>ex$zb!CaGlaibDZn9a)9DCa{N|xr^uz->(&$x*9W6{^9d1MFS-Hu}GfLI9ggH z9rRAXib?NmslqLc+ZObj!0txEZPZwb4fg5(9#@g>05+ z&s#vUgfTaz^7o{(a0$OV&x$k4`BYLw)|nEmo4vRBByTR%Je#)Tob`tU+W_2)cFn3> z6P$ppjh7bl_@z}muX^{)A_IW1w6?O4%y@0R3-~!>jjfIF?0S)!T0*CSN__azX;1jw zv@}vTzDvxm==rNB8uPIT@14WY`5O1pe$P6mA@lnwASRrgx)8 zmG;EPw9!PDIemfyv>B@twZ5g*{$n66j<=FhKMH9*Qw8T}ADAtwZ$K-1*PNvG)U%*d!+PtSz=4V2neyp`PTRh>MqG38} z?AZ0mV4{);Utv#_vgj!a0|UE`t+c11n}AY^lB_tHtz<=(qBu_}@8GIg4%ED)rG?7s|e-Q+z)F#!Q`AlL*ZVWJd)7%9GDgU8`0u( z+?DN>KVFXkvsSdFW``lic`6nmsik_KRm=e%$Fw=^0yvzQfBY-%&3#JoOZD7AOf?U6|6n}(xK`5V&S^wZ>wdzOHw8k$V;{66Mm(uhaKLXR}f8yt5 zEN91Z1eI19LkA(tG^eOTLr~P53dUS9+nPb3zrK9D6utER^8E4gC0RfJMfmu`kFT3! zg5E!kHX*e!#rlJS`XTzmd!x^6O3&d8KggT%N5bHdYbs%26rurxf~-tJX5xtXU<(w~ zdGz#?K+4*XVU!v)ZKdntOB~{d8WI|1dhcM_b(t~Aise#C6)KzwBIdFJ&mb$H=W02X zcdH;7^rYQsD9jN~{_s(j4W%-hS@VLpO^|DQ+ba(&_Wh)iMHd~Fr3ns>l#`XzKvQ>O zRa!S!DXahy%@EaVS1p5DzwcJ6Ej-xf(nWi6bDvHYs*NOn*4M6g{*5M?c!boN4s1Sh z?KHS&0S(tlCLZgySiBu$bsF6n;z?b5OHB{oeJ|u-&McOwUcuo3*6LJS`~om8+cR&R zVRcH?*|fa`xY(-Zi?ra^+t=vdoUm!vn|xZXy+XV>wy|9a!D}#Ss8(Cz5vtP_@%w#i z?S|BfD*5(1s#>|}dy~%@iAQe88(p+IR11-c4sDZFWvpO|UJA?(8YZN`zRxxMHvl9x z7ZkG%@^_j05oC7IyWT`>h?pxHiB`UqHUXV-Sl=22vzRrA|IU9&h&TWhOorC{28kpF zr{!X>LERYBsR`AYUTvC%C?}_l3?M97DW`P#Rt`@(B^`qG8|Yhpgs;+E*v+B!yr(qT zuJZf!<12t5@2FdLR&Vj&HnUi4IF7P9S?;kVHI)Zx@noCEL_{)572&0;o_Png1j2Yj zBzD^m+YA%cMx)4MSm#YCn}do-^c7tOHDs+hXOB z-}BeLby#+ftFU%)(@I|(F)8?>rE-Gma8)OZXY z%1#nHhuaS0`3>T_+}15Z+1<1Hl2j_@rKjR+hu|V4x=L8kThY?o5*n8f9j@tk! ztIZ`ALTF9?lwvRocjXk@v=j@d#Fd1SENTixfW&4@LQIzlYl+6v+A_Wk9*2-OQkA#B zi8OPSp`^dl0==ZYB{-B9(O+@8sRDRPH0%IBq*$69{Jf0BCA~w6p+J;HP#u%d%gDxh zRvo+JxlMU5iu7usa_?1>oNq7sM%EByzk>+VbX-8=vlv{OwSWBU9VZDBZHq6;bKtKB z{@-AZAP{Iwm7^Di$j24CL{Xj=VDP<^>0Mj(kv3I13rpz}*5VhwrAJ*ZS8D&wk9)V@ z9P4-Zy1S47B^Tb=y+6OESrpP9X4vFq6Qx-L(ie;IiiP00z_|iXxOzPLVjtQmtwp|r zIwTd77FvQOZ9F60!x}_Waj`WCla)e|SRAJ70y5@isUBsmOQBwk4paej!cs}TfcX_; z&}TIC-i2XUg&N^}U9@mQ%8I0THob`UKrc-Y;VEmm&+FQ-g7m|Le>#JvypxN)Q^3PF z$B2rG(?<#K+Alcg<0{-&B<|G1DONKb>s;-rXbSg}js!NDcXxFKcq^>o*bl2JB>ocl zRwqnwlsCfmr^`xz^^qF+FMt>jLu-KdmQpA7uJwia4bhiv?i~+6iWh8QQ0l4L^wg}e z{hc6CK+hVo|5T4egqFxSWqbIj=jW=jdgQkrUQ^b@J4H`=x$rp(7ab>`3ttyE2G?yp}N3(}jl0P_g7Sgh? z(lFbi|`ya z%beR>T8nl&8`Ytpj&W10cf1g{AnlL+O!LD4aTa{BdU!X6N>ljV!(=NOg|qY??8rx^ z3;qE>n0r62UFrws0IqJVX5pKzGMvShF%_-3qfn;a=H&eNRuR8^S4KzX$cUJn;($Q} z*205IL{e7)23A0nFm`!2C5r+p&eX^qnrL1+v{DBp)tr%HWGB3aF^UWqam4vBhtyW& zAWucMI0yJUQYFKi4(-Lfvv1A(6A9KY{AOr^Nz4#%Xeh|*O|;ADi_AM^`W^k=YLrv{)j|#|^5G*w2j2lm>pkl)t7YU| z>;kE>wgpx933WGW4@9@m045b>)y;b+d}9&eW{DEn*qRdQR8~Xmwb4I(?j_z74@utk zTOCAsRdrPJ*6ZX$W^_2X2gQ%*f|OwOGt}l}`6zkh@%7nok2v7audl;!Z43wm19fRf zUHD1Eu4pWCqIg2R%hCXh5?c#8G_jp>#nx(T7EGq#_sWM9F2w2^v*5~tU9g4;vqaY1 z!gqFpC>l%B$oxX|1(X^P)ycwI+h-479owp8A8r%C)x7g^rRQUQC>Iq< zRJhlVH6!#fwH7-K8l@in`0qrc&hOHX%&}^f@xLm1`2DUlQC)=BDco-$%fE_wvMIk@ zIK5*MFswLnz&gGfV&xSnoKcVp4EycA&WWbu*im=;$Z~;iV3N6WlquFf)#klL-ET9R zfhj9$=Jw-&m4q%%Z{nWf@B5Y)DL){>_0$dpc{tvZZq)9P(@YgZx%fh46g2zkKkVm! zUHST_Z?Ozny0&YR1(;e(a2UKTooJb^+*MjdjM`|+H0APvi9_c83aJ)m=Bn*LQT3S^ z=5QSxVgLQ!s7S`LccEg_q4y;GR^0efDhwzXInYQI8Aujl8`K2!+DB1Kh>;sccV`mr zZ(<3-CJo`X5vhlkC1q(c68q_ROL|(Jk%TM@%1B|k&a!26eIu&T&1xf!N-r(i%AO|8 zjDuF3H_;BbB=VKKo0>N4KPcVwDF%XVw_iLQ3q5P=PTXFW&mNAx`8TvG&b-@&TAL;O zz-s!(erEW&|LpI6TUpT58gjGPT{v@d@BDkXNc|f90{6ee2a%S-pj zzmHPWx<*O|J#flY2C)*7@|Am5nLCV}e(xDH!E8LN%p zd0}TQumn;Fl)7yV$m-XU4h!0kG{A&%Gj0f&dhYv&!?h&@S_#!Ms-L1VR6sX$Es~~& zA4i1BthhJ!7rhbg-+D9Ln?1s@RkA1sutAd76z8_TM)J z!Ax`}zSzPZH8Ie8H(Q4Z@9XpCk<=Q3p(Oq_A0#k1o;Q^aDknt4B7WG~u1l??Fe1}F z70)VB^Y*pJSt#hiKg+jS?)m#Cx!7UeJ^rill!s>-)34SW!G>Hf=_riX>iWOWH1uu1-Vk|9myFx837R@7 zZcO8W^H3g<9T`Si(vYf(*N+@uGxzK)nUdceeQXWg1#4|~F`ah!9ZHFogw?kdojBTz zZG)M)&owJ6my~B8!m-|-dYL@Lf6&K#z7h!)>PG|qbT;1^VeEF8w)F24$!3vKmcpXiugXIvB;M7|m}e`??L1 zMdG>QAySo3uwcE<@B7mDP3zN6LM1wD-dBDv;Vij4E}cr5zCV0E^MhG=O?=5SSru>% zERjD6uL#x{pCJad#bX37!&X(=;XuQd#9E2naA5{^+frL@Pa3I9RHY7q5Kae2%wE@WIDljY#W8w0 zI*kJqO1((Ozoghl`&oqX62)1OHy@TfkRev$5~%!IZx1-V#y#2~O*V~~r+8j2PC z8T%eR%#dy-9bsb~LAJQu&s`bU6Zfz1k|hqhb3S@%v`oR=)`RmF4AeyOyK#5~L0C_b zS|c?i*X(rN@2r2r$)cc>EQTf+Iwh|WffFsbjY3()IcX?C#rD`rB1DjA>rxN{XwSc^ zBrL$E>b1!fbYK3hzigHxaB{oD2@$Nqv)?g=z-LVq5m-1f7&%qUZugN4l5#VfrfpIG z8h!v#rm$PQ-McRcyKiSpJ0U4H5r}A$Mie7raT_DlfMOl1Dtk#&nwsK6$zFT9hN1%e zw8P-p9j^zaa5NN6bOX>{GIuVgrXLC^QcSyzCagJ`W8&?|kq(NU(ox?vki1>DRv`aC zk~SgQeZZ*zsn@g?ogJ)+OVk}%%JqJGIP;w~k=OFARRLnJ5?@?$Jf2IMsN9qtlaHF- zR4IwZZ%Rxp6(~yw{}Wq9@g+?y!~sH%^Jqsozy%#Ogq$wTat^vYRD)f5*gdT+*xnM= zV=CJ=rvi5V>PoyjWTNLeGG2H}8_2;$F`*lZ3XN|$kMh~?@BN;jYz0K^dE39N8$%Mx zfniyC zr6d(K6=*m1&hk}U*<|gzZoFl_wKCFOtT-eS0_dir^0cJOuF_N+^W^wIo1fQDZt0Aq zy6_5la-)4o+qqYA-fHI;R`pmnR^Q*G;~rk$wc|E^ zlC9D`uHDAUoumCNj%hx=zNu5} zUE=t=U~$B$dtzYhAOCWYdEzB98YT0yBBRqp=AcVu~1;ypNPu#sBJz(Yp$xu*?c(DBh=zm_p|3HwF(@-T({XV_J|i? zYSBSL!~`GVm?jm}8OU%jV8GN=;@|@*aZ3(ACdgajTgt7oG3i3$lGzt4sb^WiB1x-b zGc`u8I2dP1KD&eZc(~IY$q?lWAh$Ds%4{uT4A}apP_zfq*PPrbm?44O)wS&0I^E} zE)K095o-d&`!78Fng804APpzVwJ$a|UWBaYF+tVWi+T!fFI$Cb_Y!G0=rRvvAF-bR zI2-dska8O8bbl2{tiXeh%A2e)>qc4H@*?Bx6nZ{djTv^$(x3Lg?t%`gLLnIPe$_TO zx}%$UvspM5P}l->{!Jg5xnPEd5GIT7V5_9uk+Yk!GO|oABw&EuzSy~5CQDhr#Ib;)@IlRJd1{)g*G8d@dUcOSRB85_ zv5~vofB82fNkzpVG7AfDWJf^DT%WQzFgzO@(8m9x^BuA9=dL)*kC^1c$x6>3Nhmu; z^rVyX(i*2fMDbxXk(`Q;;QLr6Z-x+%u`~jz&JGHb zOPl^t*u`Ib+mhp`6;M9%^dH|WzO?}nCuoxm9UVK9;c5(J+F4^q*7=IDW$?fXTF_ZQ z!b4+|!gjBCGi^47m`bP^+mD*HRQg23v0h8kHk?^U_4F>(nOK;FOu^^QzXQIh z%}P~O4iOz!2Mbd09-@z3PrtZvttJ1VuG*MA3nUUbBNhRib zx@$7-wbZ9gbHf!L)p;M`E|*u=}m&;gP$1IKym!7 zIUnec{d9B1GI5&t;u8*Kz`(d#Co_`%o(OTIkdn3Z9`7 z5bY?VWyK?|%%3NQuIFnzUe!wymJYbCSIR>S&(>3?{8Qx?Wg9#@TVyxlIK z=_NKGCSFxDzaPW>o{<|rA!5{ukCYL)vlladIJ&<{>Vc}d_1x6j^DPf&VMYJ&^0-I& zw2#BBM!11zBe_cHnTl@f!A-OJ@BMWx?#@f~mj9IehHw#*ynW;kGVa(qV^<&VJST1Z z4}AVP5&XB$sN-8rhVF4~b3a3=AVAPUscyzZ@pDwkTkXiRlb%&!j9mFXTMXx1e-7n>wTG@msU~Shgv0Y^tq!k zYXydX|6bbCi8r`4p70uK-NXlo7vLb+6r^pRFcwN&?=krWUjB+ppR#LMjQ?&*S(P>- zF1q#Yi$aqWLWWrK&pd%vFoxltya)MI=!S`laX{B4JHFV`#RbX77ozzlD@LY1Zh!Q% zEpq?tpWjfmbmZ+AmMhJ49gDmGCN6=(jh=8S{=w&8ZI@SpetmS22m6eF|0#gtH<(Pm zgroaQ2TWv5<&Zku^iYRHH?3ej3}Horx&B+@w(=Copo{ z&7;n!L&K4-((Qh`O-kFSTkMwEMP}#IRI}!-O9ZS(ZKimd!l>qaq$ekK>xwn1A)frr zRr|q-|B2p0l~JaNxTW96>s)_^+Fp6*$M(Hf{NduHFa8zUWX=1gf|Js{P>Dw|UEJs}Sqy96kl@30@oX<; zZ=LxpU=k$7f?F1b(XbbqK8>q>aieRCi7;JDVBCfXRxs4CHke7<+J1|vg|FlJAy!ev zV6-M1r7}ErhG5WsLgUj#p$vRT4z|9T1;p9>VB_10@uxZ ze+d>+&@h(q$#5U_b#!)3-F^~rfPgRuJ79S#u8IBl?cez+lL7(U9MAcUfSRRvIZ>Hc zdnR$&`A-VgxVy zF^rF(-Ug4}_V|H@Q9C)h1Siq+Ba7Av3L#Vp@SkQkS6ZcZm}YGeGYyjLD#IxDSk}Pw zQaT4GxE~y%>eYuRN$npLFn9PU^ujD$F_%$fmtu9C!?Hht;c4BJcER|?WI zjFeJYr_y;IfBUaK$s#?k-=E_jp?y317laSh{0ANZZj<8Jp6B#>0{<|u|KxnIc=y{B z>5eMoRq0iIOAzfVytDOF_1@?l8r+MF6cREv6<0JRrwg;mTO_DG^n~-hOHWlud_`{O zL1|8hKVsp>!lh1#E?m-+{N6nO+<=9P^b|%*wlGsuB{&ad{|5QlD9?3gZJ9o;ZKdn% z1s~p_vybqDq&iyeU3n>Sp0@?XlXXF(oqb_; z(l;rRyO+l?1L2^Us*2IE)n*NJ${uSM3KZye{yHj#%EutjKt}5_{#pUG?n-S1>8A6D zDx+Cz_tB4(EPaDs!jkQveYcoM61T~A{pA?qnbHxDgK2{qOwMkw%i{0J46lxJG#}D_ zfz@}#r`g?i_C1p~YJ9d+Mq?Q4CSr-U%oiUV7;Ec__=i=TXW9_Sfy`^IZ?JL#^M`eZ zEJ4~ly zF(kVb%FiAnMJj8d6a4jW{`n{PIX|{8Qa3=)JV!dbd-rma<4CV}{Qkn!<{$F;XCL!# z*QCFeYnRWheH(y#))J=a5xoQwkmhZVj1l3K$g2Uc8!`R>&ZlZHK8Y03CI*QP^A8Vm zZsqw~Nwy-)$T&Kd;7)#6)c|3`m(Ih72obj;mXXQae4aM)xwcqJC)ZCTtm-*mhT2c% z%L_QkJ8O6`nASO}aa*9hbc=Kh`*ns`^k>Kbb2 z5Av`vA*0_KXl9>{pCtZL`|E$UMYg~cJ^uQq31wI(FQZ~$Yxh+_(}R`^Bwg99|KRhV z%Tl1dvPU%^tJJF#%c?VwEmSjCd_#ZO3BiT$ z4Bv22M0}YPgTMb-A!a0RT8>ogBri88&VafllVN|o+3(}93=8sgkR#cGZ7jM2dnRv% z$lV2RzA;>0ev?Mq{3Ic0c*Z4~tCv5I~42AS~fPBYbbxd8I06^>sUh^yM$_ zL7`rlumfa(q8>avxFbEXuTgqH-^jY?0WX78jGWBl8+ieM*cB53I0gwQO?>l)y>2rZ z-goV?@chxwyx={Eq2~?W1Mz&^o)TnpB4=*X?kjlhXvRjT1`p=kku8^V%P=69MNsu! zjcuRDez~k_G80gQ1dTZf+%B8L;-Xj4^L5Xg+)&1aNrP1Bb5XUq_r)DR6Qr83u9F{N z99Sx***Lvtbot~@Q`E(49==WP{*_b3R{M$)rYdBRzi?bBh2%R^H;FJQt;aI!U#`o& zcHGOA&TrsY!lGCAH01Q2_9M+knR#wbM}XW#n&}i$Fjn)*GA;?l@QbM_>wOtZ#I!KJ zDLpC~bCz@lS+5E+kp+=}S~h%{5>^8VRjjh-Z4Jx+>jGQ?{wcUy#jXl(oO?7TP z!(1Q8n%!xzdQ~CZt2~Ob6XcS@4!t$5!7r&)_vx zT{GLi??yqAb&Gj9&MU{=i>fmHn>t+@bKL!dV`thi)3*$k!_`PHc>HPwG_scUCO? zXsSVKFc(*hZt5b#m=3vsL_2x%S< z4kEi2iVwf@CQY)OJL2(H!cEJrbCrC`-4pik5{XVqK$UP+$a7J(q~|OF?)x%$V(~|) zwiW99_{V*6AA~`UFnkq(qAhQ#%pjPplx?f@K-78m0IEz>r|Hwv$l$f_unvfM ze}3OP_4aUkL}8zvc33_f#W>W^OPKv{f08FX5wL3CC`ka|=vQrmS9?J`cN9DgiPW%p z;;wv+*W)ASHDy85_y~gmn6aI|aTWLF#x35a_Yp$h9P3L*OplaY?y1^fEFx-|_gK^S zf_y09{SvQDjAYg~;GMqf3ilb|G54I23{>7;J-&3Ni1C5Ihi&T-U~>{Ma>0uVMT+yX zrHct?^EtqaB(aK<5^*jN^M8!uYC;mK0&w19@{OQ#?ML!)0fmLrJ_Pb`H)B(QSMinX z_>ZJr=(%Nh3iUV^VzEhSQljI-6sJ{qF?4|dbNEOC>NbPM$gon4BurY1*I|;1veR1_ zvx%4~dXwfe7;MW+)8S5oh_ceTDg8Jhyg}?GUolZ%PQF7&1R<;eLXj1QVus>FyFLb~F>kF*o22L<7TzRW$Dc2j$O)G=oRwK{ua zZ991fu1obs>CBf%KQV3@JK{6QQ#ndqdUo@T9<3+{JAG2W(!lF5vWp;ccH9i~R1KVh zmOPvf3&-J7?Kbx(FKBs}tYKs#D;7C+twYojL(A}R!TCf8@MaR+5~y@Y)au;H^vzV% zN__k*h&0<4Ts(k1!88i46ih@k33g8OKYRofoxqV7zZQF54A9cyu+m z%kdk@(IbF6F%e4kaEyHShTz&*jHh89&gK*FCD?xTcw8SX!*iiY@x!K(Kr9$ zL(f&+l|{LU@!+!Ej)E5o!~s*KM!%z$X||qHawg9&>Iisks9OXCQ{pFY>%l5kU{(Ii z>UwEhzkDYPC=P}gECBZ&WuEg?+=^n>quS-#v)9tqNwJf?EN8@lHbHMaOcyw0;t}b8 z&&alZ5s!WPRbA^__d8KeJ0Y82p;*#=%e52c^09hKN9E}YnM1YB+Z@l2 zhkB{pau&BYPxqT+NwMev9R$Q+L_$eU0D>SY7QjMmeoXeXf(!^D%rp@on}x;0ACiO& zK+MK=dKv9u^UONBjD3Zn+`$kG48&Z`522wp&HDVyZLwG-DZ0rWc0ZSnmV61&>Q-j6 zY5S`Pc_mlj{g%*_8rmQQZQ@SUp?EOwKYZNehQa3fC+m=KQdTS%2WgfW->=fSXuG-k;3#! zl=BD1%#p42DXOw-wfNcjOh$9q41XGrb_~Y-baImW{^MKD1`4yznl?k{3umTUZ+nq$ zRghwa11SiAM$GP*X|^A%$g*s&5261y-*@)2nh9CYA|P>S`A4O6bvW*G@zVn#qH2Yd z9bZK_g}?;1DZZAgx)X}czOPpvX0)t@|GG7a7^Sv2L(4*GGH5a>$vVej5m4CTt$ zqBB8ZrPt)%mE&alsp}(qMG}6aA@|#oueWS93+sj}_TjNZbSVmTBGV30{BpG= z#Xp5S=5Xso7$ZAyGj&X&D&Oc({V3pd#u8$b+W6d23;IVu{!a^*;2i$e&z{bme9D-N zA<~sc3%!C4udF6U+MR0_7lmaf%!G!G(ON{16ijqP1M;PBQeu7vy&;k@?VW z13xJkUV3}K6VZphU3(3@2Ox`{GFTje%L<7jAZ($s zMeprw@E!*uBRa;O@hrn9HtyRwS=g+Zk)O2TV(8E?N|@%vdOZ5lyjWm0&fpCvq00^Cvl!Zijz2Vd0;i_`knQ zU8napSbxJ{&L&Au5>-B_6smbRt7dF8xU}-ZHfsK&tGt_euK<%nOn_hwY214#b$xj5_ig$v#iC^0YYof0@I-hx6b69UbNK z6xdcLE3L^FPn1ozQ}45c8A zDZBz1PL`#cq>(!o5^;XJLZPx0DKYa=*fn@~c&1X|Akb#Q4nMuj#|X`GCGwM&GVHGk z?hO$nO86aWi|>w#_0lHyV)9=&@u-wG(~Y=K`lr`U!60-$J@{NlRsB0U5b%p!`8|VVF5y z8SrNw2pIE)WNz91-b=k=()wLr#BU11E{gz@xMTd2h}SQed6=@M97yekeCxVePYqp} zj`?RM8P_wRRf`)HQt6FCJw+c}H27*V_7pJ{i5WCyQR7XOGr)NP!KQQzX^PF`X2b`_Avo(Yaw4B|nh16g+7QV$jv)Hq`z&h7T*d4a6Wz2=-#8-BxW;PR?bjXBB#Y%Yi!B4MQ-}i9<^30 zb|RV!SaL!XhG{URT5U7qwiU%=@y(>+OllAL51%s$3^0eWo-bS#AC+wWofeI51j$eR zmRhf9Na0F20-Prby(An8BCPtjaHD2!HzNSr209PY6)p)*tgpG+ zfp3YY{Z|(&8KN>yqN?;*0u)l!Umkm4Xl^(jKjR{OB|Yl=O_O(9`vQg(90IwW5_2d* zB9{4?5IH?YaYDUh@+nsL$Jh0~6tZi_TC-Z8(>u{I^vkKkf2}8%Bfwhtsr$`yT$oV;~+O&&rqwLUv^+pg(e#-Vw_ylLQa z`m>#D4E0`u8?9+|N+AR{7`x{#eAcF^EK#p3TU(4OiRN;(w^VxCK)^~=TLyjZqIp^*7|vunpcUvz23!BaTI5a)nS=p8wunGzRp z+%gX;eqZNPl4dIZw?AYOa|>f<-ykx1;@6s*vZ5}4MJSTsWS&2oTkt1IE9`#0^5ML4 zz&`NCBze5h(l_gu#wa;v5+(+Ujqpv)aG~5JO{pTltB=q~dKb3?b9}EilDCqiFCH7Y z20jy|h;w`i(`E7-S{O#BZ7swe1HD=GuhbPw7o&Djj4^Zei-s7uTpj0NR;Q1Cl5Mi>Fe@W zXQ$bv^@m%D&#f8OZGUI!>+$qxRcPZ+dU5h-x?D|!qTP1aSIklTwJ-TCkekY(Nfz@; zqC*Ek(68S)0>zUw<`N09LCsRW4~@535s_)L58(f9v**8$gZ`)g5#Ep!Us<}LNH=KJ z@MW$~2ka-nADVc)@_5smcU{ZR^BeSdj*-Ao;k{1VOe2J-Oc>_&HL+C0eNbXEFjt&H z`?EF}vnx#Lipu2k98d9JL}u^R$#^hWvgg-KIl}HY8i7iYTr@ythV)WTuBfjC?(iz8TM0uM%S2-g z`^_P1H-nQOh4JHF2`QYT0&aFrzaEAU`RbQAC|eg#EYu016UBDjefMNKq^G%gL9(K` z*X8h(pVg=9dFZ{lBz~#?`#q(tZlY>$<`$@RxpgzM^Xg<3eEd+_@Y{jFHf0a$*J&Mh zM$XxM^y4h2raEyrCK9velCK-hWqHiGA0cVtu_bqqZ6 z_Xz?Xe;MHZgU>(tiU0aC{1Y-+O6jd?P3VZk4nAwg2Pv%KA7k(siGH@@R&bX@@4e=+ zgvc(xsfBaA{?X!b$uIw#I%G^gdQQhzGrY zTAwrbc;LTUcw|p|esgKeFY0Nv@nOm^L}^!(c7iP4Mfsk+d2D}^QDD*nI>JLkB$sqmj9U#JgX!7iiO#t zR#Y$@4Yw?!0lkQxr4}w4PUf+BVrUGIX4#4vgRL^hO~I_;H7;T`td*gnN6~9;SIT$x z>!H0-x^z`(#WyvEu~JVskW|zUWNFm}bH${+*ZG9|3`%<5lVw((QvP1R2su}|qOs#0 zIU~Jxx?j5ZvLlyxooDRVPd(qMOsX~p*KdnfsLU_dxPH9gVn>TTJ^4nK@Z8lZS}f(r zSt{fB=TJ^YsjI9mWdp-HVe|0&>HWgXVovG0;J4d}-8-ygdWBPOse%oFHxzz5(MBSYC{uk!t-mkuU7AhHfR?}e3>r=9wf@43Qm zPC25nO!kIIBkB3eUWydw>##Y|g%-J$Rn=;wy&%Lv%%B0`&8GwGLLiKW3Me6&oR^p- zs%X^j=py6#KKQt=qZO;LDdv#0l{KNhD(Vj*ws9-!&-$RnS&TE0=-84*QO$!KY%g^f zwF+tU98Kht)J`x>RR(y<663_kMvkD&mTtG?NcXfH(VrOd@u+ol%6LyA4!|IyFemu%oB@pU~o)8YgjuEnMW4`{9qX>3-P z`%wf9$!p}n)$fW)z ztFM1(3^iD`stewUFOtZt*c(Mo`oyKRUJ#7exP%_gk1uvW_>7*szi`;Cr{AB(&;Lwt z+`Q%wvS-(04c{jnFO0EMnrLn}NQ!RQvuri}c!$W;gXyX*juSIItL!t~bk`6vqgDD5S;afaqZrby7Pqpi>K%S6~1ZG<79F~V8+ zo#VDgytTlIU+0~MwdF2}vwhB&7g*jeKXdAtQB%qRu;t3ndjyF{?CwubAv4T>_?$_Q zgCk%|>*V1MC>RUHoopS2-&EjmGT&G>^IiQfQ6TK5HMX^4_(v7eceb19t4!BXCMy=* zcnGHP9op*b&=ZRyD!t7Lb2YpAV= zw_7Ths8^+nGAxvbX)IKZJW=kK8M824W+e?9=LX~LPjHM(h*)!RC>2?lI%s9FFcH2M zDq%@JTpiVqyKt7qy?|mmLfTz2)T-Q3jRTd5<_%jp3T!$yvG(&KMq(~cSRfl>AFT=q z0)DI53tN{m0=qU>cK07D8)f}zRWfm`QfimKxos51s5TVU6Ry_8H|mvCn~ZF3O<;}^ zofsSv*ny{CEq*)fu<(e@kDfV+S`R)mijguIiSTL2&Vo)IL;v=Vx{*c#yZl+dKQ~6u zm8a(mDKn()Ji2X~9zyW%WdSa!@qeuQ$PRm3f&4%zgJdArLdrbE6v`w^5DpI)8dQWc zNZi!Y#zFG>gTWkLFdUnHOcn~0pnZqrgdT6<;JY>VVe6zM37tt90^T`wD|}+#VdVJy zuW(o%>E!XjBlnAjqegic6lUqpK3o+Pot?73CBWIBreuX{zY7az)h(Yoxet!6E_piZ zuLC3dTu)S?T!Qy`weP17N}I=!9~|f6+R?m?#;a3+5O0-4Cx#p*`~jc^wv|E2*Ru%* zuGu#NlaYB|)1#j=iCGN4CHR@R-1%}Uh=!nezD2-hk4f#vT#?*(_|MN`a{3? z2w8PgOj1-itV`#-`=g&H$QBrEoZSyMdls9us6A@K!dTc{;lby_GXD0_$L29LwKV&j zH{dg?ii)|Vutqh>l&$>%UUl^_7O2QKo(bA`VI z5Fnwzvu%YloXjaGk%GjMc^zA0j)J0sL=&qK6yHQ3IGe*`Jsefm5ssTA5e&ynpK4=< zvx7LZ7=oAvRB5KIT2hST`!b$Y0a!1j2hvWAZrCBAzu*ei8cyG)_s7eM51&S&Kmf8$ zp_w#*59}KO*15y=5c~UmnXw2(!C+w8tMlv-+jrMDeV7xQpSS z&ugTFr0=Rd424MsuA}=JV~Cl{^mX5>W9d1jsEIp;q$=)_Bg0wc+F~*Cwv{!f*sOPt z6m?jydl_fk`q%G;|NMmqoaT$D)V_Mdj}FUw{d%e4UX$@*gx1|V|2sH+c6i5|)cPyx zfjxwG$;&uJ&jt`>8V&zwJwLs=7XJcnUe46P@v2s1s;s?&b>%(Ou#Kw1pKl}BS21@1 z=(au*43DH@CWEJE7it!KNsY)Y1y|v~h=iIA_#F+;Cyk2Bt8s&+XBGm8ylrHLd-Vb} z8Ns4=_(Y4BtPo}RH@bS!P%E|HJ4j_N$%>oDrwP0KC2ye*=>-1EZyEH?-h6q2LnoUyzM5zG%}I(an)=;$@KEj(s~9)ff!pXUz|2op{Ff)u3-1%Jar4-5xP!H=A4m|mPb7G_4}d5<{fNAX#c=pI zQN_mL5m6|Db9K!ayB-TakxK@aJ(yUyi_E2kO-HJeu3T@rP^>QX0f^ z%$L@8#KRfO6w#PV8AYVgbl*LXX?}XV3$K&aGad@Q(U!B6+XeFf(N7KkGGqMoCN38x z6{)qT;*^1tVBosCk+eK#we%t_C1W4$A&l~tykMi&vp>G{#~|HXh04K_y50Y?0ndMk zhk_AEKsJYOzHIjMWtQDInJkLypt*J=^DcqbOhCSD@~K|NspZ{oH0DiVRoqeMJos-wCHt=>TWV~z8))**L#iy$#xHYK?1x5bOiv(fd% z9S!$|<4tQU{V#u&^Sq&a{1)N*2gXYz+|Db+DjFPe@p zzBhYfat{K3wGz^Mto*O|=RZ8)|Nj@t^XSmd*RYMPMF7L5Ib7ce3*Jp85v>`@)c4Tb zEyr?A_g`P!tG>&9JDX6si9L;hSey!O!umG41wif#+BTHXl%Y9(!f-8(COl7xE>zVd z@vfX`%({SWvyf7~zJUC`w_H<}1gS)uBU!THC$xl=Qmw~t(5efro*6wo-CbWCm$=0I zD)!@hwd5Pj50)sp&siA~tRFY-BPXJnuIwRjzRSq^+yAhfLxpjoZ&2RUlUCV#yst7K z4S6ZO>C5-b;nbg?fAIMi`Jew2x5CpWP~<)?8e|wUmP|RV_e*I_X?#_mrVgp@!Si}= zh=_-rV4y)*W`vFJ9WziyfVFtm8qNkrh$)-X2!Fr+<~P4uaqWwBIciReLru>#-mz)X zOt%8_&soaEt2_=k4q293p=i8T4cU?s+9}QMypl)RZD||CXoecV;p8~camr0Yic%=4Ml>j7=$UJjmksrk{rbuaX z%=!P2PoZ?AlvUlu+vVM8G27I(ix3U7YEuXI5ic3}(2RK)&6$I14m8`oKN1n+LZdlH90%v#6A&{M>1k7= zvV45&!D_isDWgrbD1rQ<*m5}e0Ub_iqi10+&94-6BKYY?wzb@zxkdN|23U7#%;529 z{psoQ;b{StoFn$pow!iRK1RaIN(*UaX#G}lG7S&>rDUe2X<4+uBxEq6e4K*U_i5^b z#E!=tq^~Od8-J*D(jPu+;Gf`flO#7q;rKF%_H#Q-X$D^pxy6q5ye;MAAJ5d zJWgpxn2SEgsxo0BNRx1!W&SXPC7`rx{80%GPtB?6jQID4lqzCqdRScP_WlB!%3j>V z55P^Tfe1;dJIKP%%z>?fI(LY4`~lj)JA+4*BMiYOXXm)%WH;Qm3um5ZivW~qamE&B zCU+b(4VJj&;4wLv6m4D~p^@83wbV=r#mdIV?e$Udsa)6MalN{lpwq#rkSz}(pnr!~ zEA52VieJa)$h&~gs${w*8`q48N%!1 zCLkpFFkLB^LMGwjM;e|M?#{yN8@Clz7`?O0LyX47qrn&wTv(Xgpou>kp{3A!G=Uu* z3^{zS@33m6?z#4@g1`d;UJ8E>5iRvR@rjV(+g@t#j~@sit|O6HOBHI4$smxL41Y!a zZpS#njLzT=6|5`7++7|qrQ;%H=6G3Tg1dj2l|iap6l2-Fn9=mx*&$v#_IOqYa^0dC|<BvWX^>^u8)6`I|L;cJk`^_y$2&Vyn+6 zE-uVR_LFsh$5cpn`PSm=4;Qk+ zb8#ZOI^2sizF`I*8>_JTcm36DcnTJ3&Y6e%NRxvOBe%gMERmi*ccc%|I@9TB*ii8Q zR}M>^hQwQ?Guy0U2nDaXTm5JD5_^gVbB zfJ}elVLVOP9{fq(o5WtlKN6c7ZGO4-m5v)D-DNYksrwph+n0uSdZ9 zRf$7Tgj+L*RvUg%SY=?|O2VtCZAeNTRP&2gOtfN9-3t)UoC>Ch8sFmhV_&*rD&SDl zkG=?qtv!+CljBaa3w-7l`FzxB1MukGRvk@=6f2#*7gPM3)jw)kwcMs|%V|ml)LQ)m z2`bD>gyT;l0_G|Tmb=QXM4cTMudZ($ydK4Ret7+j!+t-V7{=5#u<|k1{1OrCe#Oap zg1^WX-{LlEpOhf6+E-n5a&P-!OLek$|7Pa`uyx#i%2l_IEPmF9YVfMP0m{^k!KS2-)NbKf~IH&={_o=EYWP~&zC3xj}?R#Xf%cF@cT z2`$zRWg0&p2agf~B??vj+~-8u!0$j3*J2VIB@#>T>NaqVN0>+aVfM`A;e6v7l-5Tk zRbiEI5b=HJ=g#Iz2!^bcKP8cjjbi2CWMvDVls8A!^>9OxG}apnk{>%Gc$DOx-(@#! zZb_{%*>v-aJ1-+@0mn&mOF$V4*iHydiJOq+(opzlxg!Z=*tu^oD|+Mr^A%aXi_T>W zVvz+?R2IHU68Xv?u;Xj6`!Nmi=|CiMq-iP+^6f<7H8I+XI zuc{|ZtE?E9R7tmAL%BT7%6~*jCz3^elYYrttV0Uj!JI0&3;A5>RQAoO><=G16(ev0 zuhNce{SuOXBQw>HRADhmRsxDQKW?V7sr0k`tqQ`%L9_i64*hIysL zKC@0NxlU4VR>~y$3_ZwGN9^0t)6=yVEMRf928X#v9MOX|cVgj-}INV^SfHNB~eTme8+gL;!hzkAVoEb&Y!X z>gWHxVfc$H2izhYdZROgVfB_X`V0psK~GgEM>Z znoj{u3{P@rhXxOx?3M8E9PKKQxeqm3=5VwJ+iB_NtLraMrm%dll|&YMQC&gCNV9mD z#lY(nDFJB=^`|ETk%KCmYN;6R2Qt(3r%Q%Zh}@G1v(6tr!SvIV&-Dp1PunQw$I$>@ zTnx?(O-5Tr^01DNAb0dOv;IhrkVK0Ha!Uyb`$<9b4zRhRw&lEmIh+&(FZ1~@qr|eA z)!ZGO^6n;!r@A9gs-SxmN4m3d?MZBH)u9)cdHL?DLk%yHySd&E1j$_#<*i05)#@hl z8{eIc8&r*YNqw|H^LVFsiq)4o*L?=zvau@0wo1p>6`K0kLiI0$#9f|bZ4XU3*B&#P zW<5k<%tO(IaYC`50If7(=?>_XVw`wD??%2)bwCm_d>qq8VbdU9#0asi5%2N}m-z$D z5_^ZqsQiim0siGiRt*wwj>wQmuk`5~CMHK-z2v2H8{FJcG2|kCw9t4Zp$^(#{iSMr ztXe~bxDC*MtIw1*0vo}dP>DE{6s3Q47hiV&#FamWMt!1NwOROy{OZ40ViZ^RDbm|B zO+r#pLIRwEo|`WZ3@o=N1+3DOEetdnJ!QUa?yTNeRFan$=EoVUjod4zD-v^!HuNAU z@Gdk5uWSfSFR6U7_tYUp2M8np+69%%!yXAS!=nW^I5^1WIgN6Y;KIsfth8=eWd!{w zqWh)CBS=GJG3IL+!^OaKxGBkak;{;P0YUQ*>}sWQ{LzpT%y-e_%jCNOaz9Ad>F|0o zLN6ui>K+xW*8E+YcOnrUm1MNXx2vrzN2pl|P7T$_9|p+lvThqU(bFr#!A=V*Hkpt$ z<7)B)kC+-Z(WyWB*%1}tuFUs0Z6?9wf~I|Obir5qB7dP#-y~Ke`oEnYqb7{H9b@<` zR~qRCkuUAYEp1(uNq5V@Ju*vZ;XMer{c_xDFj=dXf)=4QtWYlXfen;}$_7Xtz^Py( zwF~FIf|SO5g(RnmF+*bY2=UEv9Na_jU$N4-p^Uvottx=~>k>&Kc+ zge+G=Zph+Xo2Y059b|;oUL6tC2}Tsesiv1#g)hU= zRh-~0Xy}`8Bqko37&Jr@jvhsZBntSvacrk&H&KG6J%nV9tAJM!I3*SWt!_3Ftili! z!YRR^Aq7?l`U(P?mW9G3fjASe8X5#Y%O~-%&I3zifpm`6hTsY5hFzZT0Lb(*a)pQYuGex6LV!Lg><^9Yd0!zTvfr<1?wqX!z|Qnc=UJFyR$)Di#>at{`ZZ(ZM_ z3N;{{%YNl$i*fb(4(6jDq;zFW>c5DKn$LX^fB*C}{S-TzHIn&;s=U*W@ z_xa}0%3ZQ~;ZPwVp<%3`6X#R)=1wCAE-dB!WkQ;gJ-u@VXnD*9W`skU`j=$w`Ftw) z1q7+mRHIfq&2xsKj{G!0En~5;vfA%Gi;^mAiFm|91OziVYBccyQ5-=6OI_tq;v>RH>)-e>QVo1;83RDpmoOQl)2RPiN$ z1v!=&P)ns-ze{5!_^zmO67+b58BObeq9wVK|V z`})Ci40|Rc$*q&zxbY6ZcC+?&8950@2y+UODG10=;Kb!}X%y_T6(DAZ5YXb$sHO|U zR2{ID-AP;{FJqa*6lkT)K*h(2pc_S6Ja#@)W!3ny{6rDmgjikshEw(xC2Gjp{X^^I zj2u1kvz7MvaQ9gmH))*;gUK1I?me_S3^{kB6A=t(|Hxz&{u6~=v8jJBcYd&ag_U^a+IZ3wfShh# zI3P04FCY&avO5rqA2W8}iKs2o7a;~L?Q7vD=7rilVP5O{prR1wi4Uy_m$)>N5<|Xm z+7F(GoTeg}YB%MkNZ?my@@F^gj&3E%>%PH-EQ!_$FoMyjaPMgI)a$y%MV{vm_3REs zhQC@-I06EeCqI_<*#`BlFCv+j#=BHusicj+v;+YlsA?W{uENHUnsP| zL=KdYG)AY=HU0soOl2b?$pY|WM}+#U7YK9E%|*O_JTJ|lg_E5<;oLx?0wnnOLp^e| zPdugvLOzmXOhg`n+z?+IK^Y&J4xQphZ#2v`;}IwCANyl&4?;}-F~=xFn$ajW<*>*pNR?HDCjWoFlK)B zs4Mm@IttU(*s3lc!DlPVB`MPe$61w&eA91rps zL4On{?LM&?bRrgHe70;cI2cTL#p*3JS~LZi4U9kn2+jly8OvR}ma$!#gcb5MQD1xr zYD#sjTn9)3VI#|1PGdR>Teu1+(=hC(nIRDObRU)2YC&X@Hb0b3a`Ez%hE&0Oc4_T~ z*aV2Pl9=m&TCGFW>haVyyAMbx3tz7cr*ZSUr>$R~KwE041i$cFs~lIILyvHg{S zRr8CN#VfCTd==CQW3#|rkVz5>#FEy*12q^rpnBNlg|xPwKEiv_s8MRnW7Z?);P+xq z$&R$BB9n-4Y=Z|P;D|@UPpgviIo#35waGxl`vKF!-2&!{j!E~E6iprvSLBN7`jB-s z*g>!hic5|`{}QOPA{|s=ds9+u`|Es{=yA3eBQ<8VwdhFTfqec$4pD9IIzA;n&bk8? z`a0UZcGOz5jD;4<#dayDoTVL$Y=MqOL74}Un+uVU2Yc_e;rRCnHqJyziBIDBN$bmt zvTvY^#}ETo;ZyVB(HU}dR(9dEaKWb7P|%`%qS1oyh|N&cLWoy;@msjPtq9sUy2nSF z7h_fOa7atj#ckabJf4p)eHJ6=RkoINU6S6vc&Yn8`BejQcK6||Ngk+$0iGYmPO~9{ z5>OIE+93A#?Kju0yL_{EyX=F5MZ1IOLMQMjx_UYP-8RV=%05Lc&cKh(q^OwD(_EQf zfrZ(jKawo31JeXC81fS#^a)x)t$wAY_$>91i*!>X8k!wjDglG_^ycr?sp_t~z|HdV z)%f{Y(+VYqsMQ+Gv7V*}IG54W=gT(Tpnm95BgamM4vScYpEu$Q0=9S7?2j)6bN!2< z2vBGyJZPTwyu??M|A(xSaT5s25mp}7=(iqbbi=Rd`Na`EP2UA>( zzz6BEHT~l}Em6I`;eWCC&v=smp?CJ;kdubn(j2XQ3(5x~5eZo$p-4iK#73RrZQ76D zCvCdBnWmPn3`@0Lth|3{-Of!#1D1o9k}YHvL@NZ&8t~4sex2lqiKA~K9K?>wo!M%9 zcW%@8{WKdLo)z;g3!B6BWvBS_np!M&iCBbMxD1O_T*33wwv2#Q8^^1DeW0vIoPX&r z0AjWuFR8SL=Y^PQO^Qfp;JPvh3d)O!V@Qb03sOYaV~hcykp1+=#MF>;kfnrYv6KL_ zSo;2)v2{QKxMTurgfxT_lR#o(-7a4KA;@T0Yw$-=eS6vg8YWRV3k6FjI9LcMgyiik z%-Sh%gmIJruN3H9WX!2NS57=vyuH-eq!zHLDP78m#gMa2?f&#gee2(o0qRLfdjkm7 z2hVY&EH{cX44>2ix_lgz9tA(yl^-3s*E?7o<4?KRSuRzLF@GnRcYFSBSMP4OF&t!o zA^xGCB*vV6@NkrTyIeTzY@LbD7G_8>e!EwlZerK9r<-X^e$r0&h_q*nZYs+R_>BL( zf_pAJeTPj|$2Lq%h8%k>A`w81BZXY2o``p&-* z069-xz$!bM_U zInuo8r}f)T6b?d^l=Xvfz`*wbA@opb6QW>eiOvixHIAutwK4m3P3E)Ct5=TGAmQMk ziaU8tsaq<2TmO1?tuHv&Ui{7HC3yXHpAg36l*TH?f>_KEk7^bON#@oyy`-vr_p|DW z@O`FtMCnaNsls;K-r&+PRk>4+-`T7DRI`o&6El~Um#fcfffJ$W>NDx0=yF187=RnB z|Aqiin1D)Qn5kk7jhBX+)$_J3-+i!>Ngm!Ce+tIwVqlFRd0VjaO)h`cRCo}2{Z|6m z#r)btMwtcQt)QMXTsg3JkeY2$?hrxkRU)flOxI)45o$+*t)t70U9wKX^V9l_F^6{C z_HulF?OlA~uWz+aX4e=(PyXx2tA`3cpC=z3J6p9>PNf}{Gp!}~Kc#EtjbKn=C{t5t zr)=?Y+K(wr?h}r7%e3P4aOE`OeZ28KkgF_scYdDL$e)Yz9 zU79>rz~I75wwCTerb#AjnT){FVVLE7tu3t4ml0hDMCfDXP&XXOtw12G2gW5$L_lnp zcUKvzg%BC99Yp5}miVpN_;Wcwv86pl`&tMgwqtx7SH@i3LV9SB?~cM!I&+eCj{op> ze#dN${HqyoHEg*B-k@|{LTi1vABK;MGsosKri9$G+W|1Xc{VV`y{z2pGtASb5m(Rr z`>YZ@=12*xN4XX_n0-cL8T*@Z(-f=6Se0}{oKw>3Es`8T@~K(tS0wsrhK=y!XHVp9IJlk5WR4 zs$^6S1s0Pz0=p|ubJj-TBa_$=#gJb(-b-*H09d*#!^>B`V)*gLagPEMsQEZ;JR zhA+wh8z!b=(>IayKjpuKn^(eywqu)u&iD`*#b&%sE2FRqvTLMF>rxf8aQca&?SQ20 z2?}9*@=Qj<>QhNjq218iOz60pcGYD5(iMf*EG=Mq=TDoF&^c+H*B}OmpC54-jU!|v z-}sAUV;fBAl`xwMR*ewq<6op)nU07qjtSTd^L2cGFtu8-*wAhjjfB}ncl;a=dfZhs zV#KSfy5Tc8vO0M|IVP5pQUTBYHHxhA1of3q5lcNqr=hn3Vc!b(uV$U_o?y!@kwBWI z27pcBKii*>>8ehuHFw*Y6S(B#`|KZT6gY^}X`!YD-9IvF+X=gvxxq3v2|LWou!0>8 zda!2OkjPL~nlCO$^o}Z}jAZJvyjUsmP~FpDBC=^sHG%YU&$T+HE=bBrjQpARm_y-S3593_Q=WvIUCE1!MA2Vi3T%Y5S%6h9|Zx=GGp zZ(^i!7VGyz8D~eY@)HO_%@=dga1`E%qixX7Jhhy`D&(xm%$Qw8iE^Vh^e9)5$1NOq z-~RC)@$~%Mhk0L_Ctcm%$?@X`)U5eXY_WqPaRJNl$cA-%ziZisgB%OB)>Q)M9>TUF z3xJfF-}=Xuoq+o4$C%8Xd^&QwjmT1Pc|kcNX=*XdWb!iBre9R9p|KLRGaIq#H;UPr z4@C-mV$?O@q-lVfeUn5IK-=4UIvmlTJ}}3Q)sMrJj7J-3jzKrDC!~m!oFS*{1A}72 zBat-dqYDqh!R=>_#$ceIZ&UWSs2*vm{PF_ygkg789Aho+faU`tiO3@60dgM^;?4CQ zIVpUrh*v)MV(mb`A0J5d$z-EuoHKFzIJP7*>_*KzcR`l!|Ehkqx`zaZ>N!l1nP5|- zvSng&ZtV{Vj{3RMqr%wmluY=*M81U@=rJOUPE=tK2;6s$+AHNmdYN5~_OdT7Yr|5LCbrP1W1v8Ca6Z@q(RjU&`5RC5^R#mFx%0roTHSSM30!{ zdB5g$xZ&Cg+m*v?b2l9<`IjYHl7q8^h`qEO%%TYo2dCU{qVuT3`#cOmCqW#I3U$oyG!WCI@%9ola^LSZH{8+?e;O#}LATxd7*wpTatlkI< z2(*+(g7%d}hQpugLWasE(}rL`u^5FjCWGcvKo=cIbXP3^6Em}@ADSQ50LS7-BYEDv zwJ_v0q>&)!$&)58(rvk?W;x)gw!oWn_S`Uew;u#kiCy;lC!*eLSuu^R3WGd3GBk~R zAHQ}jcD5UiqU%J^MQ#mmN@)#c&}eLSL(YR)gWj)Gqq1LG$`W{2L4FWA$aCSU(rPX^ zv95vJ)-(a%L`v-WY7NVJJ}8$)_11L^+4AR+Ot;L)b$ikLjSn_%G}qS5Qcovv-6$ci zL;`mCOlg$rL5hO@|0r-3!>oPfI9brokg=tF@Kh)(E!_Ut4S$k7K539%8hTdj=$23xZPnU z``b^2YO85uw?S^gfND;48^*`)GE$z$Q$Eum%7aPcl!j%baC#t&sVeD96wsBRafyd_ zY>Xc{9V*R*43~6lw|E+El32G7i5Tg6E;~T#3?m0$=;}K8Y9Kc2b;0}RYVW2cU-_Ji z5CJm{XBQtzWOp{r8w(IHZ!@9^OXr+2WOojI88VFB=(%NZkTcAm`vOA!f(w1m45ox3 zgV_LZgf8=R2)>Z{I4LTSAD~47F#+=Z;pK~vz>VBn2%Z48u!GYKc&Bv^iRL2AkxS}^ z!&t#ji7I(gd|A{=IFOUrnRGbJ^w5!gZw{N+umbnRlU3g1!a?Duft2ZVlzOkW`SIlP zH|Z-7lo)b*L2kHIlF)1F9$5$$-Y`v-hL!3i9yB@bTyx!5uE~BkK?0hkKZr+yfNn~f zyZIC{Pfy%0&bq?3`UK44Wb3bm1BY-dHj($ZvHTt{_fsAV^ag*Ty@t@o;9?A$Ti*4Z zOm`G9H+OCt^9ZI>pUj#cDyh(sG@h?~p5=~#K8@>{p&_;fNrgI{5o&pJKT#>;5J{F> zv_D2UhvzE{#hfxW>ZBVrr^+_$-tC_^5?yvwSv9;WpN9V|D>@c&3Pd&jl!_lJ(M6dK z>$Dn=jPx8H2Ur*$8vUh%g^do&@Qak*Vu7})?yBCo{iRqPEu9e%M5 zAq8u8VSABkb6rE1tB9X~N}(F5pCp16qfc%FjyGauaGWJK>F2U(g?VVax6d|&nAoh}IQQ$wZmAlfB z^LiLyBXizyWuYSepb}0$aZ0W_f8R3S=F_?Uvp#Oc%zC&m=lveo%Xh>EE)?E3I<-(V zam)!OUaL0G+*MsVM&i8`&TrfjAGM4E)`k6ZW=qNBoYBv-yxzSh2t{h0sOCtjd>A72 z^a)=}@xPpV4ZDh@P0*HE9WBl+A_e{g>>l3G_Xg-(h8P!RyerbV?8US}bK{UzABdJvQs7hKsN8R2sM2a8LqMazY9B-fWG1S~6t{@UK6WLO@$x%L$)LT;Ppy1C z*ThSI6V&vu9^>s^@J%m_J?-Z_0lDb7ER`W3uO&pf&E?c3b*LQ}cJ zO~0+Ip4KI}Ci?BuV4li7!MCuPn``fl49w*XEHxbvs%NY~`?7)JDU3&R6qD_Eq?vaks9kH%NU(WbsD9>nNV!TRfYtxu+3JMwJ z=*D>JMk)~~=I(4kgbM^+C53|4lt1%r;$G$>WvUE&LYy5DGi;@|kyC@WS&AOvDR|PE zB2o~rVcSzmR#*BG@F4wVRs)US4aL*_y<58a=%2VQmE);l$yC-v8 z^@m;vjT!%-g(4CT%Oy)H8ZMD7(a#V88!U#|mhaiJ>fy^fdwVfpjRaQixS#SyW`1l5 zzoth>qN)!OVRxME;^0a(-!gQ@;i#s}Bd^>qD@zs&8_5ZJU2 zf#a!_0(_7+*LJ!$oJh4JM*>_OKFM~IN|`_PxSSU%Kgea)DTxNUXx((^{uN68eHyyi zw?^DoB_AEEX`H@7o6_t_*lI$+L`gR6n;mO6aor_M7*3>)x7|9@14EyS56vjsR4(&D z-u?Tp1!_~%@JE^|Su&cqpG`lJT94OCq`U$s12ztMQHf)scXYud1_{1rv2TI`v&{7C zq>`Zt!^S!BVoqStRfz)0n)P{cOHi!^&F&OTH}bW2YqS?dJkh0)bjwvn{J$|c#6{5n zYp_jJDI)Y2chUPlL|8JL@@|y`w^ZHORc$^I1nU-5JsQ2*pRXK!6#m$!$_AAM}GVM7EFunigpZ`#?P8(e-prbOyAWhPz5#npzX+uCmCodJ>%dV=8qRUI%^_%=96~Pp*=f)xQF*?bs zXo0hKc_Huze`FnNzgkh5wZ(f*NcEj*B`>_n%gQXG3SQMCCBe-t8qV7Wt@WrPm;H6k ztK7AYllipw9**OhMir9YJj+M0dxg~XvPxPc*kL1K7iLGF)*N@I=nrDb0A8pP8lg@bCyG z6AqLVle7U?1f60j-aJPRg+_bp*_DT%<1Wdq^Mx+4O|t|s|KU5axh7ebf~ zUxH8?0beC}OR&Y&E`O2ct)%cl9vx&iz(*PaGd`$4v}e;x1PV%&b*bx>PdocDu+h*f z?nxL~f+z-SnYE=>7@n$vUovvd+wCtt|8#x&e?Ne`N_UiOEmLL|GuZO-0Vzh)$x`>s z&=0FeYj&7eXf}3)S9CML&*3SEYEnSuE`b0AJ(}rDJ}w0b4j&k&#hXGBE6E!xZ@QlItONj5r*qG>w@|ZS&Z8JAyZvc+f>T{=VSJ% zZKipyi-SdxGE=&^Kp)q_dS0dq{f~3*YF4&;h1@dUQ?(u7m~+{LqRKt-bvoVNZ*rJ~ zP;v_mR7u9v%z4v=FLKS)(-2mp?^_v7@XBYDyB(O(p=1mtXo@0J{*8PqwYhbWrGen6 zc3iU-QwqaZ*AX#MFSOn`oak4{OeF)Pu&BAX8&x=b!Y&6Z<>>KMg-Z)Ga;2qnyv`2t z8yzI&V;+=U^}XX|bs-$N?R`%jpc|NtARr#hwowsSzefXS?}+6N!Vk140u%Vo3if(Aq6)cF2h!Wm!vsrz-%FT)3v3av+Z-9xzlv+iB zB=6fb1bpNYh_f)GFa8u~U`iS@a_@kHy`~E0K};oYeI$e*LUT?OuKqvn}z> z@Mk`6OL6aQQG{bZWR9^2#XS-d0htKf5S{(kZHU{$wDSd=PkLhoGb8Y;<6-7&0s?lg ze4h0pfzJ0Y^>`<3}yPPnhOAp~jGNc^{BE%GpXUWRo+t2l-54FQUO0eedr_;N^pnQTC^Hq_M0DDI>+4L<1H9_YS(~)T8wI0v%!4woTdSBl~GE zP-$naqxau22J9%qlyc(_Kh>~oS4JA6L2R-Wk?_dEBv^aPc1s}Ui1rMcX3tk8;!v$8 zWov8i)(vKYs8f+-_;fixSZKLyj9~Bf%ivH;I9{K=oWWvgx74ZGtU;~eNpF%;QCPKC z@l^ORuQDYiOH~h+bK!Z2fv#%!dGPt+l}{#JQHWEx!LVW4NSaSR}OhQaz^F>QCa;N>X+2DQc zu*k4Ya)x%Tko<5X`yg>ycadXaM4TU!hsI(&e^6z>(dFkMIiSo^C()L}I_P0cXSMow z<9?~|?ypMTbZ2Z}=AxCEhZ(9vk9E-G6$#sM&}SD+8iNh1z|6^nKJL~mF=ZDWW8!L- z^u9ifRll)ztV%60u6xhpW5lHQ-Yd;$=Jxrgz?IZuetb!E!nCDzkm|^exKa7olDmP$ z?4sMMgB`Gsc8vWqvx|ZE9l!Ntp67fyu^wxk^pa_x^_a40e}9=lzmH85}*&H!+VdcGI@;=r#^YDoBCLHTQ$jA8F z(&{{{!xYkf`e2jJ5F`dL=C->KORPAh)tea;GEX<)Vl)!0!n>~clXvWX5upn z8$#%b!p5A1vxPDSS0P~i_D5}3L){46bOs+jy9$fgnV8}epvWCxFL4yq35kOz@+gV=j*C4{J#xjXgr;swEBD95&?5T^!KDk!pgF;t5Q zxw+w>{T{yJ{7#rbpZk?69?PRIDc~WYf%gtf#c}Xv6ERyv{q(dmZHGD+dN!Iq*+Je; zsXju_H#{IG5!?*m@RCGc9q00Xf()M9!mIpzq})cWH0%z1HZTymA$)uSP!NoKoh0b{ za<1$ApPO#{uX4%`v1syXx<74ApZSK9%&)47GZKL$-P;F`DyoSXiEocxz!_WrRjlis zu2EH?e$nq6y}YQ$IvP|)!CyW8)~`zZ)vk&tXtEN@Zy5oZ|FFBL6^ z!d~SHR|!ADzbWGJeR{OvXc~K|F;|eFW%`ljZYf1j}u?bE>P+TUq|fzB$42SnL9lz)5}Q4k|Jqr?uv|D z5RVK2K4WF=;!KN#pR|;-c>u>bwA2jv9$_gC-N=-^U0|ZaQk`Nhnj){v7RTifZ~}D; zsyl%|+1+ecNojt&VdGnaVftq7JWtyRrshvssw}7b6&s) z6BQ~6t$0^Yqd7`9ItB$4UKW{~Gh5;%XYx>O7t)DUD2s^5Y~fYqIJR)82if#SNzE?o zXY=!kb+k(}BF7AzG8#Y4{qm^59FY9jKAP+d*td?43vS*QsT02e{I0)yeq7GuT_4o* z>+K`6rwAceG5(>SDiTbn4WtZ9H<%mzj!W{vDUsU)(J^&c>kOpb@VDf7b5Zi`=_lXbOjwi#}_Zh(S`42E^Y1=wDsXse_|AN7B*Ja z|DrbiN1yr8_@QdA4v!+g)EXk#Ti`iSOjA)rxm=o1T9~}j}kFV{9`;ndKhN}+GivaRmE0fu3Asc z2!f7bRda~NPH4^x!w-6JFEe1|GLRC;`xxiCG`0G^XZd$)7|{9_hAGqzqP&?_gQq&-v&wO-~!GBg@# zdqP96XkiZhwmhI4xhqKe!lrj{je+Flpfa{@4ET{f18Y2e2O7(@z9L9?+Vy+ zqMQ|}ALuF-G|Y6Qw!i}A2+Dvs=K&qsT5^VxiDd8Ap6)k-(YOW7sR^$nX4qRB(RlX z$|mcv!IB!+=793J`&;Pwmh<@W36h>qbJb#@78kqT{I)fIQ0Q^Xg8f#z71HU}yx+yi z1COTn+;uc5$n8)3b0cccRcZwGgmUiF6lowFhu!zgC%|S}^qv_y-yvgVMHdZ#Evkyj zjWsczB_}0=MyA4eLkxfn$0M{>Nhw0d1fQ#9gr`&y?B%D{w16>#dLjB~C~R%_sa1@N zS%*|!)?Iy1!n1^ifFEo*dGg|R!SL87#u6$Vrm}M>7!Z)M^61t5nkcLvzsU^-NeD0c z;^UhK`l9p5`o$NNv=1gGfx%v(N#G%`FQM&{=y1qy5*DYkhfqpZ*&Zofi`=8P#2~B z_4Csw6*)Bx%9TWo5?|~ch0grC3ru)nGQMz0aY!;XfMYWZm?Wsr(}07J^`;{GsvoW8F*Z;8s=2d(9M7 zDe};Z;>gm$s9AE|SNoI3t`3O#x~vV|2Odq;T@bPt&{DKGelonV^AS3LGU%`r(#Um?Fgg*kYJSFuX!QASPeTrV2DE6tDP&3;lP#t>=f@BFksbsR&5>eu z&_5BiNZDWDX0TBoo9o47oD4nzWQ3#&L|Nb=)V&;E0$OF=1$r06j(2|cdN&GtJqbVo z!$$-Zo9{N)5X^uc+CSAdcQ7mlZgW0qV#YD)c4Iw(iU8xf33r*61BjYLB?=an129g~ z3Dj@;+5o|(-Oo5$a&+T@8?ehoJ<*B&b`3e8ca^-kPY;c2p`DZ=!()k`7AmxMm?OuD z{M|yPHrrq2XJ2p|7`Q&WxX$--TFIL=rvYGApL5MOy5ZBQ$I`!t^6$E=fBrDAMa|%} zsUc^>tZu33eB94{yU{~n#V$Gs=B4ZTialXwC~fF;svUR3xoJIaz)8O)b`A%(zVh;; zu__RU3K1qTG1M6D}GsS_rf47+hB&v^wvLO#E?LW()}D}p~fSY zc>8j4(_Pyy&bBPj!}*<`>vb>o*7J{fv9qOyS3d3RW5E2UUOXUkjhbtPXyFlIdA=aI zq)HsEg3|n7eEy?A=D+g1yKG0!qe)M7JVzd`n;P?%%&vFtCOdc4ssM8U;cNp|q|C;F z-ZLsKp~d2Y+~T|fkb}zFdd$9-s1p5l?L~kW5M)up2>dUyU5`awgT-EU*U$|q|CoHGa6I1m96jGS;Z5>mFtNU@M_7a z$jwMhn@%)%aU=u!-kEd8@tEg0U&y`k$z^s0R%G^~K4saF7aI=G99OE*M6#OEA5CQT z|9yVrUnL-Hw;}T`>3jJi1pfzII1B!b(x}*Ng>NGbRJO<=tF))ko;!dxToMV*BEpp_ zofX#5D1)C4tp)~NKAbEVhy6VwFD3DoLh`^3{yZ0TVk!EVw(@-o%Toj1TDI z^1LGz4n<%R_A{0ELCy&+xb^w@u=G)}6bJ3+W9HiD>kOF*mk;m4>h!Uec9Sd<=Jd{@d{c{NL$Sx(Ld*SnKbuKL&oMaS~&v(@Ad=u5J}ec$J?;;2dG(&Fr{P71(yH zb6sPn=*e+mh*@7Y_YVyd z$1N45(f}~;h#&kX?WDoB@@~qG*m3CcfWCwp1mvMHZJxxrDGdtqfB+c(vIx3z6o=#$ zgOlzZ$0#l%Ob-$mOs4tFdXj~%e(khjlF!6}?STSc+S0q{aw^*=h%5OpLJ5f*&jEvL zRb?O2gAW%+33nEQhUH00X4C5(G9f)uw|VhH4stOhAr3i%Yp~)ZiQqBm-_>AgyG`|x z?R%B84CVEVZiKqM@_Ck-17@##UZl&5J4DMOwgV332F5iEy$z&&D{Ol%?WYTxy!aTI1^4_Y0S89OgC;`-k(t5-$&e$W4gI$o-Nb&E4@S z^F?4d85Uh5bf>=I<bNl8s%0 zs`sfSR-gF#nKEexr$KaNwRrP#^b7l~R6QW|MJGT`rl7Uwu0`Dg+2Z z4<-JRl7H}Cp_Xp768MnyF*+PI&XtlM@nK_R)T$(x?UNhv;%;~NW{$g&t&rE|YG~|x z(x_=QK4~_Xs!kqR@wJv0kNOB=N-rCVdzNxj;bT;KN@EJgQ(z$Qut?fdjIHV`0&XjX z=JWHbDMxG1ZS|FBcBxExpw8biOWDMEBg1roDYQ{d^B<|HViF^hsM)3n_DwHMKo&w1 zNdxC29*7)tN4!$1_y)@HpZIvER&)5x=8qWBYoe}R4vujrl~(h*%YIU$CQ6c|jo6Y8 zg1UZ(m+cFUCTX`0SLDFztwe-Jo=1P#nw_8i!vkI6%b)o9K!^j7c`LVcKq;tgEE8B| zQ7u4X!kZ9VSdYT-ALLitnnHfBq(QVAvEZj+CBSSNrhuu5nS|qi&0uQbB$XH(s^{A* zWSFVgCb3-+3%zrt-i^UDQckSXDm*)K15eS552lWRbYaGdQbjKLPYQ9#ZHh4t&A1mz z1=xp13(}O63*U&7869mOJd*OVCVA1X4FM|L%v-aioeW`Dn52TO zJRiU2Usdm>_XRzy{#ktZJjf>tSzR3IBpDfmUf@3zs;HeqgkGK!!rxk)LZb4Jbe)gV zRZuve5VLil+Z=|oO&e2GkY0EdheO)h`J*cpiREK_Ptxxw#GmH=J(chM&=3}AE2nlw z>N~+9gy?1t6c?V#7}g^hJQydXCUK+vqeE#APV6&0sL_E>J>@pyT)9iGAQE1!MAIhtTL8Bd7i YB&@w@u<1882gG$|!}-%ATuhw*1%nEsF#rGn diff --git a/demo/stream.py b/demo/stream.py deleted file mode 100644 index dcd4ed3..0000000 --- a/demo/stream.py +++ /dev/null @@ -1,55 +0,0 @@ -from argparse import ArgumentParser -import asyncio -from dotenv import load_dotenv -from lmnt.api import Speech -from openai import AsyncOpenAI -import os - -load_dotenv() # Don't forget to add your LMNT and OpenAI API keys to .env. - -MODEL = 'gpt-3.5-turbo' -DEFAULT_PROMPT = 'Tell me an interesting fact about the universe.' -VOICE_ID = 'lily' - - -async def reader_task(conn): - """Streams audio data from the server and writes it to `output.mp3`.""" - with open('output.mp3', 'wb') as f: - async for msg in conn: - f.write(msg['audio']) - - -async def writer_task(conn, prompt): - """Streams text from ChatGPT to LMNT.""" - client = AsyncOpenAI(api_key=os.getenv('OPENAI_API_KEY')) - response = await client.chat.completions.create(model=MODEL, - messages=[{'role': 'user', 'content': prompt}], - stream=True) - - async for chunk in response: - if not chunk.choices[0] or not chunk.choices[0].delta or not chunk.choices[0].delta.content: - continue - content = chunk.choices[0].delta.content - await conn.append_text(content) - print(content, end='', flush=True) - - await conn.finish() - - -async def main(args): - speech = Speech(os.getenv('LMNT_API_KEY')) - conn = await speech.synthesize_streaming(VOICE_ID, return_extras=False, language=args.language) - - t1 = asyncio.create_task(reader_task(conn)) - t2 = asyncio.create_task(writer_task(conn, args.prompt)) - - await t1 - await t2 - await speech.close() - - -if __name__ == '__main__': - parser = ArgumentParser() - parser.add_argument('prompt', default=DEFAULT_PROMPT, nargs='?') - parser.add_argument('-l', '--language', required=False, default='en', help='Language code') - asyncio.run(main(parser.parse_args())) diff --git a/demo/synthesize.py b/demo/synthesize.py deleted file mode 100644 index 1812239..0000000 --- a/demo/synthesize.py +++ /dev/null @@ -1,32 +0,0 @@ -import argparse -import asyncio -import os -from dotenv import load_dotenv -from lmnt.api import Speech - -load_dotenv() # Don't forget to add your LMNT API key to .env. - - -async def main(args): - async with Speech(os.getenv('LMNT_API_KEY')) as s: - # Get the list of available voices. - voices = await s.list_voices() - print(voices) - - # Get your account information. - account = await s.account_info() - print(account) - - # Synthesize text to speech. - synthesize = await s.synthesize(text=args.text, voice=args.voice, language=args.language) - with open('output.mp3', 'wb') as f: - f.write(synthesize['audio']) - print('Done.') - -if __name__ == '__main__': - parser = argparse.ArgumentParser(description='Synthesize text to speech using LMNT API') - parser.add_argument('-t', '--text', required=False, default='This is a test of the LMNT API.', help='Text to synthesize') - parser.add_argument('-v', '--voice', required=False, default='lily', help='Voice to use') - parser.add_argument('-l', '--language', required=False, default='en', help='Language code') - args = parser.parse_args() - asyncio.run(main(args)) diff --git a/examples/.keep b/examples/.keep new file mode 100644 index 0000000..d8c73e9 --- /dev/null +++ b/examples/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store example files demonstrating usage of this SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/examples/create-voice.py b/examples/create-voice.py new file mode 100644 index 0000000..f0daa7d --- /dev/null +++ b/examples/create-voice.py @@ -0,0 +1,13 @@ +from pathlib import Path + +from lmnt import Lmnt + +client = Lmnt() + +response = client.voices.create( + name="My Voice", + files=[Path("sample1.wav"), Path("sample2.wav")], + enhance=False, +) + +print(response) diff --git a/examples/generate.py b/examples/generate.py new file mode 100644 index 0000000..04bef0d --- /dev/null +++ b/examples/generate.py @@ -0,0 +1,26 @@ +from lmnt import Lmnt + +client = Lmnt() + +# Use streaming response to get chunks as they arrive +with client.speech.with_streaming_response.generate( + text="""Okay that's the 4-piece Original Combo with coleslaw and iced tea, and the two-pack of Nashville Hot sliders. Before I get you the total, uh, have you tried our new Peach Cobbler? It's warm, got a buttery crust, folks are loving it - only $2.99 extra.""", + voice="leah", +) as response: + # Collect all chunks and print when each arrives + all_content = b"" + chunk_count = 0 + + for chunk in response.iter_bytes(): + chunk_count += 1 + print(f"Chunk {chunk_count} received: {len(chunk)} bytes") + all_content += chunk + + print(f"Total chunks received: {chunk_count}") + print(f"Total content size: {len(all_content)} bytes") + +# Write the complete audio to file +with open("output.wav", "wb") as f: + f.write(all_content) + +print("Audio saved to output.wav") diff --git a/examples/generate_async.py b/examples/generate_async.py new file mode 100644 index 0000000..676d5ce --- /dev/null +++ b/examples/generate_async.py @@ -0,0 +1,36 @@ +import asyncio + +from lmnt import AsyncLmnt + + +async def main() -> None: + client = AsyncLmnt() + + # Use async streaming response to get chunks as they arrive + async with client.speech.with_streaming_response.generate( + text="""Okay that's the 4-piece Original Combo with coleslaw and iced tea, and the two-pack of Nashville Hot sliders. Before I get you the total, uh, have you tried our new Peach Cobbler? It's warm, got a buttery crust, folks are loving it - only $2.99 extra.""", + voice="leah", + ) as response: + print(f"Response headers: {response.headers}") + + # Collect all chunks and print when each arrives + all_content = b"" + chunk_count = 0 + + async for chunk in response.iter_bytes(): + chunk_count += 1 + print(f"Chunk {chunk_count} received: {len(chunk)} bytes") + all_content += chunk + + print(f"Total chunks received: {chunk_count}") + print(f"Total content size: {len(all_content)} bytes") + + # Write the complete audio to file + with open("output_async.wav", "wb") as f: + f.write(all_content) + + print("Audio saved to output_async.wav") + + +if __name__ == "__main__": + asyncio.run(main()) diff --git a/examples/speech_session.py b/examples/speech_session.py new file mode 100644 index 0000000..cc7ed97 --- /dev/null +++ b/examples/speech_session.py @@ -0,0 +1,41 @@ +import asyncio + +from lmnt import AsyncLmnt +from lmnt.resources.sessions import SpeechSession + + +async def main() -> None: + # Gets API Key from environment variable LMNT_API_KEY + lmnt = AsyncLmnt() + + # Construct the streaming connection with our desired voice + session = await lmnt.speech.sessions.create(voice="leah", return_extras=True) + write_task = asyncio.create_task(write_messages(session)) + read_task = asyncio.create_task(read_messages(session)) + + await asyncio.gather(write_task, read_task) + + +async def write_messages(session: SpeechSession) -> None: + # Simulate a message stream w/ a 1 second delay between messages + for i in range(5): + await session.append_text("Hello, world!") + print(f" ** Sent to LMNT -- Message {i} ** ") + await asyncio.sleep(1) + + # After finish is called, the server will flush its buffer and close the + # connection once all the audio has been synthesized + await session.finish() + + +async def read_messages(session: SpeechSession) -> None: + with open("stream-output.mp3", "wb") as audio_file: + async for message in session: + audio_bytes = len(message.audio) + print(f" ** Received from LMNT -- {audio_bytes} bytes ** ") + print(f" ** Durations: {message.durations} ** ") + audio_file.write(message.audio) + + +if __name__ == "__main__": + asyncio.run(main()) diff --git a/mypy.ini b/mypy.ini new file mode 100644 index 0000000..ba9a000 --- /dev/null +++ b/mypy.ini @@ -0,0 +1,50 @@ +[mypy] +pretty = True +show_error_codes = True + +# Exclude _files.py because mypy isn't smart enough to apply +# the correct type narrowing and as this is an internal module +# it's fine to just use Pyright. +# +# We also exclude our `tests` as mypy doesn't always infer +# types correctly and Pyright will still catch any type errors. +exclude = ^(src/lmnt/_files\.py|_dev/.*\.py|tests/.*)$ + +strict_equality = True +implicit_reexport = True +check_untyped_defs = True +no_implicit_optional = True + +warn_return_any = True +warn_unreachable = True +warn_unused_configs = True + +# Turn these options off as it could cause conflicts +# with the Pyright options. +warn_unused_ignores = False +warn_redundant_casts = False + +disallow_any_generics = True +disallow_untyped_defs = True +disallow_untyped_calls = True +disallow_subclassing_any = True +disallow_incomplete_defs = True +disallow_untyped_decorators = True +cache_fine_grained = True + +# By default, mypy reports an error if you assign a value to the result +# of a function call that doesn't return anything. We do this in our test +# cases: +# ``` +# result = ... +# assert result is None +# ``` +# Changing this codegen to make mypy happy would increase complexity +# and would not be worth it. +disable_error_code = func-returns-value,overload-cannot-match + +# https://github.com/python/mypy/issues/12162 +[mypy.overrides] +module = "black.files.*" +ignore_errors = true +ignore_missing_imports = true diff --git a/noxfile.py b/noxfile.py new file mode 100644 index 0000000..53bca7f --- /dev/null +++ b/noxfile.py @@ -0,0 +1,9 @@ +import nox + + +@nox.session(reuse_venv=True, name="test-pydantic-v1") +def test_pydantic_v1(session: nox.Session) -> None: + session.install("-r", "requirements-dev.lock") + session.install("pydantic<2") + + session.run("pytest", "--showlocals", "--ignore=tests/functional", *session.posargs) diff --git a/pyproject.toml b/pyproject.toml index a7b8bbf..b55f9ae 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -1,33 +1,212 @@ +[project] +name = "lmnt" +version = "2.0.0" +description = "The official Python library for the LMNT API" +dynamic = ["readme"] +license = "Apache-2.0" +authors = [ +{ name = "Lmnt", email = "feedback@lmnt.com" }, +] +dependencies = [ + "httpx>=0.23.0, <1", + "pydantic>=1.9.0, <3", + "typing-extensions>=4.10, <5", + "anyio>=3.5.0, <5", + "distro>=1.7.0, <2", + "sniffio", + "websockets", +] +requires-python = ">= 3.8" +classifiers = [ + "Typing :: Typed", + "Intended Audience :: Developers", + "Programming Language :: Python :: 3.8", + "Programming Language :: Python :: 3.9", + "Programming Language :: Python :: 3.10", + "Programming Language :: Python :: 3.11", + "Programming Language :: Python :: 3.12", + "Programming Language :: Python :: 3.13", + "Operating System :: OS Independent", + "Operating System :: POSIX", + "Operating System :: MacOS", + "Operating System :: POSIX :: Linux", + "Operating System :: Microsoft :: Windows", + "Topic :: Software Development :: Libraries :: Python Modules", + "License :: OSI Approved :: Apache Software License" +] + +[project.urls] +Homepage = "https://github.com/stainless-sdks/lmnt-com-python" +Repository = "https://github.com/stainless-sdks/lmnt-com-python" + +[project.optional-dependencies] +aiohttp = ["aiohttp", "httpx_aiohttp>=0.1.8"] + +[tool.rye] +managed = true +# version pins are in requirements-dev.lock +dev-dependencies = [ + "pyright==1.1.399", + "mypy", + "respx", + "pytest", + "pytest-asyncio", + "ruff", + "time-machine", + "nox", + "dirty-equals>=0.6.0", + "importlib-metadata>=6.7.0", + "rich>=13.7.1", + "nest_asyncio==1.6.0", + "pytest-xdist>=3.6.1", +] + +[tool.rye.scripts] +format = { chain = [ + "format:ruff", + "format:docs", + "fix:ruff", + # run formatting again to fix any inconsistencies when imports are stripped + "format:ruff", +]} +"format:docs" = "python scripts/utils/ruffen-docs.py README.md api.md" +"format:ruff" = "ruff format" + +"lint" = { chain = [ + "check:ruff", + "typecheck", + "check:importable", +]} +"check:ruff" = "ruff check ." +"fix:ruff" = "ruff check --fix ." + +"check:importable" = "python -c 'import lmnt'" + +typecheck = { chain = [ + "typecheck:pyright", + "typecheck:mypy" +]} +"typecheck:pyright" = "pyright" +"typecheck:verify-types" = "pyright --verifytypes lmnt --ignoreexternal" +"typecheck:mypy" = "mypy ." + [build-system] -requires = ["setuptools>=45", "setuptools_scm[toml]>=6.2"] -build-backend = "setuptools.build_meta" +requires = ["hatchling==1.26.3", "hatch-fancy-pypi-readme"] +build-backend = "hatchling.build" -[tool.setuptools_scm] +[tool.hatch.build] +include = [ + "src/*" +] + +[tool.hatch.build.targets.wheel] +packages = ["src/lmnt"] + +[tool.hatch.build.targets.sdist] +# Basically everything except hidden files/directories (such as .github, .devcontainers, .python-version, etc) +include = [ + "/*.toml", + "/*.json", + "/*.lock", + "/*.md", + "/mypy.ini", + "/noxfile.py", + "bin/*", + "examples/*", + "src/*", + "tests/*", +] + +[tool.hatch.metadata.hooks.fancy-pypi-readme] +content-type = "text/markdown" + +[[tool.hatch.metadata.hooks.fancy-pypi-readme.fragments]] +path = "README.md" + +[[tool.hatch.metadata.hooks.fancy-pypi-readme.substitutions]] +# replace relative links with absolute links +pattern = '\[(.+?)\]\(((?!https?://)\S+?)\)' +replacement = '[\1](https://github.com/stainless-sdks/lmnt-com-python/tree/main/\g<2>)' + +[tool.pytest.ini_options] +testpaths = ["tests"] +addopts = "--tb=short -n auto" +xfail_strict = true +asyncio_mode = "auto" +asyncio_default_fixture_loop_scope = "session" +filterwarnings = [ + "error" +] + +[tool.pyright] +# this enables practically every flag given by pyright. +# there are a couple of flags that are still disabled by +# default in strict mode as they are experimental and niche. +typeCheckingMode = "strict" +pythonVersion = "3.8" + +exclude = [ + "_dev", + ".venv", + ".nox", +] + +reportImplicitOverride = true +reportOverlappingOverload = false + +reportImportCycles = false +reportPrivateUsage = false [tool.ruff] -cache-dir = "~/.cache/ruff" -line-length = 160 -preview = true +line-length = 120 +output-format = "grouped" +target-version = "py37" + +[tool.ruff.format] +docstring-code-format = true [tool.ruff.lint] select = [ - "E4", "E7", "E9", - "F", - "I", - "N801", "N802", "N803", "N804", "N805", "N807", "N815", "N816", "N818", "N999", - "Q", + # isort + "I", + # bugbear rules + "B", + # remove unused imports + "F401", + # bare except statements + "E722", + # unused arguments + "ARG", + # print statements + "T201", + "T203", + # misuse of typing.TYPE_CHECKING + "TC004", + # import rules + "TID251", +] +ignore = [ + # mutable defaults + "B006", +] +unfixable = [ + # disable auto fix for print statements + "T201", + "T203", ] -ignore = ["I001"] -[tool.ruff.lint.flake8-quotes] -docstring-quotes = "double" -inline-quotes = "single" -multiline-quotes = "double" +[tool.ruff.lint.flake8-tidy-imports.banned-api] +"functools.lru_cache".msg = "This function does not retain type information for the wrapped function's arguments; The `lru_cache` function from `_utils` should be used instead" -[tool.ruff.lint.per-file-ignores] -# F401 = unused import; this warning doesn't make sense in __init__.py files -"__init__.py" = ["F401"] +[tool.ruff.lint.isort] +length-sort = true +length-sort-straight = true +combine-as-imports = true +extra-standard-library = ["typing_extensions"] +known-first-party = ["lmnt", "tests"] -[tool.autopep8] -max-line-length = 160 -indent-size = 2 +[tool.ruff.lint.per-file-ignores] +"bin/**.py" = ["T201", "T203"] +"scripts/**.py" = ["T201", "T203"] +"tests/**.py" = ["T201", "T203"] +"examples/**.py" = ["T201", "T203"] diff --git a/requirements-dev.lock b/requirements-dev.lock new file mode 100644 index 0000000..2854519 --- /dev/null +++ b/requirements-dev.lock @@ -0,0 +1,137 @@ +# generated by rye +# use `rye lock` or `rye sync` to update this lockfile +# +# last locked with the following flags: +# pre: false +# features: [] +# all-features: true +# with-sources: false +# generate-hashes: false +# universal: false + +-e file:. +aiohappyeyeballs==2.6.1 + # via aiohttp +aiohttp==3.12.8 + # via httpx-aiohttp + # via lmnt +aiosignal==1.3.2 + # via aiohttp +annotated-types==0.6.0 + # via pydantic +anyio==4.4.0 + # via httpx + # via lmnt +argcomplete==3.1.2 + # via nox +async-timeout==5.0.1 + # via aiohttp +attrs==25.3.0 + # via aiohttp +certifi==2023.7.22 + # via httpcore + # via httpx +colorlog==6.7.0 + # via nox +dirty-equals==0.6.0 +distlib==0.3.7 + # via virtualenv +distro==1.8.0 + # via lmnt +exceptiongroup==1.2.2 + # via anyio + # via pytest +execnet==2.1.1 + # via pytest-xdist +filelock==3.12.4 + # via virtualenv +frozenlist==1.6.2 + # via aiohttp + # via aiosignal +h11==0.16.0 + # via httpcore +httpcore==1.0.9 + # via httpx +httpx==0.28.1 + # via httpx-aiohttp + # via lmnt + # via respx +httpx-aiohttp==0.1.8 + # via lmnt +idna==3.4 + # via anyio + # via httpx + # via yarl +importlib-metadata==7.0.0 +iniconfig==2.0.0 + # via pytest +markdown-it-py==3.0.0 + # via rich +mdurl==0.1.2 + # via markdown-it-py +multidict==6.4.4 + # via aiohttp + # via yarl +mypy==1.14.1 +mypy-extensions==1.0.0 + # via mypy +nest-asyncio==1.6.0 +nodeenv==1.8.0 + # via pyright +nox==2023.4.22 +packaging==23.2 + # via nox + # via pytest +platformdirs==3.11.0 + # via virtualenv +pluggy==1.5.0 + # via pytest +propcache==0.3.1 + # via aiohttp + # via yarl +pydantic==2.10.3 + # via lmnt +pydantic-core==2.27.1 + # via pydantic +pygments==2.18.0 + # via rich +pyright==1.1.399 +pytest==8.3.3 + # via pytest-asyncio + # via pytest-xdist +pytest-asyncio==0.24.0 +pytest-xdist==3.7.0 +python-dateutil==2.8.2 + # via time-machine +pytz==2023.3.post1 + # via dirty-equals +respx==0.22.0 +rich==13.7.1 +ruff==0.9.4 +setuptools==68.2.2 + # via nodeenv +six==1.16.0 + # via python-dateutil +sniffio==1.3.0 + # via anyio + # via lmnt +time-machine==2.9.0 +tomli==2.0.2 + # via mypy + # via pytest +typing-extensions==4.12.2 + # via anyio + # via lmnt + # via multidict + # via mypy + # via pydantic + # via pydantic-core + # via pyright +virtualenv==20.24.5 + # via nox +websockets==15.0.1 + # via lmnt +yarl==1.20.0 + # via aiohttp +zipp==3.17.0 + # via importlib-metadata diff --git a/requirements.lock b/requirements.lock new file mode 100644 index 0000000..36a1dbe --- /dev/null +++ b/requirements.lock @@ -0,0 +1,74 @@ +# generated by rye +# use `rye lock` or `rye sync` to update this lockfile +# +# last locked with the following flags: +# pre: false +# features: [] +# all-features: true +# with-sources: false +# generate-hashes: false +# universal: false + +-e file:. +aiohappyeyeballs==2.6.1 + # via aiohttp +aiohttp==3.12.8 + # via httpx-aiohttp + # via lmnt +aiosignal==1.3.2 + # via aiohttp +annotated-types==0.6.0 + # via pydantic +anyio==4.4.0 + # via httpx + # via lmnt +async-timeout==5.0.1 + # via aiohttp +attrs==25.3.0 + # via aiohttp +certifi==2023.7.22 + # via httpcore + # via httpx +distro==1.8.0 + # via lmnt +exceptiongroup==1.2.2 + # via anyio +frozenlist==1.6.2 + # via aiohttp + # via aiosignal +h11==0.16.0 + # via httpcore +httpcore==1.0.9 + # via httpx +httpx==0.28.1 + # via httpx-aiohttp + # via lmnt +httpx-aiohttp==0.1.8 + # via lmnt +idna==3.4 + # via anyio + # via httpx + # via yarl +multidict==6.4.4 + # via aiohttp + # via yarl +propcache==0.3.1 + # via aiohttp + # via yarl +pydantic==2.10.3 + # via lmnt +pydantic-core==2.27.1 + # via pydantic +sniffio==1.3.0 + # via anyio + # via lmnt +typing-extensions==4.12.2 + # via anyio + # via lmnt + # via multidict + # via pydantic + # via pydantic-core +websockets==15.0.1 + # via lmnt +yarl==1.20.0 + # via aiohttp diff --git a/scripts/bootstrap b/scripts/bootstrap new file mode 100755 index 0000000..e84fe62 --- /dev/null +++ b/scripts/bootstrap @@ -0,0 +1,19 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if ! command -v rye >/dev/null 2>&1 && [ -f "Brewfile" ] && [ "$(uname -s)" = "Darwin" ]; then + brew bundle check >/dev/null 2>&1 || { + echo "==> Installing Homebrew dependencies…" + brew bundle + } +fi + +echo "==> Installing Python dependencies…" + +# experimental uv support makes installations significantly faster +rye config --set-bool behavior.use-uv=true + +rye sync --all-features diff --git a/scripts/format b/scripts/format new file mode 100755 index 0000000..667ec2d --- /dev/null +++ b/scripts/format @@ -0,0 +1,8 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +echo "==> Running formatters" +rye run format diff --git a/scripts/lint b/scripts/lint new file mode 100755 index 0000000..1be4925 --- /dev/null +++ b/scripts/lint @@ -0,0 +1,11 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +echo "==> Running lints" +rye run lint + +echo "==> Making sure it imports" +rye run python -c 'import lmnt' diff --git a/scripts/mock b/scripts/mock new file mode 100755 index 0000000..d2814ae --- /dev/null +++ b/scripts/mock @@ -0,0 +1,41 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if [[ -n "$1" && "$1" != '--'* ]]; then + URL="$1" + shift +else + URL="$(grep 'openapi_spec_url' .stats.yml | cut -d' ' -f2)" +fi + +# Check if the URL is empty +if [ -z "$URL" ]; then + echo "Error: No OpenAPI spec path/url provided or found in .stats.yml" + exit 1 +fi + +echo "==> Starting mock server with URL ${URL}" + +# Run prism mock on the given spec +if [ "$1" == "--daemon" ]; then + npm exec --package=@stainless-api/prism-cli@5.8.5 -- prism mock "$URL" &> .prism.log & + + # Wait for server to come online + echo -n "Waiting for server" + while ! grep -q "✖ fatal\|Prism is listening" ".prism.log" ; do + echo -n "." + sleep 0.1 + done + + if grep -q "✖ fatal" ".prism.log"; then + cat .prism.log + exit 1 + fi + + echo +else + npm exec --package=@stainless-api/prism-cli@5.8.5 -- prism mock "$URL" +fi diff --git a/scripts/test b/scripts/test new file mode 100755 index 0000000..2b87845 --- /dev/null +++ b/scripts/test @@ -0,0 +1,61 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +RED='\033[0;31m' +GREEN='\033[0;32m' +YELLOW='\033[0;33m' +NC='\033[0m' # No Color + +function prism_is_running() { + curl --silent "http://localhost:4010" >/dev/null 2>&1 +} + +kill_server_on_port() { + pids=$(lsof -t -i tcp:"$1" || echo "") + if [ "$pids" != "" ]; then + kill "$pids" + echo "Stopped $pids." + fi +} + +function is_overriding_api_base_url() { + [ -n "$TEST_API_BASE_URL" ] +} + +if ! is_overriding_api_base_url && ! prism_is_running ; then + # When we exit this script, make sure to kill the background mock server process + trap 'kill_server_on_port 4010' EXIT + + # Start the dev server + ./scripts/mock --daemon +fi + +if is_overriding_api_base_url ; then + echo -e "${GREEN}✔ Running tests against ${TEST_API_BASE_URL}${NC}" + echo +elif ! prism_is_running ; then + echo -e "${RED}ERROR:${NC} The test suite will not run without a mock Prism server" + echo -e "running against your OpenAPI spec." + echo + echo -e "To run the server, pass in the path or url of your OpenAPI" + echo -e "spec to the prism command:" + echo + echo -e " \$ ${YELLOW}npm exec --package=@stoplight/prism-cli@~5.3.2 -- prism mock path/to/your.openapi.yml${NC}" + echo + + exit 1 +else + echo -e "${GREEN}✔ Mock prism server is running with your OpenAPI spec${NC}" + echo +fi + +export DEFER_PYDANTIC_BUILD=false + +echo "==> Running tests" +rye run pytest "$@" + +echo "==> Running Pydantic v1 tests" +rye run nox -s test-pydantic-v1 -- "$@" diff --git a/scripts/utils/ruffen-docs.py b/scripts/utils/ruffen-docs.py new file mode 100644 index 0000000..0cf2bd2 --- /dev/null +++ b/scripts/utils/ruffen-docs.py @@ -0,0 +1,167 @@ +# fork of https://github.com/asottile/blacken-docs adapted for ruff +from __future__ import annotations + +import re +import sys +import argparse +import textwrap +import contextlib +import subprocess +from typing import Match, Optional, Sequence, Generator, NamedTuple, cast + +MD_RE = re.compile( + r"(?P^(?P *)```\s*python\n)" r"(?P.*?)" r"(?P^(?P=indent)```\s*$)", + re.DOTALL | re.MULTILINE, +) +MD_PYCON_RE = re.compile( + r"(?P^(?P *)```\s*pycon\n)" r"(?P.*?)" r"(?P^(?P=indent)```.*$)", + re.DOTALL | re.MULTILINE, +) +PYCON_PREFIX = ">>> " +PYCON_CONTINUATION_PREFIX = "..." +PYCON_CONTINUATION_RE = re.compile( + rf"^{re.escape(PYCON_CONTINUATION_PREFIX)}( |$)", +) +DEFAULT_LINE_LENGTH = 100 + + +class CodeBlockError(NamedTuple): + offset: int + exc: Exception + + +def format_str( + src: str, +) -> tuple[str, Sequence[CodeBlockError]]: + errors: list[CodeBlockError] = [] + + @contextlib.contextmanager + def _collect_error(match: Match[str]) -> Generator[None, None, None]: + try: + yield + except Exception as e: + errors.append(CodeBlockError(match.start(), e)) + + def _md_match(match: Match[str]) -> str: + code = textwrap.dedent(match["code"]) + with _collect_error(match): + code = format_code_block(code) + code = textwrap.indent(code, match["indent"]) + return f"{match['before']}{code}{match['after']}" + + def _pycon_match(match: Match[str]) -> str: + code = "" + fragment = cast(Optional[str], None) + + def finish_fragment() -> None: + nonlocal code + nonlocal fragment + + if fragment is not None: + with _collect_error(match): + fragment = format_code_block(fragment) + fragment_lines = fragment.splitlines() + code += f"{PYCON_PREFIX}{fragment_lines[0]}\n" + for line in fragment_lines[1:]: + # Skip blank lines to handle Black adding a blank above + # functions within blocks. A blank line would end the REPL + # continuation prompt. + # + # >>> if True: + # ... def f(): + # ... pass + # ... + if line: + code += f"{PYCON_CONTINUATION_PREFIX} {line}\n" + if fragment_lines[-1].startswith(" "): + code += f"{PYCON_CONTINUATION_PREFIX}\n" + fragment = None + + indentation = None + for line in match["code"].splitlines(): + orig_line, line = line, line.lstrip() + if indentation is None and line: + indentation = len(orig_line) - len(line) + continuation_match = PYCON_CONTINUATION_RE.match(line) + if continuation_match and fragment is not None: + fragment += line[continuation_match.end() :] + "\n" + else: + finish_fragment() + if line.startswith(PYCON_PREFIX): + fragment = line[len(PYCON_PREFIX) :] + "\n" + else: + code += orig_line[indentation:] + "\n" + finish_fragment() + return code + + def _md_pycon_match(match: Match[str]) -> str: + code = _pycon_match(match) + code = textwrap.indent(code, match["indent"]) + return f"{match['before']}{code}{match['after']}" + + src = MD_RE.sub(_md_match, src) + src = MD_PYCON_RE.sub(_md_pycon_match, src) + return src, errors + + +def format_code_block(code: str) -> str: + return subprocess.check_output( + [ + sys.executable, + "-m", + "ruff", + "format", + "--stdin-filename=script.py", + f"--line-length={DEFAULT_LINE_LENGTH}", + ], + encoding="utf-8", + input=code, + ) + + +def format_file( + filename: str, + skip_errors: bool, +) -> int: + with open(filename, encoding="UTF-8") as f: + contents = f.read() + new_contents, errors = format_str(contents) + for error in errors: + lineno = contents[: error.offset].count("\n") + 1 + print(f"{filename}:{lineno}: code block parse error {error.exc}") + if errors and not skip_errors: + return 1 + if contents != new_contents: + print(f"{filename}: Rewriting...") + with open(filename, "w", encoding="UTF-8") as f: + f.write(new_contents) + return 0 + else: + return 0 + + +def main(argv: Sequence[str] | None = None) -> int: + parser = argparse.ArgumentParser() + parser.add_argument( + "-l", + "--line-length", + type=int, + default=DEFAULT_LINE_LENGTH, + ) + parser.add_argument( + "-S", + "--skip-string-normalization", + action="store_true", + ) + parser.add_argument("-E", "--skip-errors", action="store_true") + parser.add_argument("filenames", nargs="*") + args = parser.parse_args(argv) + + retv = 0 + for filename in args.filenames: + retv |= format_file(filename, skip_errors=args.skip_errors) + return retv + + +if __name__ == "__main__": + raise SystemExit(main()) diff --git a/setup.py b/setup.py deleted file mode 100644 index d1cc7a2..0000000 --- a/setup.py +++ /dev/null @@ -1,30 +0,0 @@ -from setuptools import find_namespace_packages, setup - - -DESCRIPTION = 'Python client library for the LMNT API' -AUTHOR = 'LMNT, Inc.' -AUTHOR_EMAIL = 'feedback@lmnt.com' -URL = 'https://github.com/lmnt-com/lmnt-python' -LICENSE = 'Apache 2.0' -KEYWORDS = ['speech tts ai ml genai'] -CLASSIFIERS = [ - 'Programming Language :: Python :: 3', - 'License :: OSI Approved :: Apache Software License', - 'Operating System :: OS Independent', -] - -setup(name='lmnt', - description=DESCRIPTION, - long_description=open('README.md', 'r').read(), - long_description_content_type='text/markdown', - author=AUTHOR, - author_email=AUTHOR_EMAIL, - url=URL, - license=LICENSE, - keywords=KEYWORDS, - packages=find_namespace_packages('src'), - package_dir={'': 'src'}, - install_requires=[ - 'aiohttp ~= 3.8' - ], - classifiers=CLASSIFIERS) diff --git a/src/lmnt/__init__.py b/src/lmnt/__init__.py new file mode 100644 index 0000000..a6fc5c6 --- /dev/null +++ b/src/lmnt/__init__.py @@ -0,0 +1,90 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +import typing as _t + +from . import types +from ._types import NOT_GIVEN, Omit, NoneType, NotGiven, Transport, ProxiesTypes +from ._utils import file_from_path +from ._client import Lmnt, Client, Stream, Timeout, AsyncLmnt, Transport, AsyncClient, AsyncStream, RequestOptions +from ._models import BaseModel +from ._version import __title__, __version__ +from ._response import APIResponse as APIResponse, AsyncAPIResponse as AsyncAPIResponse +from ._constants import DEFAULT_TIMEOUT, DEFAULT_MAX_RETRIES, DEFAULT_CONNECTION_LIMITS +from ._exceptions import ( + APIError, + LmntError, + ConflictError, + NotFoundError, + APIStatusError, + RateLimitError, + APITimeoutError, + BadRequestError, + APIConnectionError, + AuthenticationError, + InternalServerError, + PermissionDeniedError, + UnprocessableEntityError, + APIResponseValidationError, +) +from ._base_client import DefaultHttpxClient, DefaultAioHttpClient, DefaultAsyncHttpxClient +from ._utils._logs import setup_logging as _setup_logging + +__all__ = [ + "types", + "__version__", + "__title__", + "NoneType", + "Transport", + "ProxiesTypes", + "NotGiven", + "NOT_GIVEN", + "Omit", + "LmntError", + "APIError", + "APIStatusError", + "APITimeoutError", + "APIConnectionError", + "APIResponseValidationError", + "BadRequestError", + "AuthenticationError", + "PermissionDeniedError", + "NotFoundError", + "ConflictError", + "UnprocessableEntityError", + "RateLimitError", + "InternalServerError", + "Timeout", + "RequestOptions", + "Client", + "AsyncClient", + "Stream", + "AsyncStream", + "Lmnt", + "AsyncLmnt", + "file_from_path", + "BaseModel", + "DEFAULT_TIMEOUT", + "DEFAULT_MAX_RETRIES", + "DEFAULT_CONNECTION_LIMITS", + "DefaultHttpxClient", + "DefaultAsyncHttpxClient", + "DefaultAioHttpClient", +] + +if not _t.TYPE_CHECKING: + from ._utils._resources_proxy import resources as resources + +_setup_logging() + +# Update the __module__ attribute for exported symbols so that +# error messages point to this module instead of the module +# it was originally defined in, e.g. +# lmnt._exceptions.NotFoundError -> lmnt.NotFoundError +__locals = locals() +for __name in __all__: + if not __name.startswith("__"): + try: + __locals[__name].__module__ = "lmnt" + except (TypeError, AttributeError): + # Some of our exported symbols are builtins which we can't set attributes for. + pass diff --git a/src/lmnt/_base_client.py b/src/lmnt/_base_client.py new file mode 100644 index 0000000..7974f3a --- /dev/null +++ b/src/lmnt/_base_client.py @@ -0,0 +1,1992 @@ +from __future__ import annotations + +import sys +import json +import time +import uuid +import email +import asyncio +import inspect +import logging +import platform +import email.utils +from types import TracebackType +from random import random +from typing import ( + TYPE_CHECKING, + Any, + Dict, + Type, + Union, + Generic, + Mapping, + TypeVar, + Iterable, + Iterator, + Optional, + Generator, + AsyncIterator, + cast, + overload, +) +from typing_extensions import Literal, override, get_origin + +import anyio +import httpx +import distro +import pydantic +from httpx import URL +from pydantic import PrivateAttr + +from . import _exceptions +from ._qs import Querystring +from ._files import to_httpx_files, async_to_httpx_files +from ._types import ( + NOT_GIVEN, + Body, + Omit, + Query, + Headers, + Timeout, + NotGiven, + ResponseT, + AnyMapping, + PostParser, + RequestFiles, + HttpxSendArgs, + RequestOptions, + HttpxRequestFiles, + ModelBuilderProtocol, +) +from ._utils import is_dict, is_list, asyncify, is_given, lru_cache, is_mapping +from ._compat import PYDANTIC_V2, model_copy, model_dump +from ._models import GenericModel, FinalRequestOptions, validate_type, construct_type +from ._response import ( + APIResponse, + BaseAPIResponse, + AsyncAPIResponse, + extract_response_type, +) +from ._constants import ( + DEFAULT_TIMEOUT, + MAX_RETRY_DELAY, + DEFAULT_MAX_RETRIES, + INITIAL_RETRY_DELAY, + RAW_RESPONSE_HEADER, + OVERRIDE_CAST_TO_HEADER, + DEFAULT_CONNECTION_LIMITS, +) +from ._streaming import Stream, SSEDecoder, AsyncStream, SSEBytesDecoder +from ._exceptions import ( + APIStatusError, + APITimeoutError, + APIConnectionError, + APIResponseValidationError, +) + +log: logging.Logger = logging.getLogger(__name__) + +# TODO: make base page type vars covariant +SyncPageT = TypeVar("SyncPageT", bound="BaseSyncPage[Any]") +AsyncPageT = TypeVar("AsyncPageT", bound="BaseAsyncPage[Any]") + + +_T = TypeVar("_T") +_T_co = TypeVar("_T_co", covariant=True) + +_StreamT = TypeVar("_StreamT", bound=Stream[Any]) +_AsyncStreamT = TypeVar("_AsyncStreamT", bound=AsyncStream[Any]) + +if TYPE_CHECKING: + from httpx._config import ( + DEFAULT_TIMEOUT_CONFIG, # pyright: ignore[reportPrivateImportUsage] + ) + + HTTPX_DEFAULT_TIMEOUT = DEFAULT_TIMEOUT_CONFIG +else: + try: + from httpx._config import DEFAULT_TIMEOUT_CONFIG as HTTPX_DEFAULT_TIMEOUT + except ImportError: + # taken from https://github.com/encode/httpx/blob/3ba5fe0d7ac70222590e759c31442b1cab263791/httpx/_config.py#L366 + HTTPX_DEFAULT_TIMEOUT = Timeout(5.0) + + +class PageInfo: + """Stores the necessary information to build the request to retrieve the next page. + + Either `url` or `params` must be set. + """ + + url: URL | NotGiven + params: Query | NotGiven + json: Body | NotGiven + + @overload + def __init__( + self, + *, + url: URL, + ) -> None: ... + + @overload + def __init__( + self, + *, + params: Query, + ) -> None: ... + + @overload + def __init__( + self, + *, + json: Body, + ) -> None: ... + + def __init__( + self, + *, + url: URL | NotGiven = NOT_GIVEN, + json: Body | NotGiven = NOT_GIVEN, + params: Query | NotGiven = NOT_GIVEN, + ) -> None: + self.url = url + self.json = json + self.params = params + + @override + def __repr__(self) -> str: + if self.url: + return f"{self.__class__.__name__}(url={self.url})" + if self.json: + return f"{self.__class__.__name__}(json={self.json})" + return f"{self.__class__.__name__}(params={self.params})" + + +class BasePage(GenericModel, Generic[_T]): + """ + Defines the core interface for pagination. + + Type Args: + ModelT: The pydantic model that represents an item in the response. + + Methods: + has_next_page(): Check if there is another page available + next_page_info(): Get the necessary information to make a request for the next page + """ + + _options: FinalRequestOptions = PrivateAttr() + _model: Type[_T] = PrivateAttr() + + def has_next_page(self) -> bool: + items = self._get_page_items() + if not items: + return False + return self.next_page_info() is not None + + def next_page_info(self) -> Optional[PageInfo]: ... + + def _get_page_items(self) -> Iterable[_T]: # type: ignore[empty-body] + ... + + def _params_from_url(self, url: URL) -> httpx.QueryParams: + # TODO: do we have to preprocess params here? + return httpx.QueryParams(cast(Any, self._options.params)).merge(url.params) + + def _info_to_options(self, info: PageInfo) -> FinalRequestOptions: + options = model_copy(self._options) + options._strip_raw_response_header() + + if not isinstance(info.params, NotGiven): + options.params = {**options.params, **info.params} + return options + + if not isinstance(info.url, NotGiven): + params = self._params_from_url(info.url) + url = info.url.copy_with(params=params) + options.params = dict(url.params) + options.url = str(url) + return options + + if not isinstance(info.json, NotGiven): + if not is_mapping(info.json): + raise TypeError("Pagination is only supported with mappings") + + if not options.json_data: + options.json_data = {**info.json} + else: + if not is_mapping(options.json_data): + raise TypeError("Pagination is only supported with mappings") + + options.json_data = {**options.json_data, **info.json} + return options + + raise ValueError("Unexpected PageInfo state") + + +class BaseSyncPage(BasePage[_T], Generic[_T]): + _client: SyncAPIClient = pydantic.PrivateAttr() + + def _set_private_attributes( + self, + client: SyncAPIClient, + model: Type[_T], + options: FinalRequestOptions, + ) -> None: + if PYDANTIC_V2 and getattr(self, "__pydantic_private__", None) is None: + self.__pydantic_private__ = {} + + self._model = model + self._client = client + self._options = options + + # Pydantic uses a custom `__iter__` method to support casting BaseModels + # to dictionaries. e.g. dict(model). + # As we want to support `for item in page`, this is inherently incompatible + # with the default pydantic behaviour. It is not possible to support both + # use cases at once. Fortunately, this is not a big deal as all other pydantic + # methods should continue to work as expected as there is an alternative method + # to cast a model to a dictionary, model.dict(), which is used internally + # by pydantic. + def __iter__(self) -> Iterator[_T]: # type: ignore + for page in self.iter_pages(): + for item in page._get_page_items(): + yield item + + def iter_pages(self: SyncPageT) -> Iterator[SyncPageT]: + page = self + while True: + yield page + if page.has_next_page(): + page = page.get_next_page() + else: + return + + def get_next_page(self: SyncPageT) -> SyncPageT: + info = self.next_page_info() + if not info: + raise RuntimeError( + "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`." + ) + + options = self._info_to_options(info) + return self._client._request_api_list(self._model, page=self.__class__, options=options) + + +class AsyncPaginator(Generic[_T, AsyncPageT]): + def __init__( + self, + client: AsyncAPIClient, + options: FinalRequestOptions, + page_cls: Type[AsyncPageT], + model: Type[_T], + ) -> None: + self._model = model + self._client = client + self._options = options + self._page_cls = page_cls + + def __await__(self) -> Generator[Any, None, AsyncPageT]: + return self._get_page().__await__() + + async def _get_page(self) -> AsyncPageT: + def _parser(resp: AsyncPageT) -> AsyncPageT: + resp._set_private_attributes( + model=self._model, + options=self._options, + client=self._client, + ) + return resp + + self._options.post_parser = _parser + + return await self._client.request(self._page_cls, self._options) + + async def __aiter__(self) -> AsyncIterator[_T]: + # https://github.com/microsoft/pyright/issues/3464 + page = cast( + AsyncPageT, + await self, # type: ignore + ) + async for item in page: + yield item + + +class BaseAsyncPage(BasePage[_T], Generic[_T]): + _client: AsyncAPIClient = pydantic.PrivateAttr() + + def _set_private_attributes( + self, + model: Type[_T], + client: AsyncAPIClient, + options: FinalRequestOptions, + ) -> None: + if PYDANTIC_V2 and getattr(self, "__pydantic_private__", None) is None: + self.__pydantic_private__ = {} + + self._model = model + self._client = client + self._options = options + + async def __aiter__(self) -> AsyncIterator[_T]: + async for page in self.iter_pages(): + for item in page._get_page_items(): + yield item + + async def iter_pages(self: AsyncPageT) -> AsyncIterator[AsyncPageT]: + page = self + while True: + yield page + if page.has_next_page(): + page = await page.get_next_page() + else: + return + + async def get_next_page(self: AsyncPageT) -> AsyncPageT: + info = self.next_page_info() + if not info: + raise RuntimeError( + "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`." + ) + + options = self._info_to_options(info) + return await self._client._request_api_list(self._model, page=self.__class__, options=options) + + +_HttpxClientT = TypeVar("_HttpxClientT", bound=Union[httpx.Client, httpx.AsyncClient]) +_DefaultStreamT = TypeVar("_DefaultStreamT", bound=Union[Stream[Any], AsyncStream[Any]]) + + +class BaseClient(Generic[_HttpxClientT, _DefaultStreamT]): + _client: _HttpxClientT + _version: str + _base_url: URL + max_retries: int + timeout: Union[float, Timeout, None] + _strict_response_validation: bool + _idempotency_header: str | None + _default_stream_cls: type[_DefaultStreamT] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + _strict_response_validation: bool, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None = DEFAULT_TIMEOUT, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + ) -> None: + self._version = version + self._base_url = self._enforce_trailing_slash(URL(base_url)) + self.max_retries = max_retries + self.timeout = timeout + self._custom_headers = custom_headers or {} + self._custom_query = custom_query or {} + self._strict_response_validation = _strict_response_validation + self._idempotency_header = None + self._platform: Platform | None = None + + if max_retries is None: # pyright: ignore[reportUnnecessaryComparison] + raise TypeError( + "max_retries cannot be None. If you want to disable retries, pass `0`; if you want unlimited retries, pass `math.inf` or a very high number; if you want the default behavior, pass `lmnt.DEFAULT_MAX_RETRIES`" + ) + + def _enforce_trailing_slash(self, url: URL) -> URL: + if url.raw_path.endswith(b"/"): + return url + return url.copy_with(raw_path=url.raw_path + b"/") + + def _make_status_error_from_response( + self, + response: httpx.Response, + ) -> APIStatusError: + if response.is_closed and not response.is_stream_consumed: + # We can't read the response body as it has been closed + # before it was read. This can happen if an event hook + # raises a status error. + body = None + err_msg = f"Error code: {response.status_code}" + else: + err_text = response.text.strip() + body = err_text + + try: + body = json.loads(err_text) + err_msg = f"Error code: {response.status_code} - {body}" + except Exception: + err_msg = err_text or f"Error code: {response.status_code}" + + return self._make_status_error(err_msg, body=body, response=response) + + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> _exceptions.APIStatusError: + raise NotImplementedError() + + def _build_headers(self, options: FinalRequestOptions, *, retries_taken: int = 0) -> httpx.Headers: + custom_headers = options.headers or {} + headers_dict = _merge_mappings(self.default_headers, custom_headers) + self._validate_headers(headers_dict, custom_headers) + + # headers are case-insensitive while dictionaries are not. + headers = httpx.Headers(headers_dict) + + idempotency_header = self._idempotency_header + if idempotency_header and options.idempotency_key and idempotency_header not in headers: + headers[idempotency_header] = options.idempotency_key + + # Don't set these headers if they were already set or removed by the caller. We check + # `custom_headers`, which can contain `Omit()`, instead of `headers` to account for the removal case. + lower_custom_headers = [header.lower() for header in custom_headers] + if "x-stainless-retry-count" not in lower_custom_headers: + headers["x-stainless-retry-count"] = str(retries_taken) + if "x-stainless-read-timeout" not in lower_custom_headers: + timeout = self.timeout if isinstance(options.timeout, NotGiven) else options.timeout + if isinstance(timeout, Timeout): + timeout = timeout.read + if timeout is not None: + headers["x-stainless-read-timeout"] = str(timeout) + + return headers + + def _prepare_url(self, url: str) -> URL: + """ + Merge a URL argument together with any 'base_url' on the client, + to create the URL used for the outgoing request. + """ + # Copied from httpx's `_merge_url` method. + merge_url = URL(url) + if merge_url.is_relative_url: + merge_raw_path = self.base_url.raw_path + merge_url.raw_path.lstrip(b"/") + return self.base_url.copy_with(raw_path=merge_raw_path) + + return merge_url + + def _make_sse_decoder(self) -> SSEDecoder | SSEBytesDecoder: + return SSEDecoder() + + def _build_request( + self, + options: FinalRequestOptions, + *, + retries_taken: int = 0, + ) -> httpx.Request: + if log.isEnabledFor(logging.DEBUG): + log.debug("Request options: %s", model_dump(options, exclude_unset=True)) + + kwargs: dict[str, Any] = {} + + json_data = options.json_data + if options.extra_json is not None: + if json_data is None: + json_data = cast(Body, options.extra_json) + elif is_mapping(json_data): + json_data = _merge_mappings(json_data, options.extra_json) + else: + raise RuntimeError(f"Unexpected JSON data type, {type(json_data)}, cannot merge with `extra_body`") + + headers = self._build_headers(options, retries_taken=retries_taken) + params = _merge_mappings(self.default_query, options.params) + content_type = headers.get("Content-Type") + files = options.files + + # If the given Content-Type header is multipart/form-data then it + # has to be removed so that httpx can generate the header with + # additional information for us as it has to be in this form + # for the server to be able to correctly parse the request: + # multipart/form-data; boundary=---abc-- + if content_type is not None and content_type.startswith("multipart/form-data"): + if "boundary" not in content_type: + # only remove the header if the boundary hasn't been explicitly set + # as the caller doesn't want httpx to come up with their own boundary + headers.pop("Content-Type") + + # As we are now sending multipart/form-data instead of application/json + # we need to tell httpx to use it, https://www.python-httpx.org/advanced/clients/#multipart-file-encoding + if json_data: + if not is_dict(json_data): + raise TypeError( + f"Expected query input to be a dictionary for multipart requests but got {type(json_data)} instead." + ) + kwargs["data"] = self._serialize_multipartform(json_data) + + # httpx determines whether or not to send a "multipart/form-data" + # request based on the truthiness of the "files" argument. + # This gets around that issue by generating a dict value that + # evaluates to true. + # + # https://github.com/encode/httpx/discussions/2399#discussioncomment-3814186 + if not files: + files = cast(HttpxRequestFiles, ForceMultipartDict()) + + prepared_url = self._prepare_url(options.url) + if "_" in prepared_url.host: + # work around https://github.com/encode/httpx/discussions/2880 + kwargs["extensions"] = {"sni_hostname": prepared_url.host.replace("_", "-")} + + is_body_allowed = options.method.lower() != "get" + + if is_body_allowed: + kwargs["json"] = json_data if is_given(json_data) else None + kwargs["files"] = files + else: + headers.pop("Content-Type", None) + kwargs.pop("data", None) + + # TODO: report this error to httpx + return self._client.build_request( # pyright: ignore[reportUnknownMemberType] + headers=headers, + timeout=self.timeout if isinstance(options.timeout, NotGiven) else options.timeout, + method=options.method, + url=prepared_url, + # the `Query` type that we use is incompatible with qs' + # `Params` type as it needs to be typed as `Mapping[str, object]` + # so that passing a `TypedDict` doesn't cause an error. + # https://github.com/microsoft/pyright/issues/3526#event-6715453066 + params=self.qs.stringify(cast(Mapping[str, Any], params)) if params else None, + **kwargs, + ) + + def _serialize_multipartform(self, data: Mapping[object, object]) -> dict[str, object]: + items = self.qs.stringify_items( + # TODO: type ignore is required as stringify_items is well typed but we can't be + # well typed without heavy validation. + data, # type: ignore + array_format="brackets", + ) + serialized: dict[str, object] = {} + for key, value in items: + existing = serialized.get(key) + + if not existing: + serialized[key] = value + continue + + # If a value has already been set for this key then that + # means we're sending data like `array[]=[1, 2, 3]` and we + # need to tell httpx that we want to send multiple values with + # the same key which is done by using a list or a tuple. + # + # Note: 2d arrays should never result in the same key at both + # levels so it's safe to assume that if the value is a list, + # it was because we changed it to be a list. + if is_list(existing): + existing.append(value) + else: + serialized[key] = [existing, value] + + return serialized + + def _maybe_override_cast_to(self, cast_to: type[ResponseT], options: FinalRequestOptions) -> type[ResponseT]: + if not is_given(options.headers): + return cast_to + + # make a copy of the headers so we don't mutate user-input + headers = dict(options.headers) + + # we internally support defining a temporary header to override the + # default `cast_to` type for use with `.with_raw_response` and `.with_streaming_response` + # see _response.py for implementation details + override_cast_to = headers.pop(OVERRIDE_CAST_TO_HEADER, NOT_GIVEN) + if is_given(override_cast_to): + options.headers = headers + return cast(Type[ResponseT], override_cast_to) + + return cast_to + + def _should_stream_response_body(self, request: httpx.Request) -> bool: + return request.headers.get(RAW_RESPONSE_HEADER) == "stream" # type: ignore[no-any-return] + + def _process_response_data( + self, + *, + data: object, + cast_to: type[ResponseT], + response: httpx.Response, + ) -> ResponseT: + if data is None: + return cast(ResponseT, None) + + if cast_to is object: + return cast(ResponseT, data) + + try: + if inspect.isclass(cast_to) and issubclass(cast_to, ModelBuilderProtocol): + return cast(ResponseT, cast_to.build(response=response, data=data)) + + if self._strict_response_validation: + return cast(ResponseT, validate_type(type_=cast_to, value=data)) + + return cast(ResponseT, construct_type(type_=cast_to, value=data)) + except pydantic.ValidationError as err: + raise APIResponseValidationError(response=response, body=data) from err + + @property + def qs(self) -> Querystring: + return Querystring() + + @property + def custom_auth(self) -> httpx.Auth | None: + return None + + @property + def auth_headers(self) -> dict[str, str]: + return {} + + @property + def default_headers(self) -> dict[str, str | Omit]: + return { + "Accept": "application/json", + "Content-Type": "application/json", + "User-Agent": self.user_agent, + **self.platform_headers(), + **self.auth_headers, + **self._custom_headers, + } + + @property + def default_query(self) -> dict[str, object]: + return { + **self._custom_query, + } + + def _validate_headers( + self, + headers: Headers, # noqa: ARG002 + custom_headers: Headers, # noqa: ARG002 + ) -> None: + """Validate the given default headers and custom headers. + + Does nothing by default. + """ + return + + @property + def user_agent(self) -> str: + return f"{self.__class__.__name__}/Python {self._version}" + + @property + def base_url(self) -> URL: + return self._base_url + + @base_url.setter + def base_url(self, url: URL | str) -> None: + self._base_url = self._enforce_trailing_slash(url if isinstance(url, URL) else URL(url)) + + def platform_headers(self) -> Dict[str, str]: + # the actual implementation is in a separate `lru_cache` decorated + # function because adding `lru_cache` to methods will leak memory + # https://github.com/python/cpython/issues/88476 + return platform_headers(self._version, platform=self._platform) + + def _parse_retry_after_header(self, response_headers: Optional[httpx.Headers] = None) -> float | None: + """Returns a float of the number of seconds (not milliseconds) to wait after retrying, or None if unspecified. + + About the Retry-After header: https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After + See also https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After#syntax + """ + if response_headers is None: + return None + + # First, try the non-standard `retry-after-ms` header for milliseconds, + # which is more precise than integer-seconds `retry-after` + try: + retry_ms_header = response_headers.get("retry-after-ms", None) + return float(retry_ms_header) / 1000 + except (TypeError, ValueError): + pass + + # Next, try parsing `retry-after` header as seconds (allowing nonstandard floats). + retry_header = response_headers.get("retry-after") + try: + # note: the spec indicates that this should only ever be an integer + # but if someone sends a float there's no reason for us to not respect it + return float(retry_header) + except (TypeError, ValueError): + pass + + # Last, try parsing `retry-after` as a date. + retry_date_tuple = email.utils.parsedate_tz(retry_header) + if retry_date_tuple is None: + return None + + retry_date = email.utils.mktime_tz(retry_date_tuple) + return float(retry_date - time.time()) + + def _calculate_retry_timeout( + self, + remaining_retries: int, + options: FinalRequestOptions, + response_headers: Optional[httpx.Headers] = None, + ) -> float: + max_retries = options.get_max_retries(self.max_retries) + + # If the API asks us to wait a certain amount of time (and it's a reasonable amount), just do what it says. + retry_after = self._parse_retry_after_header(response_headers) + if retry_after is not None and 0 < retry_after <= 60: + return retry_after + + # Also cap retry count to 1000 to avoid any potential overflows with `pow` + nb_retries = min(max_retries - remaining_retries, 1000) + + # Apply exponential backoff, but not more than the max. + sleep_seconds = min(INITIAL_RETRY_DELAY * pow(2.0, nb_retries), MAX_RETRY_DELAY) + + # Apply some jitter, plus-or-minus half a second. + jitter = 1 - 0.25 * random() + timeout = sleep_seconds * jitter + return timeout if timeout >= 0 else 0 + + def _should_retry(self, response: httpx.Response) -> bool: + # Note: this is not a standard header + should_retry_header = response.headers.get("x-should-retry") + + # If the server explicitly says whether or not to retry, obey. + if should_retry_header == "true": + log.debug("Retrying as header `x-should-retry` is set to `true`") + return True + if should_retry_header == "false": + log.debug("Not retrying as header `x-should-retry` is set to `false`") + return False + + # Retry on request timeouts. + if response.status_code == 408: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry on lock timeouts. + if response.status_code == 409: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry on rate limits. + if response.status_code == 429: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry internal errors. + if response.status_code >= 500: + log.debug("Retrying due to status code %i", response.status_code) + return True + + log.debug("Not retrying") + return False + + def _idempotency_key(self) -> str: + return f"stainless-python-retry-{uuid.uuid4()}" + + +class _DefaultHttpxClient(httpx.Client): + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + super().__init__(**kwargs) + + +if TYPE_CHECKING: + DefaultHttpxClient = httpx.Client + """An alias to `httpx.Client` that provides the same defaults that this SDK + uses internally. + + This is useful because overriding the `http_client` with your own instance of + `httpx.Client` will result in httpx's defaults being used, not ours. + """ +else: + DefaultHttpxClient = _DefaultHttpxClient + + +class SyncHttpxClientWrapper(DefaultHttpxClient): + def __del__(self) -> None: + if self.is_closed: + return + + try: + self.close() + except Exception: + pass + + +class SyncAPIClient(BaseClient[httpx.Client, Stream[Any]]): + _client: httpx.Client + _default_stream_cls: type[Stream[Any]] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None | NotGiven = NOT_GIVEN, + http_client: httpx.Client | None = None, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + _strict_response_validation: bool, + ) -> None: + if not is_given(timeout): + # if the user passed in a custom http client with a non-default + # timeout set then we use that timeout. + # + # note: there is an edge case here where the user passes in a client + # where they've explicitly set the timeout to match the default timeout + # as this check is structural, meaning that we'll think they didn't + # pass in a timeout and will ignore it + if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT: + timeout = http_client.timeout + else: + timeout = DEFAULT_TIMEOUT + + if http_client is not None and not isinstance(http_client, httpx.Client): # pyright: ignore[reportUnnecessaryIsInstance] + raise TypeError( + f"Invalid `http_client` argument; Expected an instance of `httpx.Client` but got {type(http_client)}" + ) + + super().__init__( + version=version, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + base_url=base_url, + max_retries=max_retries, + custom_query=custom_query, + custom_headers=custom_headers, + _strict_response_validation=_strict_response_validation, + ) + self._client = http_client or SyncHttpxClientWrapper( + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + ) + + def is_closed(self) -> bool: + return self._client.is_closed + + def close(self) -> None: + """Close the underlying HTTPX client. + + The client will *not* be usable after this. + """ + # If an error is thrown while constructing a client, self._client + # may not be present + if hasattr(self, "_client"): + self._client.close() + + def __enter__(self: _T) -> _T: + return self + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + self.close() + + def _prepare_options( + self, + options: FinalRequestOptions, # noqa: ARG002 + ) -> FinalRequestOptions: + """Hook for mutating the given options""" + return options + + def _prepare_request( + self, + request: httpx.Request, # noqa: ARG002 + ) -> None: + """This method is used as a callback for mutating the `Request` object + after it has been constructed. + This is useful for cases where you want to add certain headers based off of + the request properties, e.g. `url`, `method` etc. + """ + return None + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[True], + stream_cls: Type[_StreamT], + ) -> _StreamT: ... + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: Type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + cast_to = self._maybe_override_cast_to(cast_to, options) + + # create a copy of the options we were given so that if the + # options are mutated later & we then retry, the retries are + # given the original options + input_options = model_copy(options) + if input_options.idempotency_key is None and input_options.method.lower() != "get": + # ensure the idempotency key is reused between requests + input_options.idempotency_key = self._idempotency_key() + + response: httpx.Response | None = None + max_retries = input_options.get_max_retries(self.max_retries) + + retries_taken = 0 + for retries_taken in range(max_retries + 1): + options = model_copy(input_options) + options = self._prepare_options(options) + + remaining_retries = max_retries - retries_taken + request = self._build_request(options, retries_taken=retries_taken) + self._prepare_request(request) + + kwargs: HttpxSendArgs = {} + if self.custom_auth is not None: + kwargs["auth"] = self.custom_auth + + if options.follow_redirects is not None: + kwargs["follow_redirects"] = options.follow_redirects + + log.debug("Sending HTTP Request: %s %s", request.method, request.url) + + response = None + try: + response = self._client.send( + request, + stream=stream or self._should_stream_response_body(request=request), + **kwargs, + ) + except httpx.TimeoutException as err: + log.debug("Encountered httpx.TimeoutException", exc_info=True) + + if remaining_retries > 0: + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising timeout error") + raise APITimeoutError(request=request) from err + except Exception as err: + log.debug("Encountered Exception", exc_info=True) + + if remaining_retries > 0: + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising connection error") + raise APIConnectionError(request=request) from err + + log.debug( + 'HTTP Response: %s %s "%i %s" %s', + request.method, + request.url, + response.status_code, + response.reason_phrase, + response.headers, + ) + + try: + response.raise_for_status() + except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code + log.debug("Encountered httpx.HTTPStatusError", exc_info=True) + + if remaining_retries > 0 and self._should_retry(err.response): + err.response.close() + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=response, + ) + continue + + # If the response is streamed then we need to explicitly read the response + # to completion before attempting to access the response text. + if not err.response.is_closed: + err.response.read() + + log.debug("Re-raising status error") + raise self._make_status_error_from_response(err.response) from None + + break + + assert response is not None, "could not resolve response (should never happen)" + return self._process_response( + cast_to=cast_to, + options=options, + response=response, + stream=stream, + stream_cls=stream_cls, + retries_taken=retries_taken, + ) + + def _sleep_for_retry( + self, *, retries_taken: int, max_retries: int, options: FinalRequestOptions, response: httpx.Response | None + ) -> None: + remaining_retries = max_retries - retries_taken + if remaining_retries == 1: + log.debug("1 retry left") + else: + log.debug("%i retries left", remaining_retries) + + timeout = self._calculate_retry_timeout(remaining_retries, options, response.headers if response else None) + log.info("Retrying request to %s in %f seconds", options.url, timeout) + + time.sleep(timeout) + + def _process_response( + self, + *, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + response: httpx.Response, + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + retries_taken: int = 0, + ) -> ResponseT: + origin = get_origin(cast_to) or cast_to + + if ( + inspect.isclass(origin) + and issubclass(origin, BaseAPIResponse) + # we only want to actually return the custom BaseAPIResponse class if we're + # returning the raw response, or if we're not streaming SSE, as if we're streaming + # SSE then `cast_to` doesn't actively reflect the type we need to parse into + and (not stream or bool(response.request.headers.get(RAW_RESPONSE_HEADER))) + ): + if not issubclass(origin, APIResponse): + raise TypeError(f"API Response types must subclass {APIResponse}; Received {origin}") + + response_cls = cast("type[BaseAPIResponse[Any]]", cast_to) + return cast( + ResponseT, + response_cls( + raw=response, + client=self, + cast_to=extract_response_type(response_cls), + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ), + ) + + if cast_to == httpx.Response: + return cast(ResponseT, response) + + api_response = APIResponse( + raw=response, + client=self, + cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast] + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ) + if bool(response.request.headers.get(RAW_RESPONSE_HEADER)): + return cast(ResponseT, api_response) + + return api_response.parse() + + def _request_api_list( + self, + model: Type[object], + page: Type[SyncPageT], + options: FinalRequestOptions, + ) -> SyncPageT: + def _parser(resp: SyncPageT) -> SyncPageT: + resp._set_private_attributes( + client=self, + model=model, + options=options, + ) + return resp + + options.post_parser = _parser + + return self.request(page, options, stream=False) + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_StreamT], + ) -> _StreamT: ... + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + opts = FinalRequestOptions.construct(method="get", url=path, **options) + # cast is required because mypy complains about returning Any even though + # it understands the type variables + return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)) + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: Literal[True], + stream_cls: type[_StreamT], + ) -> _StreamT: ... + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: bool, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + opts = FinalRequestOptions.construct( + method="post", url=path, json_data=body, files=to_httpx_files(files), **options + ) + return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)) + + def patch( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct(method="patch", url=path, json_data=body, **options) + return self.request(cast_to, opts) + + def put( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct( + method="put", url=path, json_data=body, files=to_httpx_files(files), **options + ) + return self.request(cast_to, opts) + + def delete( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, **options) + return self.request(cast_to, opts) + + def get_api_list( + self, + path: str, + *, + model: Type[object], + page: Type[SyncPageT], + body: Body | None = None, + options: RequestOptions = {}, + method: str = "get", + ) -> SyncPageT: + opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options) + return self._request_api_list(model, page, opts) + + +class _DefaultAsyncHttpxClient(httpx.AsyncClient): + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + super().__init__(**kwargs) + + +try: + import httpx_aiohttp +except ImportError: + + class _DefaultAioHttpClient(httpx.AsyncClient): + def __init__(self, **_kwargs: Any) -> None: + raise RuntimeError("To use the aiohttp client you must have installed the package with the `aiohttp` extra") +else: + + class _DefaultAioHttpClient(httpx_aiohttp.HttpxAiohttpClient): # type: ignore + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + + super().__init__(**kwargs) + + +if TYPE_CHECKING: + DefaultAsyncHttpxClient = httpx.AsyncClient + """An alias to `httpx.AsyncClient` that provides the same defaults that this SDK + uses internally. + + This is useful because overriding the `http_client` with your own instance of + `httpx.AsyncClient` will result in httpx's defaults being used, not ours. + """ + + DefaultAioHttpClient = httpx.AsyncClient + """An alias to `httpx.AsyncClient` that changes the default HTTP transport to `aiohttp`.""" +else: + DefaultAsyncHttpxClient = _DefaultAsyncHttpxClient + DefaultAioHttpClient = _DefaultAioHttpClient + + +class AsyncHttpxClientWrapper(DefaultAsyncHttpxClient): + def __del__(self) -> None: + if self.is_closed: + return + + try: + # TODO(someday): support non asyncio runtimes here + asyncio.get_running_loop().create_task(self.aclose()) + except Exception: + pass + + +class AsyncAPIClient(BaseClient[httpx.AsyncClient, AsyncStream[Any]]): + _client: httpx.AsyncClient + _default_stream_cls: type[AsyncStream[Any]] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + _strict_response_validation: bool, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None | NotGiven = NOT_GIVEN, + http_client: httpx.AsyncClient | None = None, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + ) -> None: + if not is_given(timeout): + # if the user passed in a custom http client with a non-default + # timeout set then we use that timeout. + # + # note: there is an edge case here where the user passes in a client + # where they've explicitly set the timeout to match the default timeout + # as this check is structural, meaning that we'll think they didn't + # pass in a timeout and will ignore it + if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT: + timeout = http_client.timeout + else: + timeout = DEFAULT_TIMEOUT + + if http_client is not None and not isinstance(http_client, httpx.AsyncClient): # pyright: ignore[reportUnnecessaryIsInstance] + raise TypeError( + f"Invalid `http_client` argument; Expected an instance of `httpx.AsyncClient` but got {type(http_client)}" + ) + + super().__init__( + version=version, + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + max_retries=max_retries, + custom_query=custom_query, + custom_headers=custom_headers, + _strict_response_validation=_strict_response_validation, + ) + self._client = http_client or AsyncHttpxClientWrapper( + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + ) + + def is_closed(self) -> bool: + return self._client.is_closed + + async def close(self) -> None: + """Close the underlying HTTPX client. + + The client will *not* be usable after this. + """ + await self._client.aclose() + + async def __aenter__(self: _T) -> _T: + return self + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + await self.close() + + async def _prepare_options( + self, + options: FinalRequestOptions, # noqa: ARG002 + ) -> FinalRequestOptions: + """Hook for mutating the given options""" + return options + + async def _prepare_request( + self, + request: httpx.Request, # noqa: ARG002 + ) -> None: + """This method is used as a callback for mutating the `Request` object + after it has been constructed. + This is useful for cases where you want to add certain headers based off of + the request properties, e.g. `url`, `method` etc. + """ + return None + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + if self._platform is None: + # `get_platform` can make blocking IO calls so we + # execute it earlier while we are in an async context + self._platform = await asyncify(get_platform)() + + cast_to = self._maybe_override_cast_to(cast_to, options) + + # create a copy of the options we were given so that if the + # options are mutated later & we then retry, the retries are + # given the original options + input_options = model_copy(options) + if input_options.idempotency_key is None and input_options.method.lower() != "get": + # ensure the idempotency key is reused between requests + input_options.idempotency_key = self._idempotency_key() + + response: httpx.Response | None = None + max_retries = input_options.get_max_retries(self.max_retries) + + retries_taken = 0 + for retries_taken in range(max_retries + 1): + options = model_copy(input_options) + options = await self._prepare_options(options) + + remaining_retries = max_retries - retries_taken + request = self._build_request(options, retries_taken=retries_taken) + await self._prepare_request(request) + + kwargs: HttpxSendArgs = {} + if self.custom_auth is not None: + kwargs["auth"] = self.custom_auth + + if options.follow_redirects is not None: + kwargs["follow_redirects"] = options.follow_redirects + + log.debug("Sending HTTP Request: %s %s", request.method, request.url) + + response = None + try: + response = await self._client.send( + request, + stream=stream or self._should_stream_response_body(request=request), + **kwargs, + ) + except httpx.TimeoutException as err: + log.debug("Encountered httpx.TimeoutException", exc_info=True) + + if remaining_retries > 0: + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising timeout error") + raise APITimeoutError(request=request) from err + except Exception as err: + log.debug("Encountered Exception", exc_info=True) + + if remaining_retries > 0: + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising connection error") + raise APIConnectionError(request=request) from err + + log.debug( + 'HTTP Response: %s %s "%i %s" %s', + request.method, + request.url, + response.status_code, + response.reason_phrase, + response.headers, + ) + + try: + response.raise_for_status() + except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code + log.debug("Encountered httpx.HTTPStatusError", exc_info=True) + + if remaining_retries > 0 and self._should_retry(err.response): + await err.response.aclose() + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=response, + ) + continue + + # If the response is streamed then we need to explicitly read the response + # to completion before attempting to access the response text. + if not err.response.is_closed: + await err.response.aread() + + log.debug("Re-raising status error") + raise self._make_status_error_from_response(err.response) from None + + break + + assert response is not None, "could not resolve response (should never happen)" + return await self._process_response( + cast_to=cast_to, + options=options, + response=response, + stream=stream, + stream_cls=stream_cls, + retries_taken=retries_taken, + ) + + async def _sleep_for_retry( + self, *, retries_taken: int, max_retries: int, options: FinalRequestOptions, response: httpx.Response | None + ) -> None: + remaining_retries = max_retries - retries_taken + if remaining_retries == 1: + log.debug("1 retry left") + else: + log.debug("%i retries left", remaining_retries) + + timeout = self._calculate_retry_timeout(remaining_retries, options, response.headers if response else None) + log.info("Retrying request to %s in %f seconds", options.url, timeout) + + await anyio.sleep(timeout) + + async def _process_response( + self, + *, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + response: httpx.Response, + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + retries_taken: int = 0, + ) -> ResponseT: + origin = get_origin(cast_to) or cast_to + + if ( + inspect.isclass(origin) + and issubclass(origin, BaseAPIResponse) + # we only want to actually return the custom BaseAPIResponse class if we're + # returning the raw response, or if we're not streaming SSE, as if we're streaming + # SSE then `cast_to` doesn't actively reflect the type we need to parse into + and (not stream or bool(response.request.headers.get(RAW_RESPONSE_HEADER))) + ): + if not issubclass(origin, AsyncAPIResponse): + raise TypeError(f"API Response types must subclass {AsyncAPIResponse}; Received {origin}") + + response_cls = cast("type[BaseAPIResponse[Any]]", cast_to) + return cast( + "ResponseT", + response_cls( + raw=response, + client=self, + cast_to=extract_response_type(response_cls), + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ), + ) + + if cast_to == httpx.Response: + return cast(ResponseT, response) + + api_response = AsyncAPIResponse( + raw=response, + client=self, + cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast] + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ) + if bool(response.request.headers.get(RAW_RESPONSE_HEADER)): + return cast(ResponseT, api_response) + + return await api_response.parse() + + def _request_api_list( + self, + model: Type[_T], + page: Type[AsyncPageT], + options: FinalRequestOptions, + ) -> AsyncPaginator[_T, AsyncPageT]: + return AsyncPaginator(client=self, options=options, page_cls=page, model=model) + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + opts = FinalRequestOptions.construct(method="get", url=path, **options) + return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls) + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + opts = FinalRequestOptions.construct( + method="post", url=path, json_data=body, files=await async_to_httpx_files(files), **options + ) + return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls) + + async def patch( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct(method="patch", url=path, json_data=body, **options) + return await self.request(cast_to, opts) + + async def put( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct( + method="put", url=path, json_data=body, files=await async_to_httpx_files(files), **options + ) + return await self.request(cast_to, opts) + + async def delete( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, **options) + return await self.request(cast_to, opts) + + def get_api_list( + self, + path: str, + *, + model: Type[_T], + page: Type[AsyncPageT], + body: Body | None = None, + options: RequestOptions = {}, + method: str = "get", + ) -> AsyncPaginator[_T, AsyncPageT]: + opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options) + return self._request_api_list(model, page, opts) + + +def make_request_options( + *, + query: Query | None = None, + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + idempotency_key: str | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + post_parser: PostParser | NotGiven = NOT_GIVEN, +) -> RequestOptions: + """Create a dict of type RequestOptions without keys of NotGiven values.""" + options: RequestOptions = {} + if extra_headers is not None: + options["headers"] = extra_headers + + if extra_body is not None: + options["extra_json"] = cast(AnyMapping, extra_body) + + if query is not None: + options["params"] = query + + if extra_query is not None: + options["params"] = {**options.get("params", {}), **extra_query} + + if not isinstance(timeout, NotGiven): + options["timeout"] = timeout + + if idempotency_key is not None: + options["idempotency_key"] = idempotency_key + + if is_given(post_parser): + # internal + options["post_parser"] = post_parser # type: ignore + + return options + + +class ForceMultipartDict(Dict[str, None]): + def __bool__(self) -> bool: + return True + + +class OtherPlatform: + def __init__(self, name: str) -> None: + self.name = name + + @override + def __str__(self) -> str: + return f"Other:{self.name}" + + +Platform = Union[ + OtherPlatform, + Literal[ + "MacOS", + "Linux", + "Windows", + "FreeBSD", + "OpenBSD", + "iOS", + "Android", + "Unknown", + ], +] + + +def get_platform() -> Platform: + try: + system = platform.system().lower() + platform_name = platform.platform().lower() + except Exception: + return "Unknown" + + if "iphone" in platform_name or "ipad" in platform_name: + # Tested using Python3IDE on an iPhone 11 and Pythonista on an iPad 7 + # system is Darwin and platform_name is a string like: + # - Darwin-21.6.0-iPhone12,1-64bit + # - Darwin-21.6.0-iPad7,11-64bit + return "iOS" + + if system == "darwin": + return "MacOS" + + if system == "windows": + return "Windows" + + if "android" in platform_name: + # Tested using Pydroid 3 + # system is Linux and platform_name is a string like 'Linux-5.10.81-android12-9-00001-geba40aecb3b7-ab8534902-aarch64-with-libc' + return "Android" + + if system == "linux": + # https://distro.readthedocs.io/en/latest/#distro.id + distro_id = distro.id() + if distro_id == "freebsd": + return "FreeBSD" + + if distro_id == "openbsd": + return "OpenBSD" + + return "Linux" + + if platform_name: + return OtherPlatform(platform_name) + + return "Unknown" + + +@lru_cache(maxsize=None) +def platform_headers(version: str, *, platform: Platform | None) -> Dict[str, str]: + return { + "X-Stainless-Lang": "python", + "X-Stainless-Package-Version": version, + "X-Stainless-OS": str(platform or get_platform()), + "X-Stainless-Arch": str(get_architecture()), + "X-Stainless-Runtime": get_python_runtime(), + "X-Stainless-Runtime-Version": get_python_version(), + } + + +class OtherArch: + def __init__(self, name: str) -> None: + self.name = name + + @override + def __str__(self) -> str: + return f"other:{self.name}" + + +Arch = Union[OtherArch, Literal["x32", "x64", "arm", "arm64", "unknown"]] + + +def get_python_runtime() -> str: + try: + return platform.python_implementation() + except Exception: + return "unknown" + + +def get_python_version() -> str: + try: + return platform.python_version() + except Exception: + return "unknown" + + +def get_architecture() -> Arch: + try: + machine = platform.machine().lower() + except Exception: + return "unknown" + + if machine in ("arm64", "aarch64"): + return "arm64" + + # TODO: untested + if machine == "arm": + return "arm" + + if machine == "x86_64": + return "x64" + + # TODO: untested + if sys.maxsize <= 2**32: + return "x32" + + if machine: + return OtherArch(machine) + + return "unknown" + + +def _merge_mappings( + obj1: Mapping[_T_co, Union[_T, Omit]], + obj2: Mapping[_T_co, Union[_T, Omit]], +) -> Dict[_T_co, _T]: + """Merge two mappings of the same type, removing any values that are instances of `Omit`. + + In cases with duplicate keys the second mapping takes precedence. + """ + merged = {**obj1, **obj2} + return {key: value for key, value in merged.items() if not isinstance(value, Omit)} diff --git a/src/lmnt/_client.py b/src/lmnt/_client.py new file mode 100644 index 0000000..6920690 --- /dev/null +++ b/src/lmnt/_client.py @@ -0,0 +1,410 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, Union, Mapping +from typing_extensions import Self, override + +import httpx + +from . import _exceptions +from ._qs import Querystring +from ._types import ( + NOT_GIVEN, + Omit, + Timeout, + NotGiven, + Transport, + ProxiesTypes, + RequestOptions, +) +from ._utils import is_given, get_async_library +from ._version import __version__ +from .resources import speech, voices, accounts +from ._streaming import Stream as Stream, AsyncStream as AsyncStream +from ._exceptions import LmntError, APIStatusError +from ._base_client import ( + DEFAULT_MAX_RETRIES, + SyncAPIClient, + AsyncAPIClient, +) + +__all__ = ["Timeout", "Transport", "ProxiesTypes", "RequestOptions", "Lmnt", "AsyncLmnt", "Client", "AsyncClient"] + + +class Lmnt(SyncAPIClient): + speech: speech.SpeechResource + accounts: accounts.AccountsResource + voices: voices.VoicesResource + with_raw_response: LmntWithRawResponse + with_streaming_response: LmntWithStreamedResponse + + # client options + api_key: str + + def __init__( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: Union[float, Timeout, None, NotGiven] = NOT_GIVEN, + max_retries: int = DEFAULT_MAX_RETRIES, + default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + # Configure a custom httpx client. + # We provide a `DefaultHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`. + # See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details. + http_client: httpx.Client | None = None, + # Enable or disable schema validation for data returned by the API. + # When enabled an error APIResponseValidationError is raised + # if the API responds with invalid data for the expected schema. + # + # This parameter may be removed or changed in the future. + # If you rely on this feature, please open a GitHub issue + # outlining your use-case to help us decide if it should be + # part of our public interface in the future. + _strict_response_validation: bool = False, + ) -> None: + """Construct a new synchronous Lmnt client instance. + + This automatically infers the `api_key` argument from the `LMNT_API_KEY` environment variable if it is not provided. + """ + if api_key is None: + api_key = os.environ.get("LMNT_API_KEY") + if api_key is None: + raise LmntError( + "The api_key client option must be set either by passing api_key to the client or by setting the LMNT_API_KEY environment variable" + ) + self.api_key = api_key + + if base_url is None: + base_url = os.environ.get("LMNT_BASE_URL") + if base_url is None: + base_url = f"https://api.lmnt.com" + + super().__init__( + version=__version__, + base_url=base_url, + max_retries=max_retries, + timeout=timeout, + http_client=http_client, + custom_headers=default_headers, + custom_query=default_query, + _strict_response_validation=_strict_response_validation, + ) + + self.speech = speech.SpeechResource(self) + self.accounts = accounts.AccountsResource(self) + self.voices = voices.VoicesResource(self) + self.with_raw_response = LmntWithRawResponse(self) + self.with_streaming_response = LmntWithStreamedResponse(self) + + @property + @override + def qs(self) -> Querystring: + return Querystring(array_format="comma") + + @property + @override + def auth_headers(self) -> dict[str, str]: + api_key = self.api_key + return {"X-API-Key": api_key} + + @property + @override + def default_headers(self) -> dict[str, str | Omit]: + return { + **super().default_headers, + "X-Stainless-Async": "false", + **self._custom_headers, + } + + def copy( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = NOT_GIVEN, + http_client: httpx.Client | None = None, + max_retries: int | NotGiven = NOT_GIVEN, + default_headers: Mapping[str, str] | None = None, + set_default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + set_default_query: Mapping[str, object] | None = None, + _extra_kwargs: Mapping[str, Any] = {}, + ) -> Self: + """ + Create a new client instance re-using the same options given to the current client with optional overriding. + """ + if default_headers is not None and set_default_headers is not None: + raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive") + + if default_query is not None and set_default_query is not None: + raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive") + + headers = self._custom_headers + if default_headers is not None: + headers = {**headers, **default_headers} + elif set_default_headers is not None: + headers = set_default_headers + + params = self._custom_query + if default_query is not None: + params = {**params, **default_query} + elif set_default_query is not None: + params = set_default_query + + http_client = http_client or self._client + return self.__class__( + api_key=api_key or self.api_key, + base_url=base_url or self.base_url, + timeout=self.timeout if isinstance(timeout, NotGiven) else timeout, + http_client=http_client, + max_retries=max_retries if is_given(max_retries) else self.max_retries, + default_headers=headers, + default_query=params, + **_extra_kwargs, + ) + + # Alias for `copy` for nicer inline usage, e.g. + # client.with_options(timeout=10).foo.create(...) + with_options = copy + + @override + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> APIStatusError: + if response.status_code == 400: + return _exceptions.BadRequestError(err_msg, response=response, body=body) + + if response.status_code == 401: + return _exceptions.AuthenticationError(err_msg, response=response, body=body) + + if response.status_code == 403: + return _exceptions.PermissionDeniedError(err_msg, response=response, body=body) + + if response.status_code == 404: + return _exceptions.NotFoundError(err_msg, response=response, body=body) + + if response.status_code == 409: + return _exceptions.ConflictError(err_msg, response=response, body=body) + + if response.status_code == 422: + return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body) + + if response.status_code == 429: + return _exceptions.RateLimitError(err_msg, response=response, body=body) + + if response.status_code >= 500: + return _exceptions.InternalServerError(err_msg, response=response, body=body) + return APIStatusError(err_msg, response=response, body=body) + + +class AsyncLmnt(AsyncAPIClient): + speech: speech.AsyncSpeechResource + accounts: accounts.AsyncAccountsResource + voices: voices.AsyncVoicesResource + with_raw_response: AsyncLmntWithRawResponse + with_streaming_response: AsyncLmntWithStreamedResponse + + # client options + api_key: str + + def __init__( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: Union[float, Timeout, None, NotGiven] = NOT_GIVEN, + max_retries: int = DEFAULT_MAX_RETRIES, + default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + # Configure a custom httpx client. + # We provide a `DefaultAsyncHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`. + # See the [httpx documentation](https://www.python-httpx.org/api/#asyncclient) for more details. + http_client: httpx.AsyncClient | None = None, + # Enable or disable schema validation for data returned by the API. + # When enabled an error APIResponseValidationError is raised + # if the API responds with invalid data for the expected schema. + # + # This parameter may be removed or changed in the future. + # If you rely on this feature, please open a GitHub issue + # outlining your use-case to help us decide if it should be + # part of our public interface in the future. + _strict_response_validation: bool = False, + ) -> None: + """Construct a new async AsyncLmnt client instance. + + This automatically infers the `api_key` argument from the `LMNT_API_KEY` environment variable if it is not provided. + """ + if api_key is None: + api_key = os.environ.get("LMNT_API_KEY") + if api_key is None: + raise LmntError( + "The api_key client option must be set either by passing api_key to the client or by setting the LMNT_API_KEY environment variable" + ) + self.api_key = api_key + + if base_url is None: + base_url = os.environ.get("LMNT_BASE_URL") + if base_url is None: + base_url = f"https://api.lmnt.com" + + super().__init__( + version=__version__, + base_url=base_url, + max_retries=max_retries, + timeout=timeout, + http_client=http_client, + custom_headers=default_headers, + custom_query=default_query, + _strict_response_validation=_strict_response_validation, + ) + + self.speech = speech.AsyncSpeechResource(self) + self.accounts = accounts.AsyncAccountsResource(self) + self.voices = voices.AsyncVoicesResource(self) + self.with_raw_response = AsyncLmntWithRawResponse(self) + self.with_streaming_response = AsyncLmntWithStreamedResponse(self) + + @property + @override + def qs(self) -> Querystring: + return Querystring(array_format="comma") + + @property + @override + def auth_headers(self) -> dict[str, str]: + api_key = self.api_key + return {"X-API-Key": api_key} + + @property + @override + def default_headers(self) -> dict[str, str | Omit]: + return { + **super().default_headers, + "X-Stainless-Async": f"async:{get_async_library()}", + **self._custom_headers, + } + + def copy( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = NOT_GIVEN, + http_client: httpx.AsyncClient | None = None, + max_retries: int | NotGiven = NOT_GIVEN, + default_headers: Mapping[str, str] | None = None, + set_default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + set_default_query: Mapping[str, object] | None = None, + _extra_kwargs: Mapping[str, Any] = {}, + ) -> Self: + """ + Create a new client instance re-using the same options given to the current client with optional overriding. + """ + if default_headers is not None and set_default_headers is not None: + raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive") + + if default_query is not None and set_default_query is not None: + raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive") + + headers = self._custom_headers + if default_headers is not None: + headers = {**headers, **default_headers} + elif set_default_headers is not None: + headers = set_default_headers + + params = self._custom_query + if default_query is not None: + params = {**params, **default_query} + elif set_default_query is not None: + params = set_default_query + + http_client = http_client or self._client + return self.__class__( + api_key=api_key or self.api_key, + base_url=base_url or self.base_url, + timeout=self.timeout if isinstance(timeout, NotGiven) else timeout, + http_client=http_client, + max_retries=max_retries if is_given(max_retries) else self.max_retries, + default_headers=headers, + default_query=params, + **_extra_kwargs, + ) + + # Alias for `copy` for nicer inline usage, e.g. + # client.with_options(timeout=10).foo.create(...) + with_options = copy + + @override + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> APIStatusError: + if response.status_code == 400: + return _exceptions.BadRequestError(err_msg, response=response, body=body) + + if response.status_code == 401: + return _exceptions.AuthenticationError(err_msg, response=response, body=body) + + if response.status_code == 403: + return _exceptions.PermissionDeniedError(err_msg, response=response, body=body) + + if response.status_code == 404: + return _exceptions.NotFoundError(err_msg, response=response, body=body) + + if response.status_code == 409: + return _exceptions.ConflictError(err_msg, response=response, body=body) + + if response.status_code == 422: + return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body) + + if response.status_code == 429: + return _exceptions.RateLimitError(err_msg, response=response, body=body) + + if response.status_code >= 500: + return _exceptions.InternalServerError(err_msg, response=response, body=body) + return APIStatusError(err_msg, response=response, body=body) + + +class LmntWithRawResponse: + def __init__(self, client: Lmnt) -> None: + self.speech = speech.SpeechResourceWithRawResponse(client.speech) + self.accounts = accounts.AccountsResourceWithRawResponse(client.accounts) + self.voices = voices.VoicesResourceWithRawResponse(client.voices) + + +class AsyncLmntWithRawResponse: + def __init__(self, client: AsyncLmnt) -> None: + self.speech = speech.AsyncSpeechResourceWithRawResponse(client.speech) + self.accounts = accounts.AsyncAccountsResourceWithRawResponse(client.accounts) + self.voices = voices.AsyncVoicesResourceWithRawResponse(client.voices) + + +class LmntWithStreamedResponse: + def __init__(self, client: Lmnt) -> None: + self.speech = speech.SpeechResourceWithStreamingResponse(client.speech) + self.accounts = accounts.AccountsResourceWithStreamingResponse(client.accounts) + self.voices = voices.VoicesResourceWithStreamingResponse(client.voices) + + +class AsyncLmntWithStreamedResponse: + def __init__(self, client: AsyncLmnt) -> None: + self.speech = speech.AsyncSpeechResourceWithStreamingResponse(client.speech) + self.accounts = accounts.AsyncAccountsResourceWithStreamingResponse(client.accounts) + self.voices = voices.AsyncVoicesResourceWithStreamingResponse(client.voices) + + +Client = Lmnt + +AsyncClient = AsyncLmnt diff --git a/src/lmnt/_compat.py b/src/lmnt/_compat.py new file mode 100644 index 0000000..92d9ee6 --- /dev/null +++ b/src/lmnt/_compat.py @@ -0,0 +1,219 @@ +from __future__ import annotations + +from typing import TYPE_CHECKING, Any, Union, Generic, TypeVar, Callable, cast, overload +from datetime import date, datetime +from typing_extensions import Self, Literal + +import pydantic +from pydantic.fields import FieldInfo + +from ._types import IncEx, StrBytesIntFloat + +_T = TypeVar("_T") +_ModelT = TypeVar("_ModelT", bound=pydantic.BaseModel) + +# --------------- Pydantic v2 compatibility --------------- + +# Pyright incorrectly reports some of our functions as overriding a method when they don't +# pyright: reportIncompatibleMethodOverride=false + +PYDANTIC_V2 = pydantic.VERSION.startswith("2.") + +# v1 re-exports +if TYPE_CHECKING: + + def parse_date(value: date | StrBytesIntFloat) -> date: # noqa: ARG001 + ... + + def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: # noqa: ARG001 + ... + + def get_args(t: type[Any]) -> tuple[Any, ...]: # noqa: ARG001 + ... + + def is_union(tp: type[Any] | None) -> bool: # noqa: ARG001 + ... + + def get_origin(t: type[Any]) -> type[Any] | None: # noqa: ARG001 + ... + + def is_literal_type(type_: type[Any]) -> bool: # noqa: ARG001 + ... + + def is_typeddict(type_: type[Any]) -> bool: # noqa: ARG001 + ... + +else: + if PYDANTIC_V2: + from pydantic.v1.typing import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + is_typeddict as is_typeddict, + is_literal_type as is_literal_type, + ) + from pydantic.v1.datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime + else: + from pydantic.typing import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + is_typeddict as is_typeddict, + is_literal_type as is_literal_type, + ) + from pydantic.datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime + + +# refactored config +if TYPE_CHECKING: + from pydantic import ConfigDict as ConfigDict +else: + if PYDANTIC_V2: + from pydantic import ConfigDict + else: + # TODO: provide an error message here? + ConfigDict = None + + +# renamed methods / properties +def parse_obj(model: type[_ModelT], value: object) -> _ModelT: + if PYDANTIC_V2: + return model.model_validate(value) + else: + return cast(_ModelT, model.parse_obj(value)) # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + + +def field_is_required(field: FieldInfo) -> bool: + if PYDANTIC_V2: + return field.is_required() + return field.required # type: ignore + + +def field_get_default(field: FieldInfo) -> Any: + value = field.get_default() + if PYDANTIC_V2: + from pydantic_core import PydanticUndefined + + if value == PydanticUndefined: + return None + return value + return value + + +def field_outer_type(field: FieldInfo) -> Any: + if PYDANTIC_V2: + return field.annotation + return field.outer_type_ # type: ignore + + +def get_model_config(model: type[pydantic.BaseModel]) -> Any: + if PYDANTIC_V2: + return model.model_config + return model.__config__ # type: ignore + + +def get_model_fields(model: type[pydantic.BaseModel]) -> dict[str, FieldInfo]: + if PYDANTIC_V2: + return model.model_fields + return model.__fields__ # type: ignore + + +def model_copy(model: _ModelT, *, deep: bool = False) -> _ModelT: + if PYDANTIC_V2: + return model.model_copy(deep=deep) + return model.copy(deep=deep) # type: ignore + + +def model_json(model: pydantic.BaseModel, *, indent: int | None = None) -> str: + if PYDANTIC_V2: + return model.model_dump_json(indent=indent) + return model.json(indent=indent) # type: ignore + + +def model_dump( + model: pydantic.BaseModel, + *, + exclude: IncEx | None = None, + exclude_unset: bool = False, + exclude_defaults: bool = False, + warnings: bool = True, + mode: Literal["json", "python"] = "python", +) -> dict[str, Any]: + if PYDANTIC_V2 or hasattr(model, "model_dump"): + return model.model_dump( + mode=mode, + exclude=exclude, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + # warnings are not supported in Pydantic v1 + warnings=warnings if PYDANTIC_V2 else True, + ) + return cast( + "dict[str, Any]", + model.dict( # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + exclude=exclude, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + ), + ) + + +def model_parse(model: type[_ModelT], data: Any) -> _ModelT: + if PYDANTIC_V2: + return model.model_validate(data) + return model.parse_obj(data) # pyright: ignore[reportDeprecated] + + +# generic models +if TYPE_CHECKING: + + class GenericModel(pydantic.BaseModel): ... + +else: + if PYDANTIC_V2: + # there no longer needs to be a distinction in v2 but + # we still have to create our own subclass to avoid + # inconsistent MRO ordering errors + class GenericModel(pydantic.BaseModel): ... + + else: + import pydantic.generics + + class GenericModel(pydantic.generics.GenericModel, pydantic.BaseModel): ... + + +# cached properties +if TYPE_CHECKING: + cached_property = property + + # we define a separate type (copied from typeshed) + # that represents that `cached_property` is `set`able + # at runtime, which differs from `@property`. + # + # this is a separate type as editors likely special case + # `@property` and we don't want to cause issues just to have + # more helpful internal types. + + class typed_cached_property(Generic[_T]): + func: Callable[[Any], _T] + attrname: str | None + + def __init__(self, func: Callable[[Any], _T]) -> None: ... + + @overload + def __get__(self, instance: None, owner: type[Any] | None = None) -> Self: ... + + @overload + def __get__(self, instance: object, owner: type[Any] | None = None) -> _T: ... + + def __get__(self, instance: object, owner: type[Any] | None = None) -> _T | Self: + raise NotImplementedError() + + def __set_name__(self, owner: type[Any], name: str) -> None: ... + + # __set__ is not defined at runtime, but @cached_property is designed to be settable + def __set__(self, instance: object, value: _T) -> None: ... +else: + from functools import cached_property as cached_property + + typed_cached_property = cached_property diff --git a/src/lmnt/_constants.py b/src/lmnt/_constants.py new file mode 100644 index 0000000..6ddf2c7 --- /dev/null +++ b/src/lmnt/_constants.py @@ -0,0 +1,14 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +import httpx + +RAW_RESPONSE_HEADER = "X-Stainless-Raw-Response" +OVERRIDE_CAST_TO_HEADER = "____stainless_override_cast_to" + +# default timeout is 1 minute +DEFAULT_TIMEOUT = httpx.Timeout(timeout=60, connect=5.0) +DEFAULT_MAX_RETRIES = 2 +DEFAULT_CONNECTION_LIMITS = httpx.Limits(max_connections=100, max_keepalive_connections=20) + +INITIAL_RETRY_DELAY = 0.5 +MAX_RETRY_DELAY = 8.0 diff --git a/src/lmnt/_exceptions.py b/src/lmnt/_exceptions.py new file mode 100644 index 0000000..e28409d --- /dev/null +++ b/src/lmnt/_exceptions.py @@ -0,0 +1,108 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal + +import httpx + +__all__ = [ + "BadRequestError", + "AuthenticationError", + "PermissionDeniedError", + "NotFoundError", + "ConflictError", + "UnprocessableEntityError", + "RateLimitError", + "InternalServerError", +] + + +class LmntError(Exception): + pass + + +class APIError(LmntError): + message: str + request: httpx.Request + + body: object | None + """The API response body. + + If the API responded with a valid JSON structure then this property will be the + decoded result. + + If it isn't a valid JSON structure then this will be the raw response. + + If there was no response associated with this error then it will be `None`. + """ + + def __init__(self, message: str, request: httpx.Request, *, body: object | None) -> None: # noqa: ARG002 + super().__init__(message) + self.request = request + self.message = message + self.body = body + + +class APIResponseValidationError(APIError): + response: httpx.Response + status_code: int + + def __init__(self, response: httpx.Response, body: object | None, *, message: str | None = None) -> None: + super().__init__(message or "Data returned by API invalid for expected schema.", response.request, body=body) + self.response = response + self.status_code = response.status_code + + +class APIStatusError(APIError): + """Raised when an API response has a status code of 4xx or 5xx.""" + + response: httpx.Response + status_code: int + + def __init__(self, message: str, *, response: httpx.Response, body: object | None) -> None: + super().__init__(message, response.request, body=body) + self.response = response + self.status_code = response.status_code + + +class APIConnectionError(APIError): + def __init__(self, *, message: str = "Connection error.", request: httpx.Request) -> None: + super().__init__(message, request, body=None) + + +class APITimeoutError(APIConnectionError): + def __init__(self, request: httpx.Request) -> None: + super().__init__(message="Request timed out.", request=request) + + +class BadRequestError(APIStatusError): + status_code: Literal[400] = 400 # pyright: ignore[reportIncompatibleVariableOverride] + + +class AuthenticationError(APIStatusError): + status_code: Literal[401] = 401 # pyright: ignore[reportIncompatibleVariableOverride] + + +class PermissionDeniedError(APIStatusError): + status_code: Literal[403] = 403 # pyright: ignore[reportIncompatibleVariableOverride] + + +class NotFoundError(APIStatusError): + status_code: Literal[404] = 404 # pyright: ignore[reportIncompatibleVariableOverride] + + +class ConflictError(APIStatusError): + status_code: Literal[409] = 409 # pyright: ignore[reportIncompatibleVariableOverride] + + +class UnprocessableEntityError(APIStatusError): + status_code: Literal[422] = 422 # pyright: ignore[reportIncompatibleVariableOverride] + + +class RateLimitError(APIStatusError): + status_code: Literal[429] = 429 # pyright: ignore[reportIncompatibleVariableOverride] + + +class InternalServerError(APIStatusError): + pass diff --git a/src/lmnt/_files.py b/src/lmnt/_files.py new file mode 100644 index 0000000..4c5e37e --- /dev/null +++ b/src/lmnt/_files.py @@ -0,0 +1,123 @@ +from __future__ import annotations + +import io +import os +import pathlib +from typing import overload +from typing_extensions import TypeGuard + +import anyio + +from ._types import ( + FileTypes, + FileContent, + RequestFiles, + HttpxFileTypes, + Base64FileInput, + HttpxFileContent, + HttpxRequestFiles, +) +from ._utils import is_tuple_t, is_mapping_t, is_sequence_t + + +def is_base64_file_input(obj: object) -> TypeGuard[Base64FileInput]: + return isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike) + + +def is_file_content(obj: object) -> TypeGuard[FileContent]: + return ( + isinstance(obj, bytes) or isinstance(obj, tuple) or isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike) + ) + + +def assert_is_file_content(obj: object, *, key: str | None = None) -> None: + if not is_file_content(obj): + prefix = f"Expected entry at `{key}`" if key is not None else f"Expected file input `{obj!r}`" + raise RuntimeError( + f"{prefix} to be bytes, an io.IOBase instance, PathLike or a tuple but received {type(obj)} instead. See https://github.com/stainless-sdks/lmnt-com-python/tree/main#file-uploads" + ) from None + + +@overload +def to_httpx_files(files: None) -> None: ... + + +@overload +def to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ... + + +def to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None: + if files is None: + return None + + if is_mapping_t(files): + files = {key: _transform_file(file) for key, file in files.items()} + elif is_sequence_t(files): + files = [(key, _transform_file(file)) for key, file in files] + else: + raise TypeError(f"Unexpected file type input {type(files)}, expected mapping or sequence") + + return files + + +def _transform_file(file: FileTypes) -> HttpxFileTypes: + if is_file_content(file): + if isinstance(file, os.PathLike): + path = pathlib.Path(file) + return (path.name, path.read_bytes()) + + return file + + if is_tuple_t(file): + return (file[0], _read_file_content(file[1]), *file[2:]) + + raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple") + + +def _read_file_content(file: FileContent) -> HttpxFileContent: + if isinstance(file, os.PathLike): + return pathlib.Path(file).read_bytes() + return file + + +@overload +async def async_to_httpx_files(files: None) -> None: ... + + +@overload +async def async_to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ... + + +async def async_to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None: + if files is None: + return None + + if is_mapping_t(files): + files = {key: await _async_transform_file(file) for key, file in files.items()} + elif is_sequence_t(files): + files = [(key, await _async_transform_file(file)) for key, file in files] + else: + raise TypeError("Unexpected file type input {type(files)}, expected mapping or sequence") + + return files + + +async def _async_transform_file(file: FileTypes) -> HttpxFileTypes: + if is_file_content(file): + if isinstance(file, os.PathLike): + path = anyio.Path(file) + return (path.name, await path.read_bytes()) + + return file + + if is_tuple_t(file): + return (file[0], await _async_read_file_content(file[1]), *file[2:]) + + raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple") + + +async def _async_read_file_content(file: FileContent) -> HttpxFileContent: + if isinstance(file, os.PathLike): + return await anyio.Path(file).read_bytes() + + return file diff --git a/src/lmnt/_models.py b/src/lmnt/_models.py new file mode 100644 index 0000000..528d568 --- /dev/null +++ b/src/lmnt/_models.py @@ -0,0 +1,808 @@ +from __future__ import annotations + +import os +import inspect +from typing import TYPE_CHECKING, Any, Type, Union, Generic, TypeVar, Callable, Optional, cast +from datetime import date, datetime +from typing_extensions import ( + List, + Unpack, + Literal, + ClassVar, + Protocol, + Required, + ParamSpec, + TypedDict, + TypeGuard, + final, + override, + runtime_checkable, +) + +import pydantic +from pydantic.fields import FieldInfo + +from ._types import ( + Body, + IncEx, + Query, + ModelT, + Headers, + Timeout, + NotGiven, + AnyMapping, + HttpxRequestFiles, +) +from ._utils import ( + PropertyInfo, + is_list, + is_given, + json_safe, + lru_cache, + is_mapping, + parse_date, + coerce_boolean, + parse_datetime, + strip_not_given, + extract_type_arg, + is_annotated_type, + is_type_alias_type, + strip_annotated_type, +) +from ._compat import ( + PYDANTIC_V2, + ConfigDict, + GenericModel as BaseGenericModel, + get_args, + is_union, + parse_obj, + get_origin, + is_literal_type, + get_model_config, + get_model_fields, + field_get_default, +) +from ._constants import RAW_RESPONSE_HEADER + +if TYPE_CHECKING: + from pydantic_core.core_schema import ModelField, ModelSchema, LiteralSchema, ModelFieldsSchema + +__all__ = ["BaseModel", "GenericModel"] + +_T = TypeVar("_T") +_BaseModelT = TypeVar("_BaseModelT", bound="BaseModel") + +P = ParamSpec("P") + + +@runtime_checkable +class _ConfigProtocol(Protocol): + allow_population_by_field_name: bool + + +class BaseModel(pydantic.BaseModel): + if PYDANTIC_V2: + model_config: ClassVar[ConfigDict] = ConfigDict( + extra="allow", defer_build=coerce_boolean(os.environ.get("DEFER_PYDANTIC_BUILD", "true")) + ) + else: + + @property + @override + def model_fields_set(self) -> set[str]: + # a forwards-compat shim for pydantic v2 + return self.__fields_set__ # type: ignore + + class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated] + extra: Any = pydantic.Extra.allow # type: ignore + + def to_dict( + self, + *, + mode: Literal["json", "python"] = "python", + use_api_names: bool = True, + exclude_unset: bool = True, + exclude_defaults: bool = False, + exclude_none: bool = False, + warnings: bool = True, + ) -> dict[str, object]: + """Recursively generate a dictionary representation of the model, optionally specifying which fields to include or exclude. + + By default, fields that were not set by the API will not be included, + and keys will match the API response, *not* the property names from the model. + + For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property, + the output will use the `"fooBar"` key (unless `use_api_names=False` is passed). + + Args: + mode: + If mode is 'json', the dictionary will only contain JSON serializable types. e.g. `datetime` will be turned into a string, `"2024-3-22T18:11:19.117000Z"`. + If mode is 'python', the dictionary may contain any Python objects. e.g. `datetime(2024, 3, 22)` + + use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that are set to their default value from the output. + exclude_none: Whether to exclude fields that have a value of `None` from the output. + warnings: Whether to log warnings when invalid fields are encountered. This is only supported in Pydantic v2. + """ + return self.model_dump( + mode=mode, + by_alias=use_api_names, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + warnings=warnings, + ) + + def to_json( + self, + *, + indent: int | None = 2, + use_api_names: bool = True, + exclude_unset: bool = True, + exclude_defaults: bool = False, + exclude_none: bool = False, + warnings: bool = True, + ) -> str: + """Generates a JSON string representing this model as it would be received from or sent to the API (but with indentation). + + By default, fields that were not set by the API will not be included, + and keys will match the API response, *not* the property names from the model. + + For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property, + the output will use the `"fooBar"` key (unless `use_api_names=False` is passed). + + Args: + indent: Indentation to use in the JSON output. If `None` is passed, the output will be compact. Defaults to `2` + use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that have the default value. + exclude_none: Whether to exclude fields that have a value of `None`. + warnings: Whether to show any warnings that occurred during serialization. This is only supported in Pydantic v2. + """ + return self.model_dump_json( + indent=indent, + by_alias=use_api_names, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + warnings=warnings, + ) + + @override + def __str__(self) -> str: + # mypy complains about an invalid self arg + return f"{self.__repr_name__()}({self.__repr_str__(', ')})" # type: ignore[misc] + + # Override the 'construct' method in a way that supports recursive parsing without validation. + # Based on https://github.com/samuelcolvin/pydantic/issues/1168#issuecomment-817742836. + @classmethod + @override + def construct( # pyright: ignore[reportIncompatibleMethodOverride] + __cls: Type[ModelT], + _fields_set: set[str] | None = None, + **values: object, + ) -> ModelT: + m = __cls.__new__(__cls) + fields_values: dict[str, object] = {} + + config = get_model_config(__cls) + populate_by_name = ( + config.allow_population_by_field_name + if isinstance(config, _ConfigProtocol) + else config.get("populate_by_name") + ) + + if _fields_set is None: + _fields_set = set() + + model_fields = get_model_fields(__cls) + for name, field in model_fields.items(): + key = field.alias + if key is None or (key not in values and populate_by_name): + key = name + + if key in values: + fields_values[name] = _construct_field(value=values[key], field=field, key=key) + _fields_set.add(name) + else: + fields_values[name] = field_get_default(field) + + _extra = {} + for key, value in values.items(): + if key not in model_fields: + if PYDANTIC_V2: + _extra[key] = value + else: + _fields_set.add(key) + fields_values[key] = value + + object.__setattr__(m, "__dict__", fields_values) + + if PYDANTIC_V2: + # these properties are copied from Pydantic's `model_construct()` method + object.__setattr__(m, "__pydantic_private__", None) + object.__setattr__(m, "__pydantic_extra__", _extra) + object.__setattr__(m, "__pydantic_fields_set__", _fields_set) + else: + # init_private_attributes() does not exist in v2 + m._init_private_attributes() # type: ignore + + # copied from Pydantic v1's `construct()` method + object.__setattr__(m, "__fields_set__", _fields_set) + + return m + + if not TYPE_CHECKING: + # type checkers incorrectly complain about this assignment + # because the type signatures are technically different + # although not in practice + model_construct = construct + + if not PYDANTIC_V2: + # we define aliases for some of the new pydantic v2 methods so + # that we can just document these methods without having to specify + # a specific pydantic version as some users may not know which + # pydantic version they are currently using + + @override + def model_dump( + self, + *, + mode: Literal["json", "python"] | str = "python", + include: IncEx | None = None, + exclude: IncEx | None = None, + by_alias: bool = False, + exclude_unset: bool = False, + exclude_defaults: bool = False, + exclude_none: bool = False, + round_trip: bool = False, + warnings: bool | Literal["none", "warn", "error"] = True, + context: dict[str, Any] | None = None, + serialize_as_any: bool = False, + ) -> dict[str, Any]: + """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump + + Generate a dictionary representation of the model, optionally specifying which fields to include or exclude. + + Args: + mode: The mode in which `to_python` should run. + If mode is 'json', the dictionary will only contain JSON serializable types. + If mode is 'python', the dictionary may contain any Python objects. + include: A list of fields to include in the output. + exclude: A list of fields to exclude from the output. + by_alias: Whether to use the field's alias in the dictionary key if defined. + exclude_unset: Whether to exclude fields that are unset or None from the output. + exclude_defaults: Whether to exclude fields that are set to their default value from the output. + exclude_none: Whether to exclude fields that have a value of `None` from the output. + round_trip: Whether to enable serialization and deserialization round-trip support. + warnings: Whether to log warnings when invalid fields are encountered. + + Returns: + A dictionary representation of the model. + """ + if mode not in {"json", "python"}: + raise ValueError("mode must be either 'json' or 'python'") + if round_trip != False: + raise ValueError("round_trip is only supported in Pydantic v2") + if warnings != True: + raise ValueError("warnings is only supported in Pydantic v2") + if context is not None: + raise ValueError("context is only supported in Pydantic v2") + if serialize_as_any != False: + raise ValueError("serialize_as_any is only supported in Pydantic v2") + dumped = super().dict( # pyright: ignore[reportDeprecated] + include=include, + exclude=exclude, + by_alias=by_alias, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + ) + + return cast(dict[str, Any], json_safe(dumped)) if mode == "json" else dumped + + @override + def model_dump_json( + self, + *, + indent: int | None = None, + include: IncEx | None = None, + exclude: IncEx | None = None, + by_alias: bool = False, + exclude_unset: bool = False, + exclude_defaults: bool = False, + exclude_none: bool = False, + round_trip: bool = False, + warnings: bool | Literal["none", "warn", "error"] = True, + context: dict[str, Any] | None = None, + serialize_as_any: bool = False, + ) -> str: + """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump_json + + Generates a JSON representation of the model using Pydantic's `to_json` method. + + Args: + indent: Indentation to use in the JSON output. If None is passed, the output will be compact. + include: Field(s) to include in the JSON output. Can take either a string or set of strings. + exclude: Field(s) to exclude from the JSON output. Can take either a string or set of strings. + by_alias: Whether to serialize using field aliases. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that have the default value. + exclude_none: Whether to exclude fields that have a value of `None`. + round_trip: Whether to use serialization/deserialization between JSON and class instance. + warnings: Whether to show any warnings that occurred during serialization. + + Returns: + A JSON string representation of the model. + """ + if round_trip != False: + raise ValueError("round_trip is only supported in Pydantic v2") + if warnings != True: + raise ValueError("warnings is only supported in Pydantic v2") + if context is not None: + raise ValueError("context is only supported in Pydantic v2") + if serialize_as_any != False: + raise ValueError("serialize_as_any is only supported in Pydantic v2") + return super().json( # type: ignore[reportDeprecated] + indent=indent, + include=include, + exclude=exclude, + by_alias=by_alias, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + ) + + +def _construct_field(value: object, field: FieldInfo, key: str) -> object: + if value is None: + return field_get_default(field) + + if PYDANTIC_V2: + type_ = field.annotation + else: + type_ = cast(type, field.outer_type_) # type: ignore + + if type_ is None: + raise RuntimeError(f"Unexpected field type is None for {key}") + + return construct_type(value=value, type_=type_, metadata=getattr(field, "metadata", None)) + + +def is_basemodel(type_: type) -> bool: + """Returns whether or not the given type is either a `BaseModel` or a union of `BaseModel`""" + if is_union(type_): + for variant in get_args(type_): + if is_basemodel(variant): + return True + + return False + + return is_basemodel_type(type_) + + +def is_basemodel_type(type_: type) -> TypeGuard[type[BaseModel] | type[GenericModel]]: + origin = get_origin(type_) or type_ + if not inspect.isclass(origin): + return False + return issubclass(origin, BaseModel) or issubclass(origin, GenericModel) + + +def build( + base_model_cls: Callable[P, _BaseModelT], + *args: P.args, + **kwargs: P.kwargs, +) -> _BaseModelT: + """Construct a BaseModel class without validation. + + This is useful for cases where you need to instantiate a `BaseModel` + from an API response as this provides type-safe params which isn't supported + by helpers like `construct_type()`. + + ```py + build(MyModel, my_field_a="foo", my_field_b=123) + ``` + """ + if args: + raise TypeError( + "Received positional arguments which are not supported; Keyword arguments must be used instead", + ) + + return cast(_BaseModelT, construct_type(type_=base_model_cls, value=kwargs)) + + +def construct_type_unchecked(*, value: object, type_: type[_T]) -> _T: + """Loose coercion to the expected type with construction of nested values. + + Note: the returned value from this function is not guaranteed to match the + given type. + """ + return cast(_T, construct_type(value=value, type_=type_)) + + +def construct_type(*, value: object, type_: object, metadata: Optional[List[Any]] = None) -> object: + """Loose coercion to the expected type with construction of nested values. + + If the given value does not match the expected type then it is returned as-is. + """ + + # store a reference to the original type we were given before we extract any inner + # types so that we can properly resolve forward references in `TypeAliasType` annotations + original_type = None + + # we allow `object` as the input type because otherwise, passing things like + # `Literal['value']` will be reported as a type error by type checkers + type_ = cast("type[object]", type_) + if is_type_alias_type(type_): + original_type = type_ # type: ignore[unreachable] + type_ = type_.__value__ # type: ignore[unreachable] + + # unwrap `Annotated[T, ...]` -> `T` + if metadata is not None: + meta: tuple[Any, ...] = tuple(metadata) + elif is_annotated_type(type_): + meta = get_args(type_)[1:] + type_ = extract_type_arg(type_, 0) + else: + meta = tuple() + + # we need to use the origin class for any types that are subscripted generics + # e.g. Dict[str, object] + origin = get_origin(type_) or type_ + args = get_args(type_) + + if is_union(origin): + try: + return validate_type(type_=cast("type[object]", original_type or type_), value=value) + except Exception: + pass + + # if the type is a discriminated union then we want to construct the right variant + # in the union, even if the data doesn't match exactly, otherwise we'd break code + # that relies on the constructed class types, e.g. + # + # class FooType: + # kind: Literal['foo'] + # value: str + # + # class BarType: + # kind: Literal['bar'] + # value: int + # + # without this block, if the data we get is something like `{'kind': 'bar', 'value': 'foo'}` then + # we'd end up constructing `FooType` when it should be `BarType`. + discriminator = _build_discriminated_union_meta(union=type_, meta_annotations=meta) + if discriminator and is_mapping(value): + variant_value = value.get(discriminator.field_alias_from or discriminator.field_name) + if variant_value and isinstance(variant_value, str): + variant_type = discriminator.mapping.get(variant_value) + if variant_type: + return construct_type(type_=variant_type, value=value) + + # if the data is not valid, use the first variant that doesn't fail while deserializing + for variant in args: + try: + return construct_type(value=value, type_=variant) + except Exception: + continue + + raise RuntimeError(f"Could not convert data into a valid instance of {type_}") + + if origin == dict: + if not is_mapping(value): + return value + + _, items_type = get_args(type_) # Dict[_, items_type] + return {key: construct_type(value=item, type_=items_type) for key, item in value.items()} + + if ( + not is_literal_type(type_) + and inspect.isclass(origin) + and (issubclass(origin, BaseModel) or issubclass(origin, GenericModel)) + ): + if is_list(value): + return [cast(Any, type_).construct(**entry) if is_mapping(entry) else entry for entry in value] + + if is_mapping(value): + if issubclass(type_, BaseModel): + return type_.construct(**value) # type: ignore[arg-type] + + return cast(Any, type_).construct(**value) + + if origin == list: + if not is_list(value): + return value + + inner_type = args[0] # List[inner_type] + return [construct_type(value=entry, type_=inner_type) for entry in value] + + if origin == float: + if isinstance(value, int): + coerced = float(value) + if coerced != value: + return value + return coerced + + return value + + if type_ == datetime: + try: + return parse_datetime(value) # type: ignore + except Exception: + return value + + if type_ == date: + try: + return parse_date(value) # type: ignore + except Exception: + return value + + return value + + +@runtime_checkable +class CachedDiscriminatorType(Protocol): + __discriminator__: DiscriminatorDetails + + +class DiscriminatorDetails: + field_name: str + """The name of the discriminator field in the variant class, e.g. + + ```py + class Foo(BaseModel): + type: Literal['foo'] + ``` + + Will result in field_name='type' + """ + + field_alias_from: str | None + """The name of the discriminator field in the API response, e.g. + + ```py + class Foo(BaseModel): + type: Literal['foo'] = Field(alias='type_from_api') + ``` + + Will result in field_alias_from='type_from_api' + """ + + mapping: dict[str, type] + """Mapping of discriminator value to variant type, e.g. + + {'foo': FooVariant, 'bar': BarVariant} + """ + + def __init__( + self, + *, + mapping: dict[str, type], + discriminator_field: str, + discriminator_alias: str | None, + ) -> None: + self.mapping = mapping + self.field_name = discriminator_field + self.field_alias_from = discriminator_alias + + +def _build_discriminated_union_meta(*, union: type, meta_annotations: tuple[Any, ...]) -> DiscriminatorDetails | None: + if isinstance(union, CachedDiscriminatorType): + return union.__discriminator__ + + discriminator_field_name: str | None = None + + for annotation in meta_annotations: + if isinstance(annotation, PropertyInfo) and annotation.discriminator is not None: + discriminator_field_name = annotation.discriminator + break + + if not discriminator_field_name: + return None + + mapping: dict[str, type] = {} + discriminator_alias: str | None = None + + for variant in get_args(union): + variant = strip_annotated_type(variant) + if is_basemodel_type(variant): + if PYDANTIC_V2: + field = _extract_field_schema_pv2(variant, discriminator_field_name) + if not field: + continue + + # Note: if one variant defines an alias then they all should + discriminator_alias = field.get("serialization_alias") + + field_schema = field["schema"] + + if field_schema["type"] == "literal": + for entry in cast("LiteralSchema", field_schema)["expected"]: + if isinstance(entry, str): + mapping[entry] = variant + else: + field_info = cast("dict[str, FieldInfo]", variant.__fields__).get(discriminator_field_name) # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + if not field_info: + continue + + # Note: if one variant defines an alias then they all should + discriminator_alias = field_info.alias + + if (annotation := getattr(field_info, "annotation", None)) and is_literal_type(annotation): + for entry in get_args(annotation): + if isinstance(entry, str): + mapping[entry] = variant + + if not mapping: + return None + + details = DiscriminatorDetails( + mapping=mapping, + discriminator_field=discriminator_field_name, + discriminator_alias=discriminator_alias, + ) + cast(CachedDiscriminatorType, union).__discriminator__ = details + return details + + +def _extract_field_schema_pv2(model: type[BaseModel], field_name: str) -> ModelField | None: + schema = model.__pydantic_core_schema__ + if schema["type"] == "definitions": + schema = schema["schema"] + + if schema["type"] != "model": + return None + + schema = cast("ModelSchema", schema) + fields_schema = schema["schema"] + if fields_schema["type"] != "model-fields": + return None + + fields_schema = cast("ModelFieldsSchema", fields_schema) + field = fields_schema["fields"].get(field_name) + if not field: + return None + + return cast("ModelField", field) # pyright: ignore[reportUnnecessaryCast] + + +def validate_type(*, type_: type[_T], value: object) -> _T: + """Strict validation that the given value matches the expected type""" + if inspect.isclass(type_) and issubclass(type_, pydantic.BaseModel): + return cast(_T, parse_obj(type_, value)) + + return cast(_T, _validate_non_model_type(type_=type_, value=value)) + + +def set_pydantic_config(typ: Any, config: pydantic.ConfigDict) -> None: + """Add a pydantic config for the given type. + + Note: this is a no-op on Pydantic v1. + """ + setattr(typ, "__pydantic_config__", config) # noqa: B010 + + +# our use of subclassing here causes weirdness for type checkers, +# so we just pretend that we don't subclass +if TYPE_CHECKING: + GenericModel = BaseModel +else: + + class GenericModel(BaseGenericModel, BaseModel): + pass + + +if PYDANTIC_V2: + from pydantic import TypeAdapter as _TypeAdapter + + _CachedTypeAdapter = cast("TypeAdapter[object]", lru_cache(maxsize=None)(_TypeAdapter)) + + if TYPE_CHECKING: + from pydantic import TypeAdapter + else: + TypeAdapter = _CachedTypeAdapter + + def _validate_non_model_type(*, type_: type[_T], value: object) -> _T: + return TypeAdapter(type_).validate_python(value) + +elif not TYPE_CHECKING: # TODO: condition is weird + + class RootModel(GenericModel, Generic[_T]): + """Used as a placeholder to easily convert runtime types to a Pydantic format + to provide validation. + + For example: + ```py + validated = RootModel[int](__root__="5").__root__ + # validated: 5 + ``` + """ + + __root__: _T + + def _validate_non_model_type(*, type_: type[_T], value: object) -> _T: + model = _create_pydantic_model(type_).validate(value) + return cast(_T, model.__root__) + + def _create_pydantic_model(type_: _T) -> Type[RootModel[_T]]: + return RootModel[type_] # type: ignore + + +class FinalRequestOptionsInput(TypedDict, total=False): + method: Required[str] + url: Required[str] + params: Query + headers: Headers + max_retries: int + timeout: float | Timeout | None + files: HttpxRequestFiles | None + idempotency_key: str + json_data: Body + extra_json: AnyMapping + follow_redirects: bool + + +@final +class FinalRequestOptions(pydantic.BaseModel): + method: str + url: str + params: Query = {} + headers: Union[Headers, NotGiven] = NotGiven() + max_retries: Union[int, NotGiven] = NotGiven() + timeout: Union[float, Timeout, None, NotGiven] = NotGiven() + files: Union[HttpxRequestFiles, None] = None + idempotency_key: Union[str, None] = None + post_parser: Union[Callable[[Any], Any], NotGiven] = NotGiven() + follow_redirects: Union[bool, None] = None + + # It should be noted that we cannot use `json` here as that would override + # a BaseModel method in an incompatible fashion. + json_data: Union[Body, None] = None + extra_json: Union[AnyMapping, None] = None + + if PYDANTIC_V2: + model_config: ClassVar[ConfigDict] = ConfigDict(arbitrary_types_allowed=True) + else: + + class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated] + arbitrary_types_allowed: bool = True + + def get_max_retries(self, max_retries: int) -> int: + if isinstance(self.max_retries, NotGiven): + return max_retries + return self.max_retries + + def _strip_raw_response_header(self) -> None: + if not is_given(self.headers): + return + + if self.headers.get(RAW_RESPONSE_HEADER): + self.headers = {**self.headers} + self.headers.pop(RAW_RESPONSE_HEADER) + + # override the `construct` method so that we can run custom transformations. + # this is necessary as we don't want to do any actual runtime type checking + # (which means we can't use validators) but we do want to ensure that `NotGiven` + # values are not present + # + # type ignore required because we're adding explicit types to `**values` + @classmethod + def construct( # type: ignore + cls, + _fields_set: set[str] | None = None, + **values: Unpack[FinalRequestOptionsInput], + ) -> FinalRequestOptions: + kwargs: dict[str, Any] = { + # we unconditionally call `strip_not_given` on any value + # as it will just ignore any non-mapping types + key: strip_not_given(value) + for key, value in values.items() + } + if PYDANTIC_V2: + return super().model_construct(_fields_set, **kwargs) + return cast(FinalRequestOptions, super().construct(_fields_set, **kwargs)) # pyright: ignore[reportDeprecated] + + if not TYPE_CHECKING: + # type checkers incorrectly complain about this assignment + model_construct = construct diff --git a/src/lmnt/_qs.py b/src/lmnt/_qs.py new file mode 100644 index 0000000..274320c --- /dev/null +++ b/src/lmnt/_qs.py @@ -0,0 +1,150 @@ +from __future__ import annotations + +from typing import Any, List, Tuple, Union, Mapping, TypeVar +from urllib.parse import parse_qs, urlencode +from typing_extensions import Literal, get_args + +from ._types import NOT_GIVEN, NotGiven, NotGivenOr +from ._utils import flatten + +_T = TypeVar("_T") + + +ArrayFormat = Literal["comma", "repeat", "indices", "brackets"] +NestedFormat = Literal["dots", "brackets"] + +PrimitiveData = Union[str, int, float, bool, None] +# this should be Data = Union[PrimitiveData, "List[Data]", "Tuple[Data]", "Mapping[str, Data]"] +# https://github.com/microsoft/pyright/issues/3555 +Data = Union[PrimitiveData, List[Any], Tuple[Any], "Mapping[str, Any]"] +Params = Mapping[str, Data] + + +class Querystring: + array_format: ArrayFormat + nested_format: NestedFormat + + def __init__( + self, + *, + array_format: ArrayFormat = "repeat", + nested_format: NestedFormat = "brackets", + ) -> None: + self.array_format = array_format + self.nested_format = nested_format + + def parse(self, query: str) -> Mapping[str, object]: + # Note: custom format syntax is not supported yet + return parse_qs(query) + + def stringify( + self, + params: Params, + *, + array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN, + nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN, + ) -> str: + return urlencode( + self.stringify_items( + params, + array_format=array_format, + nested_format=nested_format, + ) + ) + + def stringify_items( + self, + params: Params, + *, + array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN, + nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN, + ) -> list[tuple[str, str]]: + opts = Options( + qs=self, + array_format=array_format, + nested_format=nested_format, + ) + return flatten([self._stringify_item(key, value, opts) for key, value in params.items()]) + + def _stringify_item( + self, + key: str, + value: Data, + opts: Options, + ) -> list[tuple[str, str]]: + if isinstance(value, Mapping): + items: list[tuple[str, str]] = [] + nested_format = opts.nested_format + for subkey, subvalue in value.items(): + items.extend( + self._stringify_item( + # TODO: error if unknown format + f"{key}.{subkey}" if nested_format == "dots" else f"{key}[{subkey}]", + subvalue, + opts, + ) + ) + return items + + if isinstance(value, (list, tuple)): + array_format = opts.array_format + if array_format == "comma": + return [ + ( + key, + ",".join(self._primitive_value_to_str(item) for item in value if item is not None), + ), + ] + elif array_format == "repeat": + items = [] + for item in value: + items.extend(self._stringify_item(key, item, opts)) + return items + elif array_format == "indices": + raise NotImplementedError("The array indices format is not supported yet") + elif array_format == "brackets": + items = [] + key = key + "[]" + for item in value: + items.extend(self._stringify_item(key, item, opts)) + return items + else: + raise NotImplementedError( + f"Unknown array_format value: {array_format}, choose from {', '.join(get_args(ArrayFormat))}" + ) + + serialised = self._primitive_value_to_str(value) + if not serialised: + return [] + return [(key, serialised)] + + def _primitive_value_to_str(self, value: PrimitiveData) -> str: + # copied from httpx + if value is True: + return "true" + elif value is False: + return "false" + elif value is None: + return "" + return str(value) + + +_qs = Querystring() +parse = _qs.parse +stringify = _qs.stringify +stringify_items = _qs.stringify_items + + +class Options: + array_format: ArrayFormat + nested_format: NestedFormat + + def __init__( + self, + qs: Querystring = _qs, + *, + array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN, + nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN, + ) -> None: + self.array_format = qs.array_format if isinstance(array_format, NotGiven) else array_format + self.nested_format = qs.nested_format if isinstance(nested_format, NotGiven) else nested_format diff --git a/src/lmnt/_resource.py b/src/lmnt/_resource.py new file mode 100644 index 0000000..aaf4e4c --- /dev/null +++ b/src/lmnt/_resource.py @@ -0,0 +1,43 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import time +from typing import TYPE_CHECKING + +import anyio + +if TYPE_CHECKING: + from ._client import Lmnt, AsyncLmnt + + +class SyncAPIResource: + _client: Lmnt + + def __init__(self, client: Lmnt) -> None: + self._client = client + self._get = client.get + self._post = client.post + self._patch = client.patch + self._put = client.put + self._delete = client.delete + self._get_api_list = client.get_api_list + + def _sleep(self, seconds: float) -> None: + time.sleep(seconds) + + +class AsyncAPIResource: + _client: AsyncLmnt + + def __init__(self, client: AsyncLmnt) -> None: + self._client = client + self._get = client.get + self._post = client.post + self._patch = client.patch + self._put = client.put + self._delete = client.delete + self._get_api_list = client.get_api_list + + async def _sleep(self, seconds: float) -> None: + await anyio.sleep(seconds) diff --git a/src/lmnt/_response.py b/src/lmnt/_response.py new file mode 100644 index 0000000..aae7cd1 --- /dev/null +++ b/src/lmnt/_response.py @@ -0,0 +1,830 @@ +from __future__ import annotations + +import os +import inspect +import logging +import datetime +import functools +from types import TracebackType +from typing import ( + TYPE_CHECKING, + Any, + Union, + Generic, + TypeVar, + Callable, + Iterator, + AsyncIterator, + cast, + overload, +) +from typing_extensions import Awaitable, ParamSpec, override, get_origin + +import anyio +import httpx +import pydantic + +from ._types import NoneType +from ._utils import is_given, extract_type_arg, is_annotated_type, is_type_alias_type, extract_type_var_from_base +from ._models import BaseModel, is_basemodel +from ._constants import RAW_RESPONSE_HEADER, OVERRIDE_CAST_TO_HEADER +from ._streaming import Stream, AsyncStream, is_stream_class_type, extract_stream_chunk_type +from ._exceptions import LmntError, APIResponseValidationError + +if TYPE_CHECKING: + from ._models import FinalRequestOptions + from ._base_client import BaseClient + + +P = ParamSpec("P") +R = TypeVar("R") +_T = TypeVar("_T") +_APIResponseT = TypeVar("_APIResponseT", bound="APIResponse[Any]") +_AsyncAPIResponseT = TypeVar("_AsyncAPIResponseT", bound="AsyncAPIResponse[Any]") + +log: logging.Logger = logging.getLogger(__name__) + + +class BaseAPIResponse(Generic[R]): + _cast_to: type[R] + _client: BaseClient[Any, Any] + _parsed_by_type: dict[type[Any], Any] + _is_sse_stream: bool + _stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None + _options: FinalRequestOptions + + http_response: httpx.Response + + retries_taken: int + """The number of retries made. If no retries happened this will be `0`""" + + def __init__( + self, + *, + raw: httpx.Response, + cast_to: type[R], + client: BaseClient[Any, Any], + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + options: FinalRequestOptions, + retries_taken: int = 0, + ) -> None: + self._cast_to = cast_to + self._client = client + self._parsed_by_type = {} + self._is_sse_stream = stream + self._stream_cls = stream_cls + self._options = options + self.http_response = raw + self.retries_taken = retries_taken + + @property + def headers(self) -> httpx.Headers: + return self.http_response.headers + + @property + def http_request(self) -> httpx.Request: + """Returns the httpx Request instance associated with the current response.""" + return self.http_response.request + + @property + def status_code(self) -> int: + return self.http_response.status_code + + @property + def url(self) -> httpx.URL: + """Returns the URL for which the request was made.""" + return self.http_response.url + + @property + def method(self) -> str: + return self.http_request.method + + @property + def http_version(self) -> str: + return self.http_response.http_version + + @property + def elapsed(self) -> datetime.timedelta: + """The time taken for the complete request/response cycle to complete.""" + return self.http_response.elapsed + + @property + def is_closed(self) -> bool: + """Whether or not the response body has been closed. + + If this is False then there is response data that has not been read yet. + You must either fully consume the response body or call `.close()` + before discarding the response to prevent resource leaks. + """ + return self.http_response.is_closed + + @override + def __repr__(self) -> str: + return ( + f"<{self.__class__.__name__} [{self.status_code} {self.http_response.reason_phrase}] type={self._cast_to}>" + ) + + def _parse(self, *, to: type[_T] | None = None) -> R | _T: + cast_to = to if to is not None else self._cast_to + + # unwrap `TypeAlias('Name', T)` -> `T` + if is_type_alias_type(cast_to): + cast_to = cast_to.__value__ # type: ignore[unreachable] + + # unwrap `Annotated[T, ...]` -> `T` + if cast_to and is_annotated_type(cast_to): + cast_to = extract_type_arg(cast_to, 0) + + origin = get_origin(cast_to) or cast_to + + if self._is_sse_stream: + if to: + if not is_stream_class_type(to): + raise TypeError(f"Expected custom parse type to be a subclass of {Stream} or {AsyncStream}") + + return cast( + _T, + to( + cast_to=extract_stream_chunk_type( + to, + failure_message="Expected custom stream type to be passed with a type argument, e.g. Stream[ChunkType]", + ), + response=self.http_response, + client=cast(Any, self._client), + ), + ) + + if self._stream_cls: + return cast( + R, + self._stream_cls( + cast_to=extract_stream_chunk_type(self._stream_cls), + response=self.http_response, + client=cast(Any, self._client), + ), + ) + + stream_cls = cast("type[Stream[Any]] | type[AsyncStream[Any]] | None", self._client._default_stream_cls) + if stream_cls is None: + raise MissingStreamClassError() + + return cast( + R, + stream_cls( + cast_to=cast_to, + response=self.http_response, + client=cast(Any, self._client), + ), + ) + + if cast_to is NoneType: + return cast(R, None) + + response = self.http_response + if cast_to == str: + return cast(R, response.text) + + if cast_to == bytes: + return cast(R, response.content) + + if cast_to == int: + return cast(R, int(response.text)) + + if cast_to == float: + return cast(R, float(response.text)) + + if cast_to == bool: + return cast(R, response.text.lower() == "true") + + if origin == APIResponse: + raise RuntimeError("Unexpected state - cast_to is `APIResponse`") + + if inspect.isclass(origin) and issubclass(origin, httpx.Response): + # Because of the invariance of our ResponseT TypeVar, users can subclass httpx.Response + # and pass that class to our request functions. We cannot change the variance to be either + # covariant or contravariant as that makes our usage of ResponseT illegal. We could construct + # the response class ourselves but that is something that should be supported directly in httpx + # as it would be easy to incorrectly construct the Response object due to the multitude of arguments. + if cast_to != httpx.Response: + raise ValueError(f"Subclasses of httpx.Response cannot be passed to `cast_to`") + return cast(R, response) + + if ( + inspect.isclass( + origin # pyright: ignore[reportUnknownArgumentType] + ) + and not issubclass(origin, BaseModel) + and issubclass(origin, pydantic.BaseModel) + ): + raise TypeError("Pydantic models must subclass our base model type, e.g. `from lmnt import BaseModel`") + + if ( + cast_to is not object + and not origin is list + and not origin is dict + and not origin is Union + and not issubclass(origin, BaseModel) + ): + raise RuntimeError( + f"Unsupported type, expected {cast_to} to be a subclass of {BaseModel}, {dict}, {list}, {Union}, {NoneType}, {str} or {httpx.Response}." + ) + + # split is required to handle cases where additional information is included + # in the response, e.g. application/json; charset=utf-8 + content_type, *_ = response.headers.get("content-type", "*").split(";") + if not content_type.endswith("json"): + if is_basemodel(cast_to): + try: + data = response.json() + except Exception as exc: + log.debug("Could not read JSON from response data due to %s - %s", type(exc), exc) + else: + return self._client._process_response_data( + data=data, + cast_to=cast_to, # type: ignore + response=response, + ) + + if self._client._strict_response_validation: + raise APIResponseValidationError( + response=response, + message=f"Expected Content-Type response header to be `application/json` but received `{content_type}` instead.", + body=response.text, + ) + + # If the API responds with content that isn't JSON then we just return + # the (decoded) text without performing any parsing so that you can still + # handle the response however you need to. + return response.text # type: ignore + + data = response.json() + + return self._client._process_response_data( + data=data, + cast_to=cast_to, # type: ignore + response=response, + ) + + +class APIResponse(BaseAPIResponse[R]): + @overload + def parse(self, *, to: type[_T]) -> _T: ... + + @overload + def parse(self) -> R: ... + + def parse(self, *, to: type[_T] | None = None) -> R | _T: + """Returns the rich python representation of this response's data. + + For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`. + + You can customise the type that the response is parsed into through + the `to` argument, e.g. + + ```py + from lmnt import BaseModel + + + class MyModel(BaseModel): + foo: str + + + obj = response.parse(to=MyModel) + print(obj.foo) + ``` + + We support parsing: + - `BaseModel` + - `dict` + - `list` + - `Union` + - `str` + - `int` + - `float` + - `httpx.Response` + """ + cache_key = to if to is not None else self._cast_to + cached = self._parsed_by_type.get(cache_key) + if cached is not None: + return cached # type: ignore[no-any-return] + + if not self._is_sse_stream: + self.read() + + parsed = self._parse(to=to) + if is_given(self._options.post_parser): + parsed = self._options.post_parser(parsed) + + self._parsed_by_type[cache_key] = parsed + return parsed + + def read(self) -> bytes: + """Read and return the binary response content.""" + try: + return self.http_response.read() + except httpx.StreamConsumed as exc: + # The default error raised by httpx isn't very + # helpful in our case so we re-raise it with + # a different error message. + raise StreamAlreadyConsumed() from exc + + def text(self) -> str: + """Read and decode the response content into a string.""" + self.read() + return self.http_response.text + + def json(self) -> object: + """Read and decode the JSON response content.""" + self.read() + return self.http_response.json() + + def close(self) -> None: + """Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + self.http_response.close() + + def iter_bytes(self, chunk_size: int | None = None) -> Iterator[bytes]: + """ + A byte-iterator over the decoded response content. + + This automatically handles gzip, deflate and brotli encoded responses. + """ + for chunk in self.http_response.iter_bytes(chunk_size): + yield chunk + + def iter_text(self, chunk_size: int | None = None) -> Iterator[str]: + """A str-iterator over the decoded response content + that handles both gzip, deflate, etc but also detects the content's + string encoding. + """ + for chunk in self.http_response.iter_text(chunk_size): + yield chunk + + def iter_lines(self) -> Iterator[str]: + """Like `iter_text()` but will only yield chunks for each line""" + for chunk in self.http_response.iter_lines(): + yield chunk + + +class AsyncAPIResponse(BaseAPIResponse[R]): + @overload + async def parse(self, *, to: type[_T]) -> _T: ... + + @overload + async def parse(self) -> R: ... + + async def parse(self, *, to: type[_T] | None = None) -> R | _T: + """Returns the rich python representation of this response's data. + + For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`. + + You can customise the type that the response is parsed into through + the `to` argument, e.g. + + ```py + from lmnt import BaseModel + + + class MyModel(BaseModel): + foo: str + + + obj = response.parse(to=MyModel) + print(obj.foo) + ``` + + We support parsing: + - `BaseModel` + - `dict` + - `list` + - `Union` + - `str` + - `httpx.Response` + """ + cache_key = to if to is not None else self._cast_to + cached = self._parsed_by_type.get(cache_key) + if cached is not None: + return cached # type: ignore[no-any-return] + + if not self._is_sse_stream: + await self.read() + + parsed = self._parse(to=to) + if is_given(self._options.post_parser): + parsed = self._options.post_parser(parsed) + + self._parsed_by_type[cache_key] = parsed + return parsed + + async def read(self) -> bytes: + """Read and return the binary response content.""" + try: + return await self.http_response.aread() + except httpx.StreamConsumed as exc: + # the default error raised by httpx isn't very + # helpful in our case so we re-raise it with + # a different error message + raise StreamAlreadyConsumed() from exc + + async def text(self) -> str: + """Read and decode the response content into a string.""" + await self.read() + return self.http_response.text + + async def json(self) -> object: + """Read and decode the JSON response content.""" + await self.read() + return self.http_response.json() + + async def close(self) -> None: + """Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + await self.http_response.aclose() + + async def iter_bytes(self, chunk_size: int | None = None) -> AsyncIterator[bytes]: + """ + A byte-iterator over the decoded response content. + + This automatically handles gzip, deflate and brotli encoded responses. + """ + async for chunk in self.http_response.aiter_bytes(chunk_size): + yield chunk + + async def iter_text(self, chunk_size: int | None = None) -> AsyncIterator[str]: + """A str-iterator over the decoded response content + that handles both gzip, deflate, etc but also detects the content's + string encoding. + """ + async for chunk in self.http_response.aiter_text(chunk_size): + yield chunk + + async def iter_lines(self) -> AsyncIterator[str]: + """Like `iter_text()` but will only yield chunks for each line""" + async for chunk in self.http_response.aiter_lines(): + yield chunk + + +class BinaryAPIResponse(APIResponse[bytes]): + """Subclass of APIResponse providing helpers for dealing with binary data. + + Note: If you want to stream the response data instead of eagerly reading it + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + + def write_to_file( + self, + file: str | os.PathLike[str], + ) -> None: + """Write the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + + Note: if you want to stream the data to the file instead of writing + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + with open(file, mode="wb") as f: + for data in self.iter_bytes(): + f.write(data) + + +class AsyncBinaryAPIResponse(AsyncAPIResponse[bytes]): + """Subclass of APIResponse providing helpers for dealing with binary data. + + Note: If you want to stream the response data instead of eagerly reading it + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + + async def write_to_file( + self, + file: str | os.PathLike[str], + ) -> None: + """Write the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + + Note: if you want to stream the data to the file instead of writing + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + path = anyio.Path(file) + async with await path.open(mode="wb") as f: + async for data in self.iter_bytes(): + await f.write(data) + + +class StreamedBinaryAPIResponse(APIResponse[bytes]): + def stream_to_file( + self, + file: str | os.PathLike[str], + *, + chunk_size: int | None = None, + ) -> None: + """Streams the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + """ + with open(file, mode="wb") as f: + for data in self.iter_bytes(chunk_size): + f.write(data) + + +class AsyncStreamedBinaryAPIResponse(AsyncAPIResponse[bytes]): + async def stream_to_file( + self, + file: str | os.PathLike[str], + *, + chunk_size: int | None = None, + ) -> None: + """Streams the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + """ + path = anyio.Path(file) + async with await path.open(mode="wb") as f: + async for data in self.iter_bytes(chunk_size): + await f.write(data) + + +class MissingStreamClassError(TypeError): + def __init__(self) -> None: + super().__init__( + "The `stream` argument was set to `True` but the `stream_cls` argument was not given. See `lmnt._streaming` for reference", + ) + + +class StreamAlreadyConsumed(LmntError): + """ + Attempted to read or stream content, but the content has already + been streamed. + + This can happen if you use a method like `.iter_lines()` and then attempt + to read th entire response body afterwards, e.g. + + ```py + response = await client.post(...) + async for line in response.iter_lines(): + ... # do something with `line` + + content = await response.read() + # ^ error + ``` + + If you want this behaviour you'll need to either manually accumulate the response + content or call `await response.read()` before iterating over the stream. + """ + + def __init__(self) -> None: + message = ( + "Attempted to read or stream some content, but the content has " + "already been streamed. " + "This could be due to attempting to stream the response " + "content more than once." + "\n\n" + "You can fix this by manually accumulating the response content while streaming " + "or by calling `.read()` before starting to stream." + ) + super().__init__(message) + + +class ResponseContextManager(Generic[_APIResponseT]): + """Context manager for ensuring that a request is not made + until it is entered and that the response will always be closed + when the context manager exits + """ + + def __init__(self, request_func: Callable[[], _APIResponseT]) -> None: + self._request_func = request_func + self.__response: _APIResponseT | None = None + + def __enter__(self) -> _APIResponseT: + self.__response = self._request_func() + return self.__response + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + if self.__response is not None: + self.__response.close() + + +class AsyncResponseContextManager(Generic[_AsyncAPIResponseT]): + """Context manager for ensuring that a request is not made + until it is entered and that the response will always be closed + when the context manager exits + """ + + def __init__(self, api_request: Awaitable[_AsyncAPIResponseT]) -> None: + self._api_request = api_request + self.__response: _AsyncAPIResponseT | None = None + + async def __aenter__(self) -> _AsyncAPIResponseT: + self.__response = await self._api_request + return self.__response + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + if self.__response is not None: + await self.__response.close() + + +def to_streamed_response_wrapper(func: Callable[P, R]) -> Callable[P, ResponseContextManager[APIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support streaming and returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[APIResponse[R]]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + + kwargs["extra_headers"] = extra_headers + + make_request = functools.partial(func, *args, **kwargs) + + return ResponseContextManager(cast(Callable[[], APIResponse[R]], make_request)) + + return wrapped + + +def async_to_streamed_response_wrapper( + func: Callable[P, Awaitable[R]], +) -> Callable[P, AsyncResponseContextManager[AsyncAPIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support streaming and returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[AsyncAPIResponse[R]]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + + kwargs["extra_headers"] = extra_headers + + make_request = func(*args, **kwargs) + + return AsyncResponseContextManager(cast(Awaitable[AsyncAPIResponse[R]], make_request)) + + return wrapped + + +def to_custom_streamed_response_wrapper( + func: Callable[P, object], + response_cls: type[_APIResponseT], +) -> Callable[P, ResponseContextManager[_APIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support streaming and returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[_APIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + make_request = functools.partial(func, *args, **kwargs) + + return ResponseContextManager(cast(Callable[[], _APIResponseT], make_request)) + + return wrapped + + +def async_to_custom_streamed_response_wrapper( + func: Callable[P, Awaitable[object]], + response_cls: type[_AsyncAPIResponseT], +) -> Callable[P, AsyncResponseContextManager[_AsyncAPIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support streaming and returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[_AsyncAPIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + make_request = func(*args, **kwargs) + + return AsyncResponseContextManager(cast(Awaitable[_AsyncAPIResponseT], make_request)) + + return wrapped + + +def to_raw_response_wrapper(func: Callable[P, R]) -> Callable[P, APIResponse[R]]: + """Higher order function that takes one of our bound API methods and wraps it + to support returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> APIResponse[R]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + + kwargs["extra_headers"] = extra_headers + + return cast(APIResponse[R], func(*args, **kwargs)) + + return wrapped + + +def async_to_raw_response_wrapper(func: Callable[P, Awaitable[R]]) -> Callable[P, Awaitable[AsyncAPIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + async def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncAPIResponse[R]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + + kwargs["extra_headers"] = extra_headers + + return cast(AsyncAPIResponse[R], await func(*args, **kwargs)) + + return wrapped + + +def to_custom_raw_response_wrapper( + func: Callable[P, object], + response_cls: type[_APIResponseT], +) -> Callable[P, _APIResponseT]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> _APIResponseT: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + return cast(_APIResponseT, func(*args, **kwargs)) + + return wrapped + + +def async_to_custom_raw_response_wrapper( + func: Callable[P, Awaitable[object]], + response_cls: type[_AsyncAPIResponseT], +) -> Callable[P, Awaitable[_AsyncAPIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> Awaitable[_AsyncAPIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + return cast(Awaitable[_AsyncAPIResponseT], func(*args, **kwargs)) + + return wrapped + + +def extract_response_type(typ: type[BaseAPIResponse[Any]]) -> type: + """Given a type like `APIResponse[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyResponse(APIResponse[bytes]): + ... + + extract_response_type(MyResponse) -> bytes + ``` + """ + return extract_type_var_from_base( + typ, + generic_bases=cast("tuple[type, ...]", (BaseAPIResponse, APIResponse, AsyncAPIResponse)), + index=0, + ) diff --git a/src/lmnt/_streaming.py b/src/lmnt/_streaming.py new file mode 100644 index 0000000..14f38a6 --- /dev/null +++ b/src/lmnt/_streaming.py @@ -0,0 +1,333 @@ +# Note: initially copied from https://github.com/florimondmanca/httpx-sse/blob/master/src/httpx_sse/_decoders.py +from __future__ import annotations + +import json +import inspect +from types import TracebackType +from typing import TYPE_CHECKING, Any, Generic, TypeVar, Iterator, AsyncIterator, cast +from typing_extensions import Self, Protocol, TypeGuard, override, get_origin, runtime_checkable + +import httpx + +from ._utils import extract_type_var_from_base + +if TYPE_CHECKING: + from ._client import Lmnt, AsyncLmnt + + +_T = TypeVar("_T") + + +class Stream(Generic[_T]): + """Provides the core interface to iterate over a synchronous stream response.""" + + response: httpx.Response + + _decoder: SSEBytesDecoder + + def __init__( + self, + *, + cast_to: type[_T], + response: httpx.Response, + client: Lmnt, + ) -> None: + self.response = response + self._cast_to = cast_to + self._client = client + self._decoder = client._make_sse_decoder() + self._iterator = self.__stream__() + + def __next__(self) -> _T: + return self._iterator.__next__() + + def __iter__(self) -> Iterator[_T]: + for item in self._iterator: + yield item + + def _iter_events(self) -> Iterator[ServerSentEvent]: + yield from self._decoder.iter_bytes(self.response.iter_bytes()) + + def __stream__(self) -> Iterator[_T]: + cast_to = cast(Any, self._cast_to) + response = self.response + process_data = self._client._process_response_data + iterator = self._iter_events() + + for sse in iterator: + yield process_data(data=sse.json(), cast_to=cast_to, response=response) + + # Ensure the entire stream is consumed + for _sse in iterator: + ... + + def __enter__(self) -> Self: + return self + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + self.close() + + def close(self) -> None: + """ + Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + self.response.close() + + +class AsyncStream(Generic[_T]): + """Provides the core interface to iterate over an asynchronous stream response.""" + + response: httpx.Response + + _decoder: SSEDecoder | SSEBytesDecoder + + def __init__( + self, + *, + cast_to: type[_T], + response: httpx.Response, + client: AsyncLmnt, + ) -> None: + self.response = response + self._cast_to = cast_to + self._client = client + self._decoder = client._make_sse_decoder() + self._iterator = self.__stream__() + + async def __anext__(self) -> _T: + return await self._iterator.__anext__() + + async def __aiter__(self) -> AsyncIterator[_T]: + async for item in self._iterator: + yield item + + async def _iter_events(self) -> AsyncIterator[ServerSentEvent]: + async for sse in self._decoder.aiter_bytes(self.response.aiter_bytes()): + yield sse + + async def __stream__(self) -> AsyncIterator[_T]: + cast_to = cast(Any, self._cast_to) + response = self.response + process_data = self._client._process_response_data + iterator = self._iter_events() + + async for sse in iterator: + yield process_data(data=sse.json(), cast_to=cast_to, response=response) + + # Ensure the entire stream is consumed + async for _sse in iterator: + ... + + async def __aenter__(self) -> Self: + return self + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + await self.close() + + async def close(self) -> None: + """ + Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + await self.response.aclose() + + +class ServerSentEvent: + def __init__( + self, + *, + event: str | None = None, + data: str | None = None, + id: str | None = None, + retry: int | None = None, + ) -> None: + if data is None: + data = "" + + self._id = id + self._data = data + self._event = event or None + self._retry = retry + + @property + def event(self) -> str | None: + return self._event + + @property + def id(self) -> str | None: + return self._id + + @property + def retry(self) -> int | None: + return self._retry + + @property + def data(self) -> str: + return self._data + + def json(self) -> Any: + return json.loads(self.data) + + @override + def __repr__(self) -> str: + return f"ServerSentEvent(event={self.event}, data={self.data}, id={self.id}, retry={self.retry})" + + +class SSEDecoder: + _data: list[str] + _event: str | None + _retry: int | None + _last_event_id: str | None + + def __init__(self) -> None: + self._event = None + self._data = [] + self._last_event_id = None + self._retry = None + + def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + for chunk in self._iter_chunks(iterator): + # Split before decoding so splitlines() only uses \r and \n + for raw_line in chunk.splitlines(): + line = raw_line.decode("utf-8") + sse = self.decode(line) + if sse: + yield sse + + def _iter_chunks(self, iterator: Iterator[bytes]) -> Iterator[bytes]: + """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks""" + data = b"" + for chunk in iterator: + for line in chunk.splitlines(keepends=True): + data += line + if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")): + yield data + data = b"" + if data: + yield data + + async def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + async for chunk in self._aiter_chunks(iterator): + # Split before decoding so splitlines() only uses \r and \n + for raw_line in chunk.splitlines(): + line = raw_line.decode("utf-8") + sse = self.decode(line) + if sse: + yield sse + + async def _aiter_chunks(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[bytes]: + """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks""" + data = b"" + async for chunk in iterator: + for line in chunk.splitlines(keepends=True): + data += line + if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")): + yield data + data = b"" + if data: + yield data + + def decode(self, line: str) -> ServerSentEvent | None: + # See: https://html.spec.whatwg.org/multipage/server-sent-events.html#event-stream-interpretation # noqa: E501 + + if not line: + if not self._event and not self._data and not self._last_event_id and self._retry is None: + return None + + sse = ServerSentEvent( + event=self._event, + data="\n".join(self._data), + id=self._last_event_id, + retry=self._retry, + ) + + # NOTE: as per the SSE spec, do not reset last_event_id. + self._event = None + self._data = [] + self._retry = None + + return sse + + if line.startswith(":"): + return None + + fieldname, _, value = line.partition(":") + + if value.startswith(" "): + value = value[1:] + + if fieldname == "event": + self._event = value + elif fieldname == "data": + self._data.append(value) + elif fieldname == "id": + if "\0" in value: + pass + else: + self._last_event_id = value + elif fieldname == "retry": + try: + self._retry = int(value) + except (TypeError, ValueError): + pass + else: + pass # Field is ignored. + + return None + + +@runtime_checkable +class SSEBytesDecoder(Protocol): + def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + ... + + def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]: + """Given an async iterator that yields raw binary data, iterate over it & yield every event encountered""" + ... + + +def is_stream_class_type(typ: type) -> TypeGuard[type[Stream[object]] | type[AsyncStream[object]]]: + """TypeGuard for determining whether or not the given type is a subclass of `Stream` / `AsyncStream`""" + origin = get_origin(typ) or typ + return inspect.isclass(origin) and issubclass(origin, (Stream, AsyncStream)) + + +def extract_stream_chunk_type( + stream_cls: type, + *, + failure_message: str | None = None, +) -> type: + """Given a type like `Stream[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyStream(Stream[bytes]): + ... + + extract_stream_chunk_type(MyStream) -> bytes + ``` + """ + from ._base_client import Stream, AsyncStream + + return extract_type_var_from_base( + stream_cls, + index=0, + generic_bases=cast("tuple[type, ...]", (Stream, AsyncStream)), + failure_message=failure_message, + ) diff --git a/src/lmnt/_types.py b/src/lmnt/_types.py new file mode 100644 index 0000000..f789ccd --- /dev/null +++ b/src/lmnt/_types.py @@ -0,0 +1,219 @@ +from __future__ import annotations + +from os import PathLike +from typing import ( + IO, + TYPE_CHECKING, + Any, + Dict, + List, + Type, + Tuple, + Union, + Mapping, + TypeVar, + Callable, + Optional, + Sequence, +) +from typing_extensions import Set, Literal, Protocol, TypeAlias, TypedDict, override, runtime_checkable + +import httpx +import pydantic +from httpx import URL, Proxy, Timeout, Response, BaseTransport, AsyncBaseTransport + +if TYPE_CHECKING: + from ._models import BaseModel + from ._response import APIResponse, AsyncAPIResponse + +Transport = BaseTransport +AsyncTransport = AsyncBaseTransport +Query = Mapping[str, object] +Body = object +AnyMapping = Mapping[str, object] +ModelT = TypeVar("ModelT", bound=pydantic.BaseModel) +_T = TypeVar("_T") + + +# Approximates httpx internal ProxiesTypes and RequestFiles types +# while adding support for `PathLike` instances +ProxiesDict = Dict["str | URL", Union[None, str, URL, Proxy]] +ProxiesTypes = Union[str, Proxy, ProxiesDict] +if TYPE_CHECKING: + Base64FileInput = Union[IO[bytes], PathLike[str]] + FileContent = Union[IO[bytes], bytes, PathLike[str]] +else: + Base64FileInput = Union[IO[bytes], PathLike] + FileContent = Union[IO[bytes], bytes, PathLike] # PathLike is not subscriptable in Python 3.8. +FileTypes = Union[ + # file (or bytes) + FileContent, + # (filename, file (or bytes)) + Tuple[Optional[str], FileContent], + # (filename, file (or bytes), content_type) + Tuple[Optional[str], FileContent, Optional[str]], + # (filename, file (or bytes), content_type, headers) + Tuple[Optional[str], FileContent, Optional[str], Mapping[str, str]], +] +RequestFiles = Union[Mapping[str, FileTypes], Sequence[Tuple[str, FileTypes]]] + +# duplicate of the above but without our custom file support +HttpxFileContent = Union[IO[bytes], bytes] +HttpxFileTypes = Union[ + # file (or bytes) + HttpxFileContent, + # (filename, file (or bytes)) + Tuple[Optional[str], HttpxFileContent], + # (filename, file (or bytes), content_type) + Tuple[Optional[str], HttpxFileContent, Optional[str]], + # (filename, file (or bytes), content_type, headers) + Tuple[Optional[str], HttpxFileContent, Optional[str], Mapping[str, str]], +] +HttpxRequestFiles = Union[Mapping[str, HttpxFileTypes], Sequence[Tuple[str, HttpxFileTypes]]] + +# Workaround to support (cast_to: Type[ResponseT]) -> ResponseT +# where ResponseT includes `None`. In order to support directly +# passing `None`, overloads would have to be defined for every +# method that uses `ResponseT` which would lead to an unacceptable +# amount of code duplication and make it unreadable. See _base_client.py +# for example usage. +# +# This unfortunately means that you will either have +# to import this type and pass it explicitly: +# +# from lmnt import NoneType +# client.get('/foo', cast_to=NoneType) +# +# or build it yourself: +# +# client.get('/foo', cast_to=type(None)) +if TYPE_CHECKING: + NoneType: Type[None] +else: + NoneType = type(None) + + +class RequestOptions(TypedDict, total=False): + headers: Headers + max_retries: int + timeout: float | Timeout | None + params: Query + extra_json: AnyMapping + idempotency_key: str + follow_redirects: bool + + +# Sentinel class used until PEP 0661 is accepted +class NotGiven: + """ + A sentinel singleton class used to distinguish omitted keyword arguments + from those passed in with the value None (which may have different behavior). + + For example: + + ```py + def get(timeout: Union[int, NotGiven, None] = NotGiven()) -> Response: ... + + + get(timeout=1) # 1s timeout + get(timeout=None) # No timeout + get() # Default timeout behavior, which may not be statically known at the method definition. + ``` + """ + + def __bool__(self) -> Literal[False]: + return False + + @override + def __repr__(self) -> str: + return "NOT_GIVEN" + + +NotGivenOr = Union[_T, NotGiven] +NOT_GIVEN = NotGiven() + + +class Omit: + """In certain situations you need to be able to represent a case where a default value has + to be explicitly removed and `None` is not an appropriate substitute, for example: + + ```py + # as the default `Content-Type` header is `application/json` that will be sent + client.post("/upload/files", files={"file": b"my raw file content"}) + + # you can't explicitly override the header as it has to be dynamically generated + # to look something like: 'multipart/form-data; boundary=0d8382fcf5f8c3be01ca2e11002d2983' + client.post(..., headers={"Content-Type": "multipart/form-data"}) + + # instead you can remove the default `application/json` header by passing Omit + client.post(..., headers={"Content-Type": Omit()}) + ``` + """ + + def __bool__(self) -> Literal[False]: + return False + + +@runtime_checkable +class ModelBuilderProtocol(Protocol): + @classmethod + def build( + cls: type[_T], + *, + response: Response, + data: object, + ) -> _T: ... + + +Headers = Mapping[str, Union[str, Omit]] + + +class HeadersLikeProtocol(Protocol): + def get(self, __key: str) -> str | None: ... + + +HeadersLike = Union[Headers, HeadersLikeProtocol] + +ResponseT = TypeVar( + "ResponseT", + bound=Union[ + object, + str, + None, + "BaseModel", + List[Any], + Dict[str, Any], + Response, + ModelBuilderProtocol, + "APIResponse[Any]", + "AsyncAPIResponse[Any]", + ], +) + +StrBytesIntFloat = Union[str, bytes, int, float] + +# Note: copied from Pydantic +# https://github.com/pydantic/pydantic/blob/6f31f8f68ef011f84357330186f603ff295312fd/pydantic/main.py#L79 +IncEx: TypeAlias = Union[Set[int], Set[str], Mapping[int, Union["IncEx", bool]], Mapping[str, Union["IncEx", bool]]] + +PostParser = Callable[[Any], Any] + + +@runtime_checkable +class InheritsGeneric(Protocol): + """Represents a type that has inherited from `Generic` + + The `__orig_bases__` property can be used to determine the resolved + type variable for a given base class. + """ + + __orig_bases__: tuple[_GenericAlias] + + +class _GenericAlias(Protocol): + __origin__: type[object] + + +class HttpxSendArgs(TypedDict, total=False): + auth: httpx.Auth + follow_redirects: bool diff --git a/src/lmnt/_utils/__init__.py b/src/lmnt/_utils/__init__.py new file mode 100644 index 0000000..d4fda26 --- /dev/null +++ b/src/lmnt/_utils/__init__.py @@ -0,0 +1,57 @@ +from ._sync import asyncify as asyncify +from ._proxy import LazyProxy as LazyProxy +from ._utils import ( + flatten as flatten, + is_dict as is_dict, + is_list as is_list, + is_given as is_given, + is_tuple as is_tuple, + json_safe as json_safe, + lru_cache as lru_cache, + is_mapping as is_mapping, + is_tuple_t as is_tuple_t, + parse_date as parse_date, + is_iterable as is_iterable, + is_sequence as is_sequence, + coerce_float as coerce_float, + is_mapping_t as is_mapping_t, + removeprefix as removeprefix, + removesuffix as removesuffix, + extract_files as extract_files, + is_sequence_t as is_sequence_t, + required_args as required_args, + coerce_boolean as coerce_boolean, + coerce_integer as coerce_integer, + file_from_path as file_from_path, + parse_datetime as parse_datetime, + strip_not_given as strip_not_given, + deepcopy_minimal as deepcopy_minimal, + get_async_library as get_async_library, + maybe_coerce_float as maybe_coerce_float, + get_required_header as get_required_header, + maybe_coerce_boolean as maybe_coerce_boolean, + maybe_coerce_integer as maybe_coerce_integer, +) +from ._typing import ( + is_list_type as is_list_type, + is_union_type as is_union_type, + extract_type_arg as extract_type_arg, + is_iterable_type as is_iterable_type, + is_required_type as is_required_type, + is_annotated_type as is_annotated_type, + is_type_alias_type as is_type_alias_type, + strip_annotated_type as strip_annotated_type, + extract_type_var_from_base as extract_type_var_from_base, +) +from ._streams import consume_sync_iterator as consume_sync_iterator, consume_async_iterator as consume_async_iterator +from ._transform import ( + PropertyInfo as PropertyInfo, + transform as transform, + async_transform as async_transform, + maybe_transform as maybe_transform, + async_maybe_transform as async_maybe_transform, +) +from ._reflection import ( + function_has_argument as function_has_argument, + assert_signatures_in_sync as assert_signatures_in_sync, +) diff --git a/src/lmnt/_utils/_logs.py b/src/lmnt/_utils/_logs.py new file mode 100644 index 0000000..ec50b31 --- /dev/null +++ b/src/lmnt/_utils/_logs.py @@ -0,0 +1,25 @@ +import os +import logging + +logger: logging.Logger = logging.getLogger("lmnt") +httpx_logger: logging.Logger = logging.getLogger("httpx") + + +def _basic_config() -> None: + # e.g. [2023-10-05 14:12:26 - lmnt._base_client:818 - DEBUG] HTTP Request: POST http://127.0.0.1:4010/foo/bar "200 OK" + logging.basicConfig( + format="[%(asctime)s - %(name)s:%(lineno)d - %(levelname)s] %(message)s", + datefmt="%Y-%m-%d %H:%M:%S", + ) + + +def setup_logging() -> None: + env = os.environ.get("LMNT_LOG") + if env == "debug": + _basic_config() + logger.setLevel(logging.DEBUG) + httpx_logger.setLevel(logging.DEBUG) + elif env == "info": + _basic_config() + logger.setLevel(logging.INFO) + httpx_logger.setLevel(logging.INFO) diff --git a/src/lmnt/_utils/_proxy.py b/src/lmnt/_utils/_proxy.py new file mode 100644 index 0000000..0f239a3 --- /dev/null +++ b/src/lmnt/_utils/_proxy.py @@ -0,0 +1,65 @@ +from __future__ import annotations + +from abc import ABC, abstractmethod +from typing import Generic, TypeVar, Iterable, cast +from typing_extensions import override + +T = TypeVar("T") + + +class LazyProxy(Generic[T], ABC): + """Implements data methods to pretend that an instance is another instance. + + This includes forwarding attribute access and other methods. + """ + + # Note: we have to special case proxies that themselves return proxies + # to support using a proxy as a catch-all for any random access, e.g. `proxy.foo.bar.baz` + + def __getattr__(self, attr: str) -> object: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied # pyright: ignore + return getattr(proxied, attr) + + @override + def __repr__(self) -> str: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied.__class__.__name__ + return repr(self.__get_proxied__()) + + @override + def __str__(self) -> str: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied.__class__.__name__ + return str(proxied) + + @override + def __dir__(self) -> Iterable[str]: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return [] + return proxied.__dir__() + + @property # type: ignore + @override + def __class__(self) -> type: # pyright: ignore + try: + proxied = self.__get_proxied__() + except Exception: + return type(self) + if issubclass(type(proxied), LazyProxy): + return type(proxied) + return proxied.__class__ + + def __get_proxied__(self) -> T: + return self.__load__() + + def __as_proxied__(self) -> T: + """Helper method that returns the current proxy, typed as the loaded object""" + return cast(T, self) + + @abstractmethod + def __load__(self) -> T: ... diff --git a/src/lmnt/_utils/_reflection.py b/src/lmnt/_utils/_reflection.py new file mode 100644 index 0000000..89aa712 --- /dev/null +++ b/src/lmnt/_utils/_reflection.py @@ -0,0 +1,42 @@ +from __future__ import annotations + +import inspect +from typing import Any, Callable + + +def function_has_argument(func: Callable[..., Any], arg_name: str) -> bool: + """Returns whether or not the given function has a specific parameter""" + sig = inspect.signature(func) + return arg_name in sig.parameters + + +def assert_signatures_in_sync( + source_func: Callable[..., Any], + check_func: Callable[..., Any], + *, + exclude_params: set[str] = set(), +) -> None: + """Ensure that the signature of the second function matches the first.""" + + check_sig = inspect.signature(check_func) + source_sig = inspect.signature(source_func) + + errors: list[str] = [] + + for name, source_param in source_sig.parameters.items(): + if name in exclude_params: + continue + + custom_param = check_sig.parameters.get(name) + if not custom_param: + errors.append(f"the `{name}` param is missing") + continue + + if custom_param.annotation != source_param.annotation: + errors.append( + f"types for the `{name}` param are do not match; source={repr(source_param.annotation)} checking={repr(custom_param.annotation)}" + ) + continue + + if errors: + raise AssertionError(f"{len(errors)} errors encountered when comparing signatures:\n\n" + "\n\n".join(errors)) diff --git a/src/lmnt/_utils/_resources_proxy.py b/src/lmnt/_utils/_resources_proxy.py new file mode 100644 index 0000000..a66adec --- /dev/null +++ b/src/lmnt/_utils/_resources_proxy.py @@ -0,0 +1,24 @@ +from __future__ import annotations + +from typing import Any +from typing_extensions import override + +from ._proxy import LazyProxy + + +class ResourcesProxy(LazyProxy[Any]): + """A proxy for the `lmnt.resources` module. + + This is used so that we can lazily import `lmnt.resources` only when + needed *and* so that users can just import `lmnt` and reference `lmnt.resources` + """ + + @override + def __load__(self) -> Any: + import importlib + + mod = importlib.import_module("lmnt.resources") + return mod + + +resources = ResourcesProxy().__as_proxied__() diff --git a/src/lmnt/_utils/_streams.py b/src/lmnt/_utils/_streams.py new file mode 100644 index 0000000..f4a0208 --- /dev/null +++ b/src/lmnt/_utils/_streams.py @@ -0,0 +1,12 @@ +from typing import Any +from typing_extensions import Iterator, AsyncIterator + + +def consume_sync_iterator(iterator: Iterator[Any]) -> None: + for _ in iterator: + ... + + +async def consume_async_iterator(iterator: AsyncIterator[Any]) -> None: + async for _ in iterator: + ... diff --git a/src/lmnt/_utils/_sync.py b/src/lmnt/_utils/_sync.py new file mode 100644 index 0000000..ad7ec71 --- /dev/null +++ b/src/lmnt/_utils/_sync.py @@ -0,0 +1,86 @@ +from __future__ import annotations + +import sys +import asyncio +import functools +import contextvars +from typing import Any, TypeVar, Callable, Awaitable +from typing_extensions import ParamSpec + +import anyio +import sniffio +import anyio.to_thread + +T_Retval = TypeVar("T_Retval") +T_ParamSpec = ParamSpec("T_ParamSpec") + + +if sys.version_info >= (3, 9): + _asyncio_to_thread = asyncio.to_thread +else: + # backport of https://docs.python.org/3/library/asyncio-task.html#asyncio.to_thread + # for Python 3.8 support + async def _asyncio_to_thread( + func: Callable[T_ParamSpec, T_Retval], /, *args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs + ) -> Any: + """Asynchronously run function *func* in a separate thread. + + Any *args and **kwargs supplied for this function are directly passed + to *func*. Also, the current :class:`contextvars.Context` is propagated, + allowing context variables from the main thread to be accessed in the + separate thread. + + Returns a coroutine that can be awaited to get the eventual result of *func*. + """ + loop = asyncio.events.get_running_loop() + ctx = contextvars.copy_context() + func_call = functools.partial(ctx.run, func, *args, **kwargs) + return await loop.run_in_executor(None, func_call) + + +async def to_thread( + func: Callable[T_ParamSpec, T_Retval], /, *args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs +) -> T_Retval: + if sniffio.current_async_library() == "asyncio": + return await _asyncio_to_thread(func, *args, **kwargs) + + return await anyio.to_thread.run_sync( + functools.partial(func, *args, **kwargs), + ) + + +# inspired by `asyncer`, https://github.com/tiangolo/asyncer +def asyncify(function: Callable[T_ParamSpec, T_Retval]) -> Callable[T_ParamSpec, Awaitable[T_Retval]]: + """ + Take a blocking function and create an async one that receives the same + positional and keyword arguments. For python version 3.9 and above, it uses + asyncio.to_thread to run the function in a separate thread. For python version + 3.8, it uses locally defined copy of the asyncio.to_thread function which was + introduced in python 3.9. + + Usage: + + ```python + def blocking_func(arg1, arg2, kwarg1=None): + # blocking code + return result + + + result = asyncify(blocking_function)(arg1, arg2, kwarg1=value1) + ``` + + ## Arguments + + `function`: a blocking regular callable (e.g. a function) + + ## Return + + An async function that takes the same positional and keyword arguments as the + original one, that when called runs the same original function in a thread worker + and returns the result. + """ + + async def wrapper(*args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs) -> T_Retval: + return await to_thread(function, *args, **kwargs) + + return wrapper diff --git a/src/lmnt/_utils/_transform.py b/src/lmnt/_utils/_transform.py new file mode 100644 index 0000000..b0cc20a --- /dev/null +++ b/src/lmnt/_utils/_transform.py @@ -0,0 +1,447 @@ +from __future__ import annotations + +import io +import base64 +import pathlib +from typing import Any, Mapping, TypeVar, cast +from datetime import date, datetime +from typing_extensions import Literal, get_args, override, get_type_hints as _get_type_hints + +import anyio +import pydantic + +from ._utils import ( + is_list, + is_given, + lru_cache, + is_mapping, + is_iterable, +) +from .._files import is_base64_file_input +from ._typing import ( + is_list_type, + is_union_type, + extract_type_arg, + is_iterable_type, + is_required_type, + is_annotated_type, + strip_annotated_type, +) +from .._compat import get_origin, model_dump, is_typeddict + +_T = TypeVar("_T") + + +# TODO: support for drilling globals() and locals() +# TODO: ensure works correctly with forward references in all cases + + +PropertyFormat = Literal["iso8601", "base64", "custom"] + + +class PropertyInfo: + """Metadata class to be used in Annotated types to provide information about a given type. + + For example: + + class MyParams(TypedDict): + account_holder_name: Annotated[str, PropertyInfo(alias='accountHolderName')] + + This means that {'account_holder_name': 'Robert'} will be transformed to {'accountHolderName': 'Robert'} before being sent to the API. + """ + + alias: str | None + format: PropertyFormat | None + format_template: str | None + discriminator: str | None + + def __init__( + self, + *, + alias: str | None = None, + format: PropertyFormat | None = None, + format_template: str | None = None, + discriminator: str | None = None, + ) -> None: + self.alias = alias + self.format = format + self.format_template = format_template + self.discriminator = discriminator + + @override + def __repr__(self) -> str: + return f"{self.__class__.__name__}(alias='{self.alias}', format={self.format}, format_template='{self.format_template}', discriminator='{self.discriminator}')" + + +def maybe_transform( + data: object, + expected_type: object, +) -> Any | None: + """Wrapper over `transform()` that allows `None` to be passed. + + See `transform()` for more details. + """ + if data is None: + return None + return transform(data, expected_type) + + +# Wrapper over _transform_recursive providing fake types +def transform( + data: _T, + expected_type: object, +) -> _T: + """Transform dictionaries based off of type information from the given type, for example: + + ```py + class Params(TypedDict, total=False): + card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]] + + + transformed = transform({"card_id": ""}, Params) + # {'cardID': ''} + ``` + + Any keys / data that does not have type information given will be included as is. + + It should be noted that the transformations that this function does are not represented in the type system. + """ + transformed = _transform_recursive(data, annotation=cast(type, expected_type)) + return cast(_T, transformed) + + +@lru_cache(maxsize=8096) +def _get_annotated_type(type_: type) -> type | None: + """If the given type is an `Annotated` type then it is returned, if not `None` is returned. + + This also unwraps the type when applicable, e.g. `Required[Annotated[T, ...]]` + """ + if is_required_type(type_): + # Unwrap `Required[Annotated[T, ...]]` to `Annotated[T, ...]` + type_ = get_args(type_)[0] + + if is_annotated_type(type_): + return type_ + + return None + + +def _maybe_transform_key(key: str, type_: type) -> str: + """Transform the given `data` based on the annotations provided in `type_`. + + Note: this function only looks at `Annotated` types that contain `PropertyInfo` metadata. + """ + annotated_type = _get_annotated_type(type_) + if annotated_type is None: + # no `Annotated` definition for this type, no transformation needed + return key + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.alias is not None: + return annotation.alias + + return key + + +def _no_transform_needed(annotation: type) -> bool: + return annotation == float or annotation == int + + +def _transform_recursive( + data: object, + *, + annotation: type, + inner_type: type | None = None, +) -> object: + """Transform the given data against the expected type. + + Args: + annotation: The direct type annotation given to the particular piece of data. + This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc + + inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type + is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in + the list can be transformed using the metadata from the container type. + + Defaults to the same value as the `annotation` argument. + """ + if inner_type is None: + inner_type = annotation + + stripped_type = strip_annotated_type(inner_type) + origin = get_origin(stripped_type) or stripped_type + if is_typeddict(stripped_type) and is_mapping(data): + return _transform_typeddict(data, stripped_type) + + if origin == dict and is_mapping(data): + items_type = get_args(stripped_type)[1] + return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()} + + if ( + # List[T] + (is_list_type(stripped_type) and is_list(data)) + # Iterable[T] + or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str)) + ): + # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually + # intended as an iterable, so we don't transform it. + if isinstance(data, dict): + return cast(object, data) + + inner_type = extract_type_arg(stripped_type, 0) + if _no_transform_needed(inner_type): + # for some types there is no need to transform anything, so we can get a small + # perf boost from skipping that work. + # + # but we still need to convert to a list to ensure the data is json-serializable + if is_list(data): + return data + return list(data) + + return [_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data] + + if is_union_type(stripped_type): + # For union types we run the transformation against all subtypes to ensure that everything is transformed. + # + # TODO: there may be edge cases where the same normalized field name will transform to two different names + # in different subtypes. + for subtype in get_args(stripped_type): + data = _transform_recursive(data, annotation=annotation, inner_type=subtype) + return data + + if isinstance(data, pydantic.BaseModel): + return model_dump(data, exclude_unset=True, mode="json") + + annotated_type = _get_annotated_type(annotation) + if annotated_type is None: + return data + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.format is not None: + return _format_data(data, annotation.format, annotation.format_template) + + return data + + +def _format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object: + if isinstance(data, (date, datetime)): + if format_ == "iso8601": + return data.isoformat() + + if format_ == "custom" and format_template is not None: + return data.strftime(format_template) + + if format_ == "base64" and is_base64_file_input(data): + binary: str | bytes | None = None + + if isinstance(data, pathlib.Path): + binary = data.read_bytes() + elif isinstance(data, io.IOBase): + binary = data.read() + + if isinstance(binary, str): # type: ignore[unreachable] + binary = binary.encode() + + if not isinstance(binary, bytes): + raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}") + + return base64.b64encode(binary).decode("ascii") + + return data + + +def _transform_typeddict( + data: Mapping[str, object], + expected_type: type, +) -> Mapping[str, object]: + result: dict[str, object] = {} + annotations = get_type_hints(expected_type, include_extras=True) + for key, value in data.items(): + if not is_given(value): + # we don't need to include `NotGiven` values here as they'll + # be stripped out before the request is sent anyway + continue + + type_ = annotations.get(key) + if type_ is None: + # we do not have a type annotation for this field, leave it as is + result[key] = value + else: + result[_maybe_transform_key(key, type_)] = _transform_recursive(value, annotation=type_) + return result + + +async def async_maybe_transform( + data: object, + expected_type: object, +) -> Any | None: + """Wrapper over `async_transform()` that allows `None` to be passed. + + See `async_transform()` for more details. + """ + if data is None: + return None + return await async_transform(data, expected_type) + + +async def async_transform( + data: _T, + expected_type: object, +) -> _T: + """Transform dictionaries based off of type information from the given type, for example: + + ```py + class Params(TypedDict, total=False): + card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]] + + + transformed = transform({"card_id": ""}, Params) + # {'cardID': ''} + ``` + + Any keys / data that does not have type information given will be included as is. + + It should be noted that the transformations that this function does are not represented in the type system. + """ + transformed = await _async_transform_recursive(data, annotation=cast(type, expected_type)) + return cast(_T, transformed) + + +async def _async_transform_recursive( + data: object, + *, + annotation: type, + inner_type: type | None = None, +) -> object: + """Transform the given data against the expected type. + + Args: + annotation: The direct type annotation given to the particular piece of data. + This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc + + inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type + is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in + the list can be transformed using the metadata from the container type. + + Defaults to the same value as the `annotation` argument. + """ + if inner_type is None: + inner_type = annotation + + stripped_type = strip_annotated_type(inner_type) + origin = get_origin(stripped_type) or stripped_type + if is_typeddict(stripped_type) and is_mapping(data): + return await _async_transform_typeddict(data, stripped_type) + + if origin == dict and is_mapping(data): + items_type = get_args(stripped_type)[1] + return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()} + + if ( + # List[T] + (is_list_type(stripped_type) and is_list(data)) + # Iterable[T] + or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str)) + ): + # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually + # intended as an iterable, so we don't transform it. + if isinstance(data, dict): + return cast(object, data) + + inner_type = extract_type_arg(stripped_type, 0) + if _no_transform_needed(inner_type): + # for some types there is no need to transform anything, so we can get a small + # perf boost from skipping that work. + # + # but we still need to convert to a list to ensure the data is json-serializable + if is_list(data): + return data + return list(data) + + return [await _async_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data] + + if is_union_type(stripped_type): + # For union types we run the transformation against all subtypes to ensure that everything is transformed. + # + # TODO: there may be edge cases where the same normalized field name will transform to two different names + # in different subtypes. + for subtype in get_args(stripped_type): + data = await _async_transform_recursive(data, annotation=annotation, inner_type=subtype) + return data + + if isinstance(data, pydantic.BaseModel): + return model_dump(data, exclude_unset=True, mode="json") + + annotated_type = _get_annotated_type(annotation) + if annotated_type is None: + return data + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.format is not None: + return await _async_format_data(data, annotation.format, annotation.format_template) + + return data + + +async def _async_format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object: + if isinstance(data, (date, datetime)): + if format_ == "iso8601": + return data.isoformat() + + if format_ == "custom" and format_template is not None: + return data.strftime(format_template) + + if format_ == "base64" and is_base64_file_input(data): + binary: str | bytes | None = None + + if isinstance(data, pathlib.Path): + binary = await anyio.Path(data).read_bytes() + elif isinstance(data, io.IOBase): + binary = data.read() + + if isinstance(binary, str): # type: ignore[unreachable] + binary = binary.encode() + + if not isinstance(binary, bytes): + raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}") + + return base64.b64encode(binary).decode("ascii") + + return data + + +async def _async_transform_typeddict( + data: Mapping[str, object], + expected_type: type, +) -> Mapping[str, object]: + result: dict[str, object] = {} + annotations = get_type_hints(expected_type, include_extras=True) + for key, value in data.items(): + if not is_given(value): + # we don't need to include `NotGiven` values here as they'll + # be stripped out before the request is sent anyway + continue + + type_ = annotations.get(key) + if type_ is None: + # we do not have a type annotation for this field, leave it as is + result[key] = value + else: + result[_maybe_transform_key(key, type_)] = await _async_transform_recursive(value, annotation=type_) + return result + + +@lru_cache(maxsize=8096) +def get_type_hints( + obj: Any, + globalns: dict[str, Any] | None = None, + localns: Mapping[str, Any] | None = None, + include_extras: bool = False, +) -> dict[str, Any]: + return _get_type_hints(obj, globalns=globalns, localns=localns, include_extras=include_extras) diff --git a/src/lmnt/_utils/_typing.py b/src/lmnt/_utils/_typing.py new file mode 100644 index 0000000..1bac954 --- /dev/null +++ b/src/lmnt/_utils/_typing.py @@ -0,0 +1,151 @@ +from __future__ import annotations + +import sys +import typing +import typing_extensions +from typing import Any, TypeVar, Iterable, cast +from collections import abc as _c_abc +from typing_extensions import ( + TypeIs, + Required, + Annotated, + get_args, + get_origin, +) + +from ._utils import lru_cache +from .._types import InheritsGeneric +from .._compat import is_union as _is_union + + +def is_annotated_type(typ: type) -> bool: + return get_origin(typ) == Annotated + + +def is_list_type(typ: type) -> bool: + return (get_origin(typ) or typ) == list + + +def is_iterable_type(typ: type) -> bool: + """If the given type is `typing.Iterable[T]`""" + origin = get_origin(typ) or typ + return origin == Iterable or origin == _c_abc.Iterable + + +def is_union_type(typ: type) -> bool: + return _is_union(get_origin(typ)) + + +def is_required_type(typ: type) -> bool: + return get_origin(typ) == Required + + +def is_typevar(typ: type) -> bool: + # type ignore is required because type checkers + # think this expression will always return False + return type(typ) == TypeVar # type: ignore + + +_TYPE_ALIAS_TYPES: tuple[type[typing_extensions.TypeAliasType], ...] = (typing_extensions.TypeAliasType,) +if sys.version_info >= (3, 12): + _TYPE_ALIAS_TYPES = (*_TYPE_ALIAS_TYPES, typing.TypeAliasType) + + +def is_type_alias_type(tp: Any, /) -> TypeIs[typing_extensions.TypeAliasType]: + """Return whether the provided argument is an instance of `TypeAliasType`. + + ```python + type Int = int + is_type_alias_type(Int) + # > True + Str = TypeAliasType("Str", str) + is_type_alias_type(Str) + # > True + ``` + """ + return isinstance(tp, _TYPE_ALIAS_TYPES) + + +# Extracts T from Annotated[T, ...] or from Required[Annotated[T, ...]] +@lru_cache(maxsize=8096) +def strip_annotated_type(typ: type) -> type: + if is_required_type(typ) or is_annotated_type(typ): + return strip_annotated_type(cast(type, get_args(typ)[0])) + + return typ + + +def extract_type_arg(typ: type, index: int) -> type: + args = get_args(typ) + try: + return cast(type, args[index]) + except IndexError as err: + raise RuntimeError(f"Expected type {typ} to have a type argument at index {index} but it did not") from err + + +def extract_type_var_from_base( + typ: type, + *, + generic_bases: tuple[type, ...], + index: int, + failure_message: str | None = None, +) -> type: + """Given a type like `Foo[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyResponse(Foo[bytes]): + ... + + extract_type_var(MyResponse, bases=(Foo,), index=0) -> bytes + ``` + + And where a generic subclass is given: + ```py + _T = TypeVar('_T') + class MyResponse(Foo[_T]): + ... + + extract_type_var(MyResponse[bytes], bases=(Foo,), index=0) -> bytes + ``` + """ + cls = cast(object, get_origin(typ) or typ) + if cls in generic_bases: # pyright: ignore[reportUnnecessaryContains] + # we're given the class directly + return extract_type_arg(typ, index) + + # if a subclass is given + # --- + # this is needed as __orig_bases__ is not present in the typeshed stubs + # because it is intended to be for internal use only, however there does + # not seem to be a way to resolve generic TypeVars for inherited subclasses + # without using it. + if isinstance(cls, InheritsGeneric): + target_base_class: Any | None = None + for base in cls.__orig_bases__: + if base.__origin__ in generic_bases: + target_base_class = base + break + + if target_base_class is None: + raise RuntimeError( + "Could not find the generic base class;\n" + "This should never happen;\n" + f"Does {cls} inherit from one of {generic_bases} ?" + ) + + extracted = extract_type_arg(target_base_class, index) + if is_typevar(extracted): + # If the extracted type argument is itself a type variable + # then that means the subclass itself is generic, so we have + # to resolve the type argument from the class itself, not + # the base class. + # + # Note: if there is more than 1 type argument, the subclass could + # change the ordering of the type arguments, this is not currently + # supported. + return extract_type_arg(typ, index) + + return extracted + + raise RuntimeError(failure_message or f"Could not resolve inner type variable at index {index} for {typ}") diff --git a/src/lmnt/_utils/_utils.py b/src/lmnt/_utils/_utils.py new file mode 100644 index 0000000..ea3cf3f --- /dev/null +++ b/src/lmnt/_utils/_utils.py @@ -0,0 +1,422 @@ +from __future__ import annotations + +import os +import re +import inspect +import functools +from typing import ( + Any, + Tuple, + Mapping, + TypeVar, + Callable, + Iterable, + Sequence, + cast, + overload, +) +from pathlib import Path +from datetime import date, datetime +from typing_extensions import TypeGuard + +import sniffio + +from .._types import NotGiven, FileTypes, NotGivenOr, HeadersLike +from .._compat import parse_date as parse_date, parse_datetime as parse_datetime + +_T = TypeVar("_T") +_TupleT = TypeVar("_TupleT", bound=Tuple[object, ...]) +_MappingT = TypeVar("_MappingT", bound=Mapping[str, object]) +_SequenceT = TypeVar("_SequenceT", bound=Sequence[object]) +CallableT = TypeVar("CallableT", bound=Callable[..., Any]) + + +def flatten(t: Iterable[Iterable[_T]]) -> list[_T]: + return [item for sublist in t for item in sublist] + + +def extract_files( + # TODO: this needs to take Dict but variance issues..... + # create protocol type ? + query: Mapping[str, object], + *, + paths: Sequence[Sequence[str]], +) -> list[tuple[str, FileTypes]]: + """Recursively extract files from the given dictionary based on specified paths. + + A path may look like this ['foo', 'files', '', 'data']. + + Note: this mutates the given dictionary. + """ + files: list[tuple[str, FileTypes]] = [] + for path in paths: + files.extend(_extract_items(query, path, index=0, flattened_key=None)) + return files + + +def _extract_items( + obj: object, + path: Sequence[str], + *, + index: int, + flattened_key: str | None, +) -> list[tuple[str, FileTypes]]: + try: + key = path[index] + except IndexError: + if isinstance(obj, NotGiven): + # no value was provided - we can safely ignore + return [] + + # cyclical import + from .._files import assert_is_file_content + + # We have exhausted the path, return the entry we found. + assert flattened_key is not None + + if is_list(obj): + files: list[tuple[str, FileTypes]] = [] + for entry in obj: + assert_is_file_content(entry, key=flattened_key + "[]" if flattened_key else "") + files.append((flattened_key + "[]", cast(FileTypes, entry))) + return files + + assert_is_file_content(obj, key=flattened_key) + return [(flattened_key, cast(FileTypes, obj))] + + index += 1 + if is_dict(obj): + try: + # We are at the last entry in the path so we must remove the field + if (len(path)) == index: + item = obj.pop(key) + else: + item = obj[key] + except KeyError: + # Key was not present in the dictionary, this is not indicative of an error + # as the given path may not point to a required field. We also do not want + # to enforce required fields as the API may differ from the spec in some cases. + return [] + if flattened_key is None: + flattened_key = key + else: + flattened_key += f"[{key}]" + return _extract_items( + item, + path, + index=index, + flattened_key=flattened_key, + ) + elif is_list(obj): + if key != "": + return [] + + return flatten( + [ + _extract_items( + item, + path, + index=index, + flattened_key=flattened_key + "[]" if flattened_key is not None else "[]", + ) + for item in obj + ] + ) + + # Something unexpected was passed, just ignore it. + return [] + + +def is_given(obj: NotGivenOr[_T]) -> TypeGuard[_T]: + return not isinstance(obj, NotGiven) + + +# Type safe methods for narrowing types with TypeVars. +# The default narrowing for isinstance(obj, dict) is dict[unknown, unknown], +# however this cause Pyright to rightfully report errors. As we know we don't +# care about the contained types we can safely use `object` in it's place. +# +# There are two separate functions defined, `is_*` and `is_*_t` for different use cases. +# `is_*` is for when you're dealing with an unknown input +# `is_*_t` is for when you're narrowing a known union type to a specific subset + + +def is_tuple(obj: object) -> TypeGuard[tuple[object, ...]]: + return isinstance(obj, tuple) + + +def is_tuple_t(obj: _TupleT | object) -> TypeGuard[_TupleT]: + return isinstance(obj, tuple) + + +def is_sequence(obj: object) -> TypeGuard[Sequence[object]]: + return isinstance(obj, Sequence) + + +def is_sequence_t(obj: _SequenceT | object) -> TypeGuard[_SequenceT]: + return isinstance(obj, Sequence) + + +def is_mapping(obj: object) -> TypeGuard[Mapping[str, object]]: + return isinstance(obj, Mapping) + + +def is_mapping_t(obj: _MappingT | object) -> TypeGuard[_MappingT]: + return isinstance(obj, Mapping) + + +def is_dict(obj: object) -> TypeGuard[dict[object, object]]: + return isinstance(obj, dict) + + +def is_list(obj: object) -> TypeGuard[list[object]]: + return isinstance(obj, list) + + +def is_iterable(obj: object) -> TypeGuard[Iterable[object]]: + return isinstance(obj, Iterable) + + +def deepcopy_minimal(item: _T) -> _T: + """Minimal reimplementation of copy.deepcopy() that will only copy certain object types: + + - mappings, e.g. `dict` + - list + + This is done for performance reasons. + """ + if is_mapping(item): + return cast(_T, {k: deepcopy_minimal(v) for k, v in item.items()}) + if is_list(item): + return cast(_T, [deepcopy_minimal(entry) for entry in item]) + return item + + +# copied from https://github.com/Rapptz/RoboDanny +def human_join(seq: Sequence[str], *, delim: str = ", ", final: str = "or") -> str: + size = len(seq) + if size == 0: + return "" + + if size == 1: + return seq[0] + + if size == 2: + return f"{seq[0]} {final} {seq[1]}" + + return delim.join(seq[:-1]) + f" {final} {seq[-1]}" + + +def quote(string: str) -> str: + """Add single quotation marks around the given string. Does *not* do any escaping.""" + return f"'{string}'" + + +def required_args(*variants: Sequence[str]) -> Callable[[CallableT], CallableT]: + """Decorator to enforce a given set of arguments or variants of arguments are passed to the decorated function. + + Useful for enforcing runtime validation of overloaded functions. + + Example usage: + ```py + @overload + def foo(*, a: str) -> str: ... + + + @overload + def foo(*, b: bool) -> str: ... + + + # This enforces the same constraints that a static type checker would + # i.e. that either a or b must be passed to the function + @required_args(["a"], ["b"]) + def foo(*, a: str | None = None, b: bool | None = None) -> str: ... + ``` + """ + + def inner(func: CallableT) -> CallableT: + params = inspect.signature(func).parameters + positional = [ + name + for name, param in params.items() + if param.kind + in { + param.POSITIONAL_ONLY, + param.POSITIONAL_OR_KEYWORD, + } + ] + + @functools.wraps(func) + def wrapper(*args: object, **kwargs: object) -> object: + given_params: set[str] = set() + for i, _ in enumerate(args): + try: + given_params.add(positional[i]) + except IndexError: + raise TypeError( + f"{func.__name__}() takes {len(positional)} argument(s) but {len(args)} were given" + ) from None + + for key in kwargs.keys(): + given_params.add(key) + + for variant in variants: + matches = all((param in given_params for param in variant)) + if matches: + break + else: # no break + if len(variants) > 1: + variations = human_join( + ["(" + human_join([quote(arg) for arg in variant], final="and") + ")" for variant in variants] + ) + msg = f"Missing required arguments; Expected either {variations} arguments to be given" + else: + assert len(variants) > 0 + + # TODO: this error message is not deterministic + missing = list(set(variants[0]) - given_params) + if len(missing) > 1: + msg = f"Missing required arguments: {human_join([quote(arg) for arg in missing])}" + else: + msg = f"Missing required argument: {quote(missing[0])}" + raise TypeError(msg) + return func(*args, **kwargs) + + return wrapper # type: ignore + + return inner + + +_K = TypeVar("_K") +_V = TypeVar("_V") + + +@overload +def strip_not_given(obj: None) -> None: ... + + +@overload +def strip_not_given(obj: Mapping[_K, _V | NotGiven]) -> dict[_K, _V]: ... + + +@overload +def strip_not_given(obj: object) -> object: ... + + +def strip_not_given(obj: object | None) -> object: + """Remove all top-level keys where their values are instances of `NotGiven`""" + if obj is None: + return None + + if not is_mapping(obj): + return obj + + return {key: value for key, value in obj.items() if not isinstance(value, NotGiven)} + + +def coerce_integer(val: str) -> int: + return int(val, base=10) + + +def coerce_float(val: str) -> float: + return float(val) + + +def coerce_boolean(val: str) -> bool: + return val == "true" or val == "1" or val == "on" + + +def maybe_coerce_integer(val: str | None) -> int | None: + if val is None: + return None + return coerce_integer(val) + + +def maybe_coerce_float(val: str | None) -> float | None: + if val is None: + return None + return coerce_float(val) + + +def maybe_coerce_boolean(val: str | None) -> bool | None: + if val is None: + return None + return coerce_boolean(val) + + +def removeprefix(string: str, prefix: str) -> str: + """Remove a prefix from a string. + + Backport of `str.removeprefix` for Python < 3.9 + """ + if string.startswith(prefix): + return string[len(prefix) :] + return string + + +def removesuffix(string: str, suffix: str) -> str: + """Remove a suffix from a string. + + Backport of `str.removesuffix` for Python < 3.9 + """ + if string.endswith(suffix): + return string[: -len(suffix)] + return string + + +def file_from_path(path: str) -> FileTypes: + contents = Path(path).read_bytes() + file_name = os.path.basename(path) + return (file_name, contents) + + +def get_required_header(headers: HeadersLike, header: str) -> str: + lower_header = header.lower() + if is_mapping_t(headers): + # mypy doesn't understand the type narrowing here + for k, v in headers.items(): # type: ignore + if k.lower() == lower_header and isinstance(v, str): + return v + + # to deal with the case where the header looks like Stainless-Event-Id + intercaps_header = re.sub(r"([^\w])(\w)", lambda pat: pat.group(1) + pat.group(2).upper(), header.capitalize()) + + for normalized_header in [header, lower_header, header.upper(), intercaps_header]: + value = headers.get(normalized_header) + if value: + return value + + raise ValueError(f"Could not find {header} header") + + +def get_async_library() -> str: + try: + return sniffio.current_async_library() + except Exception: + return "false" + + +def lru_cache(*, maxsize: int | None = 128) -> Callable[[CallableT], CallableT]: + """A version of functools.lru_cache that retains the type signature + for the wrapped function arguments. + """ + wrapper = functools.lru_cache( # noqa: TID251 + maxsize=maxsize, + ) + return cast(Any, wrapper) # type: ignore[no-any-return] + + +def json_safe(data: object) -> object: + """Translates a mapping / sequence recursively in the same fashion + as `pydantic` v2's `model_dump(mode="json")`. + """ + if is_mapping(data): + return {json_safe(key): json_safe(value) for key, value in data.items()} + + if is_iterable(data) and not isinstance(data, (str, bytes, bytearray)): + return [json_safe(item) for item in data] + + if isinstance(data, (datetime, date)): + return data.isoformat() + + return data diff --git a/src/lmnt/_version.py b/src/lmnt/_version.py new file mode 100644 index 0000000..20652ed --- /dev/null +++ b/src/lmnt/_version.py @@ -0,0 +1,4 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +__title__ = "lmnt" +__version__ = "0.0.1-alpha.0" diff --git a/src/lmnt/api.py b/src/lmnt/api.py deleted file mode 100644 index aaaf6f6..0000000 --- a/src/lmnt/api.py +++ /dev/null @@ -1,502 +0,0 @@ -# Copyright 2023 LMNT, Inc. All Rights Reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. -# ============================================================================== - -from aiohttp import WSMsgType -from typing import List, Optional - -import aiohttp -import base64 -import json -import os - - -_BASE_URL = 'https://api.lmnt.com' -_SYNTHESIZE_STREAMING_ENDPOINT = '/v1/ai/speech/stream' -_LIST_VOICES_ENDPOINT = '/v1/ai/voice/list' -_VOICE_ENDPOINT = '/v1/ai/voice/{id}' -_CREATE_VOICE_ENDPOINT = '/v1/ai/voice' -_SPEECH_ENDPOINT = '/v1/ai/speech' -_CONVERT_ENDPOINT = '/v1/ai/speech/convert' -_ACCOUNT_ENDPOINT = '/v1/account' - - -class SpeechError(Exception): - def __init__(self, status, error, caller): - self.message = '' - if caller: - self.message = f'[{caller}]: ' - self.status = status - if 'error' in error: - self.message += error['error'] - elif 'message' in error: - self.message += error['message'] - else: - self.message += 'Unknown error; see status code for hints on what went wrong.' - - def __str__(self): - return f'SpeechError [status={self.status}] {self.message}' - - -class StreamError(Exception): - def __init__(self, message): - self.message = message - - def __str__(self): - return f'StreamError: {self.message}' - - -class _StreamingSynthesisIterator: - def __init__(self, original_iterator, return_extras: bool): - self.original_iterator = original_iterator - self.return_extras = return_extras - - async def __anext__(self): - msg1 = await self.original_iterator.__anext__() - if msg1.type == WSMsgType.CLOSE: - return # Equivalent to raising a StopAsyncIteration exception, will cleanly stop async for loop - data = {} - - if self.return_extras: - msg1_json = self._parse_and_check_errors(msg1, require_error=False) - msg2 = await self.original_iterator.__anext__() - if msg2.type != WSMsgType.BINARY: - self._parse_and_check_errors(msg2) - data = {'audio': msg2.data, 'durations': msg1_json['durations']} - if 'warning' in msg1_json: - data['warning'] = msg1_json['warning'] - if 'buffer_empty' in msg1_json: - data['buffer_empty'] = msg1_json['buffer_empty'] - else: - if msg1.type != WSMsgType.BINARY: - self._parse_and_check_errors(msg1) - data = {'audio': msg1.data} - - return data - - def _parse_and_check_errors(self, msg, require_error=True): - if msg.type != WSMsgType.TEXT: - raise StreamError('Unexpected message type received from server.') - msg_json = json.loads(msg.data) - if 'error' in msg_json: - raise StreamError(msg_json['error']) - if require_error: - raise StreamError('Unexpected message type received from server.') - return msg_json - - -class StreamingSynthesisConnection: - def __init__(self, socket, return_extras: bool): - self.socket = socket - self.return_extras = return_extras - - def __aiter__(self): - """ - Returns a streaming iterator that yields an object containing binary audio data (and optionally other data) as it is received from the server. - """ - return _StreamingSynthesisIterator(self.socket.__aiter__(), self.return_extras) - - async def __anext__(self): - return self.socket.__anext__() - - async def append_text(self, text: str): - msg = { - 'text': text - } - await self.socket.send_str(json.dumps(msg)) - - async def flush(self): - await self.socket.send_str('{"flush": true}') - - async def finish(self): - await self.socket.send_str('{"eof": true}') - - -class Speech: - def __init__(self, api_key: Optional[str] = None, **kwargs): - self._session = None - self._api_key = api_key or os.environ.get('LMNT_API_KEY') - self._base_url = kwargs.get('base_url', _BASE_URL) - self._connector = kwargs.get('connector', None) - if not self._api_key: - raise ValueError('Please set the `LMNT_API_KEY` environment variable or pass it in to the Speech constructor.') - - async def __aenter__(self): - self._lazy_init() - return self - - async def __aexit__(self, exc_type, exc, tb): - await self.close() - - async def close(self): - if self._session is not None: - await self._session.close() - self._session = None - - async def list_voices(self, starred: bool = False, owner: str = 'all'): - """ - Returns a list of voices available to you. - - Optional parameters: - - `starred`: Show starred voices only. Defaults to `false`. - - `owner`: Specify which voices to return. Choose from `system`, `me`, or `all`. Defaults to `all`. - - Returns a list of dictionaries containing details of each voice. - """ - if owner not in ['all', 'system', 'me']: - raise ValueError(f'Invalid owner: {owner}') - if not isinstance(starred, bool): - raise ValueError(f'Invalid starred: {starred}') - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - url = f'{self._base_url}{_LIST_VOICES_ENDPOINT}?starred={starred}&owner={owner}' - - async with self._session.get(url, headers=self._build_headers()) as resp: - await self._handle_response_errors(resp, 'Speech.list_voices') - return await resp.json() - - async def voice_info(self, voice_id: str): - """ - Returns details of a specific voice. - - Required parameters: - - `voice_id`: The id of the voice to get info on. If you don't know the id, you can get it from `list_voices()`. - - Returns a dictionary containing details of the voice. - """ - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - url = f'{self._base_url}{_VOICE_ENDPOINT}'.format(id=voice_id) - - async with self._session.get(url, headers=self._build_headers()) as resp: - await self._handle_response_errors(resp, 'Speech.voice_info') - return await resp.json() - - async def create_voice(self, name: str, enhance: bool, filenames: List[str], type: str = 'instant', gender: Optional[str] = None, description: Optional[str] = None): - """ - Creates a new voice from a set of audio files. Returns the voice metadata object. - - Parameters: - - `name`: The name of the voice. - - `enhance`: For unclean audio with background noise, applies processing to attempt to improve quality. Not on by default as it can also degrade quality in some circumstances. - - `filenames`: A list of filenames to use for the voice. - - Optional parameters: - - `type`: The type of voice to create. Must be one of `instant` or `professional`. Defaults to `instant`. - - `gender`: The gender of the voice, e.g. `male`, `female`, `nonbinary`. For categorization purposes. Defaults to `None`. - - `description`: A description of the voice. Defaults to `None`. - - Returns the voice metadata object: - - `id`: The id of the voice (`voice_id`). - - `name`: The name of the voice. - - `owner`: The owner of the voice. - - `state`: The state of the voice, e.g. `ready`, `pending`, `broken`. - - `gender`: The gender of the voice, e.g. `male`, `female`, `nonbinary`. - - `type`: The type of voice, e.g. `instant`, `professional`. - - `description`: A description of the voice. - """ - if type not in ['instant', 'professional']: - raise ValueError(f'[Speech.create_voice] Invalid type: {type}') - if name is None: - raise ValueError('[Speech.create_voice] Name must not be None.') - if len(name) == 0: - raise ValueError('[Speech.create_voice] Name must be non-empty.') - if filenames is None: - raise ValueError('[Speech.create_voice] Filenames must not be None.') - if len(filenames) == 0: - raise ValueError('[Speech.create_voice] Filenames must be non-empty.') - if enhance is None: - raise ValueError('[Speech.create_voice] Enhance must not be None.') - - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - - metadata = json.dumps({ - 'name': name, - 'enhance': enhance, - 'type': type, - 'gender': gender, - 'description': description, - }) - files = [] - try: - with aiohttp.MultipartWriter() as mpwriter: - mpwriter.append(metadata, {'Content-Type': 'application/json', 'Content-Disposition': 'form-data; name="metadata"'}) - for filename in filenames: - f = open(filename, 'rb') - files.append(f) - part = mpwriter.append(f) - part.set_content_disposition('form-data', name='file_field', filename=os.path.basename(filename)) - async with self._session.post(f'{self._base_url}{_CREATE_VOICE_ENDPOINT}', data=mpwriter, headers=self._build_headers()) as resp: - await self._handle_response_errors(resp, 'Speech.create_voice') - return await resp.json() - finally: - for file in files: - file.close() - - async def update_voice(self, voice_id: str, **kwargs): - """ - Updates metadata for a specific voice. A voice that is not owned by you can only have its `starred` field updated. - Only provided fields will be changed. - - Required parameters: - - `voice_id` (str): The id of the voice to update. If you don't know the id, you can get it from `list_voices()`. - - Optional parameters: - - `name` (str): The name of the voice. - - `starred` (bool): Whether the voice is starred by you - - `gender` (str): The gender of the voice, e.g. `male`, `female`, `nonbinary`. For categorization purposes. - - `description` (str): A description of the voice. - """ - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - url = f'{self._base_url}{_VOICE_ENDPOINT}'.format(id=voice_id) - - data = { - 'name': kwargs.get('name', None), - 'starred': kwargs.get('starred', None), - 'gender': kwargs.get('gender', None), - 'description': kwargs.get('description', None), - } - data = json.dumps({k: v for k, v in data.items() if v is not None}) - async with self._session.put(url, data=data, headers=self._build_headers(type='application/json')) as resp: - await self._handle_response_errors(resp, 'Speech.update_voice') - return await resp.json() - - async def unfreeze_voice(self, voice_id: str): - """ - Unfreezes a professional voice clone owned by you. - - We are constantly improving and releasing our speech models. Voices that are not being used will not be - upgraded automatically and will enter a frozen state. - - Do not worry though. If your voice is frozen, call this method to upgrade it to the latest model. - - Instant voices always use the latest model and are never frozen. - """ - self._lazy_init() - url = f'{self._base_url}{_VOICE_ENDPOINT}'.format(id=voice_id) - data = { - 'unfreeze': True - } - data = json.dumps({k: v for k, v in data.items() if v is not None}) - async with self._session.put(url, data=data, headers=self._build_headers(type='application/json')) as resp: - await self._handle_response_errors(resp, 'Speech.unfreeze_voice') - return await resp.json() - - async def delete_voice(self, voice_id: str): - """ - Deletes a voice and cancels any pending operations on it. The voice must be owned by you. Cannot be undone. - - Required parameters: - - `voice_id` (str): The id of the voice to delete. If you don't know the id, you can get it from `list_voices()`. - """ - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - url = f'{self._base_url}{_VOICE_ENDPOINT}'.format(id=voice_id) - - async with self._session.delete(url, headers=self._build_headers()) as resp: - await self._handle_response_errors(resp, 'Speech.delete_voice') - return await resp.json() - - async def synthesize(self, text: str, voice: str, **kwargs): - """ - Synthesize speech from text. - - Parameters: - - `text` (str): The text to synthesize. - - `voice` (str): The voice id to use for synthesis. - - Optional parameters: - - `model` (str): The name of the model to use. Defaults to `aurora`. - - `seed` (int): The seed used to specify a different take. Defaults to random. - - `format` (str): The audio format to use for synthesis. Defaults to `mp3`. - - `sample_rate` (int): 8000, 16000, or 24000 - the desired output sample rate. Defaults to 24000 for all formats except `mulaw` which defaults to 8000. - - `speed` (float): Floating point value between 0.25 (slow) and 2.0 (fast); Defaults to 1.0 - - `return_durations` (bool): If `True`, the response will include word durations detail. Defaults to `False`. - - `return_seed` (bool): If `True`, the response will include the seed used for synthesis. Defaults to `False`. - - `language` (str): The desired language of the synthesized speech. Two letter ISO 639-1 code. Defaults to `en`. - - `conversational` (bool): If `True`, the synthesized speech will be more conversational. Defaults to `False`. - - `length` (int): The desired target length of the output speech in seconds. Maximum 300.0 (5 minutes) - - Deprecated parameters: - - `durations` (bool): If `True`, the response will include word durations detail. Defaults to `False`. Deprecated in favor of `return_durations`. - - Returns an object with the following keys: - - `audio`: The binary audio file. - - `durations`: The word durations detail. Only returned if `return_durations` is `True`. - - `seed`: The seed used for synthesis. Only returned if `return_seed` is `True`. - - Each `durations` entry is a dictionary describing the duration of each word with the following keys: - - `text`: the word itself - - `start`: the time at which the word starts, in seconds - - `duration`: the overall duration of the word, in seconds - """ - assert text is not None, '[Speech.synthesize] `text` must not be None.' - assert voice is not None, '[Speech.synthesize] `voice` must not be None.' - assert len(text) > 0, '[Speech.synthesize] `text` must be non-empty.' - assert len(voice) > 0, '[Speech.synthesize] `voice` must be non-empty.' - - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - url = f'{self._base_url}{_SPEECH_ENDPOINT}' - - model = kwargs.get('model', 'aurora') - form_data = aiohttp.FormData() - form_data.add_field('text', text) - form_data.add_field('voice', voice) - if 'seed' in kwargs: - form_data.add_field('seed', kwargs.get('seed')) - form_data.add_field('format', kwargs.get('format', 'mp3')) - if model == 'aurora': - form_data.add_field('speed', kwargs.get('speed', 1.0)) - form_data.add_field('model', model) - length = kwargs.get('length', None) - if length is not None and model == 'aurora': - form_data.add_field('length', length) - if 'sample_rate' in kwargs: - form_data.add_field('sample_rate', kwargs.get('sample_rate')) - if 'quality' in kwargs: - form_data.add_field('quality', kwargs.get('quality')) - return_durations = kwargs.get('durations', False) - if 'return_durations' in kwargs: # return_durations takes precedence over durations - return_durations = kwargs['return_durations'] - if return_durations is True: - form_data.add_field('return_durations', 'true') - return_seed = kwargs.get('return_seed', False) - if 'language' in kwargs: - form_data.add_field('language', kwargs.get('language')) - if 'conversational' in kwargs: - form_data.add_field('conversational', kwargs.get('conversational')) - - async with self._session.post(url, data=form_data, headers=self._build_headers()) as resp: - await self._handle_response_errors(resp, 'Speech.synthesize') - response_data = await resp.json() - synthesis_result = {} - synthesis_result['audio'] = base64.b64decode(response_data['audio']) - if return_durations: - synthesis_result['durations'] = response_data['durations'] - if return_seed: - synthesis_result['seed'] = response_data['seed'] - return synthesis_result - - async def convert(self, audio: bytes, voice: str, **kwargs) -> bytes: - """ - Converts speech from one voice to another. - - Required parameters: - - `audio` (bytes): The audio file to be converted into a new voice. Max file size: 1 MB. - - `voice` (str): The voice id to convert the speech into. Voice ids can be retrieved from `list_voices()` or `voice_info()`. - - Optional parameters: - - `format` (str): The audio format to use for conversion. Defaults to `mp3`. - - `sample_rate` (int): 8000, 16000, or 24000 - the desired output sample rate. Defaults to 24000. - - `language` (str): The language of the source audio. Two letter ISO 639-1 code. Defaults to `en`. - - Returns: - - bytes: The binary audio data of the converted speech. - """ - assert audio is not None, '[Speech.convert] `audio` must not be None.' - assert len(audio) > 0, '[Speech.convert] `audio` must be non-empty.' - assert voice is not None, '[Speech.convert] `voice` must not be None.' - assert len(voice) > 0, '[Speech.convert] `voice` must be non-empty.' - - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - url = f'{self._base_url}{_CONVERT_ENDPOINT}' - - form_data = aiohttp.FormData() - form_data.add_field('audio', audio) - form_data.add_field('voice', voice) - - if 'format' in kwargs: - form_data.add_field('format', kwargs['format']) - if 'sample_rate' in kwargs: - form_data.add_field('sample_rate', kwargs['sample_rate']) - if 'language' in kwargs: - form_data.add_field('language', kwargs['language']) - - async with self._session.post(url, data=form_data, headers=self._build_headers()) as resp: - await self._handle_response_errors(resp, 'Speech.convert') - return await resp.read() - - async def synthesize_streaming(self, voice: str, return_extras: bool = False, **kwargs): - """ - Initiates a full-duplex streaming connection with the server that allows you to send text and receive audio in real-time. - - Parameters: - - `format` (str): `mp3`, `raw`, or `ulaw` - the desired output format. Defaults to `mp3`. - - `sample_rate` (int): 8000, 16000, or 24000 - the desired output sample rate. Defaults to 24000. - - `voice` (str): The voice id to use for this connection. - - `speed` (float): The speed to use for synthesis. Defaults to 1.0. - - `return_extras` (bool): If `True`, the response will include word durations detail. Defaults to `False`. - - `language` (str): The desired language of the synthesized speech. Two letter ISO 639-1 code. Defaults to `en`. - - `conversational` (bool): If `True`, the synthesized speech will be more conversational. Defaults to `False`. - - Returns: - - `StreamingSynthesisConnection`: The streaming connection object. - """ - if not voice: - raise ValueError('[Speech.synthesize_streaming] `voice` must not be None.') - - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - - init_msg = { - 'X-API-Key': self._api_key, - 'voice': voice - } - if 'format' in kwargs: - init_msg['format'] = kwargs['format'] - if 'sample_rate' in kwargs: - init_msg['sample_rate'] = kwargs['sample_rate'] - if 'speed' in kwargs: - init_msg['speed'] = kwargs['speed'] - if 'expressive' in kwargs: - init_msg['expressive'] = kwargs['expressive'] - init_msg['send_extras'] = return_extras - if 'language' in kwargs: - init_msg['language'] = kwargs['language'] - if 'conversational' in kwargs: - init_msg['conversational'] = kwargs['conversational'] - ws = await self._session.ws_connect(f'{self._base_url}{_SYNTHESIZE_STREAMING_ENDPOINT}') - await ws.send_str(json.dumps(init_msg)) - return StreamingSynthesisConnection(ws, return_extras) - - async def account_info(self): - """ - Returns details about your account. - """ - self._lazy_init() - assert self._session is not None, 'Session was not initialized' - url = f'{self._base_url}{_ACCOUNT_ENDPOINT}' - - async with self._session.get(url, headers=self._build_headers()) as resp: - await self._handle_response_errors(resp, 'Speech.account_info') - return await resp.json() - - def _lazy_init(self): - if self._session is None: - self._session = aiohttp.ClientSession(connector=self._connector) - - def _build_headers(self, type: Optional[str] = None): - headers = {'X-API-Key': self._api_key} - if type is not None: - headers['Content-Type'] = type - return headers - - async def _handle_response_errors(self, response, caller=None): - if response.status < 400: - return - raise SpeechError(response.status, await response.json(), caller) diff --git a/src/lmnt/lib/.keep b/src/lmnt/lib/.keep new file mode 100644 index 0000000..5e2c99f --- /dev/null +++ b/src/lmnt/lib/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store custom files to expand the SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/src/lmnt/lib/__init__.py b/src/lmnt/lib/__init__.py new file mode 100644 index 0000000..3aeaf76 --- /dev/null +++ b/src/lmnt/lib/__init__.py @@ -0,0 +1,3 @@ +from .websocket_streaming import Duration, SpeechSession, SpeechSessionResponse + +__all__ = ["SpeechSession", "SpeechSessionResponse", "Duration"] diff --git a/src/lmnt/lib/websocket_streaming.py b/src/lmnt/lib/websocket_streaming.py new file mode 100644 index 0000000..673b4a5 --- /dev/null +++ b/src/lmnt/lib/websocket_streaming.py @@ -0,0 +1,147 @@ +import json +from typing import Any, Dict, List, Final, Optional +from dataclasses import dataclass + +import websockets +from websockets.typing import Data + +URL_STREAMING: Final = "wss://api.lmnt.com/v1/ai/speech/stream" + + +@dataclass +class Duration: + """Duration information for a segment of synthesized speech.""" + + text: str + start: float # Start time in seconds + duration: float # Duration in seconds + + +@dataclass +class SpeechSessionResponse: + """Response from a speech session connection.""" + + audio: bytes + durations: Optional[List[Duration]] = None + warning: Optional[str] = None + buffer_empty: Optional[bool] = None + + +class UnexpectedMessageError(Exception): + """Exception raised when an unexpected message is received from the server.""" + + def __init__(self, message: str): + self.message = message + super().__init__(f"Unexpected message received from server: {message}") + + +class SpeechSession: + """Async websocket connection for LMNT speech session.""" + + def __init__( + self, + api_key: str, + voice: str, + format: Optional[str] = None, + language: Optional[str] = None, + sample_rate: Optional[int] = None, + return_extras: Optional[bool] = None, + ): + self.api_key = api_key + self.voice = voice + self.format = format + self.language = language + self.sample_rate = sample_rate + self.return_extras = return_extras + self.websocket: Optional[Any] = None + + async def connect(self) -> None: + """Establish the websocket connection.""" + self.websocket = await websockets.connect(URL_STREAMING) + init_msg = { + "X-API-Key": self.api_key, + "voice": self.voice, + } + if self.format: + init_msg["format"] = self.format + if self.language: + init_msg["language"] = self.language + if self.sample_rate: + init_msg["sample_rate"] = str(self.sample_rate) + if self.return_extras: + init_msg["return_extras"] = str(self.return_extras) + if self.websocket is not None: + await self.websocket.send(json.dumps(init_msg)) + + async def append_text(self, text: str) -> None: + """Append text to be synthesized.""" + await self._send_message({"text": text}) + + async def flush(self) -> None: + """Flush the current text buffer.""" + await self._send_message({"flush": True}) + + async def finish(self) -> None: + """Mark the session as finished.""" + await self._send_message({"eof": True}) + + async def close(self) -> None: + """Close the websocket connection.""" + if self.websocket is not None: + await self.websocket.close() + self.websocket = None + + async def _send_message(self, message: Dict[str, Any]) -> None: + """Send a message through the websocket.""" + if self.websocket is not None: + await self.websocket.send(json.dumps(message)) + + def __aiter__(self) -> "SpeechSession": + """Return the async iterator.""" + return self + + async def __anext__(self) -> SpeechSessionResponse: + """Get the next speech session response.""" + if not self.websocket: + raise StopAsyncIteration + try: + if self.return_extras: + extras_message = await self.websocket.recv() + if not isinstance(extras_message, str): + raise UnexpectedMessageError("Expected string for extras message") + extras = self._parse_and_check_error(extras_message) + audio_msg = await self.websocket.recv() + audio_data = self._process_audio_data(audio_msg) + durations = None + if extras.get("durations"): + durations = [Duration(**d) for d in extras["durations"]] + return SpeechSessionResponse( + audio=audio_data, + durations=durations, + warning=extras.get("warning"), + buffer_empty=extras.get("buffer_empty"), + ) + else: + audio_msg = await self.websocket.recv() + audio_data = self._process_audio_data(audio_msg) + return SpeechSessionResponse(audio=audio_data) + except websockets.exceptions.ConnectionClosed as err: + raise StopAsyncIteration from err + + def _process_audio_data(self, audio_msg: Data) -> bytes: + """Process the audio data. Handles binary audio data and JSON error messages.""" + if isinstance(audio_msg, bytes): + return audio_msg + else: + self._parse_and_check_error(str(audio_msg)) + raise UnexpectedMessageError(str(audio_msg)) + + def _parse_and_check_error(self, message: str) -> Dict[str, Any]: + """JSON parse a message and check for errors.""" + try: + msg_json: Dict[str, Any] = json.loads(message) + except json.JSONDecodeError as err: + raise ValueError(f"Invalid JSON received from server: {message}") from err + if "error" in msg_json: + raise ValueError(msg_json["error"]) + return msg_json diff --git a/src/lmnt/py.typed b/src/lmnt/py.typed new file mode 100644 index 0000000..e69de29 diff --git a/src/lmnt/resources/__init__.py b/src/lmnt/resources/__init__.py new file mode 100644 index 0000000..f139fdf --- /dev/null +++ b/src/lmnt/resources/__init__.py @@ -0,0 +1,49 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .speech import ( + SpeechResource, + AsyncSpeechResource, + SpeechResourceWithRawResponse, + AsyncSpeechResourceWithRawResponse, + SpeechResourceWithStreamingResponse, + AsyncSpeechResourceWithStreamingResponse, +) +from .voices import ( + VoicesResource, + AsyncVoicesResource, + VoicesResourceWithRawResponse, + AsyncVoicesResourceWithRawResponse, + VoicesResourceWithStreamingResponse, + AsyncVoicesResourceWithStreamingResponse, +) +from .accounts import ( + AccountsResource, + AsyncAccountsResource, + AccountsResourceWithRawResponse, + AsyncAccountsResourceWithRawResponse, + AccountsResourceWithStreamingResponse, + AsyncAccountsResourceWithStreamingResponse, +) +from .sessions import AsyncSessionsResource + +__all__ = [ + "SpeechResource", + "AsyncSpeechResource", + "SpeechResourceWithRawResponse", + "AsyncSpeechResourceWithRawResponse", + "SpeechResourceWithStreamingResponse", + "AsyncSpeechResourceWithStreamingResponse", + "AccountsResource", + "AsyncAccountsResource", + "AccountsResourceWithRawResponse", + "AsyncAccountsResourceWithRawResponse", + "AccountsResourceWithStreamingResponse", + "AsyncAccountsResourceWithStreamingResponse", + "VoicesResource", + "AsyncVoicesResource", + "VoicesResourceWithRawResponse", + "AsyncVoicesResourceWithRawResponse", + "VoicesResourceWithStreamingResponse", + "AsyncVoicesResourceWithStreamingResponse", + "AsyncSessionsResource", +] diff --git a/src/lmnt/resources/accounts.py b/src/lmnt/resources/accounts.py new file mode 100644 index 0000000..a0c840a --- /dev/null +++ b/src/lmnt/resources/accounts.py @@ -0,0 +1,135 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import httpx + +from .._types import NOT_GIVEN, Body, Query, Headers, NotGiven +from .._compat import cached_property +from .._resource import SyncAPIResource, AsyncAPIResource +from .._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from .._base_client import make_request_options +from ..types.account_retrieve_response import AccountRetrieveResponse + +__all__ = ["AccountsResource", "AsyncAccountsResource"] + + +class AccountsResource(SyncAPIResource): + @cached_property + def with_raw_response(self) -> AccountsResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#accessing-raw-response-data-eg-headers + """ + return AccountsResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AccountsResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#with_streaming_response + """ + return AccountsResourceWithStreamingResponse(self) + + def retrieve( + self, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> AccountRetrieveResponse: + """Returns details about your account.""" + return self._get( + "/v1/account", + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=AccountRetrieveResponse, + ) + + +class AsyncAccountsResource(AsyncAPIResource): + @cached_property + def with_raw_response(self) -> AsyncAccountsResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#accessing-raw-response-data-eg-headers + """ + return AsyncAccountsResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncAccountsResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#with_streaming_response + """ + return AsyncAccountsResourceWithStreamingResponse(self) + + async def retrieve( + self, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> AccountRetrieveResponse: + """Returns details about your account.""" + return await self._get( + "/v1/account", + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=AccountRetrieveResponse, + ) + + +class AccountsResourceWithRawResponse: + def __init__(self, accounts: AccountsResource) -> None: + self._accounts = accounts + + self.retrieve = to_raw_response_wrapper( + accounts.retrieve, + ) + + +class AsyncAccountsResourceWithRawResponse: + def __init__(self, accounts: AsyncAccountsResource) -> None: + self._accounts = accounts + + self.retrieve = async_to_raw_response_wrapper( + accounts.retrieve, + ) + + +class AccountsResourceWithStreamingResponse: + def __init__(self, accounts: AccountsResource) -> None: + self._accounts = accounts + + self.retrieve = to_streamed_response_wrapper( + accounts.retrieve, + ) + + +class AsyncAccountsResourceWithStreamingResponse: + def __init__(self, accounts: AsyncAccountsResource) -> None: + self._accounts = accounts + + self.retrieve = async_to_streamed_response_wrapper( + accounts.retrieve, + ) diff --git a/src/lmnt/resources/sessions.py b/src/lmnt/resources/sessions.py new file mode 100644 index 0000000..62f6204 --- /dev/null +++ b/src/lmnt/resources/sessions.py @@ -0,0 +1,43 @@ +from typing import Literal, Optional + +from .._resource import AsyncAPIResource +from ..lib.websocket_streaming import SpeechSession + +__all__ = ["AsyncSessionsResource", "SpeechSession"] + + +class AsyncSessionsResource(AsyncAPIResource): + """Methods for the Sessions resource.""" + + async def create( + self, + *, + voice: str, + format: Optional[Literal["mp3", "raw", "ulaw", "webm"]] = None, + language: Optional[str] = None, + sample_rate: Optional[Literal[8000, 16000, 24000]] = None, + return_extras: Optional[bool] = None, + ) -> SpeechSession: + """Create a new websocket connection for full-duplex streaming speech synthesis. + The websocket connection is cleanly closed when the user calls finish(). + + Args: + voice: The voice id of the voice to use for synthesis + format: The file format of the synthesized audio output ('mp3', 'raw', 'ulaw', 'webm') + language: The desired language of the synthesized speech. Two letter ISO 639-1 code. + sample_rate: The desired output sample rate in Hz (8000, 16000, or 24000) + return_extras: If True, response will contain a durations object. + + Returns: + SpeechSession: A new streaming speech session + """ + session = SpeechSession( + self._client.api_key, + voice=voice, + format=format, + language=language, + sample_rate=sample_rate, + return_extras=return_extras, + ) + await session.connect() + return session diff --git a/src/lmnt/resources/speech.py b/src/lmnt/resources/speech.py new file mode 100644 index 0000000..04f9506 --- /dev/null +++ b/src/lmnt/resources/speech.py @@ -0,0 +1,845 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Mapping, cast +from typing_extensions import Literal + +import httpx + +from ..types import speech_convert_params, speech_generate_params, speech_generate_detailed_params +from .._types import NOT_GIVEN, Body, Query, Headers, NotGiven, FileTypes +from .._utils import extract_files, maybe_transform, deepcopy_minimal, async_maybe_transform +from .._compat import cached_property +from .sessions import AsyncSessionsResource +from .._resource import SyncAPIResource, AsyncAPIResource +from .._response import ( + BinaryAPIResponse, + AsyncBinaryAPIResponse, + StreamedBinaryAPIResponse, + AsyncStreamedBinaryAPIResponse, + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + to_custom_raw_response_wrapper, + async_to_streamed_response_wrapper, + to_custom_streamed_response_wrapper, + async_to_custom_raw_response_wrapper, + async_to_custom_streamed_response_wrapper, +) +from .._base_client import make_request_options +from ..types.speech_generate_detailed_response import SpeechGenerateDetailedResponse + +__all__ = ["SpeechResource", "AsyncSpeechResource"] + + +class SpeechResource(SyncAPIResource): + @cached_property + def with_raw_response(self) -> SpeechResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#accessing-raw-response-data-eg-headers + """ + return SpeechResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> SpeechResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#with_streaming_response + """ + return SpeechResourceWithStreamingResponse(self) + + def convert( + self, + *, + audio: FileTypes, + voice: str, + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] | NotGiven = NOT_GIVEN, + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + | NotGiven = NOT_GIVEN, + sample_rate: Literal[8000, 16000, 24000] | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> BinaryAPIResponse: + """ + Converts speech from one voice to another. + + Args: + audio: The audio file to be converted into a new voice. Specify source language using + the `language` parameter. Acceptable formats: `wav`, `mp3`. Max file size: 1 MB. + + voice: The voice id to convert the speech into. Voice ids can be retrieved by calls to + `List voices` or `Voice info`. + + format: The desired output format of the audio. If you are using a streaming endpoint, + you'll generate audio faster by selecting a streamable format since chunks are + encoded and returned as they're generated. For non-streamable formats, the + entire audio will be synthesized before encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + + language: The language of the source audio. Two letter ISO 639-1 code. + + sample_rate: The desired output sample rate in Hz. Defaults to `24000` for all formats except + `mulaw` which defaults to `8000`. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = {"Accept": "application/octet-stream", **(extra_headers or {})} + body = deepcopy_minimal( + { + "audio": audio, + "voice": voice, + "format": format, + "language": language, + "sample_rate": sample_rate, + } + ) + files = extract_files(cast(Mapping[str, object], body), paths=[["audio"]]) + # It should be noted that the actual Content-Type header that will be + # sent to the server will contain a `boundary` parameter, e.g. + # multipart/form-data; boundary=---abc-- + extra_headers = {"Content-Type": "multipart/form-data", **(extra_headers or {})} + return self._post( + "/v1/ai/speech/convert", + body=maybe_transform(body, speech_convert_params.SpeechConvertParams), + files=files, + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=BinaryAPIResponse, + ) + + def generate( + self, + *, + text: str, + voice: str, + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] | NotGiven = NOT_GIVEN, + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + | NotGiven = NOT_GIVEN, + model: Literal["blizzard"] | NotGiven = NOT_GIVEN, + sample_rate: Literal[8000, 16000, 24000] | NotGiven = NOT_GIVEN, + seed: int | NotGiven = NOT_GIVEN, + temperature: float | NotGiven = NOT_GIVEN, + top_p: float | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> BinaryAPIResponse: + """ + Generates speech from text and streams the audio as binary data chunks in + real-time as they are generated. + + This is the recommended endpoint for most text-to-speech use cases. You can + either stream the chunks for low-latency playback or collect all chunks to get + the complete audio file. + + Args: + text: The text to synthesize; max 5000 characters per request (including spaces). + + voice: The voice id of the voice to use; voice ids can be retrieved by calls to + `List voices` or `Voice info`. + + format: The desired output format of the audio. If you are using a streaming endpoint, + you'll generate audio faster by selecting a streamable format since chunks are + encoded and returned as they're generated. For non-streamable formats, the + entire audio will be synthesized before encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + + language: The desired language. Two letter ISO 639-1 code. Defaults to auto language + detection. + + model: The model to use for synthesis. Learn more about models + [here](https://docs.lmnt.com/guides/models). + + sample_rate: The desired output sample rate in Hz. Defaults to `24000` for all formats except + `mulaw` which defaults to `8000`. + + seed: Seed used to specify a different take; defaults to random + + temperature: Influences how expressive and emotionally varied the speech becomes. Lower + values (like 0.3) create more neutral, consistent speaking styles. Higher values + (like 1.0) allow for more dynamic emotional range and speaking styles. + + top_p: Controls the stability of the generated speech. A lower value (like 0.3) + produces more consistent, reliable speech. A higher value (like 0.9) gives more + flexibility in how words are spoken, but might occasionally produce unusual + intonations or speech patterns. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = {"Accept": "application/octet-stream", **(extra_headers or {})} + return self._post( + "/v1/ai/speech/bytes", + body=maybe_transform( + { + "text": text, + "voice": voice, + "format": format, + "language": language, + "model": model, + "sample_rate": sample_rate, + "seed": seed, + "temperature": temperature, + "top_p": top_p, + }, + speech_generate_params.SpeechGenerateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=BinaryAPIResponse, + ) + + def generate_detailed( + self, + *, + text: str, + voice: str, + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] | NotGiven = NOT_GIVEN, + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + | NotGiven = NOT_GIVEN, + model: Literal["blizzard"] | NotGiven = NOT_GIVEN, + return_durations: bool | NotGiven = NOT_GIVEN, + sample_rate: Literal[8000, 16000, 24000] | NotGiven = NOT_GIVEN, + seed: int | NotGiven = NOT_GIVEN, + temperature: float | NotGiven = NOT_GIVEN, + top_p: float | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> SpeechGenerateDetailedResponse: + """ + Generates speech from text and returns a JSON object that contains a + **base64-encoded audio string** and optionally word-level durations + (timestamps). This endpoint waits for the entire synthesis before responding, so + it is not ideal for latency-sensitive applications. + + Args: + text: The text to synthesize; max 5000 characters per request (including spaces). + + voice: The voice id of the voice to use; voice ids can be retrieved by calls to + `List voices` or `Voice info`. + + format: The desired output format of the audio. If you are using a streaming endpoint, + you'll generate audio faster by selecting a streamable format since chunks are + encoded and returned as they're generated. For non-streamable formats, the + entire audio will be synthesized before encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + + language: The desired language. Two letter ISO 639-1 code. Defaults to auto language + detection. + + model: The model to use for synthesis. Learn more about models + [here](https://docs.lmnt.com/guides/models). + + return_durations: If set as `true`, response will contain a durations object. + + sample_rate: The desired output sample rate in Hz. Defaults to `24000` for all formats except + `mulaw` which defaults to `8000`. + + seed: Seed used to specify a different take; defaults to random + + temperature: Influences how expressive and emotionally varied the speech becomes. Lower + values (like 0.3) create more neutral, consistent speaking styles. Higher values + (like 1.0) allow for more dynamic emotional range and speaking styles. + + top_p: Controls the stability of the generated speech. A lower value (like 0.3) + produces more consistent, reliable speech. A higher value (like 0.9) gives more + flexibility in how words are spoken, but might occasionally produce unusual + intonations or speech patterns. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._post( + "/v1/ai/speech", + body=maybe_transform( + { + "text": text, + "voice": voice, + "format": format, + "language": language, + "model": model, + "return_durations": return_durations, + "sample_rate": sample_rate, + "seed": seed, + "temperature": temperature, + "top_p": top_p, + }, + speech_generate_detailed_params.SpeechGenerateDetailedParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=SpeechGenerateDetailedResponse, + ) + + +class AsyncSpeechResource(AsyncAPIResource): + @cached_property + def sessions(self) -> AsyncSessionsResource: + return AsyncSessionsResource(self._client) + + @cached_property + def with_raw_response(self) -> AsyncSpeechResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#accessing-raw-response-data-eg-headers + """ + return AsyncSpeechResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncSpeechResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#with_streaming_response + """ + return AsyncSpeechResourceWithStreamingResponse(self) + + async def convert( + self, + *, + audio: FileTypes, + voice: str, + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] | NotGiven = NOT_GIVEN, + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + | NotGiven = NOT_GIVEN, + sample_rate: Literal[8000, 16000, 24000] | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> AsyncBinaryAPIResponse: + """ + Converts speech from one voice to another. + + Args: + audio: The audio file to be converted into a new voice. Specify source language using + the `language` parameter. Acceptable formats: `wav`, `mp3`. Max file size: 1 MB. + + voice: The voice id to convert the speech into. Voice ids can be retrieved by calls to + `List voices` or `Voice info`. + + format: The desired output format of the audio. If you are using a streaming endpoint, + you'll generate audio faster by selecting a streamable format since chunks are + encoded and returned as they're generated. For non-streamable formats, the + entire audio will be synthesized before encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + + language: The language of the source audio. Two letter ISO 639-1 code. + + sample_rate: The desired output sample rate in Hz. Defaults to `24000` for all formats except + `mulaw` which defaults to `8000`. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = {"Accept": "application/octet-stream", **(extra_headers or {})} + body = deepcopy_minimal( + { + "audio": audio, + "voice": voice, + "format": format, + "language": language, + "sample_rate": sample_rate, + } + ) + files = extract_files(cast(Mapping[str, object], body), paths=[["audio"]]) + # It should be noted that the actual Content-Type header that will be + # sent to the server will contain a `boundary` parameter, e.g. + # multipart/form-data; boundary=---abc-- + extra_headers = {"Content-Type": "multipart/form-data", **(extra_headers or {})} + return await self._post( + "/v1/ai/speech/convert", + body=await async_maybe_transform(body, speech_convert_params.SpeechConvertParams), + files=files, + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=AsyncBinaryAPIResponse, + ) + + async def generate( + self, + *, + text: str, + voice: str, + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] | NotGiven = NOT_GIVEN, + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + | NotGiven = NOT_GIVEN, + model: Literal["blizzard"] | NotGiven = NOT_GIVEN, + sample_rate: Literal[8000, 16000, 24000] | NotGiven = NOT_GIVEN, + seed: int | NotGiven = NOT_GIVEN, + temperature: float | NotGiven = NOT_GIVEN, + top_p: float | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> AsyncBinaryAPIResponse: + """ + Generates speech from text and streams the audio as binary data chunks in + real-time as they are generated. + + This is the recommended endpoint for most text-to-speech use cases. You can + either stream the chunks for low-latency playback or collect all chunks to get + the complete audio file. + + Args: + text: The text to synthesize; max 5000 characters per request (including spaces). + + voice: The voice id of the voice to use; voice ids can be retrieved by calls to + `List voices` or `Voice info`. + + format: The desired output format of the audio. If you are using a streaming endpoint, + you'll generate audio faster by selecting a streamable format since chunks are + encoded and returned as they're generated. For non-streamable formats, the + entire audio will be synthesized before encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + + language: The desired language. Two letter ISO 639-1 code. Defaults to auto language + detection. + + model: The model to use for synthesis. Learn more about models + [here](https://docs.lmnt.com/guides/models). + + sample_rate: The desired output sample rate in Hz. Defaults to `24000` for all formats except + `mulaw` which defaults to `8000`. + + seed: Seed used to specify a different take; defaults to random + + temperature: Influences how expressive and emotionally varied the speech becomes. Lower + values (like 0.3) create more neutral, consistent speaking styles. Higher values + (like 1.0) allow for more dynamic emotional range and speaking styles. + + top_p: Controls the stability of the generated speech. A lower value (like 0.3) + produces more consistent, reliable speech. A higher value (like 0.9) gives more + flexibility in how words are spoken, but might occasionally produce unusual + intonations or speech patterns. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = {"Accept": "application/octet-stream", **(extra_headers or {})} + return await self._post( + "/v1/ai/speech/bytes", + body=await async_maybe_transform( + { + "text": text, + "voice": voice, + "format": format, + "language": language, + "model": model, + "sample_rate": sample_rate, + "seed": seed, + "temperature": temperature, + "top_p": top_p, + }, + speech_generate_params.SpeechGenerateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=AsyncBinaryAPIResponse, + ) + + async def generate_detailed( + self, + *, + text: str, + voice: str, + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] | NotGiven = NOT_GIVEN, + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + | NotGiven = NOT_GIVEN, + model: Literal["blizzard"] | NotGiven = NOT_GIVEN, + return_durations: bool | NotGiven = NOT_GIVEN, + sample_rate: Literal[8000, 16000, 24000] | NotGiven = NOT_GIVEN, + seed: int | NotGiven = NOT_GIVEN, + temperature: float | NotGiven = NOT_GIVEN, + top_p: float | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> SpeechGenerateDetailedResponse: + """ + Generates speech from text and returns a JSON object that contains a + **base64-encoded audio string** and optionally word-level durations + (timestamps). This endpoint waits for the entire synthesis before responding, so + it is not ideal for latency-sensitive applications. + + Args: + text: The text to synthesize; max 5000 characters per request (including spaces). + + voice: The voice id of the voice to use; voice ids can be retrieved by calls to + `List voices` or `Voice info`. + + format: The desired output format of the audio. If you are using a streaming endpoint, + you'll generate audio faster by selecting a streamable format since chunks are + encoded and returned as they're generated. For non-streamable formats, the + entire audio will be synthesized before encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + + language: The desired language. Two letter ISO 639-1 code. Defaults to auto language + detection. + + model: The model to use for synthesis. Learn more about models + [here](https://docs.lmnt.com/guides/models). + + return_durations: If set as `true`, response will contain a durations object. + + sample_rate: The desired output sample rate in Hz. Defaults to `24000` for all formats except + `mulaw` which defaults to `8000`. + + seed: Seed used to specify a different take; defaults to random + + temperature: Influences how expressive and emotionally varied the speech becomes. Lower + values (like 0.3) create more neutral, consistent speaking styles. Higher values + (like 1.0) allow for more dynamic emotional range and speaking styles. + + top_p: Controls the stability of the generated speech. A lower value (like 0.3) + produces more consistent, reliable speech. A higher value (like 0.9) gives more + flexibility in how words are spoken, but might occasionally produce unusual + intonations or speech patterns. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return await self._post( + "/v1/ai/speech", + body=await async_maybe_transform( + { + "text": text, + "voice": voice, + "format": format, + "language": language, + "model": model, + "return_durations": return_durations, + "sample_rate": sample_rate, + "seed": seed, + "temperature": temperature, + "top_p": top_p, + }, + speech_generate_detailed_params.SpeechGenerateDetailedParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=SpeechGenerateDetailedResponse, + ) + + +class SpeechResourceWithRawResponse: + def __init__(self, speech: SpeechResource) -> None: + self._speech = speech + + self.convert = to_custom_raw_response_wrapper( + speech.convert, + BinaryAPIResponse, + ) + self.generate = to_custom_raw_response_wrapper( + speech.generate, + BinaryAPIResponse, + ) + self.generate_detailed = to_raw_response_wrapper( + speech.generate_detailed, + ) + + +class AsyncSpeechResourceWithRawResponse: + def __init__(self, speech: AsyncSpeechResource) -> None: + self._speech = speech + + self.convert = async_to_custom_raw_response_wrapper( + speech.convert, + AsyncBinaryAPIResponse, + ) + self.generate = async_to_custom_raw_response_wrapper( + speech.generate, + AsyncBinaryAPIResponse, + ) + self.generate_detailed = async_to_raw_response_wrapper( + speech.generate_detailed, + ) + + +class SpeechResourceWithStreamingResponse: + def __init__(self, speech: SpeechResource) -> None: + self._speech = speech + + self.convert = to_custom_streamed_response_wrapper( + speech.convert, + StreamedBinaryAPIResponse, + ) + self.generate = to_custom_streamed_response_wrapper( + speech.generate, + StreamedBinaryAPIResponse, + ) + self.generate_detailed = to_streamed_response_wrapper( + speech.generate_detailed, + ) + + +class AsyncSpeechResourceWithStreamingResponse: + def __init__(self, speech: AsyncSpeechResource) -> None: + self._speech = speech + + self.convert = async_to_custom_streamed_response_wrapper( + speech.convert, + AsyncStreamedBinaryAPIResponse, + ) + self.generate = async_to_custom_streamed_response_wrapper( + speech.generate, + AsyncStreamedBinaryAPIResponse, + ) + self.generate_detailed = async_to_streamed_response_wrapper( + speech.generate_detailed, + ) diff --git a/src/lmnt/resources/voices.py b/src/lmnt/resources/voices.py new file mode 100644 index 0000000..0ef0411 --- /dev/null +++ b/src/lmnt/resources/voices.py @@ -0,0 +1,628 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Mapping, cast + +import httpx + +from ..types import voice_list_params, voice_create_params, voice_update_params +from .._types import NOT_GIVEN, Body, Query, Headers, NotGiven, FileTypes +from .._utils import extract_files, maybe_transform, deepcopy_minimal, async_maybe_transform +from .._compat import cached_property +from .._resource import SyncAPIResource, AsyncAPIResource +from .._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ..types.voice import Voice +from .._base_client import make_request_options +from ..types.voice_list_response import VoiceListResponse +from ..types.voice_delete_response import VoiceDeleteResponse +from ..types.voice_update_response import VoiceUpdateResponse + +__all__ = ["VoicesResource", "AsyncVoicesResource"] + + +class VoicesResource(SyncAPIResource): + @cached_property + def with_raw_response(self) -> VoicesResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#accessing-raw-response-data-eg-headers + """ + return VoicesResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> VoicesResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#with_streaming_response + """ + return VoicesResourceWithStreamingResponse(self) + + def create( + self, + *, + enhance: bool, + files: List[FileTypes], + name: str, + description: str | NotGiven = NOT_GIVEN, + gender: str | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> Voice: + """ + Submits a request to create a voice with a supplied voice configuration and a + batch of input audio data. + + Args: + enhance: For unclean audio with background noise, applies processing to attempt to + improve quality. Default is `false` as this can also degrade quality in some + circumstances. + + files: One or more input audio files to train the voice in the form of binary `wav`, + `mp3`, `mp4`, `m4a`, or `webm` attachments. + + - Max attached files: 20. + - Max total file size: 250 MB. + + name: The display name for this voice + + description: A text description of this voice. + + gender: A tag describing the gender of this voice. Has no effect on voice creation. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + body = deepcopy_minimal( + { + "enhance": enhance, + "files": files, + "name": name, + "description": description, + "gender": gender, + } + ) + extracted_files = extract_files(cast(Mapping[str, object], body), paths=[["files", ""]]) + # Remove the files from the body since they are now in extracted_files + body.pop("files", None) + # It should be noted that the actual Content-Type header that will be + # sent to the server will contain a `boundary` parameter, e.g. + # multipart/form-data; boundary=---abc-- + extra_headers = {"Content-Type": "multipart/form-data", **(extra_headers or {})} + return self._post( + "/v1/ai/voice", + body=maybe_transform(body, voice_create_params.VoiceCreateParams), + files=extracted_files, + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=Voice, + ) + + def retrieve( + self, + id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> Voice: + """ + Returns details of a specific voice. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not id: + raise ValueError(f"Expected a non-empty value for `id` but received {id!r}") + return self._get( + f"/v1/ai/voice/{id}", + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=Voice, + ) + + def update( + self, + id: str, + *, + description: str | NotGiven = NOT_GIVEN, + gender: str | NotGiven = NOT_GIVEN, + name: str | NotGiven = NOT_GIVEN, + starred: bool | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> VoiceUpdateResponse: + """Updates metadata for a specific voice. + + Only provided fields will be changed. + + Args: + description: A description of this voice. + + gender: A tag describing the gender of this voice, e.g. `male`, `female`, `nonbinary`. + + name: The display name for this voice. + + starred: If `true`, adds this voice to your starred list. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not id: + raise ValueError(f"Expected a non-empty value for `id` but received {id!r}") + return self._put( + f"/v1/ai/voice/{id}", + body=maybe_transform( + { + "description": description, + "gender": gender, + "name": name, + "starred": starred, + }, + voice_update_params.VoiceUpdateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=VoiceUpdateResponse, + ) + + def list( + self, + *, + owner: str | NotGiven = NOT_GIVEN, + starred: str | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> VoiceListResponse: + """ + Returns a list of voices available to you. + + Args: + owner: Which owner's voices to return. Choose from `system`, `me`, or `all`. + + starred: If true, only returns voices that you have starred. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._get( + "/v1/ai/voice/list", + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "owner": owner, + "starred": starred, + }, + voice_list_params.VoiceListParams, + ), + ), + cast_to=VoiceListResponse, + ) + + def delete( + self, + id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> VoiceDeleteResponse: + """Deletes a voice and cancels any pending operations on it. + + Cannot be undone. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not id: + raise ValueError(f"Expected a non-empty value for `id` but received {id!r}") + return self._delete( + f"/v1/ai/voice/{id}", + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=VoiceDeleteResponse, + ) + + +class AsyncVoicesResource(AsyncAPIResource): + @cached_property + def with_raw_response(self) -> AsyncVoicesResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#accessing-raw-response-data-eg-headers + """ + return AsyncVoicesResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncVoicesResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/stainless-sdks/lmnt-com-python#with_streaming_response + """ + return AsyncVoicesResourceWithStreamingResponse(self) + + async def create( + self, + *, + enhance: bool, + files: List[FileTypes], + name: str, + description: str | NotGiven = NOT_GIVEN, + gender: str | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> Voice: + """ + Submits a request to create a voice with a supplied voice configuration and a + batch of input audio data. + + Args: + enhance: For unclean audio with background noise, applies processing to attempt to + improve quality. Default is `false` as this can also degrade quality in some + circumstances. + + files: One or more input audio files to train the voice in the form of binary `wav`, + `mp3`, `mp4`, `m4a`, or `webm` attachments. + + - Max attached files: 20. + - Max total file size: 250 MB. + + name: The display name for this voice + + description: A text description of this voice. + + gender: A tag describing the gender of this voice. Has no effect on voice creation. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + body = deepcopy_minimal( + { + "enhance": enhance, + "files": files, + "name": name, + "description": description, + "gender": gender, + } + ) + extracted_files = extract_files(cast(Mapping[str, object], body), paths=[["files", ""]]) + # Remove the files from the body since they are now in extracted_files + body.pop("files", None) + # It should be noted that the actual Content-Type header that will be + # sent to the server will contain a `boundary` parameter, e.g. + # multipart/form-data; boundary=---abc-- + extra_headers = {"Content-Type": "multipart/form-data", **(extra_headers or {})} + return await self._post( + "/v1/ai/voice", + body=await async_maybe_transform(body, voice_create_params.VoiceCreateParams), + files=extracted_files, + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=Voice, + ) + + async def retrieve( + self, + id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> Voice: + """ + Returns details of a specific voice. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not id: + raise ValueError(f"Expected a non-empty value for `id` but received {id!r}") + return await self._get( + f"/v1/ai/voice/{id}", + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=Voice, + ) + + async def update( + self, + id: str, + *, + description: str | NotGiven = NOT_GIVEN, + gender: str | NotGiven = NOT_GIVEN, + name: str | NotGiven = NOT_GIVEN, + starred: bool | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> VoiceUpdateResponse: + """Updates metadata for a specific voice. + + Only provided fields will be changed. + + Args: + description: A description of this voice. + + gender: A tag describing the gender of this voice, e.g. `male`, `female`, `nonbinary`. + + name: The display name for this voice. + + starred: If `true`, adds this voice to your starred list. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not id: + raise ValueError(f"Expected a non-empty value for `id` but received {id!r}") + return await self._put( + f"/v1/ai/voice/{id}", + body=await async_maybe_transform( + { + "description": description, + "gender": gender, + "name": name, + "starred": starred, + }, + voice_update_params.VoiceUpdateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=VoiceUpdateResponse, + ) + + async def list( + self, + *, + owner: str | NotGiven = NOT_GIVEN, + starred: str | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> VoiceListResponse: + """ + Returns a list of voices available to you. + + Args: + owner: Which owner's voices to return. Choose from `system`, `me`, or `all`. + + starred: If true, only returns voices that you have starred. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return await self._get( + "/v1/ai/voice/list", + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + { + "owner": owner, + "starred": starred, + }, + voice_list_params.VoiceListParams, + ), + ), + cast_to=VoiceListResponse, + ) + + async def delete( + self, + id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> VoiceDeleteResponse: + """Deletes a voice and cancels any pending operations on it. + + Cannot be undone. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not id: + raise ValueError(f"Expected a non-empty value for `id` but received {id!r}") + return await self._delete( + f"/v1/ai/voice/{id}", + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=VoiceDeleteResponse, + ) + + +class VoicesResourceWithRawResponse: + def __init__(self, voices: VoicesResource) -> None: + self._voices = voices + + self.create = to_raw_response_wrapper( + voices.create, + ) + self.retrieve = to_raw_response_wrapper( + voices.retrieve, + ) + self.update = to_raw_response_wrapper( + voices.update, + ) + self.list = to_raw_response_wrapper( + voices.list, + ) + self.delete = to_raw_response_wrapper( + voices.delete, + ) + + +class AsyncVoicesResourceWithRawResponse: + def __init__(self, voices: AsyncVoicesResource) -> None: + self._voices = voices + + self.create = async_to_raw_response_wrapper( + voices.create, + ) + self.retrieve = async_to_raw_response_wrapper( + voices.retrieve, + ) + self.update = async_to_raw_response_wrapper( + voices.update, + ) + self.list = async_to_raw_response_wrapper( + voices.list, + ) + self.delete = async_to_raw_response_wrapper( + voices.delete, + ) + + +class VoicesResourceWithStreamingResponse: + def __init__(self, voices: VoicesResource) -> None: + self._voices = voices + + self.create = to_streamed_response_wrapper( + voices.create, + ) + self.retrieve = to_streamed_response_wrapper( + voices.retrieve, + ) + self.update = to_streamed_response_wrapper( + voices.update, + ) + self.list = to_streamed_response_wrapper( + voices.list, + ) + self.delete = to_streamed_response_wrapper( + voices.delete, + ) + + +class AsyncVoicesResourceWithStreamingResponse: + def __init__(self, voices: AsyncVoicesResource) -> None: + self._voices = voices + + self.create = async_to_streamed_response_wrapper( + voices.create, + ) + self.retrieve = async_to_streamed_response_wrapper( + voices.retrieve, + ) + self.update = async_to_streamed_response_wrapper( + voices.update, + ) + self.list = async_to_streamed_response_wrapper( + voices.list, + ) + self.delete = async_to_streamed_response_wrapper( + voices.delete, + ) diff --git a/src/lmnt/types/__init__.py b/src/lmnt/types/__init__.py new file mode 100644 index 0000000..9f5ed2d --- /dev/null +++ b/src/lmnt/types/__init__.py @@ -0,0 +1,16 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from .voice import Voice as Voice +from .voice_list_params import VoiceListParams as VoiceListParams +from .voice_create_params import VoiceCreateParams as VoiceCreateParams +from .voice_list_response import VoiceListResponse as VoiceListResponse +from .voice_update_params import VoiceUpdateParams as VoiceUpdateParams +from .speech_convert_params import SpeechConvertParams as SpeechConvertParams +from .voice_delete_response import VoiceDeleteResponse as VoiceDeleteResponse +from .voice_update_response import VoiceUpdateResponse as VoiceUpdateResponse +from .speech_generate_params import SpeechGenerateParams as SpeechGenerateParams +from .account_retrieve_response import AccountRetrieveResponse as AccountRetrieveResponse +from .speech_generate_detailed_params import SpeechGenerateDetailedParams as SpeechGenerateDetailedParams +from .speech_generate_detailed_response import SpeechGenerateDetailedResponse as SpeechGenerateDetailedResponse diff --git a/src/lmnt/types/account_retrieve_response.py b/src/lmnt/types/account_retrieve_response.py new file mode 100644 index 0000000..b1fd350 --- /dev/null +++ b/src/lmnt/types/account_retrieve_response.py @@ -0,0 +1,40 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional + +from .._models import BaseModel + +__all__ = ["AccountRetrieveResponse", "Plan", "Usage"] + + +class Plan(BaseModel): + character_limit: int + """The number of characters you are allowed to synthesize in this billing period.""" + + commercial_use_allowed: bool + + professional_voice_limit: Optional[int] = None + """The number of professional voices you are allowed to create.""" + + type: str + """The type of plan you are subscribed to.""" + + instant_voice_limit: Optional[int] = None + """The number of instant voices you are allowed to create.""" + + +class Usage(BaseModel): + characters: int + """The number of characters you have synthesized in this billing period.""" + + professional_voices: int + """The number of professional voices you have created.""" + + instant_voices: Optional[int] = None + """The number of instant voices you have created.""" + + +class AccountRetrieveResponse(BaseModel): + plan: Plan + + usage: Usage diff --git a/src/lmnt/types/speech_convert_params.py b/src/lmnt/types/speech_convert_params.py new file mode 100644 index 0000000..abda4d3 --- /dev/null +++ b/src/lmnt/types/speech_convert_params.py @@ -0,0 +1,75 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal, Required, TypedDict + +from .._types import FileTypes + +__all__ = ["SpeechConvertParams"] + + +class SpeechConvertParams(TypedDict, total=False): + audio: Required[FileTypes] + """The audio file to be converted into a new voice. + + Specify source language using the `language` parameter. Acceptable formats: + `wav`, `mp3`. Max file size: 1 MB. + """ + + voice: Required[str] + """The voice id to convert the speech into. + + Voice ids can be retrieved by calls to `List voices` or `Voice info`. + """ + + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] + """The desired output format of the audio. + + If you are using a streaming endpoint, you'll generate audio faster by selecting + a streamable format since chunks are encoded and returned as they're generated. + For non-streamable formats, the entire audio will be synthesized before + encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + """ + + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + """The language of the source audio. Two letter ISO 639-1 code.""" + + sample_rate: Literal[8000, 16000, 24000] + """The desired output sample rate in Hz. + + Defaults to `24000` for all formats except `mulaw` which defaults to `8000`. + """ diff --git a/src/lmnt/types/speech_generate_detailed_params.py b/src/lmnt/types/speech_generate_detailed_params.py new file mode 100644 index 0000000..19cd742 --- /dev/null +++ b/src/lmnt/types/speech_generate_detailed_params.py @@ -0,0 +1,99 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal, Required, TypedDict + +__all__ = ["SpeechGenerateDetailedParams"] + + +class SpeechGenerateDetailedParams(TypedDict, total=False): + text: Required[str] + """The text to synthesize; max 5000 characters per request (including spaces).""" + + voice: Required[str] + """ + The voice id of the voice to use; voice ids can be retrieved by calls to + `List voices` or `Voice info`. + """ + + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] + """The desired output format of the audio. + + If you are using a streaming endpoint, you'll generate audio faster by selecting + a streamable format since chunks are encoded and returned as they're generated. + For non-streamable formats, the entire audio will be synthesized before + encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + """ + + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + """The desired language. + + Two letter ISO 639-1 code. Defaults to auto language detection. + """ + + model: Literal["blizzard"] + """The model to use for synthesis. + + Learn more about models [here](https://docs.lmnt.com/guides/models). + """ + + return_durations: bool + """If set as `true`, response will contain a durations object.""" + + sample_rate: Literal[8000, 16000, 24000] + """The desired output sample rate in Hz. + + Defaults to `24000` for all formats except `mulaw` which defaults to `8000`. + """ + + seed: int + """Seed used to specify a different take; defaults to random""" + + temperature: float + """Influences how expressive and emotionally varied the speech becomes. + + Lower values (like 0.3) create more neutral, consistent speaking styles. Higher + values (like 1.0) allow for more dynamic emotional range and speaking styles. + """ + + top_p: float + """Controls the stability of the generated speech. + + A lower value (like 0.3) produces more consistent, reliable speech. A higher + value (like 0.9) gives more flexibility in how words are spoken, but might + occasionally produce unusual intonations or speech patterns. + """ diff --git a/src/lmnt/types/speech_generate_detailed_response.py b/src/lmnt/types/speech_generate_detailed_response.py new file mode 100644 index 0000000..6614405 --- /dev/null +++ b/src/lmnt/types/speech_generate_detailed_response.py @@ -0,0 +1,41 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from .._models import BaseModel + +__all__ = ["SpeechGenerateDetailedResponse", "Duration"] + + +class Duration(BaseModel): + duration: float + """The spoken duration of each synthesized input element, in seconds.""" + + start: float + """The start time of each synthsized input element, in seconds.""" + + text: str + """The synthesized input elements; beginning and ending with a short silence.""" + + +class SpeechGenerateDetailedResponse(BaseModel): + audio: str + """ + The base64-encoded audio file; the format is determined by the `format` + parameter. + """ + + seed: int + """ + The seed used to generate this speech; can be used to replicate this output take + (assuming the same text is resynthsized with this seed number, + [see here](http://docs.lmnt.com/speech/seed) for more details). + """ + + durations: Optional[List[Duration]] = None + """ + A JSON object outlining the spoken duration of each synthesized input element + (words and non-words like spaces, punctuation, etc.). See an + [example of this object](https://imgur.com/Uw6qNzY.png) for the input string + "Hello world!" + """ diff --git a/src/lmnt/types/speech_generate_params.py b/src/lmnt/types/speech_generate_params.py new file mode 100644 index 0000000..abf9f05 --- /dev/null +++ b/src/lmnt/types/speech_generate_params.py @@ -0,0 +1,96 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal, Required, TypedDict + +__all__ = ["SpeechGenerateParams"] + + +class SpeechGenerateParams(TypedDict, total=False): + text: Required[str] + """The text to synthesize; max 5000 characters per request (including spaces).""" + + voice: Required[str] + """ + The voice id of the voice to use; voice ids can be retrieved by calls to + `List voices` or `Voice info`. + """ + + format: Literal["aac", "mp3", "raw", "ulaw", "wav", "webm"] + """The desired output format of the audio. + + If you are using a streaming endpoint, you'll generate audio faster by selecting + a streamable format since chunks are encoded and returned as they're generated. + For non-streamable formats, the entire audio will be synthesized before + encoding. + + Streamable formats: + + - `mp3`: 96kbps MP3 audio. + - `raw`: 32-bit floating point raw audio. + - `ulaw`: 8-bit G711 µ-law audio with a WAV header. + - `webm`: WebM format with Opus audio codec. + + Non-streamable formats: + + - `aac`: AAC audio codec. + - `wav`: 16-bit PCM audio in WAV container. + """ + + language: Literal[ + "auto", + "de", + "en", + "es", + "fr", + "hi", + "id", + "it", + "ja", + "ko", + "nl", + "pl", + "pt", + "ru", + "sv", + "th", + "tr", + "uk", + "vi", + "zh", + ] + """The desired language. + + Two letter ISO 639-1 code. Defaults to auto language detection. + """ + + model: Literal["blizzard"] + """The model to use for synthesis. + + Learn more about models [here](https://docs.lmnt.com/guides/models). + """ + + sample_rate: Literal[8000, 16000, 24000] + """The desired output sample rate in Hz. + + Defaults to `24000` for all formats except `mulaw` which defaults to `8000`. + """ + + seed: int + """Seed used to specify a different take; defaults to random""" + + temperature: float + """Influences how expressive and emotionally varied the speech becomes. + + Lower values (like 0.3) create more neutral, consistent speaking styles. Higher + values (like 1.0) allow for more dynamic emotional range and speaking styles. + """ + + top_p: float + """Controls the stability of the generated speech. + + A lower value (like 0.3) produces more consistent, reliable speech. A higher + value (like 0.9) gives more flexibility in how words are spoken, but might + occasionally produce unusual intonations or speech patterns. + """ diff --git a/src/lmnt/types/voice.py b/src/lmnt/types/voice.py new file mode 100644 index 0000000..25b7155 --- /dev/null +++ b/src/lmnt/types/voice.py @@ -0,0 +1,40 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional +from typing_extensions import Literal + +from .._models import BaseModel + +__all__ = ["Voice"] + + +class Voice(BaseModel): + id: str + """The unique identifier of this voice.""" + + name: str + """The display name of this voice.""" + + owner: Literal["system", "me", "other"] + """The owner of this voice.""" + + state: str + """The state of this voice in the training pipeline (e.g., `ready`, `training`).""" + + description: Optional[str] = None + """A text description of this voice.""" + + gender: Optional[str] = None + """A tag describing the gender of this voice, e.g. `male`, `female`, `nonbinary`.""" + + preview_url: Optional[str] = None + """A URL that returns a preview speech sample of this voice. + + The file can be played directly in a browser or audio player. + """ + + starred: Optional[bool] = None + """Whether this voice has been starred by you or not.""" + + type: Optional[Literal["instant", "professional"]] = None + """The method by which this voice was created: `instant` or `professional`.""" diff --git a/src/lmnt/types/voice_create_params.py b/src/lmnt/types/voice_create_params.py new file mode 100644 index 0000000..efcc749 --- /dev/null +++ b/src/lmnt/types/voice_create_params.py @@ -0,0 +1,37 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List +from typing_extensions import Required, TypedDict + +from .._types import FileTypes + +__all__ = ["VoiceCreateParams"] + + +class VoiceCreateParams(TypedDict, total=False): + enhance: Required[bool] + """ + For unclean audio with background noise, applies processing to attempt to + improve quality. Default is `false` as this can also degrade quality in some + circumstances. + """ + + files: Required[List[FileTypes]] + """ + One or more input audio files to train the voice in the form of binary `wav`, + `mp3`, `mp4`, `m4a`, or `webm` attachments. + + - Max attached files: 20. + - Max total file size: 250 MB. + """ + + name: Required[str] + """The display name for this voice""" + + description: str + """A text description of this voice.""" + + gender: str + """A tag describing the gender of this voice. Has no effect on voice creation.""" diff --git a/src/lmnt/types/voice_delete_response.py b/src/lmnt/types/voice_delete_response.py new file mode 100644 index 0000000..dc46bb6 --- /dev/null +++ b/src/lmnt/types/voice_delete_response.py @@ -0,0 +1,9 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .._models import BaseModel + +__all__ = ["VoiceDeleteResponse"] + + +class VoiceDeleteResponse(BaseModel): + success: bool diff --git a/src/lmnt/types/voice_list_params.py b/src/lmnt/types/voice_list_params.py new file mode 100644 index 0000000..7eeb6f5 --- /dev/null +++ b/src/lmnt/types/voice_list_params.py @@ -0,0 +1,15 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import TypedDict + +__all__ = ["VoiceListParams"] + + +class VoiceListParams(TypedDict, total=False): + owner: str + """Which owner's voices to return. Choose from `system`, `me`, or `all`.""" + + starred: str + """If true, only returns voices that you have starred.""" diff --git a/src/lmnt/types/voice_list_response.py b/src/lmnt/types/voice_list_response.py new file mode 100644 index 0000000..2a0b872 --- /dev/null +++ b/src/lmnt/types/voice_list_response.py @@ -0,0 +1,10 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List +from typing_extensions import TypeAlias + +from .voice import Voice + +__all__ = ["VoiceListResponse"] + +VoiceListResponse: TypeAlias = List[Voice] diff --git a/src/lmnt/types/voice_update_params.py b/src/lmnt/types/voice_update_params.py new file mode 100644 index 0000000..2d6ae8e --- /dev/null +++ b/src/lmnt/types/voice_update_params.py @@ -0,0 +1,21 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import TypedDict + +__all__ = ["VoiceUpdateParams"] + + +class VoiceUpdateParams(TypedDict, total=False): + description: str + """A description of this voice.""" + + gender: str + """A tag describing the gender of this voice, e.g. `male`, `female`, `nonbinary`.""" + + name: str + """The display name for this voice.""" + + starred: bool + """If `true`, adds this voice to your starred list.""" diff --git a/src/lmnt/types/voice_update_response.py b/src/lmnt/types/voice_update_response.py new file mode 100644 index 0000000..9720403 --- /dev/null +++ b/src/lmnt/types/voice_update_response.py @@ -0,0 +1,11 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .voice import Voice +from .._models import BaseModel + +__all__ = ["VoiceUpdateResponse"] + + +class VoiceUpdateResponse(BaseModel): + voice: Voice + """Voice details""" diff --git a/test/README.md b/test/README.md deleted file mode 100644 index 0f8b041..0000000 --- a/test/README.md +++ /dev/null @@ -1,8 +0,0 @@ -# Unit Tests -Run unit tests with `pytest unit` - -# Integration Tests -Run integration tests with `pytest integration` - -# Note -Running within `unit` or `integration` directories will fail to find the filename.wav file. diff --git a/test/filename.wav b/test/filename.wav deleted file mode 100644 index 41ca2896eee4c8a203830b82c938572863a10997..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 42044 zcmW)o1zZ(N7rUm8rTCzlw*O; zOaTX&00&@)eqxm3fJ#{bUtkFa0%vq)1iaAR3!VD{ci;nT{$JM>9j#D#394a_w!$pc+kqLKpO3Ib5urf3r&X+>xgBY6O7$rSC~ffCZN0Rqs3td_P{n&rWak6!EPu-rHw!*Dq#&8U>7WbHbD3P-YcLA)#Z;y{7)BmrzdAYB`w-tdsjJd`3t*S1Is99{K7 zSI`0ZNS;2({C~a}^^}9;l|c$g#`=G07P65A(xV7z6-Ry4Low1@FO(q70i=Qd(p=G* z8LA1;9eBtBLZqAjHVMiVqnf5DSAgoXkaqt|wLm58(9asl#zb~vpcHGQUooovUkOt{ z!~Z0v&>ll+d~_~En#KO#AAt63pn)uuXF!sYs5dlZ0}}a&7U`o6`3a5mL?fN`p!9NQ`*x)9CRmDmuL;?!0cp1sr4+*|n2FMgkyQ%O zu@wG*sqi<YuT zUUr~73Y~KRM4B)l&k!MfFpwTelxu@L*8ts+rVYp!jgU_H$jgPuDpu&oL*8wPuKdxF zg=}Jnjy&Yyv8Z)75c&TWW}+6Fp)ay`7xEZal;)522515X02Q)HB(jDn7zEsqCGC)P zMZg=iXoRk~=pMnySESG#6rjHNgL>%nfA5=wd`=3dfXS$()gTPj9geo~U?Uof)4(Ax z1vFwK=^>>zGq6wKJl#qa(hHE?FVbT89C^_u zbRQ*Li?nqHK89PsCHM)pfG_Yn(t0@Z!!{U+dNLeD0}-|q^`ISSK_jrn&VXV_(tdO( zoB{^`Tfqoxp-BR*lCirF_f=58IjiATc@pU;>cp4P-hvm5dl&}SX_irkwO;bs;3TC7 zV?-H-oBfb7FnHu)+hI; z@{L7t-6tEC5Les|$fQLhIBrxpd5p@G@8jBb1mK%ZYJ1i-oR*uA{+##PlBR3{m#goJ zCIZE|En=+MZgcAnWsESDUEUukTkSowp|>R>;BVz~={{X4@4j$K%M*Nq*%bZqj(S3E z9oA;lzsfF7=}Ufga8gRzKU!UY+jO_h*j;71(}Jl`BlPXd>09C|(#2|H`llJT*wq+v z8%-!L<`(j)!IsRHBzDs33bUcjXP`jXP;Y7O$fhek1AWNhj+uq!w)cS?TOc^o8Kdx# z%+bE&jlfRf0{F7k#ExTYTir^mv6zK7Ydj32y;OBSHSdkiYiBuZ(z{8+=wdr5$ENQA zF`G(MZ@2BCDX9ZzsnIj2(M?yyF;a{=IUD59$x^Pjp&ef;(yH3K$B6w+7PO~};{+#L z0ei7HTy>YCn02(Pak=V(Y%g?keMWw7arAC$eA?#WoQJ(59NBY4?wvPyo1Lwi4j47! zv+{FYYaA|guGNKz2Ady~S<{WiqZyz0A2fG`3-nrzj?;wv)KBHZj+K0ax7c^t_B{#2 zLbDBW9jl4mP7L5kTRV-9@;AbRCKo#~7$njV;|yPo{X{U$ng4Rvajb)J^L>;k*%=*Zg#dkcTTX$l;>H#8+jS*iV0x@?kw9H)swS zjb^KQ8Ja{^Hy*`UqajICRUocizz+b^~ zZ|bD~Hqz>p(z(Pld{du~=|3VNxmS6vXOF;|7$r@S1v2JvQv3ZC>scGPiu%j?b1o^W zzm;m-6G=3-{cUUwX`>4Dvnr?O zYcWj<7@!{~HxM<9ej1bQwa#SM(qq)VkSmlJc4!u8R#Tnq$?_lS=~NhFsqsnpNPS;F zpVhB+;Wub9qym**;Aj=WwNtM)ER(Ed6={1YCnHCOq2s4^r^pR{(iWkqaESVs+Qspn zHe21yno6bge`n_zzg6DQzvcNEc}s`#m-1CzLR}jBJ`410WGaO_<>A89wpXNMuxYF# zhLrwE3SUkW?I-i#hM64c^w2IbpMa0nUK3a-w|CECf9J{i1%0ng8ci-57V?)_Bv4&) zA7G|VP%n{q6I(hb3JcjA^`{KuIo<4Gef{bKyu;u|uc|qTmn596BzUd7*^D}N0{GZJ zTM@}Ppr`;d1V-%nGC&P<@H8+Dt2xyu@?0|N#YgrW?&1)|%(s+-V6EwM=FrX#l{5Pt zy^#88cuMr@ov@jL{hULFC+vAt2eyJ|5Zp7IQvG1k^808+EXKAFqeYi=RkRJW2pcYM z(Il|f_I-j*q7Y&$c+veze}X#-+sS%J-BJx#-`4Sod)&cfitMdf4(1EW$#2>iSgHY3 zjBYtMp4Z6TtxeVg#%zWe^$UFGyw{&J{7YtFjRpxkC@jbG4P$t&e3Gg#bn4D%Z3vd+ zU(Ibe+~J7wOYeERR8Foegxw87v~y@*FpWB)yVM_{O%^UPJCul^qahDc&)bw#agWGB2y)pN=rDTaK0c0wrZ=f^W+|q!M@$$rI^FB zG+3*?igN+KA3)F2rAyk}U3Dym~yLRcCMe7+`XiugEkt7TuUy^6>dVHDOOVv#s*KZY6 zv1S@R5zP#5qKRc`&|$mqt=c){F~(LnNzagEi@WtB**}@%HODDum8fqr)k$cG8r>|S z!^nk^!agNRCbJcM_22k!aG#W8zwld>zwt-@3wWEmpD`0Ug0FNK8Ap!R4+DApRN^o@ z1?Orq^a~kR)r)n{=+nCE_$EwL4`X5vqV~6&xeyBEy+`ux2mQ)yifni0?0t+cU>lnEi&ZYCoSYTruZ#)a? z^#S_V^cJv=70(uF(peM5Tw(^v=1yVX)TOXKGW#_}q$yYdQM)=lHjW?53Gd%aUE!n| zR;vaoH)4AjGh`EqCRM5;1iuIlGxO9R^?Lx9jFM%OHjD|{95R|VsP+>vL;>a}E7Tt3 z(c5N=5xe%+@KSKQbT@>Fbww{Su*ll^z#w_ zgv12)dSwL+30*VDAxIN4F6z~&J7KaRkpoRVX{Q*M0&h2u<`ZzG@#@F-DqQ0(tb@W#D-OR@k zA9xQI-}w4)*2m@X%x^C^*j{A*^4*RLl@k!3LjvGL_ufq6aU z<^`L6@mpy;$woLZVk&wB#=DGuH)yzXw$lou%VsL)OI|ZP2RbbtU_CZy zn*FrwX>rkpA=jb;=Dc5_TJ&ihwj*Xo#*V;U^Y*puiraE@)AUVux1ZV+vq(KXXy%UC zF%vbDlcw~Iy)oF^bAXGT377Lu?$mj*UDF%c-cu`X9Z(xme7|IO(T(iNl#Fk@cy;pY z9|=DTlE-EjW~XI;%r!2L|C3m>D1Uu+K*3)H7qcd3%*(!C=~wEUA5_0DFEcOthxxbr zDNX63hxhLEyyQN9blLR5&KsN?Q_pvv183h{4nEa!V(w+tnR%ycPR%-Jj zmz_(#*Y_sjW#7H)PXj)-znt(<6qi_Zq-08Jd}D#)x$))TEir3GKOR&$W%{5W_Q3;9 z!`BbyhYuQeb;-f?>cuBlrf*oX!YlO4$kD_0Snn`h!CAxf<~+1m<*IY?^)$BDSjdGJ zn6vN?)H3oCp2tk4p91$(PsO$| zdt&xI+dW{-locsUtEU&P;;sL%;QgY~WqA{_2PX`^=e5Mrmeay(5@PJJtak<`deI)$ z8LIMYz4GUH*Q@G{zss90)l_CZtFq}*>0A2RWlC8{3)LCjvA!X=ZdBXqmdd)ct~-5e z+GQ=f+s4-AR7O>I6{<34r_N7q`YnhTrqc=Mzoccn%rbj@{qFP+xt}gwcD~AePFB{%#-(G&j5)USOer4nY}ly=3P%dp+rJq#aY5#sA)(_!qQ<0zSA@SFstDEuYlfRlem2x2IwBf` zy13^@z8c+XJk1aSn)Ut-vFa|~9riKF5_`db4!f&@WI?`hxszvbQCR1|_rbdYgMvpz zDkl*0FH8@gzG{hKiDv1v`6e+>CwRm*FKdc9JaO!-wIjOF-42X4b9rcNV{2_O)F#G0 z(9^+vyIYjQP4mO{&-v4F9^(xAsFkBV!(zKty=|ra7Hh5jdG7-IJ`0hlL8#*%q(0C< z&xQ|KLzqAK9h{rWzQ(D4`YI(QM}NMH^Zfqrr;EQ1|B%PEC)9oJ`{?lb^mmK*hu(aD zUi5KE)}6GX)X4>O;r7bK4Y~CV9Up6N|G1MBTG*Z0{O-;3f$#B;ozJm1eh<8#w_a*F zee}`hr*;?Ar&nE`b7RxP;^)mTUwrKUbRj+`F+I^PeR=xDJolngjT;#2SqnIe-A;`D zJn!JNr*m3Y=1n{8Uhnm9n7enBgRS-I!Tezt0!kz5qP_>Xic4Ah*saRms<@JCrD18- z^+|>g+D`n8t-|)ZO_|L$$p_S3loipO2mwL$}5rSZTLTvYXu9zoB_;%SO`` zKc-He<}_pf>|cvGvwCCxneaAjT;QT06bBjp#u?hCip4!kb!YnBA#J?De7emuo2??u z=)19%?vd&q$J6MB?KRiz(I+NzLajslhFAyoIaixz7{6y9G}P+%(9TL*?JSUptpjuW z3fq>~Q)#{Nalfv7iv73uOVAhadw9ys#Ho3Ea_1(hf4qom`V{)<_4k|%pUVD{BUMiu zVp`71Guuv7*VPa2itZdx?wQ(?HzB^{V_4SqnrRWj#~e~oX0mvlbkjBuo&#>^sU-el3trHd!5 z_%n4>2yOe1r=9O*Gj9yN`noLfy%}^TXtgIU_B0vGd!m1)*j#<4q_jp`wX<#~-}%PveN~3vh(wKsU5#}{o0yRpSmX7s35;0toBFk^Jaa0 zMf1zrdkqttj{oVY?8sy%S$|!U@FsOfx=liT-1d~;@h#7j?%#OCyFcV^#>|@h! z&W?-T@vfnmOao?>(S%$!(S8rSJYUyp;pa&FRonuLu%JLy41MkiFBfVH&#Gfi*WFyDm^(f8P;^a1QTV*j z(Y|h;Q-(|*+%qsbAkSYgpxDYnC=pD6PO>iP6vMLqUPS{v+2W1I&cQFox(vHBcyrLD z5GUV3g=wjee-234^40Xqxlfyay-52jZ&v|c{Jd##X+%MFVOdc?c3_4o`%BT_@_)+T zR>m}^)<12SQ8TLkY{}!y1GzgBSASpoTKD?J*VVt~|9t=5=EsU(f8HH@w(;qTr|ECc ze5-!#@KW;gPDXsTwivIyT(YQgLupn0mlC)9segj13hQ3guU9UjEfgD7PvK_4S0=`v zVCEQ|vr4%_zwq;dDZ_G{6HI%&-rMgLFm09uXhZ6}y2FdYpSpjsl$p0%dTObo9n5NZ^aWcMf`6o#|@}fn%i5SG>W-*S|JsaFjOo*Q`AYb}o-y_I!?d z^q8!-We)81pfuUmxGxKCqb(bSmZ5zd203|Qm6*Y-UQ)aIRijWa3@mHu^f z{qE+Eoi;t6YfluI=ZG@`(!TxbPhFhxPg-p5hvLIk_bd0+vg(^!KQ<=UR#(g`yHm8b z2o$d@W|#IAudRApTU+s0ZbZIo>h5@>_?=(JepCMY^|f;XOga9;>-*b0koO`jHSXPK z;(OZrnD^>$4^mbn`Q@e+Ppmjp4@>wp%WI$1Y|bB>d?Q0xIJV|&-H*nNy}SE1$Sj&% zbg%j^w|jNUx%h^oBJsD^q}Fs`SxkP8wXoQjfq$q)#JXv zRT=QZ(L*vv{kg@uIJr2h*`*^?)5iJN^WLC8AwvfoGVR2S;W?qk#94CB+`}Q$@rzqa zc>LJOlOh-0UA1cQ=t)zDZu9Q8Ut(Tlo9Yzm8R3}~JZMl^@P5B^kMY*4&2ES-`}eE>1Z{N!&E${Eqi+%ua=LXHNwk zYZ+y|&TfENqN)^GO0 zN!6hl;njnH-=e`U2G@ldM=cw+awK!ih{*N9S$?Ghx?EgDTfuCVUHkmH;07CMa93%M zjT}=>=`yZ&sM=O>tfVC8KrWuWH9bFjbzWfM^=gZTYjsze`kJ3NxmPFVkIes)=UUWJ zGOet>N?&>7&-(Hi73WKnbBl7uWSlL?OptxFOYr=#_T$R07c+mS-c2;gx|JsU;rOBb z``MrT?~0Tk*)gR#^@obG^CdYNz4hdOqFw0KS3 zp0ck+wdv0aVk}u)HI^)xM*xYj}Si)z7?Y_P52caLwYa%Ret%y|8|P z<(SNn9fO2X@liQJ!v_|Iu}3CHy&L#tP}|_8CSq%i8g7$i9Bb|78Ygi!TW*!>H*LVNfg8qd8mFIZ6mxy~thr}qbq29Sy z+kaU`^i2F?R#sUuB^#tHj1S_`NIBC+~KiSBAbUA%9}(ulOI| zls}!mul@dae0xrEQgEuE5M)&ry-v|(pDt)ji%8m)bgXDi9xrEb_TR;`O3oI(tM$y6 zq_guX3Radp$=Y8~S?OJsP%5YsG)B}9I#9FO1zkMm%xW#8IP(a2T;VvT<-guy61O|9IC7t7A4oqvfm$T2J|~&w;&s zt>m_CqUU)pGyhoM*M4m-TOD?}uXUT{?&3Jng%~i^?}^`3?+zC)hkYiGBm?=0M67Op zzlHL#>Z9s;?@QSiRja(EdvxQGnpc%iOJ5du6h#z|%>ACfwP<3AXW4;bPQ~M*#YM2_ zRsl2nc-GKdDsOu6*3$Cwla+VN9#<|Y5#)W&zFwp&c#zM}Y56@R{aR*8(cA2zbWzr@ ztaVwd5!6|1t7v#I*2fk&H3%W9d;z)3z^u zup}^c#q5#udKQJvY?=9Z=F2gP;J~2lf!BS8`LYIX2uuu-hxGcE*>&1{v-P%K?r_xM zjO_)pR?{+@Eshs`HV2Ihj~$U3{W*G4_=REZBd?7fJoe1YOY;uKPMkb`N>xnp6v@<- zS@*}?9y%;yg@2O$Ez9jTMpj%aEBiUtuf!)gNBCTRyXdgwsp)CcVzId}o!P}BgtLtY zSdVg2*&j78G`=Rh&T$onpwG+o%-4h?*h;?D#OUfNJ$+X9RR3Nn>Bl=uTMVshJJemH zdrJEZUHlfK#?^IYZA9zgI7FNS+&BR#5gOZ))}Ks_eoiIh^G6zjy!MlkA%3 zl$n(AD*av3p|m^c5vi9_+%k9`}V)?JyRFmKTrq2JFoU}J(Kz>|Ce~Lp&b>j7uWf?j7HkmMOSY>m?)-vzP zg7U!1xT?|RD{5GOc9!g|^r{W1pV`#kXx-7-FsVZ*t?IhhHnV4m>TrK@=k)&l`Y8EE zxdl-ns+5eD-1Eu|{^n$9bH{s^U#7>Sz#ZiS9%9_M}5d7Jo| z`0WTB806=(G4RKr^1=B-;=;X$jg54T7#F=adfzCgkuDZs%x^VwbL8-&#sQv2`*RN4?DJ5*;_Hh`%EVo%SG2rUYTt$sS{5$pJD!i3&nGU zF`QS-YxE2J5lI<7s1NFEi64ZkT13yL6SeDTKKU6cReSo@C^u@GWr5P=(rwBun#bzT z>XW(}^^o5C9ZQnc!hIOMd__#MTUQVRDnajZ`Su5 zed(~0b7?2j-sh|@U0TwZk(F^UMVYZS%{~iD+n+hNFgGP3la+cmMVmW0CFVzLN<`9y z4DZy^B=_7iIbX9JQv5Opl-)_anxB{Nm9iyce7akKI&VqlgzTF+8C8Y3A^EE+U*z2@ zx|zAPm{pTg6#r*p8CJBpB(`)Bl~O=k;!#&ZJMF2~~q$JJO*2pm3Kh zlpkirh|oF{zNcxka2cB~8fawBcVJecx3jzAGH#%`#CE391)F2`>l~kZB)E)mxa1t- zcENF^mAl8sz=Z+7gZ&4A(6FIdgSLho4VfFUcksT@eZeyZdWF{XzyG4f-qiL12=<# zKsRr{Ap=TW8=QXIJ+r)QKg4;iYo_x}=gV$0TztIk1MWEbIi9xC*uQs6u#L7&vOZ^4 zZu-Qg()oqeB0F=tccu(8W7{&*XX259de|eV6smX&L?gJ-Y+v4Rz=ar7r`@Sqspa)Y z>mP#v1)pNltNOmu7X5AVczCsWx6HKvd~<{r>vxyt%jG@6n%dTWscFxPb|)#(e5|#q z>1*4PmWb}@O=s$|8cq7%p!cUMH4__76^*RF^XE(6?&`;#pQ=>#3C(Lu6DkH&j%oC* z`Ba(NU{h^el-W3}i{0{1K}n5gr&IlGHbERP{xUv8qk( z_A<;?w{0X}4ffLRRn@Y*gm$=(tlTXXKZd!omhh)p#|kgD&y*Z>_SK#{fU(3(#a&}|SFo9GB~qM~!d!KeO@_mC zb{;dAX|Qm1|IEK9k+W=E4BQOfWS3ibn9x(=Y|@Lq7(|LPIlmZQ@QY-OiK9Vk^cTO2 zX>M+;{KJ1}lq33XI!*5?U9C+R?RY=yT1NsS8{EVbbWXZuqLW%@e6Y@k znq|(?l^a%RPw`F~ed&5B(7_G`l;Dy(4K@Ac%szP0{;!tbEfs=B?J`i%`>W%Nb~SrZ zcctdN#h)gq*+b`Gi`hS0yIQZZd<1X1+-38?6H2EwHxxJQ!uC2G?C_AAYQA(g6U#(^ zw5gk?lL^XbfxzRBLAPJm#IzSJs<@z7Wh52!s2``v(pvS7-h`e+bG&1%vQ&U| z+tNuLk*3A%y%eNQwvUn|YFAX9HIlf6Rv+(FNP@I+#2#Z&?JLz0;HHr|x3vbfuN6LF zOhaE%5=@3N54DU0@3k9vEY2j^HN_fzr|t@Sn!u>yOygiTsVGVtt*~gcF}5(7M5gww z7duH;5I4o|TGhfXfgccd|_0szvvxj{t!>>zRcZZER$FF)Pd=~H@nUIaFvuY z4{q;X+_|3kqTFKtmEy=QF=^q?p5c(=I7L3BWu&7It<~jA+|+wnlW;G6D0F8pHoC{& z+rM3Y9{(*_@3gXyZkl6;ahjA`%cicwjBjj0%C<_y?(kkQV0|%B;pxT~w+(BU#oiY% zPq`fG+kXMOkSBGQ${Po65Wj7cm`A`&)ffvs97=x&9i)uQ$3ys|v;wJ%=~i4sWDB~~ zPjn2ySjj%sJn(`WKt^ECm_k;8-c*m7?3P(+3cb`lQ#)q3jc!_Fi1d+5|1q2;PAGJ? zd(eWqAVz7AqjiW?b_G{lt=z!1upZNHE4%Lgjg?S5$Y=~ZnSG1V+#7@)7hVS}$(_#C zaJTTW>YatCwWqJ$V!jE%O|Glbtup<=Hc;F8e=)9LLnKpljMf28C5mKxhM6=Y&iHSK zC7lZE?B3k=Up7-ru6OTIofjnW?kX4del@b=B!MZa$qL%=z|4~SRz=GR%?!s3_^CaB z-EDY?y;DR|6HKRT-8iGV%kbaghbp#ki}V-sA?su(G&@GEH`>+rysJerg|!slia%3S zVOP0N7Pq}ncH%2|#WpGxv&~(1P`KRYp5b%H>8>}XS=M)C zjomfUO8d1Oqc$yXJiKB#wR3Hwv$Ih5%GjHnSWzdOWE;(HY1zdX!~9K!h`)8+)27)R z)tbn5Fb`qjq^FU}pj0kUcNkl88=FeajCmIAGV^CZ)z@UYQ^)L_>~aKH)h-tuV+Lxv z?dxSdRpW(L{2UwqK80$$LGdSY5D*_uPv$Rle&2hgW1`@LQLuKcQBH%K>RQmHx{2~L zrqO*Z#*nyL*@%{MF{uYtAp&o{jhZcHaRRy~U>rfQZh`I$eav9tR@Jb+RySauc(rUs z=WRoS`#8C8!$|gYosZdN%)Mf*vBI`aA1A%SxCs7IeiL{0M`CO6huz=Uu1*J98^LCK z?^G4QA{Z!s2DYG5YepY1*Qj{)E{^m1s zOAI4z-WpkQ-^A63FWItqr<8?eBGz&vx3?Fllx+;t$9kb35HWWe8G9% zP+f@C0r0$jpMYWaw#QKy#GWI~=O_eA=?`67L^F6%q?6VBmJP&H<^*F~z{-twanbrv zN6f$1O|tk&6e(4b{N50wC_S!B7W?BdEgP&4>+6(PEoKnD#E$OY!lxpCRSg*-U&&Z% zo+zKK!Av8iW<3+aSIT-iPslJ)f^UD@i54r#Bud2Sl!Uf*=_h%srT@w%3m)r^X=+7- z_@CPBLALo>%^!RrW1;?z{<-HdYDlh&MZIMh{-EhIw${LOTCP&IUJw_NW108Z!xclh z2RRmPqpTSU4dWGKcPGK=z&k{F%n99-isZk>9P1$2m<~6$~qs>!5 z+bwBH;{VINQP<#0bRLko*i)*;{#baxepK@TPA-2$$0wUjjFyY#x{Vhp-?<@98#!m}j@AuYJvj^;G zgHkgV`05W3yX|L|_(S{X%KUnb3BRE~W_W1k_-ZQXVn?&flFo*PlOFe*FSwtS+qGRa z78$+^oRzKZ?p7&`(GBBm%Vn07#MZCZi+Il-+qJ^-tD4h$#;OoFsT2DeEtUh=yI16@ zea2FOgD{!%vO;9H+?r0mG$5e6v(|02N=av&F)MJ~s*aM$40+s4`4$USmy}QRg!jip zi29{@>nvr)p9r1;>kVV>)*Eb`!Kk`w7-|)zkL2%a$)xx$FY0FU{~^wInLB;N2Q(DQ zY1b+AN$E2%th*xjqR8P+?y)<=s5vcGjkP%~^tfO(Ap?15JCt?NuitAqY%yoU9r zvAL#gMQ=G*T=&Y-yHl-BwObh;*_cR|X|7Q3tbXc)R09~5_+0uGAtB!>?}`O#Hb08d z(>O*lM7US$Pr9*8)RPRq1SfeHx}+eIbyv7e_NYr@jI&*ougDath?&N)RO}WtHx`+{ zw05d`pzL#~XgbZCZ>z4q%?=Y*s>KETW^-0MG)N$xp@ z9lf9XW^%tGO^JF+Oz+F87nP^Pt#9M?CRlVv)om>%Zx{|wN#N~iDDv?A=`-eOS(GJ1;Z^LH7-|fv@Bwb!+`udX09=@IB49S znaiB+ChfKtm1=CHZ%n?C5yTynJ>~A)19l~CT+uxBO#C(@SZ`s}MY<{C#gDoN8ONBO zF5fQvDcG)G&wJ3jnR|vcSC@&uF?gvHEleqBZ3$?pM1$2&3qjXP+@w}&+XflzPs-222BIf8vvAs04 zm^blCZw4w^mf9}(g847Vq5sl6WDLbF5PvgwYHjr2IUMRK^a9mn6r)9d1$uDbtA-FS z*~<-=bS5~DsH4~8J^Bw=2fT@Q)1IU$=Pc>2vnReW9?@?M0;V|}KvDQXJb)fYrsA<6 zo$A;Bz~|vFs2g+*;|2AUzJUcBW&;sNX}F+y$zFxN;{IY(8ny##_yYU{HIywJ#TW%E z^lYXB?L^PT;u*WtS$G33(>pOUvDu^*)rj8#)%Z$%AoU8z8E$X_Ed@HN3G7EJnm^I8 za5S-;d;;R}P*Xi?;|7exfmB_kqyusJC2>Ek5a`TieLa0EurioPPl`^ zbS}LRtEG2hJ81>I2oI+l;R|dWeGs$7V<{)^gQN7R+-oUqkvD8pF4k11bx4Ywqe zR5_`nV{kqej@IB8&;u}ty@cn%-`GCtj3EhkWIVu(si6iQ#%FECtZ5HQPAQ3l#65B{ zWMOllg0?0i!5MHLyf940q|6%Hi@Xl|fFHgEOM^3EDSZN-Ahe7PhPk@k_%~JyvKoO{ z0ttZ=$0#G{jFp2zunNlQ?btaKjgO+fAHw?SV48)$BrxRFr@>D8F#QWRA?|?V(2>Hy zPR431j?AQ;urqiMHjr*2{jleF9()QD!5(-EhGW@a7dQnk!enp&t>$+E4d5ggf|!QY zNCP{-MYtVI!$J}5p@-*TDrSN$KvvB{T!|w_Ap+tx2*Xyubee%p!IbbM+zK~?r5FdS zfeXN5wDx}+c#3#|4`|K(QV;~Dg9_*jPN5V6><1H2J3ruJ@CmE~Nr<1A4w?`@Fd2S? zp8<);fJC?q^uU8~6i^^CL63a88TeqiXnp=ah#9yF7J+_v9iD}L;1!|^W+1xYFYpmQ zK)FO_e3Hf6sq9e5M8@z#N8D~(ASd940ECt@uCsDbz3QuqvU10%stI2N8m9K#@x3HQUxh}u!0o;0Ac z|FKFvFdDSNqo{lZy5CYn8$5w45P2X*e2)#7iD-$3@G9avV!%`ohkDtM>X@O_JZOPD z+!~FRazue}5u-pL+teUN#UE)(3`YH*UTTG=i10WDveCVlpgUn$6Jk@cU^!r8(eMTQ z7n}nzNXGeymLZVdHi64vBFF{dpr0NCGC&%5gfv1R{X7SO0C6d(WH8E|g6OEXpbdP0 zBhc71LsUo{(1TKB?Td&bu?1hi5m1eM?ki%VULm#u$852EU?OYjXmWDyTA3u!bTn~a6P!*Dm4frTKZ!y5Dg4cGxk!r8z9e~IL?LXjj9ETcPU4{QwP zf!6T8gm$QZudq|l4?adCb2eB3e$z?tB^HZ(Y#a0dm$78{7u^r)v1TN}2DlN!KpX82 zzJrz6HpG#vfmL)SCd3@j=(z=4v7O)z-Ar4ewsXKYP)ARKx8Wxgf36`9t)&+t(j*bo z!6EQ1kiwbZ4Ps-C0WWM9#ON}R0({{fq`@%w2KDO}cnr6r(eo6Ijr;T&G@4I6x?}B5yv^_h@5~2Yq2EYQYn_!Ji-z27q61 z8uIf0h_=z-H~0<5A>W<_o`E^Ye}=;-_%A#JkHAx~iDuFT$d;ebyy1Z23=i4hIEo}S z^j^3Lj)u3vJUADTOJ%67MaXhD=~7Sv9)s)jW_TKeqZSCT8QJ$aeFODz8c2W|I+R|F zWRt_SfJyJ7rz862FL0cG1>@-o*baWcaOB$o$Qu7KIHO=ORts_D;Sfd45vXTLh|l`` zpU-1vu!bh#Gf)VB(tp8qNH4d*dX#q@D(Sswj88>TDHh&@8?ZJw0>zjH$V9$m1H-@* zG>;U*JBUScfLYiq6eAM;(+OArvf)seg!m;bj0L;kI4}<}KHHFOiqVWvi>R?PD7LVX z=YK%{x(M-leJDb`MdaCZupEtrmxx(f1r{O>$shfa(OpKNdmKaYb|@kTSA%_MoQ9%N zGYK3Av(TJ14V4{$a`O>?b`a&z@HHaBdQm(HLu?&|Xsru@L6n8jCpAkr&fk>(dFc^9M88jMyfpp|=+pz@fFygcHpaaVyE;4V@ zGxb~X4U9-MAN63iggGOR*9@m=?`cd7$JhnNIqV1WVof7a#&~V9mzSmWqb6!sGkka> ziGjcXdbnThAM#Y43#AJTpQ#L0oX$ip$1$D*nFPm(dUSQP28&btAwI(@)pSjz>JaTM zG-f9n?BEXOQT}uOLH%>F6EBL_E%qSS5*sls{D;riK5OT(T-&X%GUK@g6#@^KU6*RL zNg9hQ)Z;bH;5p|gqqpOw!UE3+DY{nv=7vl3D|!*3v0YlcOj>O*5Vz%psEZrzBqvOi zjAiES((^+n_XSo6v_Pu zO!|a$e@XK>rP$O+aH@48dA8qCv20+K^jw=U^O$U$f-gQVn@4r>x2lhmJIKF9x9OU0 zKi+q2F3;H_ylOAJ$=Sk`Nxmz%;wAi5nnT&=r@yxY)|gH%Q88(~sC%8j zSuurqlzOaKhu?28Hxdg~is@v!@*R7W_@cf?^A9&3TY_g2;k<0&E15~B%UC(oV(lAj6mKkXoxPIxRn{oF&!49;6{A_q5M%OM_npyU z6`^{=>ta{wBUonaDLH&h$mGr0P;&)N}8VL3g6BSXo9~iB31=+e} z-2=uz#w}(GSe$&0Wtn!aoT|AX;)QC!M{O@r`?hZlo3wKQJJO!xZ=h8fS(ujt~oR zHfJ^~hxkP#a87a_v-k5(GVc=s)ErJ5<2d6PV>6h_TFc1CPZ5WiyNMYX0CQN|2q)$P zpu`>$AFv}tDtgK;Vr4LNjFEU9?E>G?cj@IoMxO#ch7o9fUqnvFT*!WXly;YvB=6G2 zh8$g*>c09aIh1Ol&+7*2Z&2CVapY1;L0&Qda<_h!Zlzvl;8Ob#OH`%F*3GBv44?Jc zy7B5H^$guA1JK23+%&G*@j5RJL-#{{RCP{6>#pm!p}$KU(#+Q$)fqHrG^aIvI-&l! zR!6$)wfY#Hh5EbZxAu>^LHA1Iq3zMg^*FVY++^6T73zZZ5#$VLO>fel)23*TY3!&u zhAMJ}_N-d1GuM>s5_D}UOU*9bUCluqR~w@f={J)(flo@>o?5B)LlKfzJYZyj-hF4&h?t^|E`Ch-%@E4th-kv^!UfL3$iS37( zSSaC+?Z=)I&FJ}j2^PqBfV<#Vup}s>FVO+mOE3&QQLl&V=y>!T$ss=CNAYgllCc{9 zga1X86FQ=pSdU|jQTTi!lj%Ub#0laq{tUe=x#0_mU-(nvGoytl!|yVmG4t3LnIwBU zTgdj|HFLvx0X#ML7{`^fl3mA1=G@?TaxQYDoG#9C)?8L1`#tvxFO?I+`M{mbRq#*n zxA1VjlJ}KgCRv)3`Q8B3YNnU|Ty%rN3S-ioimO>kFW0gI>~)E;^S^hT_1A$n#l zq*GuCu*D1@7(0odWF#y{7Ngxf#sh z2HFyROOVm!@Gkj~TtFw&H(?1qpYo@eIcl&syw>Wq0)38VnyyJ7 zsDG+6F_7eNvWgr8w^DzTG@84P(3SL0dMm0qQh#6Pp!Nd09PP1PBmkRm-#w_Eo>FQ;S3Z-zMfCbfxNX;`oOu3N7EL=J=%wAL_`yhuMr z1X-*eB2WCP-$tc?N5mrxKsgo$H;_ia26IABE$h&%{u5q8Pi3X_Nc2wMifzONco8Nc z8VCjPm{^V86mEhJ5I}S>+3YaRB6c^!io1ss&Dh1DP?;p=8~$#dJIj}av(4DIn2*u( z`wVP1Az?j2^vXhZBSFER*nkVrGVcGoD~PNX!x*5Xyy8 zL7niCz*FQUHWyV0Qn=$-7;`wwl>LWg&5|=+7@hcbTmZh&7f>{vPVGSYIYRf6k^0x_ zOeLmN$hOMo%D(qcSM|NS3Ls~2~>0Q|~qqn1HL65e(pnG{&Q1^r$i{3T8#?r&R=X;xaFZDL|rSzWb zQT4v*Z<1Y+c6N{NW%i$xLD@!`x7H@WA(7!myCna6sl;LsT17wF*3}`zDa+Z@ZIb&7k279_ea89z+6?UCCB7ca-<4t@6L?H%pnZCY(!SkJWzu=KYK zu-s#jXC7s~!Thf29^*RW6r+E|eDNgl3}odgB96F6!ZT_#3NmRn$ub>by1@L9`AXAS zCcljfjnzgIB|6D$ql1z}3BzcFL?I3o9}pRduZV&~dqg%OnV^I>jW>onj4ft7Mo)mX zz!E;Bn`mRi!avpPb+NiB>SD!fxwCAq^iU6}S~IC_YwLUU;=AukdDJU13Fj zQf@*{TF&-ttL!JaHQ6^Z;?mvHWob{-o}`I0;xef8sTrTrAEp_nT~3>pvi!Gw@_^rV zDUbh0(OE#Xv29^EGjUIdkl^m_1=<3|+R_$E6?$9h?(TN$err^yy9*UsC=_>h*C0XS zGBZiuymeMsSu4PqO#V4@viJVKou|mZp8M*raqh0%GkK(Z>%xG-^dfB$vn0FZ-;(U& zxI=S>Aoo0{d#Pulysw4J1$Dg77wXAIa4Z5lc<{76iZ5;X$` zHZhJmnemf3iB-<}%*OM5O#U%{YdhO{iu)Z8Z*PMC1K$n4eL=2a_EDA7XT%RDE|_aG zXVaX_ct*m}1nu1B#QSp}Bs`lNo!B&YBEc!)^&IsaMZ8D+#dx1Nk7q{29Ef}yL7kc! zIzH)ve}$L3yQkYJm)DM|j-pd@NFQT{8S1{kP8rikHU}3mvfysMQrJ0eLv898<8`pM^ci!84 zo&C1^0$$D@G7qhLn5U)BPM;4xllVzU=j9IF{XUYWgad)4?#_j2uv zEzeFr{`2T^8a}P^!MX>YX;Jr~w3LU$hg}cC9w$AW@zm)l@|5%3@x+;1y0T(U0wk^SkNp&6Vn!+Ta-R8ZT6zLQ}HSDBId21pSj?6V%BVaLe1Q)gtA#TXR>GSOz2K{mN<3p z-&vnxFjMzUx*JsBpM}<>gm?&De61W!ADc)`(u}PHu_pJ785|EIEIW-_NqB;b01P@S zbWBI4LDQi9&?<Et8Ee*H_EWH!-9Vd01<5n9 z9Ni{$sqCMLxueI1-im_y@ZEkLN7`049j$e)K3SeB_!rLW`PZ~DmiVDq8o{nbx-=^+`Wze|4Oavv7l zD=sR&R1{KLShA_qzZ5Jls&p&wE8A4v*bq=Nwe)^>hCSQwu7`=D)uEnoc1g&&k`Yw6JqKoqmBnlSqT1-sn zjB}q8A8(j_aQ2)zM`sJCUy1oJb8=kijI~kpY15{%12fzbTs}Hnvsx?g;(TX*q5UK= zNmS-O`d`8VG*c4=IvJknI}iZAs4kS-N#9M>il+^AihKumi1`wkD$U?VI>#jNFB#u8 zxo-B^BF(PIF2P}?;~rNF54G1Hzcm4dp#32)r&>iv%rYdNUBq8voszt~aanoNs>N+d z=1Hv!fqC2K66aRTEtt<=cx-`x;@vs<@g;M660H|qm^YH}Y4&LB)kwF9uc1uuwO&u% zHh2iV<2+{hXuY0#UAJ3eTWPx7SY~42R&dsnEA%YoH?gMgTi4C{CsqFxSQWMxm=wjA z((-2H6#a<*pm^{6_*mMDw3HjKZs;yiE^WIo_rkJERp%ovb1u7HPQOCA;&%1)e}}F- zyyEkp?ndGD=<9o~xn8ro_V&My8}CxI!RTHdnSM zckx7ZqK{&k@}fpgzGj~2!Hj8|w`lRd^Yw9th>yYlh4q9~OjS-<7#KG7R!GIvaguHEq?2*@q>pQ^th&46Sn}?FrY(7xbbR5|gvqn+$G(rbA3GG& z6}2SvMDWW=UH-Lx?Wi;Ls7IpxM(aSEm$o#=Z;oGF4!W2*Fv-RmYrgP^Xoido4o`II-9d;8DipPX+WKK=Mg{yyXD zlHXf@Zu+tJ>$;Dv-w8G~)WXQF2-(#3kY?|Lo>zl=CjIM^=(fiWHp$|A!VRJkuST^B zK4)0UI?vOwPcrK9R7@r$(eEP@X-BBxh8T^B^0;&j9D~c@TsH4AYqMaPCz+XBUb8sv z9OOE~Nnyja46|6v)fXlno?SwZ+uQ|8;{HhP@lb5$A&zXOI=C)~RVHwe{!eXZGo-*n;*HdfPW4=z< zY%Deg`3jR%%XgN59pup9^uY=C_={fu#L0tb4P>_;C*V#HGqQK)s@YR!FNqUGCry<^A3a;c(D-;Dw3OAQ;%0HE7neb@S7VN9S0FN#*=U!d6~C8N&!?FuTXk7{G$V4hvv+VX41d10Wu(m& z+l@Ba7Ff#*)>j3y*dOSLxHN6i7;S9f__m>2k~HmHYyo8ju8(q;^^~1u&xte#jq_gsim z=(^U|H0u3~(dc`&6^uL9%`#hNT*Fcl zrK}`dqSYKDi2uZxxjY2%>h?uR~y&YPB)!a z*%3^gxqY-ax{y4H=4*V?!pkY#^^|+0&rYwzkm#`Bu-vI0fg}D8eG~oLC)q}n&e%KK zb=E{|T=dNFo`6J8Ki4$3Q0J2lgXSue4x10cWYfd89Gh4x4gE3Y2dRPJhO;FsWk)g| zvs6qXFVpxdt%8;~!l}&G&C)&N+qTB8^K4>zktEp61l$TB^-IniNSX!J{crPD9T?WyGb_I?_l#;*2 z!lJ1q%ky0e9~GY{yH;vnwzQGcu|uWow9=h~>+@^ZhXsLDGv z=4Jm@wbc7n9&bHX*Iz%W@pbKqro@_!owM8GyXk!{-4$v%R%P|nC*D2H`8dl*@Q+bH zGs1DJ{bI*bvzhkk9!=(_EGSlGwzq{1bW64g@q(7862g`^Jbpjh*nG9{Be#+Bk(ok$ zOYCCDa>^O^=n5i+mB!5F>Ye7fzHsq!PIFGQRdUoO4m>OF42uCPOPc}n%{Do9sa7eD z*DXEG0{9n*H-S9OcI9!67dVObi1i+hy-@-&uY~eHZvT_#ALU+{|3oI{dW`5vbW)D9(g;xQ7&ocfb;K z)OnJ98$64=FrEuNK6oj8s{K;~rUVsv0X}_!n?kdqUq^3=^^Lh4Z0c5NHQDjDHPz(4 zt+(~C?3!3kB{%uKUIoGwVx4QpnFLQ9+!1S)H zj{EJ_&8w^5SCo|w7B4FCET`4XEH$netUO;Pt4b{<{{5Nt>i3H5%(i&<@!O9mUd$ZmC2(wQ8nfOzaVV+-7 ze6!52=5niFlU2>_lH|f&#h-RK0s!TuDA%stSxyvC>E0d4h`?mg;X~w_J zN*y=fl9aet)ctMic z2xSKg#a37=OtQHicH5mhEDkw-^AiMkxeM+2F4OIwo4DEdx}Nm>jHh!p@kdRHO~VBlLLZ?u_dEBj*|>#?^JXWx`@<=Jqmt(= zo3ndPZ;WSzS&+(a#M{3uGHxVt9X`&kY0XBwU3Lj-YkEn74M7i zm3gu)Y`NNMtL1wOnaw)urB;FF0?X&xs9jmOsdB!J?r|a2g`xV7BnLv^ca zR<-gg50^pJnWfKbWkqG>&+29M%(|BHQ*{Tb`|291%xjLf)9Zjb_wwfrr(1tjovcf1 zn$*2LQpqek6h@;CS0Eu*-11 z{XS29ZQNH_b#r%^6U_>qWvpwQ&3j9RnU}SZ<33L}zaihIN!5O7evyIi0-XInxqbD$ z<9{w7f6|%2X;bJS3n%TIw92>B_mHdJhHbaps^7%Z!q&3E?x-!@om9kUnjZ%lPJ+cIes5idzbYD&H`t~#JCwumc0HeL)crny7 z)N#M@a#K?K)LL-`Sgok^tLv@3TJ6=avi^JR-C9}M?XoWg>wotb^p$25PpaKrU0%PT z(YS`uw4v#H{rg&WrG4G;nx*BP6>gQZs-${l%deJAO-E~tDvwl|SEg4kt|C@0t#Phv zY9e*aZkD&1wZCb-*t57}X^TtKiI$SK>XxjQ>z%86Pxt;A*d;3Nvu-`sc%Q?&BoI7gdD*fd-UUNwSrtPzs!> zE|m9^-&CQ|feT8F#%& z8}GRJ9T%LR)OWI*+(F?a@S5ZA6foqo(En>dTad{#cydO_Mc;3J!qAhUN&XWqISyk^ z3tc)qD4w%D7rKi*^SlqZ*|>jkZgV-}mg`>UY~(z{VUqJ6cfB{_!}dGm`!lG=FUp(g z>EL1J`NP-7cXz;5-yHY7USw~A_fkKScN$7IuydL3vdm?!Q-RY<$G>(598&F5ZPZq; zEY%i}%^$mQC#@aT?q3_eb+RSH(#7ni8NuAubf+-YxR9I0&EbS_L8Ixc=S(*91$7Fk z6rYTnf;Gb@6R(lI$x>V~n#sLSY{l+2d_}6XOqis>s}c?Xf3q1(K>$P*XG?#SDWHm_P4xlXm9Ol2&_9(EvZ;h^QV+oIioVU#-aXi zO>hIQ(X?@8)79oL&896G4SSmmc86)_s+QHA=h`XVx^9O)m;THFZO@e6U47rXTSaL@8KP}{ zpNBlf1%0j~StHL!(kJwTvn2b_%7V=!4db^Z(uopTj?w`MQg@*FDUEtInyLJuI&Sz6 z0QKvUWn@d@7cd3;81F+}P01(Urfp<2kQ-?g%puM>jsvUTIGW$jH04T-0rL>!HN0w* znfy-vBcoQKx!H8n7gj>y9?J=~wimm3yCu5( zcHUzB*S^DPgJZK>n|qn#LtBmQEBhhGtquuRM=Wm$8wADnfsXra^6Wp_kj!0e=G&gO z+;0(UW@;8}a*BIX_|fcv^&yi)UMp{=#an@hFBU9h$?0~?A?h^F9ZopwE5nVpg;8W= z$GSsaOukHv1EvwghDTZ-0}4j8sf4SA?Qy zQt3pGs8n=7Ebn~P7T1$1EpFf0Xxf?6_o4sUNd9nC=cd8!J-h2yisJi3%_sVQbk84% z>>KTf8~t}Ar8{PDpkuzMtDD_DJhZg`W;3aqJ$zVvqSv$+9Cc|mYnd~6rVZa)H~g!u zuthWab6~M3ZScR2xNf$1>foWyqiw>j)PeNQ6$1qwUOfk8t`cU~h0f8I)S+2&pas{N z+Hrpzqq)$1rgP@-#R;6YR@}1Qe2Y0iO~WSvZNhL)F%U*rjK9G;%4js$5)0Yqj3}5|Z8<5(xq$SL zbP00^`o+-kVSEQ^CUzgV!g@KOoOOV~F}$ZT@qw0Imb>*a;}NVVv*Wxxf)_iV+y|^M zNitbLupkdHyI7URtFUJTd3dchnMLIJ0!fU&_;z$3wO&IdC362Yngm7?<{&Co53h~+ zT75|Wix(ky&JNJN1m<#-wi%?3i2%BaLn1_5G*Z`THDCp+f;_~iW+>GQXqnV*$~AT> zXbdG`=GtGUq$qaiCkQr-_uM>f2KhRDKqVs!i1VmFFnc6Yd>XTsOi(cCPif|$!f-&D zuMcN^!$O)kTo!{vU5H$kb(0)8L!@i?9&H87oOoHbfEdkOg1M^OPJRS0(PCI?@Rw}1 zTB-X^{RSV?@6!comN7>SmZ~+HtHfIr6Xj><0dA+}FtL;v0DMI`x&d6e7Lsp9CS#HS z5AdXRul57$xPd>U1(GQ!EKzn&K17;O0~)3JD9J#@b@SnLLmy48jOtsUy@87cn}?36 zi%5Kf6|C&Ih@Z(ms?OC>`V;itw$nx!nj~7DcsXsH6*_3Io{ou<_X|CxZX;}PiH1t> zRWBK_M9I@TWjA!bl(*v;xwR6Z#ZdhE{k6|=B78iQC^`e)C;Za;0``LeK%&_aS*sxl zJ~tEy5czW2(Y~m$T6QK*!}JhegclIe`f0F7tO9e5u+;Mt(??ceFO&A;4{A-uoe>YZ z9_oi4fpo-$IC->@_CeK7UPQb#ZV9S!7bK_I5d!m`Q58rvP#rlU(4l*?d^fF^NwWCZ zVbz~&VrMEJXOB2Aud}`7rzd_P-NyT<0mEV$hta6Wq5D%kJ9Vo|n>Oq;o1|pfSRojn=bgP+t0X2^Ox)R{!1R(8LkatI-tMd`BzLLFG4Ws)xB) zl1fpm4r36+cFISB5RPGFz2-XHu2=JZ8hC?D@*>C>d1Ij%J0_LTN$^@6QI(9{O};Ti zVI*O6q6G8pYFDHJP>%&t8}ZS!__0o@KR3sus!67KYjdn8j3Izk!+Q4>D!cY%_&I5> zV=4f)naegXt*G{leK38{l+sLkrV(Psm_375*oBr8wH3NRuXu64q+LBn9p)5HkhMGk zlF1j1ma1vvdEBV}WMdO%Mje%xtvV%i#QbdvA|5lDVm4T@cO=j9konVzjnb)V5;a^< zCdJB1@H2E*1kWklx^{TG~>b|S8_bcv*A8qnJB733zg|QjX7Useh-s1o{za;YSa~=yKY=1FC)z2xQ`Y~bNL6x8EiiHas`>} zAc%!nq@-abribxfe}jb|braz%4l$RE&s9&AH*ywnIKv-Qz0^gx)uNA9b~vZj6~>)N zoBAK?!r?nzzNV+}?OJdBOv5?$R>c)926Ir&wp?uJ=nF!L4@(Kxgu?Ni!wwu5*c{lz z>(h-4Hvy&s=ceb_CePQh#dWrji^h(D;0 z7$4xBDn@6E0Cs-Z7$x3ru4CQhYg-dq*Z7^I42zxA4q6XZHhHo%7?Wspt*=tI)c-^8 z;_fmb9*QEDB5}2aJd&HM$bSqp&qdltPFfwso7KcJLQJMZ>kT8lPcTm2xbYNm8)b!7 zBVcOrDdvj$}>cw`L|KE<_$26XY1Y=9F?Y2Gy2z| zlMI>u39^roJi)`<#lM$j^5^PfBrez#3<0JYy#tc_x%@_^&3G8`?Zh_4Jlo6A_wKFy zQbw=VUSBBv4ZE<1sG$n%$W(BuS+TfBYb{(R-k^!)7#XEOrj6?eSzeRJ6MNJ3FZiRp z!=rEde}FQNXL@b3t>Fzf&TxmKGgx$Az}@9`P$nrZNo%Pi##pJxz+z^C_8akq>H5xJ zDo>*=`kVZW9zW3q-%Na%ej0A1q!=UzuM*SxKBC~VPt+dH>te>U7M6l8KDoY7~ z`Wkr#Bco1EG73@+uWKtJZWHo(>3x0^D|FZBbyjD)&&qB1U&b=cGS%J_$JuVsJHrCN z1ybpx^v44`jSll)bo(g2G0Bz!y|Tj;vgc-jBgCJY4a1q7oeaZRyWuEeV<vA}~q4-SnmQZC3!f z-~2wbZX!-whfl>_ptkD8qbIPJ&78;NYBF=XZaN0g+5r%dr#E4q1&W5=YHpM6(jH^* zk`I{QgkJqM!*xtC^1#qV*Qy=*<4Jy2msG{$YjN4Sn>Z42om8i;$Lfen=?A2N(zAqM zewDg%Oiy_Zt=C^L@)`4m*E65$kKnR&M9m?>GNQfK9_a*9Kn5r$dVu;-y85*7LrROx z2me|Tqs?c&M0&LfqK$evj;xK9Gf7KnGWe3bP!~X0ggXnZLQIs~jCYb8yRGF)>L=Pk zBCJWDIHHYYrL!tj*EA}qRx8C15StV)Nb&eD+FnowN#%94QIspaTl%!`De;-HvC$5= zR>qTWRf_4G*cQn0F;Ain$s*?w5)4W>(9p+Rr6lQJ>CWQu6bGp_Bp}q|H3YsMmOARD zpjve&$ka=bo%$G^h*Sk;Kr@s#2}HWNevW44SRVU4Jp(u*BWp&90CgcgW8^P1#1hkn z)w}Uo@;+q?o<-@Q&4tdl4PYKQ{-7Nn+AFz&{Yw48IwJMmWV-7ia>H0R@Z_ zBvtE!OhL&LJ4j8SUUCX>M>f(TIhktfv5lB_)bc_Fw}PMC^VJ(eOrH zpgl&+G%`iH)o*ad@N`2E&WiLMC_|1Z)r1^UA0*QTA}aEH{W*YY*sC$aoW&Ip{=foc zsrng}M@<;BL;Xl1Oc16GzKwZAG=tC%IfP(?1pA+SzWxnx6)?ueY3dXr!eLsz{uXjx z`VhB}=7{-?aZ*3fNNHTmA?z3&W~jt706z?0zW}4ait!U_3vC_t1fT`Jz*8|?Dp_T% zE5mQblY!H!Tk3Q8AW9-eqE1B)V~w#_^e>5*_4J9Sn0>6X$Ta13@G6#Tm=3LAhU-J% zRN_CXs!He=aW!~MtH5UH^3h$O3eQy~$bS$$XU?Um9Z_ zsGp+Y5O?Az@&!0GrWAOh=Bn2-eNY#CC&I+Ik$0lRZi>D|7lwbTBjA&8Rlum>A#@C` zg*aq0>;_$r?h=qqpAB47dZ~1PJ!_aztLYty*O*eTfiG1HRKJLwbgEjcGdJuv_~1}C zzHX~Qh9nS^L0Cf8+u^1Yj8QkHG2tOzihrt2kOUZZ;r`Q)fiIDN2u}E3{Z}-HOeS2_ zM&ceC{Pbsu4Puq1g7yfzit4EH)6T|KQ=d}CRU}ETW-@DtxLG@(Sx$HetT)WZd{X}) zgpwZMvlT;{m&D_`-+&Y1tu!K=P&r5(Azp8QE?@|11{Ft6)DkoXRX1TRd5@+Y-i+Ib zc}zw0J<<-+eC!Lu+RPThkrmC^;3Dfj0P%{Dndl^9hS=|9h2(M{X2A0M_SFJlnssb+SQ&E`mFoA{d z)4ss`#81V)B{di1#K z=+@yC-~#MSFd4GbH36Q6^NKOx1AY@)pDWQakaJ)Qg7%aF=VF%N@(@ttquvZ)v1c$` z;2`oArVt6Z1Nx(APXRaVDR4q(i690ZFdtTGJ(1mnK-537R+*#i0bCItAzA-I&NA%Q z&&T;=S0Jyn&tV(VHqsZAroTlQ3C_T&<(KsRdPmef`Al;|U!zadTY-_fb=pW}FUFiY zM|)no5blIgC$k|L`&jRyd8u21?F2^Dg-{@H#*nV9h9+<)f&b7NdJeP=t$@zfO*fS4 zhM-9OPyGjjR<~5W0quLV3BHQDHv6IJdObqM?AK9{0^ki0sAEA?^gVT85F`gSFAv<*M;q}NMY=rn4Qqanj1L!OX_&s1F zW-quMlZmmyZop>~2zUVH*sKDNqI`yDcpKsZd_8D}55@Xn=b~q{2yno@$DhZa1LuR= zz!nKiwO5ft)v&k-IO9`5{to{PamR2(+e4(Q9hHwaz!)b!K~$s zkBmfyAH|Qln|hWSLk%Knar3d0v5weHco-WGWE=j`&qB69yI~jf`i3=K+8t25HeJin zyiuQ2KT;P!4)9O)G!Tnm<)ZbZl2=QI8#z1{xIw+ z{wrBBUNvedZx|y+2wO3pQI0z1?qpGbXcIfgdHaM<9)~yI>BfKFWYRU z+gjhe;IW9A;jRJeyxvWE9M&7PXhy;GKQr#fh0gMeTQS=zrZ2Q%ieSo}poKnPU1T;F ztxD{IZJ#=>EK%is`-`Xy8Bs4y$+*tLaHnw_S zbwks$=Ixz3Iv%z;b>TW+wLWXQ+p(@Mx%Xk;QqeV0tR!_bPEYEL&V8z5@G|u5-OE+Q%C& z;$0KYu>{@cx*l{>1vWan^TG(I&rYABoq*gmeyR+acI4NHM)oh9BM$9u@1E82x#2-W zO1-j%Rq>%>W9$2|tP!KOwsz;XQ%%mTGrJEBEFL~OYBuOJ?yHVc9)ebbxx^XxZvY*8 zgR)eZFBJ1~9TtQiojbJ1CdFeBInvMPR^YsN&SLk4ltuFvwk$liAYdLaCoER)yV#-4 zJ<#3GEZoS5`Y$Pq&SJ3XyC|(diu4$I&P=*Kb}a0?(q7z&?YlO-L$XzU0_um0b#mP- zaJgsUPSt6)%OoR9MbiFNJuiDpdvSog8MW-zj4aj#yv38sO_K4HOkuk|1{Ow-CMV^X#A2zrBOgc(?svb3n!Iig}e0 zWwwPT1tx#oa#rQc%Gr@Wr(k_nWHt$HmO=Zu>#OHC;rF}0@_(swqYGD;n$)U0Uu#vk zL;B|7K9N!+ZSYjip~o_>7@x6tVyZV&xYY}p=CjQlr~=_>+g$svM(_Ab74q+6DtS1dlz;c?r`cY7P(9$D4gVt%Ojp5=Z8C#OKZqio?gfeHkLGK*7K}YUu#{fF1=Cwvj|`Cv$&;f zW^H2QmZrVU*IHz)>za*Pl&xhQL!F-edq-YMOf&|?18pVh8gejX!RH_qyaDFw&*H{_ z-MZr-K>ke*0<*xsaH6_aVn0HV-56~gkC7jj_>Nll-yR6~x*0wb}mSL-^DyCJ;F0&}QT2t7V)fQLd zIB*Xu(;p<)5|664bgk?u3?XB&bB1Xjj z_6R$$UHe3<`qKMTdMVv8T{)d!d(I4gksKHw8T>8YFDV_}IxLjHax+Z=oTXchjVEr$ zwSkK$t4XIYn;GTKMw8#gL``2Fe8AnrKFFEj|2AxPnDgY6sI(}f==(DzQ;Pzo`pVq> zokLyxT(4MO5RMo>;{7n|u}U)$GWx;uTCB8s6hD4`tY%_R$x?S}u}Fe;P~E56tI$aI zD>5MjXUFg3_S4_kt@ciFYY%`!0l()S8@(+j|C)}>JF;ZKl4omwY+Retyew%cIPYa_ z?~DiYp2R24cbe-tD>14zgzrajxNhfRV$MEAKSyLx+kr-152RD%DZUJ3^$vG#Z!Ty& zS983+vBt5%yAf_W*|w>+tINWcZDO~;HTaoxPjU89vqzH}%x4tj4zRY7W$1FFaldm+q|^E;~>rqK%_4HEg)qmPJ&S12pHSyYzo>)tTx=!&9myUn zgeb6Bp^}A5myEE+9*LKV?Z%#|D>O^S0~Bk=D+cq2v&9WVhlW0hdE(o$-I`z0m(o~y zxGZ2oAU!Mflz)d$K)>{Nz)RRmC?&xSKMPx9c&SseE!}_ne(@Xg`(fY3nJ@g$X@(Ep z|BtuMZ%P0$v?}ajq%ic0-(!EWPp40^zqz-uv%O=CYmsNK?;+2rPWP+__z_0GsLv^> zL>ZA!TR;n9Wz)%|BD@JmL3tzF;LG|$*d>(xj2d0ugU#{Q>xv7Ss_2cXge1+QZkL0 zN>U@%34W-QPK1um8YcB;_TTM$i{?!0JN9*)Y9lp+P4Orqps6~mhEt!=u&Cu$YjFFX zj$0ks9h6Q+_scH3{<#As!%HP3$vTx zO%-ONz5rP!`!Moc%9f^R1@hL3>%*V={}B}pIghf34tM8?(mT?7PIp(fd$k(sO6tNJ zuk?1eM|M1D%&SRn_O1O>%dAhW_o`i5Lu!LsAGWV<+Sd4_#ii<5eSf1@+v|q+ZTLRB zUUf%rA5K0KO4f(taN7D_pj|zDQSu)Cm;ICW09-)$f!|DAf}4Z827UmR>CS;=-1p2f z(jM{((tP|ON&_pHx{N#tJP0j;Jzx!HGu{Qa49)w7>mfA@G1FgGT$8?61SvjgeBnIQ z%{xQhGJ0>kSUF!&qOgbbs0$%j&DRF2Hpty%k7e7HFJ*I8H<3Iw4-SCnaEiJVw$VRQ z8S72;E_xzTN}6twWz%TeC8+206ZrTZ6LSaH`Kaw*SHzj>>f)>S>GHnsa?H`x$=Xxq zbI7C3Gtb%J-0lf_FY+jM_P6a5*cs0hoaT87?D!0>KS#_qXPlzHqSWFTK)8Ms;TR5q z3j7I@2jwvS4ag!Np*`AA`IJeF@oUtXG{l?5eoau}ui$Q?h18$5DeA3?_0n2NiejIP zKekl7bogT5rjDwPr)^6*?sQ!5D(*htPmSnyGKv3dxO2M7iS=mmTb`HM*b`mr|nD)1c^OZ20wDBbwIAgnv0^MbDG zc4A&*FJSQ~`y(2jP^T#GX)Y;;<+Aa-ah7taIzzigx^Z-}C{)yo_A$FZ@nh(E@6&F$ zzfe4T?4IP$ME%IC5p)e3svmkaK3{egWtDEzFx7hXEv+r$WY`BDBa0c`-0OT1=OojW z@_>amH+S6bamt-+-)p0@;X9gn-tm6yZS5W5>F#;glj82!Z(Bd5CN%FbiO1Ify zYR^sL>r7u;^;xen6&bB!;@FRP^*nFmQ@kw&@)T?-Z zz?mdtrwaC22`zj~7V(}k4;ax+x7oJZf3S)Z{9t*rPY8}$f3&Z);aIwxIhnNy=kcGg z+9_1}4R(U@O2KmWXR-rs8tx9hhcE>n47^8us->_O>HzPDf;FGC&Kj0xkLr@VQnp_f zqwrTLH1E|>>Wk_S)o*n_`tCQXSE!z;JTzI_CT%Rl*CLux)q2ecG@|{aEmt`zy_I8f z2W7hQlXAO^KXGMj+Gx)BKN4pNY5d}F;=m2j(&2{TfRW=OW$)I$qkSaDI=hKFlJm1M~~MXIQ~~+79Tqwnlpb?m#JR zzPfN^Gu(`N${L^wxB+%YtPl+1f-FFO!vy3W5`iQlOLSXxsE-dN7Oz05O@|CIhE9~8 z;)#-jBtSlxj(WW>V1HrH;cnxd2pF_(xEGs?pF}!CK2D~S=8*bG?GzrpopzbFnR1Ri zjS@o*p+_+x#%;!L`gXdKzKsDhj<6irzCBH18r$VC*T_DflLc5@Z_-jcxeL`6>L9{3PSK###K!{Cm7yu9)M%2{U@aM%j+6 zCCp6>XZl0hWLh_+jG`y+C4~`(@ssdETp%_Zi~K|{25Y(6Hq9E1uVzBMO#M-{OeI%7Rk|zLN*dZJ zL?eGLx0HX8osi9!O_90CI;5Ya=cGYWx)hKaNr_S$sZcs1DVC@t!xAH@i_}}XT>6jn zytGy-mNrUtQl2bPc2rg+8<+XZPs!iO_42KXQpE;kz0yy0SVdN!Rew?oHD^(Zf}2*N zJprkpLvR&(oh3Dg5lU?LcgMx73TcTuW=Kgu2}!M0$_u(n z5Zs9u(Mkv%aWYC9xIh{tC6OPKNt6wg)0CI!$fER8jHyeg@2JC67R`bdK?|ZSq@ARl zqrIekr#+>=GOk>iC^d4F|?O&QdZHW4o znnLAJODKmaWXfG~7@0vHApIb%B;^wY#AyVSPKw)xGsAtwuEt8hHQ*mW0Nh1;!k;v> z>Zj^o=4BfZ)8Q6qDb%iAt)*$dX?ALoG~pUs4O=s$EgFmP)SK~C%nlqZ;nmWydhOKqcMr&7T-)ad^ICKokf(9ThWCPDccT)etH{d7m zJv0OH5w3-G=(S2hXJjC)a2@=A?fnPehaaN9bpYNCN5YOU4ThjWC>tt(PCzptI|zg3 z8S1sQ+CptAI)k?sgGQd;Xf9}WX_jlIqQ_{h5o$P^VbsO`Tm4P_1%3SgSRbgrtN*I& z)Jio^3q z)bG&$KqIXdhQ%n=O@cDfHe%9H*3~eE2G|3Uzy?$;SAY+|XCNEZNf)3%$yDy30Q3bz zKu<6TvM19J&cXO2BL9FCUz0_KWsj>3yZ^%Z~^F@-~uiO*Mc*}hvJj)yYbJ_ zSSXReBe)XY6MhjWL>r=8}fsg5D!vmhqYbWY;A+KT3e?b zMA;`TS_L|!D3Qe&Rarc`Qf-6QpzGFo=pOV8`T=D?c~CV<|U*Q7y6I=rq!R4qDi{KCNTlBU2@FVyTybIol{-q~u z1T)Y_CtB%Kg3j^?Is@&5R-*GpL$T0wh=m?U0E9<-)*7KdZ6OY10@*+=&=e>H3WhdA z$yV#h=z-54rIgGLc0fB-s! z_CPJl=^Del0y4ooAQ>pfi~{`t6Bq#bB4bd^tp&qDE6^WZ+seSxs1}RC z{orqK6#Ee?#TH|IuqN0+@HW;2-MuH`UgOr`w&Hf;W}-wN5U<1W@G1E3_$quQ{xkkH z%2_GKi}2=z0>Wj&S;88EA7L+1L`WpY5g!n03Bg29ViIu*aWzp%3??#&LgFlRkkRL# ziQ9>{QBq3-VJl&jpeIBS9}??OHI3p&@R4{Gei6Z&Fqe>we~&+a@4}tH5piSKJvbL! zJ}v>b8*7i-fjtOTVW(s7pqZJo;34of;0~?;#{dg(8n6M=fUf#7U=fgrlE&VmyMWV% z-G*_)55qD2L7fu$jZ$)!p=`qh-AP>#atE1<*rCkN+Xz`V9aci$ky!LDdJ4_m>_v$} zPf=aCqx>K$90ZT(KI!J`3Sc|vCHl#V5r5bX5<-8GFGvK|$IDMFkY3 z8W5#-yodoIG^Gnj3FIU>Wy{R`@0``=o_%I_cIr1@ncbb;^L}ogGr*}S`{B+gz}Ir& zws5-f+F~P~nw!eiyqr(rbDfwd5-*A-q?#z?)diP}`7U=D5FZOfmgqr(KxOE`=i<%K zgYGCfgb|>&y+d6Yaei`+vxaO0d5JWmWn`;JmG$UTz=o{Ow$Vv4hj!L>P=~LRmGRB) zZrT#~ZKhUJUgjM%zuANJkS4rAw%2x%B6f)GB(rg~zKeFHHv5mZioQ#LY)D(Nu51G7 z&cd`OtEBIhpRyTv-y~T%yG*CB0jw%0@$2_!Z7{o@VawPkIg^&@m9$*iftA1(TC-(l zntqiW0h((H=G=RX=DtDN8?v$71%KrMvs2(T-@O_Ky5TK%oxEg>Gy7>Zjf9p-tBD@^ zmxg5D(Y|m{V6j`e4_5LOG^h((saMv2BwfTrZKHmfG|;YTRp@J?fxO1beV=H}*u(U0 z@~$&MNZ@IevIbl;X41EV}xDa7T zZ`RPfLJsn|@!**##>{n<8_0CtM3QJ3sMPtaqZ#*Ymj?Jn{5u@ zz1;(Pkk2k{8p{e@H}mZq+Cch#JhwcRf2BPqPty~6kc>;1P9<^GsibB5Hptfc6yCyK zC&R#Ioop1FIdUsmZ8eXS$R&Ot83Vtt2OSZ;FL5)`$F5`I>tNg~*7t9AZ$v+IOcLaK z?56b9z|+B&4kJF>A+GwT;O+j5#Qu{mCcU4 z9336}E=tGe5VVCYKVktf{1~F;4TRG?b%V9cXduq)yAVC;1mf5C3g? zBoVQevm((`+mLd~SFQZv*hOHTpOzn(o6HmP5_D~~bEdq3a|4LAG&msqkiT_wNLdvt z-Kt8Cq_+&76Js>2Unia}i`t`o6T&n6<;F&5S>%^UzWZUtlwdFWB&$rqu~D+f?MO$G z^*q;)uRQfsaewT6-X^fh=$mLBEhT@Z`t_!?#F`GA-L55C`Mm6uw2*aEZyY!o|EPF_ z z0#|Xegl)GwiXlb_Xx7t#&bu3UkA3YU^jrL=Tnn9}L#>=U7jQir9~%r`DC6u#x9-u0 z8WXJ#6K{p4`HS(rQWw7?DmYziHmKnxzvyk;CL;Vl1 z&gHR4Z|C*Ua`O@233IPCC($|4)LrQN$}f#E&X8C)a!xgoTbT25*`=V6w@gOQKf!Z225%WssPWclU*dP-lPp2PD?%4j`pnYD?3L!uhc zeXUxevbbXA3CDgSMD+FcX{VWf)F~*AIF9U$wY0UqQ@$9PR~!#EN%>slY1^`=241>)&&3)f*Q^wK z(a5T`B4uPE5xFNiO?;5>Ypc`Rv-hxKJ=D?MGJZF$;j5#y_vMBAvY37R_PaNZ-l=H} zt+cArwDg97pAxMuPW*GSk?#LUP7R!{)XKQ)%In34*=;)6`cJTNmCe2>k!fZ9ox7}M zH#&;06?~bClNm0nlWmvym@(Z)VlmM1f5|FVPb($qxn<3{pcNCC9h9^dlclGIZcKHVS zSUBJ4#n;gB^h=(@A7hW3>qsM~fBdvPS0i|eS%&}gz8K#b@9W=V&LD3Y{rD$hV0>s~ zv~w-x+01q9FTDe4V*4Y_<5RRDfoEt(KHhB~e?ogZr7^DbTl~y!6CD`q%-it`_7Gpa zjHddY=uDuMeNO_~Cia-ja~s>Oc~6>2x5&So*JKM{JGNim4n7f#i1Wo=Z`5#xn@{;C z(&gzbLx05QL~;{Z##eHdIAUg#&l1yP-;+;(I=6~_f@iO~v9BWSBxfD{A=a35(dvm^ zR<_&{TuDC`bIFx>_xPCL%wW~nm}n^6)8G2`kg`WJ&u02WH#}inyR-N9e~j-d&ky}B zBXm(&;93Q7!W{0ao6=RwlOKtvxEb#g`#<`!Z$@Abb(~c9Pw_bGgH@P>?+15&Y#(W# zwm)@Y?2*zF+Ix2Qc!WHFFXCUZd$UEsY_aB6+eA-aQ*E#K!L&nltfA36?lFC|HdP+h zzNR(!LQyCtl8^OcvW;8prqDxjwYElEO}7aVA8UO`hsuNOuvvrdm-DT)(RoG(+!I=9 zbAx&I&$ru_F|m`>$A6EmYWGEtMJ@r)d!#!#@Idf+xz+m8`X+wa{VSXkK0r=cm#sBc z2lomc8T>>KS-I?n+dY;>pVN1-CVDmBQun*)oYHE}72h_arI@83VaMWiNvgSv)WO}! zht72RtMR7szL+j{*c&3v+}yy-)Ly=}au|(TgUi=N?`MbgAM|-Co3!y|<>e*XE%Gh> z(_G-|>C{eiwx;opdVSJRUquf%{mB==l75IiM_#d>iCuRF(|K&IdDvf@{5Q5O_J#YS zmO&%H`yRj#xKHuQdMl&4e~C6J5sweXijRi6aUit!lXZZTy9bI`Tm2?K z9Nmyu#B#~gWML>y!e zwmVkb;J=bbefzWv@~kMZ7V?LT9drr#g^%Vrw2dq2Fy92XkRQ~S07rhYHN#mf?lt4u zJR%*gxY_gv-2ZoGzv2n$tn&vs?Hera6N}vS!je<9uKwy;Tepe^Z-$dT#vw0O+nQRjul5K1@nGf#;7WqnBK%bV4#3Qnk+k~H!edr?g zu^dY+?GV;BZ*%76J5TaTv1-x=q|>bTa!`TdlvK%_0kcuH8n?5C!~KV5J|Y8|Xzjjt>;Gu-5f4DZtu6 zOmMC*c&k+2l9c5bF^i(}wJTn84v<2%av6Y4f$^WGG*W zC)M%J!{S{wN8bfZn^Lxs9OX;+arZ9h{Y5!Udx;GL`u!MsT3nS?#boZvHtae}p{qm_ zF^|$H_C`;7(SRt|dKzh5jY~mFG(?9>8~n+i9W9 z!ngM>OV^&!^7Ri%Kle-bh%?ifD^`#ZY`=EDo{wkCVsVzY=f%$5?iaiR5Y;QOyY*7- z9BW87$>n0IxGws_=f!#csnBH&dbeK1?2d1PSF)9oyQiGJPAgsm=;g~yCM>0&7Ail9pmG zp6eaHNqh?r8btquJx+&Hp!br~a*X_0%mp6{Y8d z>FgVJ0qf>FWEZS+e87jxbh?TWJp0Whjbw9BIS)Q3C~@#yJfGyyUcg%4Mh*dU{+#>; ztIi!|J$b);Kpf%i{+Depoe0- z6RCr=HRN%u=MRSV$_A8?g-AvC7KsDf z|0>E4B!htBKMbu^#25X~qRqafE~!mY$&mDc&3jOE-JpT^psV;cH@Mf$wVjWPA;*7(`M>Z%7faV+^{7cBD z7WN_3dfb|3V-Q zK$Q=D)gpJJA06x3StN{<8c5H^+1&^g;9cVW?MwD> z5F^@)@Jq7o9q4B-wjHRs1t|wWfr@X3Z=CI@u?O_*ML39@pK*QwBT`2-rrl_7J8}!r z)^?2k57@|sq}3EB?e$iYZJ(*2m@Y^HmDXvb#0Q(fwQu-4{SvU$u*%0C? zJp=lc1^uiBO;bT>oQipx=V@Uj=wAhBU>LPj{~6FhRVNEAWFbf8WkFjruw|jmH1rif z$w0D3cCvH@q-G$bBxi|~WWFjNM9dGG)o7*Elhmsb=*cmwk^7Q#tI?_PGHfbES&9!S zYV3+bo^6<@r&9D}s+X?jCk?F=993NLUt$haL8X#pS=E+Dg(~er3hJonQJmLN%B#mw z8?L@kSGDGVVhwo|Y3ip++1NV>Dy}2l#a`m-pvo!gm1I=kDvu(rVkCJ~^%X?{l#)pe z@Jg!wJsP~8R6PqcNN5*@uBcYMmQ;@_rdm|(syx-VI#VO^xU9ymeiUODjFP!(RdHHzO~oyY)A_qKj_<%!+YCX%@)Fp`QI7rH zBEZ+tUKHN7;;_gF`iNuiV2glWl`9aBCVP)zZzt*Z`qz@YR~B#J{g3KFX^V>*6+3Lj}yuQ6o=IHRY}&P z60ct|I*&_A!Ypau%FdKdSHPLFNOc`b$1y#5ElJ0DCgLhDBWb5s>%(cY$%x@ zz&@DVRLq~WS7m)F7D5loDwRD3phKP(DH~LhR+M^Lr8wtVlxLI5UcItv&QfO{<({3W zvHeeTm1QYO;{cwiO=+3{=ah^TZ`5ApsdS~UO50Q(9G4?2)M`^a_hvgUPw`yUQl-43lCzO)LCuW5B=0@$D=B!g zP?GTEqV|gG|Hwzx@vbfEilJ(#b5EAOq+GoDN!hs?joPcd8z=NlC$*4ZWD+ zi_%Y}p^8&VGM+TlxssKVk;h487plBEQ!%fWSKrfdPrk}(6sJ|1Cw0}YvM9xUPaBjJ z6m4q8^`zkGnwO$R?~TTzS@kMFk2lY$melO1xEw?5o+NACm{vUiX5Ags1 diff --git a/test/integration/smoke_test.py b/test/integration/smoke_test.py deleted file mode 100644 index 0483127..0000000 --- a/test/integration/smoke_test.py +++ /dev/null @@ -1,268 +0,0 @@ -import asyncio -import pytest -import os -import sys - -sys.path.append(os.path.abspath(os.path.join(os.path.dirname(__file__), '..', '..', 'src', 'lmnt'))) -from api import Speech, StreamingSynthesisConnection # noqa - -# Set an API key in your environment to run these tests -X_API_KEY = os.environ['X_API_KEY'] -_BASE_URL = 'https://api.lmnt.com' - - -@pytest.fixture -async def api(): - async with Speech(X_API_KEY, base_url=_BASE_URL) as speech: - yield speech - - -@pytest.mark.asyncio -async def test_init(api: Speech): - assert api is not None - - -async def reader_task_binary(connection): - async for msg in connection: - assert msg is not None - assert 'audio' in msg - assert 'durations' not in msg - - -@pytest.mark.asyncio -async def test_synthesize_streaming(api: Speech): - voice = 'lily' - connection = await api.synthesize_streaming(voice) - assert connection is not None - assert isinstance(connection, StreamingSynthesisConnection) - reader = asyncio.create_task(reader_task_binary(connection)) - await connection.append_text('One, Hello, world!') - await connection.append_text('Two, Hello, world!') - await connection.append_text('Three, Hello, world!') - await connection.finish() - await reader - - -async def reader_task_str(connection): - async for msg in connection: - assert msg is not None - assert 'audio' in msg - assert 'durations' in msg - - -@pytest.mark.asyncio -async def test_synthesize_streaming_return_extras(api: Speech): - voice = 'lily' - connection = await api.synthesize_streaming(voice, return_extras=True) - assert connection is not None - assert isinstance(connection, StreamingSynthesisConnection) - reader = asyncio.create_task(reader_task_str(connection)) - await connection.append_text('One, Hello, world!') - await connection.append_text('Two, Hello, world!') - await connection.append_text('Three, Hello, world!') - await connection.finish() - await reader - - -@pytest.mark.asyncio -async def test_durations(api: Speech): - voice = 'lily' - text = 'Example Text' - result = await api.synthesize(text=text, voice=voice, return_durations=True) - assert result is not None - assert 'durations' in result - assert 'phonemes' not in result - assert 'audio' in result - assert len(result['durations']) > 0 - assert len(result['audio']) > 0 - assert isinstance(result['audio'], bytes) - - -@pytest.mark.asyncio -async def test_synthesize_with_invalid_voice(api: Speech): - voice = 'invalid_voice' - text = 'Example Text' - with pytest.raises(Exception): - await api.synthesize(text=text, voice=voice) - - -@pytest.mark.asyncio -async def test_synthesize_with_empty_text(api: Speech): - voice = 'lily' - text = '' - with pytest.raises(Exception): - await api.synthesize(text=text, voice=voice) - - -@pytest.mark.asyncio -async def test_synthesize(api: Speech): - voice = 'lily' - text = 'Example Text' - result = await api.synthesize(text=text, voice=voice) - assert result is not None - assert 'audio' in result - assert 'durations' not in result - assert 'seed' not in result - assert len(result['audio']) > 0 - assert isinstance(result['audio'], bytes) - - -@pytest.mark.asyncio -async def test_synthesize__non_en_language(api: Speech): - voice = 'lily' - text = 'Example Text' - language = 'pt' - result = await api.synthesize(text=text, voice=voice, language=language) - assert result is not None - assert 'audio' in result - assert 'durations' not in result - assert 'seed' not in result - assert len(result['audio']) > 0 - assert isinstance(result['audio'], bytes) - - -@pytest.mark.asyncio -async def test_synthesize_with_empty_voice(api: Speech): - voice = '' - text = 'Example Text' - with pytest.raises(Exception): - await api.synthesize(text=text, voice=voice) - - -@pytest.mark.asyncio -async def test_list_voices(api: Speech): - voices = await api.list_voices() - assert isinstance(voices, list) - assert len(voices) > 0 - - -@pytest.mark.asyncio -async def test_list_voices_starred(api: Speech): - voices = await api.list_voices(starred=True) - assert isinstance(voices, list) - - -@pytest.mark.asyncio -async def test_list_voices_owned(api: Speech): - voices = await api.list_voices(owner='me') - assert isinstance(voices, list) - - -@pytest.mark.asyncio -async def test_list_voices_owned_system(api: Speech): - voices = await api.list_voices(owner='system') - assert isinstance(voices, list) - - -@pytest.mark.asyncio -async def test_get_voice(api: Speech): - voice = await api.voice_info('lily') - assert isinstance(voice, dict) - assert voice['name'] == 'Lily' - - -@pytest.mark.asyncio -async def test_get_voice_with_invalid_voice(api: Speech): - with pytest.raises(Exception): - await api.voice_info('invalid_voice') - - -@pytest.mark.asyncio -async def test_update_voice_star(api: Speech): - await api.update_voice('lily', starred=True) - voice = await api.voice_info('lily') - assert voice.get('starred') is True - await api.update_voice('lily', starred=False) - voice = await api.voice_info('lily') - assert voice.get('starred') is False - - -@pytest.mark.asyncio -async def test_create_voice_basic_no_filenames(api: Speech): - with pytest.raises(Exception): - await api.create_voice(name='test_voice', enhance=True) - - -@pytest.mark.asyncio -async def test_create_voice_basic_empty_filenames(api: Speech): - with pytest.raises(Exception): - await api.create_voice(name='test_voice', enhance=True, filenames=[]) - - -@pytest.mark.asyncio -async def test_create_voice_basic_no_enhance(api: Speech): - with pytest.raises(Exception): - await api.create_voice(name='test_voice', filenames=['filename.wav']) - - -@pytest.mark.asyncio -async def test_create_voice_basic_no_name(api: Speech): - with pytest.raises(Exception): - await api.create_voice(enhance=True, filenames=['filename.wav']) - - -@pytest.mark.asyncio -async def test_create_voice_basic_empty_name(api: Speech): - with pytest.raises(Exception): - await api.create_voice(name='', enhance=True, filenames=['filename.wav']) - - -@pytest.mark.asyncio -async def test_create_voice_basic_invalid_filenames(api: Speech): - with pytest.raises(Exception): - await api.create_voice(name='test_voice', enhance=True, filenames=['invalid_filename.wav']) - - -@pytest.mark.asyncio -async def test_create_voice_advanced(api: Speech): - voice = await api.create_voice(name='integration_test_voice', enhance=True, filenames=['filename.wav'], description='test description', gender='male', type='instant') - voice_id = voice['id'] - stored_voice = await api.voice_info(voice_id) - await api.delete_voice(voice_id) - assert voice['name'] == 'integration_test_voice' - assert voice['owner'] == 'me' - assert voice['state'] == 'ready' - assert voice['type'] == 'instant' - voice.pop('state') # stored state is not set to ready immediately after creation - stored_voice.pop('state') - assert voice == stored_voice - with pytest.raises(Exception): - await api.voice_info(voice_id) - - -@pytest.mark.asyncio -async def test_update_owned_voice(api: Speech): - original_voice = await api.create_voice(name='test_voice_update', enhance=True, filenames=['filename.wav'], description='test description', gender='male', type='instant') - voice_id = original_voice['id'] - original_stored_voice = await api.voice_info(voice_id) - updated_voice = await api.update_voice(voice_id, description='my new description', gender='female', name='integration_new_name', starred=False) - updated_stored_voice = await api.voice_info(voice_id) - await api.delete_voice(voice_id) - updated_voice = updated_voice['voice'] - - assert original_voice['name'] == 'test_voice_update' - assert original_voice['owner'] == 'me' - assert original_voice['state'] == 'ready' - assert original_voice['type'] == 'instant' - assert original_voice['description'] == 'test description' - assert original_voice['gender'] == 'male' - original_voice.pop('state') # stored state is not set to ready immediately after creation - original_stored_voice.pop('state') - assert original_voice == original_stored_voice - - assert updated_voice['name'] == 'integration_new_name' - assert updated_voice['owner'] == 'me' - assert updated_voice['type'] == 'instant' - assert updated_voice['description'] == 'my new description' - assert updated_voice['gender'] == 'female' - updated_voice.pop('state') # stored state is not set to ready immediately after creation - updated_stored_voice.pop('state') - assert updated_voice == updated_stored_voice - with pytest.raises(Exception): - await api.voice_info(voice_id) - - -@pytest.mark.asyncio -async def test_get_account_info(api): - response = await api.account_info() - assert isinstance(response, dict) diff --git a/test/unit/test_speech.py b/test/unit/test_speech.py deleted file mode 100644 index ef0b003..0000000 --- a/test/unit/test_speech.py +++ /dev/null @@ -1,165 +0,0 @@ -import base64 -from unittest.mock import AsyncMock, patch, MagicMock -import os -import pytest -import sys -import json -sys.path.append(os.path.abspath(os.path.join(os.path.dirname(__file__), '..', '..', 'src', 'lmnt'))) -from api import Speech, StreamingSynthesisConnection, _SYNTHESIZE_STREAMING_ENDPOINT # noqa - - -MOCK_AUDIO = 'UklGRiQAAABXQVZFZm10IBAAAAABAAEAIlYAAESsAAACABAAZGF0YQAAAAA=' -MOCK_RESPONSE_OBJ = {'audio': MOCK_AUDIO, 'durations': [{'text': 'Hello,', 'start': 0.0, - 'duration': 0.5}, {'text': 'world!', 'start': 0.5, 'duration': 0.5}], 'seed': 'random_seed'} - - -@pytest.fixture -async def api(): - with patch('aiohttp.ClientSession', new=MagicMock()) as MockClientSession: - key = 'test_key' - api = Speech(key) - api._lazy_init() - MockClientSession.assert_called_once() - yield api - - -@pytest.mark.asyncio -async def test_synthesize(api): - text = 'Hello, world!' - voice = 'Voice1' - mock_response = {'audio': MOCK_AUDIO, 'durations': [], 'seed': 'random_seed'} - api._session.post.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.post.return_value.__aenter__.return_value.status = 200 - - synthesis_result = await api.synthesize(text, voice) - assert synthesis_result == {'audio': base64.b64decode(mock_response['audio'])} - - -@pytest.mark.asyncio -async def test_synthesize_return_durations(api): - text = 'Hello, world!' - voice = 'Voice1' - mock_response = MOCK_RESPONSE_OBJ - api._session.post.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.post.return_value.__aenter__.return_value.status = 200 - - synthesis_result = await api.synthesize(text, voice, return_durations=True) - assert synthesis_result == {'audio': base64.b64decode(mock_response['audio']), 'durations': mock_response['durations']} - - -@pytest.mark.asyncio -async def test_synthesize_return_seed(api): - text = 'Hello, world!' - voice = 'Voice1' - mock_response = {'audio': MOCK_AUDIO, 'durations': [], 'seed': 'random_seed'} - api._session.post.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.post.return_value.__aenter__.return_value.status = 200 - - synthesis_result = await api.synthesize(text, voice, return_seed=True) - assert synthesis_result == {'audio': base64.b64decode(mock_response['audio']), 'seed': mock_response['seed']} - - -@pytest.mark.asyncio -async def test_synthesize_return_durations_and_seed(api): - text = 'Hello, world!' - voice = 'Voice1' - mock_response = MOCK_RESPONSE_OBJ - api._session.post.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.post.return_value.__aenter__.return_value.status = 200 - - synthesis_result = await api.synthesize(text, voice, return_durations=True, return_seed=True) - assert synthesis_result == {'audio': base64.b64decode(mock_response['audio']), 'durations': mock_response['durations'], 'seed': mock_response['seed']} - - -@pytest.mark.asyncio -async def test_synthesize__non_en_language(api): - text = 'Hello, world!' - voice = 'Voice1' - language = 'pt' - mock_response = {'audio': MOCK_AUDIO, 'durations': [], 'seed': 'random_seed'} - api._session.post.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.post.return_value.__aenter__.return_value.status = 200 - - synthesis_result = await api.synthesize(text, voice, language=language) - assert synthesis_result == {'audio': base64.b64decode(mock_response['audio'])} - - -@pytest.mark.asyncio -async def test_synthesize_no_text(api): - with pytest.raises(AssertionError): - await api.synthesize(None, 'Voice1') - - -@pytest.mark.asyncio -async def test_synthesize_no_voice(api): - with pytest.raises(AssertionError): - await api.synthesize('Hello, world!', None) - - -@pytest.mark.asyncio -async def test_deprecated_durations(api): - text = 'Hello, world!' - voice = 'Voice1' - mock_response = MOCK_RESPONSE_OBJ - api._session.post.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.post.return_value.__aenter__.return_value.status = 200 - - synthesis_result = await api.synthesize(text, voice, durations=True) - assert synthesis_result == {'audio': base64.b64decode(mock_response['audio']), 'durations': mock_response['durations']} - - -@pytest.mark.asyncio -async def test_deprecated_durations_false(api): - text = 'Hello, world!' - voice = 'Voice1' - mock_response = MOCK_RESPONSE_OBJ - api._session.post.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.post.return_value.__aenter__.return_value.status = 200 - - synthesis_result = await api.synthesize(text, voice, durations=False, return_durations=True) - assert synthesis_result == {'audio': base64.b64decode(mock_response['audio']), 'durations': mock_response['durations']} - - -@pytest.mark.asyncio -async def test_synthesize_streaming(api): - voice = 'Voice1' - speed = 1.5 - expressive = 0.8 - return_extras = True - language = 'pt' - - mock_ws = AsyncMock() - api._session = AsyncMock() - api._session.ws_connect.return_value = mock_ws - - connection = await api.synthesize_streaming(voice, return_extras=return_extras, speed=speed, expressive=expressive, language=language) - - assert isinstance(connection, StreamingSynthesisConnection) - api._session.ws_connect.assert_called_once_with(f'{api._base_url}{_SYNTHESIZE_STREAMING_ENDPOINT}') - mock_ws.send_str.assert_called_once_with(json.dumps({ - 'X-API-Key': api._api_key, - 'voice': voice, - 'speed': speed, - 'expressive': expressive, - 'send_extras': return_extras, - 'language': language - })) - - -@pytest.mark.asyncio -async def test_synthesize_streaming_defaults(api): - voice = 'Voice1' - - mock_ws = AsyncMock() - api._session = AsyncMock() - api._session.ws_connect.return_value = mock_ws - - connection = await api.synthesize_streaming(voice) - - assert isinstance(connection, StreamingSynthesisConnection) - api._session.ws_connect.assert_called_once_with(f'{api._base_url}{_SYNTHESIZE_STREAMING_ENDPOINT}') - mock_ws.send_str.assert_called_once_with(json.dumps({ - 'X-API-Key': api._api_key, - 'voice': voice, - 'send_extras': False - })) diff --git a/test/unit/test_voice.py b/test/unit/test_voice.py deleted file mode 100644 index fe58823..0000000 --- a/test/unit/test_voice.py +++ /dev/null @@ -1,185 +0,0 @@ -from unittest.mock import AsyncMock, patch, MagicMock -import os -import pytest -import sys -sys.path.append(os.path.abspath(os.path.join(os.path.dirname(__file__), '..', '..', 'src', 'lmnt'))) -from api import Speech, _LIST_VOICES_ENDPOINT, _VOICE_ENDPOINT # noqa - - -def test_lazy_init(): - with patch('aiohttp.ClientSession', new=MagicMock()) as MockClientSession: - api = Speech('test_key') - api._lazy_init() - MockClientSession.assert_called_once() - assert isinstance(api._session, MagicMock) - - -@pytest.fixture -def mock_response(): - return { - 'voices': [ - {'name': 'Voice1', 'language': 'en-US'}, - {'name': 'Voice2', 'language': 'en-GB'}, - ] - } - - -@pytest.fixture -async def api(): - with patch('aiohttp.ClientSession', new=MagicMock()) as MockClientSession: - key = 'test_key' - api = Speech(key) - api._lazy_init() - MockClientSession.assert_called_once() - yield api - - -@pytest.mark.asyncio -async def test_list_voices_default_params(api, mock_response): - with patch('aiohttp.ClientSession', new=MagicMock()): - api._session.get.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.get.return_value.__aenter__.return_value.status = 200 - result = await api.list_voices() - api._session.get.assert_called_once_with( - f'{api._base_url}{_LIST_VOICES_ENDPOINT}?starred=False&owner=all', - headers=api._build_headers() - ) - assert result == mock_response - - -@pytest.mark.asyncio -async def test_list_voices_with_params(api, mock_response): - with patch('aiohttp.ClientSession', new=MagicMock()): - api._session.get.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.get.return_value.__aenter__.return_value.status = 200 - result = await api.list_voices(starred=True, owner='me') - api._session.get.assert_called_once_with( - f'{api._base_url}{_LIST_VOICES_ENDPOINT}?starred=True&owner=me', - headers=api._build_headers() - ) - assert result == mock_response - - -@pytest.mark.asyncio -async def test_list_voices_with_params_system(api, mock_response): - with patch('aiohttp.ClientSession', new=MagicMock()): - api._session.get.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.get.return_value.__aenter__.return_value.status = 200 - result = await api.list_voices(starred=True, owner='system') - api._session.get.assert_called_once_with( - f'{api._base_url}{_LIST_VOICES_ENDPOINT}?starred=True&owner=system', - headers=api._build_headers() - ) - assert result == mock_response - - -@pytest.mark.asyncio -async def test_list_voices_invalid_owner(api): - with pytest.raises(ValueError): - await api.list_voices(owner='invalid') - - -@pytest.mark.asyncio -async def test_list_voices_starred(api): - mock_response = [{'name': 'Voice1', 'starred': True}, {'name': 'Voice2', 'starred': True}] - api._session.get.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.get.return_value.__aenter__.return_value.status = 200 - - voices = await api.list_voices(starred=True) - api._session.get.assert_called_once_with( - f'{api._base_url}{_LIST_VOICES_ENDPOINT}?starred=True&owner=all', - headers=api._build_headers() - ) - assert voices == mock_response - - -@pytest.mark.asyncio -async def test_list_voices_invalid_star(api): - with pytest.raises(ValueError): - await api.list_voices(starred='invalid') - - -@pytest.mark.asyncio -async def test_voice_info(api): - mock_response = {'id': 'Voice1', 'name': 'Voice1', 'language': 'en-US'} - api._session.get.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.get.return_value.__aenter__.return_value.status = 200 - - voice_info = await api.voice_info('Voice1') - assert voice_info == mock_response - - -@pytest.mark.asyncio -async def test_voice_info_invalid_id(api): - api._session.get.return_value.__aenter__.return_value.status = 400 - - with pytest.raises(Exception): - await api.voice_info('invalid') - - -@pytest.mark.asyncio -async def test_create_voice(api): - mock_response = {'id': 'Voice1', 'name': 'Voice1', 'state': 'ready'} - api._session.post.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.post.return_value.__aenter__.return_value.status = 200 - - voice_info = await api.create_voice('Voice1', False, ['filename.wav', 'filename.wav']) - assert voice_info == mock_response - - -@pytest.mark.asyncio -async def test_create_voice_invalid_type(api): - with pytest.raises(ValueError): - await api.create_voice('Voice1', False, ['filename.wav', 'filename.wav'], type='invalid') - - -@pytest.mark.asyncio -async def test_create_voice_no_name(api): - with pytest.raises(ValueError): - await api.create_voice(None, False, ['filename.wav', 'filename.wav']) - - -@pytest.mark.asyncio -async def test_create_voice_no_files(api): - with pytest.raises(ValueError): - await api.create_voice('Voice1', False, []) - - -@pytest.mark.asyncio -async def test_update_voice(api): - mock_response = {'id': 'Voice1', 'name': 'UpdatedVoice', 'starred': True} - api._session.put.return_value.__aenter__.return_value.json = AsyncMock(return_value=mock_response) - api._session.put.return_value.__aenter__.return_value.status = 200 - - voice_info = await api.update_voice('Voice1', name='UpdatedVoice', starred=True) - assert voice_info == mock_response - - -@pytest.mark.asyncio -async def test_update_voice_invalid_id(api): - api._session.put.return_value.__aenter__.return_value.status = 400 - - with pytest.raises(Exception): - await api.update_voice('invalid', name='UpdatedVoice', starred=True) - - -@pytest.mark.asyncio -async def test_delete_voice(api): - voice_id = 'Voice1' - api._session.delete.return_value.__aenter__.return_value.status = 200 - api._session.delete.return_value.__aenter__.return_value.json = AsyncMock(return_value={}) - - response = await api.delete_voice(voice_id) - api._session.delete.assert_called_once_with( - f'{api._base_url}{_VOICE_ENDPOINT}'.format(id=voice_id), - headers=api._build_headers() - ) - assert response == {} - - -@pytest.mark.asyncio -async def test_delete_voice_invalid_id(api): - api._session.delete.return_value.__aenter__.return_value.status = 400 - - with pytest.raises(Exception): - await api.delete_voice('invalid') diff --git a/tests/__init__.py b/tests/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/__init__.py b/tests/api_resources/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/api_resources/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/test_accounts.py b/tests/api_resources/test_accounts.py new file mode 100644 index 0000000..bfc5dce --- /dev/null +++ b/tests/api_resources/test_accounts.py @@ -0,0 +1,74 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from lmnt import Lmnt, AsyncLmnt +from lmnt.types import AccountRetrieveResponse +from tests.utils import assert_matches_type + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestAccounts: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @parametrize + def test_method_retrieve(self, client: Lmnt) -> None: + account = client.accounts.retrieve() + assert_matches_type(AccountRetrieveResponse, account, path=["response"]) + + @parametrize + def test_raw_response_retrieve(self, client: Lmnt) -> None: + response = client.accounts.with_raw_response.retrieve() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + account = response.parse() + assert_matches_type(AccountRetrieveResponse, account, path=["response"]) + + @parametrize + def test_streaming_response_retrieve(self, client: Lmnt) -> None: + with client.accounts.with_streaming_response.retrieve() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + account = response.parse() + assert_matches_type(AccountRetrieveResponse, account, path=["response"]) + + assert cast(Any, response.is_closed) is True + + +class TestAsyncAccounts: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @parametrize + async def test_method_retrieve(self, async_client: AsyncLmnt) -> None: + account = await async_client.accounts.retrieve() + assert_matches_type(AccountRetrieveResponse, account, path=["response"]) + + @parametrize + async def test_raw_response_retrieve(self, async_client: AsyncLmnt) -> None: + response = await async_client.accounts.with_raw_response.retrieve() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + account = await response.parse() + assert_matches_type(AccountRetrieveResponse, account, path=["response"]) + + @parametrize + async def test_streaming_response_retrieve(self, async_client: AsyncLmnt) -> None: + async with async_client.accounts.with_streaming_response.retrieve() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + account = await response.parse() + assert_matches_type(AccountRetrieveResponse, account, path=["response"]) + + assert cast(Any, response.is_closed) is True diff --git a/tests/api_resources/test_speech.py b/tests/api_resources/test_speech.py new file mode 100644 index 0000000..5227364 --- /dev/null +++ b/tests/api_resources/test_speech.py @@ -0,0 +1,386 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import httpx +import pytest +from respx import MockRouter + +from lmnt import Lmnt, AsyncLmnt +from lmnt.types import ( + SpeechGenerateDetailedResponse, +) +from tests.utils import assert_matches_type +from lmnt._response import ( + BinaryAPIResponse, + AsyncBinaryAPIResponse, + StreamedBinaryAPIResponse, + AsyncStreamedBinaryAPIResponse, +) + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestSpeech: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @parametrize + @pytest.mark.respx(base_url=base_url) + def test_method_convert(self, client: Lmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/convert").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + speech = client.speech.convert( + audio=b"raw file contents", + voice="ava", + ) + assert speech.is_closed + assert speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, BinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + def test_method_convert_with_all_params(self, client: Lmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/convert").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + speech = client.speech.convert( + audio=b"raw file contents", + voice="ava", + format="aac", + language="auto", + sample_rate=8000, + ) + assert speech.is_closed + assert speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, BinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + def test_raw_response_convert(self, client: Lmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/convert").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + speech = client.speech.with_raw_response.convert( + audio=b"raw file contents", + voice="ava", + ) + + assert speech.is_closed is True + assert speech.http_request.headers.get("X-Stainless-Lang") == "python" + assert speech.json() == {"foo": "bar"} + assert isinstance(speech, BinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + def test_streaming_response_convert(self, client: Lmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/convert").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + with client.speech.with_streaming_response.convert( + audio=b"raw file contents", + voice="ava", + ) as speech: + assert not speech.is_closed + assert speech.http_request.headers.get("X-Stainless-Lang") == "python" + + assert speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, StreamedBinaryAPIResponse) + + assert cast(Any, speech.is_closed) is True + + @parametrize + @pytest.mark.respx(base_url=base_url) + def test_method_generate(self, client: Lmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + speech = client.speech.generate( + text="hello world.", + voice="ava", + ) + assert speech.is_closed + assert speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, BinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + def test_method_generate_with_all_params(self, client: Lmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + speech = client.speech.generate( + text="hello world.", + voice="ava", + format="aac", + language="auto", + model="blizzard", + sample_rate=8000, + seed=0, + temperature=0, + top_p=0, + ) + assert speech.is_closed + assert speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, BinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + def test_raw_response_generate(self, client: Lmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + speech = client.speech.with_raw_response.generate( + text="hello world.", + voice="ava", + ) + + assert speech.is_closed is True + assert speech.http_request.headers.get("X-Stainless-Lang") == "python" + assert speech.json() == {"foo": "bar"} + assert isinstance(speech, BinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + def test_streaming_response_generate(self, client: Lmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + with client.speech.with_streaming_response.generate( + text="hello world.", + voice="ava", + ) as speech: + assert not speech.is_closed + assert speech.http_request.headers.get("X-Stainless-Lang") == "python" + + assert speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, StreamedBinaryAPIResponse) + + assert cast(Any, speech.is_closed) is True + + @parametrize + def test_method_generate_detailed(self, client: Lmnt) -> None: + speech = client.speech.generate_detailed( + text="hello world.", + voice="ava", + ) + assert_matches_type(SpeechGenerateDetailedResponse, speech, path=["response"]) + + @parametrize + def test_method_generate_detailed_with_all_params(self, client: Lmnt) -> None: + speech = client.speech.generate_detailed( + text="hello world.", + voice="ava", + format="aac", + language="auto", + model="blizzard", + return_durations=True, + sample_rate=8000, + seed=0, + temperature=0, + top_p=0, + ) + assert_matches_type(SpeechGenerateDetailedResponse, speech, path=["response"]) + + @parametrize + def test_raw_response_generate_detailed(self, client: Lmnt) -> None: + response = client.speech.with_raw_response.generate_detailed( + text="hello world.", + voice="ava", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + speech = response.parse() + assert_matches_type(SpeechGenerateDetailedResponse, speech, path=["response"]) + + @parametrize + def test_streaming_response_generate_detailed(self, client: Lmnt) -> None: + with client.speech.with_streaming_response.generate_detailed( + text="hello world.", + voice="ava", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + speech = response.parse() + assert_matches_type(SpeechGenerateDetailedResponse, speech, path=["response"]) + + assert cast(Any, response.is_closed) is True + + +class TestAsyncSpeech: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @parametrize + @pytest.mark.respx(base_url=base_url) + async def test_method_convert(self, async_client: AsyncLmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/convert").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + speech = await async_client.speech.convert( + audio=b"raw file contents", + voice="ava", + ) + assert speech.is_closed + assert await speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, AsyncBinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + async def test_method_convert_with_all_params(self, async_client: AsyncLmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/convert").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + speech = await async_client.speech.convert( + audio=b"raw file contents", + voice="ava", + format="aac", + language="auto", + sample_rate=8000, + ) + assert speech.is_closed + assert await speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, AsyncBinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + async def test_raw_response_convert(self, async_client: AsyncLmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/convert").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + speech = await async_client.speech.with_raw_response.convert( + audio=b"raw file contents", + voice="ava", + ) + + assert speech.is_closed is True + assert speech.http_request.headers.get("X-Stainless-Lang") == "python" + assert await speech.json() == {"foo": "bar"} + assert isinstance(speech, AsyncBinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + async def test_streaming_response_convert(self, async_client: AsyncLmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/convert").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + async with async_client.speech.with_streaming_response.convert( + audio=b"raw file contents", + voice="ava", + ) as speech: + assert not speech.is_closed + assert speech.http_request.headers.get("X-Stainless-Lang") == "python" + + assert await speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, AsyncStreamedBinaryAPIResponse) + + assert cast(Any, speech.is_closed) is True + + @parametrize + @pytest.mark.respx(base_url=base_url) + async def test_method_generate(self, async_client: AsyncLmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + speech = await async_client.speech.generate( + text="hello world.", + voice="ava", + ) + assert speech.is_closed + assert await speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, AsyncBinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + async def test_method_generate_with_all_params(self, async_client: AsyncLmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + speech = await async_client.speech.generate( + text="hello world.", + voice="ava", + format="aac", + language="auto", + model="blizzard", + sample_rate=8000, + seed=0, + temperature=0, + top_p=0, + ) + assert speech.is_closed + assert await speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, AsyncBinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + async def test_raw_response_generate(self, async_client: AsyncLmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + speech = await async_client.speech.with_raw_response.generate( + text="hello world.", + voice="ava", + ) + + assert speech.is_closed is True + assert speech.http_request.headers.get("X-Stainless-Lang") == "python" + assert await speech.json() == {"foo": "bar"} + assert isinstance(speech, AsyncBinaryAPIResponse) + + @parametrize + @pytest.mark.respx(base_url=base_url) + async def test_streaming_response_generate(self, async_client: AsyncLmnt, respx_mock: MockRouter) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + async with async_client.speech.with_streaming_response.generate( + text="hello world.", + voice="ava", + ) as speech: + assert not speech.is_closed + assert speech.http_request.headers.get("X-Stainless-Lang") == "python" + + assert await speech.json() == {"foo": "bar"} + assert cast(Any, speech.is_closed) is True + assert isinstance(speech, AsyncStreamedBinaryAPIResponse) + + assert cast(Any, speech.is_closed) is True + + @parametrize + async def test_method_generate_detailed(self, async_client: AsyncLmnt) -> None: + speech = await async_client.speech.generate_detailed( + text="hello world.", + voice="ava", + ) + assert_matches_type(SpeechGenerateDetailedResponse, speech, path=["response"]) + + @parametrize + async def test_method_generate_detailed_with_all_params(self, async_client: AsyncLmnt) -> None: + speech = await async_client.speech.generate_detailed( + text="hello world.", + voice="ava", + format="aac", + language="auto", + model="blizzard", + return_durations=True, + sample_rate=8000, + seed=0, + temperature=0, + top_p=0, + ) + assert_matches_type(SpeechGenerateDetailedResponse, speech, path=["response"]) + + @parametrize + async def test_raw_response_generate_detailed(self, async_client: AsyncLmnt) -> None: + response = await async_client.speech.with_raw_response.generate_detailed( + text="hello world.", + voice="ava", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + speech = await response.parse() + assert_matches_type(SpeechGenerateDetailedResponse, speech, path=["response"]) + + @parametrize + async def test_streaming_response_generate_detailed(self, async_client: AsyncLmnt) -> None: + async with async_client.speech.with_streaming_response.generate_detailed( + text="hello world.", + voice="ava", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + speech = await response.parse() + assert_matches_type(SpeechGenerateDetailedResponse, speech, path=["response"]) + + assert cast(Any, response.is_closed) is True diff --git a/tests/api_resources/test_voices.py b/tests/api_resources/test_voices.py new file mode 100644 index 0000000..d8306a9 --- /dev/null +++ b/tests/api_resources/test_voices.py @@ -0,0 +1,449 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from lmnt import Lmnt, AsyncLmnt +from lmnt.types import ( + Voice, + VoiceListResponse, + VoiceDeleteResponse, + VoiceUpdateResponse, +) +from tests.utils import assert_matches_type + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestVoices: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @pytest.mark.skip(reason="Prism bug detailed here: https://github.com/stoplightio/prism/pull/2654") + @parametrize + def test_method_create(self, client: Lmnt) -> None: + voice = client.voices.create( + enhance=False, + files=[b"raw file contents"], + name="new-voice", + ) + assert_matches_type(Voice, voice, path=["response"]) + + @pytest.mark.skip(reason="Prism bug detailed here: https://github.com/stoplightio/prism/pull/2654") + @parametrize + def test_method_create_with_all_params(self, client: Lmnt) -> None: + voice = client.voices.create( + enhance=False, + files=[b"raw file contents"], + name="new-voice", + description="description", + gender="gender", + ) + assert_matches_type(Voice, voice, path=["response"]) + + @pytest.mark.skip(reason="Prism bug detailed here: https://github.com/stoplightio/prism/pull/2654") + @parametrize + def test_raw_response_create(self, client: Lmnt) -> None: + response = client.voices.with_raw_response.create( + enhance=False, + files=[b"raw file contents"], + name="new-voice", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = response.parse() + assert_matches_type(Voice, voice, path=["response"]) + + @pytest.mark.skip(reason="Prism bug detailed here: https://github.com/stoplightio/prism/pull/2654") + @parametrize + def test_streaming_response_create(self, client: Lmnt) -> None: + with client.voices.with_streaming_response.create( + enhance=False, + files=[b"raw file contents"], + name="new-voice", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = response.parse() + assert_matches_type(Voice, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_method_retrieve(self, client: Lmnt) -> None: + voice = client.voices.retrieve( + "id", + ) + assert_matches_type(Voice, voice, path=["response"]) + + @parametrize + def test_raw_response_retrieve(self, client: Lmnt) -> None: + response = client.voices.with_raw_response.retrieve( + "id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = response.parse() + assert_matches_type(Voice, voice, path=["response"]) + + @parametrize + def test_streaming_response_retrieve(self, client: Lmnt) -> None: + with client.voices.with_streaming_response.retrieve( + "id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = response.parse() + assert_matches_type(Voice, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_retrieve(self, client: Lmnt) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `id` but received ''"): + client.voices.with_raw_response.retrieve( + "", + ) + + @parametrize + def test_method_update(self, client: Lmnt) -> None: + voice = client.voices.update( + id="123", + ) + assert_matches_type(VoiceUpdateResponse, voice, path=["response"]) + + @parametrize + def test_method_update_with_all_params(self, client: Lmnt) -> None: + voice = client.voices.update( + id="123", + description="description", + gender="gender", + name="name", + starred=True, + ) + assert_matches_type(VoiceUpdateResponse, voice, path=["response"]) + + @parametrize + def test_raw_response_update(self, client: Lmnt) -> None: + response = client.voices.with_raw_response.update( + id="123", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = response.parse() + assert_matches_type(VoiceUpdateResponse, voice, path=["response"]) + + @parametrize + def test_streaming_response_update(self, client: Lmnt) -> None: + with client.voices.with_streaming_response.update( + id="123", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = response.parse() + assert_matches_type(VoiceUpdateResponse, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_update(self, client: Lmnt) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `id` but received ''"): + client.voices.with_raw_response.update( + id="", + ) + + @parametrize + def test_method_list(self, client: Lmnt) -> None: + voice = client.voices.list() + assert_matches_type(VoiceListResponse, voice, path=["response"]) + + @parametrize + def test_method_list_with_all_params(self, client: Lmnt) -> None: + voice = client.voices.list( + owner="owner", + starred="starred", + ) + assert_matches_type(VoiceListResponse, voice, path=["response"]) + + @parametrize + def test_raw_response_list(self, client: Lmnt) -> None: + response = client.voices.with_raw_response.list() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = response.parse() + assert_matches_type(VoiceListResponse, voice, path=["response"]) + + @parametrize + def test_streaming_response_list(self, client: Lmnt) -> None: + with client.voices.with_streaming_response.list() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = response.parse() + assert_matches_type(VoiceListResponse, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_method_delete(self, client: Lmnt) -> None: + voice = client.voices.delete( + "id", + ) + assert_matches_type(VoiceDeleteResponse, voice, path=["response"]) + + @parametrize + def test_raw_response_delete(self, client: Lmnt) -> None: + response = client.voices.with_raw_response.delete( + "id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = response.parse() + assert_matches_type(VoiceDeleteResponse, voice, path=["response"]) + + @parametrize + def test_streaming_response_delete(self, client: Lmnt) -> None: + with client.voices.with_streaming_response.delete( + "id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = response.parse() + assert_matches_type(VoiceDeleteResponse, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_delete(self, client: Lmnt) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `id` but received ''"): + client.voices.with_raw_response.delete( + "", + ) + + +class TestAsyncVoices: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @pytest.mark.skip(reason="Prism bug detailed here: https://github.com/stoplightio/prism/pull/2654") + @parametrize + async def test_method_create(self, async_client: AsyncLmnt) -> None: + voice = await async_client.voices.create( + enhance=False, + files=[b"raw file contents"], + name="new-voice", + ) + assert_matches_type(Voice, voice, path=["response"]) + + @pytest.mark.skip(reason="Prism bug detailed here: https://github.com/stoplightio/prism/pull/2654") + @parametrize + async def test_method_create_with_all_params(self, async_client: AsyncLmnt) -> None: + voice = await async_client.voices.create( + enhance=False, + files=[b"raw file contents"], + name="new-voice", + description="description", + gender="gender", + ) + assert_matches_type(Voice, voice, path=["response"]) + + @pytest.mark.skip(reason="Prism bug detailed here: https://github.com/stoplightio/prism/pull/2654") + @parametrize + async def test_raw_response_create(self, async_client: AsyncLmnt) -> None: + response = await async_client.voices.with_raw_response.create( + enhance=False, + files=[b"raw file contents"], + name="new-voice", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = await response.parse() + assert_matches_type(Voice, voice, path=["response"]) + + @pytest.mark.skip(reason="Prism bug detailed here: https://github.com/stoplightio/prism/pull/2654") + @parametrize + async def test_streaming_response_create(self, async_client: AsyncLmnt) -> None: + async with async_client.voices.with_streaming_response.create( + enhance=False, + files=[b"raw file contents"], + name="new-voice", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = await response.parse() + assert_matches_type(Voice, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_method_retrieve(self, async_client: AsyncLmnt) -> None: + voice = await async_client.voices.retrieve( + "id", + ) + assert_matches_type(Voice, voice, path=["response"]) + + @parametrize + async def test_raw_response_retrieve(self, async_client: AsyncLmnt) -> None: + response = await async_client.voices.with_raw_response.retrieve( + "id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = await response.parse() + assert_matches_type(Voice, voice, path=["response"]) + + @parametrize + async def test_streaming_response_retrieve(self, async_client: AsyncLmnt) -> None: + async with async_client.voices.with_streaming_response.retrieve( + "id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = await response.parse() + assert_matches_type(Voice, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_retrieve(self, async_client: AsyncLmnt) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `id` but received ''"): + await async_client.voices.with_raw_response.retrieve( + "", + ) + + @parametrize + async def test_method_update(self, async_client: AsyncLmnt) -> None: + voice = await async_client.voices.update( + id="123", + ) + assert_matches_type(VoiceUpdateResponse, voice, path=["response"]) + + @parametrize + async def test_method_update_with_all_params(self, async_client: AsyncLmnt) -> None: + voice = await async_client.voices.update( + id="123", + description="description", + gender="gender", + name="name", + starred=True, + ) + assert_matches_type(VoiceUpdateResponse, voice, path=["response"]) + + @parametrize + async def test_raw_response_update(self, async_client: AsyncLmnt) -> None: + response = await async_client.voices.with_raw_response.update( + id="123", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = await response.parse() + assert_matches_type(VoiceUpdateResponse, voice, path=["response"]) + + @parametrize + async def test_streaming_response_update(self, async_client: AsyncLmnt) -> None: + async with async_client.voices.with_streaming_response.update( + id="123", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = await response.parse() + assert_matches_type(VoiceUpdateResponse, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_update(self, async_client: AsyncLmnt) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `id` but received ''"): + await async_client.voices.with_raw_response.update( + id="", + ) + + @parametrize + async def test_method_list(self, async_client: AsyncLmnt) -> None: + voice = await async_client.voices.list() + assert_matches_type(VoiceListResponse, voice, path=["response"]) + + @parametrize + async def test_method_list_with_all_params(self, async_client: AsyncLmnt) -> None: + voice = await async_client.voices.list( + owner="owner", + starred="starred", + ) + assert_matches_type(VoiceListResponse, voice, path=["response"]) + + @parametrize + async def test_raw_response_list(self, async_client: AsyncLmnt) -> None: + response = await async_client.voices.with_raw_response.list() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = await response.parse() + assert_matches_type(VoiceListResponse, voice, path=["response"]) + + @parametrize + async def test_streaming_response_list(self, async_client: AsyncLmnt) -> None: + async with async_client.voices.with_streaming_response.list() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = await response.parse() + assert_matches_type(VoiceListResponse, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_method_delete(self, async_client: AsyncLmnt) -> None: + voice = await async_client.voices.delete( + "id", + ) + assert_matches_type(VoiceDeleteResponse, voice, path=["response"]) + + @parametrize + async def test_raw_response_delete(self, async_client: AsyncLmnt) -> None: + response = await async_client.voices.with_raw_response.delete( + "id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + voice = await response.parse() + assert_matches_type(VoiceDeleteResponse, voice, path=["response"]) + + @parametrize + async def test_streaming_response_delete(self, async_client: AsyncLmnt) -> None: + async with async_client.voices.with_streaming_response.delete( + "id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + voice = await response.parse() + assert_matches_type(VoiceDeleteResponse, voice, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_delete(self, async_client: AsyncLmnt) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `id` but received ''"): + await async_client.voices.with_raw_response.delete( + "", + ) diff --git a/tests/conftest.py b/tests/conftest.py new file mode 100644 index 0000000..9917845 --- /dev/null +++ b/tests/conftest.py @@ -0,0 +1,84 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +import logging +from typing import TYPE_CHECKING, Iterator, AsyncIterator + +import httpx +import pytest +from pytest_asyncio import is_async_test + +from lmnt import Lmnt, AsyncLmnt, DefaultAioHttpClient +from lmnt._utils import is_dict + +if TYPE_CHECKING: + from _pytest.fixtures import FixtureRequest # pyright: ignore[reportPrivateImportUsage] + +pytest.register_assert_rewrite("tests.utils") + +logging.getLogger("lmnt").setLevel(logging.DEBUG) + + +# automatically add `pytest.mark.asyncio()` to all of our async tests +# so we don't have to add that boilerplate everywhere +def pytest_collection_modifyitems(items: list[pytest.Function]) -> None: + pytest_asyncio_tests = (item for item in items if is_async_test(item)) + session_scope_marker = pytest.mark.asyncio(loop_scope="session") + for async_test in pytest_asyncio_tests: + async_test.add_marker(session_scope_marker, append=False) + + # We skip tests that use both the aiohttp client and respx_mock as respx_mock + # doesn't support custom transports. + for item in items: + if "async_client" not in item.fixturenames or "respx_mock" not in item.fixturenames: + continue + + if not hasattr(item, "callspec"): + continue + + async_client_param = item.callspec.params.get("async_client") + if is_dict(async_client_param) and async_client_param.get("http_client") == "aiohttp": + item.add_marker(pytest.mark.skip(reason="aiohttp client is not compatible with respx_mock")) + + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + +api_key = "My API Key" + + +@pytest.fixture(scope="session") +def client(request: FixtureRequest) -> Iterator[Lmnt]: + strict = getattr(request, "param", True) + if not isinstance(strict, bool): + raise TypeError(f"Unexpected fixture parameter type {type(strict)}, expected {bool}") + + with Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=strict) as client: + yield client + + +@pytest.fixture(scope="session") +async def async_client(request: FixtureRequest) -> AsyncIterator[AsyncLmnt]: + param = getattr(request, "param", True) + + # defaults + strict = True + http_client: None | httpx.AsyncClient = None + + if isinstance(param, bool): + strict = param + elif is_dict(param): + strict = param.get("strict", True) + assert isinstance(strict, bool) + + http_client_type = param.get("http_client", "httpx") + if http_client_type == "aiohttp": + http_client = DefaultAioHttpClient() + else: + raise TypeError(f"Unexpected fixture parameter type {type(param)}, expected bool or dict") + + async with AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=strict, http_client=http_client + ) as client: + yield client diff --git a/tests/sample_file.txt b/tests/sample_file.txt new file mode 100644 index 0000000..af5626b --- /dev/null +++ b/tests/sample_file.txt @@ -0,0 +1 @@ +Hello, world! diff --git a/tests/test_client.py b/tests/test_client.py new file mode 100644 index 0000000..de66e57 --- /dev/null +++ b/tests/test_client.py @@ -0,0 +1,1688 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import gc +import os +import sys +import json +import time +import asyncio +import inspect +import subprocess +import tracemalloc +from typing import Any, Union, cast +from textwrap import dedent +from unittest import mock +from typing_extensions import Literal + +import httpx +import pytest +from respx import MockRouter +from pydantic import ValidationError + +from lmnt import Lmnt, AsyncLmnt, APIResponseValidationError +from lmnt._types import Omit +from lmnt._models import BaseModel, FinalRequestOptions +from lmnt._exceptions import APIStatusError, APITimeoutError, APIResponseValidationError +from lmnt._base_client import ( + DEFAULT_TIMEOUT, + HTTPX_DEFAULT_TIMEOUT, + BaseClient, + DefaultHttpxClient, + DefaultAsyncHttpxClient, + make_request_options, +) + +from .utils import update_env + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") +api_key = "My API Key" + + +def _get_params(client: BaseClient[Any, Any]) -> dict[str, str]: + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + return dict(url.params) + + +def _low_retry_timeout(*_args: Any, **_kwargs: Any) -> float: + return 0.1 + + +def _get_open_connections(client: Lmnt | AsyncLmnt) -> int: + transport = client._client._transport + assert isinstance(transport, httpx.HTTPTransport) or isinstance(transport, httpx.AsyncHTTPTransport) + + pool = transport._pool + return len(pool._requests) + + +class TestLmnt: + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + @pytest.mark.respx(base_url=base_url) + def test_raw_response(self, respx_mock: MockRouter) -> None: + respx_mock.post("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = self.client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + @pytest.mark.respx(base_url=base_url) + def test_raw_response_for_binary(self, respx_mock: MockRouter) -> None: + respx_mock.post("/foo").mock( + return_value=httpx.Response(200, headers={"Content-Type": "application/binary"}, content='{"foo": "bar"}') + ) + + response = self.client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + def test_copy(self) -> None: + copied = self.client.copy() + assert id(copied) != id(self.client) + + copied = self.client.copy(api_key="another My API Key") + assert copied.api_key == "another My API Key" + assert self.client.api_key == "My API Key" + + def test_copy_default_options(self) -> None: + # options that have a default are overridden correctly + copied = self.client.copy(max_retries=7) + assert copied.max_retries == 7 + assert self.client.max_retries == 2 + + copied2 = copied.copy(max_retries=6) + assert copied2.max_retries == 6 + assert copied.max_retries == 7 + + # timeout + assert isinstance(self.client.timeout, httpx.Timeout) + copied = self.client.copy(timeout=None) + assert copied.timeout is None + assert isinstance(self.client.timeout, httpx.Timeout) + + def test_copy_default_headers(self) -> None: + client = Lmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + assert client.default_headers["X-Foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert copied.default_headers["X-Foo"] == "bar" + + # merges already given headers + copied = client.copy(default_headers={"X-Bar": "stainless"}) + assert copied.default_headers["X-Foo"] == "bar" + assert copied.default_headers["X-Bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_headers={"X-Foo": "stainless"}) + assert copied.default_headers["X-Foo"] == "stainless" + + # set_default_headers + + # completely overrides already set values + copied = client.copy(set_default_headers={}) + assert copied.default_headers.get("X-Foo") is None + + copied = client.copy(set_default_headers={"X-Bar": "Robert"}) + assert copied.default_headers["X-Bar"] == "Robert" + + with pytest.raises( + ValueError, + match="`default_headers` and `set_default_headers` arguments are mutually exclusive", + ): + client.copy(set_default_headers={}, default_headers={"X-Foo": "Bar"}) + + def test_copy_default_query(self) -> None: + client = Lmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"foo": "bar"} + ) + assert _get_params(client)["foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert _get_params(copied)["foo"] == "bar" + + # merges already given params + copied = client.copy(default_query={"bar": "stainless"}) + params = _get_params(copied) + assert params["foo"] == "bar" + assert params["bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_query={"foo": "stainless"}) + assert _get_params(copied)["foo"] == "stainless" + + # set_default_query + + # completely overrides already set values + copied = client.copy(set_default_query={}) + assert _get_params(copied) == {} + + copied = client.copy(set_default_query={"bar": "Robert"}) + assert _get_params(copied)["bar"] == "Robert" + + with pytest.raises( + ValueError, + # TODO: update + match="`default_query` and `set_default_query` arguments are mutually exclusive", + ): + client.copy(set_default_query={}, default_query={"foo": "Bar"}) + + def test_copy_signature(self) -> None: + # ensure the same parameters that can be passed to the client are defined in the `.copy()` method + init_signature = inspect.signature( + # mypy doesn't like that we access the `__init__` property. + self.client.__init__, # type: ignore[misc] + ) + copy_signature = inspect.signature(self.client.copy) + exclude_params = {"transport", "proxies", "_strict_response_validation"} + + for name in init_signature.parameters.keys(): + if name in exclude_params: + continue + + copy_param = copy_signature.parameters.get(name) + assert copy_param is not None, f"copy() signature is missing the {name} param" + + @pytest.mark.skipif(sys.version_info >= (3, 10), reason="fails because of a memory leak that started from 3.12") + def test_copy_build_request(self) -> None: + options = FinalRequestOptions(method="get", url="/foo") + + def build_request(options: FinalRequestOptions) -> None: + client = self.client.copy() + client._build_request(options) + + # ensure that the machinery is warmed up before tracing starts. + build_request(options) + gc.collect() + + tracemalloc.start(1000) + + snapshot_before = tracemalloc.take_snapshot() + + ITERATIONS = 10 + for _ in range(ITERATIONS): + build_request(options) + + gc.collect() + snapshot_after = tracemalloc.take_snapshot() + + tracemalloc.stop() + + def add_leak(leaks: list[tracemalloc.StatisticDiff], diff: tracemalloc.StatisticDiff) -> None: + if diff.count == 0: + # Avoid false positives by considering only leaks (i.e. allocations that persist). + return + + if diff.count % ITERATIONS != 0: + # Avoid false positives by considering only leaks that appear per iteration. + return + + for frame in diff.traceback: + if any( + frame.filename.endswith(fragment) + for fragment in [ + # to_raw_response_wrapper leaks through the @functools.wraps() decorator. + # + # removing the decorator fixes the leak for reasons we don't understand. + "lmnt/_legacy_response.py", + "lmnt/_response.py", + # pydantic.BaseModel.model_dump || pydantic.BaseModel.dict leak memory for some reason. + "lmnt/_compat.py", + # Standard library leaks we don't care about. + "/logging/__init__.py", + ] + ): + return + + leaks.append(diff) + + leaks: list[tracemalloc.StatisticDiff] = [] + for diff in snapshot_after.compare_to(snapshot_before, "traceback"): + add_leak(leaks, diff) + if leaks: + for leak in leaks: + print("MEMORY LEAK:", leak) + for frame in leak.traceback: + print(frame) + raise AssertionError() + + def test_request_timeout(self) -> None: + request = self.client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + request = self.client._build_request( + FinalRequestOptions(method="get", url="/foo", timeout=httpx.Timeout(100.0)) + ) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(100.0) + + def test_client_timeout_option(self) -> None: + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True, timeout=httpx.Timeout(0)) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(0) + + def test_http_client_timeout_option(self) -> None: + # custom timeout given to the httpx client should be used + with httpx.Client(timeout=None) as http_client: + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(None) + + # no timeout given to the httpx client should not use the httpx default + with httpx.Client() as http_client: + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + # explicitly passing the default timeout currently results in it being ignored + with httpx.Client(timeout=HTTPX_DEFAULT_TIMEOUT) as http_client: + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT # our default + + async def test_invalid_http_client(self) -> None: + with pytest.raises(TypeError, match="Invalid `http_client` arg"): + async with httpx.AsyncClient() as http_client: + Lmnt( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=cast(Any, http_client), + ) + + def test_default_headers_option(self) -> None: + client = Lmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "bar" + assert request.headers.get("x-stainless-lang") == "python" + + client2 = Lmnt( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + default_headers={ + "X-Foo": "stainless", + "X-Stainless-Lang": "my-overriding-header", + }, + ) + request = client2._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "stainless" + assert request.headers.get("x-stainless-lang") == "my-overriding-header" + + def test_default_query_option(self) -> None: + client = Lmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"query_param": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + assert dict(url.params) == {"query_param": "bar"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo", + params={"foo": "baz", "query_param": "overridden"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"foo": "baz", "query_param": "overridden"} + + def test_request_extra_json(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": False} + + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"baz": False} + + # `extra_json` takes priority over `json_data` when keys clash + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar", "baz": True}, + extra_json={"baz": None}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": None} + + def test_request_extra_headers(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options(extra_headers={"X-Foo": "Foo"}), + ), + ) + assert request.headers.get("X-Foo") == "Foo" + + # `extra_headers` takes priority over `default_headers` when keys clash + request = self.client.with_options(default_headers={"X-Bar": "true"})._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_headers={"X-Bar": "false"}, + ), + ), + ) + assert request.headers.get("X-Bar") == "false" + + def test_request_extra_query(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_query={"my_query_param": "Foo"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"my_query_param": "Foo"} + + # if both `query` and `extra_query` are given, they are merged + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"bar": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"bar": "1", "foo": "2"} + + # `extra_query` takes priority over `query` when keys clash + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"foo": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"foo": "2"} + + def test_multipart_repeating_array(self, client: Lmnt) -> None: + request = client._build_request( + FinalRequestOptions.construct( + method="post", + url="/foo", + headers={"Content-Type": "multipart/form-data; boundary=6b7ba517decee4a450543ea6ae821c82"}, + json_data={"array": ["foo", "bar"]}, + files=[("foo.txt", b"hello world")], + ) + ) + + assert request.read().split(b"\r\n") == [ + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"foo", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"bar", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="foo.txt"; filename="upload"', + b"Content-Type: application/octet-stream", + b"", + b"hello world", + b"--6b7ba517decee4a450543ea6ae821c82--", + b"", + ] + + @pytest.mark.respx(base_url=base_url) + def test_basic_union_response(self, respx_mock: MockRouter) -> None: + class Model1(BaseModel): + name: str + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + @pytest.mark.respx(base_url=base_url) + def test_union_response_different_types(self, respx_mock: MockRouter) -> None: + """Union of objects with the same field name using a different type""" + + class Model1(BaseModel): + foo: int + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": 1})) + + response = self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model1) + assert response.foo == 1 + + @pytest.mark.respx(base_url=base_url) + def test_non_application_json_content_type_for_json_data(self, respx_mock: MockRouter) -> None: + """ + Response that sets Content-Type to something other than application/json but returns json data + """ + + class Model(BaseModel): + foo: int + + respx_mock.get("/foo").mock( + return_value=httpx.Response( + 200, + content=json.dumps({"foo": 2}), + headers={"Content-Type": "application/text"}, + ) + ) + + response = self.client.get("/foo", cast_to=Model) + assert isinstance(response, Model) + assert response.foo == 2 + + def test_base_url_setter(self) -> None: + client = Lmnt(base_url="https://example.com/from_init", api_key=api_key, _strict_response_validation=True) + assert client.base_url == "https://example.com/from_init/" + + client.base_url = "https://example.com/from_setter" # type: ignore[assignment] + + assert client.base_url == "https://example.com/from_setter/" + + def test_base_url_env(self) -> None: + with update_env(LMNT_BASE_URL="http://localhost:5000/from/env"): + client = Lmnt(api_key=api_key, _strict_response_validation=True) + assert client.base_url == "http://localhost:5000/from/env/" + + @pytest.mark.parametrize( + "client", + [ + Lmnt(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + Lmnt( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_trailing_slash(self, client: Lmnt) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + + @pytest.mark.parametrize( + "client", + [ + Lmnt(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + Lmnt( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_no_trailing_slash(self, client: Lmnt) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + + @pytest.mark.parametrize( + "client", + [ + Lmnt(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + Lmnt( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_absolute_request_url(self, client: Lmnt) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="https://myapi.com/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "https://myapi.com/foo" + + def test_copied_client_does_not_close_http(self) -> None: + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + assert not client.is_closed() + + copied = client.copy() + assert copied is not client + + del copied + + assert not client.is_closed() + + def test_client_context_manager(self) -> None: + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + with client as c2: + assert c2 is client + assert not c2.is_closed() + assert not client.is_closed() + assert client.is_closed() + + @pytest.mark.respx(base_url=base_url) + def test_client_response_validation_error(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": {"invalid": True}})) + + with pytest.raises(APIResponseValidationError) as exc: + self.client.get("/foo", cast_to=Model) + + assert isinstance(exc.value.__cause__, ValidationError) + + def test_client_max_retries_validation(self) -> None: + with pytest.raises(TypeError, match=r"max_retries cannot be None"): + Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True, max_retries=cast(Any, None)) + + @pytest.mark.respx(base_url=base_url) + def test_received_text_for_expected_json(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + name: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, text="my-custom-format")) + + strict_client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + with pytest.raises(APIResponseValidationError): + strict_client.get("/foo", cast_to=Model) + + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=False) + + response = client.get("/foo", cast_to=Model) + assert isinstance(response, str) # type: ignore[unreachable] + + @pytest.mark.parametrize( + "remaining_retries,retry_after,timeout", + [ + [3, "20", 20], + [3, "0", 0.5], + [3, "-10", 0.5], + [3, "60", 60], + [3, "61", 0.5], + [3, "Fri, 29 Sep 2023 16:26:57 GMT", 20], + [3, "Fri, 29 Sep 2023 16:26:37 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:27:37 GMT", 60], + [3, "Fri, 29 Sep 2023 16:27:38 GMT", 0.5], + [3, "99999999999999999999999999999999999", 0.5], + [3, "Zun, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "", 0.5], + [2, "", 0.5 * 2.0], + [1, "", 0.5 * 4.0], + [-1100, "", 8], # test large number potentially overflowing + ], + ) + @mock.patch("time.time", mock.MagicMock(return_value=1696004797)) + def test_parse_retry_after_header(self, remaining_retries: int, retry_after: str, timeout: float) -> None: + client = Lmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + headers = httpx.Headers({"retry-after": retry_after}) + options = FinalRequestOptions(method="get", url="/foo", max_retries=3) + calculated = client._calculate_retry_timeout(remaining_retries, options, headers) + assert calculated == pytest.approx(timeout, 0.5 * 0.875) # pyright: ignore[reportUnknownMemberType] + + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_retrying_timeout_errors_doesnt_leak(self, respx_mock: MockRouter, client: Lmnt) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(side_effect=httpx.TimeoutException("Test timeout error")) + + with pytest.raises(APITimeoutError): + client.speech.with_streaming_response.generate(text="hello world.", voice="ava").__enter__() + + assert _get_open_connections(self.client) == 0 + + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_retrying_status_errors_doesnt_leak(self, respx_mock: MockRouter, client: Lmnt) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(500)) + + with pytest.raises(APIStatusError): + client.speech.with_streaming_response.generate(text="hello world.", voice="ava").__enter__() + assert _get_open_connections(self.client) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.parametrize("failure_mode", ["status", "exception"]) + def test_retries_taken( + self, + client: Lmnt, + failures_before_success: int, + failure_mode: Literal["status", "exception"], + respx_mock: MockRouter, + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + if failure_mode == "exception": + raise RuntimeError("oops") + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/ai/speech/bytes").mock(side_effect=retry_handler) + + response = client.speech.with_raw_response.generate(text="hello world.", voice="ava") + + assert response.retries_taken == failures_before_success + assert int(response.http_request.headers.get("x-stainless-retry-count")) == failures_before_success + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_omit_retry_count_header(self, client: Lmnt, failures_before_success: int, respx_mock: MockRouter) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/ai/speech/bytes").mock(side_effect=retry_handler) + + response = client.speech.with_raw_response.generate( + text="hello world.", voice="ava", extra_headers={"x-stainless-retry-count": Omit()} + ) + + assert len(response.http_request.headers.get_list("x-stainless-retry-count")) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_overwrite_retry_count_header( + self, client: Lmnt, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/ai/speech/bytes").mock(side_effect=retry_handler) + + response = client.speech.with_raw_response.generate( + text="hello world.", voice="ava", extra_headers={"x-stainless-retry-count": "42"} + ) + + assert response.http_request.headers.get("x-stainless-retry-count") == "42" + + def test_proxy_environment_variables(self, monkeypatch: pytest.MonkeyPatch) -> None: + # Test that the proxy environment variables are set correctly + monkeypatch.setenv("HTTPS_PROXY", "https://example.org") + + client = DefaultHttpxClient() + + mounts = tuple(client._mounts.items()) + assert len(mounts) == 1 + assert mounts[0][0].pattern == "https://" + + @pytest.mark.filterwarnings("ignore:.*deprecated.*:DeprecationWarning") + def test_default_client_creation(self) -> None: + # Ensure that the client can be initialized without any exceptions + DefaultHttpxClient( + verify=True, + cert=None, + trust_env=True, + http1=True, + http2=False, + limits=httpx.Limits(max_connections=100, max_keepalive_connections=20), + ) + + @pytest.mark.respx(base_url=base_url) + def test_follow_redirects(self, respx_mock: MockRouter) -> None: + # Test that the default follow_redirects=True allows following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + respx_mock.get("/redirected").mock(return_value=httpx.Response(200, json={"status": "ok"})) + + response = self.client.post("/redirect", body={"key": "value"}, cast_to=httpx.Response) + assert response.status_code == 200 + assert response.json() == {"status": "ok"} + + @pytest.mark.respx(base_url=base_url) + def test_follow_redirects_disabled(self, respx_mock: MockRouter) -> None: + # Test that follow_redirects=False prevents following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + + with pytest.raises(APIStatusError) as exc_info: + self.client.post( + "/redirect", body={"key": "value"}, options={"follow_redirects": False}, cast_to=httpx.Response + ) + + assert exc_info.value.response.status_code == 302 + assert exc_info.value.response.headers["Location"] == f"{base_url}/redirected" + + +class TestAsyncLmnt: + client = AsyncLmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_raw_response(self, respx_mock: MockRouter) -> None: + respx_mock.post("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await self.client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_raw_response_for_binary(self, respx_mock: MockRouter) -> None: + respx_mock.post("/foo").mock( + return_value=httpx.Response(200, headers={"Content-Type": "application/binary"}, content='{"foo": "bar"}') + ) + + response = await self.client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + def test_copy(self) -> None: + copied = self.client.copy() + assert id(copied) != id(self.client) + + copied = self.client.copy(api_key="another My API Key") + assert copied.api_key == "another My API Key" + assert self.client.api_key == "My API Key" + + def test_copy_default_options(self) -> None: + # options that have a default are overridden correctly + copied = self.client.copy(max_retries=7) + assert copied.max_retries == 7 + assert self.client.max_retries == 2 + + copied2 = copied.copy(max_retries=6) + assert copied2.max_retries == 6 + assert copied.max_retries == 7 + + # timeout + assert isinstance(self.client.timeout, httpx.Timeout) + copied = self.client.copy(timeout=None) + assert copied.timeout is None + assert isinstance(self.client.timeout, httpx.Timeout) + + def test_copy_default_headers(self) -> None: + client = AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + assert client.default_headers["X-Foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert copied.default_headers["X-Foo"] == "bar" + + # merges already given headers + copied = client.copy(default_headers={"X-Bar": "stainless"}) + assert copied.default_headers["X-Foo"] == "bar" + assert copied.default_headers["X-Bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_headers={"X-Foo": "stainless"}) + assert copied.default_headers["X-Foo"] == "stainless" + + # set_default_headers + + # completely overrides already set values + copied = client.copy(set_default_headers={}) + assert copied.default_headers.get("X-Foo") is None + + copied = client.copy(set_default_headers={"X-Bar": "Robert"}) + assert copied.default_headers["X-Bar"] == "Robert" + + with pytest.raises( + ValueError, + match="`default_headers` and `set_default_headers` arguments are mutually exclusive", + ): + client.copy(set_default_headers={}, default_headers={"X-Foo": "Bar"}) + + def test_copy_default_query(self) -> None: + client = AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"foo": "bar"} + ) + assert _get_params(client)["foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert _get_params(copied)["foo"] == "bar" + + # merges already given params + copied = client.copy(default_query={"bar": "stainless"}) + params = _get_params(copied) + assert params["foo"] == "bar" + assert params["bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_query={"foo": "stainless"}) + assert _get_params(copied)["foo"] == "stainless" + + # set_default_query + + # completely overrides already set values + copied = client.copy(set_default_query={}) + assert _get_params(copied) == {} + + copied = client.copy(set_default_query={"bar": "Robert"}) + assert _get_params(copied)["bar"] == "Robert" + + with pytest.raises( + ValueError, + # TODO: update + match="`default_query` and `set_default_query` arguments are mutually exclusive", + ): + client.copy(set_default_query={}, default_query={"foo": "Bar"}) + + def test_copy_signature(self) -> None: + # ensure the same parameters that can be passed to the client are defined in the `.copy()` method + init_signature = inspect.signature( + # mypy doesn't like that we access the `__init__` property. + self.client.__init__, # type: ignore[misc] + ) + copy_signature = inspect.signature(self.client.copy) + exclude_params = {"transport", "proxies", "_strict_response_validation"} + + for name in init_signature.parameters.keys(): + if name in exclude_params: + continue + + copy_param = copy_signature.parameters.get(name) + assert copy_param is not None, f"copy() signature is missing the {name} param" + + @pytest.mark.skipif(sys.version_info >= (3, 10), reason="fails because of a memory leak that started from 3.12") + def test_copy_build_request(self) -> None: + options = FinalRequestOptions(method="get", url="/foo") + + def build_request(options: FinalRequestOptions) -> None: + client = self.client.copy() + client._build_request(options) + + # ensure that the machinery is warmed up before tracing starts. + build_request(options) + gc.collect() + + tracemalloc.start(1000) + + snapshot_before = tracemalloc.take_snapshot() + + ITERATIONS = 10 + for _ in range(ITERATIONS): + build_request(options) + + gc.collect() + snapshot_after = tracemalloc.take_snapshot() + + tracemalloc.stop() + + def add_leak(leaks: list[tracemalloc.StatisticDiff], diff: tracemalloc.StatisticDiff) -> None: + if diff.count == 0: + # Avoid false positives by considering only leaks (i.e. allocations that persist). + return + + if diff.count % ITERATIONS != 0: + # Avoid false positives by considering only leaks that appear per iteration. + return + + for frame in diff.traceback: + if any( + frame.filename.endswith(fragment) + for fragment in [ + # to_raw_response_wrapper leaks through the @functools.wraps() decorator. + # + # removing the decorator fixes the leak for reasons we don't understand. + "lmnt/_legacy_response.py", + "lmnt/_response.py", + # pydantic.BaseModel.model_dump || pydantic.BaseModel.dict leak memory for some reason. + "lmnt/_compat.py", + # Standard library leaks we don't care about. + "/logging/__init__.py", + ] + ): + return + + leaks.append(diff) + + leaks: list[tracemalloc.StatisticDiff] = [] + for diff in snapshot_after.compare_to(snapshot_before, "traceback"): + add_leak(leaks, diff) + if leaks: + for leak in leaks: + print("MEMORY LEAK:", leak) + for frame in leak.traceback: + print(frame) + raise AssertionError() + + async def test_request_timeout(self) -> None: + request = self.client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + request = self.client._build_request( + FinalRequestOptions(method="get", url="/foo", timeout=httpx.Timeout(100.0)) + ) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(100.0) + + async def test_client_timeout_option(self) -> None: + client = AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, timeout=httpx.Timeout(0) + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(0) + + async def test_http_client_timeout_option(self) -> None: + # custom timeout given to the httpx client should be used + async with httpx.AsyncClient(timeout=None) as http_client: + client = AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(None) + + # no timeout given to the httpx client should not use the httpx default + async with httpx.AsyncClient() as http_client: + client = AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + # explicitly passing the default timeout currently results in it being ignored + async with httpx.AsyncClient(timeout=HTTPX_DEFAULT_TIMEOUT) as http_client: + client = AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT # our default + + def test_invalid_http_client(self) -> None: + with pytest.raises(TypeError, match="Invalid `http_client` arg"): + with httpx.Client() as http_client: + AsyncLmnt( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=cast(Any, http_client), + ) + + def test_default_headers_option(self) -> None: + client = AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "bar" + assert request.headers.get("x-stainless-lang") == "python" + + client2 = AsyncLmnt( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + default_headers={ + "X-Foo": "stainless", + "X-Stainless-Lang": "my-overriding-header", + }, + ) + request = client2._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "stainless" + assert request.headers.get("x-stainless-lang") == "my-overriding-header" + + def test_default_query_option(self) -> None: + client = AsyncLmnt( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"query_param": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + assert dict(url.params) == {"query_param": "bar"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo", + params={"foo": "baz", "query_param": "overridden"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"foo": "baz", "query_param": "overridden"} + + def test_request_extra_json(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": False} + + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"baz": False} + + # `extra_json` takes priority over `json_data` when keys clash + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar", "baz": True}, + extra_json={"baz": None}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": None} + + def test_request_extra_headers(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options(extra_headers={"X-Foo": "Foo"}), + ), + ) + assert request.headers.get("X-Foo") == "Foo" + + # `extra_headers` takes priority over `default_headers` when keys clash + request = self.client.with_options(default_headers={"X-Bar": "true"})._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_headers={"X-Bar": "false"}, + ), + ), + ) + assert request.headers.get("X-Bar") == "false" + + def test_request_extra_query(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_query={"my_query_param": "Foo"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"my_query_param": "Foo"} + + # if both `query` and `extra_query` are given, they are merged + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"bar": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"bar": "1", "foo": "2"} + + # `extra_query` takes priority over `query` when keys clash + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"foo": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"foo": "2"} + + def test_multipart_repeating_array(self, async_client: AsyncLmnt) -> None: + request = async_client._build_request( + FinalRequestOptions.construct( + method="post", + url="/foo", + headers={"Content-Type": "multipart/form-data; boundary=6b7ba517decee4a450543ea6ae821c82"}, + json_data={"array": ["foo", "bar"]}, + files=[("foo.txt", b"hello world")], + ) + ) + + assert request.read().split(b"\r\n") == [ + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"foo", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"bar", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="foo.txt"; filename="upload"', + b"Content-Type: application/octet-stream", + b"", + b"hello world", + b"--6b7ba517decee4a450543ea6ae821c82--", + b"", + ] + + @pytest.mark.respx(base_url=base_url) + async def test_basic_union_response(self, respx_mock: MockRouter) -> None: + class Model1(BaseModel): + name: str + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + @pytest.mark.respx(base_url=base_url) + async def test_union_response_different_types(self, respx_mock: MockRouter) -> None: + """Union of objects with the same field name using a different type""" + + class Model1(BaseModel): + foo: int + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": 1})) + + response = await self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model1) + assert response.foo == 1 + + @pytest.mark.respx(base_url=base_url) + async def test_non_application_json_content_type_for_json_data(self, respx_mock: MockRouter) -> None: + """ + Response that sets Content-Type to something other than application/json but returns json data + """ + + class Model(BaseModel): + foo: int + + respx_mock.get("/foo").mock( + return_value=httpx.Response( + 200, + content=json.dumps({"foo": 2}), + headers={"Content-Type": "application/text"}, + ) + ) + + response = await self.client.get("/foo", cast_to=Model) + assert isinstance(response, Model) + assert response.foo == 2 + + def test_base_url_setter(self) -> None: + client = AsyncLmnt(base_url="https://example.com/from_init", api_key=api_key, _strict_response_validation=True) + assert client.base_url == "https://example.com/from_init/" + + client.base_url = "https://example.com/from_setter" # type: ignore[assignment] + + assert client.base_url == "https://example.com/from_setter/" + + def test_base_url_env(self) -> None: + with update_env(LMNT_BASE_URL="http://localhost:5000/from/env"): + client = AsyncLmnt(api_key=api_key, _strict_response_validation=True) + assert client.base_url == "http://localhost:5000/from/env/" + + @pytest.mark.parametrize( + "client", + [ + AsyncLmnt(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + AsyncLmnt( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_trailing_slash(self, client: AsyncLmnt) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + + @pytest.mark.parametrize( + "client", + [ + AsyncLmnt(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + AsyncLmnt( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_no_trailing_slash(self, client: AsyncLmnt) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + + @pytest.mark.parametrize( + "client", + [ + AsyncLmnt(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + AsyncLmnt( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_absolute_request_url(self, client: AsyncLmnt) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="https://myapi.com/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "https://myapi.com/foo" + + async def test_copied_client_does_not_close_http(self) -> None: + client = AsyncLmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + assert not client.is_closed() + + copied = client.copy() + assert copied is not client + + del copied + + await asyncio.sleep(0.2) + assert not client.is_closed() + + async def test_client_context_manager(self) -> None: + client = AsyncLmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + async with client as c2: + assert c2 is client + assert not c2.is_closed() + assert not client.is_closed() + assert client.is_closed() + + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_client_response_validation_error(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": {"invalid": True}})) + + with pytest.raises(APIResponseValidationError) as exc: + await self.client.get("/foo", cast_to=Model) + + assert isinstance(exc.value.__cause__, ValidationError) + + async def test_client_max_retries_validation(self) -> None: + with pytest.raises(TypeError, match=r"max_retries cannot be None"): + AsyncLmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True, max_retries=cast(Any, None)) + + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_received_text_for_expected_json(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + name: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, text="my-custom-format")) + + strict_client = AsyncLmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + with pytest.raises(APIResponseValidationError): + await strict_client.get("/foo", cast_to=Model) + + client = AsyncLmnt(base_url=base_url, api_key=api_key, _strict_response_validation=False) + + response = await client.get("/foo", cast_to=Model) + assert isinstance(response, str) # type: ignore[unreachable] + + @pytest.mark.parametrize( + "remaining_retries,retry_after,timeout", + [ + [3, "20", 20], + [3, "0", 0.5], + [3, "-10", 0.5], + [3, "60", 60], + [3, "61", 0.5], + [3, "Fri, 29 Sep 2023 16:26:57 GMT", 20], + [3, "Fri, 29 Sep 2023 16:26:37 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:27:37 GMT", 60], + [3, "Fri, 29 Sep 2023 16:27:38 GMT", 0.5], + [3, "99999999999999999999999999999999999", 0.5], + [3, "Zun, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "", 0.5], + [2, "", 0.5 * 2.0], + [1, "", 0.5 * 4.0], + [-1100, "", 8], # test large number potentially overflowing + ], + ) + @mock.patch("time.time", mock.MagicMock(return_value=1696004797)) + @pytest.mark.asyncio + async def test_parse_retry_after_header(self, remaining_retries: int, retry_after: str, timeout: float) -> None: + client = AsyncLmnt(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + headers = httpx.Headers({"retry-after": retry_after}) + options = FinalRequestOptions(method="get", url="/foo", max_retries=3) + calculated = client._calculate_retry_timeout(remaining_retries, options, headers) + assert calculated == pytest.approx(timeout, 0.5 * 0.875) # pyright: ignore[reportUnknownMemberType] + + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_retrying_timeout_errors_doesnt_leak(self, respx_mock: MockRouter, async_client: AsyncLmnt) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(side_effect=httpx.TimeoutException("Test timeout error")) + + with pytest.raises(APITimeoutError): + await async_client.speech.with_streaming_response.generate(text="hello world.", voice="ava").__aenter__() + + assert _get_open_connections(self.client) == 0 + + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_retrying_status_errors_doesnt_leak(self, respx_mock: MockRouter, async_client: AsyncLmnt) -> None: + respx_mock.post("/v1/ai/speech/bytes").mock(return_value=httpx.Response(500)) + + with pytest.raises(APIStatusError): + await async_client.speech.with_streaming_response.generate(text="hello world.", voice="ava").__aenter__() + assert _get_open_connections(self.client) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + @pytest.mark.parametrize("failure_mode", ["status", "exception"]) + async def test_retries_taken( + self, + async_client: AsyncLmnt, + failures_before_success: int, + failure_mode: Literal["status", "exception"], + respx_mock: MockRouter, + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + if failure_mode == "exception": + raise RuntimeError("oops") + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/ai/speech/bytes").mock(side_effect=retry_handler) + + response = await client.speech.with_raw_response.generate(text="hello world.", voice="ava") + + assert response.retries_taken == failures_before_success + assert int(response.http_request.headers.get("x-stainless-retry-count")) == failures_before_success + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_omit_retry_count_header( + self, async_client: AsyncLmnt, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/ai/speech/bytes").mock(side_effect=retry_handler) + + response = await client.speech.with_raw_response.generate( + text="hello world.", voice="ava", extra_headers={"x-stainless-retry-count": Omit()} + ) + + assert len(response.http_request.headers.get_list("x-stainless-retry-count")) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("lmnt._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_overwrite_retry_count_header( + self, async_client: AsyncLmnt, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/ai/speech/bytes").mock(side_effect=retry_handler) + + response = await client.speech.with_raw_response.generate( + text="hello world.", voice="ava", extra_headers={"x-stainless-retry-count": "42"} + ) + + assert response.http_request.headers.get("x-stainless-retry-count") == "42" + + def test_get_platform(self) -> None: + # A previous implementation of asyncify could leave threads unterminated when + # used with nest_asyncio. + # + # Since nest_asyncio.apply() is global and cannot be un-applied, this + # test is run in a separate process to avoid affecting other tests. + test_code = dedent(""" + import asyncio + import nest_asyncio + import threading + + from lmnt._utils import asyncify + from lmnt._base_client import get_platform + + async def test_main() -> None: + result = await asyncify(get_platform)() + print(result) + for thread in threading.enumerate(): + print(thread.name) + + nest_asyncio.apply() + asyncio.run(test_main()) + """) + with subprocess.Popen( + [sys.executable, "-c", test_code], + text=True, + ) as process: + timeout = 10 # seconds + + start_time = time.monotonic() + while True: + return_code = process.poll() + if return_code is not None: + if return_code != 0: + raise AssertionError("calling get_platform using asyncify resulted in a non-zero exit code") + + # success + break + + if time.monotonic() - start_time > timeout: + process.kill() + raise AssertionError("calling get_platform using asyncify resulted in a hung process") + + time.sleep(0.1) + + async def test_proxy_environment_variables(self, monkeypatch: pytest.MonkeyPatch) -> None: + # Test that the proxy environment variables are set correctly + monkeypatch.setenv("HTTPS_PROXY", "https://example.org") + + client = DefaultAsyncHttpxClient() + + mounts = tuple(client._mounts.items()) + assert len(mounts) == 1 + assert mounts[0][0].pattern == "https://" + + @pytest.mark.filterwarnings("ignore:.*deprecated.*:DeprecationWarning") + async def test_default_client_creation(self) -> None: + # Ensure that the client can be initialized without any exceptions + DefaultAsyncHttpxClient( + verify=True, + cert=None, + trust_env=True, + http1=True, + http2=False, + limits=httpx.Limits(max_connections=100, max_keepalive_connections=20), + ) + + @pytest.mark.respx(base_url=base_url) + async def test_follow_redirects(self, respx_mock: MockRouter) -> None: + # Test that the default follow_redirects=True allows following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + respx_mock.get("/redirected").mock(return_value=httpx.Response(200, json={"status": "ok"})) + + response = await self.client.post("/redirect", body={"key": "value"}, cast_to=httpx.Response) + assert response.status_code == 200 + assert response.json() == {"status": "ok"} + + @pytest.mark.respx(base_url=base_url) + async def test_follow_redirects_disabled(self, respx_mock: MockRouter) -> None: + # Test that follow_redirects=False prevents following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + + with pytest.raises(APIStatusError) as exc_info: + await self.client.post( + "/redirect", body={"key": "value"}, options={"follow_redirects": False}, cast_to=httpx.Response + ) + + assert exc_info.value.response.status_code == 302 + assert exc_info.value.response.headers["Location"] == f"{base_url}/redirected" diff --git a/tests/test_deepcopy.py b/tests/test_deepcopy.py new file mode 100644 index 0000000..0e7298d --- /dev/null +++ b/tests/test_deepcopy.py @@ -0,0 +1,58 @@ +from lmnt._utils import deepcopy_minimal + + +def assert_different_identities(obj1: object, obj2: object) -> None: + assert obj1 == obj2 + assert id(obj1) != id(obj2) + + +def test_simple_dict() -> None: + obj1 = {"foo": "bar"} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + + +def test_nested_dict() -> None: + obj1 = {"foo": {"bar": True}} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1["foo"], obj2["foo"]) + + +def test_complex_nested_dict() -> None: + obj1 = {"foo": {"bar": [{"hello": "world"}]}} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1["foo"], obj2["foo"]) + assert_different_identities(obj1["foo"]["bar"], obj2["foo"]["bar"]) + assert_different_identities(obj1["foo"]["bar"][0], obj2["foo"]["bar"][0]) + + +def test_simple_list() -> None: + obj1 = ["a", "b", "c"] + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + + +def test_nested_list() -> None: + obj1 = ["a", [1, 2, 3]] + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1[1], obj2[1]) + + +class MyObject: ... + + +def test_ignores_other_types() -> None: + # custom classes + my_obj = MyObject() + obj1 = {"foo": my_obj} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert obj1["foo"] is my_obj + + # tuples + obj3 = ("a", "b") + obj4 = deepcopy_minimal(obj3) + assert obj3 is obj4 diff --git a/tests/test_extract_files.py b/tests/test_extract_files.py new file mode 100644 index 0000000..9da5509 --- /dev/null +++ b/tests/test_extract_files.py @@ -0,0 +1,64 @@ +from __future__ import annotations + +from typing import Sequence + +import pytest + +from lmnt._types import FileTypes +from lmnt._utils import extract_files + + +def test_removes_files_from_input() -> None: + query = {"foo": "bar"} + assert extract_files(query, paths=[]) == [] + assert query == {"foo": "bar"} + + query2 = {"foo": b"Bar", "hello": "world"} + assert extract_files(query2, paths=[["foo"]]) == [("foo", b"Bar")] + assert query2 == {"hello": "world"} + + query3 = {"foo": {"foo": {"bar": b"Bar"}}, "hello": "world"} + assert extract_files(query3, paths=[["foo", "foo", "bar"]]) == [("foo[foo][bar]", b"Bar")] + assert query3 == {"foo": {"foo": {}}, "hello": "world"} + + query4 = {"foo": {"bar": b"Bar", "baz": "foo"}, "hello": "world"} + assert extract_files(query4, paths=[["foo", "bar"]]) == [("foo[bar]", b"Bar")] + assert query4 == {"hello": "world", "foo": {"baz": "foo"}} + + +def test_multiple_files() -> None: + query = {"documents": [{"file": b"My first file"}, {"file": b"My second file"}]} + assert extract_files(query, paths=[["documents", "", "file"]]) == [ + ("documents[][file]", b"My first file"), + ("documents[][file]", b"My second file"), + ] + assert query == {"documents": [{}, {}]} + + +@pytest.mark.parametrize( + "query,paths,expected", + [ + [ + {"foo": {"bar": "baz"}}, + [["foo", "", "bar"]], + [], + ], + [ + {"foo": ["bar", "baz"]}, + [["foo", "bar"]], + [], + ], + [ + {"foo": {"bar": "baz"}}, + [["foo", "foo"]], + [], + ], + ], + ids=["dict expecting array", "array expecting dict", "unknown keys"], +) +def test_ignores_incorrect_paths( + query: dict[str, object], + paths: Sequence[Sequence[str]], + expected: list[tuple[str, FileTypes]], +) -> None: + assert extract_files(query, paths=paths) == expected diff --git a/tests/test_files.py b/tests/test_files.py new file mode 100644 index 0000000..419ad33 --- /dev/null +++ b/tests/test_files.py @@ -0,0 +1,51 @@ +from pathlib import Path + +import anyio +import pytest +from dirty_equals import IsDict, IsList, IsBytes, IsTuple + +from lmnt._files import to_httpx_files, async_to_httpx_files + +readme_path = Path(__file__).parent.parent.joinpath("README.md") + + +def test_pathlib_includes_file_name() -> None: + result = to_httpx_files({"file": readme_path}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +def test_tuple_input() -> None: + result = to_httpx_files([("file", readme_path)]) + print(result) + assert result == IsList(IsTuple("file", IsTuple("README.md", IsBytes()))) + + +@pytest.mark.asyncio +async def test_async_pathlib_includes_file_name() -> None: + result = await async_to_httpx_files({"file": readme_path}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +@pytest.mark.asyncio +async def test_async_supports_anyio_path() -> None: + result = await async_to_httpx_files({"file": anyio.Path(readme_path)}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +@pytest.mark.asyncio +async def test_async_tuple_input() -> None: + result = await async_to_httpx_files([("file", readme_path)]) + print(result) + assert result == IsList(IsTuple("file", IsTuple("README.md", IsBytes()))) + + +def test_string_not_allowed() -> None: + with pytest.raises(TypeError, match="Expected file types input to be a FileContent type or to be a tuple"): + to_httpx_files( + { + "file": "foo", # type: ignore + } + ) diff --git a/tests/test_models.py b/tests/test_models.py new file mode 100644 index 0000000..6c27337 --- /dev/null +++ b/tests/test_models.py @@ -0,0 +1,936 @@ +import json +from typing import Any, Dict, List, Union, Optional, cast +from datetime import datetime, timezone +from typing_extensions import Literal, Annotated, TypeAliasType + +import pytest +import pydantic +from pydantic import Field + +from lmnt._utils import PropertyInfo +from lmnt._compat import PYDANTIC_V2, parse_obj, model_dump, model_json +from lmnt._models import BaseModel, construct_type + + +class BasicModel(BaseModel): + foo: str + + +@pytest.mark.parametrize("value", ["hello", 1], ids=["correct type", "mismatched"]) +def test_basic(value: object) -> None: + m = BasicModel.construct(foo=value) + assert m.foo == value + + +def test_directly_nested_model() -> None: + class NestedModel(BaseModel): + nested: BasicModel + + m = NestedModel.construct(nested={"foo": "Foo!"}) + assert m.nested.foo == "Foo!" + + # mismatched types + m = NestedModel.construct(nested="hello!") + assert cast(Any, m.nested) == "hello!" + + +def test_optional_nested_model() -> None: + class NestedModel(BaseModel): + nested: Optional[BasicModel] + + m1 = NestedModel.construct(nested=None) + assert m1.nested is None + + m2 = NestedModel.construct(nested={"foo": "bar"}) + assert m2.nested is not None + assert m2.nested.foo == "bar" + + # mismatched types + m3 = NestedModel.construct(nested={"foo"}) + assert isinstance(cast(Any, m3.nested), set) + assert cast(Any, m3.nested) == {"foo"} + + +def test_list_nested_model() -> None: + class NestedModel(BaseModel): + nested: List[BasicModel] + + m = NestedModel.construct(nested=[{"foo": "bar"}, {"foo": "2"}]) + assert m.nested is not None + assert isinstance(m.nested, list) + assert len(m.nested) == 2 + assert m.nested[0].foo == "bar" + assert m.nested[1].foo == "2" + + # mismatched types + m = NestedModel.construct(nested=True) + assert cast(Any, m.nested) is True + + m = NestedModel.construct(nested=[False]) + assert cast(Any, m.nested) == [False] + + +def test_optional_list_nested_model() -> None: + class NestedModel(BaseModel): + nested: Optional[List[BasicModel]] + + m1 = NestedModel.construct(nested=[{"foo": "bar"}, {"foo": "2"}]) + assert m1.nested is not None + assert isinstance(m1.nested, list) + assert len(m1.nested) == 2 + assert m1.nested[0].foo == "bar" + assert m1.nested[1].foo == "2" + + m2 = NestedModel.construct(nested=None) + assert m2.nested is None + + # mismatched types + m3 = NestedModel.construct(nested={1}) + assert cast(Any, m3.nested) == {1} + + m4 = NestedModel.construct(nested=[False]) + assert cast(Any, m4.nested) == [False] + + +def test_list_optional_items_nested_model() -> None: + class NestedModel(BaseModel): + nested: List[Optional[BasicModel]] + + m = NestedModel.construct(nested=[None, {"foo": "bar"}]) + assert m.nested is not None + assert isinstance(m.nested, list) + assert len(m.nested) == 2 + assert m.nested[0] is None + assert m.nested[1] is not None + assert m.nested[1].foo == "bar" + + # mismatched types + m3 = NestedModel.construct(nested="foo") + assert cast(Any, m3.nested) == "foo" + + m4 = NestedModel.construct(nested=[False]) + assert cast(Any, m4.nested) == [False] + + +def test_list_mismatched_type() -> None: + class NestedModel(BaseModel): + nested: List[str] + + m = NestedModel.construct(nested=False) + assert cast(Any, m.nested) is False + + +def test_raw_dictionary() -> None: + class NestedModel(BaseModel): + nested: Dict[str, str] + + m = NestedModel.construct(nested={"hello": "world"}) + assert m.nested == {"hello": "world"} + + # mismatched types + m = NestedModel.construct(nested=False) + assert cast(Any, m.nested) is False + + +def test_nested_dictionary_model() -> None: + class NestedModel(BaseModel): + nested: Dict[str, BasicModel] + + m = NestedModel.construct(nested={"hello": {"foo": "bar"}}) + assert isinstance(m.nested, dict) + assert m.nested["hello"].foo == "bar" + + # mismatched types + m = NestedModel.construct(nested={"hello": False}) + assert cast(Any, m.nested["hello"]) is False + + +def test_unknown_fields() -> None: + m1 = BasicModel.construct(foo="foo", unknown=1) + assert m1.foo == "foo" + assert cast(Any, m1).unknown == 1 + + m2 = BasicModel.construct(foo="foo", unknown={"foo_bar": True}) + assert m2.foo == "foo" + assert cast(Any, m2).unknown == {"foo_bar": True} + + assert model_dump(m2) == {"foo": "foo", "unknown": {"foo_bar": True}} + + +def test_strict_validation_unknown_fields() -> None: + class Model(BaseModel): + foo: str + + model = parse_obj(Model, dict(foo="hello!", user="Robert")) + assert model.foo == "hello!" + assert cast(Any, model).user == "Robert" + + assert model_dump(model) == {"foo": "hello!", "user": "Robert"} + + +def test_aliases() -> None: + class Model(BaseModel): + my_field: int = Field(alias="myField") + + m = Model.construct(myField=1) + assert m.my_field == 1 + + # mismatched types + m = Model.construct(myField={"hello": False}) + assert cast(Any, m.my_field) == {"hello": False} + + +def test_repr() -> None: + model = BasicModel(foo="bar") + assert str(model) == "BasicModel(foo='bar')" + assert repr(model) == "BasicModel(foo='bar')" + + +def test_repr_nested_model() -> None: + class Child(BaseModel): + name: str + age: int + + class Parent(BaseModel): + name: str + child: Child + + model = Parent(name="Robert", child=Child(name="Foo", age=5)) + assert str(model) == "Parent(name='Robert', child=Child(name='Foo', age=5))" + assert repr(model) == "Parent(name='Robert', child=Child(name='Foo', age=5))" + + +def test_optional_list() -> None: + class Submodel(BaseModel): + name: str + + class Model(BaseModel): + items: Optional[List[Submodel]] + + m = Model.construct(items=None) + assert m.items is None + + m = Model.construct(items=[]) + assert m.items == [] + + m = Model.construct(items=[{"name": "Robert"}]) + assert m.items is not None + assert len(m.items) == 1 + assert m.items[0].name == "Robert" + + +def test_nested_union_of_models() -> None: + class Submodel1(BaseModel): + bar: bool + + class Submodel2(BaseModel): + thing: str + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2] + + m = Model.construct(foo={"thing": "hello"}) + assert isinstance(m.foo, Submodel2) + assert m.foo.thing == "hello" + + +def test_nested_union_of_mixed_types() -> None: + class Submodel1(BaseModel): + bar: bool + + class Model(BaseModel): + foo: Union[Submodel1, Literal[True], Literal["CARD_HOLDER"]] + + m = Model.construct(foo=True) + assert m.foo is True + + m = Model.construct(foo="CARD_HOLDER") + assert m.foo == "CARD_HOLDER" + + m = Model.construct(foo={"bar": False}) + assert isinstance(m.foo, Submodel1) + assert m.foo.bar is False + + +def test_nested_union_multiple_variants() -> None: + class Submodel1(BaseModel): + bar: bool + + class Submodel2(BaseModel): + thing: str + + class Submodel3(BaseModel): + foo: int + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2, None, Submodel3] + + m = Model.construct(foo={"thing": "hello"}) + assert isinstance(m.foo, Submodel2) + assert m.foo.thing == "hello" + + m = Model.construct(foo=None) + assert m.foo is None + + m = Model.construct() + assert m.foo is None + + m = Model.construct(foo={"foo": "1"}) + assert isinstance(m.foo, Submodel3) + assert m.foo.foo == 1 + + +def test_nested_union_invalid_data() -> None: + class Submodel1(BaseModel): + level: int + + class Submodel2(BaseModel): + name: str + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2] + + m = Model.construct(foo=True) + assert cast(bool, m.foo) is True + + m = Model.construct(foo={"name": 3}) + if PYDANTIC_V2: + assert isinstance(m.foo, Submodel1) + assert m.foo.name == 3 # type: ignore + else: + assert isinstance(m.foo, Submodel2) + assert m.foo.name == "3" + + +def test_list_of_unions() -> None: + class Submodel1(BaseModel): + level: int + + class Submodel2(BaseModel): + name: str + + class Model(BaseModel): + items: List[Union[Submodel1, Submodel2]] + + m = Model.construct(items=[{"level": 1}, {"name": "Robert"}]) + assert len(m.items) == 2 + assert isinstance(m.items[0], Submodel1) + assert m.items[0].level == 1 + assert isinstance(m.items[1], Submodel2) + assert m.items[1].name == "Robert" + + m = Model.construct(items=[{"level": -1}, 156]) + assert len(m.items) == 2 + assert isinstance(m.items[0], Submodel1) + assert m.items[0].level == -1 + assert cast(Any, m.items[1]) == 156 + + +def test_union_of_lists() -> None: + class SubModel1(BaseModel): + level: int + + class SubModel2(BaseModel): + name: str + + class Model(BaseModel): + items: Union[List[SubModel1], List[SubModel2]] + + # with one valid entry + m = Model.construct(items=[{"name": "Robert"}]) + assert len(m.items) == 1 + assert isinstance(m.items[0], SubModel2) + assert m.items[0].name == "Robert" + + # with two entries pointing to different types + m = Model.construct(items=[{"level": 1}, {"name": "Robert"}]) + assert len(m.items) == 2 + assert isinstance(m.items[0], SubModel1) + assert m.items[0].level == 1 + assert isinstance(m.items[1], SubModel1) + assert cast(Any, m.items[1]).name == "Robert" + + # with two entries pointing to *completely* different types + m = Model.construct(items=[{"level": -1}, 156]) + assert len(m.items) == 2 + assert isinstance(m.items[0], SubModel1) + assert m.items[0].level == -1 + assert cast(Any, m.items[1]) == 156 + + +def test_dict_of_union() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + foo: str + + class Model(BaseModel): + data: Dict[str, Union[SubModel1, SubModel2]] + + m = Model.construct(data={"hello": {"name": "there"}, "foo": {"foo": "bar"}}) + assert len(list(m.data.keys())) == 2 + assert isinstance(m.data["hello"], SubModel1) + assert m.data["hello"].name == "there" + assert isinstance(m.data["foo"], SubModel2) + assert m.data["foo"].foo == "bar" + + # TODO: test mismatched type + + +def test_double_nested_union() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + bar: str + + class Model(BaseModel): + data: Dict[str, List[Union[SubModel1, SubModel2]]] + + m = Model.construct(data={"foo": [{"bar": "baz"}, {"name": "Robert"}]}) + assert len(m.data["foo"]) == 2 + + entry1 = m.data["foo"][0] + assert isinstance(entry1, SubModel2) + assert entry1.bar == "baz" + + entry2 = m.data["foo"][1] + assert isinstance(entry2, SubModel1) + assert entry2.name == "Robert" + + # TODO: test mismatched type + + +def test_union_of_dict() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + foo: str + + class Model(BaseModel): + data: Union[Dict[str, SubModel1], Dict[str, SubModel2]] + + m = Model.construct(data={"hello": {"name": "there"}, "foo": {"foo": "bar"}}) + assert len(list(m.data.keys())) == 2 + assert isinstance(m.data["hello"], SubModel1) + assert m.data["hello"].name == "there" + assert isinstance(m.data["foo"], SubModel1) + assert cast(Any, m.data["foo"]).foo == "bar" + + +def test_iso8601_datetime() -> None: + class Model(BaseModel): + created_at: datetime + + expected = datetime(2019, 12, 27, 18, 11, 19, 117000, tzinfo=timezone.utc) + + if PYDANTIC_V2: + expected_json = '{"created_at":"2019-12-27T18:11:19.117000Z"}' + else: + expected_json = '{"created_at": "2019-12-27T18:11:19.117000+00:00"}' + + model = Model.construct(created_at="2019-12-27T18:11:19.117Z") + assert model.created_at == expected + assert model_json(model) == expected_json + + model = parse_obj(Model, dict(created_at="2019-12-27T18:11:19.117Z")) + assert model.created_at == expected + assert model_json(model) == expected_json + + +def test_does_not_coerce_int() -> None: + class Model(BaseModel): + bar: int + + assert Model.construct(bar=1).bar == 1 + assert Model.construct(bar=10.9).bar == 10.9 + assert Model.construct(bar="19").bar == "19" # type: ignore[comparison-overlap] + assert Model.construct(bar=False).bar is False + + +def test_int_to_float_safe_conversion() -> None: + class Model(BaseModel): + float_field: float + + m = Model.construct(float_field=10) + assert m.float_field == 10.0 + assert isinstance(m.float_field, float) + + m = Model.construct(float_field=10.12) + assert m.float_field == 10.12 + assert isinstance(m.float_field, float) + + # number too big + m = Model.construct(float_field=2**53 + 1) + assert m.float_field == 2**53 + 1 + assert isinstance(m.float_field, int) + + +def test_deprecated_alias() -> None: + class Model(BaseModel): + resource_id: str = Field(alias="model_id") + + @property + def model_id(self) -> str: + return self.resource_id + + m = Model.construct(model_id="id") + assert m.model_id == "id" + assert m.resource_id == "id" + assert m.resource_id is m.model_id + + m = parse_obj(Model, {"model_id": "id"}) + assert m.model_id == "id" + assert m.resource_id == "id" + assert m.resource_id is m.model_id + + +def test_omitted_fields() -> None: + class Model(BaseModel): + resource_id: Optional[str] = None + + m = Model.construct() + assert m.resource_id is None + assert "resource_id" not in m.model_fields_set + + m = Model.construct(resource_id=None) + assert m.resource_id is None + assert "resource_id" in m.model_fields_set + + m = Model.construct(resource_id="foo") + assert m.resource_id == "foo" + assert "resource_id" in m.model_fields_set + + +def test_to_dict() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert m.to_dict() == {"FOO": "hello"} + assert m.to_dict(use_api_names=False) == {"foo": "hello"} + + m2 = Model() + assert m2.to_dict() == {} + assert m2.to_dict(exclude_unset=False) == {"FOO": None} + assert m2.to_dict(exclude_unset=False, exclude_none=True) == {} + assert m2.to_dict(exclude_unset=False, exclude_defaults=True) == {} + + m3 = Model(FOO=None) + assert m3.to_dict() == {"FOO": None} + assert m3.to_dict(exclude_none=True) == {} + assert m3.to_dict(exclude_defaults=True) == {} + + class Model2(BaseModel): + created_at: datetime + + time_str = "2024-03-21T11:39:01.275859" + m4 = Model2.construct(created_at=time_str) + assert m4.to_dict(mode="python") == {"created_at": datetime.fromisoformat(time_str)} + assert m4.to_dict(mode="json") == {"created_at": time_str} + + if not PYDANTIC_V2: + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.to_dict(warnings=False) + + +def test_forwards_compat_model_dump_method() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert m.model_dump() == {"foo": "hello"} + assert m.model_dump(include={"bar"}) == {} + assert m.model_dump(exclude={"foo"}) == {} + assert m.model_dump(by_alias=True) == {"FOO": "hello"} + + m2 = Model() + assert m2.model_dump() == {"foo": None} + assert m2.model_dump(exclude_unset=True) == {} + assert m2.model_dump(exclude_none=True) == {} + assert m2.model_dump(exclude_defaults=True) == {} + + m3 = Model(FOO=None) + assert m3.model_dump() == {"foo": None} + assert m3.model_dump(exclude_none=True) == {} + + if not PYDANTIC_V2: + with pytest.raises(ValueError, match="round_trip is only supported in Pydantic v2"): + m.model_dump(round_trip=True) + + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.model_dump(warnings=False) + + +def test_compat_method_no_error_for_warnings() -> None: + class Model(BaseModel): + foo: Optional[str] + + m = Model(foo="hello") + assert isinstance(model_dump(m, warnings=False), dict) + + +def test_to_json() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert json.loads(m.to_json()) == {"FOO": "hello"} + assert json.loads(m.to_json(use_api_names=False)) == {"foo": "hello"} + + if PYDANTIC_V2: + assert m.to_json(indent=None) == '{"FOO":"hello"}' + else: + assert m.to_json(indent=None) == '{"FOO": "hello"}' + + m2 = Model() + assert json.loads(m2.to_json()) == {} + assert json.loads(m2.to_json(exclude_unset=False)) == {"FOO": None} + assert json.loads(m2.to_json(exclude_unset=False, exclude_none=True)) == {} + assert json.loads(m2.to_json(exclude_unset=False, exclude_defaults=True)) == {} + + m3 = Model(FOO=None) + assert json.loads(m3.to_json()) == {"FOO": None} + assert json.loads(m3.to_json(exclude_none=True)) == {} + + if not PYDANTIC_V2: + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.to_json(warnings=False) + + +def test_forwards_compat_model_dump_json_method() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert json.loads(m.model_dump_json()) == {"foo": "hello"} + assert json.loads(m.model_dump_json(include={"bar"})) == {} + assert json.loads(m.model_dump_json(include={"foo"})) == {"foo": "hello"} + assert json.loads(m.model_dump_json(by_alias=True)) == {"FOO": "hello"} + + assert m.model_dump_json(indent=2) == '{\n "foo": "hello"\n}' + + m2 = Model() + assert json.loads(m2.model_dump_json()) == {"foo": None} + assert json.loads(m2.model_dump_json(exclude_unset=True)) == {} + assert json.loads(m2.model_dump_json(exclude_none=True)) == {} + assert json.loads(m2.model_dump_json(exclude_defaults=True)) == {} + + m3 = Model(FOO=None) + assert json.loads(m3.model_dump_json()) == {"foo": None} + assert json.loads(m3.model_dump_json(exclude_none=True)) == {} + + if not PYDANTIC_V2: + with pytest.raises(ValueError, match="round_trip is only supported in Pydantic v2"): + m.model_dump_json(round_trip=True) + + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.model_dump_json(warnings=False) + + +def test_type_compat() -> None: + # our model type can be assigned to Pydantic's model type + + def takes_pydantic(model: pydantic.BaseModel) -> None: # noqa: ARG001 + ... + + class OurModel(BaseModel): + foo: Optional[str] = None + + takes_pydantic(OurModel()) + + +def test_annotated_types() -> None: + class Model(BaseModel): + value: str + + m = construct_type( + value={"value": "foo"}, + type_=cast(Any, Annotated[Model, "random metadata"]), + ) + assert isinstance(m, Model) + assert m.value == "foo" + + +def test_discriminated_unions_invalid_data() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "a", "data": 100}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, A) + assert m.type == "a" + if PYDANTIC_V2: + assert m.data == 100 # type: ignore[comparison-overlap] + else: + # pydantic v1 automatically converts inputs to strings + # if the expected type is a str + assert m.data == "100" + + +def test_discriminated_unions_unknown_variant() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + m = construct_type( + value={"type": "c", "data": None, "new_thing": "bar"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + + # just chooses the first variant + assert isinstance(m, A) + assert m.type == "c" # type: ignore[comparison-overlap] + assert m.data == None # type: ignore[unreachable] + assert m.new_thing == "bar" + + +def test_discriminated_unions_invalid_data_nested_unions() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + class C(BaseModel): + type: Literal["c"] + + data: bool + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[Union[A, B], C], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "c", "data": "foo"}, + type_=cast(Any, Annotated[Union[Union[A, B], C], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, C) + assert m.type == "c" + assert m.data == "foo" # type: ignore[comparison-overlap] + + +def test_discriminated_unions_with_aliases_invalid_data() -> None: + class A(BaseModel): + foo_type: Literal["a"] = Field(alias="type") + + data: str + + class B(BaseModel): + foo_type: Literal["b"] = Field(alias="type") + + data: int + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="foo_type")]), + ) + assert isinstance(m, B) + assert m.foo_type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "a", "data": 100}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="foo_type")]), + ) + assert isinstance(m, A) + assert m.foo_type == "a" + if PYDANTIC_V2: + assert m.data == 100 # type: ignore[comparison-overlap] + else: + # pydantic v1 automatically converts inputs to strings + # if the expected type is a str + assert m.data == "100" + + +def test_discriminated_unions_overlapping_discriminators_invalid_data() -> None: + class A(BaseModel): + type: Literal["a"] + + data: bool + + class B(BaseModel): + type: Literal["a"] + + data: int + + m = construct_type( + value={"type": "a", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "a" + assert m.data == "foo" # type: ignore[comparison-overlap] + + +def test_discriminated_unions_invalid_data_uses_cache() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + UnionType = cast(Any, Union[A, B]) + + assert not hasattr(UnionType, "__discriminator__") + + m = construct_type( + value={"type": "b", "data": "foo"}, type_=cast(Any, Annotated[UnionType, PropertyInfo(discriminator="type")]) + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + discriminator = UnionType.__discriminator__ + assert discriminator is not None + + m = construct_type( + value={"type": "b", "data": "foo"}, type_=cast(Any, Annotated[UnionType, PropertyInfo(discriminator="type")]) + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + # if the discriminator details object stays the same between invocations then + # we hit the cache + assert UnionType.__discriminator__ is discriminator + + +@pytest.mark.skipif(not PYDANTIC_V2, reason="TypeAliasType is not supported in Pydantic v1") +def test_type_alias_type() -> None: + Alias = TypeAliasType("Alias", str) # pyright: ignore + + class Model(BaseModel): + alias: Alias + union: Union[int, Alias] + + m = construct_type(value={"alias": "foo", "union": "bar"}, type_=Model) + assert isinstance(m, Model) + assert isinstance(m.alias, str) + assert m.alias == "foo" + assert isinstance(m.union, str) + assert m.union == "bar" + + +@pytest.mark.skipif(not PYDANTIC_V2, reason="TypeAliasType is not supported in Pydantic v1") +def test_field_named_cls() -> None: + class Model(BaseModel): + cls: str + + m = construct_type(value={"cls": "foo"}, type_=Model) + assert isinstance(m, Model) + assert isinstance(m.cls, str) + + +def test_discriminated_union_case() -> None: + class A(BaseModel): + type: Literal["a"] + + data: bool + + class B(BaseModel): + type: Literal["b"] + + data: List[Union[A, object]] + + class ModelA(BaseModel): + type: Literal["modelA"] + + data: int + + class ModelB(BaseModel): + type: Literal["modelB"] + + required: str + + data: Union[A, B] + + # when constructing ModelA | ModelB, value data doesn't match ModelB exactly - missing `required` + m = construct_type( + value={"type": "modelB", "data": {"type": "a", "data": True}}, + type_=cast(Any, Annotated[Union[ModelA, ModelB], PropertyInfo(discriminator="type")]), + ) + + assert isinstance(m, ModelB) + + +def test_nested_discriminated_union() -> None: + class InnerType1(BaseModel): + type: Literal["type_1"] + + class InnerModel(BaseModel): + inner_value: str + + class InnerType2(BaseModel): + type: Literal["type_2"] + some_inner_model: InnerModel + + class Type1(BaseModel): + base_type: Literal["base_type_1"] + value: Annotated[ + Union[ + InnerType1, + InnerType2, + ], + PropertyInfo(discriminator="type"), + ] + + class Type2(BaseModel): + base_type: Literal["base_type_2"] + + T = Annotated[ + Union[ + Type1, + Type2, + ], + PropertyInfo(discriminator="base_type"), + ] + + model = construct_type( + type_=T, + value={ + "base_type": "base_type_1", + "value": { + "type": "type_2", + }, + }, + ) + assert isinstance(model, Type1) + assert isinstance(model.value, InnerType2) diff --git a/tests/test_qs.py b/tests/test_qs.py new file mode 100644 index 0000000..0ed5ce8 --- /dev/null +++ b/tests/test_qs.py @@ -0,0 +1,78 @@ +from typing import Any, cast +from functools import partial +from urllib.parse import unquote + +import pytest + +from lmnt._qs import Querystring, stringify + + +def test_empty() -> None: + assert stringify({}) == "" + assert stringify({"a": {}}) == "" + assert stringify({"a": {"b": {"c": {}}}}) == "" + + +def test_basic() -> None: + assert stringify({"a": 1}) == "a=1" + assert stringify({"a": "b"}) == "a=b" + assert stringify({"a": True}) == "a=true" + assert stringify({"a": False}) == "a=false" + assert stringify({"a": 1.23456}) == "a=1.23456" + assert stringify({"a": None}) == "" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_nested_dotted(method: str) -> None: + if method == "class": + serialise = Querystring(nested_format="dots").stringify + else: + serialise = partial(stringify, nested_format="dots") + + assert unquote(serialise({"a": {"b": "c"}})) == "a.b=c" + assert unquote(serialise({"a": {"b": "c", "d": "e", "f": "g"}})) == "a.b=c&a.d=e&a.f=g" + assert unquote(serialise({"a": {"b": {"c": {"d": "e"}}}})) == "a.b.c.d=e" + assert unquote(serialise({"a": {"b": True}})) == "a.b=true" + + +def test_nested_brackets() -> None: + assert unquote(stringify({"a": {"b": "c"}})) == "a[b]=c" + assert unquote(stringify({"a": {"b": "c", "d": "e", "f": "g"}})) == "a[b]=c&a[d]=e&a[f]=g" + assert unquote(stringify({"a": {"b": {"c": {"d": "e"}}}})) == "a[b][c][d]=e" + assert unquote(stringify({"a": {"b": True}})) == "a[b]=true" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_array_comma(method: str) -> None: + if method == "class": + serialise = Querystring(array_format="comma").stringify + else: + serialise = partial(stringify, array_format="comma") + + assert unquote(serialise({"in": ["foo", "bar"]})) == "in=foo,bar" + assert unquote(serialise({"a": {"b": [True, False]}})) == "a[b]=true,false" + assert unquote(serialise({"a": {"b": [True, False, None, True]}})) == "a[b]=true,false,true" + + +def test_array_repeat() -> None: + assert unquote(stringify({"in": ["foo", "bar"]})) == "in=foo&in=bar" + assert unquote(stringify({"a": {"b": [True, False]}})) == "a[b]=true&a[b]=false" + assert unquote(stringify({"a": {"b": [True, False, None, True]}})) == "a[b]=true&a[b]=false&a[b]=true" + assert unquote(stringify({"in": ["foo", {"b": {"c": ["d", "e"]}}]})) == "in=foo&in[b][c]=d&in[b][c]=e" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_array_brackets(method: str) -> None: + if method == "class": + serialise = Querystring(array_format="brackets").stringify + else: + serialise = partial(stringify, array_format="brackets") + + assert unquote(serialise({"in": ["foo", "bar"]})) == "in[]=foo&in[]=bar" + assert unquote(serialise({"a": {"b": [True, False]}})) == "a[b][]=true&a[b][]=false" + assert unquote(serialise({"a": {"b": [True, False, None, True]}})) == "a[b][]=true&a[b][]=false&a[b][]=true" + + +def test_unknown_array_format() -> None: + with pytest.raises(NotImplementedError, match="Unknown array_format value: foo, choose from comma, repeat"): + stringify({"a": ["foo", "bar"]}, array_format=cast(Any, "foo")) diff --git a/tests/test_required_args.py b/tests/test_required_args.py new file mode 100644 index 0000000..7b0bf60 --- /dev/null +++ b/tests/test_required_args.py @@ -0,0 +1,111 @@ +from __future__ import annotations + +import pytest + +from lmnt._utils import required_args + + +def test_too_many_positional_params() -> None: + @required_args(["a"]) + def foo(a: str | None = None) -> str | None: + return a + + with pytest.raises(TypeError, match=r"foo\(\) takes 1 argument\(s\) but 2 were given"): + foo("a", "b") # type: ignore + + +def test_positional_param() -> None: + @required_args(["a"]) + def foo(a: str | None = None) -> str | None: + return a + + assert foo("a") == "a" + assert foo(None) is None + assert foo(a="b") == "b" + + with pytest.raises(TypeError, match="Missing required argument: 'a'"): + foo() + + +def test_keyword_only_param() -> None: + @required_args(["a"]) + def foo(*, a: str | None = None) -> str | None: + return a + + assert foo(a="a") == "a" + assert foo(a=None) is None + assert foo(a="b") == "b" + + with pytest.raises(TypeError, match="Missing required argument: 'a'"): + foo() + + +def test_multiple_params() -> None: + @required_args(["a", "b", "c"]) + def foo(a: str = "", *, b: str = "", c: str = "") -> str | None: + return f"{a} {b} {c}" + + assert foo(a="a", b="b", c="c") == "a b c" + + error_message = r"Missing required arguments.*" + + with pytest.raises(TypeError, match=error_message): + foo() + + with pytest.raises(TypeError, match=error_message): + foo(a="a") + + with pytest.raises(TypeError, match=error_message): + foo(b="b") + + with pytest.raises(TypeError, match=error_message): + foo(c="c") + + with pytest.raises(TypeError, match=r"Missing required argument: 'a'"): + foo(b="a", c="c") + + with pytest.raises(TypeError, match=r"Missing required argument: 'b'"): + foo("a", c="c") + + +def test_multiple_variants() -> None: + @required_args(["a"], ["b"]) + def foo(*, a: str | None = None, b: str | None = None) -> str | None: + return a if a is not None else b + + assert foo(a="foo") == "foo" + assert foo(b="bar") == "bar" + assert foo(a=None) is None + assert foo(b=None) is None + + # TODO: this error message could probably be improved + with pytest.raises( + TypeError, + match=r"Missing required arguments; Expected either \('a'\) or \('b'\) arguments to be given", + ): + foo() + + +def test_multiple_params_multiple_variants() -> None: + @required_args(["a", "b"], ["c"]) + def foo(*, a: str | None = None, b: str | None = None, c: str | None = None) -> str | None: + if a is not None: + return a + if b is not None: + return b + return c + + error_message = r"Missing required arguments; Expected either \('a' and 'b'\) or \('c'\) arguments to be given" + + with pytest.raises(TypeError, match=error_message): + foo(a="foo") + + with pytest.raises(TypeError, match=error_message): + foo(b="bar") + + with pytest.raises(TypeError, match=error_message): + foo() + + assert foo(a=None, b="bar") == "bar" + assert foo(c=None) is None + assert foo(c="foo") == "foo" diff --git a/tests/test_response.py b/tests/test_response.py new file mode 100644 index 0000000..fd13311 --- /dev/null +++ b/tests/test_response.py @@ -0,0 +1,277 @@ +import json +from typing import Any, List, Union, cast +from typing_extensions import Annotated + +import httpx +import pytest +import pydantic + +from lmnt import Lmnt, AsyncLmnt, BaseModel +from lmnt._response import ( + APIResponse, + BaseAPIResponse, + AsyncAPIResponse, + BinaryAPIResponse, + AsyncBinaryAPIResponse, + extract_response_type, +) +from lmnt._streaming import Stream +from lmnt._base_client import FinalRequestOptions + + +class ConcreteBaseAPIResponse(APIResponse[bytes]): ... + + +class ConcreteAPIResponse(APIResponse[List[str]]): ... + + +class ConcreteAsyncAPIResponse(APIResponse[httpx.Response]): ... + + +def test_extract_response_type_direct_classes() -> None: + assert extract_response_type(BaseAPIResponse[str]) == str + assert extract_response_type(APIResponse[str]) == str + assert extract_response_type(AsyncAPIResponse[str]) == str + + +def test_extract_response_type_direct_class_missing_type_arg() -> None: + with pytest.raises( + RuntimeError, + match="Expected type to have a type argument at index 0 but it did not", + ): + extract_response_type(AsyncAPIResponse) + + +def test_extract_response_type_concrete_subclasses() -> None: + assert extract_response_type(ConcreteBaseAPIResponse) == bytes + assert extract_response_type(ConcreteAPIResponse) == List[str] + assert extract_response_type(ConcreteAsyncAPIResponse) == httpx.Response + + +def test_extract_response_type_binary_response() -> None: + assert extract_response_type(BinaryAPIResponse) == bytes + assert extract_response_type(AsyncBinaryAPIResponse) == bytes + + +class PydanticModel(pydantic.BaseModel): ... + + +def test_response_parse_mismatched_basemodel(client: Lmnt) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo"), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + with pytest.raises( + TypeError, + match="Pydantic models must subclass our base model type, e.g. `from lmnt import BaseModel`", + ): + response.parse(to=PydanticModel) + + +@pytest.mark.asyncio +async def test_async_response_parse_mismatched_basemodel(async_client: AsyncLmnt) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo"), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + with pytest.raises( + TypeError, + match="Pydantic models must subclass our base model type, e.g. `from lmnt import BaseModel`", + ): + await response.parse(to=PydanticModel) + + +def test_response_parse_custom_stream(client: Lmnt) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo"), + client=client, + stream=True, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + stream = response.parse(to=Stream[int]) + assert stream._cast_to == int + + +@pytest.mark.asyncio +async def test_async_response_parse_custom_stream(async_client: AsyncLmnt) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo"), + client=async_client, + stream=True, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + stream = await response.parse(to=Stream[int]) + assert stream._cast_to == int + + +class CustomModel(BaseModel): + foo: str + bar: int + + +def test_response_parse_custom_model(client: Lmnt) -> None: + response = APIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse(to=CustomModel) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +@pytest.mark.asyncio +async def test_async_response_parse_custom_model(async_client: AsyncLmnt) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse(to=CustomModel) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +def test_response_parse_annotated_type(client: Lmnt) -> None: + response = APIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse( + to=cast("type[CustomModel]", Annotated[CustomModel, "random metadata"]), + ) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +async def test_async_response_parse_annotated_type(async_client: AsyncLmnt) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse( + to=cast("type[CustomModel]", Annotated[CustomModel, "random metadata"]), + ) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +@pytest.mark.parametrize( + "content, expected", + [ + ("false", False), + ("true", True), + ("False", False), + ("True", True), + ("TrUe", True), + ("FalSe", False), + ], +) +def test_response_parse_bool(client: Lmnt, content: str, expected: bool) -> None: + response = APIResponse( + raw=httpx.Response(200, content=content), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + result = response.parse(to=bool) + assert result is expected + + +@pytest.mark.parametrize( + "content, expected", + [ + ("false", False), + ("true", True), + ("False", False), + ("True", True), + ("TrUe", True), + ("FalSe", False), + ], +) +async def test_async_response_parse_bool(client: AsyncLmnt, content: str, expected: bool) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=content), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + result = await response.parse(to=bool) + assert result is expected + + +class OtherModel(BaseModel): + a: str + + +@pytest.mark.parametrize("client", [False], indirect=True) # loose validation +def test_response_parse_expect_model_union_non_json_content(client: Lmnt) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo", headers={"Content-Type": "application/text"}), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse(to=cast(Any, Union[CustomModel, OtherModel])) + assert isinstance(obj, str) + assert obj == "foo" + + +@pytest.mark.asyncio +@pytest.mark.parametrize("async_client", [False], indirect=True) # loose validation +async def test_async_response_parse_expect_model_union_non_json_content(async_client: AsyncLmnt) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo", headers={"Content-Type": "application/text"}), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse(to=cast(Any, Union[CustomModel, OtherModel])) + assert isinstance(obj, str) + assert obj == "foo" diff --git a/tests/test_streaming.py b/tests/test_streaming.py new file mode 100644 index 0000000..3a9166b --- /dev/null +++ b/tests/test_streaming.py @@ -0,0 +1,248 @@ +from __future__ import annotations + +from typing import Iterator, AsyncIterator + +import httpx +import pytest + +from lmnt import Lmnt, AsyncLmnt +from lmnt._streaming import Stream, AsyncStream, ServerSentEvent + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_basic(sync: bool, client: Lmnt, async_client: AsyncLmnt) -> None: + def body() -> Iterator[bytes]: + yield b"event: completion\n" + yield b'data: {"foo":true}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_data_missing_event(sync: bool, client: Lmnt, async_client: AsyncLmnt) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"foo":true}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_event_missing_data(sync: bool, client: Lmnt, async_client: AsyncLmnt) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.data == "" + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_events(sync: bool, client: Lmnt, async_client: AsyncLmnt) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"\n" + yield b"event: completion\n" + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.data == "" + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.data == "" + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_events_with_data(sync: bool, client: Lmnt, async_client: AsyncLmnt) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b'data: {"foo":true}\n' + yield b"\n" + yield b"event: completion\n" + yield b'data: {"bar":false}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.json() == {"bar": False} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_data_lines_with_empty_line(sync: bool, client: Lmnt, async_client: AsyncLmnt) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"data: {\n" + yield b'data: "foo":\n' + yield b"data: \n" + yield b"data:\n" + yield b"data: true}\n" + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + assert sse.data == '{\n"foo":\n\n\ntrue}' + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_data_json_escaped_double_new_line(sync: bool, client: Lmnt, async_client: AsyncLmnt) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b'data: {"foo": "my long\\n\\ncontent"}' + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": "my long\n\ncontent"} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_data_lines(sync: bool, client: Lmnt, async_client: AsyncLmnt) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"data: {\n" + yield b'data: "foo":\n' + yield b"data: true}\n" + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_special_new_line_character( + sync: bool, + client: Lmnt, + async_client: AsyncLmnt, +) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"content":" culpa"}\n' + yield b"\n" + yield b'data: {"content":" \xe2\x80\xa8"}\n' + yield b"\n" + yield b'data: {"content":"foo"}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": " culpa"} + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": " 
"} + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": "foo"} + + await assert_empty_iter(iterator) + + +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multi_byte_character_multiple_chunks( + sync: bool, + client: Lmnt, + async_client: AsyncLmnt, +) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"content":"' + # bytes taken from the string 'известни' and arbitrarily split + # so that some multi-byte characters span multiple chunks + yield b"\xd0" + yield b"\xb8\xd0\xb7\xd0" + yield b"\xb2\xd0\xb5\xd1\x81\xd1\x82\xd0\xbd\xd0\xb8" + yield b'"}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": "известни"} + + +async def to_aiter(iter: Iterator[bytes]) -> AsyncIterator[bytes]: + for chunk in iter: + yield chunk + + +async def iter_next(iter: Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]) -> ServerSentEvent: + if isinstance(iter, AsyncIterator): + return await iter.__anext__() + + return next(iter) + + +async def assert_empty_iter(iter: Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]) -> None: + with pytest.raises((StopAsyncIteration, RuntimeError)): + await iter_next(iter) + + +def make_event_iterator( + content: Iterator[bytes], + *, + sync: bool, + client: Lmnt, + async_client: AsyncLmnt, +) -> Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]: + if sync: + return Stream(cast_to=object, client=client, response=httpx.Response(200, content=content))._iter_events() + + return AsyncStream( + cast_to=object, client=async_client, response=httpx.Response(200, content=to_aiter(content)) + )._iter_events() diff --git a/tests/test_transform.py b/tests/test_transform.py new file mode 100644 index 0000000..5548673 --- /dev/null +++ b/tests/test_transform.py @@ -0,0 +1,453 @@ +from __future__ import annotations + +import io +import pathlib +from typing import Any, Dict, List, Union, TypeVar, Iterable, Optional, cast +from datetime import date, datetime +from typing_extensions import Required, Annotated, TypedDict + +import pytest + +from lmnt._types import NOT_GIVEN, Base64FileInput +from lmnt._utils import ( + PropertyInfo, + transform as _transform, + parse_datetime, + async_transform as _async_transform, +) +from lmnt._compat import PYDANTIC_V2 +from lmnt._models import BaseModel + +_T = TypeVar("_T") + +SAMPLE_FILE_PATH = pathlib.Path(__file__).parent.joinpath("sample_file.txt") + + +async def transform( + data: _T, + expected_type: object, + use_async: bool, +) -> _T: + if use_async: + return await _async_transform(data, expected_type=expected_type) + + return _transform(data, expected_type=expected_type) + + +parametrize = pytest.mark.parametrize("use_async", [False, True], ids=["sync", "async"]) + + +class Foo1(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +@parametrize +@pytest.mark.asyncio +async def test_top_level_alias(use_async: bool) -> None: + assert await transform({"foo_bar": "hello"}, expected_type=Foo1, use_async=use_async) == {"fooBar": "hello"} + + +class Foo2(TypedDict): + bar: Bar2 + + +class Bar2(TypedDict): + this_thing: Annotated[int, PropertyInfo(alias="this__thing")] + baz: Annotated[Baz2, PropertyInfo(alias="Baz")] + + +class Baz2(TypedDict): + my_baz: Annotated[str, PropertyInfo(alias="myBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_recursive_typeddict(use_async: bool) -> None: + assert await transform({"bar": {"this_thing": 1}}, Foo2, use_async) == {"bar": {"this__thing": 1}} + assert await transform({"bar": {"baz": {"my_baz": "foo"}}}, Foo2, use_async) == {"bar": {"Baz": {"myBaz": "foo"}}} + + +class Foo3(TypedDict): + things: List[Bar3] + + +class Bar3(TypedDict): + my_field: Annotated[str, PropertyInfo(alias="myField")] + + +@parametrize +@pytest.mark.asyncio +async def test_list_of_typeddict(use_async: bool) -> None: + result = await transform({"things": [{"my_field": "foo"}, {"my_field": "foo2"}]}, Foo3, use_async) + assert result == {"things": [{"myField": "foo"}, {"myField": "foo2"}]} + + +class Foo4(TypedDict): + foo: Union[Bar4, Baz4] + + +class Bar4(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz4(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_union_of_typeddict(use_async: bool) -> None: + assert await transform({"foo": {"foo_bar": "bar"}}, Foo4, use_async) == {"foo": {"fooBar": "bar"}} + assert await transform({"foo": {"foo_baz": "baz"}}, Foo4, use_async) == {"foo": {"fooBaz": "baz"}} + assert await transform({"foo": {"foo_baz": "baz", "foo_bar": "bar"}}, Foo4, use_async) == { + "foo": {"fooBaz": "baz", "fooBar": "bar"} + } + + +class Foo5(TypedDict): + foo: Annotated[Union[Bar4, List[Baz4]], PropertyInfo(alias="FOO")] + + +class Bar5(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz5(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_union_of_list(use_async: bool) -> None: + assert await transform({"foo": {"foo_bar": "bar"}}, Foo5, use_async) == {"FOO": {"fooBar": "bar"}} + assert await transform( + { + "foo": [ + {"foo_baz": "baz"}, + {"foo_baz": "baz"}, + ] + }, + Foo5, + use_async, + ) == {"FOO": [{"fooBaz": "baz"}, {"fooBaz": "baz"}]} + + +class Foo6(TypedDict): + bar: Annotated[str, PropertyInfo(alias="Bar")] + + +@parametrize +@pytest.mark.asyncio +async def test_includes_unknown_keys(use_async: bool) -> None: + assert await transform({"bar": "bar", "baz_": {"FOO": 1}}, Foo6, use_async) == { + "Bar": "bar", + "baz_": {"FOO": 1}, + } + + +class Foo7(TypedDict): + bar: Annotated[List[Bar7], PropertyInfo(alias="bAr")] + foo: Bar7 + + +class Bar7(TypedDict): + foo: str + + +@parametrize +@pytest.mark.asyncio +async def test_ignores_invalid_input(use_async: bool) -> None: + assert await transform({"bar": ""}, Foo7, use_async) == {"bAr": ""} + assert await transform({"foo": ""}, Foo7, use_async) == {"foo": ""} + + +class DatetimeDict(TypedDict, total=False): + foo: Annotated[datetime, PropertyInfo(format="iso8601")] + + bar: Annotated[Optional[datetime], PropertyInfo(format="iso8601")] + + required: Required[Annotated[Optional[datetime], PropertyInfo(format="iso8601")]] + + list_: Required[Annotated[Optional[List[datetime]], PropertyInfo(format="iso8601")]] + + union: Annotated[Union[int, datetime], PropertyInfo(format="iso8601")] + + +class DateDict(TypedDict, total=False): + foo: Annotated[date, PropertyInfo(format="iso8601")] + + +class DatetimeModel(BaseModel): + foo: datetime + + +class DateModel(BaseModel): + foo: Optional[date] + + +@parametrize +@pytest.mark.asyncio +async def test_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + tz = "Z" if PYDANTIC_V2 else "+00:00" + assert await transform({"foo": dt}, DatetimeDict, use_async) == {"foo": "2023-02-23T14:16:36.337692+00:00"} # type: ignore[comparison-overlap] + assert await transform(DatetimeModel(foo=dt), Any, use_async) == {"foo": "2023-02-23T14:16:36.337692" + tz} # type: ignore[comparison-overlap] + + dt = dt.replace(tzinfo=None) + assert await transform({"foo": dt}, DatetimeDict, use_async) == {"foo": "2023-02-23T14:16:36.337692"} # type: ignore[comparison-overlap] + assert await transform(DatetimeModel(foo=dt), Any, use_async) == {"foo": "2023-02-23T14:16:36.337692"} # type: ignore[comparison-overlap] + + assert await transform({"foo": None}, DateDict, use_async) == {"foo": None} # type: ignore[comparison-overlap] + assert await transform(DateModel(foo=None), Any, use_async) == {"foo": None} # type: ignore + assert await transform({"foo": date.fromisoformat("2023-02-23")}, DateDict, use_async) == {"foo": "2023-02-23"} # type: ignore[comparison-overlap] + assert await transform(DateModel(foo=date.fromisoformat("2023-02-23")), DateDict, use_async) == { + "foo": "2023-02-23" + } # type: ignore[comparison-overlap] + + +@parametrize +@pytest.mark.asyncio +async def test_optional_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"bar": dt}, DatetimeDict, use_async) == {"bar": "2023-02-23T14:16:36.337692+00:00"} # type: ignore[comparison-overlap] + + assert await transform({"bar": None}, DatetimeDict, use_async) == {"bar": None} + + +@parametrize +@pytest.mark.asyncio +async def test_required_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"required": dt}, DatetimeDict, use_async) == { + "required": "2023-02-23T14:16:36.337692+00:00" + } # type: ignore[comparison-overlap] + + assert await transform({"required": None}, DatetimeDict, use_async) == {"required": None} + + +@parametrize +@pytest.mark.asyncio +async def test_union_datetime(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"union": dt}, DatetimeDict, use_async) == { # type: ignore[comparison-overlap] + "union": "2023-02-23T14:16:36.337692+00:00" + } + + assert await transform({"union": "foo"}, DatetimeDict, use_async) == {"union": "foo"} + + +@parametrize +@pytest.mark.asyncio +async def test_nested_list_iso6801_format(use_async: bool) -> None: + dt1 = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + dt2 = parse_datetime("2022-01-15T06:34:23Z") + assert await transform({"list_": [dt1, dt2]}, DatetimeDict, use_async) == { # type: ignore[comparison-overlap] + "list_": ["2023-02-23T14:16:36.337692+00:00", "2022-01-15T06:34:23+00:00"] + } + + +@parametrize +@pytest.mark.asyncio +async def test_datetime_custom_format(use_async: bool) -> None: + dt = parse_datetime("2022-01-15T06:34:23Z") + + result = await transform(dt, Annotated[datetime, PropertyInfo(format="custom", format_template="%H")], use_async) + assert result == "06" # type: ignore[comparison-overlap] + + +class DateDictWithRequiredAlias(TypedDict, total=False): + required_prop: Required[Annotated[date, PropertyInfo(format="iso8601", alias="prop")]] + + +@parametrize +@pytest.mark.asyncio +async def test_datetime_with_alias(use_async: bool) -> None: + assert await transform({"required_prop": None}, DateDictWithRequiredAlias, use_async) == {"prop": None} # type: ignore[comparison-overlap] + assert await transform( + {"required_prop": date.fromisoformat("2023-02-23")}, DateDictWithRequiredAlias, use_async + ) == {"prop": "2023-02-23"} # type: ignore[comparison-overlap] + + +class MyModel(BaseModel): + foo: str + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_model_to_dictionary(use_async: bool) -> None: + assert cast(Any, await transform(MyModel(foo="hi!"), Any, use_async)) == {"foo": "hi!"} + assert cast(Any, await transform(MyModel.construct(foo="hi!"), Any, use_async)) == {"foo": "hi!"} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_empty_model(use_async: bool) -> None: + assert cast(Any, await transform(MyModel.construct(), Any, use_async)) == {} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_unknown_field(use_async: bool) -> None: + assert cast(Any, await transform(MyModel.construct(my_untyped_field=True), Any, use_async)) == { + "my_untyped_field": True + } + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_mismatched_types(use_async: bool) -> None: + model = MyModel.construct(foo=True) + if PYDANTIC_V2: + with pytest.warns(UserWarning): + params = await transform(model, Any, use_async) + else: + params = await transform(model, Any, use_async) + assert cast(Any, params) == {"foo": True} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_mismatched_object_type(use_async: bool) -> None: + model = MyModel.construct(foo=MyModel.construct(hello="world")) + if PYDANTIC_V2: + with pytest.warns(UserWarning): + params = await transform(model, Any, use_async) + else: + params = await transform(model, Any, use_async) + assert cast(Any, params) == {"foo": {"hello": "world"}} + + +class ModelNestedObjects(BaseModel): + nested: MyModel + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_nested_objects(use_async: bool) -> None: + model = ModelNestedObjects.construct(nested={"foo": "stainless"}) + assert isinstance(model.nested, MyModel) + assert cast(Any, await transform(model, Any, use_async)) == {"nested": {"foo": "stainless"}} + + +class ModelWithDefaultField(BaseModel): + foo: str + with_none_default: Union[str, None] = None + with_str_default: str = "foo" + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_default_field(use_async: bool) -> None: + # should be excluded when defaults are used + model = ModelWithDefaultField.construct() + assert model.with_none_default is None + assert model.with_str_default == "foo" + assert cast(Any, await transform(model, Any, use_async)) == {} + + # should be included when the default value is explicitly given + model = ModelWithDefaultField.construct(with_none_default=None, with_str_default="foo") + assert model.with_none_default is None + assert model.with_str_default == "foo" + assert cast(Any, await transform(model, Any, use_async)) == {"with_none_default": None, "with_str_default": "foo"} + + # should be included when a non-default value is explicitly given + model = ModelWithDefaultField.construct(with_none_default="bar", with_str_default="baz") + assert model.with_none_default == "bar" + assert model.with_str_default == "baz" + assert cast(Any, await transform(model, Any, use_async)) == {"with_none_default": "bar", "with_str_default": "baz"} + + +class TypedDictIterableUnion(TypedDict): + foo: Annotated[Union[Bar8, Iterable[Baz8]], PropertyInfo(alias="FOO")] + + +class Bar8(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz8(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_iterable_of_dictionaries(use_async: bool) -> None: + assert await transform({"foo": [{"foo_baz": "bar"}]}, TypedDictIterableUnion, use_async) == { + "FOO": [{"fooBaz": "bar"}] + } + assert cast(Any, await transform({"foo": ({"foo_baz": "bar"},)}, TypedDictIterableUnion, use_async)) == { + "FOO": [{"fooBaz": "bar"}] + } + + def my_iter() -> Iterable[Baz8]: + yield {"foo_baz": "hello"} + yield {"foo_baz": "world"} + + assert await transform({"foo": my_iter()}, TypedDictIterableUnion, use_async) == { + "FOO": [{"fooBaz": "hello"}, {"fooBaz": "world"}] + } + + +@parametrize +@pytest.mark.asyncio +async def test_dictionary_items(use_async: bool) -> None: + class DictItems(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + assert await transform({"foo": {"foo_baz": "bar"}}, Dict[str, DictItems], use_async) == {"foo": {"fooBaz": "bar"}} + + +class TypedDictIterableUnionStr(TypedDict): + foo: Annotated[Union[str, Iterable[Baz8]], PropertyInfo(alias="FOO")] + + +@parametrize +@pytest.mark.asyncio +async def test_iterable_union_str(use_async: bool) -> None: + assert await transform({"foo": "bar"}, TypedDictIterableUnionStr, use_async) == {"FOO": "bar"} + assert cast(Any, await transform(iter([{"foo_baz": "bar"}]), Union[str, Iterable[Baz8]], use_async)) == [ + {"fooBaz": "bar"} + ] + + +class TypedDictBase64Input(TypedDict): + foo: Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")] + + +@parametrize +@pytest.mark.asyncio +async def test_base64_file_input(use_async: bool) -> None: + # strings are left as-is + assert await transform({"foo": "bar"}, TypedDictBase64Input, use_async) == {"foo": "bar"} + + # pathlib.Path is automatically converted to base64 + assert await transform({"foo": SAMPLE_FILE_PATH}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQo=" + } # type: ignore[comparison-overlap] + + # io instances are automatically converted to base64 + assert await transform({"foo": io.StringIO("Hello, world!")}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQ==" + } # type: ignore[comparison-overlap] + assert await transform({"foo": io.BytesIO(b"Hello, world!")}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQ==" + } # type: ignore[comparison-overlap] + + +@parametrize +@pytest.mark.asyncio +async def test_transform_skipping(use_async: bool) -> None: + # lists of ints are left as-is + data = [1, 2, 3] + assert await transform(data, List[int], use_async) is data + + # iterables of ints are converted to a list + data = iter([1, 2, 3]) + assert await transform(data, Iterable[int], use_async) == [1, 2, 3] + + +@parametrize +@pytest.mark.asyncio +async def test_strips_notgiven(use_async: bool) -> None: + assert await transform({"foo_bar": "bar"}, Foo1, use_async) == {"fooBar": "bar"} + assert await transform({"foo_bar": NOT_GIVEN}, Foo1, use_async) == {} diff --git a/tests/test_utils/test_proxy.py b/tests/test_utils/test_proxy.py new file mode 100644 index 0000000..ae178a9 --- /dev/null +++ b/tests/test_utils/test_proxy.py @@ -0,0 +1,34 @@ +import operator +from typing import Any +from typing_extensions import override + +from lmnt._utils import LazyProxy + + +class RecursiveLazyProxy(LazyProxy[Any]): + @override + def __load__(self) -> Any: + return self + + def __call__(self, *_args: Any, **_kwds: Any) -> Any: + raise RuntimeError("This should never be called!") + + +def test_recursive_proxy() -> None: + proxy = RecursiveLazyProxy() + assert repr(proxy) == "RecursiveLazyProxy" + assert str(proxy) == "RecursiveLazyProxy" + assert dir(proxy) == [] + assert type(proxy).__name__ == "RecursiveLazyProxy" + assert type(operator.attrgetter("name.foo.bar.baz")(proxy)).__name__ == "RecursiveLazyProxy" + + +def test_isinstance_does_not_error() -> None: + class AlwaysErrorProxy(LazyProxy[Any]): + @override + def __load__(self) -> Any: + raise RuntimeError("Mocking missing dependency") + + proxy = AlwaysErrorProxy() + assert not isinstance(proxy, dict) + assert isinstance(proxy, LazyProxy) diff --git a/tests/test_utils/test_typing.py b/tests/test_utils/test_typing.py new file mode 100644 index 0000000..edb76c0 --- /dev/null +++ b/tests/test_utils/test_typing.py @@ -0,0 +1,73 @@ +from __future__ import annotations + +from typing import Generic, TypeVar, cast + +from lmnt._utils import extract_type_var_from_base + +_T = TypeVar("_T") +_T2 = TypeVar("_T2") +_T3 = TypeVar("_T3") + + +class BaseGeneric(Generic[_T]): ... + + +class SubclassGeneric(BaseGeneric[_T]): ... + + +class BaseGenericMultipleTypeArgs(Generic[_T, _T2, _T3]): ... + + +class SubclassGenericMultipleTypeArgs(BaseGenericMultipleTypeArgs[_T, _T2, _T3]): ... + + +class SubclassDifferentOrderGenericMultipleTypeArgs(BaseGenericMultipleTypeArgs[_T2, _T, _T3]): ... + + +def test_extract_type_var() -> None: + assert ( + extract_type_var_from_base( + BaseGeneric[int], + index=0, + generic_bases=cast("tuple[type, ...]", (BaseGeneric,)), + ) + == int + ) + + +def test_extract_type_var_generic_subclass() -> None: + assert ( + extract_type_var_from_base( + SubclassGeneric[int], + index=0, + generic_bases=cast("tuple[type, ...]", (BaseGeneric,)), + ) + == int + ) + + +def test_extract_type_var_multiple() -> None: + typ = BaseGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) + + +def test_extract_type_var_generic_subclass_multiple() -> None: + typ = SubclassGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) + + +def test_extract_type_var_generic_subclass_different_ordering_multiple() -> None: + typ = SubclassDifferentOrderGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) diff --git a/tests/utils.py b/tests/utils.py new file mode 100644 index 0000000..6bc6195 --- /dev/null +++ b/tests/utils.py @@ -0,0 +1,159 @@ +from __future__ import annotations + +import os +import inspect +import traceback +import contextlib +from typing import Any, TypeVar, Iterator, cast +from datetime import date, datetime +from typing_extensions import Literal, get_args, get_origin, assert_type + +from lmnt._types import Omit, NoneType +from lmnt._utils import ( + is_dict, + is_list, + is_list_type, + is_union_type, + extract_type_arg, + is_annotated_type, + is_type_alias_type, +) +from lmnt._compat import PYDANTIC_V2, field_outer_type, get_model_fields +from lmnt._models import BaseModel + +BaseModelT = TypeVar("BaseModelT", bound=BaseModel) + + +def assert_matches_model(model: type[BaseModelT], value: BaseModelT, *, path: list[str]) -> bool: + for name, field in get_model_fields(model).items(): + field_value = getattr(value, name) + if PYDANTIC_V2: + allow_none = False + else: + # in v1 nullability was structured differently + # https://docs.pydantic.dev/2.0/migration/#required-optional-and-nullable-fields + allow_none = getattr(field, "allow_none", False) + + assert_matches_type( + field_outer_type(field), + field_value, + path=[*path, name], + allow_none=allow_none, + ) + + return True + + +# Note: the `path` argument is only used to improve error messages when `--showlocals` is used +def assert_matches_type( + type_: Any, + value: object, + *, + path: list[str], + allow_none: bool = False, +) -> None: + if is_type_alias_type(type_): + type_ = type_.__value__ + + # unwrap `Annotated[T, ...]` -> `T` + if is_annotated_type(type_): + type_ = extract_type_arg(type_, 0) + + if allow_none and value is None: + return + + if type_ is None or type_ is NoneType: + assert value is None + return + + origin = get_origin(type_) or type_ + + if is_list_type(type_): + return _assert_list_type(type_, value) + + if origin == str: + assert isinstance(value, str) + elif origin == int: + assert isinstance(value, int) + elif origin == bool: + assert isinstance(value, bool) + elif origin == float: + assert isinstance(value, float) + elif origin == bytes: + assert isinstance(value, bytes) + elif origin == datetime: + assert isinstance(value, datetime) + elif origin == date: + assert isinstance(value, date) + elif origin == object: + # nothing to do here, the expected type is unknown + pass + elif origin == Literal: + assert value in get_args(type_) + elif origin == dict: + assert is_dict(value) + + args = get_args(type_) + key_type = args[0] + items_type = args[1] + + for key, item in value.items(): + assert_matches_type(key_type, key, path=[*path, ""]) + assert_matches_type(items_type, item, path=[*path, ""]) + elif is_union_type(type_): + variants = get_args(type_) + + try: + none_index = variants.index(type(None)) + except ValueError: + pass + else: + # special case Optional[T] for better error messages + if len(variants) == 2: + if value is None: + # valid + return + + return assert_matches_type(type_=variants[not none_index], value=value, path=path) + + for i, variant in enumerate(variants): + try: + assert_matches_type(variant, value, path=[*path, f"variant {i}"]) + return + except AssertionError: + traceback.print_exc() + continue + + raise AssertionError("Did not match any variants") + elif issubclass(origin, BaseModel): + assert isinstance(value, type_) + assert assert_matches_model(type_, cast(Any, value), path=path) + elif inspect.isclass(origin) and origin.__name__ == "HttpxBinaryResponseContent": + assert value.__class__.__name__ == "HttpxBinaryResponseContent" + else: + assert None, f"Unhandled field type: {type_}" + + +def _assert_list_type(type_: type[object], value: object) -> None: + assert is_list(value) + + inner_type = get_args(type_)[0] + for entry in value: + assert_type(inner_type, entry) # type: ignore + + +@contextlib.contextmanager +def update_env(**new_env: str | Omit) -> Iterator[None]: + old = os.environ.copy() + + try: + for name, value in new_env.items(): + if isinstance(value, Omit): + os.environ.pop(name, None) + else: + os.environ[name] = value + + yield None + finally: + os.environ.clear() + os.environ.update(old)