\d*)
-serialize =
+serialize =
{major}.{minor}.{patch}{release}{num}
{major}.{minor}.{patch}
tag_name = {new_version}
@@ -15,7 +15,7 @@ tag_name = {new_version}
name = cobra
url = https://opencobra.github.io/cobrapy
download_url = https://pypi.org/project/cobra
-project_urls =
+project_urls =
Source Code = https://github.com/opencobra/cobrapy
Documentation = https://cobrapy.readthedocs.io
Bug Tracker = https://github.com/opencobra/cobrapy/issues
@@ -23,7 +23,7 @@ author = The cobrapy core development team.
author_email = cobra-pie@googlegroups.com
maintainer = Moritz E. Beber
maintainer_email = moritz.beber@gmail.com
-classifiers =
+classifiers =
Development Status :: 5 - Production/Stable
Intended Audience :: Science/Research
License :: OSI Approved :: GNU General Public License v2 or later (GPLv2+)
@@ -41,7 +41,7 @@ license = LGPL-2.0-or-later OR GPL-2.0-or-later
description = COBRApy is a package for constraint-based modeling of metabolic networks.
long_description = file: README.rst, INSTALL.rst
long_description_content_type = text/x-rst
-keywords =
+keywords =
metabolism
biology
constraint-based
@@ -53,7 +53,7 @@ keywords =
[options]
zip_safe = True
-install_requires =
+install_requires =
appdirs ~=1.4
depinfo ~=1.7
diskcache ~=5.0
@@ -68,24 +68,25 @@ install_requires =
rich >=8.0
ruamel.yaml ~=0.16
swiglpk
-tests_require =
+ jsonschema
+tests_require =
tox
packages = find:
-package_dir =
+package_dir =
= src
[options.packages.find]
where = src
[options.package_data]
-cobra =
+cobra =
data/*
io/*.json
[options.extras_require]
-array =
+array =
scipy
-development =
+development =
black
bumpversion
isort
@@ -97,7 +98,7 @@ universal = 1
[bumpversion:part:release]
optional_value = placeholder
first_value = placeholder
-values =
+values =
placeholder
a
diff --git a/src/cobra/core/__init__.py b/src/cobra/core/__init__.py
index 12e082517..69379f9a5 100644
--- a/src/cobra/core/__init__.py
+++ b/src/cobra/core/__init__.py
@@ -1,10 +1,13 @@
from cobra.core.configuration import Configuration
from cobra.core.dictlist import DictList
-from cobra.core.gene import Gene, GPR
+from cobra.core.gene import GPR, Gene
+from cobra.core.group import Group
from cobra.core.metabolite import Metabolite
+from cobra.core.metadata import MetaData
+from cobra.core.metadata.cvterm import CVTerm, CVTermList, ExternalResources
+from cobra.core.metadata.history import Creator, History
from cobra.core.model import Model
from cobra.core.object import Object
from cobra.core.reaction import Reaction
-from cobra.core.group import Group
from cobra.core.solution import Solution, get_solution
from cobra.core.species import Species
diff --git a/src/cobra/core/group.py b/src/cobra/core/group.py
index 501a3ffc2..ac2e508b3 100644
--- a/src/cobra/core/group.py
+++ b/src/cobra/core/group.py
@@ -3,7 +3,6 @@
from typing import Iterable, Optional, Set
from warnings import warn
-from .dictlist import DictList
from .object import Object
diff --git a/src/cobra/core/metadata/__init__.py b/src/cobra/core/metadata/__init__.py
new file mode 100644
index 000000000..8bbb78957
--- /dev/null
+++ b/src/cobra/core/metadata/__init__.py
@@ -0,0 +1,7 @@
+"""Provide functions for loading, saving and modifying metadata annotations."""
+
+from cobra.core.metadata.cvterm import CVTerm, CVTermList, ExternalResources, Qualifier
+from cobra.core.metadata.helper import URL_IDENTIFIERS_PATTERN, parse_identifiers_uri
+from cobra.core.metadata.history import Creator, History
+from cobra.core.metadata.custompairs import KeyValuePairs
+from cobra.core.metadata.metadata import MetaData
diff --git a/src/cobra/core/metadata/custompairs.py b/src/cobra/core/metadata/custompairs.py
new file mode 100644
index 000000000..22e61b28d
--- /dev/null
+++ b/src/cobra/core/metadata/custompairs.py
@@ -0,0 +1,172 @@
+"""Class to deal with Key-Value pairs.
+
+Key-Value pairs are described in SBML FBC3. For the FBC3 standard, see
+https://github.com/bgoli/sbml-fbc-spec/blob/main/sf_svn/spec/main.pdf
+"""
+import uuid
+from collections import UserDict
+from typing import Dict, Iterable, Optional, Union
+from dataclasses import dataclass, field, fields, asdict
+
+from ...util import format_long_string
+
+
+@dataclass
+class KeyValueEntry:
+ """Single key-value entry.
+
+ The key is an attribute on the entry.
+
+ Parameters
+ ----------
+ key: str
+ Defined as mandatory in the FBC3 standard.
+ id: str
+ optional. Default None.
+ name: str
+ optional. Default None.
+ value: str
+ optional. Default None.
+ uri: str
+ Can be a URN or URL. Optional (default None).
+ """
+ key: str
+ id: Optional[str] = None
+ name: Optional[str] = None
+ value: Optional[str] = None
+ uri: Optional[str] = None
+
+ @staticmethod
+ def from_data(data: Optional[Union[Dict, "KeyValueEntry"]]) -> "KeyValueEntry":
+ """Make a KeyValueDict object using the data passed.
+
+ Parameters
+ ----------
+ data - dict or KeyValueEntry
+ If dict, will use the values of the dictionary to populate a new
+ KeyValueEntry. If None, will return empty KeyValueEntry.
+
+ Returns
+ -------
+ KeyValueEntry
+ """
+ if isinstance(data, KeyValueEntry):
+ return data
+ elif isinstance(data, dict):
+ if 'key' not in data:
+ data['key'] = uuid.uuid4().hex
+ return KeyValueEntry(**data)
+ else:
+ raise TypeError(f"Invalid format for KeyValueEntry: '{data}'")
+
+ def __str__(self) -> str:
+ """Get string representation of the KeyValueEntry as dictionary.
+
+ Returns
+ -------
+ str
+ """
+ return str(asdict(self))
+
+ def __repr__(self) -> str:
+ """Get string representation, including module and class name.
+
+ Returns
+ -------
+ str
+ """
+ return (
+ f"{self.__class__.__module__}.{self.__class__.__qualname__}"
+ f"({repr(self.key)}, {repr(self.id)}, {repr(self.name)}, {repr(self.value)}"
+ f", {repr(self.uri)})"
+ )
+
+
+class KeyValuePairs(UserDict):
+ """A UserDict to store KeyValueEntries.
+
+ Parameters
+ ----------
+ entries : Iterable
+ an iterable containing entry information
+ """
+
+ def __init__(self, entries: Iterable[Union[Dict, KeyValueEntry]] = None):
+ """Initialize the KeyValuePairs dictionary class.
+
+ Parameters
+ ----------
+ entries: Iterable
+ An iterable of dictionaries or KeyValueEntry, which will be inputted to the
+ dictionary.
+ """
+ super().__init__()
+ if entries:
+ for item in entries:
+ entry = KeyValueEntry.from_data(item)
+ self.data[entry.key] = entry
+
+ def __setitem__(self, key: str, item: Union[Dict, KeyValueEntry]) -> None:
+ """Set item.
+
+ Parameters
+ ----------
+ key: str
+ item: dictionary or KeyValueEntry
+ """
+ entry = KeyValueEntry.from_data(item)
+ self.data[key] = entry
+
+ def __str__(self) -> str:
+ """Convert KeyValuePairs to str.
+
+ Parameters
+ ----------
+ self : KeyValuePairs
+ UserDict defining key value pairs
+
+ Returns
+ ------
+ string
+ a string representation of a dictionary
+ """
+ return str(self.to_dict())
+
+ def __repr__(self) -> str:
+ """Get string representation, including module and class name.
+
+ Returns
+ -------
+ str
+ """
+ return (
+ f"{self.__class__.__module__}.{self.__class__.__qualname__}"
+ f"({self.to_dict()!r})"
+ )
+
+ def _repr_html_(self) -> str:
+ """Get HTML representation.
+
+ Returns
+ -------
+ str
+ HTML formatted string
+ """
+ return f"""KeyValuePairs
{format_long_string(
+ self.__str__(), 100)}
"""
+
+ def to_dict(self) -> dict:
+ """Get dictionary representation.
+
+ Returns
+ -------
+ dict
+ keys are the keys, and each value is the KeyValueEntry represented as
+ a dict.
+ """
+ return {k: asdict(v) for k, v in self.data.items()}
+
+ #query
+
+ #add_key_value_pair
+ #delete_key_value_pair?? Maybe with query
diff --git a/src/cobra/core/metadata/cvterm.py b/src/cobra/core/metadata/cvterm.py
new file mode 100644
index 000000000..726a5056a
--- /dev/null
+++ b/src/cobra/core/metadata/cvterm.py
@@ -0,0 +1,1148 @@
+"""Define the Controlled Vocabulary term class."""
+
+import re
+from collections import UserList
+from enum import Enum
+from typing import Callable, Dict, FrozenSet, Iterable, List, Optional, Pattern, Union
+
+from .helper import URL_IDENTIFIERS_PATTERN, parse_identifiers_uri
+
+
+class Qualifier(Enum):
+ """The possible qualifiers inside a CVTerm.
+
+ The qualifiers and their detailed description are present in
+ https://co.mbine.org/standards/qualifiers.
+
+ Qualifiers are divided into two groups
+ bqb These kinds of qualifiers define the relationship between a biological
+ object represented by a model element and its annotation.
+ bqm These kinds of qualifiers define the relationship between a modelling
+ object and its annotation.
+ """
+
+ bqb_is = "bqb_is"
+ bqb_hasPart = "bqb_hasPart"
+ bqb_isPartOf = "bqb_isPartOf"
+ bqb_isVersionOf = "bqb_isVersionOf"
+ bqb_hasVersion = "bqb_hasVersion"
+ bqb_isHomologTo = "bqb_isHomologTo"
+ bqb_isDescribedBy = "bqb_isDescribedBy"
+ bqb_isEncodedBy = "bqb_isEncodedBy"
+ bqb_encodes = "bqb_encodes"
+ bqb_occursIn = "bqb_occursIn"
+ bqb_hasProperty = "bqb_hasProperty"
+ bqb_isPropertyOf = "bqb_isPropertyOf"
+ bqb_hasTaxon = "bqb_hasTaxon"
+ bqb_unknown = "bqb_unknown"
+ bqm_is = "bqm_is"
+ bqm_isDescribedBy = "bqm_isDescribedBy"
+ bqm_isDerivedFrom = "bqm_isDerivedFrom"
+ bqm_isInstanceOf = "bqm_isInstanceOf"
+ bqm_hasInstance = "bqm_hasInstance"
+ bqm_unknown = "bqm_unknown"
+
+
+class CVTerm:
+ """CVTerm class, representing controlled vocabulary.
+
+ Controlled Vocabulary (CVTerm) can be defined as a curated and controlled
+ relationship, described by Qualifier (see above) - the relationship between an
+ object and annotation must be part of the Qualifier class. These relationships
+ are based in biochemical or biological relationships. The qualifiers/relationships
+ are divided into bqbiol/bqb (biological qualification) and bqmodel/bqm (model
+ qualifications). See two examples:
+ "bqb_is" The biological entity represented by the SBML component is the subject
+ of the referenced resource. This could serve to link a reaction to its counterpart
+ in (e.g.) the ChEBI or Reactome databases.
+ "bqm_is" The modeling object encoded by the SBML component is the subject of
+ the referenced resource. This might be used, e.g., to link the model
+ to an entry in a model database.
+ See https://co.mbine.org/standards/qualifiers
+ For a definition of all qualifiers, see SBML Level 3, Version 2 Core, p 104
+ (http://co.mbine.org/specifications/sbml.level-3.version-2.core.release-2.pdf)
+
+ The annotation will have one or more URI, which are encapsulated in
+ ExternalResources class (see below).
+
+ Each CVTerm has only ONE qualifier, and can have many URI in the resources. If
+ you need to use another qualifier, it can be nested data (if relevant), or it
+ should be in another CVTerm.
+ If an object has multiple CVTerms, they are placed in a CVTermList (see below).
+
+ This is how a CVTerm object looks :
+ CVTerm.qualifier = "bqb_is"
+ CVTerm.ex_res =
+ {"resources": [
+ "resource_uri",
+ ...
+ ],
+ "nested_data":CVTermList Object
+ }
+
+ Examples of how CVTerms can be used
+
+ Model examples (Each of these is a separate CVTerm)
+ qualifier=bqm_is
+ resources=["https://identifiers.org/biomodels.db/BIOMD0000000003"]
+ A model identifier
+ qualifier=bqm_isDescribed_by
+ resources=["https://identifiers.org/pubmed/1833774"]
+ A published article detailing the model
+ qualifier=bqm_isVersionOf
+ resources=["https://identifiers.org/wikipathways/WP179",
+ "https://identifiers.org/reactome/REACT_152"/]
+ Two links to what this model is a version of (in this case, cell cycle).
+
+ Reaction examples
+ qualifier=bqb_is
+ resources=["https://identifiers.org/reactome/REACT_6327"/]
+ A link to a reaction database that details reactions.
+ qualifier=bqb_hasPart
+ resources=["http://identifiers.org/uniprot/P04551",
+ http://identifiers.org/uniprot/P10815"]
+ resources.nested_date = {
+ qualifier=bqb_isDescribedby
+ resources=["https://identifiers.org/pubmed/1111111"]
+ Two proteins that form part of the same complex. The nested data links to an
+ article describing the formation of the complex.
+ It is nested data because it is relevant to the hasPart CVTerm, but uses a
+ different qualifier.
+ """
+
+ def __init__(
+ self,
+ ex_res: Optional[Union["ExternalResources", Dict, str]] = None,
+ qualifier: Union[Qualifier, str] = Qualifier.bqb_is,
+ ):
+ """Initialize a CVTerm.
+
+ Parameters
+ ----------
+ ex_res: ExternalResources or dict
+ The external resources (URI format), which may include nested data. Can be
+ qualifier: Qualifier or str
+ The qualifier for the relationship.
+ """
+ self._ex_res = None
+ self._qualifier = None
+ self._ex_res = self.check_ex_res_type(ex_res)
+ self._qualifier = self.check_qualifier_type(qualifier)
+
+ @property
+ def qualifier(self) -> Qualifier:
+ """Get qualifier for CVTerm.
+
+ Returns
+ -------
+ Qualifier
+ """
+ return self._qualifier
+
+ @qualifier.setter
+ def qualifier(self, qualifier: Union[str, Qualifier]) -> None:
+ """Set Qualifier.
+
+ Parameters
+ ----------
+ qualifier - str, int or Qualifier
+ Is converted to the Qualifier class.
+
+ See Also
+ --------
+ CVTerm.check_qualifier_type()
+ """
+ self._qualifier = self.check_qualifier_type(qualifier)
+
+ @property
+ def external_resources(self) -> "ExternalResources":
+ """Get external resources.
+
+ Returns
+ -------
+ ExternalResources
+ """
+ return self._ex_res
+
+ @external_resources.setter
+ def external_resources(
+ self, external_resources: Union[dict, "ExternalResources"]
+ ) -> None:
+ """Set external resources.
+
+ Parameters
+ ----------
+ external_resources - dict or ExternalResources
+ Is converted to the ExternalResources class.
+
+ See Also
+ --------
+ CVTerm.check_ex_res_type()
+ """
+ self._ex_res = self.check_ex_res_type(external_resources)
+
+ @property
+ def resources(self) -> FrozenSet:
+ """Get all resources.
+
+ Returns:
+ -------
+ FrozenSet:
+ a set of all resources in the CVTerm as a set of strings
+ including external resources of nested data as strings
+ """
+ return self.external_resources.resource_nested
+
+ @staticmethod
+ def check_ex_res_type(
+ ex_res: Optional[Union["ExternalResources", Dict, str]]
+ ) -> "ExternalResources":
+ """Check and parse input to ExternalResources.
+
+ Parameters
+ ----------
+ ex_res: ExternalResources or dict or str, optional
+ Input data to check if it is or can be transformed to ExternalResources
+ class. String must start with http:// or https:// to be acceptable.
+ Dictionary must match the format required by from_dict.
+ If None is given, an empty ExternalResources is returned.
+ No parsing of identifiers/URIs is done, perhaps in future versions.
+
+ Returns
+ -------
+ ExternalResources
+
+ Raises
+ ------
+ TypeError
+ If given anything other than None, str, dict or ExternalResources.
+ Will raise this error if given a string that does not start with http(s)://
+
+ See Also
+ --------
+ ExternalResources.from_dict()
+ """
+ if ex_res is None:
+ return ExternalResources()
+ elif isinstance(ex_res, ExternalResources):
+ return ex_res
+ elif isinstance(ex_res, dict):
+ return ExternalResources.from_dict(ex_res)
+ elif isinstance(ex_res, str) and ("http://" in ex_res or "https://" in ex_res):
+ return ExternalResources(resources=[ex_res])
+ else:
+ raise TypeError(
+ f"Allowed types for CVTerm ex_res are ExternalResources, str, None, "
+ f"or dict, not {type(ex_res)}: {ex_res}"
+ )
+
+ @staticmethod
+ def check_qualifier_type(qual: Union[str, Qualifier]) -> Qualifier:
+ """Check and parse input to Qualifier class.
+
+ Parameters
+ ----------
+ qual: str or Qualifier, optional
+ Input data to check if it is or can be transformed to Qualifier class.
+ Strings must be a member of the Qualifier values.
+ If None is given, an empty Qualifier is returned.
+
+ Returns
+ -------
+ Qualifier
+
+ Raises
+ ------
+ TypeError
+ If given anything other than None, str, or Qualifier.
+ Will raise this error if given a string that does not match the defined
+ Qualifier members.
+ """
+ if isinstance(qual, str) and qual not in Qualifier.__members__:
+ raise TypeError(f"{qual} is not a supported enum Qualifier")
+ elif isinstance(qual, Qualifier):
+ return qual
+ elif isinstance(qual, str):
+ return Qualifier[qual]
+ else:
+ raise TypeError(
+ f"Allowed types for CVTerm qualifier must be Qualifier,"
+ f"str member of the Qualifier enum {type(qual)}, {qual}"
+ )
+
+ def to_dict(self) -> Dict:
+ """Represent a CVTerm object in python dict.
+
+ Returns
+ -------
+ dict:
+ A dict that has two keys
+ "qualifier" - the qualifier as a string
+ "external_resources" - the resources as a dictionary
+
+ See Also
+ --------
+ ExternalResources.to_dict()
+
+ """
+ return {
+ "qualifier": self.qualifier.value,
+ "external_resources": self.external_resources.to_dict(),
+ }
+
+ @classmethod
+ def from_dict(cls, data_dict: Dict) -> "CVTerm":
+ """Generate a CVTerm object based on a python dict.
+
+ Parameters
+ ----------
+ data_dict: dict
+ A dict that has two keys
+ "qualifier" - the qualifier as a string, optional. If not present, the
+ qualifier is set to bqb_is.
+ "external_resources" - the resources as a dictionary, optional
+
+ Returns
+ -------
+ CVTerm
+
+ See Also
+ --------
+ ExternalResources.to_dict()
+
+ """
+ return cls(
+ ex_res=data_dict.get("external_resources", None),
+ qualifier=data_dict.get("qualifier", Qualifier["bqb_is"]),
+ )
+
+ def __eq__(self, other: Union["CVTerm", dict]) -> bool:
+ """Compare two CVTerm objects and return boolean for equality.
+
+ If a dict is given, it is transformed to CVTerm.
+ First, the qualifier is compared. If they are not identical, False is returned.
+ Then the external resources are compared, see ExternalResources.__eq__().
+
+ Parameters
+ ----------
+ other: dict or CVTerm
+
+ Returns
+ -------
+ bool
+ False if other is not CVTerm or dict.
+ False if qualifiers are different, or external resources are different.
+ True if qualifier and external resources are identical.
+
+ See Also
+ --------
+ CVTerm.from_dict()
+ ExternalResources.__eq__()
+ """
+ if not isinstance(other, (CVTerm, dict)):
+ return False
+ if isinstance(other, dict):
+ return self == CVTerm.from_dict(other)
+ if self.qualifier != other.qualifier:
+ return False
+ if self.external_resources != other.external_resources:
+ return False
+ return True
+
+ def __repr__(self) -> str:
+ """Return the CVTerm as str with module, class, and code to recreate it.
+
+ Returns
+ -------
+ str
+ """
+ return (
+ f"{self.__class__.__module__}.{self.__class__.__qualname__}"
+ f"({self.to_dict()})"
+ )
+
+ def _repr_html_(self) -> str:
+ """Return the CVTerm as HTML string with qualifier, resources and address.
+
+ Returns
+ -------
+ str
+ HTML formatted string
+ """
+ return f"""
+ {self.qualifier.name}:
+ "Resources"
+ {"
".join([res for res in self.external_resources.resources])}
+ Memory address{id(self):#x}
+ """
+
+
+class CVTermList(UserList):
+ """A list of CVTerm objects.
+
+ Representation of multiple CVTerm objects in a list. It is list that contains
+ CVTerm objects. As a list, it means that objects can repeat, and that the order is
+ maintained.
+
+ CVTermList is built using UserList, which means that the actual list can be
+ accessed using CVTermList.data. As a list, the order is kept, items may repeat.
+ __init__, __setitem__, __append__, __extend__ will check the data to make sure it
+ is a CVTerm or can be transformed to CVTerm using _check_CVTerm().
+ All list functions that are not overloaded will behave like standard lists.
+
+ Parameters
+ ----------
+ data : list
+ a list containing qualifier and external resources in CVTerm format
+
+ 1. The only way to add annotation data via old format is by
+ using the method "add_simple_annotations()". This will set all qualifiers as
+ "bqb_is". If you want to use other qualifiers and/or nested data, use
+ add_cvterms() or extend().
+ 2. Multiple CVTerm data can be added by using add_cvterms() or extend(). Both
+ accept iterables, including CVTermList.
+ """
+
+ def __init__(self, data: Iterable[Union[CVTerm, Dict]] = None):
+ """Initialize CVTermList object.
+
+ Parameters
+ ----------
+ data: Iterable of dict or CVTerm
+ Dicts will be transformed to CVTerm via _check_CVTerm.
+
+ Notes
+ -----
+ _check_CVTerm will raise TypeError if given a class other than dict or CVTerm,
+ so initialization of CVTermList may raise TypeError.
+ """
+ if data is None:
+ data = []
+ data = [self._check_CVTerm(datum) for datum in data]
+ super().__init__(data)
+
+ @staticmethod
+ def _check_CVTerm(cvterm: Union[CVTerm, Dict]) -> Optional["CVTerm"]:
+ if cvterm is None:
+ return
+ if isinstance(cvterm, CVTerm):
+ return cvterm
+ elif isinstance(cvterm, dict):
+ return CVTerm.from_dict(cvterm)
+ else:
+ raise TypeError(
+ f"Allowed types for CVTerm ex_res are CVTerm "
+ f"or dict, not {type(cvterm)}: {cvterm}"
+ )
+
+ @staticmethod
+ def from_data(data: Optional[Union[List, "CVTerm", "CVTermList"]]) -> "CVTermList":
+ """Parse a CVTermList object from given data.
+
+ Parameters
+ ----------
+ data: list, CVTerm or CVTermList or None, optional
+ This will be transformed to CVTermList class.
+ None will result in an empty CVTermList.
+ CVTerm will be placed in a list and become a CVTermList.
+ If given CVTermList, will return the data untransformed.
+
+ Returns
+ -------
+ CVTermList
+
+ Raises
+ ------
+ TypeError
+ If not given None, dict, CVTerm or CVTermList.
+ """
+ if data is None:
+ return CVTermList()
+ elif isinstance(data, list):
+ return CVTermList(data)
+ elif isinstance(data, CVTerm):
+ return CVTermList([data])
+ elif isinstance(data, CVTermList):
+ return data
+ else:
+ raise TypeError(f"Invalid format for CVTermList: '{data}'")
+
+ def to_list_of_dicts(self) -> List[dict]:
+ """Represent a CVTermList object as a list of python dicts.
+
+ Returns:
+ -------
+ list:
+ a list where each item is a dict, made by CVTerm.to_dict(). Used for JSON
+ and YAML export.
+
+ See Also
+ --------
+ CVTerm.to_dict()
+ """
+ return [cvterm.to_dict() for cvterm in self.data]
+
+ def add_cvterms(self, cvterms: Iterable[Union["CVTerm", Dict]]) -> None:
+ """Add multiple CVTerm to CVTermList.
+
+ Parameters
+ ----------
+ cvterms : Iterable
+ CVTermList list of CVTerms or CVTerm dicts to be added to the CVTermList
+ """
+ self.extend(cvterms)
+
+ def add_simple_annotations(self, data: Dict = None) -> None:
+ """Add simple annotation.
+
+ Adds standardized via old annotation format (dictionary like format).
+ The default qualifier, i.e "bqb_is", will be used.
+ This function will add identifiers.org to the keys given to form the URI.
+ If the annotation does not match the identifiers format, you should use
+ add_cvterms directly (and create the correct link) and/or use the
+ custompairs field of annotation.
+
+ This function will skip "sbo" keys since they should be added via
+ annotation["sbo"], see MetaData.
+
+ Parameters
+ ----------
+ data : dict
+ the data in old annotation format
+ keys are str representing namespace
+ If the value is a list, each value is added to the namespace, making a
+ CVTerm with one ExternalResources object htat has mulitple URIs. If the
+ value is a string, then only one value will be added to the namespace.
+
+ Examples
+ --------
+ >>> from cobra import Species
+ >>> s = Species()
+ >>> s.annotation.standardized.add_simple_annotations({"chebi": "CHEBI:17234"})
+ >>> s.annotation.standardized.add_simple_annotations({"chebi": ["CHBEI:1723456", "CHEBI:172345"]})
+ >>> s.annotation
+ >>> s.annotation.standardized
+ >>> s.annotation.annotations
+ """
+ if data is None:
+ data = {}
+
+ if not isinstance(data, dict):
+ raise TypeError(f"The data passed must be of type dict: {data}")
+
+ cvterm_list = []
+ for key, value in data.items():
+
+ if not isinstance(value, (list, str)):
+ raise TypeError(
+ f"The value passed must be of type list or str: {value}"
+ )
+ if key.lower() == "sbo":
+ continue
+
+ qual = Qualifier["bqb_is"]
+ # if there is only one identifier i.e. annotation
+ # of the form { "chebi": ["CHEBI:17234"]}
+ if isinstance(value, str):
+ uri = ["https://identifiers.org/" + key + "/" + value]
+ # if there are multiple identifiers for this key i.e. annotation
+ # of the form { "chebi": ["CHEBI:124", "CHEBI:17234"]}
+ elif isinstance(value, list):
+ uri = [
+ "https://identifiers.org/" + key + "/" + identifier
+ for identifier in value
+ ]
+ else:
+ raise TypeError(
+ f"The identifier passed must be of type string or list: {value}"
+ )
+ cvterm_list.append(CVTerm(ex_res=ExternalResources(uri), qualifier=qual))
+ self.add_cvterms(cvterm_list)
+
+ def delete_annotation(self, resource: Union[str, Pattern]) -> None:
+ """Delete annotation - the converse of add_simple_annotation.
+
+ This will go over the CVTerms, and delete all resources that match the pattern.
+ It will call the funciton recursively for ExternalResources that have
+ nested_data.
+ CVTerms that end with neither resources nor nested data are removed.
+
+ Parameters
+ ----------
+ resource: str or Pattern
+
+ Examples
+ --------
+ >>> from cobra.io import load_model
+ >>> e_coli = load_model('iJO1366')
+ >>> e_coli.annotation
+ >>> e_coli.annotation.standardized.delete_annotation('bigg')
+ >>> e_coli.annotation
+ >>> e_coli.annotation.annotations
+ >>> e_coli.metabolites[0].annotation.standardized
+ >>> e_coli.metabolites[0].annotation.standardized.delete_annotation(r'/bi\S+')
+ """
+ regex_searcher = re.compile(resource)
+ tmp_cvterm_list = []
+ for cvterm in self.data:
+ cvterm.external_resources.resources = [
+ res
+ for res in cvterm.external_resources.resources
+ if not regex_searcher.findall(res)
+ ]
+ if cvterm.external_resources.nested_data:
+ cvterm.external_resources.nested_data.delete_annotation(resource)
+ if (
+ cvterm.external_resources.resources
+ or cvterm.external_resources.nested_data
+ ):
+ tmp_cvterm_list.append(cvterm)
+ self.data = tmp_cvterm_list
+
+ @property
+ def annotations(self) -> Dict:
+ """Return CVTermList as annotation dictionary.
+
+ This function will return the CVTermList as a sorted annotation dictionary in
+ the older annotation format. In the dictionary, the keys are the namespaces,
+ while the values are lists of annotation identifiers.
+
+ Qualifiers are not present in the annotation dictionary. This function will
+ use CVTermList.resources(), which will get all resources of all CVTerm objects,
+ including nested resources.
+
+ Different CVTerms will be unified by namespace. Namespaces and values are
+ sorted in the dictionary, to avoid shifting caused by usage of sets.
+
+ For example, a CVTermList that looks like
+
+ [
+ {
+ "external_resources": {
+ "resources": [
+ "https://identifiers.org/uniprot/P69906",
+ "https://identifiers.org/uniprot/P68871",
+ "https://identifiers.org/kegg.compound/C00032",
+ ]
+ },
+ "qualifier": "bqb_hasPart",
+ },
+ {
+ "qualifier": "bqb_hasPart",
+ "external_resources": {
+ "resources": [
+ "https://identifiers.org/uniprot/P69905",
+ "https://www.uniprot.org/uniprot/P68871",
+ "https://identifiers.org/chebi/CHEBI:17627",
+ ],
+ "nested_data": {
+ "qualifier": "bqb_isDescribedBy",
+ "external_resources": {
+ "resources": [
+ "https://identifiers.org/eco/000000",
+ ]
+ },
+ },
+ },
+ ]
+
+ Will be outputted as a dictionary that looks like
+ {
+ "chebi": ["CHEBI:17627"],
+ "eco": ["000000"],
+ "kegg.compound": ["C00032"],
+ "uniprot": ["P68871", "P69905", "P69906"],
+ }
+
+ Returns
+ -------
+ dict
+ Dictionary where keys are namespaces, sorted in ascending order. Values
+ are lists of identifiers, also sorted in ascentding order.
+
+ """
+ annotation_dict = {}
+ resources = self.resources
+ for res in resources:
+ if re.match(URL_IDENTIFIERS_PATTERN, res):
+ namespace, identifier = parse_identifiers_uri(res)
+ if namespace in annotation_dict.keys():
+ annotation_dict[namespace].append(identifier)
+ else:
+ annotation_dict[namespace] = [identifier]
+ return {k: sorted(annotation_dict[k]) for k in sorted(annotation_dict.keys())}
+
+ @property
+ def resources(self) -> FrozenSet[str]:
+ """Get all resources.
+
+ Returns:
+ -------
+ FrozenSet:
+ a set of all external resources in the original self.data list of CVTerms
+ including external resources of nested data. The Set contains the URIs as
+ strings, not in the ExternalResources format.
+ """
+ resources = set()
+ for datum in self.data:
+ if (
+ datum.external_resources.resources
+ or datum.external_resources.nested_data
+ ):
+ resources.update(datum.external_resources.resource_nested)
+ return frozenset(resources)
+
+ @property
+ def qualifiers(self) -> FrozenSet[Qualifier]:
+ """Get all qualifiers used by CVTerm objects in the CVTermList.
+
+ Returns:
+ -------
+ FrozenSet:
+ a frozen set of all qualifiers in the original self.data list of CVTerms
+ """
+ qualifier_set = set()
+ for datum in self.data:
+ qualifier_set.add(datum.qualifier)
+ return frozenset(qualifier_set)
+
+ def query(
+ self,
+ search_function: Union[str, Pattern, Callable],
+ attribute: Union[str, None] = None,
+ ) -> "CVTermList":
+ """Query the CVTermList and return a list of CVTerm objects.
+
+ Parameters
+ ----------
+ search_function : a string, regular expression or function
+ Used to find the matching elements in the list.
+ - a regular expression (possibly compiled), in which case the
+ given attribute of the object should match the regular expression.
+ - a function which takes one argument and returns True for
+ desired values
+
+ attribute : string or None
+ the name attribute of the object to passed as argument to the
+ `search_function`. If this is None and a regular expression/string is given,
+ will match the regular expression to both qualifier and resources.
+
+ Returns
+ -------
+ CVTermList
+ a new list of CVTerm objects which match the query
+
+ Examples
+ --------
+ >>> from cobra.io import load_model
+ >>> model = load_model('iJO1366')
+ >>> model.annotation.standardized.query('bqb', 'qualifier')
+ >>> import re
+ >>> regex = re.compile('^bqm')
+ >>> model.annotation.standardized.query(regex, 'qualifier')
+ """
+
+ def select_attribute(
+ x: CVTerm,
+ ) -> Union[CVTerm, ExternalResources, Qualifier, set]:
+ if attribute is None:
+ return x
+ else:
+ return getattr(x, attribute)
+
+ try:
+ # if the search_function is a regular expression
+ regex_searcher = re.compile(search_function)
+
+ if attribute is None:
+ attribute = ""
+
+ if attribute == "qualifier":
+ matches = [
+ cvterm
+ for cvterm in self.data
+ if regex_searcher.findall(select_attribute(cvterm).name) != []
+ ]
+ elif attribute == "resources":
+ matches = [
+ cvterm
+ for cvterm in self.data
+ if any(
+ regex_searcher.findall(res) for res in select_attribute(cvterm)
+ )
+ ]
+ elif attribute == "external_resources":
+ matches = [
+ cvterm
+ for cvterm in self.data
+ if any(
+ regex_searcher.findall(res)
+ for res in select_attribute(cvterm).resources
+ )
+ ]
+ else:
+ matches = [
+ cvterm
+ for cvterm in self.data
+ if regex_searcher.findall(cvterm.qualifier.name) != []
+ or any(regex_searcher.findall(res) for res in cvterm.resources)
+ ]
+ except TypeError:
+ matches = [
+ cvterm
+ for cvterm in self.data
+ if search_function(select_attribute(cvterm))
+ ]
+
+ results = self.__class__(matches)
+ return results
+
+ def __setitem__(self, key: int, value: Union[CVTerm, Dict]) -> None:
+ """Set item in CVTermList.
+
+ This function will check that it is a valid item, converting it to CVTerm if
+ necessary (see _check_CVTerm).
+
+ Parameters
+ ----------
+ key: int
+ value: CVTerm or dict
+ dict will be converted to CVTerm
+ """
+ UserList.__setitem__(self, key, self._check_CVTerm(value))
+
+ def append(self, item: Union[CVTerm, Dict]) -> None:
+ """Append CVTerm to end.
+
+ Parameters
+ ----------
+ item: CVTerm or dict
+ dict will be converted to CVTerm.
+ """
+ self._check_CVTerm(item)
+ UserList.append(self, item)
+
+ def extend(
+ self, iterable: Union["CVTermList", Iterable[Union[CVTerm, Dict]]]
+ ) -> None:
+ """Extend data list by appending elements from the iterable.
+
+ Parameters
+ ----------
+ iterable : Iterable
+ """
+ if isinstance(iterable, CVTermList):
+ self.data.extend(iterable.data)
+ elif isinstance(iterable, Iterable):
+ self.data.extend([self._check_CVTerm(i) for i in iterable])
+
+ def __eq__(self, other: [list, "CVTermList"]) -> bool:
+ """Compare two CVTermList objects to find out whether they are the same.
+
+ Equality is defined as them having the same data, but not necessarily the same
+ objects. If the given item is not a CVTermList or list, this function will
+ return False.
+
+ Parameters
+ ----------
+ other: CVTermList or list
+
+ Returns
+ -------
+ bool: True if the data matches, False otherwise
+ """
+ if isinstance(other, list):
+ return self.__eq__(CVTermList.from_data(other))
+ if not isinstance(other, CVTermList):
+ return False
+ if len(self.data) != len(other.data):
+ return False
+ for self_i, other_i in zip(self.data, other.data):
+ if self_i != other_i:
+ return False
+ return True
+
+ def _repr_html_(self) -> str:
+ """Generate CVTermList as HTML.
+
+ Returns
+ -------
+ str
+ HTML representation of the list of CVTerm resources.
+ """
+ return f"""CVTermList{"
".join([cvterm._repr_html_()
+ for cvterm in self.data])}"""
+
+
+class ExternalResources:
+ """Representation of a single set of resources and its nested annotation.
+
+ Each resource in the resources fields is a URI that uniquely identifies both the
+ resource and the data within the resource. Since a URI is not a URL, it does not
+ have to map to a physical Web object; it simply needs to identify, uniquely, a
+ controlled vocabulary term or database object.
+ These URIs are MIRIAM identifiers, following the format defined in
+ https://identifiers.org/.
+
+ The format allowed is
+ https://identifiers.org/[provider_code/]namespace:accession
+
+ The optional parameter provider_code denotes the Provider Code part of the Prefix.
+ It is trailed by a slash, to separate it from the required namespace,
+ which is followed by a colon and the accession.
+
+ Example Resources URIs
+ ----------------------
+ https://identifiers.org/pubmed:22140103
+ https://identifiers.org/ec-code:1.1.1.1
+
+ https://identifiers.org/epmc/pubmed:22140103
+ https://identifiers.org/expasy/ec-code:1.1.1.1
+
+
+ Parameters
+ ----------
+ resources: list or str
+ A list of URIs (resources)
+ nested_data : CVTermList
+ Nested annotation, in CVTermList format
+
+ Can also be created from dictionary, see ExternalResources.from_dict()
+ """
+
+ def __init__(
+ self,
+ resources: Optional[Union[List, str]] = None,
+ nested_data: Optional[Union[Dict, CVTerm, CVTermList]] = None,
+ ):
+ """Initialize ExternalResources object.
+
+ Parameters
+ ----------
+ resources: list or str, optional
+ A list of URIs (resources) or str. Str will be placed in a list if only
+ one resource is used.
+ nested_data : dict or CVTerm or CVTermList, optional
+ Nested annotation, in CVTermList format
+
+ See Also
+ --------
+ ExternalResources.resources()
+ ExternalResources.nested_data()
+ """
+ self._resources = None
+ self._nested_data = None
+ self.resources = resources
+ if resources:
+ self.nested_data = nested_data
+
+ @property
+ def resources(self) -> FrozenSet:
+ """Get resources of ExternalResources.
+
+ Returns
+ -------
+ frozenset:
+ The list of URIs in a frozenset.
+ """
+ return frozenset(self._resources)
+
+ @resources.setter
+ def resources(self, value: Union[List[str], str]) -> None:
+ """Set resources of ExternalResources.
+
+ Will set the URIs of ExternalResources.
+
+ Parameters
+ ----------
+ value: str or list
+ Should be list of URIs. If only one string is given, the function
+ assumes it is one URI, and it is placed in a list.
+ If None is given, the resources field is set to an empty list.
+
+ Raises
+ ------
+ TypeError
+ If value is neither list nor str.
+ """
+ if value is None:
+ value = []
+ if isinstance(value, list):
+ self._resources = value
+ elif isinstance(value, str):
+ self._resources = [value]
+ else:
+ raise TypeError(f"The resources must be a string or a list: {value}")
+
+ @property
+ def resource_nested(self) -> FrozenSet:
+ """Get resources, including resources of nested data.
+
+ This will get resources of the current ExternalResource and all resources
+ of nested data, if they exist.
+
+ Returns
+ -------
+ FrozenSet: a frozen set of URIs
+ """
+ resources = set()
+ resources.update(self.resources)
+ if self.nested_data:
+ resources.update(self.nested_data.resources)
+ return frozenset(resources)
+
+ @property
+ def nested_data(self) -> Optional[CVTermList]:
+ """Get nested data of ExternalResources.
+
+ Returns
+ -------
+ CVTermList: optional
+ Will return None if this ExternalResources object has no nested data.
+ """
+ return self._nested_data
+
+ @nested_data.setter
+ def nested_data(self, value: Optional[Union[Dict, List, CVTerm, CVTermList]]):
+ """Set nested data of ExternalResources.
+
+ This function will convert the given value to CVTermList as follows
+ - dict is converted to CVTerm via CVTerm.from_dict()
+ - list is converted via CVTermList.from_data()
+ - CVTerm is placed in a list and tranformed to CVTermList
+ - CVTermList is unchanged
+ - None will set the nested_data as an empty CVTermList (used for new
+ ExternalResources objects)
+
+ Parameters
+ ----------
+ value: dict or list or CVTerm or CVTermList, optional
+
+ Raises
+ ------
+ TypeError
+ If value is neither None, list, CVTerm or CVTermList.
+ """
+ if value is None:
+ self._nested_data = CVTermList()
+ elif isinstance(value, CVTerm):
+ self._nested_data = CVTermList([value])
+ elif isinstance(value, CVTermList):
+ self._nested_data = value
+ elif isinstance(value, list):
+ self._nested_data = CVTermList.from_data(value)
+ elif isinstance(value, dict):
+ self._nested_data = CVTermList.from_data(CVTerm.from_dict(value))
+ else:
+ raise TypeError(
+ f"The nested data structure does not have valid CVTerm format: {value}"
+ )
+
+ def to_dict(self):
+ """Generate a dict representing an ExternalResource object.
+
+ Returns
+ -------
+ dict
+ A dictionary with two keys
+ "resources" - sorted list of resources.
+ "nested_data" - optional, dict of nested_data. See CVTermList.to_dict()
+ """
+ ex_dic = {"resources": sorted(self._resources)}
+ if self.nested_data is not None and len(self.nested_data):
+ ex_dic["nested_data"] = self.nested_data.to_list_of_dicts()
+ return ex_dic
+
+ @classmethod
+ def from_dict(cls, input_data: Dict) -> "ExternalResources":
+ """Generate ExternalResources object from dict.
+
+ Parameters
+ ----------
+ input_data: dict
+ Accepts a dictionary as input that has two keys
+ "resources", optional a list of URIs
+ "nested_data", optional - nested data. Nested data must be a list,
+ CVTerm or CVTermList.
+
+ Returns
+ -------
+ ExternalResources
+
+ See Also
+ --------
+ ExternalResources.nested_data
+
+ """
+ ex_res = cls(
+ resources=input_data.get("resources", None),
+ nested_data=input_data.get("nested_data", None),
+ )
+ return ex_res
+
+ def __eq__(self, other: "ExternalResources") -> bool:
+ """Compare two ExternalResources object.
+
+ Compare two ExternalResources objects to find out whether
+ they are same (have same data) or not.
+
+ Returns
+ -------
+ bool
+ True if resources are equal in both objects, and both objects have the same
+ nested_data (None or identical CVTerm). False otherwise.
+ """
+ if self.resources != other.resources:
+ return False
+ if self.nested_data is None and other.nested_data is None:
+ return True
+ elif self.nested_data is None or other.nested_data is None:
+ return False
+ elif self.nested_data != other.nested_data:
+ return False
+ return True
+
+ def __str__(self) -> str:
+ """Return ExternalResources dictionary as str.
+
+ Returns
+ -------
+ str
+ String output of to_dict().
+
+ See Also
+ --------
+ ExternalResources.to_dict()
+ """
+ return str(self.to_dict())
+
+ def __repr__(self) -> str:
+ """Generate ExternalResources as str, with class.
+
+ Returns
+ -------
+ str
+ """
+ return (
+ f"{self.__class__.__module__}.{self.__class__.__qualname__} "
+ f"{self.__str__()}"
+ )
+
+ def _repr_html_(self) -> str:
+ """Generate ExternalResources as HTML.
+
+ Returns
+ -------
+ str
+ HTML representation of the external resource.
+ """
+ html_rep = f"""
+
+ Resources{"
".join(self.resources)}
"""
+ if self.nested_data is not None and len(self.nested_data):
+ html_rep += f"""Nested Data{self.nested_data}
"""
+
+ html_rep += f"""
+ Memory address{id(self):#x}
+
"""
+ return html_rep
diff --git a/src/cobra/core/metadata/helper.py b/src/cobra/core/metadata/helper.py
new file mode 100644
index 000000000..9f1aa7e93
--- /dev/null
+++ b/src/cobra/core/metadata/helper.py
@@ -0,0 +1,45 @@
+"""Helper functions and properties for dealing with annotation data.
+
+This is a unification of helper functions from sbml.py and cvterm.py.
+
+"""
+import logging
+import re
+from typing import Tuple, Union
+
+
+LOGGER = logging.getLogger(__name__)
+
+__all__ = ["URL_IDENTIFIERS_PATTERN", "parse_identifiers_uri"]
+
+# the URL pattern to parse namespace and identifier
+URL_IDENTIFIERS_PATTERN = re.compile(r"^https?://identifiers.org/(.+?)[:/](.+)")
+
+
+def parse_identifiers_uri(uri: str) -> Union[None, Tuple[str, str]]:
+ """Parse namespace and term from given identifiers annotation uri.
+
+ Parameters
+ ----------
+ uri : str
+ uri (identifiers.org url)
+
+ Returns
+ -------
+ (namespace, identifier) if resolvable, None otherwise
+ """
+ match = URL_IDENTIFIERS_PATTERN.match(uri)
+ if match:
+ namespace, identifier = match.group(1), match.group(2)
+ if namespace.isupper():
+ identifier = f"{namespace}:{identifier}"
+ namespace = namespace.lower()
+ else:
+ LOGGER.warning(
+ f"{uri} does not conform to "
+ f"'http(s)://identifiers.org/collection/id' or"
+ f"'http(s)://identifiers.org/COLLECTION:id"
+ )
+ return None
+
+ return namespace, identifier
diff --git a/src/cobra/core/metadata/history.py b/src/cobra/core/metadata/history.py
new file mode 100644
index 000000000..8eb866eb7
--- /dev/null
+++ b/src/cobra/core/metadata/history.py
@@ -0,0 +1,392 @@
+"""Encodes History and Creator.
+
+The history allows to encode provenance meta-data about
+model objects. The history allows to encode who created or modified
+objects in a model with respective time stamps.
+"""
+import re
+from datetime import datetime
+from typing import Dict, Iterable, List, NamedTuple, Optional, Union
+
+
+STRTIME_FORMAT = "%Y-%m-%dT%H:%M:%S%z"
+
+
+class History:
+ """History object encoding object provenance.
+
+ Parameters
+ ----------
+ creators : list
+ A list of Creators
+ created_date : datetime
+ The datetime of creation in W3CDTF ISO 8601 format
+ modified_dates : list
+ A list of datetimes when the object was modified.
+ """
+
+ def __init__(
+ self,
+ creators: Optional[List["Creator"]] = None,
+ created_date: Optional[Union[datetime, str]] = None,
+ modified_dates: Optional[List[Union[datetime, str]]] = None,
+ ):
+ """Initialize the class.
+
+ Parameters
+ ----------
+ creators: list
+ list of Creator class. Optional, default None.
+ created_date: datetime
+ Created date. Optional, default None.
+ modified_dates: list
+ Dates when this annotation was modified. List of datetime dates or strings.
+ Optional, default None.
+ """
+ if modified_dates is None:
+ modified_dates = []
+ if creators is None:
+ creators = []
+ self._creators = []
+ self._created_date = None
+ self._modified_dates = []
+
+ # use properties to set fields
+ self.creators = creators
+ self.created_date = created_date
+ self.modified_dates = modified_dates
+
+ @property
+ def creators(self) -> List["Creator"]:
+ """Get creators for History.
+
+ Returns
+ -------
+ list
+ A list of Creator objects.
+ """
+ return self._creators
+
+ @creators.setter
+ def creators(self, values: Iterable[Union[Dict, "Creator"]]) -> None:
+ """Set creators for History.
+
+ Parameters
+ ----------
+ values: iterable
+ An iterable of dictionaries and/or Creator objects.
+ """
+ self._creators = [Creator.from_data(v) for v in values]
+
+ @staticmethod
+ def parse_datetime(value: Optional[Union[str, datetime]]) -> Optional[datetime]:
+ """Parse datetime into str.
+
+ Parameters
+ ----------
+ value: str or datetime
+ Optional. If None, the function will return None.
+ str is converted to datetime.
+ If given datetime, the format will be validated.
+
+ Returns
+ -------
+ datetime: optional
+ Returns None if given None.
+
+ Raises
+ ------
+ TypeError
+ If value is not None, or an instance of str, datetime.
+ """
+ if value is None:
+ return None
+ if isinstance(value, datetime):
+ return value
+ elif isinstance(value, str):
+ return History.date_from_str(value)
+ else:
+ raise TypeError(
+ f"Invalid type passed for datetime. "
+ f"Accepted types are 'str' or 'datetime' objects: {value}"
+ )
+
+ @staticmethod
+ def date_from_str(datetime_str: str) -> datetime:
+ """Validate if the date format is of type w3cdtf ISO 8601.
+
+ Parameters
+ ----------
+ datetime_str: str
+ Datetime in string format.
+
+ Returns
+ -------
+ datetime if valid format
+
+ Raises
+ ------
+ ValueError if not valid.
+ """
+ if not isinstance(datetime_str, str):
+ raise TypeError(f"The date passed must be of type string: {datetime_str}")
+
+ # python 3.6 doesn't allow : (colon) in the utc offset.
+ try:
+ datetime_return = datetime.strptime(datetime_str, STRTIME_FORMAT)
+ return datetime_return
+ except ValueError as e:
+ datetime_str = datetime_str.replace("Z", "+0000")
+ datetime_str = re.sub(r"(\+\d\d):(\d\d)\Z", "\\1\\2", datetime_str)
+ try:
+ datetime_return = datetime.strptime(datetime_str, STRTIME_FORMAT)
+ except ValueError:
+ raise ValueError(str(e))
+ return datetime_return
+
+ @property
+ def created_date(self) -> Optional[datetime]:
+ """Get created date for History.
+
+ Returns
+ -------
+ datetime
+ """
+ return self._created_date
+
+ @created_date.setter
+ def created_date(self, date: Union[str, "datetime"]) -> None:
+ """Set created date for History.
+
+ Parameters
+ ----------
+ date: str or datetime
+ """
+ self._created_date = self.parse_datetime(date)
+
+ @property
+ def modified_dates(self) -> List[datetime]:
+ """Get modified dates.
+
+ Returns
+ -------
+ list
+ List of datetimes when this annotation was modified, if any exist.
+ List can be empty.
+ """
+ return self._modified_dates
+
+ @modified_dates.setter
+ def modified_dates(self, dates: Iterable[Union[str, datetime]]) -> None:
+ """Set modified dates.
+
+ Parameters
+ -------
+ list
+ List of datetimes or strings when this annotation was modified.
+ """
+ self._modified_dates = [self.parse_datetime(d) for d in dates]
+
+ @staticmethod
+ def from_data(data: Union[Dict, "History"]) -> "History":
+ """Parse history from data.
+
+ Parameters
+ ----------
+ data: dict or History
+ Dict will be parsed to History object.
+
+ Returns
+ -------
+ History
+
+ Raises
+ ------
+ TypeError
+ If data is neither dict, History or None.
+ """
+ if data is None:
+ return History()
+ elif isinstance(data, History):
+ return data
+ elif isinstance(data, dict):
+ return History(**data)
+ else:
+ raise TypeError(f"Unsupported type for History: '{data}'")
+
+ def is_empty(self) -> bool:
+ """Check if history is empty.
+
+ Returns
+ -------
+ bool
+ Returns False if at least one history attribute is set, else True.
+ """
+ if self.creators:
+ return False
+ if self.created_date:
+ return False
+ if self.modified_dates:
+ return False
+ return True
+
+ def __eq__(self, other: "History") -> bool:
+ """Check equality of two history objects.
+
+ A history is equal if all attributes are equal.
+ If one and only one of self or other is empty will return False.
+ If both are empty, will return True.
+
+ Returns
+ -------
+ bool - True if equal, False otherwise.
+ """
+ if self.is_empty() and other.is_empty():
+ return True
+ elif (self.is_empty() and not other.is_empty()) or (
+ not self.is_empty() and other.is_empty()
+ ):
+ return False
+ # check equality of creators
+ if len(self.creators) != len(other.creators):
+ return False
+ for k, creator in enumerate(self.creators):
+ if creator != other.creators[k]:
+ return False
+
+ # checking equality of created_date
+ if self.created_date != other.created_date:
+ return False
+
+ # checking equality of modified_dates
+ if len(self.modified_dates) != len(other.modified_dates):
+ return False
+ for k, modified_date in enumerate(self.modified_dates):
+ if modified_date != other.modified_dates[k]:
+ return False
+
+ return True
+
+ def to_dict(self) -> Dict:
+ """Return dictionary representation of History.
+
+ Returns
+ -------
+ dict - Dictionary representation, of this format
+ {
+ "creators": list[dict]
+ "created_date": str
+ "modified_dates": list[str]
+ }
+ """
+ return {
+ "creators": [c.to_dict() for c in self.creators],
+ "created_date": self.created_date and self.created_date.isoformat(),
+ "modified_dates": [
+ mod_date.isoformat() for mod_date in self._modified_dates
+ ],
+ }
+
+ def __str__(self) -> str:
+ """Return a string representation.
+
+ Returns
+ -------
+ str
+ History in a flattened dictionary.
+ """
+ return str(self.to_dict())
+
+ def __repr__(self):
+ """Return a string with module and class name.
+
+ Returns
+ -------
+ str
+ History in a string, with module and class name.
+ """
+ return (
+ f"{self.__class__.__module__}.{self.__class__.__qualname__}"
+ f"({self.creators}, {self.created_date}, {self.modified_dates})"
+ )
+
+
+class Creator(NamedTuple):
+ """Metadata for person who created an object.
+
+ Parameters
+ ----------
+ given_name: str
+ Optional. Default None.
+ family_name: str
+ Optional. Default None.
+ email: str
+ Optional. Default None.
+ organisation: str
+ Optional. Default None.
+ """
+
+ given_name: Optional[str] = None
+ family_name: Optional[str] = None
+ email: Optional[str] = None
+ organisation: Optional[str] = None
+
+ @staticmethod
+ def from_data(data: Union[Dict, "Creator"]) -> "Creator":
+ """Parse creator from data.
+
+ Parameters
+ ----------
+ data: dict or Creator
+ Dictionary will be converted to Creator class.
+
+ Returns
+ -------
+ Creator - the creator in the Creator class
+ """
+ if not data:
+ return Creator()
+ elif isinstance(data, Creator):
+ return data
+ elif isinstance(data, dict):
+ return Creator(**data)
+ else:
+ raise TypeError(f"Invalid format for Creator: {data}")
+
+ def to_dict(self) -> Dict:
+ """Convert Creator to dictionary.
+
+ Returns
+ -------
+ dict in this format
+ {
+ "given_name": str,
+ "family_name": str,
+ "email": str,
+ "organisation": str,
+ }
+ """
+ return dict(self._asdict())
+
+ def __str__(self) -> str:
+ """Return string representation of Creator.
+
+ Returns
+ -------
+ str
+ String version of flattened dictionary.
+ """
+ return str(self.to_dict())
+
+ def __repr__(self):
+ """Return the Creator with module, class, and internal fields.
+
+ Returns
+ -------
+ str
+ """
+ return (
+ f"{self.__class__.__module__}.{self.__class__.__qualname__}"
+ f"('{self.given_name}', '{self.family_name}', '{self.email}', "
+ f"'{self.organisation}')"
+ )
diff --git a/src/cobra/core/metadata/metadata.py b/src/cobra/core/metadata/metadata.py
new file mode 100644
index 000000000..463139b6a
--- /dev/null
+++ b/src/cobra/core/metadata/metadata.py
@@ -0,0 +1,483 @@
+"""Define the cobra MetaData class."""
+
+from collections import OrderedDict
+from collections.abc import MutableMapping
+from datetime import datetime
+from typing import Dict, Iterable, Iterator, List, Optional, Union
+
+from ..metadata.custompairs import KeyValuePairs
+from ..metadata.cvterm import CVTerm, CVTermList
+from ..metadata.history import Creator, History
+
+
+class MetaData(MutableMapping):
+ """Meta-data of a cobrapy object.
+
+ Meta-data encodes additional information on an object such as annotations
+ or notes. Such information is currently stored in SBML on the notes and
+ annotation fields.
+
+ Meta-data consists of four components:
+ - standardized: storing resource:identifier annotation information in a CVTermList
+ object. The annotation information is exposed via the dict interface for
+ full backwards compatibility to the earlier object.annotation field. See
+ CVTermList.annotations() and MetaData.annotations()
+ - sbo - a single SBO term for the object. Can theoretically be placed in
+ standardized, but the most descriptive term should be kept in sbo. Right now,
+ cobrapy doesn't allow multiple sbo terms.
+ - History: storing the object history consisting of creators, created date, and
+ modified dates.
+ - custompairs (KeyValuePairs), a list of key-value pairs to
+ store additional information
+
+ Parameters
+ ----------
+ cvterms : dict or CVTermList object
+ The standardized store annotations to external resources
+ history : dict, History
+ The history stores information about the creator,
+ created and modified dates.
+ sbo: str
+ The sbo term to use for the entity. If you want to use more than one SBO term
+ (not recommended), use SBO in identifers.org format and put it in standardized.
+ keyvaluepairs : list
+ Key-value pairs which are not suitable to be
+ represented anywhere else in the model.
+ Data is represented as an OrderedDict.
+ """
+
+ def __init__(
+ self,
+ cvterms: Union[Dict, CVTermList] = None,
+ history: Union[Dict, History] = None,
+ sbo: str = "",
+ keyvaluepairs: List = None,
+ ):
+ """Initialize the MetaData class.
+
+ Parameters
+ ---------
+ cvterms : dict or CVTermList, optional
+ Which controlled vocabulary terms does the metadata have. Default None.
+ history: dict or History, optional
+ History of annotation, including creation data, creators, and optional
+ modificiation date. Default None.
+ sbo: str
+ SBO term, if relevant. Default "".
+ keyvaluepairs: KeyValuePairs
+ For annotations that don't match the identifiers.org format.
+
+ """
+ self._standardized = CVTermList.from_data(cvterms)
+ self._history = History.from_data(history)
+ self._custompairs = KeyValuePairs(keyvaluepairs)
+ self._sbo = sbo
+
+ # use setters
+ self.sbo = sbo
+ self.standardized = cvterms
+ self.history = history
+ self.custompairs = keyvaluepairs
+
+ @property
+ def standardized(self) -> "CVTermList":
+ """Get standardized field of MetaData.
+
+ Returns
+ -------
+ CVTermList
+ """
+ return self._standardized
+
+ @standardized.setter
+ def standardized(self, cvterms: Union[Dict, CVTermList]) -> None:
+ """Set standardized field of MetaData with controlled vocabulary (CVTerm).
+
+ Parameters
+ ----------
+ cvterms: dict or CVTermList
+ dict is converted to CVTermList using CVTermList.from_data().
+ The wrong type will lead to a TypeError being raised.
+ """
+ self._standardized = CVTermList.from_data(cvterms)
+
+ def add_cvterms(self, cvterms: Iterable[Union[Dict, CVTerm]]) -> None:
+ """Add one or more CVTerm objects to the standardized field.
+
+ This method will add CVTerm objects to the standardized field.
+
+ Parameters
+ ----------
+ cvterms: Iterable
+ An iterable of CVTerm objects or CVTerm dict compatible objects.
+ CVTermList is an acceptable Iterable in this case.
+
+ See Also
+ --------
+ CVTermList.add_cvterms()
+ """
+ self._standardized.add_cvterms(cvterms)
+
+ @property
+ def annotations(self) -> Dict:
+ """Backwards compatible annotations."""
+ anno_dict = self.standardized.annotations
+ if self.sbo:
+ anno_dict["sbo"] = self.sbo
+ return anno_dict
+
+ @property
+ def history(self) -> History:
+ """Get history of the object.
+
+ Returns
+ -------
+ History
+ """
+ return self._history
+
+ @history.setter
+ def history(self, history: Optional[Union[Dict, History]]) -> None:
+ """Set history of the object.
+
+ Parameters
+ ----------
+ history: History or dict or None
+ If None is given, will set the History to be empty.
+ Dict is converted via History.from_data()
+ """
+ self._history = History.from_data(history)
+
+ def add_creators(self, creators: Iterable[Union[Creator, dict]]) -> None:
+ """Add one or more creators to the object history.
+
+ The creators will be parsed and need to be a Creator object or a dictionary
+ in the correct format.
+
+ Parameters
+ ----------
+ creators: Iterable of dict or Creator
+ An iterable of dicts or Creator objects.
+
+ See Also
+ --------
+ Creator.from_data()
+ """
+ self.history.creators.extend(
+ [Creator.from_data(creator) for creator in creators]
+ )
+
+ def add_modification_dates(
+ self, dates: Union[datetime, str, Iterable[Union[datetime, str]]]
+ ) -> None:
+ """Add modification dates to the object history.
+
+ The dates will be parsed and need to be string in the acceptable format or
+ datetime.
+
+ Parameters
+ ----------
+ dates: Iterable or str or datetime
+ An iterable of strings or datetime objects, or one str or one datetime.
+
+ See Also
+ --------
+ History.parse_datetime()
+ """
+ if isinstance(dates, (str, datetime)):
+ dates = [dates]
+ self.history.modified_dates.extend([History.parse_datetime(d) for d in dates])
+
+ @property
+ def sbo(self) -> str:
+ """Return the SBO term of the MetaData.
+
+ Returns
+ -------
+ str: SBO as string
+ """
+ return self._sbo
+
+ @sbo.setter
+ def sbo(self, value: str) -> None:
+ """Set the SBO term."""
+ if isinstance(value, list):
+ value = value[0]
+ self._sbo = value
+
+ @property
+ def keyvaluepairs(self) -> KeyValuePairs:
+ return self._custompairs
+
+ @keyvaluepairs.setter
+ def keyvaluepairs(self, keyvaluepairs: Union[Dict, KeyValuePairs]) -> None:
+ self._custompairs = KeyValuePairs(keyvaluepairs)
+
+ def __setitem__(self, key: str, value: Union[List, str]) -> None:
+ """Set the item for accessing metadata as dict (the old style annotation).
+
+ Parameters
+ ----------
+ key: str
+ provider key word.
+ value: List or str
+ A str that is one term or a list that will contain multiple terms
+
+ This function will first delete the existing value for the key, and then set
+ it to the new value. Be careful - if you give this function incorrect input,
+ the deletion will happen anyway, and the value of the key will be empty!
+
+ If the key is sbo, sets the self.sbo term to the first item in the list. The
+ rest of the items in the list are ignored.
+ Cobrapy support for multiple SBO terms is not implemented yet.
+
+ See Also
+ --------
+ `CVTermList().add_simple_annotations()`
+ """
+ if key == "sbo":
+ if isinstance(value, list):
+ value = value[0]
+ self.sbo = value
+ else:
+ self.__delitem__(key)
+ self._standardized.add_simple_annotations(dict({key: value}))
+
+ def __getitem__(self, key: str) -> List:
+ """Get item using old annotation type dictionary.
+
+ If the key is sbo, will return the sbo field directly.
+ Otherwise, will query the annotations (old style) dictionary.
+
+ Note, that __setitem__, __getitem__ and __delitem__ will ignore custompairs. If
+ you want to edit that field, use relevant functions for it.
+
+ Parameters
+ ----------
+ key: str
+ provider key word.
+
+ Returns
+ -------
+ list
+ """
+ if key == "sbo":
+ return [self.sbo]
+ else:
+ return self.annotations[key]
+
+ def __delitem__(self, key: str) -> None:
+ """Delete item using old annotation type dictionary as reference.
+
+ If the key is sbo, will zero out the sbo field directly to an empty string.
+ Otherwise, will delete from the annotations (old style) dictionary, using
+ the value as a pattern to search in CVTermList resources.
+ See `CVTermList.delete_simple_annotation()`
+
+ Parameters
+ ----------
+ key: str
+ provider key word.
+
+ Note, that __setitem__, __getitem__ and __delitem__ will ignore custompairs. If
+ you want to edit that field, use relevant functions for it.
+ """
+ if key == "sbo":
+ self.sbo = ""
+ else:
+ self._standardized.delete_annotation(key)
+
+ def __eq__(self, other: Union["MetaData", Dict]) -> bool:
+ """Compare two MetaData objects to find out whether they are the same.
+
+ If given a dict, the dictionary is converted to MetaData and then compared.
+
+ Equality is defined in two ways, depending if history and custompairs exist.
+ 1) If history or custompairs exist and are not empty/None, the two objects are
+ equal (the function will return True) if
+ - standardized (CVTermList) are equal
+ - all attributes of the history (History) are equal
+ - custompairs are identical
+ If one of these three conditions is not true, the function will return False.
+ 2) If only standardized exist, while history and custompairs are empty
+ (history.is_empty() is True and custompairs is None) for both objects,
+ then the annotations field (CVTermList.annotations()) is compared as two
+ dictionaries.
+
+ Parameters
+ ----------
+ other: MetaData or dict
+
+ Returns
+ -------
+ bool: True if equal, False otherwise.
+ """
+ if isinstance(other, dict):
+ return self == MetaData.from_dict(other)
+ if (
+ self.standardized
+ and self.history.is_empty()
+ and not self.custompairs
+ and other.standardized
+ and other.history.is_empty()
+ and not other.custompairs
+ ):
+ return self.annotations == other.annotations
+
+ return (
+ (self.standardized == other.standardized)
+ and (self.history == other.history)
+ and (self.custompairs == other.custompairs)
+ )
+
+ def __ne__(self, other) -> bool:
+ """Define not-equal to override default.
+
+ Parameters
+ ----------
+ other: MetaData or dict
+
+ Returns
+ -------
+ bool: False if equal, True otherwise.
+
+ See Also
+ --------
+ MetaData.__eq__()
+ """
+ return not self.__eq__(other)
+
+ def __iter__(self) -> Iterator:
+ """Iterate over the MetaData annotations dict.
+
+ This function will iterate over the annotations (old-style) dictionary.
+
+ Returns
+ -------
+ Iterator
+ """
+ return iter(self.annotations)
+
+ def __len__(self) -> int:
+ """Return the length of the MetaData annotations dict.
+
+ The length of the annotations dict will be returned as a int.
+
+ Returns
+ -------
+ int
+ result of running len on the annotations dict
+ """
+ return len(self.annotations)
+
+ def __str__(self) -> str:
+ """Return the MetaData as str.
+
+ The annotations dict will be returned as a string. This does not include all
+ of the possible MetaData fields.
+
+ Returns
+ -------
+ str
+ """
+ return str(dict(self.annotations))
+
+ def __repr__(self) -> str:
+ """Return the MetaData as str with module, class, and code to recreate it.
+
+ If MetaData has standardized, history or custompairs, the dictionary will
+ contain them as keys.
+ If not, the dictionary will have only the annotations dictionary.
+ In either case, if sbo field is set, it will be outputted in the dictionary.
+
+ Returns
+ -------
+ str
+
+ See Also
+ --------
+ MetaData.from_dict()
+ """
+ repr_str = (
+ f"{self.__class__.__module__}.{self.__class__.__qualname__}.from_dict("
+ )
+ cvterms = self.standardized
+ history = self.history
+ keyValuepairs = self.keyvaluepairs
+
+ if cvterms or not history.is_empty() or keyValuepairs:
+ repr_str += (
+ f"'standardized': {self.standardized.to_list_of_dicts()},"
+ f"'history': {self.history.to_dict()},"
+ f"'custompairs': {self.custompairs},"
+ )
+ if self.sbo:
+ repr_str += f"'sbo': {self.sbo})"
+ else:
+ anno_dict = self.annotations
+ if self.sbo:
+ anno_dict.update({"sbo": self.sbo})
+ repr_str += f"{anno_dict})"
+ return repr_str
+
+ def to_dict(self) -> Dict:
+ """Create string dictionary for serialization.
+
+ Returns
+ -------
+ dict
+ """
+ d = OrderedDict()
+ if self.sbo:
+ # set first SBO term as sbo
+ d["sbo"] = self.sbo
+
+ if self.standardized:
+ d["standardized"] = self.standardized.to_list_of_dicts()
+
+ if self.history and not self.history.is_empty():
+ d["history"] = self.history.to_dict()
+
+ if self.keyvaluepairs:
+ d["custompairs"] = self.keyvaluepairs.to_dict()
+
+ return d
+
+ @staticmethod
+ def from_dict(data: Dict) -> "MetaData":
+ """Generate MetaData from dictionary.
+
+ This function has two options
+ 1) If the dictionary has standardized, history, or custompairs, it uses
+ the relevant fields to create MetaData.
+ 2) If the dictionary has none of the above fields, it creates an empty
+ MetaData object, and then fills it using CVTermList.add_simple_annotation()
+ where the keys are namespaces and the values are identifiers.
+ In this case, all qualifiers will be "bqb_is".
+
+ In either case, if "sbo" is present as one of the keys, this will fill the sbo
+ field of the MetaData using the value of "sbo" key.
+
+ Parameters
+ ----------
+ data: dict
+ Dictionary to transform into MetaData.
+
+ Returns
+ -------
+ MetaData
+ """
+ cvterms = data.get("standardized", None)
+ history = data.get("history", None)
+ keyValuepairs = data.get("custompairs", None)
+
+ if cvterms or history or keyValuepairs:
+ annotation = MetaData(cvterms, history, keyValuepairs)
+ else:
+ annotation = MetaData()
+ annotation.standardized.add_simple_annotations(data)
+
+ if "sbo" in data:
+ annotation["sbo"] = data["sbo"]
+
+ return annotation
diff --git a/src/cobra/core/model.py b/src/cobra/core/model.py
index 5abf5acaf..e332c44c5 100644
--- a/src/cobra/core/model.py
+++ b/src/cobra/core/model.py
@@ -324,7 +324,7 @@ def copy(self):
"reactions",
"genes",
"notes",
- "annotation",
+ "_annotation",
"groups",
}
for attr in self.__dict__:
@@ -334,13 +334,14 @@ def copy(self):
new.annotation = deepcopy(self.annotation)
new.metabolites = DictList()
- do_not_copy_by_ref = {"_reaction", "_model"}
+ do_not_copy_by_ref = {"_reaction", "_model", "_annotation"}
for metabolite in self.metabolites:
new_met = metabolite.__class__()
for attr, value in metabolite.__dict__.items():
if attr not in do_not_copy_by_ref:
new_met.__dict__[attr] = copy(value) if attr == "formula" else value
new_met._model = new
+ new_met.annotation = deepcopy(metabolite.annotation)
new.metabolites.append(new_met)
new.genes = DictList()
@@ -352,16 +353,18 @@ def copy(self):
copy(value) if attr == "formula" else value
)
new_gene._model = new
+ new_gene.annotation = deepcopy(gene.annotation)
new.genes.append(new_gene)
new.reactions = DictList()
- do_not_copy_by_ref = {"_model", "_metabolites", "_genes"}
+ do_not_copy_by_ref = {"_model", "_metabolites", "_genes", "_annotation"}
for reaction in self.reactions:
new_reaction = reaction.__class__()
for attr, value in reaction.__dict__.items():
if attr not in do_not_copy_by_ref:
new_reaction.__dict__[attr] = copy(value)
new_reaction._model = new
+ new_reaction._annotation = deepcopy(reaction.annotation)
new.reactions.append(new_reaction)
# update awareness
for metabolite, stoic in reaction._metabolites.items():
@@ -371,7 +374,7 @@ def copy(self):
new_reaction.update_genes_from_gpr()
new.groups = DictList()
- do_not_copy_by_ref = {"_model", "_members"}
+ do_not_copy_by_ref = {"_model", "_members", "_annotation"}
# Groups can be members of other groups. We initialize them first and
# then update their members.
for group in self.groups:
@@ -380,6 +383,7 @@ def copy(self):
if attr not in do_not_copy_by_ref:
new_group.__dict__[attr] = copy(value)
new_group._model = new
+ new_group.annotation = deepcopy(group.annotation)
new.groups.append(new_group)
for group in self.groups:
new_group = new.groups.get_by_id(group.id)
@@ -393,7 +397,7 @@ def copy(self):
elif isinstance(member, Gene):
new_object = new.genes.get_by_id(member.id)
elif isinstance(member, Group):
- new_object = new.genes.get_by_id(member.id)
+ new_object = new.groups.get_by_id(member.id)
else:
raise TypeError(
"The group member {!r} is unexpectedly not a "
diff --git a/src/cobra/core/object.py b/src/cobra/core/object.py
index 78d092d05..fb75c2777 100644
--- a/src/cobra/core/object.py
+++ b/src/cobra/core/object.py
@@ -2,6 +2,8 @@
from typing import Optional
+from cobra.core.metadata import MetaData
+
class Object:
"""Defines common behavior of object in cobra.core."""
@@ -23,7 +25,7 @@ def __init__(self, id: Optional[str] = None, name: str = "") -> None:
self.name = name
self.notes = {}
- self._annotation = {}
+ self._annotation = MetaData()
@property
def id(self) -> str:
@@ -70,7 +72,7 @@ def _set_id_with_model(self, value) -> None:
self._id = value
@property
- def annotation(self) -> dict:
+ def annotation(self) -> MetaData:
"""Get annotation dictionary.
Returns
@@ -93,10 +95,15 @@ def annotation(self, annotation):
------
TypeError if annotation not a dict.
"""
- if not isinstance(annotation, dict):
- raise TypeError("Annotation must be a dict")
- else:
+ if isinstance(annotation, MetaData):
self._annotation = annotation
+ elif isinstance(annotation, dict):
+ self._annotation = MetaData().from_dict(annotation)
+ else:
+ raise TypeError(
+ f"The data passed for annotation must be inside "
+ f"a dictionary or MetaData: {annotation}"
+ )
def __getstate__(self) -> dict:
"""Get state of annotation.
diff --git a/src/cobra/data/mini.json b/src/cobra/data/mini.json
index df70c0a4f..35421b87d 100644
--- a/src/cobra/data/mini.json
+++ b/src/cobra/data/mini.json
@@ -5,1120 +5,1195 @@
},
"genes": [
{
- "id": "b0755",
+ "id": "G_b0755",
"name": "gpmA"
},
{
- "id": "b0875",
+ "id": "G_b0875",
"name": "aqpZ"
},
{
- "id": "b1101",
+ "id": "G_b1101",
"name": "ptsG"
},
{
- "id": "b1380",
+ "id": "G_b1380",
"name": "ldhA"
},
{
- "id": "b1621",
+ "id": "G_b1621",
"name": "malX"
},
{
"annotation": {
- "ncbiprotein": [
- "1208453",
- "1652654"
- ]
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1208453",
+ "http://identifiers.org/ncbiprotein/1652654"
+ ]
+ }
+ ]
+ }
},
- "id": "b1676",
+ "id": "G_b1676",
"name": "pykF"
},
{
- "id": "b1723",
+ "id": "G_b1723",
"name": "pfkB"
},
{
- "id": "b1773",
+ "id": "G_b1773",
"name": "ydjI"
},
{
- "id": "b1779",
+ "id": "G_b1779",
"name": "gapA"
},
{
- "id": "b1817",
+ "id": "G_b1817",
"name": "manX"
},
{
- "id": "b1818",
+ "id": "G_b1818",
"name": "manY"
},
{
- "id": "b1819",
+ "id": "G_b1819",
"name": "manZ"
},
{
- "id": "b1854",
+ "id": "G_b1854",
"name": "pykA"
},
{
- "id": "b2097",
+ "id": "G_b2097",
"name": "fbaB"
},
{
- "id": "b2133",
+ "id": "G_b2133",
"name": "dld"
},
{
- "id": "b2415",
+ "id": "G_b2415",
"name": "ptsH"
},
{
- "id": "b2416",
+ "id": "G_b2416",
"name": "ptsI"
},
{
- "id": "b2417",
+ "id": "G_b2417",
"name": "crr"
},
{
"annotation": {
- "ncbiprotein": "1653839"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1653839"
+ ]
+ }
+ ]
+ }
},
- "id": "b2779",
+ "id": "G_b2779",
"name": "eno"
},
{
- "id": "b2925",
+ "id": "G_b2925",
"name": "fbaA"
},
{
"annotation": {
- "ncbiprotein": "1653609"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1653609"
+ ]
+ }
+ ]
+ }
},
- "id": "b2926",
+ "id": "G_b2926",
"name": "pgk"
},
{
- "id": "b2987",
+ "id": "G_b2987",
"name": "pitB"
},
{
- "id": "b3493",
+ "id": "G_b3493",
"name": "pitA"
},
{
- "id": "b3612",
+ "id": "G_b3612",
"name": "gpmM"
},
{
"annotation": {
- "ncbiprotein": [
- "1006614",
- "1651919"
- ]
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1006614",
+ "http://identifiers.org/ncbiprotein/1651919"
+ ]
+ }
+ ]
+ }
},
- "id": "b3916",
+ "id": "G_b3916",
"name": "pfkA"
},
{
- "id": "b3919",
+ "id": "G_b3919",
"name": "tpiA"
},
{
"annotation": {
- "ncbiprotein": "1653253"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1653253"
+ ]
+ }
+ ]
+ }
},
- "id": "b4025",
+ "id": "G_b4025",
"name": "pgi"
},
{
- "id": "b4395",
+ "id": "G_b4395",
"name": "ytjC"
},
{
- "id": "s0001",
+ "id": "G_s0001",
"name": "G_s0001"
}
],
+ "groups": [],
"id": "mini_textbook",
"metabolites": [
{
"annotation": {
- "bigg.metabolite": "13dpg",
- "biocyc": "DPG",
- "chebi": [
- "CHEBI:16001",
- "CHEBI:1658",
- "CHEBI:20189",
- "CHEBI:57604",
- "CHEBI:11881"
- ],
- "hmdb": "HMDB01270",
- "kegg.compound": "C00236",
- "pubchem.substance": "3535",
- "reactome": "REACT_29800",
- "seed.compound": "cpd00203",
- "unipathway.compound": "UPC00236"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/13dpg",
+ "http://identifiers.org/biocyc/DPG",
+ "http://identifiers.org/chebi/CHEBI:16001",
+ "http://identifiers.org/chebi/CHEBI:1658",
+ "http://identifiers.org/chebi/CHEBI:20189",
+ "http://identifiers.org/chebi/CHEBI:57604",
+ "http://identifiers.org/chebi/CHEBI:11881",
+ "http://identifiers.org/hmdb/HMDB01270",
+ "http://identifiers.org/kegg.compound/C00236",
+ "http://identifiers.org/pubchem.substance/3535",
+ "http://identifiers.org/reactome/REACT_29800",
+ "http://identifiers.org/seed.compound/cpd00203",
+ "http://identifiers.org/unipathway.compound/UPC00236"
+ ]
+ }
+ ]
+ }
},
"charge": -4,
"compartment": "c",
"formula": "C3H4O10P2",
- "id": "13dpg_c",
+ "id": "M_13dpg_c",
"name": "3-Phospho-D-glyceroyl phosphate"
},
{
"annotation": {
- "bigg.metabolite": "2pg",
- "biocyc": "2-PG",
- "chebi": [
- "CHEBI:1267",
- "CHEBI:58289",
- "CHEBI:17835",
- "CHEBI:21028",
- "CHEBI:11651",
- "CHEBI:12986",
- "CHEBI:24344",
- "CHEBI:39868"
- ],
- "hmdb": [
- "HMDB03391",
- "HMDB00362"
- ],
- "kegg.compound": "C00631",
- "pubchem.substance": "3904",
- "reactome": "REACT_30485",
- "seed.compound": "cpd00482",
- "unipathway.compound": "UPC00631"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/2pg",
+ "http://identifiers.org/biocyc/2-PG",
+ "http://identifiers.org/chebi/CHEBI:1267",
+ "http://identifiers.org/chebi/CHEBI:58289",
+ "http://identifiers.org/chebi/CHEBI:17835",
+ "http://identifiers.org/chebi/CHEBI:21028",
+ "http://identifiers.org/chebi/CHEBI:11651",
+ "http://identifiers.org/chebi/CHEBI:12986",
+ "http://identifiers.org/chebi/CHEBI:24344",
+ "http://identifiers.org/chebi/CHEBI:39868",
+ "http://identifiers.org/hmdb/HMDB03391",
+ "http://identifiers.org/hmdb/HMDB00362",
+ "http://identifiers.org/kegg.compound/C00631",
+ "http://identifiers.org/pubchem.substance/3904",
+ "http://identifiers.org/reactome/REACT_30485",
+ "http://identifiers.org/seed.compound/cpd00482",
+ "http://identifiers.org/unipathway.compound/UPC00631"
+ ]
+ }
+ ]
+ }
},
"charge": -3,
"compartment": "c",
"formula": "C3H4O7P",
- "id": "2pg_c",
+ "id": "M_2pg_c",
"name": "D-Glycerate 2-phosphate"
},
{
"annotation": {
- "bigg.metabolite": "3pg",
- "biocyc": "G3P",
- "chebi": [
- "CHEBI:40016",
- "CHEBI:58272",
- "CHEBI:57998",
- "CHEBI:11879",
- "CHEBI:1657",
- "CHEBI:1659",
- "CHEBI:17050",
- "CHEBI:21029",
- "CHEBI:11882",
- "CHEBI:11880",
- "CHEBI:12987",
- "CHEBI:17794",
- "CHEBI:24345"
- ],
- "hmdb": "HMDB00807",
- "kegg.compound": [
- "C00197",
- "C00597"
- ],
- "pubchem.substance": "3497",
- "reactome": "REACT_29728",
- "seed.compound": "cpd00169",
- "unipathway.compound": [
- "UPC00597",
- "UPC00197"
- ]
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/3pg",
+ "http://identifiers.org/biocyc/G3P",
+ "http://identifiers.org/chebi/CHEBI:40016",
+ "http://identifiers.org/chebi/CHEBI:58272",
+ "http://identifiers.org/chebi/CHEBI:57998",
+ "http://identifiers.org/chebi/CHEBI:11879",
+ "http://identifiers.org/chebi/CHEBI:1657",
+ "http://identifiers.org/chebi/CHEBI:1659",
+ "http://identifiers.org/chebi/CHEBI:17050",
+ "http://identifiers.org/chebi/CHEBI:21029",
+ "http://identifiers.org/chebi/CHEBI:11882",
+ "http://identifiers.org/chebi/CHEBI:11880",
+ "http://identifiers.org/chebi/CHEBI:12987",
+ "http://identifiers.org/chebi/CHEBI:17794",
+ "http://identifiers.org/chebi/CHEBI:24345",
+ "http://identifiers.org/hmdb/HMDB00807",
+ "http://identifiers.org/kegg.compound/C00197",
+ "http://identifiers.org/kegg.compound/C00597",
+ "http://identifiers.org/pubchem.substance/3497",
+ "http://identifiers.org/reactome/REACT_29728",
+ "http://identifiers.org/seed.compound/cpd00169",
+ "http://identifiers.org/unipathway.compound/UPC00597",
+ "http://identifiers.org/unipathway.compound/UPC00197"
+ ]
+ }
+ ]
+ }
},
"charge": -3,
"compartment": "c",
"formula": "C3H4O7P",
- "id": "3pg_c",
+ "id": "M_3pg_c",
"name": "3-Phospho-D-glycerate"
},
{
"annotation": {
- "bigg.metabolite": "adp",
- "biocyc": [
- "ADP",
- "ADP-GROUP"
- ],
- "cas": [
- "58-64-0"
- ],
- "chebi": [
- "CHEBI:13222",
- "CHEBI:16761",
- "CHEBI:2342",
- "CHEBI:22244",
- "CHEBI:40553",
- "CHEBI:456216"
- ],
- "hmdb": "HMDB01341",
- "kegg.compound": "C00008",
- "kegg.glycan": "G11113",
- "pubchem.substance": "3310",
- "reactome": [
- "REACT_190072",
- "REACT_481002",
- "REACT_211606",
- "REACT_429160",
- "REACT_29370",
- "REACT_196180",
- "REACT_113581",
- "REACT_113582",
- "REACT_114564",
- "REACT_114565",
- "REACT_429153"
- ],
- "seed.compound": "cpd00008",
- "unipathway.compound": "UPC00008"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/adp",
+ "http://identifiers.org/biocyc/ADP",
+ "http://identifiers.org/biocyc/ADP-GROUP",
+ "http://identifiers.org/cas/58-64-0",
+ "http://identifiers.org/cas/58-64-0",
+ "http://identifiers.org/chebi/CHEBI:13222",
+ "http://identifiers.org/chebi/CHEBI:16761",
+ "http://identifiers.org/chebi/CHEBI:2342",
+ "http://identifiers.org/chebi/CHEBI:22244",
+ "http://identifiers.org/chebi/CHEBI:40553",
+ "http://identifiers.org/chebi/CHEBI:456216",
+ "http://identifiers.org/hmdb/HMDB01341",
+ "http://identifiers.org/kegg.compound/C00008",
+ "http://identifiers.org/kegg.glycan/G11113",
+ "http://identifiers.org/pubchem.substance/3310",
+ "http://identifiers.org/reactome/REACT_190072",
+ "http://identifiers.org/reactome/REACT_481002",
+ "http://identifiers.org/reactome/REACT_211606",
+ "http://identifiers.org/reactome/REACT_429160",
+ "http://identifiers.org/reactome/REACT_29370",
+ "http://identifiers.org/reactome/REACT_196180",
+ "http://identifiers.org/reactome/REACT_113581",
+ "http://identifiers.org/reactome/REACT_113582",
+ "http://identifiers.org/reactome/REACT_114564",
+ "http://identifiers.org/reactome/REACT_114565",
+ "http://identifiers.org/reactome/REACT_429153",
+ "http://identifiers.org/seed.compound/cpd00008",
+ "http://identifiers.org/unipathway.compound/UPC00008"
+ ]
+ }
+ ]
+ }
},
"charge": -3,
"compartment": "c",
"formula": "C10H12N5O10P2",
- "id": "adp_c",
+ "id": "M_adp_c",
"name": "ADP"
},
{
"annotation": {
- "bigg.metabolite": "atp",
- "biocyc": "ATP",
- "cas": [
- "56-65-5"
- ],
- "chebi": [
- "CHEBI:40938",
- "CHEBI:15422",
- "CHEBI:57299",
- "CHEBI:13236",
- "CHEBI:10789",
- "CHEBI:30616",
- "CHEBI:22249",
- "CHEBI:10841",
- "CHEBI:2359"
- ],
- "hmdb": "HMDB00538",
- "kegg.compound": "C00002",
- "kegg.drug": "D08646",
- "pubchem.substance": "3304",
- "reactome": [
- "REACT_190078",
- "REACT_113592",
- "REACT_113593",
- "REACT_114570",
- "REACT_29358",
- "REACT_389573",
- "REACT_139836",
- "REACT_211579"
- ],
- "seed.compound": "cpd00002",
- "unipathway.compound": "UPC00002"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/atp",
+ "http://identifiers.org/biocyc/ATP",
+ "http://identifiers.org/cas/56-65-5",
+ "http://identifiers.org/cas/56-65-5",
+ "http://identifiers.org/chebi/CHEBI:40938",
+ "http://identifiers.org/chebi/CHEBI:15422",
+ "http://identifiers.org/chebi/CHEBI:57299",
+ "http://identifiers.org/chebi/CHEBI:13236",
+ "http://identifiers.org/chebi/CHEBI:10789",
+ "http://identifiers.org/chebi/CHEBI:30616",
+ "http://identifiers.org/chebi/CHEBI:22249",
+ "http://identifiers.org/chebi/CHEBI:10841",
+ "http://identifiers.org/chebi/CHEBI:2359",
+ "http://identifiers.org/hmdb/HMDB00538",
+ "http://identifiers.org/kegg.compound/C00002",
+ "http://identifiers.org/kegg.drug/D08646",
+ "http://identifiers.org/pubchem.substance/3304",
+ "http://identifiers.org/reactome/REACT_190078",
+ "http://identifiers.org/reactome/REACT_113592",
+ "http://identifiers.org/reactome/REACT_113593",
+ "http://identifiers.org/reactome/REACT_114570",
+ "http://identifiers.org/reactome/REACT_29358",
+ "http://identifiers.org/reactome/REACT_389573",
+ "http://identifiers.org/reactome/REACT_139836",
+ "http://identifiers.org/reactome/REACT_211579",
+ "http://identifiers.org/seed.compound/cpd00002",
+ "http://identifiers.org/unipathway.compound/UPC00002"
+ ]
+ }
+ ]
+ }
},
"charge": -4,
"compartment": "c",
"formula": "C10H12N5O13P3",
- "id": "atp_c",
+ "id": "M_atp_c",
"name": "ATP"
},
{
"annotation": {
- "bigg.metabolite": "dhap",
- "biocyc": "DIHYDROXY-ACETONE-PHOSPHATE",
- "cas": [
- "57-04-5"
- ],
- "chebi": [
- "CHEBI:14341",
- "CHEBI:57642",
- "CHEBI:14342",
- "CHEBI:16108",
- "CHEBI:5454",
- "CHEBI:24355",
- "CHEBI:39571"
- ],
- "hmdb": [
- "HMDB01473",
- "HMDB11735"
- ],
- "kegg.compound": "C00111",
- "pubchem.substance": "3411",
- "reactome": [
- "REACT_188451",
- "REACT_75970",
- "REACT_390404"
- ],
- "seed.compound": "cpd00095",
- "unipathway.compound": "UPC00111"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/dhap",
+ "http://identifiers.org/biocyc/DIHYDROXY-ACETONE-PHOSPHATE",
+ "http://identifiers.org/cas/57-04-5",
+ "http://identifiers.org/cas/57-04-5",
+ "http://identifiers.org/chebi/CHEBI:14341",
+ "http://identifiers.org/chebi/CHEBI:57642",
+ "http://identifiers.org/chebi/CHEBI:14342",
+ "http://identifiers.org/chebi/CHEBI:16108",
+ "http://identifiers.org/chebi/CHEBI:5454",
+ "http://identifiers.org/chebi/CHEBI:24355",
+ "http://identifiers.org/chebi/CHEBI:39571",
+ "http://identifiers.org/hmdb/HMDB01473",
+ "http://identifiers.org/hmdb/HMDB11735",
+ "http://identifiers.org/kegg.compound/C00111",
+ "http://identifiers.org/pubchem.substance/3411",
+ "http://identifiers.org/reactome/REACT_188451",
+ "http://identifiers.org/reactome/REACT_75970",
+ "http://identifiers.org/reactome/REACT_390404",
+ "http://identifiers.org/seed.compound/cpd00095",
+ "http://identifiers.org/unipathway.compound/UPC00111"
+ ]
+ }
+ ]
+ }
},
"charge": -2,
"compartment": "c",
"formula": "C3H5O6P",
- "id": "dhap_c",
+ "id": "M_dhap_c",
"name": "Dihydroxyacetone phosphate"
},
{
"annotation": {
- "bigg.metabolite": "f6p",
- "biocyc": "FRUCTOSE-6P",
- "cas": [
- "643-13-0"
- ],
- "chebi": [
- "CHEBI:57634",
- "CHEBI:12352",
- "CHEBI:45804",
- "CHEBI:61527",
- "CHEBI:61553",
- "CHEBI:10375",
- "CHEBI:16084",
- "CHEBI:42378",
- "CHEBI:22768"
- ],
- "hmdb": "HMDB03971",
- "kegg.compound": [
- "C05345",
- "C00085"
- ],
- "pubchem.substance": "3385",
- "seed.compound": "cpd00072",
- "unipathway.compound": [
- "UPC05345",
- "UPC00085"
- ]
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/f6p",
+ "http://identifiers.org/biocyc/FRUCTOSE-6P",
+ "http://identifiers.org/cas/643-13-0",
+ "http://identifiers.org/cas/643-13-0",
+ "http://identifiers.org/chebi/CHEBI:57634",
+ "http://identifiers.org/chebi/CHEBI:12352",
+ "http://identifiers.org/chebi/CHEBI:45804",
+ "http://identifiers.org/chebi/CHEBI:61527",
+ "http://identifiers.org/chebi/CHEBI:61553",
+ "http://identifiers.org/chebi/CHEBI:10375",
+ "http://identifiers.org/chebi/CHEBI:16084",
+ "http://identifiers.org/chebi/CHEBI:42378",
+ "http://identifiers.org/chebi/CHEBI:22768",
+ "http://identifiers.org/hmdb/HMDB03971",
+ "http://identifiers.org/kegg.compound/C05345",
+ "http://identifiers.org/kegg.compound/C00085",
+ "http://identifiers.org/pubchem.substance/3385",
+ "http://identifiers.org/seed.compound/cpd00072",
+ "http://identifiers.org/unipathway.compound/UPC05345",
+ "http://identifiers.org/unipathway.compound/UPC00085"
+ ]
+ }
+ ]
+ }
},
"charge": -2,
"compartment": "c",
"formula": "C6H11O9P",
- "id": "f6p_c",
+ "id": "M_f6p_c",
"name": "D-Fructose 6-phosphate"
},
{
"annotation": {
- "bigg.metabolite": "fdp",
- "biocyc": "FRUCTOSE-16-DIPHOSPHATE",
- "cas": [
- "488-69-7"
- ],
- "chebi": [
- "CHEBI:32968",
- "CHEBI:49299",
- "CHEBI:42553",
- "CHEBI:32966",
- "CHEBI:37736",
- "CHEBI:28013",
- "CHEBI:32967",
- "CHEBI:41014",
- "CHEBI:22767",
- "CHEBI:10374",
- "CHEBI:40595",
- "CHEBI:40591"
- ],
- "kegg.compound": [
- "C05378",
- "C00354"
- ],
- "pubchem.substance": "3647",
- "seed.compound": "cpd00290",
- "unipathway.compound": "UPC00354"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/fdp",
+ "http://identifiers.org/biocyc/FRUCTOSE-16-DIPHOSPHATE",
+ "http://identifiers.org/cas/488-69-7",
+ "http://identifiers.org/cas/488-69-7",
+ "http://identifiers.org/chebi/CHEBI:32968",
+ "http://identifiers.org/chebi/CHEBI:49299",
+ "http://identifiers.org/chebi/CHEBI:42553",
+ "http://identifiers.org/chebi/CHEBI:32966",
+ "http://identifiers.org/chebi/CHEBI:37736",
+ "http://identifiers.org/chebi/CHEBI:28013",
+ "http://identifiers.org/chebi/CHEBI:32967",
+ "http://identifiers.org/chebi/CHEBI:41014",
+ "http://identifiers.org/chebi/CHEBI:22767",
+ "http://identifiers.org/chebi/CHEBI:10374",
+ "http://identifiers.org/chebi/CHEBI:40595",
+ "http://identifiers.org/chebi/CHEBI:40591",
+ "http://identifiers.org/kegg.compound/C05378",
+ "http://identifiers.org/kegg.compound/C00354",
+ "http://identifiers.org/pubchem.substance/3647",
+ "http://identifiers.org/seed.compound/cpd00290",
+ "http://identifiers.org/unipathway.compound/UPC00354"
+ ]
+ }
+ ]
+ }
},
"charge": -4,
"compartment": "c",
"formula": "C6H10O12P2",
- "id": "fdp_c",
+ "id": "M_fdp_c",
"name": "D-Fructose 1,6-bisphosphate"
},
{
"annotation": {
- "bigg.metabolite": "g3p",
- "cas": [
- "142-10-9"
- ],
- "chebi": [
- "CHEBI:17138",
- "CHEBI:14333",
- "CHEBI:5446",
- "CHEBI:58027"
- ],
- "hmdb": "HMDB01112",
- "kegg.compound": [
- "C00661",
- "C00118"
- ],
- "pubchem.substance": "3930",
- "seed.compound": "cpd00102",
- "unipathway.compound": [
- "UPC00661",
- "UPC00118"
- ]
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/g3p",
+ "http://identifiers.org/cas/142-10-9",
+ "http://identifiers.org/cas/142-10-9",
+ "http://identifiers.org/chebi/CHEBI:17138",
+ "http://identifiers.org/chebi/CHEBI:14333",
+ "http://identifiers.org/chebi/CHEBI:5446",
+ "http://identifiers.org/chebi/CHEBI:58027",
+ "http://identifiers.org/hmdb/HMDB01112",
+ "http://identifiers.org/kegg.compound/C00661",
+ "http://identifiers.org/kegg.compound/C00118",
+ "http://identifiers.org/pubchem.substance/3930",
+ "http://identifiers.org/seed.compound/cpd00102",
+ "http://identifiers.org/unipathway.compound/UPC00661",
+ "http://identifiers.org/unipathway.compound/UPC00118"
+ ]
+ }
+ ]
+ }
},
"charge": -2,
"compartment": "c",
"formula": "C3H5O6P",
- "id": "g3p_c",
+ "id": "M_g3p_c",
"name": "Glyceraldehyde 3-phosphate"
},
{
"annotation": {
- "bigg.metabolite": "g6p",
- "biocyc": [
- "D-glucose-6-phosphate",
- "GLC-6-P"
- ],
- "cas": [
- "56-73-5"
- ],
- "chebi": [
- "CHEBI:10399",
- "CHEBI:22797",
- "CHEBI:41041",
- "CHEBI:17719",
- "CHEBI:4170",
- "CHEBI:61548",
- "CHEBI:58247",
- "CHEBI:12375"
- ],
- "hmdb": [
- "HMDB03498",
- "HMDB06793",
- "HMDB01401",
- "HMDB01549"
- ],
- "kegg.compound": [
- "C00092",
- "C01172"
- ],
- "pubchem.substance": "3392",
- "reactome": "REACT_1629756",
- "seed.compound": "cpd00079",
- "unipathway.compound": "UPC00092"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/g6p",
+ "http://identifiers.org/biocyc/D-glucose-6-phosphate",
+ "http://identifiers.org/biocyc/GLC-6-P",
+ "http://identifiers.org/cas/56-73-5",
+ "http://identifiers.org/cas/56-73-5",
+ "http://identifiers.org/chebi/CHEBI:10399",
+ "http://identifiers.org/chebi/CHEBI:22797",
+ "http://identifiers.org/chebi/CHEBI:41041",
+ "http://identifiers.org/chebi/CHEBI:17719",
+ "http://identifiers.org/chebi/CHEBI:4170",
+ "http://identifiers.org/chebi/CHEBI:61548",
+ "http://identifiers.org/chebi/CHEBI:58247",
+ "http://identifiers.org/chebi/CHEBI:12375",
+ "http://identifiers.org/hmdb/HMDB03498",
+ "http://identifiers.org/hmdb/HMDB06793",
+ "http://identifiers.org/hmdb/HMDB01401",
+ "http://identifiers.org/hmdb/HMDB01549",
+ "http://identifiers.org/kegg.compound/C00092",
+ "http://identifiers.org/kegg.compound/C01172",
+ "http://identifiers.org/pubchem.substance/3392",
+ "http://identifiers.org/reactome/REACT_1629756",
+ "http://identifiers.org/seed.compound/cpd00079",
+ "http://identifiers.org/unipathway.compound/UPC00092"
+ ]
+ }
+ ]
+ }
},
"charge": -2,
"compartment": "c",
"formula": "C6H11O9P",
- "id": "g6p_c",
+ "id": "M_g6p_c",
"name": "D-Glucose 6-phosphate"
},
{
"annotation": {
- "bigg.metabolite": "glc__D",
- "cas": [
- "50-99-7"
- ],
- "kegg.compound": "C00031",
- "pubchem.substance": "3333"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/glc__D",
+ "http://identifiers.org/cas/50-99-7",
+ "http://identifiers.org/cas/50-99-7",
+ "http://identifiers.org/kegg.compound/C00031",
+ "http://identifiers.org/pubchem.substance/3333"
+ ]
+ }
+ ]
+ }
},
"charge": 0,
"compartment": "e",
"formula": "C6H12O6",
- "id": "glc__D_e",
+ "id": "M_glc__D_e",
"name": "D-Glucose"
},
{
"annotation": {
- "bigg.metabolite": "h2o",
- "biocyc": [
- "WATER",
- "OH",
- "OXONIUM"
- ],
- "cas": [
- "7732-18-5"
- ],
- "chebi": [
- "CHEBI:15377",
- "CHEBI:13365",
- "CHEBI:41979",
- "CHEBI:16234",
- "CHEBI:36385",
- "CHEBI:42857",
- "CHEBI:27313",
- "CHEBI:44819",
- "CHEBI:29373",
- "CHEBI:10743",
- "CHEBI:5594",
- "CHEBI:29356",
- "CHEBI:53442",
- "CHEBI:29375",
- "CHEBI:29374",
- "CHEBI:13419",
- "CHEBI:43228",
- "CHEBI:44292",
- "CHEBI:13352",
- "CHEBI:41981",
- "CHEBI:29412",
- "CHEBI:42043",
- "CHEBI:33811",
- "CHEBI:33813",
- "CHEBI:35511",
- "CHEBI:5585",
- "CHEBI:44641",
- "CHEBI:44701"
- ],
- "hmdb": [
- "HMDB01039",
- "HMDB02111"
- ],
- "kegg.compound": [
- "C01328",
- "C00001",
- "C18714",
- "C18712"
- ],
- "kegg.drug": [
- "D00001",
- "D06322",
- "D03703"
- ],
- "pubchem.substance": "3303",
- "reactome": [
- "REACT_947593",
- "REACT_189422",
- "REACT_141343",
- "REACT_113518",
- "REACT_1605715",
- "REACT_109276",
- "REACT_113521",
- "REACT_113519",
- "REACT_2022884",
- "REACT_351603",
- "REACT_29356"
- ],
- "seed.compound": [
- "cpd15275",
- "cpd00001"
- ],
- "unipathway.compound": [
- "UPC00001",
- "UPC01328"
- ]
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h2o",
+ "http://identifiers.org/biocyc/WATER",
+ "http://identifiers.org/biocyc/OH",
+ "http://identifiers.org/biocyc/OXONIUM",
+ "http://identifiers.org/cas/7732-18-5",
+ "http://identifiers.org/cas/7732-18-5",
+ "http://identifiers.org/chebi/CHEBI:15377",
+ "http://identifiers.org/chebi/CHEBI:13365",
+ "http://identifiers.org/chebi/CHEBI:41979",
+ "http://identifiers.org/chebi/CHEBI:16234",
+ "http://identifiers.org/chebi/CHEBI:36385",
+ "http://identifiers.org/chebi/CHEBI:42857",
+ "http://identifiers.org/chebi/CHEBI:27313",
+ "http://identifiers.org/chebi/CHEBI:44819",
+ "http://identifiers.org/chebi/CHEBI:29373",
+ "http://identifiers.org/chebi/CHEBI:10743",
+ "http://identifiers.org/chebi/CHEBI:5594",
+ "http://identifiers.org/chebi/CHEBI:29356",
+ "http://identifiers.org/chebi/CHEBI:53442",
+ "http://identifiers.org/chebi/CHEBI:29375",
+ "http://identifiers.org/chebi/CHEBI:29374",
+ "http://identifiers.org/chebi/CHEBI:13419",
+ "http://identifiers.org/chebi/CHEBI:43228",
+ "http://identifiers.org/chebi/CHEBI:44292",
+ "http://identifiers.org/chebi/CHEBI:13352",
+ "http://identifiers.org/chebi/CHEBI:41981",
+ "http://identifiers.org/chebi/CHEBI:29412",
+ "http://identifiers.org/chebi/CHEBI:42043",
+ "http://identifiers.org/chebi/CHEBI:33811",
+ "http://identifiers.org/chebi/CHEBI:33813",
+ "http://identifiers.org/chebi/CHEBI:35511",
+ "http://identifiers.org/chebi/CHEBI:5585",
+ "http://identifiers.org/chebi/CHEBI:44641",
+ "http://identifiers.org/chebi/CHEBI:44701",
+ "http://identifiers.org/hmdb/HMDB01039",
+ "http://identifiers.org/hmdb/HMDB02111",
+ "http://identifiers.org/kegg.compound/C01328",
+ "http://identifiers.org/kegg.compound/C00001",
+ "http://identifiers.org/kegg.compound/C18714",
+ "http://identifiers.org/kegg.compound/C18712",
+ "http://identifiers.org/kegg.drug/D00001",
+ "http://identifiers.org/kegg.drug/D06322",
+ "http://identifiers.org/kegg.drug/D03703",
+ "http://identifiers.org/pubchem.substance/3303",
+ "http://identifiers.org/reactome/REACT_947593",
+ "http://identifiers.org/reactome/REACT_189422",
+ "http://identifiers.org/reactome/REACT_141343",
+ "http://identifiers.org/reactome/REACT_113518",
+ "http://identifiers.org/reactome/REACT_1605715",
+ "http://identifiers.org/reactome/REACT_109276",
+ "http://identifiers.org/reactome/REACT_113521",
+ "http://identifiers.org/reactome/REACT_113519",
+ "http://identifiers.org/reactome/REACT_2022884",
+ "http://identifiers.org/reactome/REACT_351603",
+ "http://identifiers.org/reactome/REACT_29356",
+ "http://identifiers.org/seed.compound/cpd15275",
+ "http://identifiers.org/seed.compound/cpd00001",
+ "http://identifiers.org/unipathway.compound/UPC00001",
+ "http://identifiers.org/unipathway.compound/UPC01328"
+ ]
+ }
+ ]
+ }
},
"charge": 0,
"compartment": "c",
"formula": "H2O",
- "id": "h2o_c",
+ "id": "M_h2o_c",
"name": "H2O"
},
{
"annotation": {
- "bigg.metabolite": "h2o",
- "biocyc": [
- "WATER",
- "OH",
- "OXONIUM"
- ],
- "cas": [
- "7732-18-5"
- ],
- "chebi": [
- "CHEBI:15377",
- "CHEBI:13365",
- "CHEBI:41979",
- "CHEBI:16234",
- "CHEBI:36385",
- "CHEBI:42857",
- "CHEBI:27313",
- "CHEBI:44819",
- "CHEBI:29373",
- "CHEBI:10743",
- "CHEBI:5594",
- "CHEBI:29356",
- "CHEBI:53442",
- "CHEBI:29375",
- "CHEBI:29374",
- "CHEBI:13419",
- "CHEBI:43228",
- "CHEBI:44292",
- "CHEBI:13352",
- "CHEBI:41981",
- "CHEBI:29412",
- "CHEBI:42043",
- "CHEBI:33811",
- "CHEBI:33813",
- "CHEBI:35511",
- "CHEBI:5585",
- "CHEBI:44641",
- "CHEBI:44701"
- ],
- "hmdb": [
- "HMDB01039",
- "HMDB02111"
- ],
- "kegg.compound": [
- "C01328",
- "C00001",
- "C18714",
- "C18712"
- ],
- "kegg.drug": [
- "D00001",
- "D06322",
- "D03703"
- ],
- "pubchem.substance": "3303",
- "reactome": [
- "REACT_947593",
- "REACT_189422",
- "REACT_141343",
- "REACT_113518",
- "REACT_1605715",
- "REACT_109276",
- "REACT_113521",
- "REACT_113519",
- "REACT_2022884",
- "REACT_351603",
- "REACT_29356"
- ],
- "seed.compound": [
- "cpd15275",
- "cpd00001"
- ],
- "unipathway.compound": [
- "UPC00001",
- "UPC01328"
- ]
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h2o",
+ "http://identifiers.org/biocyc/WATER",
+ "http://identifiers.org/biocyc/OH",
+ "http://identifiers.org/biocyc/OXONIUM",
+ "http://identifiers.org/cas/7732-18-5",
+ "http://identifiers.org/cas/7732-18-5",
+ "http://identifiers.org/chebi/CHEBI:15377",
+ "http://identifiers.org/chebi/CHEBI:13365",
+ "http://identifiers.org/chebi/CHEBI:41979",
+ "http://identifiers.org/chebi/CHEBI:16234",
+ "http://identifiers.org/chebi/CHEBI:36385",
+ "http://identifiers.org/chebi/CHEBI:42857",
+ "http://identifiers.org/chebi/CHEBI:27313",
+ "http://identifiers.org/chebi/CHEBI:44819",
+ "http://identifiers.org/chebi/CHEBI:29373",
+ "http://identifiers.org/chebi/CHEBI:10743",
+ "http://identifiers.org/chebi/CHEBI:5594",
+ "http://identifiers.org/chebi/CHEBI:29356",
+ "http://identifiers.org/chebi/CHEBI:53442",
+ "http://identifiers.org/chebi/CHEBI:29375",
+ "http://identifiers.org/chebi/CHEBI:29374",
+ "http://identifiers.org/chebi/CHEBI:13419",
+ "http://identifiers.org/chebi/CHEBI:43228",
+ "http://identifiers.org/chebi/CHEBI:44292",
+ "http://identifiers.org/chebi/CHEBI:13352",
+ "http://identifiers.org/chebi/CHEBI:41981",
+ "http://identifiers.org/chebi/CHEBI:29412",
+ "http://identifiers.org/chebi/CHEBI:42043",
+ "http://identifiers.org/chebi/CHEBI:33811",
+ "http://identifiers.org/chebi/CHEBI:33813",
+ "http://identifiers.org/chebi/CHEBI:35511",
+ "http://identifiers.org/chebi/CHEBI:5585",
+ "http://identifiers.org/chebi/CHEBI:44641",
+ "http://identifiers.org/chebi/CHEBI:44701",
+ "http://identifiers.org/hmdb/HMDB01039",
+ "http://identifiers.org/hmdb/HMDB02111",
+ "http://identifiers.org/kegg.compound/C01328",
+ "http://identifiers.org/kegg.compound/C00001",
+ "http://identifiers.org/kegg.compound/C18714",
+ "http://identifiers.org/kegg.compound/C18712",
+ "http://identifiers.org/kegg.drug/D00001",
+ "http://identifiers.org/kegg.drug/D06322",
+ "http://identifiers.org/kegg.drug/D03703",
+ "http://identifiers.org/pubchem.substance/3303",
+ "http://identifiers.org/reactome/REACT_947593",
+ "http://identifiers.org/reactome/REACT_189422",
+ "http://identifiers.org/reactome/REACT_141343",
+ "http://identifiers.org/reactome/REACT_113518",
+ "http://identifiers.org/reactome/REACT_1605715",
+ "http://identifiers.org/reactome/REACT_109276",
+ "http://identifiers.org/reactome/REACT_113521",
+ "http://identifiers.org/reactome/REACT_113519",
+ "http://identifiers.org/reactome/REACT_2022884",
+ "http://identifiers.org/reactome/REACT_351603",
+ "http://identifiers.org/reactome/REACT_29356",
+ "http://identifiers.org/seed.compound/cpd15275",
+ "http://identifiers.org/seed.compound/cpd00001",
+ "http://identifiers.org/unipathway.compound/UPC00001",
+ "http://identifiers.org/unipathway.compound/UPC01328"
+ ]
+ }
+ ]
+ }
},
"charge": 0,
"compartment": "e",
"formula": "H2O",
- "id": "h2o_e",
+ "id": "M_h2o_e",
"name": "H2O"
},
{
"annotation": {
- "bigg.metabolite": "h",
- "biocyc": "PROTON",
- "cas": [
- "12408-02-5"
- ],
- "chebi": [
- "CHEBI:24636",
- "CHEBI:15378",
- "CHEBI:10744",
- "CHEBI:13357",
- "CHEBI:5584"
- ],
- "kegg.compound": "C00080",
- "pubchem.substance": "3380",
- "reactome": [
- "REACT_194688",
- "REACT_425978",
- "REACT_193465",
- "REACT_374900",
- "REACT_74722",
- "REACT_425999",
- "REACT_428040",
- "REACT_163953",
- "REACT_372511",
- "REACT_2000349",
- "REACT_70106",
- "REACT_1470067",
- "REACT_113529",
- "REACT_425969",
- "REACT_428548",
- "REACT_156540",
- "REACT_1614597",
- "REACT_351626",
- "REACT_427899"
- ],
- "seed.compound": "cpd00067",
- "unipathway.compound": "UPC00080"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h",
+ "http://identifiers.org/biocyc/PROTON",
+ "http://identifiers.org/cas/12408-02-5",
+ "http://identifiers.org/cas/12408-02-5",
+ "http://identifiers.org/chebi/CHEBI:24636",
+ "http://identifiers.org/chebi/CHEBI:15378",
+ "http://identifiers.org/chebi/CHEBI:10744",
+ "http://identifiers.org/chebi/CHEBI:13357",
+ "http://identifiers.org/chebi/CHEBI:5584",
+ "http://identifiers.org/kegg.compound/C00080",
+ "http://identifiers.org/pubchem.substance/3380",
+ "http://identifiers.org/reactome/REACT_194688",
+ "http://identifiers.org/reactome/REACT_425978",
+ "http://identifiers.org/reactome/REACT_193465",
+ "http://identifiers.org/reactome/REACT_374900",
+ "http://identifiers.org/reactome/REACT_74722",
+ "http://identifiers.org/reactome/REACT_425999",
+ "http://identifiers.org/reactome/REACT_428040",
+ "http://identifiers.org/reactome/REACT_163953",
+ "http://identifiers.org/reactome/REACT_372511",
+ "http://identifiers.org/reactome/REACT_2000349",
+ "http://identifiers.org/reactome/REACT_70106",
+ "http://identifiers.org/reactome/REACT_1470067",
+ "http://identifiers.org/reactome/REACT_113529",
+ "http://identifiers.org/reactome/REACT_425969",
+ "http://identifiers.org/reactome/REACT_428548",
+ "http://identifiers.org/reactome/REACT_156540",
+ "http://identifiers.org/reactome/REACT_1614597",
+ "http://identifiers.org/reactome/REACT_351626",
+ "http://identifiers.org/reactome/REACT_427899",
+ "http://identifiers.org/seed.compound/cpd00067",
+ "http://identifiers.org/unipathway.compound/UPC00080"
+ ]
+ }
+ ]
+ }
},
"charge": 1,
"compartment": "c",
"formula": "H",
- "id": "h_c",
+ "id": "M_h_c",
"name": "H+"
},
{
"annotation": {
- "bigg.metabolite": "h",
- "biocyc": "PROTON",
- "cas": [
- "12408-02-5"
- ],
- "chebi": [
- "CHEBI:24636",
- "CHEBI:15378",
- "CHEBI:10744",
- "CHEBI:13357",
- "CHEBI:5584"
- ],
- "kegg.compound": "C00080",
- "pubchem.substance": "3380",
- "reactome": [
- "REACT_194688",
- "REACT_425978",
- "REACT_193465",
- "REACT_374900",
- "REACT_74722",
- "REACT_425999",
- "REACT_428040",
- "REACT_163953",
- "REACT_372511",
- "REACT_2000349",
- "REACT_70106",
- "REACT_1470067",
- "REACT_113529",
- "REACT_425969",
- "REACT_428548",
- "REACT_156540",
- "REACT_1614597",
- "REACT_351626",
- "REACT_427899"
- ],
- "seed.compound": "cpd00067",
- "unipathway.compound": "UPC00080"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h",
+ "http://identifiers.org/biocyc/PROTON",
+ "http://identifiers.org/cas/12408-02-5",
+ "http://identifiers.org/cas/12408-02-5",
+ "http://identifiers.org/chebi/CHEBI:24636",
+ "http://identifiers.org/chebi/CHEBI:15378",
+ "http://identifiers.org/chebi/CHEBI:10744",
+ "http://identifiers.org/chebi/CHEBI:13357",
+ "http://identifiers.org/chebi/CHEBI:5584",
+ "http://identifiers.org/kegg.compound/C00080",
+ "http://identifiers.org/pubchem.substance/3380",
+ "http://identifiers.org/reactome/REACT_194688",
+ "http://identifiers.org/reactome/REACT_425978",
+ "http://identifiers.org/reactome/REACT_193465",
+ "http://identifiers.org/reactome/REACT_374900",
+ "http://identifiers.org/reactome/REACT_74722",
+ "http://identifiers.org/reactome/REACT_425999",
+ "http://identifiers.org/reactome/REACT_428040",
+ "http://identifiers.org/reactome/REACT_163953",
+ "http://identifiers.org/reactome/REACT_372511",
+ "http://identifiers.org/reactome/REACT_2000349",
+ "http://identifiers.org/reactome/REACT_70106",
+ "http://identifiers.org/reactome/REACT_1470067",
+ "http://identifiers.org/reactome/REACT_113529",
+ "http://identifiers.org/reactome/REACT_425969",
+ "http://identifiers.org/reactome/REACT_428548",
+ "http://identifiers.org/reactome/REACT_156540",
+ "http://identifiers.org/reactome/REACT_1614597",
+ "http://identifiers.org/reactome/REACT_351626",
+ "http://identifiers.org/reactome/REACT_427899",
+ "http://identifiers.org/seed.compound/cpd00067",
+ "http://identifiers.org/unipathway.compound/UPC00080"
+ ]
+ }
+ ]
+ }
},
"charge": 1,
"compartment": "e",
"formula": "H",
- "id": "h_e",
+ "id": "M_h_e",
"name": "H+"
},
{
"annotation": {
- "bigg.metabolite": "lac__D",
- "biocyc": "META:D-LACTATE",
- "chebi": [
- "CHEBI:11001",
- "CHEBI:16004",
- "CHEBI:18684",
- "CHEBI:341",
- "CHEBI:42105",
- "CHEBI:42111",
- "CHEBI:43701"
- ],
- "hmdb": [
- "HMDB00171",
- "HMDB01311"
- ],
- "kegg.compound": "C00256",
- "metanetx.chemical": "MNXM285",
- "seed.compound": "cpd00221"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/lac__D",
+ "http://identifiers.org/biocyc/META:D-LACTATE",
+ "http://identifiers.org/chebi/CHEBI:11001",
+ "http://identifiers.org/chebi/CHEBI:16004",
+ "http://identifiers.org/chebi/CHEBI:18684",
+ "http://identifiers.org/chebi/CHEBI:341",
+ "http://identifiers.org/chebi/CHEBI:42105",
+ "http://identifiers.org/chebi/CHEBI:42111",
+ "http://identifiers.org/chebi/CHEBI:43701",
+ "http://identifiers.org/hmdb/HMDB00171",
+ "http://identifiers.org/hmdb/HMDB01311",
+ "http://identifiers.org/kegg.compound/C00256",
+ "http://identifiers.org/metanetx.chemical/MNXM285",
+ "http://identifiers.org/seed.compound/cpd00221"
+ ]
+ }
+ ]
+ }
},
"charge": -1,
"compartment": "c",
"formula": "C3H5O3",
- "id": "lac__D_c",
+ "id": "M_lac__D_c",
"name": "D-Lactate"
},
{
"annotation": {
- "bigg.metabolite": "lac__D",
- "biocyc": "META:D-LACTATE",
- "chebi": [
- "CHEBI:11001",
- "CHEBI:16004",
- "CHEBI:18684",
- "CHEBI:341",
- "CHEBI:42105",
- "CHEBI:42111",
- "CHEBI:43701"
- ],
- "hmdb": [
- "HMDB00171",
- "HMDB01311"
- ],
- "kegg.compound": "C00256",
- "metanetx.chemical": "MNXM285",
- "seed.compound": "cpd00221"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/lac__D",
+ "http://identifiers.org/biocyc/META:D-LACTATE",
+ "http://identifiers.org/chebi/CHEBI:11001",
+ "http://identifiers.org/chebi/CHEBI:16004",
+ "http://identifiers.org/chebi/CHEBI:18684",
+ "http://identifiers.org/chebi/CHEBI:341",
+ "http://identifiers.org/chebi/CHEBI:42105",
+ "http://identifiers.org/chebi/CHEBI:42111",
+ "http://identifiers.org/chebi/CHEBI:43701",
+ "http://identifiers.org/hmdb/HMDB00171",
+ "http://identifiers.org/hmdb/HMDB01311",
+ "http://identifiers.org/kegg.compound/C00256",
+ "http://identifiers.org/metanetx.chemical/MNXM285",
+ "http://identifiers.org/seed.compound/cpd00221"
+ ]
+ }
+ ]
+ }
},
"charge": -1,
"compartment": "e",
"formula": "C3H5O3",
- "id": "lac__D_e",
+ "id": "M_lac__D_e",
"name": "D-Lactate"
},
{
"annotation": {
- "bigg.metabolite": "nad",
- "biocyc": "NAD",
- "cas": [
- "53-84-9"
- ],
- "chebi": [
- "CHEBI:21901",
- "CHEBI:7422",
- "CHEBI:44214",
- "CHEBI:15846",
- "CHEBI:13394",
- "CHEBI:13393",
- "CHEBI:44215",
- "CHEBI:13389",
- "CHEBI:57540",
- "CHEBI:44281"
- ],
- "hmdb": "HMDB00902",
- "kegg.compound": "C00003",
- "kegg.drug": "D00002",
- "pubchem.substance": "3305",
- "reactome": [
- "REACT_192307",
- "REACT_29360",
- "REACT_427523",
- "REACT_194653",
- "REACT_113526"
- ],
- "seed.compound": "cpd00003",
- "unipathway.compound": "UPC00003"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nad",
+ "http://identifiers.org/biocyc/NAD",
+ "http://identifiers.org/cas/53-84-9",
+ "http://identifiers.org/cas/53-84-9",
+ "http://identifiers.org/chebi/CHEBI:21901",
+ "http://identifiers.org/chebi/CHEBI:7422",
+ "http://identifiers.org/chebi/CHEBI:44214",
+ "http://identifiers.org/chebi/CHEBI:15846",
+ "http://identifiers.org/chebi/CHEBI:13394",
+ "http://identifiers.org/chebi/CHEBI:13393",
+ "http://identifiers.org/chebi/CHEBI:44215",
+ "http://identifiers.org/chebi/CHEBI:13389",
+ "http://identifiers.org/chebi/CHEBI:57540",
+ "http://identifiers.org/chebi/CHEBI:44281",
+ "http://identifiers.org/hmdb/HMDB00902",
+ "http://identifiers.org/kegg.compound/C00003",
+ "http://identifiers.org/kegg.drug/D00002",
+ "http://identifiers.org/pubchem.substance/3305",
+ "http://identifiers.org/reactome/REACT_192307",
+ "http://identifiers.org/reactome/REACT_29360",
+ "http://identifiers.org/reactome/REACT_427523",
+ "http://identifiers.org/reactome/REACT_194653",
+ "http://identifiers.org/reactome/REACT_113526",
+ "http://identifiers.org/seed.compound/cpd00003",
+ "http://identifiers.org/unipathway.compound/UPC00003"
+ ]
+ }
+ ]
+ }
},
"charge": -1,
"compartment": "c",
"formula": "C21H26N7O14P2",
- "id": "nad_c",
+ "id": "M_nad_c",
"name": "Nicotinamide adenine dinucleotide"
},
{
"annotation": {
- "bigg.metabolite": "nadh",
- "biocyc": "NADH",
- "cas": [
- "58-68-4"
- ],
- "chebi": [
- "CHEBI:13395",
- "CHEBI:21902",
- "CHEBI:16908",
- "CHEBI:7423",
- "CHEBI:44216",
- "CHEBI:57945",
- "CHEBI:13396"
- ],
- "hmdb": "HMDB01487",
- "kegg.compound": "C00004",
- "pubchem.substance": "3306",
- "reactome": [
- "REACT_192305",
- "REACT_73473",
- "REACT_194697",
- "REACT_29362"
- ],
- "seed.compound": "cpd00004",
- "unipathway.compound": "UPC00004"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nadh",
+ "http://identifiers.org/biocyc/NADH",
+ "http://identifiers.org/cas/58-68-4",
+ "http://identifiers.org/cas/58-68-4",
+ "http://identifiers.org/chebi/CHEBI:13395",
+ "http://identifiers.org/chebi/CHEBI:21902",
+ "http://identifiers.org/chebi/CHEBI:16908",
+ "http://identifiers.org/chebi/CHEBI:7423",
+ "http://identifiers.org/chebi/CHEBI:44216",
+ "http://identifiers.org/chebi/CHEBI:57945",
+ "http://identifiers.org/chebi/CHEBI:13396",
+ "http://identifiers.org/hmdb/HMDB01487",
+ "http://identifiers.org/kegg.compound/C00004",
+ "http://identifiers.org/pubchem.substance/3306",
+ "http://identifiers.org/reactome/REACT_192305",
+ "http://identifiers.org/reactome/REACT_73473",
+ "http://identifiers.org/reactome/REACT_194697",
+ "http://identifiers.org/reactome/REACT_29362",
+ "http://identifiers.org/seed.compound/cpd00004",
+ "http://identifiers.org/unipathway.compound/UPC00004"
+ ]
+ }
+ ]
+ }
},
"charge": -2,
"compartment": "c",
"formula": "C21H27N7O14P2",
- "id": "nadh_c",
+ "id": "M_nadh_c",
"name": "Nicotinamide adenine dinucleotide - reduced"
},
{
"annotation": {
- "bigg.metabolite": "pep",
- "biocyc": "PHOSPHO-ENOL-PYRUVATE",
- "cas": [
- "138-08-9"
- ],
- "chebi": [
- "CHEBI:44897",
- "CHEBI:44894",
- "CHEBI:14812",
- "CHEBI:8147",
- "CHEBI:26055",
- "CHEBI:26054",
- "CHEBI:58702",
- "CHEBI:18021"
- ],
- "hmdb": "HMDB00263",
- "kegg.compound": "C00074",
- "pubchem.substance": "3374",
- "reactome": [
- "REACT_29492",
- "REACT_372364"
- ],
- "seed.compound": "cpd00061",
- "unipathway.compound": "UPC00074"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pep",
+ "http://identifiers.org/biocyc/PHOSPHO-ENOL-PYRUVATE",
+ "http://identifiers.org/cas/138-08-9",
+ "http://identifiers.org/cas/138-08-9",
+ "http://identifiers.org/chebi/CHEBI:44897",
+ "http://identifiers.org/chebi/CHEBI:44894",
+ "http://identifiers.org/chebi/CHEBI:14812",
+ "http://identifiers.org/chebi/CHEBI:8147",
+ "http://identifiers.org/chebi/CHEBI:26055",
+ "http://identifiers.org/chebi/CHEBI:26054",
+ "http://identifiers.org/chebi/CHEBI:58702",
+ "http://identifiers.org/chebi/CHEBI:18021",
+ "http://identifiers.org/hmdb/HMDB00263",
+ "http://identifiers.org/kegg.compound/C00074",
+ "http://identifiers.org/pubchem.substance/3374",
+ "http://identifiers.org/reactome/REACT_29492",
+ "http://identifiers.org/reactome/REACT_372364",
+ "http://identifiers.org/seed.compound/cpd00061",
+ "http://identifiers.org/unipathway.compound/UPC00074"
+ ]
+ }
+ ]
+ }
},
"charge": -3,
"compartment": "c",
"formula": "C3H2O6P",
- "id": "pep_c",
+ "id": "M_pep_c",
"name": "Phosphoenolpyruvate"
},
{
"annotation": {
- "bigg.metabolite": "pi",
- "biocyc": [
- "Pi",
- "PHOSPHATE-GROUP",
- "CPD0-1421"
- ],
- "cas": [
- "14265-44-2"
- ],
- "chebi": [
- "CHEBI:37583",
- "CHEBI:7793",
- "CHEBI:37585",
- "CHEBI:34683",
- "CHEBI:14791",
- "CHEBI:34855",
- "CHEBI:29137",
- "CHEBI:29139",
- "CHEBI:63036",
- "CHEBI:26020",
- "CHEBI:39739",
- "CHEBI:32597",
- "CHEBI:32596",
- "CHEBI:43474",
- "CHEBI:63051",
- "CHEBI:43470",
- "CHEBI:9679",
- "CHEBI:35433",
- "CHEBI:4496",
- "CHEBI:45024",
- "CHEBI:18367",
- "CHEBI:26078",
- "CHEBI:39745",
- "CHEBI:24838"
- ],
- "hmdb": "HMDB02142",
- "kegg.compound": [
- "C13556",
- "C13558",
- "C00009"
- ],
- "kegg.drug": "D05467",
- "pubchem.substance": "3311",
- "reactome": [
- "REACT_947590",
- "REACT_109277",
- "REACT_113548",
- "REACT_2255331",
- "REACT_29372",
- "REACT_113550",
- "REACT_113551"
- ],
- "seed.compound": [
- "cpd09464",
- "cpd09463",
- "cpd00009"
- ],
- "unipathway.compound": "UPC00009"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pi",
+ "http://identifiers.org/biocyc/Pi",
+ "http://identifiers.org/biocyc/PHOSPHATE-GROUP",
+ "http://identifiers.org/biocyc/CPD0-1421",
+ "http://identifiers.org/cas/14265-44-2",
+ "http://identifiers.org/cas/14265-44-2",
+ "http://identifiers.org/chebi/CHEBI:37583",
+ "http://identifiers.org/chebi/CHEBI:7793",
+ "http://identifiers.org/chebi/CHEBI:37585",
+ "http://identifiers.org/chebi/CHEBI:34683",
+ "http://identifiers.org/chebi/CHEBI:14791",
+ "http://identifiers.org/chebi/CHEBI:34855",
+ "http://identifiers.org/chebi/CHEBI:29137",
+ "http://identifiers.org/chebi/CHEBI:29139",
+ "http://identifiers.org/chebi/CHEBI:63036",
+ "http://identifiers.org/chebi/CHEBI:26020",
+ "http://identifiers.org/chebi/CHEBI:39739",
+ "http://identifiers.org/chebi/CHEBI:32597",
+ "http://identifiers.org/chebi/CHEBI:32596",
+ "http://identifiers.org/chebi/CHEBI:43474",
+ "http://identifiers.org/chebi/CHEBI:63051",
+ "http://identifiers.org/chebi/CHEBI:43470",
+ "http://identifiers.org/chebi/CHEBI:9679",
+ "http://identifiers.org/chebi/CHEBI:35433",
+ "http://identifiers.org/chebi/CHEBI:4496",
+ "http://identifiers.org/chebi/CHEBI:45024",
+ "http://identifiers.org/chebi/CHEBI:18367",
+ "http://identifiers.org/chebi/CHEBI:26078",
+ "http://identifiers.org/chebi/CHEBI:39745",
+ "http://identifiers.org/chebi/CHEBI:24838",
+ "http://identifiers.org/hmdb/HMDB02142",
+ "http://identifiers.org/kegg.compound/C13556",
+ "http://identifiers.org/kegg.compound/C13558",
+ "http://identifiers.org/kegg.compound/C00009",
+ "http://identifiers.org/kegg.drug/D05467",
+ "http://identifiers.org/pubchem.substance/3311",
+ "http://identifiers.org/reactome/REACT_947590",
+ "http://identifiers.org/reactome/REACT_109277",
+ "http://identifiers.org/reactome/REACT_113548",
+ "http://identifiers.org/reactome/REACT_2255331",
+ "http://identifiers.org/reactome/REACT_29372",
+ "http://identifiers.org/reactome/REACT_113550",
+ "http://identifiers.org/reactome/REACT_113551",
+ "http://identifiers.org/seed.compound/cpd09464",
+ "http://identifiers.org/seed.compound/cpd09463",
+ "http://identifiers.org/seed.compound/cpd00009",
+ "http://identifiers.org/unipathway.compound/UPC00009"
+ ]
+ }
+ ]
+ }
},
"charge": -2,
"compartment": "c",
"formula": "HO4P",
- "id": "pi_c",
+ "id": "M_pi_c",
"name": "Phosphate"
},
{
"annotation": {
- "bigg.metabolite": "pi",
- "biocyc": [
- "Pi",
- "PHOSPHATE-GROUP",
- "CPD0-1421"
- ],
- "cas": [
- "14265-44-2"
- ],
- "chebi": [
- "CHEBI:37583",
- "CHEBI:7793",
- "CHEBI:37585",
- "CHEBI:34683",
- "CHEBI:14791",
- "CHEBI:34855",
- "CHEBI:29137",
- "CHEBI:29139",
- "CHEBI:63036",
- "CHEBI:26020",
- "CHEBI:39739",
- "CHEBI:32597",
- "CHEBI:32596",
- "CHEBI:43474",
- "CHEBI:63051",
- "CHEBI:43470",
- "CHEBI:9679",
- "CHEBI:35433",
- "CHEBI:4496",
- "CHEBI:45024",
- "CHEBI:18367",
- "CHEBI:26078",
- "CHEBI:39745",
- "CHEBI:24838"
- ],
- "hmdb": "HMDB02142",
- "kegg.compound": [
- "C13556",
- "C13558",
- "C00009"
- ],
- "kegg.drug": "D05467",
- "pubchem.substance": "3311",
- "reactome": [
- "REACT_947590",
- "REACT_109277",
- "REACT_113548",
- "REACT_2255331",
- "REACT_29372",
- "REACT_113550",
- "REACT_113551"
- ],
- "seed.compound": [
- "cpd09464",
- "cpd09463",
- "cpd00009"
- ],
- "unipathway.compound": "UPC00009"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pi",
+ "http://identifiers.org/biocyc/Pi",
+ "http://identifiers.org/biocyc/PHOSPHATE-GROUP",
+ "http://identifiers.org/biocyc/CPD0-1421",
+ "http://identifiers.org/cas/14265-44-2",
+ "http://identifiers.org/cas/14265-44-2",
+ "http://identifiers.org/chebi/CHEBI:37583",
+ "http://identifiers.org/chebi/CHEBI:7793",
+ "http://identifiers.org/chebi/CHEBI:37585",
+ "http://identifiers.org/chebi/CHEBI:34683",
+ "http://identifiers.org/chebi/CHEBI:14791",
+ "http://identifiers.org/chebi/CHEBI:34855",
+ "http://identifiers.org/chebi/CHEBI:29137",
+ "http://identifiers.org/chebi/CHEBI:29139",
+ "http://identifiers.org/chebi/CHEBI:63036",
+ "http://identifiers.org/chebi/CHEBI:26020",
+ "http://identifiers.org/chebi/CHEBI:39739",
+ "http://identifiers.org/chebi/CHEBI:32597",
+ "http://identifiers.org/chebi/CHEBI:32596",
+ "http://identifiers.org/chebi/CHEBI:43474",
+ "http://identifiers.org/chebi/CHEBI:63051",
+ "http://identifiers.org/chebi/CHEBI:43470",
+ "http://identifiers.org/chebi/CHEBI:9679",
+ "http://identifiers.org/chebi/CHEBI:35433",
+ "http://identifiers.org/chebi/CHEBI:4496",
+ "http://identifiers.org/chebi/CHEBI:45024",
+ "http://identifiers.org/chebi/CHEBI:18367",
+ "http://identifiers.org/chebi/CHEBI:26078",
+ "http://identifiers.org/chebi/CHEBI:39745",
+ "http://identifiers.org/chebi/CHEBI:24838",
+ "http://identifiers.org/hmdb/HMDB02142",
+ "http://identifiers.org/kegg.compound/C13556",
+ "http://identifiers.org/kegg.compound/C13558",
+ "http://identifiers.org/kegg.compound/C00009",
+ "http://identifiers.org/kegg.drug/D05467",
+ "http://identifiers.org/pubchem.substance/3311",
+ "http://identifiers.org/reactome/REACT_947590",
+ "http://identifiers.org/reactome/REACT_109277",
+ "http://identifiers.org/reactome/REACT_113548",
+ "http://identifiers.org/reactome/REACT_2255331",
+ "http://identifiers.org/reactome/REACT_29372",
+ "http://identifiers.org/reactome/REACT_113550",
+ "http://identifiers.org/reactome/REACT_113551",
+ "http://identifiers.org/seed.compound/cpd09464",
+ "http://identifiers.org/seed.compound/cpd09463",
+ "http://identifiers.org/seed.compound/cpd00009",
+ "http://identifiers.org/unipathway.compound/UPC00009"
+ ]
+ }
+ ]
+ }
},
"charge": -2,
"compartment": "e",
"formula": "HO4P",
- "id": "pi_e",
+ "id": "M_pi_e",
"name": "Phosphate"
},
{
"annotation": {
- "bigg.metabolite": "pyr",
- "biocyc": "PYRUVATE",
- "cas": [
- "127-17-3"
- ],
- "chebi": [
- "CHEBI:15361",
- "CHEBI:14987",
- "CHEBI:8685",
- "CHEBI:32816",
- "CHEBI:45253",
- "CHEBI:26466",
- "CHEBI:26462"
- ],
- "hmdb": "HMDB00243",
- "kegg.compound": "C00022",
- "lipidmaps": "LMFA01060077",
- "pubchem.substance": "3324",
- "reactome": [
- "REACT_113557",
- "REACT_389680",
- "REACT_29398"
- ],
- "seed.compound": "cpd00020",
- "unipathway.compound": "UPC00022"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pyr",
+ "http://identifiers.org/biocyc/PYRUVATE",
+ "http://identifiers.org/cas/127-17-3",
+ "http://identifiers.org/cas/127-17-3",
+ "http://identifiers.org/chebi/CHEBI:15361",
+ "http://identifiers.org/chebi/CHEBI:14987",
+ "http://identifiers.org/chebi/CHEBI:8685",
+ "http://identifiers.org/chebi/CHEBI:32816",
+ "http://identifiers.org/chebi/CHEBI:45253",
+ "http://identifiers.org/chebi/CHEBI:26466",
+ "http://identifiers.org/chebi/CHEBI:26462",
+ "http://identifiers.org/hmdb/HMDB00243",
+ "http://identifiers.org/kegg.compound/C00022",
+ "http://identifiers.org/lipidmaps/LMFA01060077",
+ "http://identifiers.org/pubchem.substance/3324",
+ "http://identifiers.org/reactome/REACT_113557",
+ "http://identifiers.org/reactome/REACT_389680",
+ "http://identifiers.org/reactome/REACT_29398",
+ "http://identifiers.org/seed.compound/cpd00020",
+ "http://identifiers.org/unipathway.compound/UPC00022"
+ ]
+ }
+ ]
+ }
},
"charge": -1,
"compartment": "c",
"formula": "C3H3O3",
- "id": "pyr_c",
+ "id": "M_pyr_c",
"name": "Pyruvate"
}
],
"reactions": [
{
"annotation": {
- "bigg.reaction": "ATPM"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ATPM"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "",
- "id": "ATPM",
+ "id": "R_ATPM",
"lower_bound": 8.39,
"metabolites": {
- "adp_c": 1.0,
- "atp_c": -1.0,
- "h2o_c": -1.0,
- "h_c": 1.0,
- "pi_c": 1.0
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0,
+ "M_pi_c": 1.0
},
"name": "ATP maintenance requirement",
"objective_coefficient": 1.0,
@@ -1126,7 +1201,7 @@
},
{
"gene_reaction_rule": "",
- "id": "D_LACt2",
+ "id": "R_D_LACt2",
"lower_bound": -1000.0,
"metabolites": {},
"name": "",
@@ -1134,148 +1209,218 @@
},
{
"annotation": {
- "bigg.reaction": "ENO"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ENO"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b2779",
- "id": "ENO",
+ "id": "R_ENO",
"lower_bound": -1000.0,
"metabolites": {
- "2pg_c": -1.0,
- "h2o_c": 1.0,
- "pep_c": 1.0
+ "M_2pg_c": -1.0,
+ "M_h2o_c": 1.0,
+ "M_pep_c": 1.0
},
"name": "enolase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "glc",
- "sbo": "SBO:0000627"
+ "sbo": "SBO:0000627",
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/glc"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "",
- "id": "EX_glc__D_e",
+ "id": "R_EX_glc__D_e",
"lower_bound": -10.0,
"metabolites": {
- "glc__D_e": -1.0
+ "M_glc__D_e": -1.0
},
"name": "D-Glucose exchange",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "h",
- "sbo": "SBO:0000627"
+ "sbo": "SBO:0000627",
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/h"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "",
- "id": "EX_h_e",
+ "id": "R_EX_h_e",
"lower_bound": -1000.0,
"metabolites": {
- "h_e": -1.0
+ "M_h_e": -1.0
},
"name": "H+ exchange",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "lac__D",
- "sbo": "SBO:0000627"
+ "sbo": "SBO:0000627",
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/lac__D"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "",
- "id": "EX_lac__D_e",
+ "id": "R_EX_lac__D_e",
"lower_bound": 0.0,
"metabolites": {
- "lac__D_e": -1.0
+ "M_lac__D_e": -1.0
},
"name": "D-lactate exchange",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "FBA"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FBA"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b1773 or b2097 or b2925",
- "id": "FBA",
+ "id": "R_FBA",
"lower_bound": -1000.0,
"metabolites": {
- "dhap_c": 1.0,
- "fdp_c": -1.0,
- "g3p_c": 1.0
+ "M_dhap_c": 1.0,
+ "M_fdp_c": -1.0,
+ "M_g3p_c": 1.0
},
"name": "fructose-bisphosphate aldolase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "GAPD"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GAPD"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b1779",
- "id": "GAPD",
+ "id": "R_GAPD",
"lower_bound": -1000.0,
"metabolites": {
- "13dpg_c": 1.0,
- "g3p_c": -1.0,
- "h_c": 1.0,
- "nad_c": -1.0,
- "nadh_c": 1.0,
- "pi_c": -1.0
+ "M_13dpg_c": 1.0,
+ "M_g3p_c": -1.0,
+ "M_h_c": 1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_pi_c": -1.0
},
"name": "glyceraldehyde-3-phosphate dehydrogenase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "GLCpts"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLCpts"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "(b2415 and b2417 and b1101 and b2416) or (b2415 and b2417 and b1621 and b2416) or (b2415 and b1818 and b1817 and b1819 and b2416)",
- "id": "GLCpts",
+ "id": "R_GLCpts",
"lower_bound": 0.0,
"metabolites": {
- "g6p_c": 1.0,
- "glc__D_e": -1.0,
- "pep_c": -1.0,
- "pyr_c": 1.0
+ "M_g6p_c": 1.0,
+ "M_glc__D_e": -1.0,
+ "M_pep_c": -1.0,
+ "M_pyr_c": 1.0
},
"name": "D-glucose transport via PEP:Pyr PTS",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "H2Ot"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/H2Ot"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b0875 or s0001",
- "id": "H2Ot",
+ "id": "R_H2Ot",
"lower_bound": -1000.0,
"metabolites": {
- "h2o_c": 1.0,
- "h2o_e": -1.0
+ "M_h2o_c": 1.0,
+ "M_h2o_e": -1.0
},
"name": "R H2O transport via - diffusion",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "LDH_D",
- "biocyc": "META:DLACTDEHYDROGNAD-RXN",
- "ec-code": "1.1.1.28",
- "kegg.reaction": "R00704",
- "metanetx.reaction": "MNXR101037",
- "rhea": [
- "16369",
- "16370",
- "16371",
- "16372"
- ],
- "sbo": "SBO:0000375"
+ "sbo": "SBO:0000375",
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/LDH_D",
+ "http://identifiers.org/biocyc/META:DLACTDEHYDROGNAD-RXN",
+ "http://identifiers.org/ec-code/1.1.1.28",
+ "http://identifiers.org/kegg.reaction/R00704",
+ "http://identifiers.org/metanetx.reaction/MNXR101037",
+ "http://identifiers.org/rhea/16369",
+ "http://identifiers.org/rhea/16370",
+ "http://identifiers.org/rhea/16371",
+ "http://identifiers.org/rhea/16372"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b2133 or b1380",
- "id": "LDH_D",
+ "id": "R_LDH_D",
"lower_bound": -1000.0,
"metabolites": {
- "h_c": 1.0,
- "lac__D_c": -1.0,
- "nad_c": -1.0,
- "nadh_c": 1.0,
- "pyr_c": 1.0
+ "M_h_c": 1.0,
+ "M_lac__D_c": -1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_pyr_c": 1.0
},
"name": "D-lactate dehydrogenase",
"subsystem": "Pyruvate Metabolism",
@@ -1283,17 +1428,25 @@
},
{
"annotation": {
- "bigg.reaction": "PFK"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PFK"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b3916 or b1723",
- "id": "PFK",
+ "id": "R_PFK",
"lower_bound": 0.0,
"metabolites": {
- "adp_c": 1.0,
- "atp_c": -1.0,
- "f6p_c": -1.0,
- "fdp_c": 1.0,
- "h_c": 1.0
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_f6p_c": -1.0,
+ "M_fdp_c": 1.0,
+ "M_h_c": 1.0
},
"name": "phosphofructokinase",
"objective_coefficient": 1.0,
@@ -1301,91 +1454,139 @@
},
{
"annotation": {
- "bigg.reaction": "PGI"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGI"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b4025",
- "id": "PGI",
+ "id": "R_PGI",
"lower_bound": -1000.0,
"metabolites": {
- "f6p_c": 1.0,
- "g6p_c": -1.0
+ "M_f6p_c": 1.0,
+ "M_g6p_c": -1.0
},
"name": "glucose-6-phosphate isomerase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "PGK"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGK"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b2926",
- "id": "PGK",
+ "id": "R_PGK",
"lower_bound": -1000.0,
"metabolites": {
- "13dpg_c": 1.0,
- "3pg_c": -1.0,
- "adp_c": 1.0,
- "atp_c": -1.0
+ "M_13dpg_c": 1.0,
+ "M_3pg_c": -1.0,
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0
},
"name": "phosphoglycerate kinase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "PGM"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGM"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b4395 or b3612 or b0755",
- "id": "PGM",
+ "id": "R_PGM",
"lower_bound": -1000.0,
"metabolites": {
- "2pg_c": -1.0,
- "3pg_c": 1.0
+ "M_2pg_c": -1.0,
+ "M_3pg_c": 1.0
},
"name": "phosphoglycerate mutase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "PIt2r"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PIt2r"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b2987 or b3493",
- "id": "PIt2r",
+ "id": "R_PIt2r",
"lower_bound": -1000.0,
"metabolites": {
- "h_c": 1.0,
- "h_e": -1.0,
- "pi_c": 1.0,
- "pi_e": -1.0
+ "M_h_c": 1.0,
+ "M_h_e": -1.0,
+ "M_pi_c": 1.0,
+ "M_pi_e": -1.0
},
"name": "R phosphate reversible transport via - symport",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "PYK"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PYK"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b1854 or b1676",
- "id": "PYK",
+ "id": "R_PYK",
"lower_bound": 0.0,
"metabolites": {
- "adp_c": -1.0,
- "atp_c": 1.0,
- "h_c": -1.0,
- "pep_c": -1.0,
- "pyr_c": 1.0
+ "M_adp_c": -1.0,
+ "M_atp_c": 1.0,
+ "M_h_c": -1.0,
+ "M_pep_c": -1.0,
+ "M_pyr_c": 1.0
},
"name": "pyruvate kinase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "TPI"
+ "standardized": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/TPI"
+ ]
+ }
+ ]
+ }
},
"gene_reaction_rule": "b3919",
- "id": "TPI",
+ "id": "R_TPI",
"lower_bound": -1000.0,
"metabolites": {
- "dhap_c": -1.0,
- "g3p_c": 1.0
+ "M_dhap_c": -1.0,
+ "M_g3p_c": 1.0
},
"name": "triose-phosphate isomerase",
"upper_bound": 1000.0
diff --git a/src/cobra/data/mini.mat b/src/cobra/data/mini.mat
index 9f46abd4c..6f3a67bdc 100644
Binary files a/src/cobra/data/mini.mat and b/src/cobra/data/mini.mat differ
diff --git a/src/cobra/data/mini.pickle b/src/cobra/data/mini.pickle
index b0e0f1f40..864117c30 100644
Binary files a/src/cobra/data/mini.pickle and b/src/cobra/data/mini.pickle differ
diff --git a/src/cobra/data/mini.yml b/src/cobra/data/mini.yml
index cd9a28a41..6f75b9cf6 100644
--- a/src/cobra/data/mini.yml
+++ b/src/cobra/data/mini.yml
@@ -1,1168 +1,1233 @@
!!omap
- metabolites:
- !!omap
- - id: 13dpg_c
+ - id: M_13dpg_c
- name: 3-Phospho-D-glyceroyl phosphate
- compartment: c
- charge: -4
- formula: C3H4O10P2
- annotation: !!omap
- - bigg.metabolite: 13dpg
- - biocyc: DPG
- - chebi:
- - CHEBI:16001
- - CHEBI:1658
- - CHEBI:20189
- - CHEBI:57604
- - CHEBI:11881
- - hmdb: HMDB01270
- - kegg.compound: C00236
- - pubchem.substance: '3535'
- - reactome: REACT_29800
- - seed.compound: cpd00203
- - unipathway.compound: UPC00236
- - !!omap
- - id: 2pg_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/13dpg
+ - http://identifiers.org/biocyc/DPG
+ - http://identifiers.org/chebi/CHEBI:16001
+ - http://identifiers.org/chebi/CHEBI:1658
+ - http://identifiers.org/chebi/CHEBI:20189
+ - http://identifiers.org/chebi/CHEBI:57604
+ - http://identifiers.org/chebi/CHEBI:11881
+ - http://identifiers.org/hmdb/HMDB01270
+ - http://identifiers.org/kegg.compound/C00236
+ - http://identifiers.org/pubchem.substance/3535
+ - http://identifiers.org/reactome/REACT_29800
+ - http://identifiers.org/seed.compound/cpd00203
+ - http://identifiers.org/unipathway.compound/UPC00236
+ - !!omap
+ - id: M_2pg_c
- name: D-Glycerate 2-phosphate
- compartment: c
- charge: -3
- formula: C3H4O7P
- annotation: !!omap
- - bigg.metabolite: 2pg
- - biocyc: 2-PG
- - chebi:
- - CHEBI:1267
- - CHEBI:58289
- - CHEBI:17835
- - CHEBI:21028
- - CHEBI:11651
- - CHEBI:12986
- - CHEBI:24344
- - CHEBI:39868
- - hmdb:
- - HMDB03391
- - HMDB00362
- - kegg.compound: C00631
- - pubchem.substance: '3904'
- - reactome: REACT_30485
- - seed.compound: cpd00482
- - unipathway.compound: UPC00631
- - !!omap
- - id: 3pg_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/2pg
+ - http://identifiers.org/biocyc/2-PG
+ - http://identifiers.org/chebi/CHEBI:1267
+ - http://identifiers.org/chebi/CHEBI:58289
+ - http://identifiers.org/chebi/CHEBI:17835
+ - http://identifiers.org/chebi/CHEBI:21028
+ - http://identifiers.org/chebi/CHEBI:11651
+ - http://identifiers.org/chebi/CHEBI:12986
+ - http://identifiers.org/chebi/CHEBI:24344
+ - http://identifiers.org/chebi/CHEBI:39868
+ - http://identifiers.org/hmdb/HMDB03391
+ - http://identifiers.org/hmdb/HMDB00362
+ - http://identifiers.org/kegg.compound/C00631
+ - http://identifiers.org/pubchem.substance/3904
+ - http://identifiers.org/reactome/REACT_30485
+ - http://identifiers.org/seed.compound/cpd00482
+ - http://identifiers.org/unipathway.compound/UPC00631
+ - !!omap
+ - id: M_3pg_c
- name: 3-Phospho-D-glycerate
- compartment: c
- charge: -3
- formula: C3H4O7P
- annotation: !!omap
- - bigg.metabolite: 3pg
- - biocyc: G3P
- - chebi:
- - CHEBI:40016
- - CHEBI:58272
- - CHEBI:57998
- - CHEBI:11879
- - CHEBI:1657
- - CHEBI:1659
- - CHEBI:17050
- - CHEBI:21029
- - CHEBI:11882
- - CHEBI:11880
- - CHEBI:12987
- - CHEBI:17794
- - CHEBI:24345
- - hmdb: HMDB00807
- - kegg.compound:
- - C00197
- - C00597
- - pubchem.substance: '3497'
- - reactome: REACT_29728
- - seed.compound: cpd00169
- - unipathway.compound:
- - UPC00597
- - UPC00197
- - !!omap
- - id: adp_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/3pg
+ - http://identifiers.org/biocyc/G3P
+ - http://identifiers.org/chebi/CHEBI:40016
+ - http://identifiers.org/chebi/CHEBI:58272
+ - http://identifiers.org/chebi/CHEBI:57998
+ - http://identifiers.org/chebi/CHEBI:11879
+ - http://identifiers.org/chebi/CHEBI:1657
+ - http://identifiers.org/chebi/CHEBI:1659
+ - http://identifiers.org/chebi/CHEBI:17050
+ - http://identifiers.org/chebi/CHEBI:21029
+ - http://identifiers.org/chebi/CHEBI:11882
+ - http://identifiers.org/chebi/CHEBI:11880
+ - http://identifiers.org/chebi/CHEBI:12987
+ - http://identifiers.org/chebi/CHEBI:17794
+ - http://identifiers.org/chebi/CHEBI:24345
+ - http://identifiers.org/hmdb/HMDB00807
+ - http://identifiers.org/kegg.compound/C00197
+ - http://identifiers.org/kegg.compound/C00597
+ - http://identifiers.org/pubchem.substance/3497
+ - http://identifiers.org/reactome/REACT_29728
+ - http://identifiers.org/seed.compound/cpd00169
+ - http://identifiers.org/unipathway.compound/UPC00597
+ - http://identifiers.org/unipathway.compound/UPC00197
+ - !!omap
+ - id: M_adp_c
- name: ADP
- compartment: c
- charge: -3
- formula: C10H12N5O10P2
- annotation: !!omap
- - bigg.metabolite: adp
- - biocyc:
- - ADP
- - ADP-GROUP
- - cas:
- - 58-64-0
- - chebi:
- - CHEBI:13222
- - CHEBI:16761
- - CHEBI:2342
- - CHEBI:22244
- - CHEBI:40553
- - CHEBI:456216
- - hmdb: HMDB01341
- - kegg.compound: C00008
- - kegg.glycan: G11113
- - pubchem.substance: '3310'
- - reactome:
- - REACT_190072
- - REACT_481002
- - REACT_211606
- - REACT_429160
- - REACT_29370
- - REACT_196180
- - REACT_113581
- - REACT_113582
- - REACT_114564
- - REACT_114565
- - REACT_429153
- - seed.compound: cpd00008
- - unipathway.compound: UPC00008
- - !!omap
- - id: atp_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/adp
+ - http://identifiers.org/biocyc/ADP
+ - http://identifiers.org/biocyc/ADP-GROUP
+ - http://identifiers.org/cas/58-64-0
+ - http://identifiers.org/cas/58-64-0
+ - http://identifiers.org/chebi/CHEBI:13222
+ - http://identifiers.org/chebi/CHEBI:16761
+ - http://identifiers.org/chebi/CHEBI:2342
+ - http://identifiers.org/chebi/CHEBI:22244
+ - http://identifiers.org/chebi/CHEBI:40553
+ - http://identifiers.org/chebi/CHEBI:456216
+ - http://identifiers.org/hmdb/HMDB01341
+ - http://identifiers.org/kegg.compound/C00008
+ - http://identifiers.org/kegg.glycan/G11113
+ - http://identifiers.org/pubchem.substance/3310
+ - http://identifiers.org/reactome/REACT_190072
+ - http://identifiers.org/reactome/REACT_481002
+ - http://identifiers.org/reactome/REACT_211606
+ - http://identifiers.org/reactome/REACT_429160
+ - http://identifiers.org/reactome/REACT_29370
+ - http://identifiers.org/reactome/REACT_196180
+ - http://identifiers.org/reactome/REACT_113581
+ - http://identifiers.org/reactome/REACT_113582
+ - http://identifiers.org/reactome/REACT_114564
+ - http://identifiers.org/reactome/REACT_114565
+ - http://identifiers.org/reactome/REACT_429153
+ - http://identifiers.org/seed.compound/cpd00008
+ - http://identifiers.org/unipathway.compound/UPC00008
+ - !!omap
+ - id: M_atp_c
- name: ATP
- compartment: c
- charge: -4
- formula: C10H12N5O13P3
- annotation: !!omap
- - bigg.metabolite: atp
- - biocyc: ATP
- - cas:
- - 56-65-5
- - chebi:
- - CHEBI:40938
- - CHEBI:15422
- - CHEBI:57299
- - CHEBI:13236
- - CHEBI:10789
- - CHEBI:30616
- - CHEBI:22249
- - CHEBI:10841
- - CHEBI:2359
- - hmdb: HMDB00538
- - kegg.compound: C00002
- - kegg.drug: D08646
- - pubchem.substance: '3304'
- - reactome:
- - REACT_190078
- - REACT_113592
- - REACT_113593
- - REACT_114570
- - REACT_29358
- - REACT_389573
- - REACT_139836
- - REACT_211579
- - seed.compound: cpd00002
- - unipathway.compound: UPC00002
- - !!omap
- - id: dhap_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/atp
+ - http://identifiers.org/biocyc/ATP
+ - http://identifiers.org/cas/56-65-5
+ - http://identifiers.org/cas/56-65-5
+ - http://identifiers.org/chebi/CHEBI:40938
+ - http://identifiers.org/chebi/CHEBI:15422
+ - http://identifiers.org/chebi/CHEBI:57299
+ - http://identifiers.org/chebi/CHEBI:13236
+ - http://identifiers.org/chebi/CHEBI:10789
+ - http://identifiers.org/chebi/CHEBI:30616
+ - http://identifiers.org/chebi/CHEBI:22249
+ - http://identifiers.org/chebi/CHEBI:10841
+ - http://identifiers.org/chebi/CHEBI:2359
+ - http://identifiers.org/hmdb/HMDB00538
+ - http://identifiers.org/kegg.compound/C00002
+ - http://identifiers.org/kegg.drug/D08646
+ - http://identifiers.org/pubchem.substance/3304
+ - http://identifiers.org/reactome/REACT_190078
+ - http://identifiers.org/reactome/REACT_113592
+ - http://identifiers.org/reactome/REACT_113593
+ - http://identifiers.org/reactome/REACT_114570
+ - http://identifiers.org/reactome/REACT_29358
+ - http://identifiers.org/reactome/REACT_389573
+ - http://identifiers.org/reactome/REACT_139836
+ - http://identifiers.org/reactome/REACT_211579
+ - http://identifiers.org/seed.compound/cpd00002
+ - http://identifiers.org/unipathway.compound/UPC00002
+ - !!omap
+ - id: M_dhap_c
- name: Dihydroxyacetone phosphate
- compartment: c
- charge: -2
- formula: C3H5O6P
- annotation: !!omap
- - bigg.metabolite: dhap
- - biocyc: DIHYDROXY-ACETONE-PHOSPHATE
- - cas:
- - 57-04-5
- - chebi:
- - CHEBI:14341
- - CHEBI:57642
- - CHEBI:14342
- - CHEBI:16108
- - CHEBI:5454
- - CHEBI:24355
- - CHEBI:39571
- - hmdb:
- - HMDB01473
- - HMDB11735
- - kegg.compound: C00111
- - pubchem.substance: '3411'
- - reactome:
- - REACT_188451
- - REACT_75970
- - REACT_390404
- - seed.compound: cpd00095
- - unipathway.compound: UPC00111
- - !!omap
- - id: f6p_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/dhap
+ - http://identifiers.org/biocyc/DIHYDROXY-ACETONE-PHOSPHATE
+ - http://identifiers.org/cas/57-04-5
+ - http://identifiers.org/cas/57-04-5
+ - http://identifiers.org/chebi/CHEBI:14341
+ - http://identifiers.org/chebi/CHEBI:57642
+ - http://identifiers.org/chebi/CHEBI:14342
+ - http://identifiers.org/chebi/CHEBI:16108
+ - http://identifiers.org/chebi/CHEBI:5454
+ - http://identifiers.org/chebi/CHEBI:24355
+ - http://identifiers.org/chebi/CHEBI:39571
+ - http://identifiers.org/hmdb/HMDB01473
+ - http://identifiers.org/hmdb/HMDB11735
+ - http://identifiers.org/kegg.compound/C00111
+ - http://identifiers.org/pubchem.substance/3411
+ - http://identifiers.org/reactome/REACT_188451
+ - http://identifiers.org/reactome/REACT_75970
+ - http://identifiers.org/reactome/REACT_390404
+ - http://identifiers.org/seed.compound/cpd00095
+ - http://identifiers.org/unipathway.compound/UPC00111
+ - !!omap
+ - id: M_f6p_c
- name: D-Fructose 6-phosphate
- compartment: c
- charge: -2
- formula: C6H11O9P
- annotation: !!omap
- - bigg.metabolite: f6p
- - biocyc: FRUCTOSE-6P
- - cas:
- - 643-13-0
- - chebi:
- - CHEBI:57634
- - CHEBI:12352
- - CHEBI:45804
- - CHEBI:61527
- - CHEBI:61553
- - CHEBI:10375
- - CHEBI:16084
- - CHEBI:42378
- - CHEBI:22768
- - hmdb: HMDB03971
- - kegg.compound:
- - C05345
- - C00085
- - pubchem.substance: '3385'
- - seed.compound: cpd00072
- - unipathway.compound:
- - UPC05345
- - UPC00085
- - !!omap
- - id: fdp_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/f6p
+ - http://identifiers.org/biocyc/FRUCTOSE-6P
+ - http://identifiers.org/cas/643-13-0
+ - http://identifiers.org/cas/643-13-0
+ - http://identifiers.org/chebi/CHEBI:57634
+ - http://identifiers.org/chebi/CHEBI:12352
+ - http://identifiers.org/chebi/CHEBI:45804
+ - http://identifiers.org/chebi/CHEBI:61527
+ - http://identifiers.org/chebi/CHEBI:61553
+ - http://identifiers.org/chebi/CHEBI:10375
+ - http://identifiers.org/chebi/CHEBI:16084
+ - http://identifiers.org/chebi/CHEBI:42378
+ - http://identifiers.org/chebi/CHEBI:22768
+ - http://identifiers.org/hmdb/HMDB03971
+ - http://identifiers.org/kegg.compound/C05345
+ - http://identifiers.org/kegg.compound/C00085
+ - http://identifiers.org/pubchem.substance/3385
+ - http://identifiers.org/seed.compound/cpd00072
+ - http://identifiers.org/unipathway.compound/UPC05345
+ - http://identifiers.org/unipathway.compound/UPC00085
+ - !!omap
+ - id: M_fdp_c
- name: D-Fructose 1,6-bisphosphate
- compartment: c
- charge: -4
- formula: C6H10O12P2
- annotation: !!omap
- - bigg.metabolite: fdp
- - biocyc: FRUCTOSE-16-DIPHOSPHATE
- - cas:
- - 488-69-7
- - chebi:
- - CHEBI:32968
- - CHEBI:49299
- - CHEBI:42553
- - CHEBI:32966
- - CHEBI:37736
- - CHEBI:28013
- - CHEBI:32967
- - CHEBI:41014
- - CHEBI:22767
- - CHEBI:10374
- - CHEBI:40595
- - CHEBI:40591
- - kegg.compound:
- - C05378
- - C00354
- - pubchem.substance: '3647'
- - seed.compound: cpd00290
- - unipathway.compound: UPC00354
- - !!omap
- - id: g3p_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/fdp
+ - http://identifiers.org/biocyc/FRUCTOSE-16-DIPHOSPHATE
+ - http://identifiers.org/cas/488-69-7
+ - http://identifiers.org/cas/488-69-7
+ - http://identifiers.org/chebi/CHEBI:32968
+ - http://identifiers.org/chebi/CHEBI:49299
+ - http://identifiers.org/chebi/CHEBI:42553
+ - http://identifiers.org/chebi/CHEBI:32966
+ - http://identifiers.org/chebi/CHEBI:37736
+ - http://identifiers.org/chebi/CHEBI:28013
+ - http://identifiers.org/chebi/CHEBI:32967
+ - http://identifiers.org/chebi/CHEBI:41014
+ - http://identifiers.org/chebi/CHEBI:22767
+ - http://identifiers.org/chebi/CHEBI:10374
+ - http://identifiers.org/chebi/CHEBI:40595
+ - http://identifiers.org/chebi/CHEBI:40591
+ - http://identifiers.org/kegg.compound/C05378
+ - http://identifiers.org/kegg.compound/C00354
+ - http://identifiers.org/pubchem.substance/3647
+ - http://identifiers.org/seed.compound/cpd00290
+ - http://identifiers.org/unipathway.compound/UPC00354
+ - !!omap
+ - id: M_g3p_c
- name: Glyceraldehyde 3-phosphate
- compartment: c
- charge: -2
- formula: C3H5O6P
- annotation: !!omap
- - bigg.metabolite: g3p
- - cas:
- - 142-10-9
- - chebi:
- - CHEBI:17138
- - CHEBI:14333
- - CHEBI:5446
- - CHEBI:58027
- - hmdb: HMDB01112
- - kegg.compound:
- - C00661
- - C00118
- - pubchem.substance: '3930'
- - seed.compound: cpd00102
- - unipathway.compound:
- - UPC00661
- - UPC00118
- - !!omap
- - id: g6p_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/g3p
+ - http://identifiers.org/cas/142-10-9
+ - http://identifiers.org/cas/142-10-9
+ - http://identifiers.org/chebi/CHEBI:17138
+ - http://identifiers.org/chebi/CHEBI:14333
+ - http://identifiers.org/chebi/CHEBI:5446
+ - http://identifiers.org/chebi/CHEBI:58027
+ - http://identifiers.org/hmdb/HMDB01112
+ - http://identifiers.org/kegg.compound/C00661
+ - http://identifiers.org/kegg.compound/C00118
+ - http://identifiers.org/pubchem.substance/3930
+ - http://identifiers.org/seed.compound/cpd00102
+ - http://identifiers.org/unipathway.compound/UPC00661
+ - http://identifiers.org/unipathway.compound/UPC00118
+ - !!omap
+ - id: M_g6p_c
- name: D-Glucose 6-phosphate
- compartment: c
- charge: -2
- formula: C6H11O9P
- annotation: !!omap
- - bigg.metabolite: g6p
- - biocyc:
- - D-glucose-6-phosphate
- - GLC-6-P
- - cas:
- - 56-73-5
- - chebi:
- - CHEBI:10399
- - CHEBI:22797
- - CHEBI:41041
- - CHEBI:17719
- - CHEBI:4170
- - CHEBI:61548
- - CHEBI:58247
- - CHEBI:12375
- - hmdb:
- - HMDB03498
- - HMDB06793
- - HMDB01401
- - HMDB01549
- - kegg.compound:
- - C00092
- - C01172
- - pubchem.substance: '3392'
- - reactome: REACT_1629756
- - seed.compound: cpd00079
- - unipathway.compound: UPC00092
- - !!omap
- - id: glc__D_e
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/g6p
+ - http://identifiers.org/biocyc/D-glucose-6-phosphate
+ - http://identifiers.org/biocyc/GLC-6-P
+ - http://identifiers.org/cas/56-73-5
+ - http://identifiers.org/cas/56-73-5
+ - http://identifiers.org/chebi/CHEBI:10399
+ - http://identifiers.org/chebi/CHEBI:22797
+ - http://identifiers.org/chebi/CHEBI:41041
+ - http://identifiers.org/chebi/CHEBI:17719
+ - http://identifiers.org/chebi/CHEBI:4170
+ - http://identifiers.org/chebi/CHEBI:61548
+ - http://identifiers.org/chebi/CHEBI:58247
+ - http://identifiers.org/chebi/CHEBI:12375
+ - http://identifiers.org/hmdb/HMDB03498
+ - http://identifiers.org/hmdb/HMDB06793
+ - http://identifiers.org/hmdb/HMDB01401
+ - http://identifiers.org/hmdb/HMDB01549
+ - http://identifiers.org/kegg.compound/C00092
+ - http://identifiers.org/kegg.compound/C01172
+ - http://identifiers.org/pubchem.substance/3392
+ - http://identifiers.org/reactome/REACT_1629756
+ - http://identifiers.org/seed.compound/cpd00079
+ - http://identifiers.org/unipathway.compound/UPC00092
+ - !!omap
+ - id: M_glc__D_e
- name: D-Glucose
- compartment: e
- charge: 0
- formula: C6H12O6
- annotation: !!omap
- - bigg.metabolite: glc__D
- - cas:
- - 50-99-7
- - kegg.compound: C00031
- - pubchem.substance: '3333'
- - !!omap
- - id: h2o_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/glc__D
+ - http://identifiers.org/cas/50-99-7
+ - http://identifiers.org/cas/50-99-7
+ - http://identifiers.org/kegg.compound/C00031
+ - http://identifiers.org/pubchem.substance/3333
+ - !!omap
+ - id: M_h2o_c
- name: H2O
- compartment: c
- charge: 0
- formula: H2O
- annotation: !!omap
- - bigg.metabolite: h2o
- - biocyc:
- - WATER
- - OH
- - OXONIUM
- - cas:
- - 7732-18-5
- - chebi:
- - CHEBI:15377
- - CHEBI:13365
- - CHEBI:41979
- - CHEBI:16234
- - CHEBI:36385
- - CHEBI:42857
- - CHEBI:27313
- - CHEBI:44819
- - CHEBI:29373
- - CHEBI:10743
- - CHEBI:5594
- - CHEBI:29356
- - CHEBI:53442
- - CHEBI:29375
- - CHEBI:29374
- - CHEBI:13419
- - CHEBI:43228
- - CHEBI:44292
- - CHEBI:13352
- - CHEBI:41981
- - CHEBI:29412
- - CHEBI:42043
- - CHEBI:33811
- - CHEBI:33813
- - CHEBI:35511
- - CHEBI:5585
- - CHEBI:44641
- - CHEBI:44701
- - hmdb:
- - HMDB01039
- - HMDB02111
- - kegg.compound:
- - C01328
- - C00001
- - C18714
- - C18712
- - kegg.drug:
- - D00001
- - D06322
- - D03703
- - pubchem.substance: '3303'
- - reactome:
- - REACT_947593
- - REACT_189422
- - REACT_141343
- - REACT_113518
- - REACT_1605715
- - REACT_109276
- - REACT_113521
- - REACT_113519
- - REACT_2022884
- - REACT_351603
- - REACT_29356
- - seed.compound:
- - cpd15275
- - cpd00001
- - unipathway.compound:
- - UPC00001
- - UPC01328
- - !!omap
- - id: h2o_e
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/h2o
+ - http://identifiers.org/biocyc/WATER
+ - http://identifiers.org/biocyc/OH
+ - http://identifiers.org/biocyc/OXONIUM
+ - http://identifiers.org/cas/7732-18-5
+ - http://identifiers.org/cas/7732-18-5
+ - http://identifiers.org/chebi/CHEBI:15377
+ - http://identifiers.org/chebi/CHEBI:13365
+ - http://identifiers.org/chebi/CHEBI:41979
+ - http://identifiers.org/chebi/CHEBI:16234
+ - http://identifiers.org/chebi/CHEBI:36385
+ - http://identifiers.org/chebi/CHEBI:42857
+ - http://identifiers.org/chebi/CHEBI:27313
+ - http://identifiers.org/chebi/CHEBI:44819
+ - http://identifiers.org/chebi/CHEBI:29373
+ - http://identifiers.org/chebi/CHEBI:10743
+ - http://identifiers.org/chebi/CHEBI:5594
+ - http://identifiers.org/chebi/CHEBI:29356
+ - http://identifiers.org/chebi/CHEBI:53442
+ - http://identifiers.org/chebi/CHEBI:29375
+ - http://identifiers.org/chebi/CHEBI:29374
+ - http://identifiers.org/chebi/CHEBI:13419
+ - http://identifiers.org/chebi/CHEBI:43228
+ - http://identifiers.org/chebi/CHEBI:44292
+ - http://identifiers.org/chebi/CHEBI:13352
+ - http://identifiers.org/chebi/CHEBI:41981
+ - http://identifiers.org/chebi/CHEBI:29412
+ - http://identifiers.org/chebi/CHEBI:42043
+ - http://identifiers.org/chebi/CHEBI:33811
+ - http://identifiers.org/chebi/CHEBI:33813
+ - http://identifiers.org/chebi/CHEBI:35511
+ - http://identifiers.org/chebi/CHEBI:5585
+ - http://identifiers.org/chebi/CHEBI:44641
+ - http://identifiers.org/chebi/CHEBI:44701
+ - http://identifiers.org/hmdb/HMDB01039
+ - http://identifiers.org/hmdb/HMDB02111
+ - http://identifiers.org/kegg.compound/C01328
+ - http://identifiers.org/kegg.compound/C00001
+ - http://identifiers.org/kegg.compound/C18714
+ - http://identifiers.org/kegg.compound/C18712
+ - http://identifiers.org/kegg.drug/D00001
+ - http://identifiers.org/kegg.drug/D06322
+ - http://identifiers.org/kegg.drug/D03703
+ - http://identifiers.org/pubchem.substance/3303
+ - http://identifiers.org/reactome/REACT_947593
+ - http://identifiers.org/reactome/REACT_189422
+ - http://identifiers.org/reactome/REACT_141343
+ - http://identifiers.org/reactome/REACT_113518
+ - http://identifiers.org/reactome/REACT_1605715
+ - http://identifiers.org/reactome/REACT_109276
+ - http://identifiers.org/reactome/REACT_113521
+ - http://identifiers.org/reactome/REACT_113519
+ - http://identifiers.org/reactome/REACT_2022884
+ - http://identifiers.org/reactome/REACT_351603
+ - http://identifiers.org/reactome/REACT_29356
+ - http://identifiers.org/seed.compound/cpd15275
+ - http://identifiers.org/seed.compound/cpd00001
+ - http://identifiers.org/unipathway.compound/UPC00001
+ - http://identifiers.org/unipathway.compound/UPC01328
+ - !!omap
+ - id: M_h2o_e
- name: H2O
- compartment: e
- charge: 0
- formula: H2O
- annotation: !!omap
- - bigg.metabolite: h2o
- - biocyc:
- - WATER
- - OH
- - OXONIUM
- - cas:
- - 7732-18-5
- - chebi:
- - CHEBI:15377
- - CHEBI:13365
- - CHEBI:41979
- - CHEBI:16234
- - CHEBI:36385
- - CHEBI:42857
- - CHEBI:27313
- - CHEBI:44819
- - CHEBI:29373
- - CHEBI:10743
- - CHEBI:5594
- - CHEBI:29356
- - CHEBI:53442
- - CHEBI:29375
- - CHEBI:29374
- - CHEBI:13419
- - CHEBI:43228
- - CHEBI:44292
- - CHEBI:13352
- - CHEBI:41981
- - CHEBI:29412
- - CHEBI:42043
- - CHEBI:33811
- - CHEBI:33813
- - CHEBI:35511
- - CHEBI:5585
- - CHEBI:44641
- - CHEBI:44701
- - hmdb:
- - HMDB01039
- - HMDB02111
- - kegg.compound:
- - C01328
- - C00001
- - C18714
- - C18712
- - kegg.drug:
- - D00001
- - D06322
- - D03703
- - pubchem.substance: '3303'
- - reactome:
- - REACT_947593
- - REACT_189422
- - REACT_141343
- - REACT_113518
- - REACT_1605715
- - REACT_109276
- - REACT_113521
- - REACT_113519
- - REACT_2022884
- - REACT_351603
- - REACT_29356
- - seed.compound:
- - cpd15275
- - cpd00001
- - unipathway.compound:
- - UPC00001
- - UPC01328
- - !!omap
- - id: h_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/h2o
+ - http://identifiers.org/biocyc/WATER
+ - http://identifiers.org/biocyc/OH
+ - http://identifiers.org/biocyc/OXONIUM
+ - http://identifiers.org/cas/7732-18-5
+ - http://identifiers.org/cas/7732-18-5
+ - http://identifiers.org/chebi/CHEBI:15377
+ - http://identifiers.org/chebi/CHEBI:13365
+ - http://identifiers.org/chebi/CHEBI:41979
+ - http://identifiers.org/chebi/CHEBI:16234
+ - http://identifiers.org/chebi/CHEBI:36385
+ - http://identifiers.org/chebi/CHEBI:42857
+ - http://identifiers.org/chebi/CHEBI:27313
+ - http://identifiers.org/chebi/CHEBI:44819
+ - http://identifiers.org/chebi/CHEBI:29373
+ - http://identifiers.org/chebi/CHEBI:10743
+ - http://identifiers.org/chebi/CHEBI:5594
+ - http://identifiers.org/chebi/CHEBI:29356
+ - http://identifiers.org/chebi/CHEBI:53442
+ - http://identifiers.org/chebi/CHEBI:29375
+ - http://identifiers.org/chebi/CHEBI:29374
+ - http://identifiers.org/chebi/CHEBI:13419
+ - http://identifiers.org/chebi/CHEBI:43228
+ - http://identifiers.org/chebi/CHEBI:44292
+ - http://identifiers.org/chebi/CHEBI:13352
+ - http://identifiers.org/chebi/CHEBI:41981
+ - http://identifiers.org/chebi/CHEBI:29412
+ - http://identifiers.org/chebi/CHEBI:42043
+ - http://identifiers.org/chebi/CHEBI:33811
+ - http://identifiers.org/chebi/CHEBI:33813
+ - http://identifiers.org/chebi/CHEBI:35511
+ - http://identifiers.org/chebi/CHEBI:5585
+ - http://identifiers.org/chebi/CHEBI:44641
+ - http://identifiers.org/chebi/CHEBI:44701
+ - http://identifiers.org/hmdb/HMDB01039
+ - http://identifiers.org/hmdb/HMDB02111
+ - http://identifiers.org/kegg.compound/C01328
+ - http://identifiers.org/kegg.compound/C00001
+ - http://identifiers.org/kegg.compound/C18714
+ - http://identifiers.org/kegg.compound/C18712
+ - http://identifiers.org/kegg.drug/D00001
+ - http://identifiers.org/kegg.drug/D06322
+ - http://identifiers.org/kegg.drug/D03703
+ - http://identifiers.org/pubchem.substance/3303
+ - http://identifiers.org/reactome/REACT_947593
+ - http://identifiers.org/reactome/REACT_189422
+ - http://identifiers.org/reactome/REACT_141343
+ - http://identifiers.org/reactome/REACT_113518
+ - http://identifiers.org/reactome/REACT_1605715
+ - http://identifiers.org/reactome/REACT_109276
+ - http://identifiers.org/reactome/REACT_113521
+ - http://identifiers.org/reactome/REACT_113519
+ - http://identifiers.org/reactome/REACT_2022884
+ - http://identifiers.org/reactome/REACT_351603
+ - http://identifiers.org/reactome/REACT_29356
+ - http://identifiers.org/seed.compound/cpd15275
+ - http://identifiers.org/seed.compound/cpd00001
+ - http://identifiers.org/unipathway.compound/UPC00001
+ - http://identifiers.org/unipathway.compound/UPC01328
+ - !!omap
+ - id: M_h_c
- name: H+
- compartment: c
- charge: 1
- formula: H
- annotation: !!omap
- - bigg.metabolite: h
- - biocyc: PROTON
- - cas:
- - 12408-02-5
- - chebi:
- - CHEBI:24636
- - CHEBI:15378
- - CHEBI:10744
- - CHEBI:13357
- - CHEBI:5584
- - kegg.compound: C00080
- - pubchem.substance: '3380'
- - reactome:
- - REACT_194688
- - REACT_425978
- - REACT_193465
- - REACT_374900
- - REACT_74722
- - REACT_425999
- - REACT_428040
- - REACT_163953
- - REACT_372511
- - REACT_2000349
- - REACT_70106
- - REACT_1470067
- - REACT_113529
- - REACT_425969
- - REACT_428548
- - REACT_156540
- - REACT_1614597
- - REACT_351626
- - REACT_427899
- - seed.compound: cpd00067
- - unipathway.compound: UPC00080
- - !!omap
- - id: h_e
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/h
+ - http://identifiers.org/biocyc/PROTON
+ - http://identifiers.org/cas/12408-02-5
+ - http://identifiers.org/cas/12408-02-5
+ - http://identifiers.org/chebi/CHEBI:24636
+ - http://identifiers.org/chebi/CHEBI:15378
+ - http://identifiers.org/chebi/CHEBI:10744
+ - http://identifiers.org/chebi/CHEBI:13357
+ - http://identifiers.org/chebi/CHEBI:5584
+ - http://identifiers.org/kegg.compound/C00080
+ - http://identifiers.org/pubchem.substance/3380
+ - http://identifiers.org/reactome/REACT_194688
+ - http://identifiers.org/reactome/REACT_425978
+ - http://identifiers.org/reactome/REACT_193465
+ - http://identifiers.org/reactome/REACT_374900
+ - http://identifiers.org/reactome/REACT_74722
+ - http://identifiers.org/reactome/REACT_425999
+ - http://identifiers.org/reactome/REACT_428040
+ - http://identifiers.org/reactome/REACT_163953
+ - http://identifiers.org/reactome/REACT_372511
+ - http://identifiers.org/reactome/REACT_2000349
+ - http://identifiers.org/reactome/REACT_70106
+ - http://identifiers.org/reactome/REACT_1470067
+ - http://identifiers.org/reactome/REACT_113529
+ - http://identifiers.org/reactome/REACT_425969
+ - http://identifiers.org/reactome/REACT_428548
+ - http://identifiers.org/reactome/REACT_156540
+ - http://identifiers.org/reactome/REACT_1614597
+ - http://identifiers.org/reactome/REACT_351626
+ - http://identifiers.org/reactome/REACT_427899
+ - http://identifiers.org/seed.compound/cpd00067
+ - http://identifiers.org/unipathway.compound/UPC00080
+ - !!omap
+ - id: M_h_e
- name: H+
- compartment: e
- charge: 1
- formula: H
- annotation: !!omap
- - bigg.metabolite: h
- - biocyc: PROTON
- - cas:
- - 12408-02-5
- - chebi:
- - CHEBI:24636
- - CHEBI:15378
- - CHEBI:10744
- - CHEBI:13357
- - CHEBI:5584
- - kegg.compound: C00080
- - pubchem.substance: '3380'
- - reactome:
- - REACT_194688
- - REACT_425978
- - REACT_193465
- - REACT_374900
- - REACT_74722
- - REACT_425999
- - REACT_428040
- - REACT_163953
- - REACT_372511
- - REACT_2000349
- - REACT_70106
- - REACT_1470067
- - REACT_113529
- - REACT_425969
- - REACT_428548
- - REACT_156540
- - REACT_1614597
- - REACT_351626
- - REACT_427899
- - seed.compound: cpd00067
- - unipathway.compound: UPC00080
- - !!omap
- - id: lac__D_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/h
+ - http://identifiers.org/biocyc/PROTON
+ - http://identifiers.org/cas/12408-02-5
+ - http://identifiers.org/cas/12408-02-5
+ - http://identifiers.org/chebi/CHEBI:24636
+ - http://identifiers.org/chebi/CHEBI:15378
+ - http://identifiers.org/chebi/CHEBI:10744
+ - http://identifiers.org/chebi/CHEBI:13357
+ - http://identifiers.org/chebi/CHEBI:5584
+ - http://identifiers.org/kegg.compound/C00080
+ - http://identifiers.org/pubchem.substance/3380
+ - http://identifiers.org/reactome/REACT_194688
+ - http://identifiers.org/reactome/REACT_425978
+ - http://identifiers.org/reactome/REACT_193465
+ - http://identifiers.org/reactome/REACT_374900
+ - http://identifiers.org/reactome/REACT_74722
+ - http://identifiers.org/reactome/REACT_425999
+ - http://identifiers.org/reactome/REACT_428040
+ - http://identifiers.org/reactome/REACT_163953
+ - http://identifiers.org/reactome/REACT_372511
+ - http://identifiers.org/reactome/REACT_2000349
+ - http://identifiers.org/reactome/REACT_70106
+ - http://identifiers.org/reactome/REACT_1470067
+ - http://identifiers.org/reactome/REACT_113529
+ - http://identifiers.org/reactome/REACT_425969
+ - http://identifiers.org/reactome/REACT_428548
+ - http://identifiers.org/reactome/REACT_156540
+ - http://identifiers.org/reactome/REACT_1614597
+ - http://identifiers.org/reactome/REACT_351626
+ - http://identifiers.org/reactome/REACT_427899
+ - http://identifiers.org/seed.compound/cpd00067
+ - http://identifiers.org/unipathway.compound/UPC00080
+ - !!omap
+ - id: M_lac__D_c
- name: D-Lactate
- compartment: c
- charge: -1
- formula: C3H5O3
- annotation: !!omap
- - bigg.metabolite: lac__D
- - biocyc: META:D-LACTATE
- - chebi:
- - CHEBI:11001
- - CHEBI:16004
- - CHEBI:18684
- - CHEBI:341
- - CHEBI:42105
- - CHEBI:42111
- - CHEBI:43701
- - hmdb:
- - HMDB00171
- - HMDB01311
- - kegg.compound: C00256
- - metanetx.chemical: MNXM285
- - seed.compound: cpd00221
- - !!omap
- - id: lac__D_e
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/lac__D
+ - http://identifiers.org/biocyc/META:D-LACTATE
+ - http://identifiers.org/chebi/CHEBI:11001
+ - http://identifiers.org/chebi/CHEBI:16004
+ - http://identifiers.org/chebi/CHEBI:18684
+ - http://identifiers.org/chebi/CHEBI:341
+ - http://identifiers.org/chebi/CHEBI:42105
+ - http://identifiers.org/chebi/CHEBI:42111
+ - http://identifiers.org/chebi/CHEBI:43701
+ - http://identifiers.org/hmdb/HMDB00171
+ - http://identifiers.org/hmdb/HMDB01311
+ - http://identifiers.org/kegg.compound/C00256
+ - http://identifiers.org/metanetx.chemical/MNXM285
+ - http://identifiers.org/seed.compound/cpd00221
+ - !!omap
+ - id: M_lac__D_e
- name: D-Lactate
- compartment: e
- charge: -1
- formula: C3H5O3
- annotation: !!omap
- - bigg.metabolite: lac__D
- - biocyc: META:D-LACTATE
- - chebi:
- - CHEBI:11001
- - CHEBI:16004
- - CHEBI:18684
- - CHEBI:341
- - CHEBI:42105
- - CHEBI:42111
- - CHEBI:43701
- - hmdb:
- - HMDB00171
- - HMDB01311
- - kegg.compound: C00256
- - metanetx.chemical: MNXM285
- - seed.compound: cpd00221
- - !!omap
- - id: nad_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/lac__D
+ - http://identifiers.org/biocyc/META:D-LACTATE
+ - http://identifiers.org/chebi/CHEBI:11001
+ - http://identifiers.org/chebi/CHEBI:16004
+ - http://identifiers.org/chebi/CHEBI:18684
+ - http://identifiers.org/chebi/CHEBI:341
+ - http://identifiers.org/chebi/CHEBI:42105
+ - http://identifiers.org/chebi/CHEBI:42111
+ - http://identifiers.org/chebi/CHEBI:43701
+ - http://identifiers.org/hmdb/HMDB00171
+ - http://identifiers.org/hmdb/HMDB01311
+ - http://identifiers.org/kegg.compound/C00256
+ - http://identifiers.org/metanetx.chemical/MNXM285
+ - http://identifiers.org/seed.compound/cpd00221
+ - !!omap
+ - id: M_nad_c
- name: Nicotinamide adenine dinucleotide
- compartment: c
- charge: -1
- formula: C21H26N7O14P2
- annotation: !!omap
- - bigg.metabolite: nad
- - biocyc: NAD
- - cas:
- - 53-84-9
- - chebi:
- - CHEBI:21901
- - CHEBI:7422
- - CHEBI:44214
- - CHEBI:15846
- - CHEBI:13394
- - CHEBI:13393
- - CHEBI:44215
- - CHEBI:13389
- - CHEBI:57540
- - CHEBI:44281
- - hmdb: HMDB00902
- - kegg.compound: C00003
- - kegg.drug: D00002
- - pubchem.substance: '3305'
- - reactome:
- - REACT_192307
- - REACT_29360
- - REACT_427523
- - REACT_194653
- - REACT_113526
- - seed.compound: cpd00003
- - unipathway.compound: UPC00003
- - !!omap
- - id: nadh_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/nad
+ - http://identifiers.org/biocyc/NAD
+ - http://identifiers.org/cas/53-84-9
+ - http://identifiers.org/cas/53-84-9
+ - http://identifiers.org/chebi/CHEBI:21901
+ - http://identifiers.org/chebi/CHEBI:7422
+ - http://identifiers.org/chebi/CHEBI:44214
+ - http://identifiers.org/chebi/CHEBI:15846
+ - http://identifiers.org/chebi/CHEBI:13394
+ - http://identifiers.org/chebi/CHEBI:13393
+ - http://identifiers.org/chebi/CHEBI:44215
+ - http://identifiers.org/chebi/CHEBI:13389
+ - http://identifiers.org/chebi/CHEBI:57540
+ - http://identifiers.org/chebi/CHEBI:44281
+ - http://identifiers.org/hmdb/HMDB00902
+ - http://identifiers.org/kegg.compound/C00003
+ - http://identifiers.org/kegg.drug/D00002
+ - http://identifiers.org/pubchem.substance/3305
+ - http://identifiers.org/reactome/REACT_192307
+ - http://identifiers.org/reactome/REACT_29360
+ - http://identifiers.org/reactome/REACT_427523
+ - http://identifiers.org/reactome/REACT_194653
+ - http://identifiers.org/reactome/REACT_113526
+ - http://identifiers.org/seed.compound/cpd00003
+ - http://identifiers.org/unipathway.compound/UPC00003
+ - !!omap
+ - id: M_nadh_c
- name: Nicotinamide adenine dinucleotide - reduced
- compartment: c
- charge: -2
- formula: C21H27N7O14P2
- annotation: !!omap
- - bigg.metabolite: nadh
- - biocyc: NADH
- - cas:
- - 58-68-4
- - chebi:
- - CHEBI:13395
- - CHEBI:21902
- - CHEBI:16908
- - CHEBI:7423
- - CHEBI:44216
- - CHEBI:57945
- - CHEBI:13396
- - hmdb: HMDB01487
- - kegg.compound: C00004
- - pubchem.substance: '3306'
- - reactome:
- - REACT_192305
- - REACT_73473
- - REACT_194697
- - REACT_29362
- - seed.compound: cpd00004
- - unipathway.compound: UPC00004
- - !!omap
- - id: pep_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/nadh
+ - http://identifiers.org/biocyc/NADH
+ - http://identifiers.org/cas/58-68-4
+ - http://identifiers.org/cas/58-68-4
+ - http://identifiers.org/chebi/CHEBI:13395
+ - http://identifiers.org/chebi/CHEBI:21902
+ - http://identifiers.org/chebi/CHEBI:16908
+ - http://identifiers.org/chebi/CHEBI:7423
+ - http://identifiers.org/chebi/CHEBI:44216
+ - http://identifiers.org/chebi/CHEBI:57945
+ - http://identifiers.org/chebi/CHEBI:13396
+ - http://identifiers.org/hmdb/HMDB01487
+ - http://identifiers.org/kegg.compound/C00004
+ - http://identifiers.org/pubchem.substance/3306
+ - http://identifiers.org/reactome/REACT_192305
+ - http://identifiers.org/reactome/REACT_73473
+ - http://identifiers.org/reactome/REACT_194697
+ - http://identifiers.org/reactome/REACT_29362
+ - http://identifiers.org/seed.compound/cpd00004
+ - http://identifiers.org/unipathway.compound/UPC00004
+ - !!omap
+ - id: M_pep_c
- name: Phosphoenolpyruvate
- compartment: c
- charge: -3
- formula: C3H2O6P
- annotation: !!omap
- - bigg.metabolite: pep
- - biocyc: PHOSPHO-ENOL-PYRUVATE
- - cas:
- - 138-08-9
- - chebi:
- - CHEBI:44897
- - CHEBI:44894
- - CHEBI:14812
- - CHEBI:8147
- - CHEBI:26055
- - CHEBI:26054
- - CHEBI:58702
- - CHEBI:18021
- - hmdb: HMDB00263
- - kegg.compound: C00074
- - pubchem.substance: '3374'
- - reactome:
- - REACT_29492
- - REACT_372364
- - seed.compound: cpd00061
- - unipathway.compound: UPC00074
- - !!omap
- - id: pi_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/pep
+ - http://identifiers.org/biocyc/PHOSPHO-ENOL-PYRUVATE
+ - http://identifiers.org/cas/138-08-9
+ - http://identifiers.org/cas/138-08-9
+ - http://identifiers.org/chebi/CHEBI:44897
+ - http://identifiers.org/chebi/CHEBI:44894
+ - http://identifiers.org/chebi/CHEBI:14812
+ - http://identifiers.org/chebi/CHEBI:8147
+ - http://identifiers.org/chebi/CHEBI:26055
+ - http://identifiers.org/chebi/CHEBI:26054
+ - http://identifiers.org/chebi/CHEBI:58702
+ - http://identifiers.org/chebi/CHEBI:18021
+ - http://identifiers.org/hmdb/HMDB00263
+ - http://identifiers.org/kegg.compound/C00074
+ - http://identifiers.org/pubchem.substance/3374
+ - http://identifiers.org/reactome/REACT_29492
+ - http://identifiers.org/reactome/REACT_372364
+ - http://identifiers.org/seed.compound/cpd00061
+ - http://identifiers.org/unipathway.compound/UPC00074
+ - !!omap
+ - id: M_pi_c
- name: Phosphate
- compartment: c
- charge: -2
- formula: HO4P
- annotation: !!omap
- - bigg.metabolite: pi
- - biocyc:
- - Pi
- - PHOSPHATE-GROUP
- - CPD0-1421
- - cas:
- - 14265-44-2
- - chebi:
- - CHEBI:37583
- - CHEBI:7793
- - CHEBI:37585
- - CHEBI:34683
- - CHEBI:14791
- - CHEBI:34855
- - CHEBI:29137
- - CHEBI:29139
- - CHEBI:63036
- - CHEBI:26020
- - CHEBI:39739
- - CHEBI:32597
- - CHEBI:32596
- - CHEBI:43474
- - CHEBI:63051
- - CHEBI:43470
- - CHEBI:9679
- - CHEBI:35433
- - CHEBI:4496
- - CHEBI:45024
- - CHEBI:18367
- - CHEBI:26078
- - CHEBI:39745
- - CHEBI:24838
- - hmdb: HMDB02142
- - kegg.compound:
- - C13556
- - C13558
- - C00009
- - kegg.drug: D05467
- - pubchem.substance: '3311'
- - reactome:
- - REACT_947590
- - REACT_109277
- - REACT_113548
- - REACT_2255331
- - REACT_29372
- - REACT_113550
- - REACT_113551
- - seed.compound:
- - cpd09464
- - cpd09463
- - cpd00009
- - unipathway.compound: UPC00009
- - !!omap
- - id: pi_e
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/pi
+ - http://identifiers.org/biocyc/Pi
+ - http://identifiers.org/biocyc/PHOSPHATE-GROUP
+ - http://identifiers.org/biocyc/CPD0-1421
+ - http://identifiers.org/cas/14265-44-2
+ - http://identifiers.org/cas/14265-44-2
+ - http://identifiers.org/chebi/CHEBI:37583
+ - http://identifiers.org/chebi/CHEBI:7793
+ - http://identifiers.org/chebi/CHEBI:37585
+ - http://identifiers.org/chebi/CHEBI:34683
+ - http://identifiers.org/chebi/CHEBI:14791
+ - http://identifiers.org/chebi/CHEBI:34855
+ - http://identifiers.org/chebi/CHEBI:29137
+ - http://identifiers.org/chebi/CHEBI:29139
+ - http://identifiers.org/chebi/CHEBI:63036
+ - http://identifiers.org/chebi/CHEBI:26020
+ - http://identifiers.org/chebi/CHEBI:39739
+ - http://identifiers.org/chebi/CHEBI:32597
+ - http://identifiers.org/chebi/CHEBI:32596
+ - http://identifiers.org/chebi/CHEBI:43474
+ - http://identifiers.org/chebi/CHEBI:63051
+ - http://identifiers.org/chebi/CHEBI:43470
+ - http://identifiers.org/chebi/CHEBI:9679
+ - http://identifiers.org/chebi/CHEBI:35433
+ - http://identifiers.org/chebi/CHEBI:4496
+ - http://identifiers.org/chebi/CHEBI:45024
+ - http://identifiers.org/chebi/CHEBI:18367
+ - http://identifiers.org/chebi/CHEBI:26078
+ - http://identifiers.org/chebi/CHEBI:39745
+ - http://identifiers.org/chebi/CHEBI:24838
+ - http://identifiers.org/hmdb/HMDB02142
+ - http://identifiers.org/kegg.compound/C13556
+ - http://identifiers.org/kegg.compound/C13558
+ - http://identifiers.org/kegg.compound/C00009
+ - http://identifiers.org/kegg.drug/D05467
+ - http://identifiers.org/pubchem.substance/3311
+ - http://identifiers.org/reactome/REACT_947590
+ - http://identifiers.org/reactome/REACT_109277
+ - http://identifiers.org/reactome/REACT_113548
+ - http://identifiers.org/reactome/REACT_2255331
+ - http://identifiers.org/reactome/REACT_29372
+ - http://identifiers.org/reactome/REACT_113550
+ - http://identifiers.org/reactome/REACT_113551
+ - http://identifiers.org/seed.compound/cpd09464
+ - http://identifiers.org/seed.compound/cpd09463
+ - http://identifiers.org/seed.compound/cpd00009
+ - http://identifiers.org/unipathway.compound/UPC00009
+ - !!omap
+ - id: M_pi_e
- name: Phosphate
- compartment: e
- charge: -2
- formula: HO4P
- annotation: !!omap
- - bigg.metabolite: pi
- - biocyc:
- - Pi
- - PHOSPHATE-GROUP
- - CPD0-1421
- - cas:
- - 14265-44-2
- - chebi:
- - CHEBI:37583
- - CHEBI:7793
- - CHEBI:37585
- - CHEBI:34683
- - CHEBI:14791
- - CHEBI:34855
- - CHEBI:29137
- - CHEBI:29139
- - CHEBI:63036
- - CHEBI:26020
- - CHEBI:39739
- - CHEBI:32597
- - CHEBI:32596
- - CHEBI:43474
- - CHEBI:63051
- - CHEBI:43470
- - CHEBI:9679
- - CHEBI:35433
- - CHEBI:4496
- - CHEBI:45024
- - CHEBI:18367
- - CHEBI:26078
- - CHEBI:39745
- - CHEBI:24838
- - hmdb: HMDB02142
- - kegg.compound:
- - C13556
- - C13558
- - C00009
- - kegg.drug: D05467
- - pubchem.substance: '3311'
- - reactome:
- - REACT_947590
- - REACT_109277
- - REACT_113548
- - REACT_2255331
- - REACT_29372
- - REACT_113550
- - REACT_113551
- - seed.compound:
- - cpd09464
- - cpd09463
- - cpd00009
- - unipathway.compound: UPC00009
- - !!omap
- - id: pyr_c
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/pi
+ - http://identifiers.org/biocyc/Pi
+ - http://identifiers.org/biocyc/PHOSPHATE-GROUP
+ - http://identifiers.org/biocyc/CPD0-1421
+ - http://identifiers.org/cas/14265-44-2
+ - http://identifiers.org/cas/14265-44-2
+ - http://identifiers.org/chebi/CHEBI:37583
+ - http://identifiers.org/chebi/CHEBI:7793
+ - http://identifiers.org/chebi/CHEBI:37585
+ - http://identifiers.org/chebi/CHEBI:34683
+ - http://identifiers.org/chebi/CHEBI:14791
+ - http://identifiers.org/chebi/CHEBI:34855
+ - http://identifiers.org/chebi/CHEBI:29137
+ - http://identifiers.org/chebi/CHEBI:29139
+ - http://identifiers.org/chebi/CHEBI:63036
+ - http://identifiers.org/chebi/CHEBI:26020
+ - http://identifiers.org/chebi/CHEBI:39739
+ - http://identifiers.org/chebi/CHEBI:32597
+ - http://identifiers.org/chebi/CHEBI:32596
+ - http://identifiers.org/chebi/CHEBI:43474
+ - http://identifiers.org/chebi/CHEBI:63051
+ - http://identifiers.org/chebi/CHEBI:43470
+ - http://identifiers.org/chebi/CHEBI:9679
+ - http://identifiers.org/chebi/CHEBI:35433
+ - http://identifiers.org/chebi/CHEBI:4496
+ - http://identifiers.org/chebi/CHEBI:45024
+ - http://identifiers.org/chebi/CHEBI:18367
+ - http://identifiers.org/chebi/CHEBI:26078
+ - http://identifiers.org/chebi/CHEBI:39745
+ - http://identifiers.org/chebi/CHEBI:24838
+ - http://identifiers.org/hmdb/HMDB02142
+ - http://identifiers.org/kegg.compound/C13556
+ - http://identifiers.org/kegg.compound/C13558
+ - http://identifiers.org/kegg.compound/C00009
+ - http://identifiers.org/kegg.drug/D05467
+ - http://identifiers.org/pubchem.substance/3311
+ - http://identifiers.org/reactome/REACT_947590
+ - http://identifiers.org/reactome/REACT_109277
+ - http://identifiers.org/reactome/REACT_113548
+ - http://identifiers.org/reactome/REACT_2255331
+ - http://identifiers.org/reactome/REACT_29372
+ - http://identifiers.org/reactome/REACT_113550
+ - http://identifiers.org/reactome/REACT_113551
+ - http://identifiers.org/seed.compound/cpd09464
+ - http://identifiers.org/seed.compound/cpd09463
+ - http://identifiers.org/seed.compound/cpd00009
+ - http://identifiers.org/unipathway.compound/UPC00009
+ - !!omap
+ - id: M_pyr_c
- name: Pyruvate
- compartment: c
- charge: -1
- formula: C3H3O3
- annotation: !!omap
- - bigg.metabolite: pyr
- - biocyc: PYRUVATE
- - cas:
- - 127-17-3
- - chebi:
- - CHEBI:15361
- - CHEBI:14987
- - CHEBI:8685
- - CHEBI:32816
- - CHEBI:45253
- - CHEBI:26466
- - CHEBI:26462
- - hmdb: HMDB00243
- - kegg.compound: C00022
- - lipidmaps: LMFA01060077
- - pubchem.substance: '3324'
- - reactome:
- - REACT_113557
- - REACT_389680
- - REACT_29398
- - seed.compound: cpd00020
- - unipathway.compound: UPC00022
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.metabolite/pyr
+ - http://identifiers.org/biocyc/PYRUVATE
+ - http://identifiers.org/cas/127-17-3
+ - http://identifiers.org/cas/127-17-3
+ - http://identifiers.org/chebi/CHEBI:15361
+ - http://identifiers.org/chebi/CHEBI:14987
+ - http://identifiers.org/chebi/CHEBI:8685
+ - http://identifiers.org/chebi/CHEBI:32816
+ - http://identifiers.org/chebi/CHEBI:45253
+ - http://identifiers.org/chebi/CHEBI:26466
+ - http://identifiers.org/chebi/CHEBI:26462
+ - http://identifiers.org/hmdb/HMDB00243
+ - http://identifiers.org/kegg.compound/C00022
+ - http://identifiers.org/lipidmaps/LMFA01060077
+ - http://identifiers.org/pubchem.substance/3324
+ - http://identifiers.org/reactome/REACT_113557
+ - http://identifiers.org/reactome/REACT_389680
+ - http://identifiers.org/reactome/REACT_29398
+ - http://identifiers.org/seed.compound/cpd00020
+ - http://identifiers.org/unipathway.compound/UPC00022
- reactions:
- !!omap
- - id: ATPM
+ - id: R_ATPM
- name: ATP maintenance requirement
- - metabolites: !!omap
- - adp_c: 1.0
- - atp_c: -1.0
- - h2o_c: -1.0
- - h_c: 1.0
- - pi_c: 1.0
- lower_bound: 8.39
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap
+ - M_atp_c: -1.0
+ - M_h2o_c: -1.0
+ - M_adp_c: 1.0
+ - M_h_c: 1.0
+ - M_pi_c: 1.0
- objective_coefficient: 1.0
- annotation: !!omap
- - bigg.reaction: ATPM
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/ATPM
- !!omap
- - id: D_LACt2
+ - id: R_D_LACt2
- name: ''
- - metabolites: !!omap []
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap []
- !!omap
- - id: ENO
+ - id: R_ENO
- name: enolase
- - metabolites: !!omap
- - 2pg_c: -1.0
- - h2o_c: 1.0
- - pep_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b2779
+ - metabolites: !!omap
+ - M_2pg_c: -1.0
+ - M_pep_c: 1.0
+ - M_h2o_c: 1.0
- annotation: !!omap
- - bigg.reaction: ENO
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/ENO
- !!omap
- - id: EX_glc__D_e
+ - id: R_EX_glc__D_e
- name: D-Glucose exchange
- - metabolites: !!omap
- - glc__D_e: -1.0
- lower_bound: -10.0
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap
+ - M_glc__D_e: -1.0
- annotation: !!omap
- - bigg.reaction: glc
- sbo: SBO:0000627
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/glc
- !!omap
- - id: EX_h_e
+ - id: R_EX_h_e
- name: H+ exchange
- - metabolites: !!omap
- - h_e: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap
+ - M_h_e: -1.0
- annotation: !!omap
- - bigg.reaction: h
- sbo: SBO:0000627
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/h
- !!omap
- - id: EX_lac__D_e
+ - id: R_EX_lac__D_e
- name: D-lactate exchange
- - metabolites: !!omap
- - lac__D_e: -1.0
- lower_bound: 0.0
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap
+ - M_lac__D_e: -1.0
- annotation: !!omap
- - bigg.reaction: lac__D
- sbo: SBO:0000627
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/lac__D
- !!omap
- - id: FBA
+ - id: R_FBA
- name: fructose-bisphosphate aldolase
- - metabolites: !!omap
- - dhap_c: 1.0
- - fdp_c: -1.0
- - g3p_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b1773 or b2097 or b2925
+ - metabolites: !!omap
+ - M_fdp_c: -1.0
+ - M_dhap_c: 1.0
+ - M_g3p_c: 1.0
- annotation: !!omap
- - bigg.reaction: FBA
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/FBA
- !!omap
- - id: GAPD
+ - id: R_GAPD
- name: glyceraldehyde-3-phosphate dehydrogenase
- - metabolites: !!omap
- - 13dpg_c: 1.0
- - g3p_c: -1.0
- - h_c: 1.0
- - nad_c: -1.0
- - nadh_c: 1.0
- - pi_c: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b1779
+ - metabolites: !!omap
+ - M_nad_c: -1.0
+ - M_13dpg_c: 1.0
+ - M_nadh_c: 1.0
+ - M_g3p_c: -1.0
+ - M_pi_c: -1.0
+ - M_h_c: 1.0
- annotation: !!omap
- - bigg.reaction: GAPD
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/GAPD
- !!omap
- - id: GLCpts
+ - id: R_GLCpts
- name: D-glucose transport via PEP:Pyr PTS
- - metabolites: !!omap
- - g6p_c: 1.0
- - glc__D_e: -1.0
- - pep_c: -1.0
- - pyr_c: 1.0
- lower_bound: 0.0
- upper_bound: 1000.0
- gene_reaction_rule: (b2415 and b2417 and b1101 and b2416) or (b2415 and b2417
and b1621 and b2416) or (b2415 and b1818 and b1817 and b1819 and b2416)
+ - metabolites: !!omap
+ - M_g6p_c: 1.0
+ - M_pyr_c: 1.0
+ - M_glc__D_e: -1.0
+ - M_pep_c: -1.0
- annotation: !!omap
- - bigg.reaction: GLCpts
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/GLCpts
- !!omap
- - id: H2Ot
+ - id: R_H2Ot
- name: R H2O transport via - diffusion
- - metabolites: !!omap
- - h2o_c: 1.0
- - h2o_e: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b0875 or s0001
+ - metabolites: !!omap
+ - M_h2o_e: -1.0
+ - M_h2o_c: 1.0
- annotation: !!omap
- - bigg.reaction: H2Ot
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/H2Ot
- !!omap
- - id: LDH_D
+ - id: R_LDH_D
- name: D-lactate dehydrogenase
- - metabolites: !!omap
- - h_c: 1.0
- - lac__D_c: -1.0
- - nad_c: -1.0
- - nadh_c: 1.0
- - pyr_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b2133 or b1380
+ - metabolites: !!omap
+ - M_lac__D_c: -1.0
+ - M_nad_c: -1.0
+ - M_h_c: 1.0
+ - M_nadh_c: 1.0
+ - M_pyr_c: 1.0
- subsystem: Pyruvate Metabolism
- annotation: !!omap
- - bigg.reaction: LDH_D
- - biocyc: META:DLACTDEHYDROGNAD-RXN
- - ec-code: 1.1.1.28
- - kegg.reaction: R00704
- - metanetx.reaction: MNXR101037
- - rhea:
- - '16369'
- - '16370'
- - '16371'
- - '16372'
- sbo: SBO:0000375
- - !!omap
- - id: PFK
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/LDH_D
+ - http://identifiers.org/biocyc/META:DLACTDEHYDROGNAD-RXN
+ - http://identifiers.org/ec-code/1.1.1.28
+ - http://identifiers.org/kegg.reaction/R00704
+ - http://identifiers.org/metanetx.reaction/MNXR101037
+ - http://identifiers.org/rhea/16369
+ - http://identifiers.org/rhea/16370
+ - http://identifiers.org/rhea/16371
+ - http://identifiers.org/rhea/16372
+ - !!omap
+ - id: R_PFK
- name: phosphofructokinase
- - metabolites: !!omap
- - adp_c: 1.0
- - atp_c: -1.0
- - f6p_c: -1.0
- - fdp_c: 1.0
- - h_c: 1.0
- lower_bound: 0.0
- upper_bound: 1000.0
- gene_reaction_rule: b3916 or b1723
+ - metabolites: !!omap
+ - M_f6p_c: -1.0
+ - M_atp_c: -1.0
+ - M_adp_c: 1.0
+ - M_fdp_c: 1.0
+ - M_h_c: 1.0
- objective_coefficient: 1.0
- annotation: !!omap
- - bigg.reaction: PFK
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/PFK
- !!omap
- - id: PGI
+ - id: R_PGI
- name: glucose-6-phosphate isomerase
- - metabolites: !!omap
- - f6p_c: 1.0
- - g6p_c: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b4025
+ - metabolites: !!omap
+ - M_g6p_c: -1.0
+ - M_f6p_c: 1.0
- annotation: !!omap
- - bigg.reaction: PGI
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/PGI
- !!omap
- - id: PGK
+ - id: R_PGK
- name: phosphoglycerate kinase
- - metabolites: !!omap
- - 13dpg_c: 1.0
- - 3pg_c: -1.0
- - adp_c: 1.0
- - atp_c: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b2926
+ - metabolites: !!omap
+ - M_3pg_c: -1.0
+ - M_atp_c: -1.0
+ - M_13dpg_c: 1.0
+ - M_adp_c: 1.0
- annotation: !!omap
- - bigg.reaction: PGK
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/PGK
- !!omap
- - id: PGM
+ - id: R_PGM
- name: phosphoglycerate mutase
- - metabolites: !!omap
- - 2pg_c: -1.0
- - 3pg_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b4395 or b3612 or b0755
+ - metabolites: !!omap
+ - M_2pg_c: -1.0
+ - M_3pg_c: 1.0
- annotation: !!omap
- - bigg.reaction: PGM
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/PGM
- !!omap
- - id: PIt2r
+ - id: R_PIt2r
- name: R phosphate reversible transport via - symport
- - metabolites: !!omap
- - h_c: 1.0
- - h_e: -1.0
- - pi_c: 1.0
- - pi_e: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b2987 or b3493
+ - metabolites: !!omap
+ - M_pi_e: -1.0
+ - M_h_e: -1.0
+ - M_h_c: 1.0
+ - M_pi_c: 1.0
- annotation: !!omap
- - bigg.reaction: PIt2r
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/PIt2r
- !!omap
- - id: PYK
+ - id: R_PYK
- name: pyruvate kinase
- - metabolites: !!omap
- - adp_c: -1.0
- - atp_c: 1.0
- - h_c: -1.0
- - pep_c: -1.0
- - pyr_c: 1.0
- lower_bound: 0.0
- upper_bound: 1000.0
- gene_reaction_rule: b1854 or b1676
+ - metabolites: !!omap
+ - M_adp_c: -1.0
+ - M_h_c: -1.0
+ - M_pep_c: -1.0
+ - M_atp_c: 1.0
+ - M_pyr_c: 1.0
- annotation: !!omap
- - bigg.reaction: PYK
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/PYK
- !!omap
- - id: TPI
+ - id: R_TPI
- name: triose-phosphate isomerase
- - metabolites: !!omap
- - dhap_c: -1.0
- - g3p_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b3919
+ - metabolites: !!omap
+ - M_dhap_c: -1.0
+ - M_g3p_c: 1.0
- annotation: !!omap
- - bigg.reaction: TPI
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/bigg.reaction/TPI
- genes:
- !!omap
- - id: b0755
+ - id: G_b0755
- name: gpmA
- !!omap
- - id: b0875
+ - id: G_b0875
- name: aqpZ
- !!omap
- - id: b1101
+ - id: G_b1101
- name: ptsG
- !!omap
- - id: b1380
+ - id: G_b1380
- name: ldhA
- !!omap
- - id: b1621
+ - id: G_b1621
- name: malX
- !!omap
- - id: b1676
+ - id: G_b1676
- name: pykF
- annotation: !!omap
- - ncbiprotein:
- - '1208453'
- - '1652654'
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/ncbiprotein/1208453
+ - http://identifiers.org/ncbiprotein/1652654
- !!omap
- - id: b1723
+ - id: G_b1723
- name: pfkB
- !!omap
- - id: b1773
+ - id: G_b1773
- name: ydjI
- !!omap
- - id: b1779
+ - id: G_b1779
- name: gapA
- !!omap
- - id: b1817
+ - id: G_b1817
- name: manX
- !!omap
- - id: b1818
+ - id: G_b1818
- name: manY
- !!omap
- - id: b1819
+ - id: G_b1819
- name: manZ
- !!omap
- - id: b1854
+ - id: G_b1854
- name: pykA
- !!omap
- - id: b2097
+ - id: G_b2097
- name: fbaB
- !!omap
- - id: b2133
+ - id: G_b2133
- name: dld
- !!omap
- - id: b2415
+ - id: G_b2415
- name: ptsH
- !!omap
- - id: b2416
+ - id: G_b2416
- name: ptsI
- !!omap
- - id: b2417
+ - id: G_b2417
- name: crr
- !!omap
- - id: b2779
+ - id: G_b2779
- name: eno
- annotation: !!omap
- - ncbiprotein: '1653839'
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/ncbiprotein/1653839
- !!omap
- - id: b2925
+ - id: G_b2925
- name: fbaA
- !!omap
- - id: b2926
+ - id: G_b2926
- name: pgk
- annotation: !!omap
- - ncbiprotein: '1653609'
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/ncbiprotein/1653609
- !!omap
- - id: b2987
+ - id: G_b2987
- name: pitB
- !!omap
- - id: b3493
+ - id: G_b3493
- name: pitA
- !!omap
- - id: b3612
+ - id: G_b3612
- name: gpmM
- !!omap
- - id: b3916
+ - id: G_b3916
- name: pfkA
- annotation: !!omap
- - ncbiprotein:
- - '1006614'
- - '1651919'
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/ncbiprotein/1006614
+ - http://identifiers.org/ncbiprotein/1651919
- !!omap
- - id: b3919
+ - id: G_b3919
- name: tpiA
- !!omap
- - id: b4025
+ - id: G_b4025
- name: pgi
- annotation: !!omap
- - ncbiprotein: '1653253'
+ - standardized: !!omap
+ - bqb_is:
+ - resources:
+ - http://identifiers.org/ncbiprotein/1653253
- !!omap
- - id: b4395
+ - id: G_b4395
- name: ytjC
- !!omap
- - id: s0001
+ - id: G_s0001
- name: G_s0001
+- groups: []
- id: mini_textbook
- compartments: !!omap
- c: cytosol
diff --git a/src/cobra/data/mini_cobra.xml b/src/cobra/data/mini_cobra.xml
index bc0d31f38..a22f61a4a 100644
--- a/src/cobra/data/mini_cobra.xml
+++ b/src/cobra/data/mini_cobra.xml
@@ -21,19 +21,19 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -46,23 +46,23 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -75,29 +75,29 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -110,33 +110,34 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -149,32 +150,33 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -187,25 +189,26 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -218,25 +221,26 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -249,26 +253,27 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -281,19 +286,20 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -306,28 +312,29 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -340,10 +347,11 @@
-
-
-
-
+
+
+
+
+
@@ -356,64 +364,65 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -426,64 +435,65 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -496,37 +506,38 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -539,37 +550,38 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -582,20 +594,20 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -608,20 +620,20 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -634,30 +646,31 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -670,25 +683,26 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -701,24 +715,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -731,52 +746,53 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -789,52 +805,53 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -847,25 +864,26 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -889,7 +907,7 @@
-
+
@@ -905,14 +923,14 @@
-
+
-
+
@@ -935,7 +953,7 @@
-
+
@@ -951,7 +969,7 @@
-
+
@@ -967,7 +985,7 @@
-
+
@@ -983,7 +1001,7 @@
-
+
@@ -1010,7 +1028,7 @@
-
+
@@ -1036,7 +1054,7 @@
-
+
@@ -1080,7 +1098,7 @@
-
+
@@ -1105,15 +1123,15 @@
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
@@ -1141,7 +1159,7 @@
-
+
@@ -1169,7 +1187,7 @@
-
+
@@ -1191,7 +1209,7 @@
-
+
@@ -1215,7 +1233,7 @@
-
+
@@ -1241,7 +1259,7 @@
-
+
@@ -1268,7 +1286,7 @@
-
+
@@ -1296,7 +1314,7 @@
-
+
@@ -1322,97 +1340,97 @@
-
-
-
-
-
+
+
+
+
+
-
-
+
+
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
-
+
-
+
-
+
-
-
-
+
+
+
-
-
+
+
-
+
-
+
-
-
+
+
diff --git a/src/cobra/flux_analysis/reaction.py b/src/cobra/flux_analysis/reaction.py
index d3f146d4a..ebc8a1e9a 100644
--- a/src/cobra/flux_analysis/reaction.py
+++ b/src/cobra/flux_analysis/reaction.py
@@ -58,13 +58,14 @@ def assess(
if m.slim_optimize(error_value=0.0) >= flux_coefficient_cutoff:
return True
else:
- results = {}
- results["precursors"] = assess_component(
- model, reaction, "reactants", flux_coefficient_cutoff
- )
- results["products"] = assess_component(
- model, reaction, "products", flux_coefficient_cutoff
- )
+ results = {
+ "precursors": assess_component(
+ model, reaction, "reactants", flux_coefficient_cutoff
+ ),
+ "products": assess_component(
+ model, reaction, "products", flux_coefficient_cutoff
+ ),
+ }
return results
diff --git a/src/cobra/io/__init__.py b/src/cobra/io/__init__.py
index 66d8a1b92..4c7ac6135 100644
--- a/src/cobra/io/__init__.py
+++ b/src/cobra/io/__init__.py
@@ -2,8 +2,14 @@
from cobra.io.dict import model_from_dict, model_to_dict
-from cobra.io.json import from_json, load_json_model, save_json_model, to_json
-from cobra.io.mat import load_matlab_model, save_matlab_model
+from cobra.io.json import (
+ from_json,
+ load_json_model,
+ save_json_model,
+ to_json,
+ validate_json_model,
+)
+from cobra.io.mat import load_matlab_model, save_matlab_model, create_mat_dict
from cobra.io.sbml import read_sbml_model, write_sbml_model, validate_sbml_model
from cobra.io.yaml import from_yaml, load_yaml_model, save_yaml_model, to_yaml
from cobra.io.web import AbstractModelRepository, BiGGModels, BioModels, load_model
diff --git a/src/cobra/io/dict.py b/src/cobra/io/dict.py
index b0f009d4c..73f565dc9 100644
--- a/src/cobra/io/dict.py
+++ b/src/cobra/io/dict.py
@@ -1,12 +1,25 @@
"""Provide functions for cobrapy objects to generic Python objects and vice-versa."""
-
-from collections import OrderedDict
-from operator import attrgetter, itemgetter
-from typing import TYPE_CHECKING, Dict, List, Sequence, Set, Union
+import itertools
+import re
+from collections import OrderedDict, defaultdict
+from typing import TYPE_CHECKING, Dict, List, Sequence, Set, Tuple, Union
import numpy as np
-from ..core import Gene, Metabolite, Model, Reaction
+from ..core import Gene, Group, Metabolite, Model, Reaction
+from ..core.metadata import MetaData
+from ..core.metadata.helper import URL_IDENTIFIERS_PATTERN, parse_identifiers_uri
+from ..io.sbml import (
+ F_GENE,
+ F_GENE_REV,
+ F_GROUP,
+ F_GROUP_REV,
+ F_REACTION,
+ F_REACTION_REV,
+ F_REPLACE,
+ F_SPECIE,
+ F_SPECIE_REV,
+)
from ..util.solver import set_objective
@@ -16,7 +29,6 @@
_REQUIRED_REACTION_ATTRIBUTES = [
"id",
"name",
- "metabolites",
"lower_bound",
"upper_bound",
"gene_reaction_rule",
@@ -57,6 +69,14 @@
"annotation": {},
}
+_REQUIRED_GROUP_ATTRIBUTES = ["id", "kind", "members"]
+_ORDERED_OPTIONAL_GROUP_KEYS = ["name", "notes", "annotation"]
+_OPTIONAL_GROUP_ATTRIBUTES = {
+ "name": "",
+ "notes": {},
+ "annotation": {},
+}
+
_ORDERED_OPTIONAL_MODEL_KEYS = ["name", "compartments", "notes", "annotation"]
_OPTIONAL_MODEL_ATTRIBUTES = {
"name": None,
@@ -67,9 +87,25 @@
}
+def flatten(list_of_lists: Union[List, Tuple]) -> List:
+ """Flatten lists of lists.
+
+ Parameters
+ ----------
+ list_of_lists: List or Tuple
+ List or Tuple of lists or tuples to flatten.
+
+ Returns
+ -------
+ list: flattened list
+
+ """
+ return list(itertools.chain.from_iterable(list_of_lists))
+
+
def _fix_type(
value: Union[str, np.float, np.bool, Set, Dict]
-) -> Union[str, float, bool, List, OrderedDict]:
+) -> Union[str, float, bool, List, OrderedDict, Dict]:
"""Convert possible types to correct Python types.
Parameters
@@ -86,6 +122,8 @@ def _fix_type(
# Because numpy floats can not be pickled to json
if isinstance(value, str):
return str(value)
+ if isinstance(value, np.float) and (np.isnan(value) or np.isinf(value)):
+ return str(value)
if isinstance(value, np.float):
return float(value)
if isinstance(value, np.bool):
@@ -94,6 +132,8 @@ def _fix_type(
return list(value)
if isinstance(value, dict):
return OrderedDict((key, value[key]) for key in sorted(value))
+ if isinstance(value, MetaData):
+ return value.to_dict()
# handle legacy Formula type
if value.__class__.__name__ == "Formula":
return str(value)
@@ -131,19 +171,78 @@ def _update_optional(
"""
for key in ordered_keys:
default = optional_attribute_dict[key]
- value = getattr(cobra_object, key)
+ value = getattr(cobra_object, key, None)
if value is None or value == default:
continue
new_dict[key] = _fix_type(value)
-def _metabolite_to_dict(metabolite: Metabolite) -> OrderedDict:
+def _fix_id_from_dict(
+ _id_to_fix: str,
+ _class_to_fix_to: str,
+ f_replace: dict = F_REPLACE, # noqa: W0102
+):
+ if f_replace is None:
+ f_replace = {}
+ if not f_replace:
+ return _id_to_fix
+ if _class_to_fix_to == "Metabolite":
+ return F_REPLACE[F_SPECIE](_id_to_fix)
+ elif _class_to_fix_to == "Reaction":
+ return F_REPLACE[F_REACTION](_id_to_fix)
+ elif _class_to_fix_to == "Gene":
+ return F_REPLACE[F_GENE](_id_to_fix)
+ elif _class_to_fix_to == "Group":
+ return F_REPLACE[F_GROUP](_id_to_fix)
+
+
+def _fix_value_from_dict(_key: str, _value_to_fix: Union[List, str]):
+ if _key == "annotation":
+ # if annotation is in the form of list of list, modify the format
+ # https://github.com/opencobra/cobrapy/issues/736
+ if isinstance(_value_to_fix, list) and isinstance(_value_to_fix[0], list):
+ _value_to_fix = flatten(_value_to_fix)
+ anno_dict = defaultdict(list)
+ if isinstance(_value_to_fix, list):
+ for item in _value_to_fix:
+ if re.match(URL_IDENTIFIERS_PATTERN, item):
+ provider, identifier = parse_identifiers_uri(item)
+ anno_dict[provider].append(identifier)
+ _value_to_fix = anno_dict
+ _value_to_fix = MetaData.from_dict(_value_to_fix)
+ elif _key == "lower_bound" or _key == "upper_bound":
+ _value_to_fix = float(_value_to_fix)
+
+ return _value_to_fix
+
+
+def _get_by_id(
+ _id: str, _object_to_get: str, model: Model
+) -> Union[Gene, Metabolite, Group, Reaction]:
+ if _object_to_get == "Reaction":
+ return model.reactions.get_by_id(_id)
+ elif _object_to_get == "Metabolite":
+ return model.metabolites.get_by_id(_id)
+ elif _object_to_get == "Group":
+ return model.groups.get_by_id(_id)
+ elif _object_to_get == "Gene":
+ return model.genes.get_by_id(_id)
+
+
+def _metabolite_to_dict(
+ metabolite: Metabolite, f_replace: dict = F_REPLACE # noqa: W0102
+) -> OrderedDict:
"""Convert a cobra Metabolite object to dictionary.
Parameters
----------
metabolite : cobra.Metabolite
The cobra.Metabolite to convert to dictionary.
+ f_replace : dict of replacement functions for id replacement
+ Dictionary of replacement functions for gene, specie, and reaction.
+ By default, the following id changes are performed on import:
+ clip G_ from genes, clip M_ from species, clip R_ from reactions
+ If no replacements should be performed, set f_replace={} or None
Returns
-------
@@ -155,9 +254,15 @@ def _metabolite_to_dict(metabolite: Metabolite) -> OrderedDict:
_metabolite_from_dict : Convert a dictionary to cobra Metabolite object.
"""
+ if f_replace is None:
+ f_replace = {}
+
new_metabolite = OrderedDict()
for key in _REQUIRED_METABOLITE_ATTRIBUTES:
- new_metabolite[key] = _fix_type(getattr(metabolite, key))
+ if key == "id" and f_replace and F_SPECIE_REV in f_replace:
+ new_metabolite[key] = _fix_type(f_replace[F_SPECIE_REV](metabolite.id))
+ else:
+ new_metabolite[key] = _fix_type(getattr(metabolite, key))
_update_optional(
metabolite,
new_metabolite,
@@ -167,7 +272,9 @@ def _metabolite_to_dict(metabolite: Metabolite) -> OrderedDict:
return new_metabolite
-def _metabolite_from_dict(metabolite: Dict) -> Metabolite:
+def _metabolite_from_dict(
+ metabolite: Dict, f_replace: dict = F_REPLACE # noqa: W0102
+) -> Metabolite:
"""Convert a dictionary to cobra Metabolite object.
Parameters
@@ -184,9 +291,17 @@ def _metabolite_from_dict(metabolite: Dict) -> Metabolite:
_metabolite_to_dict : Convert a cobra Metabolite object to dictionary.
"""
- new_metabolite = Metabolite()
- for k, v in metabolite.items():
- setattr(new_metabolite, k, v)
+ if f_replace is None:
+ f_replace = {}
+
+ new_metabolite = Metabolite(
+ _fix_id_from_dict(metabolite["id"], "Metabolite", f_replace)
+ )
+ [
+ setattr(new_metabolite, k, _fix_value_from_dict(k, v))
+ for k, v in metabolite.items()
+ if k != "id"
+ ]
return new_metabolite
@@ -210,14 +325,17 @@ def _gene_to_dict(gene: Gene) -> OrderedDict:
"""
new_gene = OrderedDict()
for key in _REQUIRED_GENE_ATTRIBUTES:
- new_gene[key] = _fix_type(getattr(gene, key))
+ if key == "id":
+ new_gene[key] = _fix_type(F_REPLACE["F_GENE_REV"](gene.id))
+ else:
+ new_gene[key] = _fix_type(getattr(gene, key))
_update_optional(
gene, new_gene, _OPTIONAL_GENE_ATTRIBUTES, _ORDERED_OPTIONAL_GENE_KEYS
)
return new_gene
-def gene_from_dict(gene: Dict) -> Gene:
+def gene_from_dict(gene: Dict, f_replace: dict = F_REPLACE) -> Gene: # noqa: W0102
"""Convert a dictionary to cobra Gene object.
Parameters
@@ -235,9 +353,15 @@ def gene_from_dict(gene: Dict) -> Gene:
_gene_to_dict : Convert a cobra Gene object to a dictionary.
"""
- new_gene = Gene(gene["id"])
- for k, v in gene.items():
- setattr(new_gene, k, v)
+ if f_replace is None:
+ f_replace = {}
+
+ new_gene = Gene(_fix_id_from_dict(gene["id"], "Gene", f_replace))
+ [
+ setattr(new_gene, k, _fix_value_from_dict(k, v))
+ for k, v in gene.items()
+ if k != "id"
+ ]
return new_gene
@@ -261,22 +385,18 @@ def _reaction_to_dict(reaction: Reaction) -> OrderedDict:
"""
new_reaction = OrderedDict()
for key in _REQUIRED_REACTION_ATTRIBUTES:
- if key != "metabolites":
- if key == "lower_bound" and (
- np.isnan(reaction.lower_bound) or np.isinf(reaction.lower_bound)
- ):
- new_reaction[key] = str(_fix_type(getattr(reaction, key)))
- elif key == "upper_bound" and (
- np.isnan(reaction.upper_bound) or np.isinf(reaction.upper_bound)
- ):
- new_reaction[key] = str(_fix_type(getattr(reaction, key)))
- else:
- new_reaction[key] = _fix_type(getattr(reaction, key))
- continue
- mets = OrderedDict()
- for met in sorted(reaction.metabolites, key=attrgetter("id")):
- mets[str(met)] = reaction.metabolites[met]
- new_reaction["metabolites"] = mets
+ if key == "id":
+ new_reaction[key] = _fix_type(F_REPLACE[F_REACTION_REV](reaction.id))
+ else:
+ new_reaction[key] = _fix_type(getattr(reaction, key))
+ if F_REPLACE and F_SPECIE_REV in F_REPLACE:
+ mets = {
+ F_REPLACE[F_SPECIE_REV](met.id): stoic
+ for met, stoic in reaction.metabolites.items()
+ }
+ else:
+ mets = {met.id: stoic for met, stoic in reaction.metabolites.items()}
+ new_reaction["metabolites"] = OrderedDict(mets)
_update_optional(
reaction,
new_reaction,
@@ -286,7 +406,9 @@ def _reaction_to_dict(reaction: Reaction) -> OrderedDict:
return new_reaction
-def _reaction_from_dict(reaction: Dict, model: Model) -> Reaction:
+def _reaction_from_dict(
+ reaction: Dict, model: Model, f_replace: Dict = F_REPLACE # noqa: W0102
+) -> Reaction:
"""Convert a dictionary to a cobra Reaction object.
Parameters
@@ -306,26 +428,93 @@ def _reaction_from_dict(reaction: Dict, model: Model) -> Reaction:
_reaction_to_dict : Convert a cobra Reaction object to a dictionary.
"""
- new_reaction = Reaction()
- for k, v in reaction.items():
- if k in {"objective_coefficient", "reversibility", "reaction"}:
- continue
- elif k == "metabolites":
- new_reaction.add_metabolites(
- OrderedDict(
- (model.metabolites.get_by_id(str(met)), coeff)
- for met, coeff in v.items()
- )
+ if f_replace is None:
+ f_replace = {}
+
+ new_reaction = Reaction(_fix_id_from_dict(reaction["id"], "Reaction", f_replace))
+ [
+ setattr(new_reaction, k, _fix_value_from_dict(k, v))
+ for k, v in reaction.items()
+ if k
+ not in {
+ "id",
+ "objective_coefficient",
+ "reversibility",
+ "reaction",
+ "metabolites",
+ }
+ ]
+
+ new_reaction.add_metabolites(
+ OrderedDict(
+ (
+ model.metabolites.get_by_id(
+ _fix_id_from_dict(str(met), "Metabolite", f_replace)
+ ),
+ coeff,
)
- else:
- if k == "lower_bound" or k == "upper_bound":
- setattr(new_reaction, k, float(v))
- else:
- setattr(new_reaction, k, v)
+ for met, coeff in reaction.get("metabolites", {}).items()
+ )
+ )
return new_reaction
-def model_to_dict(model: Model, sort: bool = False) -> OrderedDict:
+def group_to_dict(group: "Group") -> Dict:
+ new_group = OrderedDict()
+ for key in _REQUIRED_GROUP_ATTRIBUTES:
+ if key != "members":
+ if key == "id":
+ new_group[key] = _fix_type(F_REPLACE[F_GROUP_REV](group.id))
+ else:
+ new_group[key] = _fix_type(getattr(group, key))
+ continue
+ members = []
+ for member in group.members:
+ idRef = member.id
+ if isinstance(member, Reaction):
+ idRef = F_REPLACE[F_REACTION_REV](member.id)
+ elif isinstance(member, Gene):
+ idRef = F_REPLACE[F_GENE_REV](member.id)
+ elif isinstance(member, Metabolite):
+ idRef = F_REPLACE[F_SPECIE_REV](member.id)
+ elif isinstance(member, Group):
+ idRef = F_REPLACE[F_GROUP_REV](member.id)
+ json_member = {"idRef": idRef, "type": type(member).__name__}
+ members.append(json_member)
+ new_group["members"] = members
+ _update_optional(
+ group, new_group, _OPTIONAL_GROUP_ATTRIBUTES, _ORDERED_OPTIONAL_GROUP_KEYS
+ )
+ return new_group
+
+
+def group_from_dict(
+ group: Dict, model: Model, f_replace=F_REPLACE # noqa: W0102
+) -> Group:
+ if f_replace is None:
+ f_replace = {}
+
+ new_group = Group(_fix_id_from_dict(group["id"], "Group"))
+ [
+ setattr(new_group, k, _fix_value_from_dict(k, v))
+ for k, v in group.items()
+ if k not in {"id", "members"}
+ ]
+ cobra_members = [
+ _get_by_id(
+ _fix_id_from_dict(member["idRef"], member["type"], f_replace),
+ member["type"],
+ model,
+ )
+ for member in group["members"]
+ ]
+ new_group.add_members(cobra_members)
+ return new_group
+
+
+def model_to_dict(
+ model: Model, sort: bool = False, f_replace: dict = F_REPLACE # noqa: W0102
+) -> OrderedDict:
"""Convert a cobra Model to a dictionary.
Parameters
@@ -335,6 +524,11 @@ def model_to_dict(model: Model, sort: bool = False) -> OrderedDict:
sort : bool, optional
Whether to sort the metabolites, reactions, and genes or maintain the
order defined in the model (default False).
+ f_replace : dict of replacement functions for id replacement
+ Dictionary of replacement functions for gene, specie, and reaction.
+ By default, the following id changes are performed on import:
+ clip G_ from genes, clip M_ from species, clip R_ from reactions
+ If no replacements should be performed, set f_replace={} or None
Returns
-------
@@ -349,19 +543,29 @@ def model_to_dict(model: Model, sort: bool = False) -> OrderedDict:
model_from_dict : Convert a dictionary to a cobra Model.
"""
+ if f_replace is None:
+ f_replace = {}
+
obj = OrderedDict()
obj["metabolites"] = list(map(_metabolite_to_dict, model.metabolites))
obj["reactions"] = list(map(_reaction_to_dict, model.reactions))
obj["genes"] = list(map(_gene_to_dict, model.genes))
+ obj["groups"] = list(map(group_to_dict, model.groups))
+
+ # sbml meta info
+ if hasattr(model, "_sbml"):
+ obj["sbml_info"] = OrderedDict(
+ {key: _fix_type(value) for key, value in model._sbml.items()}
+ )
obj["id"] = model.id
_update_optional(
model, obj, _OPTIONAL_MODEL_ATTRIBUTES, _ORDERED_OPTIONAL_MODEL_KEYS
)
if sort:
- get_id = itemgetter("id")
- obj["metabolites"].sort(key=get_id)
- obj["reactions"].sort(key=get_id)
- obj["genes"].sort(key=get_id)
+ obj["metabolites"].sort(key=lambda x: x["id"])
+ obj["reactions"].sort(key=lambda x: x["id"])
+ obj["genes"].sort(key=lambda x: x["id"])
+ obj["groups"].sort(key=lambda x: x["id"])
return obj
@@ -408,11 +612,24 @@ def model_from_dict(obj: Dict) -> Model:
rxn for rxn in obj["reactions"] if rxn.get("objective_coefficient", 0) != 0
]
coefficients = {
- model.reactions.get_by_id(rxn["id"]): rxn["objective_coefficient"]
+ model.reactions.get_by_id(F_REPLACE["F_REACTION"](rxn["id"])): rxn[
+ "objective_coefficient"
+ ]
for rxn in objective_reactions
}
+ if "groups" in obj:
+ model.add_groups([group_from_dict(group, model) for group in obj["groups"]])
set_objective(model, coefficients)
- for k, v in obj.items():
- if k in {"id", "name", "notes", "compartments", "annotation"}:
- setattr(model, k, v)
+
+ # sbml meta info
+ if "sbml_info" in obj:
+ meta = {k: _fix_value_from_dict(k, v) for k, v in obj["sbml_info"].items()}
+ model._sbml = meta
+
+ [
+ setattr(model, k, _fix_value_from_dict(k, v))
+ for k, v in obj.items()
+ if k in {"id", "name", "compartments", "annotation", "notes"}
+ ]
+
return model
diff --git a/src/cobra/io/json.py b/src/cobra/io/json.py
index 8fec5191d..31c20be70 100644
--- a/src/cobra/io/json.py
+++ b/src/cobra/io/json.py
@@ -1,6 +1,11 @@
"""Provide functions for I/O in JSON format."""
from pathlib import Path
-from typing import TYPE_CHECKING, Any, Union
+from typing import TYPE_CHECKING, Any, Dict, List, Union
+
+import jsonschema
+from importlib_resources import files
+
+from cobra import io as cio
from .dict import model_from_dict, model_to_dict
@@ -17,6 +22,18 @@
JSON_SPEC = "1"
+def json_schema_v1() -> Dict:
+ with files(cio).joinpath("schema_v1.json").open("r") as handle:
+ schema_v1 = json.load(handle)
+ return schema_v1
+
+
+def json_schema_v2() -> Dict:
+ with files(cio).joinpath("schema_v2.json").open("r") as handle:
+ schema_v2 = json.load(handle)
+ return schema_v2
+
+
def to_json(model: "Model", sort: bool = False, **kwargs: Any) -> str:
"""Return the model as a JSON string.
@@ -72,7 +89,7 @@ def save_json_model(
filename: Union[str, Path],
sort: bool = False,
pretty: bool = False,
- **kwargs: Any
+ **kwargs: Any,
) -> None:
"""Write the cobra model to a file in JSON format.
@@ -80,7 +97,7 @@ def save_json_model(
----------
model : cobra.Model
The cobra model to represent.
- filename : str or file-like
+ filename : str or file-like or Path
File path or descriptor that the JSON representation should be
written to.
sort : bool, optional
@@ -130,7 +147,7 @@ def load_json_model(filename: Union[str, Path]) -> "Model":
Parameters
----------
- filename : str or file-like
+ filename : str or file-like or Path
File path or descriptor that contains the JSON document describing the
cobra model.
@@ -149,3 +166,48 @@ def load_json_model(filename: Union[str, Path]) -> "Model":
return model_from_dict(json.load(file_handle))
else:
return model_from_dict(json.load(filename))
+
+
+def validate_json_model(
+ filename: Union[str, bytes], json_schema_version: int = 1
+) -> List:
+ """
+ Validate a model in json format against the schema with given version
+ Parameters
+ ----------
+ filename : str or file-like
+ File path or descriptor that contains the JSON document describing the
+ cobra model.
+ json_schema_version : int {1, 2}
+ the version of schema to be used for validation.
+ Currently we have v1 and v2 only and v2 is under development
+ Returns
+ -------
+ errors : list
+ The list of errors encountered while validating
+ """
+
+ if json_schema_version == 1:
+ schema = json_schema_v1()
+ elif json_schema_version == 2:
+ schema = json_schema_v2()
+ else:
+ raise ValueError(
+ f"Only v1 and v2 of JSON schema are available. JSON "
+ f"schema v{json_schema_version} is not supported."
+ )
+
+ # TODO - Should the validator be picked by schema?
+ # Something like validators.validator_for
+ validator = jsonschema.Draft7Validator(schema)
+
+ try:
+ if isinstance(filename, (str, Path)):
+ with open(filename, "r") as file_handle:
+ errors = validator.iter_errors(json.load(file_handle))
+ else:
+ errors = validator.iter_errors(json.load(filename))
+ except OSError:
+ errors = validator.iter_errors(json.loads(filename))
+
+ return list(errors)
diff --git a/src/cobra/io/mat.py b/src/cobra/io/mat.py
index ae436b646..6efe0d48b 100644
--- a/src/cobra/io/mat.py
+++ b/src/cobra/io/mat.py
@@ -908,7 +908,7 @@ def from_mat_struct(
new_group = Group(
id=g_name, name=g_name, members=group_members, kind="partonomy"
)
- new_group.annotation["sbo"] = "SBO:0000633"
+ new_group.annotation["sbo"] = ["SBO:0000633"]
new_groups.append(new_group)
model.add_groups(new_groups)
diff --git a/src/cobra/io/sbml.py b/src/cobra/io/sbml.py
index 48eed544b..2f2cfd96b 100644
--- a/src/cobra/io/sbml.py
+++ b/src/cobra/io/sbml.py
@@ -9,6 +9,7 @@
Parsing of fbc models was implemented as efficient as possible, whereas
(discouraged) fallback solutions are not optimized for efficiency.
+#TODO - fix the following paragraph, which is incorrect. Load up keyvalue pairs from notes??
Notes are only supported in a minimal way relevant for constraint-based
models. I.e., structured information from notes in the form
key: value
@@ -19,8 +20,6 @@
Annotations are read in the Object.annotation fields.
Some SBML related issues are still open, please refer to the respective issue:
-- update annotation format and support qualifiers (depends on decision
- for new annotation format; https://github.com/opencobra/cobrapy/issues/684)
- write compartment annotations and notes (depends on updated first-class
compartments; see https://github.com/opencobra/cobrapy/issues/760)
- support compression on file handles (depends on solution for
@@ -36,13 +35,27 @@
from copy import deepcopy
from io import StringIO
from sys import platform
-from typing import IO, Match, Optional, Pattern, Tuple, Type, Union
+from typing import IO, List, Match, Optional, Pattern, Tuple, Type, Union
+from warnings import warn
import libsbml
import cobra
-from ..core import GPR, Gene, Group, Metabolite, Model, Reaction
+from ..core import (
+ GPR,
+ Creator,
+ CVTerm,
+ CVTermList,
+ ExternalResources,
+ Gene,
+ Group,
+ Metabolite,
+ MetaData,
+ Model,
+ Reaction,
+)
+from ..core.metadata.history import STRTIME_FORMAT
from ..manipulation.validate import check_metabolite_compartment_formula
from ..util.solver import linear_reaction_coefficients, set_objective
@@ -600,40 +613,6 @@ def _sbml_to_model(
cobra_model = Model(model_id)
cobra_model.name = model.getName() or None
- # meta information
- meta = {
- "model.id": model_id,
- "level": model.getLevel(),
- "version": model.getVersion(),
- "packages": [],
- }
- # History
- creators = []
- created = None
- if model.isSetModelHistory():
- history: "libsbml.ModelHistory" = model.getModelHistory()
-
- if history.isSetCreatedDate():
- created = history.getCreatedDate()
-
- c: "libsbml.ModelCreator"
- for c in history.getListCreators():
- creators.append(
- {
- "familyName": c.getFamilyName() if c.isSetFamilyName() else None,
- "givenName": c.getGivenName() if c.isSetGivenName() else None,
- "organisation": c.getOrganisation()
- if c.isSetOrganisation()
- else None,
- "email": c.getEmail() if c.isSetEmail() else None,
- }
- )
-
- meta["creators"] = creators
- meta["created"] = created
- meta["notes"] = _parse_notes_dict(doc)
- meta["annotation"] = _parse_annotations(doc)
-
info = f"<{model_id}> SBML L{model.getLevel()}V{model.getVersion()}"
packages = {}
for k in range(doc.getNumPlugins()):
@@ -646,8 +625,17 @@ def _sbml_to_model(
f"SBML package '{key}' not supported by cobrapy, "
f"information is not parsed"
)
- meta["info"] = info
- meta["packages"] = packages
+
+ # meta information
+ meta = {
+ "model.id": model_id,
+ "level": model.getLevel(),
+ "version": model.getVersion(),
+ "packages": packages,
+ "notes": _parse_notes_dict(doc),
+ "annotation": _parse_annotations(doc),
+ "info": info,
+ }
cobra_model._sbml = meta
# notes and annotations
@@ -657,9 +645,8 @@ def _sbml_to_model(
# Compartments
# FIXME: update with new compartments
compartments = {}
- for (
- compartment
- ) in model.getListOfCompartments(): # noqa: E501 type: libsbml.Compartment
+ compartment: libsbml.Compartment
+ for compartment in model.getListOfCompartments():
cid = _check_required(compartment, compartment.getIdAttribute(), "id")
compartments[cid] = compartment.getName()
cobra_model.compartments = compartments
@@ -693,17 +680,16 @@ def _sbml_to_model(
f"discouraged, use fbc:charge instead: {specie}"
)
met.charge = specie.getCharge()
- else:
- if "CHARGE" in met.notes:
- LOGGER.warning(
- f"Use of CHARGE in the notes element is "
- f"discouraged, use fbc:charge instead: {specie}"
- )
- try:
- met.charge = int(met.notes["CHARGE"])
- except ValueError:
- # handle nan, na, NA, ...
- pass
+ elif "CHARGE" in met.notes:
+ LOGGER.warning(
+ f"Use of CHARGE in the notes element is "
+ f"discouraged, use fbc:charge instead: {specie}"
+ )
+ try:
+ met.charge = int(met.notes["CHARGE"])
+ except ValueError:
+ # handle nan, na, NA, ...
+ pass
if "FORMULA" in met.notes:
LOGGER.warning(
@@ -726,7 +712,7 @@ def _sbml_to_model(
ex_rid = f"EX_{met.id}"
ex_reaction = Reaction(ex_rid)
ex_reaction.name = ex_rid
- ex_reaction.annotation = {"sbo": SBO_EXCHANGE_REACTION}
+ ex_reaction.annotation = {"sbo": [SBO_EXCHANGE_REACTION]}
ex_reaction.lower_bound = config.lower_bound
ex_reaction.upper_bound = config.upper_bound
LOGGER.warning(
@@ -740,9 +726,8 @@ def _sbml_to_model(
# Genes
if model_fbc:
- for (
- gp
- ) in model_fbc.getListOfGeneProducts(): # noqa: E501 type: libsbml.GeneProduct
+ gp: "libsbml.GeneProduct"
+ for gp in model_fbc.getListOfGeneProducts():
gid = _check_required(gp, gp.getIdAttribute(), "id")
if f_replace and F_GENE in f_replace:
gid = f_replace[F_GENE](gid)
@@ -755,18 +740,11 @@ def _sbml_to_model(
cobra_model.genes.append(cobra_gene)
else:
- for (
- cobra_reaction
- ) in model.getListOfReactions(): # noqa: E501 type: libsbml.Reaction
+ cobra_reaction: "libsbml.Reaction"
+ for cobra_reaction in model.getListOfReactions():
# fallback to notes information
notes = _parse_notes_dict(cobra_reaction)
- if "GENE ASSOCIATION" in notes:
- gpr = notes["GENE ASSOCIATION"]
- elif "GENE_ASSOCIATION" in notes:
- gpr = notes["GENE_ASSOCIATION"]
- else:
- gpr = ""
-
+ gpr = notes.get("GENE ASSOCIATION", "") or notes.get("GENE_ASSOCIATION", "")
if len(gpr) > 0:
gpr = gpr.replace("(", ";")
gpr = gpr.replace(")", ";")
@@ -861,14 +839,10 @@ def process_association(ass: "libsbml.FbcAssociation") -> Union[BoolOp, Name]:
elif reaction.isSetKineticLaw():
# some legacy models encode bounds in kinetic laws
klaw: "libsbml.KineticLaw" = reaction.getKineticLaw()
- p_lb = klaw.getParameter(
- "LOWER_BOUND"
- ) # noqa: E501 type: libsbml.LocalParameter
+ p_lb: "libsbml.LocalParameter" = klaw.getParameter("LOWER_BOUND")
if p_lb:
cobra_reaction.lower_bound = p_lb.getValue()
- p_ub = klaw.getParameter(
- "UPPER_BOUND"
- ) # noqa: E501 type: libsbml.LocalParameter
+ p_ub: "libsbml.LocalParameter" = klaw.getParameter("UPPER_BOUND")
if p_ub:
cobra_reaction.upper_bound = p_ub.getValue()
@@ -902,9 +876,8 @@ def process_association(ass: "libsbml.FbcAssociation") -> Union[BoolOp, Name]:
# parse equation
stoichiometry = defaultdict(lambda: 0)
- for (
- sref
- ) in reaction.getListOfReactants(): # noqa: E501 type: libsbml.SpeciesReference
+ sref: "libsbml.SpeciesReference"
+ for sref in reaction.getListOfReactants():
sid = _check_required(sref, sref.getSpecies(), "species")
if f_replace and F_SPECIE in f_replace:
@@ -913,9 +886,7 @@ def process_association(ass: "libsbml.FbcAssociation") -> Union[BoolOp, Name]:
_check_required(sref, sref.getStoichiometry(), "stoichiometry")
)
- for (
- sref
- ) in reaction.getListOfProducts(): # noqa: E501 type: libsbml.SpeciesReference
+ for sref in reaction.getListOfProducts():
sid = _check_required(sref, sref.getSpecies(), "species")
if f_replace and F_SPECIE in f_replace:
@@ -934,24 +905,15 @@ def process_association(ass: "libsbml.FbcAssociation") -> Union[BoolOp, Name]:
# GPR
if r_fbc:
gpr = None
- gpa = (
- r_fbc.getGeneProductAssociation()
- ) # noqa: E501 type: libsbml.GeneProductAssociation
+ gpa: libsbml.GeneProductAssociation = r_fbc.getGeneProductAssociation()
if gpa is not None:
- association = (
- gpa.getAssociation()
- ) # noqa: E501 type: libsbml.FbcAssociation
+ association: libsbml.FbcAssociation = gpa.getAssociation()
gpr = Module(process_association(association))
cobra_reaction.gpr = GPR(gpr_from=gpr)
else:
# fallback to notes information
notes = cobra_reaction.notes
- if "GENE ASSOCIATION" in notes:
- gpr = notes["GENE ASSOCIATION"]
- elif "GENE_ASSOCIATION" in notes:
- gpr = notes["GENE_ASSOCIATION"]
- else:
- gpr = ""
+ gpr = notes.get("GENE ASSOCIATION", "") or notes.get("GENE_ASSOCIATION", "")
if len(gpr) > 0:
LOGGER.warning(
@@ -969,9 +931,7 @@ def process_association(ass: "libsbml.FbcAssociation") -> Union[BoolOp, Name]:
obj_direction = "max"
coefficients = {}
if model_fbc:
- obj_list = (
- model_fbc.getListOfObjectives()
- ) # noqa: E501 type: libsbml.ListOfObjectives
+ obj_list: "libsbml.ListOfObjectives" = model_fbc.getListOfObjectives()
if obj_list is None:
LOGGER.warning("listOfObjectives element not found")
elif obj_list.size() == 0:
@@ -983,11 +943,8 @@ def process_association(ass: "libsbml.FbcAssociation") -> Union[BoolOp, Name]:
obj: "libsbml.Objective" = model_fbc.getObjective(obj_id)
obj_direction = LONG_SHORT_DIRECTION[obj.getType()]
- for (
- flux_obj
- ) in (
- obj.getListOfFluxObjectives()
- ): # noqa: E501 type: libsbml.FluxObjective
+ flux_obj: "libsbml.FluxObjective"
+ for flux_obj in obj.getListOfFluxObjectives():
rid = flux_obj.getReaction()
if f_replace and F_REACTION in f_replace:
rid = f_replace[F_REACTION](rid)
@@ -1121,7 +1078,7 @@ def process_association(ass: "libsbml.FbcAssociation") -> Union[BoolOp, Name]:
if f_replace and F_GROUP in f_replace:
gid = f_replace[F_GROUP](gid)
cobra_group = Group(gid, name=gid, kind="partonomy")
- cobra_group.annotation["sbo"] = "SBO:0000633"
+ cobra_group.annotation["sbo"] = ["SBO:0000633"]
cobra_group.add_members(cobra_members)
groups.append(cobra_group)
@@ -1226,49 +1183,20 @@ def _model_to_sbml(
if cobra_model.name is not None:
model.setName(cobra_model.name)
- # for parsing annotation corresponding to the model
+ # for parsing annotation corresponding to the model, including model history
_sbase_annotations(model, cobra_model.annotation)
# for parsing notes corresponding to the model
_sbase_notes_dict(model, cobra_model.notes)
# Meta information (ModelHistory) related to SBMLDocument
- if hasattr(cobra_model, "_sbml"):
- meta = cobra_model._sbml
+ meta = getattr(cobra_model, "_sbml", None)
+ if meta:
if "annotation" in meta:
_sbase_annotations(doc, meta["annotation"])
+
if "notes" in meta:
_sbase_notes_dict(doc, meta["notes"])
- history: "libsbml.ModelHistory" = libsbml.ModelHistory()
- if "created" in meta and meta["created"]:
- history.setCreatedDate(meta["created"])
- else:
- time = datetime.datetime.now()
- timestr = time.strftime("%Y-%m-%dT%H:%M:%S")
- date = libsbml.Date(timestr)
- _check(history.setCreatedDate(date), "set creation date")
- _check(history.setModifiedDate(date), "set modified date")
-
- if "creators" in meta:
- for cobra_creator in meta[
- "creators"
- ]: # noqa: E501 type: libsbml.ModelCreator
- creator = libsbml.ModelCreator()
- if cobra_creator.get("familyName", None):
- creator.setFamilyName(cobra_creator["familyName"])
- if cobra_creator.get("givenName", None):
- creator.setGivenName(cobra_creator["givenName"])
- if cobra_creator.get("organisation", None):
- creator.setOrganisation(cobra_creator["organisation"])
- if cobra_creator.get("email", None):
- creator.setEmail(cobra_creator["email"])
-
- _check(history.addCreator(creator), "adding creator to ModelHistory.")
-
- # TODO: Will be implemented as part of
- # https://github.com/opencobra/cobrapy/issues/810
- # _check(model.setModelHistory(history), 'set model history')
-
# Units
flux_udef = None
if units:
@@ -1379,16 +1307,12 @@ def _model_to_sbml(
if f_replace and F_SPECIE_REV in f_replace:
sid = f_replace[F_SPECIE_REV](sid)
if stoichiometry < 0:
- sref = (
- reaction.createReactant()
- ) # noqa: E501 type: libsbml.SpeciesReference
+ sref: libsbml.SpeciesReference = reaction.createReactant()
sref.setSpecies(sid)
sref.setStoichiometry(-stoichiometry)
sref.setConstant(True)
else:
- sref = (
- reaction.createProduct()
- ) # noqa: E501 type: libsbml.SpeciesReference
+ sref: libsbml.SpeciesReference = reaction.createProduct()
sref.setSpecies(sid)
sref.setStoichiometry(stoichiometry)
sref.setConstant(True)
@@ -1426,18 +1350,14 @@ def _model_to_sbml(
else:
gpr_new = gpr.to_string()
- gpa = (
- r_fbc.createGeneProductAssociation()
- ) # noqa: E501 type: libsbml.GeneProductAssociation
+ gpa: libsbml.GeneProductAssociation = r_fbc.createGeneProductAssociation()
# uses ids to identify GeneProducts (True),
# does not create GeneProducts (False)
_check(gpa.setAssociation(gpr_new, True, False), "set gpr: " + gpr_new)
# objective coefficients
if reaction_coefficients.get(cobra_reaction, 0) != 0:
- flux_obj = (
- objective.createFluxObjective()
- ) # noqa: E501 type: libsbml.FluxObjective
+ flux_obj: libsbml.FluxObjective = objective.createFluxObjective()
flux_obj.setReaction(rid)
flux_obj.setCoefficient(cobra_reaction.objective_coefficient)
@@ -1447,9 +1367,7 @@ def _model_to_sbml(
"http://www.sbml.org/sbml/level3/version1/groups/version1", "groups", True
)
doc.setPackageRequired("groups", False)
- model_group = model.getPlugin(
- "groups"
- ) # noqa: E501 type: libsbml.GroupsModelPlugin
+ model_group: libsbml.GroupsModelPlugin = model.getPlugin("groups")
for cobra_group in cobra_model.groups:
group: "libsbml.Group" = model_group.createGroup()
if f_replace and F_GROUP_REV in f_replace:
@@ -1469,15 +1387,12 @@ def _model_to_sbml(
m_type = str(type(cobra_member))
# id replacements
- if "Reaction" in m_type:
- if f_replace and F_REACTION_REV in f_replace:
- mid = f_replace[F_REACTION_REV](mid)
- if "Metabolite" in m_type:
- if f_replace and F_SPECIE_REV in f_replace:
- mid = f_replace[F_SPECIE_REV](mid)
- if "Gene" in m_type:
- if f_replace and F_GENE_REV in f_replace:
- mid = f_replace[F_GENE_REV](mid)
+ if "Reaction" in m_type and f_replace and F_REACTION_REV in f_replace:
+ mid = f_replace[F_REACTION_REV](mid)
+ if "Metabolite" in m_type and f_replace and F_SPECIE_REV in f_replace:
+ mid = f_replace[F_SPECIE_REV](mid)
+ if "Gene" in m_type and f_replace and F_GENE_REV in f_replace:
+ mid = f_replace[F_GENE_REV](mid)
member.setIdRef(mid)
if cobra_member.name and len(cobra_member.name) > 0:
@@ -1733,21 +1648,21 @@ def _sbase_notes_dict(sbase: libsbml.SBase, notes: dict) -> None:
URL_IDENTIFIERS_PATTERN = re.compile(r"^https?://identifiers.org/(.+?)[:/](.+)")
URL_IDENTIFIERS_PREFIX = "https://identifiers.org"
-QUALIFIER_TYPES = {
- "is": libsbml.BQB_IS,
- "hasPart": libsbml.BQB_HAS_PART,
- "isPartOf": libsbml.BQB_IS_PART_OF,
- "isVersionOf": libsbml.BQB_IS_VERSION_OF,
- "hasVersion": libsbml.BQB_HAS_VERSION,
- "isHomologTo": libsbml.BQB_IS_HOMOLOG_TO,
- "isDescribedBy": libsbml.BQB_IS_DESCRIBED_BY,
- "isEncodedBy": libsbml.BQB_IS_ENCODED_BY,
- "encodes": libsbml.BQB_ENCODES,
- "occursIn": libsbml.BQB_OCCURS_IN,
- "hasProperty": libsbml.BQB_HAS_PROPERTY,
- "isPropertyOf": libsbml.BQB_IS_PROPERTY_OF,
- "hasTaxon": libsbml.BQB_HAS_TAXON,
- "unknown": libsbml.BQB_UNKNOWN,
+QUALIFIER_TYPES_COBRA_SBML_DICT = {
+ "bqb_is": libsbml.BQB_IS,
+ "bqb_hasPart": libsbml.BQB_HAS_PART,
+ "bqb_isPartOf": libsbml.BQB_IS_PART_OF,
+ "bqb_isVersionOf": libsbml.BQB_IS_VERSION_OF,
+ "bqb_hasVersion": libsbml.BQB_HAS_VERSION,
+ "bqb_isHomologTo": libsbml.BQB_IS_HOMOLOG_TO,
+ "bqb_isDescribedBy": libsbml.BQB_IS_DESCRIBED_BY,
+ "bqb_isEncodedBy": libsbml.BQB_IS_ENCODED_BY,
+ "bqb_encodes": libsbml.BQB_ENCODES,
+ "bqb_occursIn": libsbml.BQB_OCCURS_IN,
+ "bqb_hasProperty": libsbml.BQB_HAS_PROPERTY,
+ "bqb_isPropertyOf": libsbml.BQB_IS_PROPERTY_OF,
+ "bqb_hasTaxon": libsbml.BQB_HAS_TAXON,
+ "bqb_unknown": libsbml.BQB_UNKNOWN,
"bqm_is": libsbml.BQM_IS,
"bqm_isDescribedBy": libsbml.BQM_IS_DESCRIBED_BY,
"bqm_isDerivedFrom": libsbml.BQM_IS_DERIVED_FROM,
@@ -1755,12 +1670,33 @@ def _sbase_notes_dict(sbase: libsbml.SBase, notes: dict) -> None:
"bqm_hasInstance": libsbml.BQM_HAS_INSTANCE,
"bqm_unknown": libsbml.BQM_UNKNOWN,
}
+BIOLOGY_QUALIFIER_TYPES_TO_COBRA_DICT = {
+ value: key
+ for key, value in QUALIFIER_TYPES_COBRA_SBML_DICT.items()
+ if re.match("bqb", key)
+}
+MODEL_QUALIFIER_TYPES_TO_COBRA_DICT = {
+ value: key
+ for key, value in QUALIFIER_TYPES_COBRA_SBML_DICT.items()
+ if re.match("bqm", key)
+}
-def _parse_annotations(sbase: libsbml.SBase) -> dict:
+def _parse_annotations(sbase: libsbml.SBase) -> MetaData:
"""Parse cobra annotations from a given SBase object.
- Annotations are dictionaries with the providers as keys.
+ The annotation format has been changed. We no longer have
+ simple dictionaries for storing annotation data. Dedicated
+ classes for storing CVTerm data, History data and key-value
+ pair data corresponding to an SBase object have been made.
+ The metadata classes inside cobra.core directory contains
+ of them. All the existing issues in old annotation format have
+ been solved. The new format annotation is completely backward
+ compatible. It can read models with old annotation format,
+ can convert old format annotation to new format annotation,
+ and writes annotation in new format only (for JSON and other
+ formats). The JSON schema v2 specifies the new format annotation
+ whereas JSON schema v1 have annotation data defined in old format.
Parameters
----------
@@ -1769,15 +1705,13 @@ def _parse_annotations(sbase: libsbml.SBase) -> dict:
Returns
-------
- dict (annotation dictionary)
+ MetaData
+ a metadata object storing COBRA annotation
"""
- # FIXME: annotation format must be updated (this is a big collection of
- # fixes) - see: https://github.com/opencobra/cobrapy/issues/684)
- annotation = {}
+ annotation = MetaData()
# SBO term
if sbase.isSetSBOTerm():
- # FIXME: correct handling of annotations
annotation["sbo"] = sbase.getSBOTermID()
# RDF annotation
@@ -1785,27 +1719,76 @@ def _parse_annotations(sbase: libsbml.SBase) -> dict:
if cvterms is None:
return annotation
- cvterm: "libsbml.CVTerm"
- for cvterm in cvterms:
- for k in range(cvterm.getNumResources()):
- # FIXME: read and store the qualifier
+ def _cvterm_to_cobra(_cvterm: "libsbml.CVTerm") -> Optional[CVTerm]:
+ """Parse the libsbml.CVTerm object to cobra CVTerm.
- uri = cvterm.getResourceURI(k)
- data = _parse_annotation_info(uri)
- if data is None:
- continue
- else:
- provider, identifier = data
-
- if provider in annotation:
- if isinstance(annotation[provider], str):
- annotation[provider] = [annotation[provider]]
- # FIXME: use a list
- if identifier not in annotation[provider]:
- annotation[provider].append(identifier)
- else:
- # FIXME: always in list
- annotation[provider] = identifier
+ Parameters
+ ----------
+ _cvterm : libsbml.CVTerm
+ The libsbml.CVTerm object from which data is to be parsed.
+
+ Returns
+ -------
+ CVTerm or None
+ The parsed data of the given libsbml.CVTerm object as CVTerm.
+ If the qualifier is unknown, this function will return None.
+ """
+ qualifier_type = _cvterm.getQualifierType()
+ if qualifier_type == libsbml.BIOLOGICAL_QUALIFIER:
+ qualifier = BIOLOGY_QUALIFIER_TYPES_TO_COBRA_DICT[
+ _cvterm.getBiologicalQualifierType()
+ ]
+ elif qualifier_type == libsbml.MODEL_QUALIFIER:
+ qualifier = MODEL_QUALIFIER_TYPES_TO_COBRA_DICT[
+ _cvterm.getModelQualifierType()
+ ]
+ else:
+ LOGGER.warning(f"The cvterm {_cvterm} has an unkown qualifier. Ignoring it")
+ return None
+ ext_res = {
+ "resources": [
+ _cvterm.getResourceURI(k) for k in range(_cvterm.getNumResources())
+ ]
+ }
+
+ nested_cv_terms = [
+ _cvterm.getNestedCVTerm(index)
+ for index in range(_cvterm.getNumNestedCVTerms())
+ ]
+ # This kludge is necessary since _cvterm.getListNestedCVTerms() doesn't give a
+ # python list, but a Swig List_t * and then SwigPyObject is not iterable
+ ext_res["nested_data"] = CVTermList(
+ [
+ _cvterm_to_cobra(_nested_cvterm)
+ for _nested_cvterm in nested_cv_terms
+ if _nested_cvterm
+ ]
+ )
+ return CVTerm(ExternalResources.from_dict(ext_res), qualifier)
+
+ annotation.add_cvterms([_cvterm_to_cobra(cvterm) for cvterm in cvterms if cvterm])
+
+ # history of the component
+ if sbase.isSetModelHistory():
+ model_history: "libsbml.ModelHistory" = sbase.getModelHistory()
+
+ annotation.history.creators = [
+ Creator(
+ creator.getGivenName() or None,
+ creator.getFamilyName() or None,
+ creator.getEmail() or None,
+ creator.getOrganisation() or None,
+ )
+ for creator in model_history.getListCreators()
+ ]
+
+ if model_history.isSetCreatedDate():
+ date: libsbml.Date = model_history.getCreatedDate()
+ annotation.history.created_date = date.getDateAsString()
+
+ annotation.history.modified_dates = [
+ _date.getDateAsString() for _date in model_history.getListModifiedDates()
+ ]
return annotation
@@ -1821,7 +1804,15 @@ def _parse_annotation_info(uri: str) -> Union[None, Tuple[str, str]]:
Returns
-------
(provider, identifier) if resolvable, None otherwise
+
+ .. deprecated ::
+ Use cobra.core.metadata.helper.parse_identifiers_uri()
"""
+ warn(
+ "_parse_annotation_info() is being replaced by "
+ "cobra.core.metadata.helper.parse_identifiers_uri()",
+ DeprecationWarning,
+ )
match = URL_IDENTIFIERS_PATTERN.match(uri)
if match:
provider, identifier = match.group(1), match.group(2)
@@ -1839,7 +1830,53 @@ def _parse_annotation_info(uri: str) -> Union[None, Tuple[str, str]]:
return provider, identifier
-def _sbase_annotations(sbase: libsbml.SBase, annotation: dict) -> None:
+def _cvterms_to_sbml(cvterms: CVTermList) -> List["libsbml.CVTerm"]:
+ """Convert cobra CVTerms to libsbml.CVTerm list.
+
+ Parameters
+ ----------
+ cvterms: CVTermList
+ cobra CVTerms object
+
+ Returns
+ -------
+ list
+ List of libsbml.cvTerm objects
+ """
+ cv_list = []
+ for cvterm in cvterms:
+ qualifier = cvterm.qualifier
+ if qualifier.name.startswith("bqb"):
+ qualifier_type = libsbml.BIOLOGICAL_QUALIFIER
+ elif qualifier.name.startswith("bqm"):
+ qualifier_type = libsbml.MODEL_QUALIFIER
+ else:
+ raise CobraSBMLError(f"Unsupported qualifier: {qualifier}")
+
+ cv: "libsbml.CVTerm" = libsbml.CVTerm()
+ cv.setQualifierType(qualifier_type)
+ if qualifier_type == libsbml.BIOLOGICAL_QUALIFIER:
+ cv.setBiologicalQualifierType(
+ QUALIFIER_TYPES_COBRA_SBML_DICT[qualifier.name]
+ )
+ elif qualifier_type == libsbml.MODEL_QUALIFIER:
+ cv.setModelQualifierType(QUALIFIER_TYPES_COBRA_SBML_DICT[qualifier.name])
+ else:
+ raise CobraSBMLError(f"Unsupported qualifier: {qualifier}")
+ for uri in sorted(cvterm.external_resources.resources):
+ cv.addResource(uri)
+
+ [
+ _check(cv.addNestedCVTerm(_cv), f"Adding nested cvterm: {_cv}")
+ for _cv in _cvterms_to_sbml(cvterm.external_resources.nested_data)
+ ]
+
+ cv_list.append(cv)
+
+ return cv_list
+
+
+def _sbase_annotations(sbase: libsbml.SBase, annotation: MetaData) -> None:
"""Set SBase annotations based on cobra annotations.
Parameters
@@ -1853,73 +1890,78 @@ def _sbase_annotations(sbase: libsbml.SBase, annotation: dict) -> None:
------
CobraSBMLError for unsupported qualifier
"""
- # FIXME: annotation format must be updated
- # (https://github.com/opencobra/cobrapy/issues/684)
- if not annotation or len(annotation) == 0:
- return
-
- # standardize annotations
annotation_data = deepcopy(annotation)
- for key, value in annotation_data.items():
- # handling of non-string annotations (e.g. integers)
- if isinstance(value, (float, int)):
- value = str(value)
- if isinstance(value, str):
- annotation_data[key] = [("is", value)]
+ if not isinstance(annotation_data, MetaData):
+ raise TypeError(
+ f"The annotation object must be of type 'Metadata': {annotation_data}"
+ )
+
+ if "SBO" in annotation_data:
+ LOGGER.warning(
+ "'SBO' provider is deprecated, use 'sbo' provider instead. Converting to"
+ "'sbo' for writing."
+ )
+ annotation_data["sbo"] = annotation_data.pop("SBO")
- for _key, value in annotation_data.items():
- for idx, item in enumerate(value):
- if isinstance(item, str):
- value[idx] = ("is", item)
+ if "sbo" in annotation and annotation.sbo:
+ sbo_term = annotation_data.sbo
+ if isinstance(sbo_term, list):
+ sbo_term = sbo_term[0]
+ _check(sbase.setSBOTerm(sbo_term), f"Setting SBOTerm: {sbo_term}")
# set metaId
meta_id = f"meta_{sbase.getId()}"
sbase.setMetaId(meta_id)
- # rdf_items = []
- for provider, data in annotation_data.items():
+ # set standardized
+ [
+ # Question for @matthiaskoenig - should I be using createCVTerms?
+ _check(sbase.addCVTerm(cv, newBag=True), f"Setting cvterm: {cv}")
+ for cv in _cvterms_to_sbml(annotation.standardized)
+ ]
+
+ # set history
+ if not annotation.history.is_empty():
+ comp_history = libsbml.ModelHistory()
+
+ for creator in annotation.history.creators:
+ comp_creator = libsbml.ModelCreator()
+ comp_creator.setGivenName(creator.given_name)
+ comp_creator.setFamilyName(creator.family_name)
+ creator.email and comp_creator.setEmail(creator.email)
+ creator.organisation and comp_creator.setOrganisation(creator.organisation)
+ _check(
+ comp_history.addCreator(comp_creator),
+ f"adding creator to {sbase.getId}.",
+ )
- # set SBOTerm
- if provider in ["SBO", "sbo"]:
- if provider == "SBO":
- LOGGER.warning(
- "'SBO' provider is deprecated, use 'sbo' provider instead"
- )
- sbo_term = data[0][1]
- _check(sbase.setSBOTerm(sbo_term), f"Setting SBOTerm: {sbo_term}")
-
- # FIXME: sbo should also be written as CVTerm
- continue
-
- for item in data:
- qualifier_str, entity = item[0], item[1]
- qualifier = QUALIFIER_TYPES.get(qualifier_str, None)
- if qualifier is None:
- qualifier = libsbml.BQB_IS
- LOGGER.error(
- f"Qualifier type is not supported on annotation: '{qualifier_str}'"
- )
+ if annotation.history.created_date:
+ date = libsbml.Date(
+ annotation.history.created_date.strftime(STRTIME_FORMAT)
+ )
+ _check(
+ comp_history.setCreatedDate(date), f"set creation date for {sbase.id}"
+ )
+ elif isinstance(sbase, libsbml.SBMLDocument):
+ time = datetime.datetime.now()
+ timestr = time.strftime(STRTIME_FORMAT)
+ date = libsbml.Date(timestr)
+ _check(comp_history.setCreatedDate(date), "set creation date for document")
- qualifier_type = libsbml.BIOLOGICAL_QUALIFIER
- if qualifier_str.startswith("bqm_"):
- qualifier_type = libsbml.MODEL_QUALIFIER
-
- cv: "libsbml.CVTerm" = libsbml.CVTerm()
- cv.setQualifierType(qualifier_type)
- if qualifier_type == libsbml.BIOLOGICAL_QUALIFIER:
- cv.setBiologicalQualifierType(qualifier)
- elif qualifier_type == libsbml.MODEL_QUALIFIER:
- cv.setModelQualifierType(qualifier)
- else:
- raise CobraSBMLError(f"Unsupported qualifier: {qualifier}")
- resource = f"{URL_IDENTIFIERS_PREFIX}/{provider}/{entity}"
- cv.addResource(resource)
+ for modified_date in annotation.history.modified_dates:
+ date = libsbml.Date(modified_date.strftime(STRTIME_FORMAT))
_check(
- sbase.addCVTerm(cv),
- f"Setting cvterm: {cv}, resource: {resource}",
+ comp_history.addModifiedDate(date),
+ f"add modification date for {sbase.id}",
)
+ # finally add the compo_history
+ _check(
+ sbase.setModelHistory(comp_history),
+ f"Setting ModelHistory: {comp_history}",
+ )
+
# -----------------------------------------------------------------------------
# Validation
@@ -1965,17 +2007,30 @@ def validate_sbml_model(
from the libsbml validator. COBRA_* types are from the cobrapy SBML
parser.
"""
- keys = (
- "SBML_FATAL",
- "SBML_ERROR",
- "SBML_SCHEMA_ERROR",
- "SBML_WARNING",
- "COBRA_FATAL",
- "COBRA_ERROR",
- "COBRA_WARNING",
- "COBRA_CHECK",
- )
- errors = {key: [] for key in keys}
+ cobra_sbml_error_dict = {
+ "SBML_FATAL": libsbml.LIBSBML_SEV_FATAL,
+ "SBML_ERROR": libsbml.LIBSBML_SEV_ERROR,
+ "SBML_SCHEMA_ERROR": libsbml.LIBSBML_SEV_SCHEMA_ERROR,
+ "SBML_WARNING": libsbml.LIBSBML_SEV_WARNING,
+ "COBRA_FATAL": None,
+ "COBRA_ERROR": None,
+ "COBRA_WARNING": None,
+ "COBRA_CHECK": None,
+ }
+ sbml_severity_dict = {
+ value: key for key, value in cobra_sbml_error_dict.items() if value
+ }
+ errors = {key: [] for key in cobra_sbml_error_dict.keys()}
+ sbml_log_dict = {
+ "SBML_FATAL": "SBML errors",
+ "SBML_ERROR": "SBML errors",
+ "SBML_SCHEMA_ERROR": "SBML errors",
+ "SBML_WARNING": "SBML warnings",
+ "COBRA_FATAL": "COBRA errors",
+ "COBRA_ERROR": "COBRA errors",
+ "COBRA_WARNING": "COBRA warnings",
+ "COBRA_CHECK": "COBRA warnings",
+ }
# [1] libsbml validation
doc: "libsbml.SBMLDocument" = _get_doc_from_filename(filename)
@@ -1997,14 +2052,7 @@ def validate_sbml_model(
e: "libsbml.SBMLError" = doc.getError(k)
msg = _error_string(e, k=k)
sev = e.getSeverity()
- if sev == libsbml.LIBSBML_SEV_FATAL:
- errors["SBML_FATAL"].append(msg)
- elif sev == libsbml.LIBSBML_SEV_ERROR:
- errors["SBML_ERROR"].append(msg)
- elif sev == libsbml.LIBSBML_SEV_SCHEMA_ERROR:
- errors["SBML_SCHEMA_ERROR"].append(msg)
- elif sev == libsbml.LIBSBML_SEV_WARNING:
- errors["SBML_WARNING"].append(msg)
+ errors[sbml_severity_dict[sev]].append(msg)
# [2] cobrapy validation (check that SBML can be read into model)
# all warnings generated while loading will be logged as errors
@@ -2021,10 +2069,10 @@ def validate_sbml_model(
model = _sbml_to_model(doc, **kwargs)
except CobraSBMLError as e:
errors["COBRA_ERROR"].append(str(e))
- return None, errors
+ model = None # If we return, we won't get to the errors["COBRA_ERROR"]
except Exception as e:
errors["COBRA_FATAL"].append(str(e))
- return None, errors
+ model = None
cobra_errors = log_stream.getvalue().split("\n")
for cobra_error in cobra_errors:
@@ -2045,21 +2093,11 @@ def validate_sbml_model(
if check_model:
errors["COBRA_CHECK"].extend(check_metabolite_compartment_formula(model))
- for key in ["SBML_FATAL", "SBML_ERROR", "SBML_SCHEMA_ERROR"]:
- if len(errors[key]) > 0:
- LOGGER.error("SBML errors in validation, check error log for details.")
- break
- for key in ["SBML_WARNING"]:
+ for key in sbml_log_dict.keys():
if len(errors[key]) > 0:
- LOGGER.error("SBML warnings in validation, check error log for details.")
- break
- for key in ["COBRA_FATAL", "COBRA_ERROR"]:
- if len(errors[key]) > 0:
- LOGGER.error("COBRA errors in validation, check error log for details.")
- break
- for key in ["COBRA_WARNING", "COBRA_CHECK"]:
- if len(errors[key]) > 0:
- LOGGER.error("COBRA warnings in validation, check error log for details.")
+ LOGGER.error(
+ f"{sbml_log_dict[key]} in validation, check error log for details."
+ )
break
return model, errors
diff --git a/src/cobra/io/schema_v1.json b/src/cobra/io/schema_v1.json
index edc9756fb..8fd7cb0a4 100644
--- a/src/cobra/io/schema_v1.json
+++ b/src/cobra/io/schema_v1.json
@@ -153,5 +153,5 @@
"metabolites",
"genes"
],
- "additionalProperties": false
+ "additionalProperties": true
}
diff --git a/src/cobra/io/schema_v2.json b/src/cobra/io/schema_v2.json
new file mode 100644
index 000000000..2aaadfbe9
--- /dev/null
+++ b/src/cobra/io/schema_v2.json
@@ -0,0 +1,370 @@
+{
+ "$schema": "http://json-schema.org/draft-04/schema#",
+ "title": "COBRA",
+ "description": "JSON representation of COBRA model",
+ "definitions": {
+ "annotation": {
+ "type": "object",
+ "properties": {
+ "sbo": {
+ "type": "string"
+ },
+ "cvterms": {
+ "type": "object",
+ "additionalProperties": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "resources": {
+ "type": "array",
+ "items": {
+ "type": "string"
+ }
+ },
+ "nested_data": {
+ "$ref": "#/definitions/annotation"
+ }
+ }
+ }
+ }
+ },
+ "history": {
+ "type": "object",
+ "properties": {
+ "creators": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "email": {
+ "type": "string"
+ },
+ "given_name": {
+ "type": "string"
+ },
+ "family_name": {
+ "type": "string"
+ },
+ "organisation": {
+ "type": "string"
+ }
+ },
+ "required": [
+ "given_name",
+ "family_name"
+ ],
+ "additionalProperties": false
+ }
+ },
+ "created_date": {
+ "type": "string",
+ "format": "date-time"
+ },
+ "modified_dates": {
+ "type": "array",
+ "items": {
+ "type": "string",
+ "format": "date-time"
+ }
+ }
+ },
+ "required": [
+ "creators",
+ "created_date",
+ "modified_dates"
+ ],
+ "additionalProperties": false
+ },
+ "listofkeyvalue": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "id": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "name": {
+ "type": "string"
+ },
+ "key": {
+ "type": "string"
+ },
+ "value": {
+ "type": "string"
+ },
+ "uri": {
+ "type": "string"
+ }
+ },
+ "required": [
+ "key"
+ ],
+ "additionalProperties": false
+ }
+ }
+ }
+ }
+ },
+ "type": "object",
+ "properties": {
+ "id": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "name": {
+ "type": "string"
+ },
+ "version": {
+ "type": "string",
+ "default": "1"
+ },
+ "reactions": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "id": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "name": {
+ "type": "string"
+ },
+ "metabolites": {
+ "type": "object",
+ "patternProperties": {
+ ".*": {
+ "type": "number"
+ }
+ }
+ },
+ "gene_reaction_rule": {
+ "type": "string"
+ },
+ "lower_bound": {
+ "type": "number"
+ },
+ "upper_bound": {
+ "type": "number"
+ },
+ "objective_coefficient": {
+ "type": "number",
+ "default": 0
+ },
+ "subsystem": {
+ "type": "string"
+ },
+ "notes": {
+ "type": "string"
+ },
+ "annotation": {
+ "$ref": "#/definitions/annotation"
+ }
+ },
+ "required": [
+ "id",
+ "name",
+ "metabolites",
+ "lower_bound",
+ "upper_bound",
+ "gene_reaction_rule"
+ ],
+ "additionalProperties": false
+ }
+ },
+ "metabolites": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "id": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "name": {
+ "type": "string"
+ },
+ "compartment": {
+ "type": "string",
+ "pattern": "[a-z]{1,2}"
+ },
+ "charge": {
+ "type": "integer"
+ },
+ "formula": {
+ "type": "string"
+ },
+ "_bound": {
+ "type": "number",
+ "default": 0
+ },
+ "notes": {
+ "type": "string"
+ },
+ "annotation": {
+ "$ref": "#/definitions/annotation"
+ }
+ },
+ "required": [
+ "id",
+ "name",
+ "compartment"
+ ],
+ "additionalProperties": false
+ }
+ },
+ "genes": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "id": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "name": {
+ "type": "string"
+ },
+ "notes": {
+ "type": "string"
+ },
+ "annotation": {
+ "$ref": "#/definitions/annotation"
+ }
+ },
+ "required": [
+ "id",
+ "name"
+ ],
+ "additionalProperties": false
+ }
+ },
+ "compartments": {
+ "type": "object",
+ "patternProperties": {
+ "[a-z]{1,2}": {
+ "type": "string"
+ }
+ }
+ },
+ "groups": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "id": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "name": {
+ "type": "string"
+ },
+ "notes": {
+ "type": "string"
+ },
+ "annotation": {
+ "$ref": "#/definitions/annotation"
+ },
+ "kind": {
+ "type": "string",
+ "enum": ["collection", "classification", "partonomy"]
+ },
+ "members": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "idRef": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "type": {
+ "type": "string"
+ }
+ },
+ "required": ["idRef", "type"]
+ }
+ }
+ },
+ "required": ["kind", "members"]
+ }
+ },
+ "user_defined_constraints": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "id": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "name": {
+ "type": "string"
+ },
+ "lower_bound": {
+ "type": "number"
+ },
+ "upper_bound": {
+ "type": "number"
+ },
+ "constraint_comps": {
+ "type": "array",
+ "items": {
+ "type": "object",
+ "properties": {
+ "id": {
+ "type": "string",
+ "pattern": "^[a-zA-Z|_][a-zA-Z0-9_]*$"
+ },
+ "name": {
+ "type": "string"
+ },
+ "coefficient": {
+ "type": "number"
+ },
+ "variable": {
+ "type": "string"
+ },
+ "variable_type": {
+ "type": "string",
+ "enum": ["linear", "quadratic"]
+ },
+ "notes": {
+ "type": "string"
+ },
+ "annotation": {
+ "$ref": "#/definitions/annotation"
+ }
+ },
+ "required": ["variable"],
+ "additionalProperties": false
+ }
+ },
+ "notes": {
+ "type": "string"
+ },
+ "annotation": {
+ "$ref": "#/definitions/annotation"
+ }
+ },
+ "required": ["lower_bound", "upper_bound", "constraint_comps"],
+ "additionalProperties": false
+ }
+ },
+ "notes": {
+ "type": "string"
+ },
+ "annotation": {
+ "$ref": "#/definitions/annotation"
+ }
+ },
+ "required": [
+ "id",
+ "reactions",
+ "metabolites",
+ "genes"
+ ],
+ "additionalProperties": true
+}
diff --git a/src/cobra/manipulation/annotate.py b/src/cobra/manipulation/annotate.py
index 6f989dd2a..9bad70d41 100644
--- a/src/cobra/manipulation/annotate.py
+++ b/src/cobra/manipulation/annotate.py
@@ -22,15 +22,18 @@ def add_SBO(model: "Model") -> None:
The model whose demand and exchange reactions need to be annotated.
"""
+ # ??? Should this be done with boundary?
for r in model.reactions:
# don't annotate already annotated reactions
- if r.annotation.get("sbo"):
+ if len(r.annotation.get("sbo")) != 0 and r.annotation.sbo:
continue
# only doing exchanges
if len(r.metabolites) != 1:
continue
met_id = list(r._metabolites)[0].id
if r.id.startswith("EX_") and r.id == "EX_" + met_id:
- r.annotation["sbo"] = "SBO:0000627"
+ r.annotation["sbo"] = ["SBO:0000627"]
elif r.id.startswith("DM_") and r.id == "DM_" + met_id:
- r.annotation["sbo"] = "SBO:0000628"
+ r.annotation["sbo"] = ["SBO:0000628"]
+ elif r.id.startswith("SK_") and r.id == "SK_" + met_id:
+ r.annotation["sbo"] = ["SBO:0000632"]
diff --git a/src/cobra/manipulation/validate.py b/src/cobra/manipulation/validate.py
index 344a05437..34c821690 100644
--- a/src/cobra/manipulation/validate.py
+++ b/src/cobra/manipulation/validate.py
@@ -33,7 +33,7 @@ def check_mass_balance(model: "Model") -> Dict["Reaction", Dict["Metabolite", fl
"""
unbalanced = {}
for reaction in model.reactions:
- if reaction.annotation.get("sbo") not in _NOT_MASS_BALANCED_TERMS:
+ if set(reaction.annotation.get("sbo", [])).isdisjoint(_NOT_MASS_BALANCED_TERMS):
balance = reaction.check_mass_balance()
if balance:
unbalanced[reaction] = balance
diff --git a/src/cobra/medium/boundary_types.py b/src/cobra/medium/boundary_types.py
index 0229b4bb4..2b327d82a 100644
--- a/src/cobra/medium/boundary_types.py
+++ b/src/cobra/medium/boundary_types.py
@@ -125,9 +125,9 @@ def is_boundary_type(
"""
# Check if the reaction has an annotation. Annotations dominate everything.
sbo_term = reaction.annotation.get("sbo", "")
- if isinstance(sbo_term, list):
+ if isinstance(sbo_term, list) and len(sbo_term) != 0:
sbo_term = sbo_term[0]
- sbo_term = sbo_term.upper()
+ sbo_term = sbo_term.upper()
if sbo_term == sbo_terms[boundary_type]:
return True
diff --git a/tests/conftest.py b/tests/conftest.py
index 0833f6d55..06792bba0 100644
--- a/tests/conftest.py
+++ b/tests/conftest.py
@@ -20,7 +20,7 @@ def create_test_model(model_name: str = "salmonella") -> Model:
Parameters
----------
model_name: str
- One of 'ecoli', 'textbook', or 'salmonella', or the
+ One of 'ecoli', 'textbook', or 'salmonella', 'ecoli_annotation' or the
path to a pickled cobra.Model .
Returns
@@ -43,6 +43,9 @@ def create_test_model(model_name: str = "salmonella") -> Model:
elif model_name == "mini":
mini_sbml = str((data_dir / "mini_fbc2.xml").resolve())
return read_sbml_model(mini_sbml)
+ elif model_name == "ecoli_annotation":
+ ecoli_annotation_sbml = str((data_dir / "e_coli_core_for_annotation.xml").resolve())
+ return read_sbml_model(ecoli_annotation_sbml)
elif model_name == "salmonella":
salmonella_pickle = str((data_dir / "salmonella.pickle").resolve())
model_name = salmonella_pickle
@@ -104,6 +107,18 @@ def salmonella(medium_model: Model) -> Model:
return medium_model.copy()
+@pytest.fixture(scope="session")
+def ecoli_annotation_model() -> Model:
+ """Provide session-level fixture for ecoli_annotation model."""
+ return create_test_model("ecoli_annotation")
+
+
+@pytest.fixture(scope="function")
+def annotation_model(ecoli_annotation_model: Model) -> Model:
+ """Provide function-level fixture for ecoli_annotation model."""
+ return ecoli_annotation_model.copy()
+
+
@pytest.fixture(scope="function")
def solved_model(data_directory: Path) -> Tuple[Solution, Model]:
"""Provide function-level fixture for solved textbook model."""
diff --git a/tests/data/cvterms_nested.json b/tests/data/cvterms_nested.json
new file mode 100644
index 000000000..e6f169c78
--- /dev/null
+++ b/tests/data/cvterms_nested.json
@@ -0,0 +1,33 @@
+[
+ {
+ "external_resources": {
+ "resources": [
+ "https://identifiers.org/uniprot/P69905",
+ "https://identifiers.org/uniprot/P68871",
+ "https://identifiers.org/kegg.compound/C00032"
+ ]
+ },
+ "qualifier": "bqb_hasPart"
+ },
+ {
+ "qualifier": "bqb_hasPart",
+ "external_resources": {
+ "resources": [
+ "https://identifiers.org/uniprot/P69905",
+ "https://www.uniprot.org/uniprot/P68871",
+ "https://identifiers.org/chebi/CHEBI:17627"
+ ],
+ "nested_data": [
+ {
+ "qualifier": "bqb_isDescribedBy",
+ "external_resources": {
+ "resources": [
+ "https://identifiers.org/pubmed/1111111",
+ "https://identifiers.org/eco/000000"
+ ]
+ }
+ }
+ ]
+ }
+ }
+]
diff --git a/tests/data/e_coli_core.json b/tests/data/e_coli_core.json
new file mode 100644
index 000000000..39db77321
--- /dev/null
+++ b/tests/data/e_coli_core.json
@@ -0,0 +1,14786 @@
+{
+"metabolites":[
+{
+"id":"glc__D_e",
+"name":"D-Glucose",
+"compartment":"e",
+"charge":0,
+"formula":"C6H12O6",
+"notes":{
+"original_bigg_ids":[
+"glc_D_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"glc__D"
+],
+"biocyc":[
+"META:Glucopyranose"
+],
+"chebi":[
+"CHEBI:12965",
+"CHEBI:20999",
+"CHEBI:4167",
+"CHEBI:17634"
+],
+"hmdb":[
+"HMDB00122",
+"HMDB06564"
+],
+"inchi_key":[
+"WQZGKKKJIJFFOK-GASJEMHNSA-N"
+],
+"kegg.compound":[
+"C00031"
+],
+"kegg.drug":[
+"D00009"
+],
+"metanetx.chemical":[
+"MNXM41"
+],
+"sabiork":[
+"1406",
+"1407"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd26821",
+"cpd00027"
+]
+}
+},
+{
+"id":"gln__L_c",
+"name":"L-Glutamine",
+"compartment":"c",
+"charge":0,
+"formula":"C5H10N2O3",
+"notes":{
+"original_bigg_ids":[
+"gln_L_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"gln__L"
+],
+"biocyc":[
+"META:GLN"
+],
+"chebi":[
+"CHEBI:42943",
+"CHEBI:42899",
+"CHEBI:32679",
+"CHEBI:32678",
+"CHEBI:58359",
+"CHEBI:28300",
+"CHEBI:42812",
+"CHEBI:13110",
+"CHEBI:18050",
+"CHEBI:32666",
+"CHEBI:6227",
+"CHEBI:32665",
+"CHEBI:21308",
+"CHEBI:42814",
+"CHEBI:5432",
+"CHEBI:24316"
+],
+"hmdb":[
+"HMDB00641"
+],
+"inchi_key":[
+"ZDXPYRJPNDTMRX-VKHMYHEASA-N"
+],
+"kegg.compound":[
+"C00064",
+"C00303"
+],
+"kegg.drug":[
+"D00015"
+],
+"metanetx.chemical":[
+"MNXM37"
+],
+"reactome.compound":[
+"113522",
+"212615",
+"29472"
+],
+"sabiork":[
+"2011",
+"74"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00253",
+"cpd00053"
+]
+}
+},
+{
+"id":"gln__L_e",
+"name":"L-Glutamine",
+"compartment":"e",
+"charge":0,
+"formula":"C5H10N2O3",
+"notes":{
+"original_bigg_ids":[
+"gln_L_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"gln__L"
+],
+"biocyc":[
+"META:GLN"
+],
+"chebi":[
+"CHEBI:42943",
+"CHEBI:42899",
+"CHEBI:32679",
+"CHEBI:32678",
+"CHEBI:58359",
+"CHEBI:28300",
+"CHEBI:42812",
+"CHEBI:13110",
+"CHEBI:18050",
+"CHEBI:32666",
+"CHEBI:6227",
+"CHEBI:32665",
+"CHEBI:21308",
+"CHEBI:42814",
+"CHEBI:5432",
+"CHEBI:24316"
+],
+"hmdb":[
+"HMDB00641"
+],
+"inchi_key":[
+"ZDXPYRJPNDTMRX-VKHMYHEASA-N"
+],
+"kegg.compound":[
+"C00064",
+"C00303"
+],
+"kegg.drug":[
+"D00015"
+],
+"metanetx.chemical":[
+"MNXM37"
+],
+"reactome.compound":[
+"113522",
+"212615",
+"29472"
+],
+"sabiork":[
+"2011",
+"74"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00253",
+"cpd00053"
+]
+}
+},
+{
+"id":"glu__L_c",
+"name":"L-Glutamate",
+"compartment":"c",
+"charge":-1,
+"formula":"C5H8NO4",
+"notes":{
+"original_bigg_ids":[
+"glu_L_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"glu__L"
+],
+"biocyc":[
+"META:Glutamates",
+"META:GLT"
+],
+"chebi":[
+"CHEBI:76051",
+"CHEBI:21301",
+"CHEBI:29985",
+"CHEBI:42825",
+"CHEBI:29987",
+"CHEBI:18237",
+"CHEBI:24314",
+"CHEBI:16015",
+"CHEBI:13107",
+"CHEBI:5431",
+"CHEBI:21304",
+"CHEBI:6224",
+"CHEBI:14321",
+"CHEBI:29988"
+],
+"hmdb":[
+"HMDB00148",
+"HMDB60475"
+],
+"inchi_key":[
+"WHUUTDBJXJRKMK-VKHMYHEASA-M"
+],
+"kegg.compound":[
+"C00025",
+"C00302"
+],
+"kegg.drug":[
+"D00007",
+"D04341"
+],
+"metanetx.chemical":[
+"MNXM89557"
+],
+"reactome.compound":[
+"428614",
+"29404",
+"113552",
+"210382"
+],
+"sabiork":[
+"73",
+"2010"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd27177",
+"cpd00023",
+"cpd19002"
+]
+}
+},
+{
+"id":"glu__L_e",
+"name":"L-Glutamate",
+"compartment":"e",
+"charge":-1,
+"formula":"C5H8NO4",
+"notes":{
+"original_bigg_ids":[
+"glu_L_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"glu__L"
+],
+"biocyc":[
+"META:Glutamates",
+"META:GLT"
+],
+"chebi":[
+"CHEBI:76051",
+"CHEBI:21301",
+"CHEBI:29985",
+"CHEBI:42825",
+"CHEBI:29987",
+"CHEBI:18237",
+"CHEBI:24314",
+"CHEBI:16015",
+"CHEBI:13107",
+"CHEBI:5431",
+"CHEBI:21304",
+"CHEBI:6224",
+"CHEBI:14321",
+"CHEBI:29988"
+],
+"hmdb":[
+"HMDB00148",
+"HMDB60475"
+],
+"inchi_key":[
+"WHUUTDBJXJRKMK-VKHMYHEASA-M"
+],
+"kegg.compound":[
+"C00025",
+"C00302"
+],
+"kegg.drug":[
+"D00007",
+"D04341"
+],
+"metanetx.chemical":[
+"MNXM89557"
+],
+"reactome.compound":[
+"428614",
+"29404",
+"113552",
+"210382"
+],
+"sabiork":[
+"73",
+"2010"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd27177",
+"cpd00023",
+"cpd19002"
+]
+}
+},
+{
+"id":"glx_c",
+"name":"Glyoxylate",
+"compartment":"c",
+"charge":-1,
+"formula":"C2H1O3",
+"notes":{
+"original_bigg_ids":[
+"glx_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"glx"
+],
+"biocyc":[
+"META:GLYOX"
+],
+"chebi":[
+"CHEBI:24420",
+"CHEBI:36655",
+"CHEBI:14368",
+"CHEBI:24421",
+"CHEBI:42767",
+"CHEBI:16891",
+"CHEBI:35977",
+"CHEBI:5509"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/cdffdb1a-3322-4cc1-9171-d857bfaa198a",
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/aecbda66-6e98-4c11-aeaf-6a072f4f963c",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/9dc0aa3b-447a-4b5d-8157-501b036f9626",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/43b74f4f-bc8a-4b8b-b587-c97d8e9eed48"
+],
+"hmdb":[
+"HMDB00119"
+],
+"inchi_key":[
+"HHLFWLYXYJOTON-UHFFFAOYSA-M"
+],
+"kegg.compound":[
+"C00048"
+],
+"metanetx.chemical":[
+"MNXM69"
+],
+"reactome.compound":[
+"904849",
+"389678"
+],
+"sabiork":[
+"1838"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00040"
+]
+}
+},
+{
+"id":"h2o_c",
+"name":"H2O H2O",
+"compartment":"c",
+"charge":0,
+"formula":"H2O",
+"notes":{
+"original_bigg_ids":[
+"h2o_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"h2o"
+],
+"biocyc":[
+"META:CPD-15815",
+"META:OXONIUM",
+"META:HYDROXYL-GROUP",
+"META:WATER",
+"META:OH"
+],
+"chebi":[
+"CHEBI:13352",
+"CHEBI:30490",
+"CHEBI:43228",
+"CHEBI:33813",
+"CHEBI:44292",
+"CHEBI:44641",
+"CHEBI:27313",
+"CHEBI:42043",
+"CHEBI:44819",
+"CHEBI:29356",
+"CHEBI:5594",
+"CHEBI:10743",
+"CHEBI:15377",
+"CHEBI:42857",
+"CHEBI:13365",
+"CHEBI:29412",
+"CHEBI:16234",
+"CHEBI:13419",
+"CHEBI:5585",
+"CHEBI:44701"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/799908db-b8c9-4982-86cb-1f225e2ad08c",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/e7f34a8e-cded-4793-b6d5-792335b38636",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/969d0227-3069-4e44-9525-7ae7bad84170"
+],
+"hmdb":[
+"HMDB02111",
+"HMDB01039"
+],
+"inchi_key":[
+"XLYOFNOQVPJJNP-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00001",
+"C01328"
+],
+"kegg.drug":[
+"D00001",
+"D06322"
+],
+"metanetx.chemical":[
+"MNXM2"
+],
+"reactome.compound":[
+"113521",
+"141343",
+"2022884",
+"5278291",
+"29356",
+"189422",
+"5668574",
+"5693747",
+"109276",
+"113519",
+"1605715",
+"8851517",
+"113518",
+"351603"
+],
+"sabiork":[
+"40"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd27222",
+"cpd00001",
+"cpd15275"
+]
+}
+},
+{
+"id":"h2o_e",
+"name":"H2O H2O",
+"compartment":"e",
+"charge":0,
+"formula":"H2O",
+"notes":{
+"original_bigg_ids":[
+"h2o_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"h2o"
+],
+"biocyc":[
+"META:CPD-15815",
+"META:OXONIUM",
+"META:HYDROXYL-GROUP",
+"META:WATER",
+"META:OH"
+],
+"chebi":[
+"CHEBI:13352",
+"CHEBI:30490",
+"CHEBI:43228",
+"CHEBI:33813",
+"CHEBI:44292",
+"CHEBI:44641",
+"CHEBI:27313",
+"CHEBI:42043",
+"CHEBI:44819",
+"CHEBI:29356",
+"CHEBI:5594",
+"CHEBI:10743",
+"CHEBI:15377",
+"CHEBI:42857",
+"CHEBI:13365",
+"CHEBI:29412",
+"CHEBI:16234",
+"CHEBI:13419",
+"CHEBI:5585",
+"CHEBI:44701"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/799908db-b8c9-4982-86cb-1f225e2ad08c",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/e7f34a8e-cded-4793-b6d5-792335b38636",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/969d0227-3069-4e44-9525-7ae7bad84170"
+],
+"hmdb":[
+"HMDB02111",
+"HMDB01039"
+],
+"inchi_key":[
+"XLYOFNOQVPJJNP-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00001",
+"C01328"
+],
+"kegg.drug":[
+"D00001",
+"D06322"
+],
+"metanetx.chemical":[
+"MNXM2"
+],
+"reactome.compound":[
+"113521",
+"141343",
+"2022884",
+"5278291",
+"29356",
+"189422",
+"5668574",
+"5693747",
+"109276",
+"113519",
+"1605715",
+"8851517",
+"113518",
+"351603"
+],
+"sabiork":[
+"40"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd27222",
+"cpd00001",
+"cpd15275"
+]
+}
+},
+{
+"id":"h_c",
+"name":"H+",
+"compartment":"c",
+"charge":1,
+"formula":"H",
+"notes":{
+"original_bigg_ids":[
+"h_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"h"
+],
+"biocyc":[
+"META:PROTON"
+],
+"chebi":[
+"CHEBI:5584",
+"CHEBI:13357",
+"CHEBI:15378",
+"CHEBI:10744"
+],
+"hmdb":[
+"HMDB59597"
+],
+"inchi_key":[
+"GPRLSGONYQIRFK-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00080"
+],
+"metanetx.chemical":[
+"MNXM1"
+],
+"reactome.compound":[
+"2000349",
+"425978",
+"74722",
+"428040",
+"427899",
+"428548",
+"156540",
+"70106",
+"425969",
+"1132304",
+"5668577",
+"1470067",
+"163953",
+"193465",
+"113529",
+"351626",
+"425999",
+"194688",
+"374900",
+"2872447",
+"372511"
+],
+"sabiork":[
+"39"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00067"
+]
+}
+},
+{
+"id":"h_e",
+"name":"H+",
+"compartment":"e",
+"charge":1,
+"formula":"H",
+"notes":{
+"original_bigg_ids":[
+"h_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"h"
+],
+"biocyc":[
+"META:PROTON"
+],
+"chebi":[
+"CHEBI:5584",
+"CHEBI:13357",
+"CHEBI:15378",
+"CHEBI:10744"
+],
+"hmdb":[
+"HMDB59597"
+],
+"inchi_key":[
+"GPRLSGONYQIRFK-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00080"
+],
+"metanetx.chemical":[
+"MNXM1"
+],
+"reactome.compound":[
+"2000349",
+"425978",
+"74722",
+"428040",
+"427899",
+"428548",
+"156540",
+"70106",
+"425969",
+"1132304",
+"5668577",
+"1470067",
+"163953",
+"193465",
+"113529",
+"351626",
+"425999",
+"194688",
+"374900",
+"2872447",
+"372511"
+],
+"sabiork":[
+"39"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00067"
+]
+}
+},
+{
+"id":"icit_c",
+"name":"Isocitrate",
+"compartment":"c",
+"charge":-3,
+"formula":"C6H5O7",
+"notes":{
+"original_bigg_ids":[
+"icit_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"icit"
+],
+"chebi":[
+"CHEBI:16087",
+"CHEBI:36454",
+"CHEBI:5998",
+"CHEBI:24886",
+"CHEBI:36453",
+"CHEBI:14465",
+"CHEBI:30887",
+"CHEBI:24884"
+],
+"hmdb":[
+"HMDB00193"
+],
+"inchi_key":[
+"ODBLHEXUDAPZAU-UHFFFAOYSA-K"
+],
+"kegg.compound":[
+"C00311"
+],
+"metanetx.chemical":[
+"MNXM89661"
+],
+"sabiork":[
+"2013"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00260"
+]
+}
+},
+{
+"id":"lac__D_c",
+"name":"D-Lactate",
+"compartment":"c",
+"charge":-1,
+"formula":"C3H5O3",
+"notes":{
+"original_bigg_ids":[
+"lac_D_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"lac__D"
+],
+"biocyc":[
+"META:D-LACTATE"
+],
+"chebi":[
+"CHEBI:16004",
+"CHEBI:341",
+"CHEBI:18684",
+"CHEBI:43701",
+"CHEBI:11001",
+"CHEBI:42111",
+"CHEBI:42105"
+],
+"hmdb":[
+"HMDB01311",
+"HMDB00171"
+],
+"inchi_key":[
+"JVTAAEKCZFNVCJ-UWTATZPHSA-M"
+],
+"kegg.compound":[
+"C00256"
+],
+"metanetx.chemical":[
+"MNXM285"
+],
+"sabiork":[
+"1997",
+"2284"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00221"
+]
+}
+},
+{
+"id":"lac__D_e",
+"name":"D-Lactate",
+"compartment":"e",
+"charge":-1,
+"formula":"C3H5O3",
+"notes":{
+"original_bigg_ids":[
+"lac_D_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"lac__D"
+],
+"biocyc":[
+"META:D-LACTATE"
+],
+"chebi":[
+"CHEBI:16004",
+"CHEBI:341",
+"CHEBI:18684",
+"CHEBI:43701",
+"CHEBI:11001",
+"CHEBI:42111",
+"CHEBI:42105"
+],
+"hmdb":[
+"HMDB01311",
+"HMDB00171"
+],
+"inchi_key":[
+"JVTAAEKCZFNVCJ-UWTATZPHSA-M"
+],
+"kegg.compound":[
+"C00256"
+],
+"metanetx.chemical":[
+"MNXM285"
+],
+"sabiork":[
+"1997",
+"2284"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00221"
+]
+}
+},
+{
+"id":"mal__L_c",
+"name":"L-Malate",
+"compartment":"c",
+"charge":-2,
+"formula":"C4H4O5",
+"notes":{
+"original_bigg_ids":[
+"mal_L_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"mal__L"
+],
+"biocyc":[
+"META:MAL"
+],
+"chebi":[
+"CHEBI:15589",
+"CHEBI:30797",
+"CHEBI:423",
+"CHEBI:18784",
+"CHEBI:18785",
+"CHEBI:13140",
+"CHEBI:11066"
+],
+"hmdb":[
+"HMDB00156"
+],
+"inchi_key":[
+"BJEPYKJPYRNKOW-REOHCLBHSA-L"
+],
+"kegg.compound":[
+"C00149"
+],
+"metanetx.chemical":[
+"MNXM98"
+],
+"reactome.compound":[
+"198498",
+"113544"
+],
+"sabiork":[
+"1918"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00130"
+]
+}
+},
+{
+"id":"mal__L_e",
+"name":"L-Malate",
+"compartment":"e",
+"charge":-2,
+"formula":"C4H4O5",
+"notes":{
+"original_bigg_ids":[
+"mal_L_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"mal__L"
+],
+"biocyc":[
+"META:MAL"
+],
+"chebi":[
+"CHEBI:15589",
+"CHEBI:30797",
+"CHEBI:423",
+"CHEBI:18784",
+"CHEBI:18785",
+"CHEBI:13140",
+"CHEBI:11066"
+],
+"hmdb":[
+"HMDB00156"
+],
+"inchi_key":[
+"BJEPYKJPYRNKOW-REOHCLBHSA-L"
+],
+"kegg.compound":[
+"C00149"
+],
+"metanetx.chemical":[
+"MNXM98"
+],
+"reactome.compound":[
+"198498",
+"113544"
+],
+"sabiork":[
+"1918"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00130"
+]
+}
+},
+{
+"id":"nad_c",
+"name":"Nicotinamide adenine dinucleotide",
+"compartment":"c",
+"charge":-1,
+"formula":"C21H26N7O14P2",
+"notes":{
+"original_bigg_ids":[
+"nad_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"nad"
+],
+"biocyc":[
+"META:NAD"
+],
+"chebi":[
+"CHEBI:7422",
+"CHEBI:44215",
+"CHEBI:13394",
+"CHEBI:21901",
+"CHEBI:57540",
+"CHEBI:15846",
+"CHEBI:44281",
+"CHEBI:44214",
+"CHEBI:13393",
+"CHEBI:29867"
+],
+"hmdb":[
+"HMDB00902"
+],
+"inchi_key":[
+"BAWFJGJZGIEFAR-NNYOXOHSSA-M"
+],
+"kegg.compound":[
+"C00003"
+],
+"kegg.drug":[
+"D00002"
+],
+"metanetx.chemical":[
+"MNXM8"
+],
+"reactome.compound":[
+"352330",
+"192307",
+"194653",
+"113526",
+"29360"
+],
+"sabiork":[
+"37"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00003"
+]
+}
+},
+{
+"id":"nadh_c",
+"name":"Nicotinamide adenine dinucleotide - reduced",
+"compartment":"c",
+"charge":-2,
+"formula":"C21H27N7O14P2",
+"notes":{
+"original_bigg_ids":[
+"nadh_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"nadh"
+],
+"biocyc":[
+"META:NADH"
+],
+"chebi":[
+"CHEBI:13395",
+"CHEBI:21902",
+"CHEBI:7423",
+"CHEBI:44216",
+"CHEBI:57945",
+"CHEBI:16908",
+"CHEBI:13396"
+],
+"hmdb":[
+"HMDB01487"
+],
+"inchi_key":[
+"BOPGDPNILDQYTO-NNYOXOHSSA-L"
+],
+"kegg.compound":[
+"C00004"
+],
+"metanetx.chemical":[
+"MNXM10"
+],
+"reactome.compound":[
+"192305",
+"73473",
+"29362",
+"194697"
+],
+"sabiork":[
+"38"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00004"
+]
+}
+},
+{
+"id":"nadp_c",
+"name":"Nicotinamide adenine dinucleotide phosphate",
+"compartment":"c",
+"charge":-3,
+"formula":"C21H25N7O17P3",
+"notes":{
+"original_bigg_ids":[
+"nadp_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"nadp"
+],
+"biocyc":[
+"META:NADP"
+],
+"chebi":[
+"CHEBI:29868",
+"CHEBI:44405",
+"CHEBI:25523",
+"CHEBI:13397",
+"CHEBI:18009",
+"CHEBI:7424",
+"CHEBI:13398",
+"CHEBI:21903",
+"CHEBI:58349",
+"CHEBI:44409"
+],
+"hmdb":[
+"HMDB00217"
+],
+"inchi_key":[
+"XJLXINKUBYWONI-NNYOXOHSSA-K"
+],
+"kegg.compound":[
+"C00006"
+],
+"metanetx.chemical":[
+"MNXM5"
+],
+"reactome.compound":[
+"194668",
+"113563",
+"6790191",
+"5623650",
+"2000348",
+"389556",
+"29366",
+"351628",
+"113564"
+],
+"sabiork":[
+"1263"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00006"
+]
+}
+},
+{
+"id":"nadph_c",
+"name":"Nicotinamide adenine dinucleotide phosphate - reduced",
+"compartment":"c",
+"charge":-4,
+"formula":"C21H26N7O17P3",
+"notes":{
+"original_bigg_ids":[
+"nadph_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"nadph"
+],
+"biocyc":[
+"META:NADPH"
+],
+"chebi":[
+"CHEBI:16474",
+"CHEBI:7425",
+"CHEBI:57783",
+"CHEBI:21904",
+"CHEBI:13399",
+"CHEBI:13400",
+"CHEBI:44286"
+],
+"hmdb":[
+"HMDB06341",
+"HMDB00221",
+"HMDB00799"
+],
+"inchi_key":[
+"ACFIXJIJDZMPPO-NNYOXOHSSA-J"
+],
+"kegg.compound":[
+"C00005"
+],
+"metanetx.chemical":[
+"MNXM6"
+],
+"reactome.compound":[
+"113600",
+"6790135",
+"113602",
+"113601",
+"2000347",
+"351627",
+"29364",
+"5623644",
+"194725"
+],
+"sabiork":[
+"1262"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00005"
+]
+}
+},
+{
+"id":"nh4_c",
+"name":"Ammonium",
+"compartment":"c",
+"charge":1,
+"formula":"H4N",
+"notes":{
+"original_bigg_ids":[
+"nh4_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"nh4"
+],
+"biocyc":[
+"META:AMMONIUM",
+"META:AMMONIA"
+],
+"chebi":[
+"CHEBI:44284",
+"CHEBI:135980",
+"CHEBI:22533",
+"CHEBI:13406",
+"CHEBI:29337",
+"CHEBI:29340",
+"CHEBI:13771",
+"CHEBI:16134",
+"CHEBI:28938",
+"CHEBI:22534",
+"CHEBI:13405",
+"CHEBI:49783",
+"CHEBI:7434",
+"CHEBI:7435",
+"CHEBI:44269",
+"CHEBI:44404",
+"CHEBI:13407"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/96667bd9-aeae-4e8f-89d3-100d0396af05",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/41e4c903-407f-49f7-bf6b-0a94d39fa3a7",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/27a89bdf-42f7-478f-91d8-e39881581096"
+],
+"hmdb":[
+"HMDB00051",
+"HMDB41827"
+],
+"inchi_key":[
+"QGZKDVFQNNGYKY-UHFFFAOYSA-O"
+],
+"kegg.compound":[
+"C00014",
+"C01342"
+],
+"kegg.drug":[
+"D02916",
+"D02915"
+],
+"metanetx.chemical":[
+"MNXM15"
+],
+"reactome.compound":[
+"5693978",
+"1132163",
+"29382",
+"76230",
+"140912",
+"389843",
+"2022135",
+"31633",
+"113561"
+],
+"sabiork":[
+"1268",
+"43"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd19013",
+"cpd00013"
+]
+}
+},
+{
+"id":"13dpg_c",
+"name":"3-Phospho-D-glyceroyl phosphate",
+"compartment":"c",
+"charge":-4,
+"formula":"C3H4O10P2",
+"notes":{
+"original_bigg_ids":[
+"13dpg_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"13dpg"
+],
+"biocyc":[
+"META:DPG"
+],
+"chebi":[
+"CHEBI:57604",
+"CHEBI:20189",
+"CHEBI:11881",
+"CHEBI:16001",
+"CHEBI:1658"
+],
+"hmdb":[
+"HMDB62758"
+],
+"inchi_key":[
+"LJQLQCAXBUHEAZ-UWTATZPHSA-J"
+],
+"kegg.compound":[
+"C00236"
+],
+"metanetx.chemical":[
+"MNXM261"
+],
+"reactome.compound":[
+"29800"
+],
+"sabiork":[
+"21215"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00203"
+]
+}
+},
+{
+"id":"nh4_e",
+"name":"Ammonium",
+"compartment":"e",
+"charge":1,
+"formula":"H4N",
+"notes":{
+"original_bigg_ids":[
+"nh4_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"nh4"
+],
+"biocyc":[
+"META:AMMONIUM",
+"META:AMMONIA"
+],
+"chebi":[
+"CHEBI:44284",
+"CHEBI:135980",
+"CHEBI:22533",
+"CHEBI:13406",
+"CHEBI:29337",
+"CHEBI:29340",
+"CHEBI:13771",
+"CHEBI:16134",
+"CHEBI:28938",
+"CHEBI:22534",
+"CHEBI:13405",
+"CHEBI:49783",
+"CHEBI:7434",
+"CHEBI:7435",
+"CHEBI:44269",
+"CHEBI:44404",
+"CHEBI:13407"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/96667bd9-aeae-4e8f-89d3-100d0396af05",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/41e4c903-407f-49f7-bf6b-0a94d39fa3a7",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/27a89bdf-42f7-478f-91d8-e39881581096"
+],
+"hmdb":[
+"HMDB00051",
+"HMDB41827"
+],
+"inchi_key":[
+"QGZKDVFQNNGYKY-UHFFFAOYSA-O"
+],
+"kegg.compound":[
+"C00014",
+"C01342"
+],
+"kegg.drug":[
+"D02916",
+"D02915"
+],
+"metanetx.chemical":[
+"MNXM15"
+],
+"reactome.compound":[
+"5693978",
+"1132163",
+"29382",
+"76230",
+"140912",
+"389843",
+"2022135",
+"31633",
+"113561"
+],
+"sabiork":[
+"1268",
+"43"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd19013",
+"cpd00013"
+]
+}
+},
+{
+"id":"o2_c",
+"name":"O2 O2",
+"compartment":"c",
+"charge":0,
+"formula":"O2",
+"notes":{
+"original_bigg_ids":[
+"o2_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"o2"
+],
+"biocyc":[
+"META:OXYGEN-MOLECULE"
+],
+"chebi":[
+"CHEBI:7860",
+"CHEBI:26689",
+"CHEBI:29097",
+"CHEBI:15379",
+"CHEBI:13416",
+"CHEBI:27140",
+"CHEBI:29793",
+"CHEBI:30491",
+"CHEBI:44742",
+"CHEBI:23833",
+"CHEBI:25366",
+"CHEBI:10745"
+],
+"envipath":[
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/d5d12248-82d3-4cf3-b7d0-2e3d096768b4"
+],
+"hmdb":[
+"HMDB01377"
+],
+"inchi_key":[
+"MYMOFIZGZYHOMD-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00007"
+],
+"kegg.drug":[
+"D00003"
+],
+"metanetx.chemical":[
+"MNXM4"
+],
+"reactome.compound":[
+"113534",
+"113535",
+"113685",
+"5668566",
+"189461",
+"113533",
+"1131511",
+"352327",
+"351593",
+"29368",
+"1236709"
+],
+"sabiork":[
+"1264"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00007"
+]
+}
+},
+{
+"id":"2pg_c",
+"name":"D-Glycerate 2-phosphate",
+"compartment":"c",
+"charge":-3,
+"formula":"C3H4O7P",
+"notes":{
+"original_bigg_ids":[
+"2pg_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"2pg"
+],
+"biocyc":[
+"META:2-PG"
+],
+"chebi":[
+"CHEBI:39868",
+"CHEBI:21028",
+"CHEBI:58289",
+"CHEBI:24344",
+"CHEBI:12986",
+"CHEBI:17835",
+"CHEBI:11651",
+"CHEBI:1267",
+"CHEBI:88350"
+],
+"hmdb":[
+"HMDB00362",
+"HMDB62707",
+"HMDB03391"
+],
+"inchi_key":[
+"GXIURPTVHJPJLF-UWTATZPHSA-K"
+],
+"kegg.compound":[
+"C00631"
+],
+"metanetx.chemical":[
+"MNXM275"
+],
+"reactome.compound":[
+"30485"
+],
+"sabiork":[
+"31"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00482"
+]
+}
+},
+{
+"id":"o2_e",
+"name":"O2 O2",
+"compartment":"e",
+"charge":0,
+"formula":"O2",
+"notes":{
+"original_bigg_ids":[
+"o2_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"o2"
+],
+"biocyc":[
+"META:OXYGEN-MOLECULE"
+],
+"chebi":[
+"CHEBI:7860",
+"CHEBI:26689",
+"CHEBI:29097",
+"CHEBI:15379",
+"CHEBI:13416",
+"CHEBI:27140",
+"CHEBI:29793",
+"CHEBI:30491",
+"CHEBI:44742",
+"CHEBI:23833",
+"CHEBI:25366",
+"CHEBI:10745"
+],
+"envipath":[
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/d5d12248-82d3-4cf3-b7d0-2e3d096768b4"
+],
+"hmdb":[
+"HMDB01377"
+],
+"inchi_key":[
+"MYMOFIZGZYHOMD-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00007"
+],
+"kegg.drug":[
+"D00003"
+],
+"metanetx.chemical":[
+"MNXM4"
+],
+"reactome.compound":[
+"113534",
+"113535",
+"113685",
+"5668566",
+"189461",
+"113533",
+"1131511",
+"352327",
+"351593",
+"29368",
+"1236709"
+],
+"sabiork":[
+"1264"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00007"
+]
+}
+},
+{
+"id":"3pg_c",
+"name":"3-Phospho-D-glycerate",
+"compartment":"c",
+"charge":-3,
+"formula":"C3H4O7P",
+"notes":{
+"original_bigg_ids":[
+"3pg_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"3pg"
+],
+"biocyc":[
+"META:G3P"
+],
+"chebi":[
+"CHEBI:11879",
+"CHEBI:11880",
+"CHEBI:17794",
+"CHEBI:21029",
+"CHEBI:1657",
+"CHEBI:58272",
+"CHEBI:12987"
+],
+"hmdb":[
+"HMDB60180"
+],
+"inchi_key":[
+"OSJPPGNTCRNQQC-UWTATZPHSA-K"
+],
+"kegg.compound":[
+"C00197"
+],
+"metanetx.chemical":[
+"MNXM126"
+],
+"reactome.compound":[
+"6799493",
+"29728"
+],
+"sabiork":[
+"21216"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00169"
+]
+}
+},
+{
+"id":"oaa_c",
+"name":"Oxaloacetate",
+"compartment":"c",
+"charge":-2,
+"formula":"C4H2O5",
+"notes":{
+"original_bigg_ids":[
+"oaa_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"oaa"
+],
+"biocyc":[
+"META:OXALACETIC_ACID"
+],
+"chebi":[
+"CHEBI:25731",
+"CHEBI:24959",
+"CHEBI:12820",
+"CHEBI:16452",
+"CHEBI:30744",
+"CHEBI:14703",
+"CHEBI:24958",
+"CHEBI:7812",
+"CHEBI:25734",
+"CHEBI:29049"
+],
+"envipath":[
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/133a11f3-81b0-4384-837e-1ccdd0a2a645",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/40afaad4-431a-4e3c-b4c7-020dbe4bdd2a",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/be7c543c-40bd-4698-9821-22f2e65c38f3"
+],
+"hmdb":[
+"HMDB00223"
+],
+"inchi_key":[
+"KHPXUQMNIQBQEV-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00036"
+],
+"lipidmaps":[
+"LMFA01170120"
+],
+"metanetx.chemical":[
+"MNXM46"
+],
+"reactome.compound":[
+"6810070",
+"113587",
+"76213"
+],
+"sabiork":[
+"1915"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00032"
+]
+}
+},
+{
+"id":"pep_c",
+"name":"Phosphoenolpyruvate",
+"compartment":"c",
+"charge":-3,
+"formula":"C3H2O6P",
+"notes":{
+"original_bigg_ids":[
+"pep_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"pep"
+],
+"biocyc":[
+"META:PHOSPHO-ENOL-PYRUVATE"
+],
+"chebi":[
+"CHEBI:18021",
+"CHEBI:44894",
+"CHEBI:26054",
+"CHEBI:14812",
+"CHEBI:26055",
+"CHEBI:8147",
+"CHEBI:58702",
+"CHEBI:44897"
+],
+"hmdb":[
+"HMDB00263"
+],
+"inchi_key":[
+"DTBNBXWJWCWCIK-UHFFFAOYSA-K"
+],
+"kegg.compound":[
+"C00074"
+],
+"metanetx.chemical":[
+"MNXM73"
+],
+"reactome.compound":[
+"372364",
+"29492"
+],
+"sabiork":[
+"32"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00061"
+]
+}
+},
+{
+"id":"6pgc_c",
+"name":"6-Phospho-D-gluconate",
+"compartment":"c",
+"charge":-3,
+"formula":"C6H10O10P",
+"notes":{
+"original_bigg_ids":[
+"6pgc_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"6pgc"
+],
+"biocyc":[
+"META:CPD-2961"
+],
+"chebi":[
+"CHEBI:33851",
+"CHEBI:2231",
+"CHEBI:16863",
+"CHEBI:40282",
+"CHEBI:12232",
+"CHEBI:48928",
+"CHEBI:58759"
+],
+"hmdb":[
+"HMDB01316",
+"HMDB62800"
+],
+"inchi_key":[
+"BIRSGZKFKXLSJQ-SQOUGZDYSA-K"
+],
+"kegg.compound":[
+"C00345"
+],
+"metanetx.chemical":[
+"MNXM325"
+],
+"reactome.compound":[
+"29996"
+],
+"sabiork":[
+"22801",
+"2024"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00284"
+]
+}
+},
+{
+"id":"pi_c",
+"name":"Phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"HO4P",
+"notes":{
+"original_bigg_ids":[
+"pi_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"pi"
+],
+"biocyc":[
+"META:Pi",
+"META:CPD-16459",
+"META:PHOSPHATE-GROUP"
+],
+"chebi":[
+"CHEBI:26078",
+"CHEBI:18367",
+"CHEBI:29139",
+"CHEBI:39739",
+"CHEBI:43470",
+"CHEBI:35780",
+"CHEBI:43474",
+"CHEBI:26020",
+"CHEBI:45024",
+"CHEBI:39745",
+"CHEBI:29137",
+"CHEBI:14791",
+"CHEBI:7793"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/db5219ee-60cb-4370-b066-340c9faf069c",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/84684967-eade-48d4-b25d-c4aede0a0836",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/ad82c39b-2edb-4953-b971-79a2d2ea6e26",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/aac01fea-4223-49c1-8b12-cd50f11ebfc8",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/c581b2ce-6238-45de-abc0-60ca8d47ed04"
+],
+"hmdb":[
+"HMDB02105",
+"HMDB00973",
+"HMDB01429",
+"HMDB02142",
+"HMDB05947"
+],
+"inchi_key":[
+"NBIIXXVUZAFLBC-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00009"
+],
+"kegg.drug":[
+"D05467"
+],
+"metanetx.chemical":[
+"MNXM9"
+],
+"reactome.compound":[
+"5228339",
+"113550",
+"8851513",
+"113551",
+"109277",
+"29372",
+"8851226",
+"113548"
+],
+"sabiork":[
+"36"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd27787",
+"cpd00009"
+]
+}
+},
+{
+"id":"6pgl_c",
+"name":"6-phospho-D-glucono-1,5-lactone",
+"compartment":"c",
+"charge":-2,
+"formula":"C6H9O9P",
+"notes":{
+"original_bigg_ids":[
+"6pgl_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"6pgl"
+],
+"biocyc":[
+"META:D-6-P-GLUCONO-DELTA-LACTONE"
+],
+"chebi":[
+"CHEBI:12233",
+"CHEBI:4160",
+"CHEBI:57955",
+"CHEBI:16938",
+"CHEBI:20989",
+"CHEBI:12958"
+],
+"hmdb":[
+"HMDB62628",
+"HMDB01127"
+],
+"inchi_key":[
+"IJOJIVNDFQSGAB-SQOUGZDYSA-L"
+],
+"kegg.compound":[
+"C01236"
+],
+"metanetx.chemical":[
+"MNXM429"
+],
+"reactome.compound":[
+"31467"
+],
+"sabiork":[
+"1366"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00911"
+]
+}
+},
+{
+"id":"pi_e",
+"name":"Phosphate",
+"compartment":"e",
+"charge":-2,
+"formula":"HO4P",
+"notes":{
+"original_bigg_ids":[
+"pi_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"pi"
+],
+"biocyc":[
+"META:Pi",
+"META:CPD-16459",
+"META:PHOSPHATE-GROUP"
+],
+"chebi":[
+"CHEBI:26078",
+"CHEBI:18367",
+"CHEBI:29139",
+"CHEBI:39739",
+"CHEBI:43470",
+"CHEBI:35780",
+"CHEBI:43474",
+"CHEBI:26020",
+"CHEBI:45024",
+"CHEBI:39745",
+"CHEBI:29137",
+"CHEBI:14791",
+"CHEBI:7793"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/db5219ee-60cb-4370-b066-340c9faf069c",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/84684967-eade-48d4-b25d-c4aede0a0836",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/ad82c39b-2edb-4953-b971-79a2d2ea6e26",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/aac01fea-4223-49c1-8b12-cd50f11ebfc8",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/c581b2ce-6238-45de-abc0-60ca8d47ed04"
+],
+"hmdb":[
+"HMDB02105",
+"HMDB00973",
+"HMDB01429",
+"HMDB02142",
+"HMDB05947"
+],
+"inchi_key":[
+"NBIIXXVUZAFLBC-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00009"
+],
+"kegg.drug":[
+"D05467"
+],
+"metanetx.chemical":[
+"MNXM9"
+],
+"reactome.compound":[
+"5228339",
+"113550",
+"8851513",
+"113551",
+"109277",
+"29372",
+"8851226",
+"113548"
+],
+"sabiork":[
+"36"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd27787",
+"cpd00009"
+]
+}
+},
+{
+"id":"ac_c",
+"name":"Acetate",
+"compartment":"c",
+"charge":-1,
+"formula":"C2H3O2",
+"notes":{
+"original_bigg_ids":[
+"ac_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"ac"
+],
+"biocyc":[
+"META:ACET"
+],
+"chebi":[
+"CHEBI:13704",
+"CHEBI:22165",
+"CHEBI:22169",
+"CHEBI:40480",
+"CHEBI:15366",
+"CHEBI:2387",
+"CHEBI:30089",
+"CHEBI:40486"
+],
+"envipath":[
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/9e26dcbe-4db9-46a0-8614-9f03545032d2",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/5e4989fc-13d3-45d4-ad57-3be380a9d3c0",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/a8f0be58-24e8-441b-8d81-a516a0ead4b3",
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/d45256fe-61fa-4f5b-bb16-91a3d615e3d8",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/b545cabc-8c9e-4b20-8848-efa015b481ea",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/3e2d750f-df31-4445-9255-163c627e9b4a"
+],
+"hmdb":[
+"HMDB00042"
+],
+"inchi_key":[
+"QTBSBXVTEAMEQO-UHFFFAOYSA-M"
+],
+"kegg.compound":[
+"C00033"
+],
+"kegg.drug":[
+"D00010"
+],
+"lipidmaps":[
+"LMFA01010002"
+],
+"metanetx.chemical":[
+"MNXM26"
+],
+"reactome.compound":[
+"1524044",
+"390305",
+"113539",
+"2022890",
+"29416"
+],
+"sabiork":[
+"1278"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00029"
+],
+"slm":[
+"000000449"
+]
+}
+},
+{
+"id":"pyr_c",
+"name":"Pyruvate",
+"compartment":"c",
+"charge":-1,
+"formula":"C3H3O3",
+"notes":{
+"original_bigg_ids":[
+"pyr_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"pyr"
+],
+"biocyc":[
+"META:PYRUVATE"
+],
+"chebi":[
+"CHEBI:26462",
+"CHEBI:26466",
+"CHEBI:8685",
+"CHEBI:32816",
+"CHEBI:45253",
+"CHEBI:14987",
+"CHEBI:15361"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/ccc99777-54dc-42d4-a97e-009b780d3905",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/dc01020e-8c7e-4087-9f56-cf8c962b7437"
+],
+"hmdb":[
+"HMDB00243"
+],
+"inchi_key":[
+"LCTONWCANYUPML-UHFFFAOYSA-M"
+],
+"kegg.compound":[
+"C00022"
+],
+"lipidmaps":[
+"LMFA01060077"
+],
+"metanetx.chemical":[
+"MNXM23"
+],
+"reactome.compound":[
+"1130930",
+"5357717",
+"113557",
+"29398",
+"389680"
+],
+"sabiork":[
+"33"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00020"
+]
+}
+},
+{
+"id":"pyr_e",
+"name":"Pyruvate",
+"compartment":"e",
+"charge":-1,
+"formula":"C3H3O3",
+"notes":{
+"original_bigg_ids":[
+"pyr_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"pyr"
+],
+"biocyc":[
+"META:PYRUVATE"
+],
+"chebi":[
+"CHEBI:26462",
+"CHEBI:26466",
+"CHEBI:8685",
+"CHEBI:32816",
+"CHEBI:45253",
+"CHEBI:14987",
+"CHEBI:15361"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/ccc99777-54dc-42d4-a97e-009b780d3905",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/dc01020e-8c7e-4087-9f56-cf8c962b7437"
+],
+"hmdb":[
+"HMDB00243"
+],
+"inchi_key":[
+"LCTONWCANYUPML-UHFFFAOYSA-M"
+],
+"kegg.compound":[
+"C00022"
+],
+"lipidmaps":[
+"LMFA01060077"
+],
+"metanetx.chemical":[
+"MNXM23"
+],
+"reactome.compound":[
+"1130930",
+"5357717",
+"113557",
+"29398",
+"389680"
+],
+"sabiork":[
+"33"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00020"
+]
+}
+},
+{
+"id":"q8_c",
+"name":"Ubiquinone-8",
+"compartment":"c",
+"charge":0,
+"formula":"C49H74O4",
+"notes":{
+"original_bigg_ids":[
+"q8_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"q8"
+],
+"biocyc":[
+"META:UBIQUINONE-8"
+],
+"chebi":[
+"CHEBI:61683"
+],
+"inchi_key":[
+"ICFIZJQGJAJRSU-SGHXUWJISA-N"
+],
+"kegg.compound":[
+"C17569"
+],
+"lipidmaps":[
+"LMPR02010005"
+],
+"metanetx.chemical":[
+"MNXM232"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd15560"
+]
+}
+},
+{
+"id":"q8h2_c",
+"name":"Ubiquinol-8",
+"compartment":"c",
+"charge":0,
+"formula":"C49H76O4",
+"notes":{
+"original_bigg_ids":[
+"q8h2_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"q8h2"
+],
+"biocyc":[
+"META:CPD-9956"
+],
+"chebi":[
+"CHEBI:61682"
+],
+"hmdb":[
+"HMDB01060"
+],
+"inchi_key":[
+"LOJUQFSPYHMHEO-SGHXUWJISA-N"
+],
+"metanetx.chemical":[
+"MNXM191"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd29608",
+"cpd15561"
+]
+}
+},
+{
+"id":"r5p_c",
+"name":"Alpha-D-Ribose 5-phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C5H9O8P",
+"notes":{
+"original_bigg_ids":[
+"r5p_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"r5p"
+],
+"biocyc":[
+"META:CPD-15318"
+],
+"chebi":[
+"CHEBI:18189",
+"CHEBI:22413",
+"CHEBI:12331",
+"CHEBI:10270"
+],
+"inchi_key":[
+"KTVPXOYAKDPRHY-AIHAYLRMSA-L"
+],
+"kegg.compound":[
+"C03736"
+],
+"metanetx.chemical":[
+"MNXM15900"
+],
+"sabiork":[
+"1473"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd19028"
+]
+}
+},
+{
+"id":"ru5p__D_c",
+"name":"D-Ribulose 5-phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C5H9O8P",
+"notes":{
+"original_bigg_ids":[
+"ru5p_D_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"ru5p__D"
+],
+"biocyc":[
+"META:RIBULOSE-5P"
+],
+"chebi":[
+"CHEBI:40192",
+"CHEBI:21088",
+"CHEBI:17363",
+"CHEBI:26572",
+"CHEBI:13040",
+"CHEBI:37455",
+"CHEBI:58121",
+"CHEBI:13018",
+"CHEBI:4243"
+],
+"hmdb":[
+"HMDB02033",
+"HMDB02694",
+"HMDB00618"
+],
+"inchi_key":[
+"FNZLKVNUWIIPSJ-UHNVWZDZSA-L"
+],
+"kegg.compound":[
+"C00199"
+],
+"metanetx.chemical":[
+"MNXM145"
+],
+"reactome.compound":[
+"29732"
+],
+"sabiork":[
+"22814",
+"1313"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00171"
+]
+}
+},
+{
+"id":"ac_e",
+"name":"Acetate",
+"compartment":"e",
+"charge":-1,
+"formula":"C2H3O2",
+"notes":{
+"original_bigg_ids":[
+"ac_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"ac"
+],
+"biocyc":[
+"META:ACET"
+],
+"chebi":[
+"CHEBI:13704",
+"CHEBI:22165",
+"CHEBI:22169",
+"CHEBI:40480",
+"CHEBI:15366",
+"CHEBI:2387",
+"CHEBI:30089",
+"CHEBI:40486"
+],
+"envipath":[
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/9e26dcbe-4db9-46a0-8614-9f03545032d2",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/5e4989fc-13d3-45d4-ad57-3be380a9d3c0",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/a8f0be58-24e8-441b-8d81-a516a0ead4b3",
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/d45256fe-61fa-4f5b-bb16-91a3d615e3d8",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/b545cabc-8c9e-4b20-8848-efa015b481ea",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/3e2d750f-df31-4445-9255-163c627e9b4a"
+],
+"hmdb":[
+"HMDB00042"
+],
+"inchi_key":[
+"QTBSBXVTEAMEQO-UHFFFAOYSA-M"
+],
+"kegg.compound":[
+"C00033"
+],
+"kegg.drug":[
+"D00010"
+],
+"lipidmaps":[
+"LMFA01010002"
+],
+"metanetx.chemical":[
+"MNXM26"
+],
+"reactome.compound":[
+"1524044",
+"390305",
+"113539",
+"2022890",
+"29416"
+],
+"sabiork":[
+"1278"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00029"
+],
+"slm":[
+"000000449"
+]
+}
+},
+{
+"id":"acald_c",
+"name":"Acetaldehyde",
+"compartment":"c",
+"charge":0,
+"formula":"C2H4O",
+"notes":{
+"original_bigg_ids":[
+"acald_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"acald"
+],
+"biocyc":[
+"META:ACETALD"
+],
+"chebi":[
+"CHEBI:40533",
+"CHEBI:13703",
+"CHEBI:2383",
+"CHEBI:22158",
+"CHEBI:15343"
+],
+"envipath":[
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/9c8865b2-a99d-42e4-a042-c88504f04b51",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/47aa8e53-36ae-4be3-987c-c1cfab66af78",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/ee2c714d-ff9d-4df8-b343-48c1ec76ef0e",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/78f3645f-408e-4001-9dda-a52ea62a15d4"
+],
+"hmdb":[
+"HMDB00990"
+],
+"inchi_key":[
+"IKHGUXGNUITLKF-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00084"
+],
+"metanetx.chemical":[
+"MNXM75"
+],
+"reactome.compound":[
+"113532",
+"29510",
+"113681",
+"113745"
+],
+"sabiork":[
+"1292"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00071"
+]
+}
+},
+{
+"id":"s7p_c",
+"name":"Sedoheptulose 7-phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C7H13O10P",
+"notes":{
+"original_bigg_ids":[
+"s7p_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"s7p"
+],
+"biocyc":[
+"META:D-SEDOHEPTULOSE-7-P"
+],
+"chebi":[
+"CHEBI:4244",
+"CHEBI:15073",
+"CHEBI:15721",
+"CHEBI:26621",
+"CHEBI:9083",
+"CHEBI:15074",
+"CHEBI:57483"
+],
+"hmdb":[
+"HMDB01068",
+"HMDB62754"
+],
+"inchi_key":[
+"JDTUMPKOJBQPKX-GBNDHIKLSA-L"
+],
+"kegg.compound":[
+"C05382"
+],
+"metanetx.chemical":[
+"MNXM271"
+],
+"reactome.compound":[
+"29882"
+],
+"sabiork":[
+"1618",
+"1325"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00238"
+]
+}
+},
+{
+"id":"acald_e",
+"name":"Acetaldehyde",
+"compartment":"e",
+"charge":0,
+"formula":"C2H4O",
+"notes":{
+"original_bigg_ids":[
+"acald_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"acald"
+],
+"biocyc":[
+"META:ACETALD"
+],
+"chebi":[
+"CHEBI:40533",
+"CHEBI:13703",
+"CHEBI:2383",
+"CHEBI:22158",
+"CHEBI:15343"
+],
+"envipath":[
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/9c8865b2-a99d-42e4-a042-c88504f04b51",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/47aa8e53-36ae-4be3-987c-c1cfab66af78",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/ee2c714d-ff9d-4df8-b343-48c1ec76ef0e",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/78f3645f-408e-4001-9dda-a52ea62a15d4"
+],
+"hmdb":[
+"HMDB00990"
+],
+"inchi_key":[
+"IKHGUXGNUITLKF-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00084"
+],
+"metanetx.chemical":[
+"MNXM75"
+],
+"reactome.compound":[
+"113532",
+"29510",
+"113681",
+"113745"
+],
+"sabiork":[
+"1292"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00071"
+]
+}
+},
+{
+"id":"accoa_c",
+"name":"Acetyl-CoA",
+"compartment":"c",
+"charge":-4,
+"formula":"C23H34N7O17P3S",
+"notes":{
+"original_bigg_ids":[
+"accoa_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"accoa"
+],
+"biocyc":[
+"META:ACETYL-COA"
+],
+"chebi":[
+"CHEBI:57288",
+"CHEBI:22192",
+"CHEBI:15351",
+"CHEBI:13712",
+"CHEBI:2408",
+"CHEBI:40470"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/57bd5e24-9d14-4b91-bc60-64c8ea6c2d11"
+],
+"hmdb":[
+"HMDB01206"
+],
+"inchi_key":[
+"ZSLZBFCDCINBPY-ZSJPKINUSA-J"
+],
+"kegg.compound":[
+"C00024"
+],
+"lipidmaps":[
+"LMFA07050029",
+"LMFA07050281"
+],
+"metanetx.chemical":[
+"MNXM21"
+],
+"reactome.compound":[
+"727753",
+"76183",
+"113560",
+"353123",
+"113559"
+],
+"sabiork":[
+"1276"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00022"
+],
+"slm":[
+"000000297"
+]
+}
+},
+{
+"id":"succ_c",
+"name":"Succinate",
+"compartment":"c",
+"charge":-2,
+"formula":"C4H4O4",
+"notes":{
+"original_bigg_ids":[
+"succ_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"succ"
+],
+"biocyc":[
+"META:SUC"
+],
+"chebi":[
+"CHEBI:22941",
+"CHEBI:26803",
+"CHEBI:15741",
+"CHEBI:132287",
+"CHEBI:45639",
+"CHEBI:30779",
+"CHEBI:15125",
+"CHEBI:22943",
+"CHEBI:26807",
+"CHEBI:9304",
+"CHEBI:90372",
+"CHEBI:30031"
+],
+"envipath":[
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/cc98aff0-7f64-4db4-9d59-de961c228496",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/6377658b-03f6-4fed-a5bf-ff0f2389b693",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/600b74d3-8fe5-426d-bedf-291175bd23e4",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/8fdfd425-4343-4bf2-8427-b2ffa57fdbd7"
+],
+"hmdb":[
+"HMDB00254"
+],
+"inchi_key":[
+"KDYFGRWQOYBRFD-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00042"
+],
+"lipidmaps":[
+"LMFA01170043"
+],
+"metanetx.chemical":[
+"MNXM25"
+],
+"reactome.compound":[
+"389583",
+"5278787",
+"159939",
+"433123",
+"29434",
+"113536"
+],
+"sabiork":[
+"1924"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00036"
+]
+}
+},
+{
+"id":"succ_e",
+"name":"Succinate",
+"compartment":"e",
+"charge":-2,
+"formula":"C4H4O4",
+"notes":{
+"original_bigg_ids":[
+"succ_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"succ"
+],
+"biocyc":[
+"META:SUC"
+],
+"chebi":[
+"CHEBI:22941",
+"CHEBI:26803",
+"CHEBI:15741",
+"CHEBI:132287",
+"CHEBI:45639",
+"CHEBI:30779",
+"CHEBI:15125",
+"CHEBI:22943",
+"CHEBI:26807",
+"CHEBI:9304",
+"CHEBI:90372",
+"CHEBI:30031"
+],
+"envipath":[
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/cc98aff0-7f64-4db4-9d59-de961c228496",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/6377658b-03f6-4fed-a5bf-ff0f2389b693",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/600b74d3-8fe5-426d-bedf-291175bd23e4",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/8fdfd425-4343-4bf2-8427-b2ffa57fdbd7"
+],
+"hmdb":[
+"HMDB00254"
+],
+"inchi_key":[
+"KDYFGRWQOYBRFD-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00042"
+],
+"lipidmaps":[
+"LMFA01170043"
+],
+"metanetx.chemical":[
+"MNXM25"
+],
+"reactome.compound":[
+"389583",
+"5278787",
+"159939",
+"433123",
+"29434",
+"113536"
+],
+"sabiork":[
+"1924"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00036"
+]
+}
+},
+{
+"id":"succoa_c",
+"name":"Succinyl-CoA",
+"compartment":"c",
+"charge":-5,
+"formula":"C25H35N7O19P3S",
+"notes":{
+"original_bigg_ids":[
+"succoa_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"succoa"
+],
+"biocyc":[
+"META:SUC-COA"
+],
+"chebi":[
+"CHEBI:57292",
+"CHEBI:10746",
+"CHEBI:15127",
+"CHEBI:15380",
+"CHEBI:9310",
+"CHEBI:45541",
+"CHEBI:26811"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/359075fb-98d9-458d-ba82-db4020e753f3"
+],
+"hmdb":[
+"HMDB01022"
+],
+"inchi_key":[
+"VNOYUJKHFWYWIR-ITIYDSSPSA-I"
+],
+"kegg.compound":[
+"C00091"
+],
+"lipidmaps":[
+"LMFA07050370"
+],
+"metanetx.chemical":[
+"MNXM92"
+],
+"reactome.compound":[
+"70958"
+],
+"sabiork":[
+"1931"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00078"
+]
+}
+},
+{
+"id":"acon_C_c",
+"name":"Cis-Aconitate",
+"compartment":"c",
+"charge":-3,
+"formula":"C6H3O6",
+"notes":{
+"original_bigg_ids":[
+"acon_C_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"acon_C"
+],
+"biocyc":[
+"META:CIS-ACONITATE"
+],
+"chebi":[
+"CHEBI:23306",
+"CHEBI:16383",
+"CHEBI:12798",
+"CHEBI:32805",
+"CHEBI:23308",
+"CHEBI:10482"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/643481e5-a35b-477e-8665-70f4dca66baa"
+],
+"hmdb":[
+"HMDB00461",
+"HMDB00072"
+],
+"inchi_key":[
+"GTZCVFVGUGFEME-IWQZZHSRSA-K"
+],
+"kegg.compound":[
+"C00417"
+],
+"metanetx.chemical":[
+"MNXM813"
+],
+"sabiork":[
+"2043"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00331"
+]
+}
+},
+{
+"id":"xu5p__D_c",
+"name":"D-Xylulose 5-phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C5H9O8P",
+"notes":{
+"original_bigg_ids":[
+"xu5p_D_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"xu5p__D"
+],
+"biocyc":[
+"META:XYLULOSE-5-PHOSPHATE"
+],
+"chebi":[
+"CHEBI:13036",
+"CHEBI:27354",
+"CHEBI:4269",
+"CHEBI:16332",
+"CHEBI:57737",
+"CHEBI:21121"
+],
+"hmdb":[
+"HMDB06212",
+"HMDB00868"
+],
+"inchi_key":[
+"FNZLKVNUWIIPSJ-RFZPGFLSSA-L"
+],
+"kegg.compound":[
+"C00231"
+],
+"metanetx.chemical":[
+"MNXM186"
+],
+"reactome.compound":[
+"29790"
+],
+"sabiork":[
+"1317"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00198"
+]
+}
+},
+{
+"id":"actp_c",
+"name":"Acetyl phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C2H3O5P",
+"notes":{
+"original_bigg_ids":[
+"actp_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"actp"
+],
+"biocyc":[
+"META:ACETYL-P"
+],
+"chebi":[
+"CHEBI:13711",
+"CHEBI:46262",
+"CHEBI:15350",
+"CHEBI:22191",
+"CHEBI:2407"
+],
+"hmdb":[
+"HMDB01494"
+],
+"inchi_key":[
+"LIPOUNRJVLNBCD-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00227"
+],
+"metanetx.chemical":[
+"MNXM280"
+],
+"sabiork":[
+"1316"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00196"
+]
+}
+},
+{
+"id":"adp_c",
+"name":"ADP C10H12N5O10P2",
+"compartment":"c",
+"charge":-3,
+"formula":"C10H12N5O10P2",
+"notes":{
+"original_bigg_ids":[
+"adp_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"adp"
+],
+"biocyc":[
+"META:ADP"
+],
+"chebi":[
+"CHEBI:2342",
+"CHEBI:16761",
+"CHEBI:456216",
+"CHEBI:40553",
+"CHEBI:22244",
+"CHEBI:87518",
+"CHEBI:13222"
+],
+"hmdb":[
+"HMDB01341"
+],
+"inchi_key":[
+"XTWYTFMLZFPYCI-KQYNXXCUSA-K"
+],
+"kegg.compound":[
+"C00008"
+],
+"kegg.glycan":[
+"G11113"
+],
+"metanetx.chemical":[
+"MNXM7"
+],
+"reactome.compound":[
+"114565",
+"211606",
+"114564",
+"6798177",
+"5632457",
+"5696026",
+"8869360",
+"29370",
+"113581",
+"113582"
+],
+"sabiork":[
+"35"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00008"
+]
+}
+},
+{
+"id":"akg_c",
+"name":"2-Oxoglutarate",
+"compartment":"c",
+"charge":-2,
+"formula":"C5H4O5",
+"notes":{
+"original_bigg_ids":[
+"akg_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"akg"
+],
+"biocyc":[
+"META:2-KETOGLUTARATE"
+],
+"chebi":[
+"CHEBI:40661",
+"CHEBI:16810",
+"CHEBI:11638",
+"CHEBI:30916",
+"CHEBI:19749",
+"CHEBI:1253",
+"CHEBI:30915",
+"CHEBI:19748"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/5b0a94f6-d411-44fd-bcc1-fb79b4e697f5",
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/6557f3f2-0ab8-494b-a865-8ce0eae788a9"
+],
+"hmdb":[
+"HMDB00208",
+"HMDB02812",
+"HMDB62781"
+],
+"inchi_key":[
+"KPGXRSRHYNQIFN-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00026"
+],
+"metanetx.chemical":[
+"MNXM20"
+],
+"reactome.compound":[
+"113594",
+"561075",
+"5278317",
+"113671",
+"29406",
+"389537"
+],
+"sabiork":[
+"1922"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00024"
+]
+}
+},
+{
+"id":"akg_e",
+"name":"2-Oxoglutarate",
+"compartment":"e",
+"charge":-2,
+"formula":"C5H4O5",
+"notes":{
+"original_bigg_ids":[
+"akg_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"akg"
+],
+"biocyc":[
+"META:2-KETOGLUTARATE"
+],
+"chebi":[
+"CHEBI:40661",
+"CHEBI:16810",
+"CHEBI:11638",
+"CHEBI:30916",
+"CHEBI:19749",
+"CHEBI:1253",
+"CHEBI:30915",
+"CHEBI:19748"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/5b0a94f6-d411-44fd-bcc1-fb79b4e697f5",
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/6557f3f2-0ab8-494b-a865-8ce0eae788a9"
+],
+"hmdb":[
+"HMDB00208",
+"HMDB02812",
+"HMDB62781"
+],
+"inchi_key":[
+"KPGXRSRHYNQIFN-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00026"
+],
+"metanetx.chemical":[
+"MNXM20"
+],
+"reactome.compound":[
+"113594",
+"561075",
+"5278317",
+"113671",
+"29406",
+"389537"
+],
+"sabiork":[
+"1922"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00024"
+]
+}
+},
+{
+"id":"amp_c",
+"name":"AMP C10H12N5O7P",
+"compartment":"c",
+"charge":-2,
+"formula":"C10H12N5O7P",
+"notes":{
+"original_bigg_ids":[
+"amp_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"amp"
+],
+"biocyc":[
+"META:AMP-GROUP",
+"META:AMP"
+],
+"chebi":[
+"CHEBI:13736",
+"CHEBI:2356",
+"CHEBI:13234",
+"CHEBI:22242",
+"CHEBI:40786",
+"CHEBI:16027",
+"CHEBI:40721",
+"CHEBI:40510",
+"CHEBI:456215",
+"CHEBI:13235",
+"CHEBI:22245",
+"CHEBI:40726",
+"CHEBI:47222",
+"CHEBI:13740",
+"CHEBI:40826",
+"CHEBI:12056"
+],
+"hmdb":[
+"HMDB00045"
+],
+"inchi_key":[
+"UDMBCSSLTHHNCD-KQYNXXCUSA-L"
+],
+"kegg.compound":[
+"C00020"
+],
+"kegg.drug":[
+"D02769"
+],
+"metanetx.chemical":[
+"MNXM14"
+],
+"reactome.compound":[
+"389620",
+"159448",
+"76577",
+"109275",
+"164121"
+],
+"sabiork":[
+"1273"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd22272",
+"cpd00018"
+]
+}
+},
+{
+"id":"atp_c",
+"name":"ATP C10H12N5O13P3",
+"compartment":"c",
+"charge":-4,
+"formula":"C10H12N5O13P3",
+"notes":{
+"original_bigg_ids":[
+"atp_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"atp"
+],
+"biocyc":[
+"META:ATP"
+],
+"chebi":[
+"CHEBI:15422",
+"CHEBI:10789",
+"CHEBI:10841",
+"CHEBI:2359",
+"CHEBI:22249",
+"CHEBI:13236",
+"CHEBI:237958",
+"CHEBI:30616",
+"CHEBI:57299",
+"CHEBI:40938"
+],
+"hmdb":[
+"HMDB00538"
+],
+"inchi_key":[
+"ZKHQWZAMYRWXGA-KQYNXXCUSA-J"
+],
+"kegg.compound":[
+"C00002"
+],
+"kegg.drug":[
+"D08646"
+],
+"metanetx.chemical":[
+"MNXM3"
+],
+"reactome.compound":[
+"8878982",
+"389573",
+"8938081",
+"211579",
+"113593",
+"113592",
+"5632460",
+"5696069",
+"29358",
+"8869363",
+"6798184"
+],
+"sabiork":[
+"34"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00002"
+]
+}
+},
+{
+"id":"cit_c",
+"name":"Citrate",
+"compartment":"c",
+"charge":-3,
+"formula":"C6H5O7",
+"notes":{
+"original_bigg_ids":[
+"cit_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"cit"
+],
+"biocyc":[
+"META:CIT"
+],
+"chebi":[
+"CHEBI:35802",
+"CHEBI:133748",
+"CHEBI:35809",
+"CHEBI:76049",
+"CHEBI:41523",
+"CHEBI:35810",
+"CHEBI:30769",
+"CHEBI:13999",
+"CHEBI:23322",
+"CHEBI:35808",
+"CHEBI:42563",
+"CHEBI:16947",
+"CHEBI:132362",
+"CHEBI:35804",
+"CHEBI:23321",
+"CHEBI:3727",
+"CHEBI:35806"
+],
+"hmdb":[
+"HMDB00094"
+],
+"inchi_key":[
+"KRKNYBCHXYNGOX-UHFFFAOYSA-K"
+],
+"kegg.compound":[
+"C00158"
+],
+"kegg.drug":[
+"D00037"
+],
+"metanetx.chemical":[
+"MNXM131"
+],
+"reactome.compound":[
+"29654",
+"433138",
+"76190"
+],
+"sabiork":[
+"1952"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00137"
+]
+}
+},
+{
+"id":"co2_c",
+"name":"CO2 CO2",
+"compartment":"c",
+"charge":0,
+"formula":"CO2",
+"notes":{
+"original_bigg_ids":[
+"co2_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"co2"
+],
+"biocyc":[
+"META:CARBON-DIOXIDE"
+],
+"chebi":[
+"CHEBI:23011",
+"CHEBI:3283",
+"CHEBI:48829",
+"CHEBI:16526",
+"CHEBI:13283",
+"CHEBI:13285",
+"CHEBI:13284",
+"CHEBI:13282"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/2ec3da94-5f50-4525-81b1-5607c5c7a3d3",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/05f60af4-0a3f-4ead-9a29-33bb0f123379"
+],
+"hmdb":[
+"HMDB01967"
+],
+"inchi_key":[
+"CURLTUGMZLYLDI-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00011"
+],
+"kegg.drug":[
+"D00004"
+],
+"metanetx.chemical":[
+"MNXM13"
+],
+"reactome.compound":[
+"29376",
+"5668565",
+"189480",
+"1132345",
+"113528",
+"1237009",
+"159751",
+"389536",
+"159942"
+],
+"sabiork":[
+"1266"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00011"
+]
+}
+},
+{
+"id":"co2_e",
+"name":"CO2 CO2",
+"compartment":"e",
+"charge":0,
+"formula":"CO2",
+"notes":{
+"original_bigg_ids":[
+"co2_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"co2"
+],
+"biocyc":[
+"META:CARBON-DIOXIDE"
+],
+"chebi":[
+"CHEBI:23011",
+"CHEBI:3283",
+"CHEBI:48829",
+"CHEBI:16526",
+"CHEBI:13283",
+"CHEBI:13285",
+"CHEBI:13284",
+"CHEBI:13282"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/2ec3da94-5f50-4525-81b1-5607c5c7a3d3",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/05f60af4-0a3f-4ead-9a29-33bb0f123379"
+],
+"hmdb":[
+"HMDB01967"
+],
+"inchi_key":[
+"CURLTUGMZLYLDI-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00011"
+],
+"kegg.drug":[
+"D00004"
+],
+"metanetx.chemical":[
+"MNXM13"
+],
+"reactome.compound":[
+"29376",
+"5668565",
+"189480",
+"1132345",
+"113528",
+"1237009",
+"159751",
+"389536",
+"159942"
+],
+"sabiork":[
+"1266"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00011"
+]
+}
+},
+{
+"id":"coa_c",
+"name":"Coenzyme A",
+"compartment":"c",
+"charge":-4,
+"formula":"C21H32N7O16P3S",
+"notes":{
+"original_bigg_ids":[
+"coa_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"coa"
+],
+"biocyc":[
+"META:COA-GROUP",
+"META:CO-A"
+],
+"chebi":[
+"CHEBI:41631",
+"CHEBI:41597",
+"CHEBI:741566",
+"CHEBI:23355",
+"CHEBI:13295",
+"CHEBI:13298",
+"CHEBI:57287",
+"CHEBI:15346",
+"CHEBI:3771",
+"CHEBI:13294"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/19310484-6aa5-4dcf-b1da-855a8c21ecfd"
+],
+"hmdb":[
+"HMDB01423",
+"HMDB62184"
+],
+"inchi_key":[
+"RGJOEKWQDUBAIZ-IBOSZNHHSA-J"
+],
+"kegg.compound":[
+"C00010"
+],
+"metanetx.chemical":[
+"MNXM12"
+],
+"reactome.compound":[
+"193514",
+"162743",
+"2485002",
+"1678675",
+"29374",
+"76194",
+"8939024"
+],
+"sabiork":[
+"1265"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd22528",
+"cpd00010"
+]
+}
+},
+{
+"id":"dhap_c",
+"name":"Dihydroxyacetone phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C3H5O6P",
+"notes":{
+"original_bigg_ids":[
+"dhap_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"dhap"
+],
+"biocyc":[
+"META:DIHYDROXY-ACETONE-PHOSPHATE"
+],
+"chebi":[
+"CHEBI:14341",
+"CHEBI:5454",
+"CHEBI:16108",
+"CHEBI:14342",
+"CHEBI:24355",
+"CHEBI:39571",
+"CHEBI:57642"
+],
+"hmdb":[
+"HMDB11735",
+"HMDB01473"
+],
+"inchi_key":[
+"GNGACRATGGDKBX-UHFFFAOYSA-L"
+],
+"kegg.compound":[
+"C00111"
+],
+"metanetx.chemical":[
+"MNXM77"
+],
+"reactome.compound":[
+"390404",
+"75970",
+"188451"
+],
+"sabiork":[
+"28"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00095"
+]
+}
+},
+{
+"id":"e4p_c",
+"name":"D-Erythrose 4-phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C4H7O7P",
+"notes":{
+"original_bigg_ids":[
+"e4p_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"e4p"
+],
+"biocyc":[
+"META:ERYTHROSE-4P"
+],
+"chebi":[
+"CHEBI:4114",
+"CHEBI:20927",
+"CHEBI:12921",
+"CHEBI:48153",
+"CHEBI:16897",
+"CHEBI:42349"
+],
+"hmdb":[
+"HMDB01321"
+],
+"inchi_key":[
+"NGHMDNPXVRFFGS-IUYQGCFVSA-L"
+],
+"kegg.compound":[
+"C00279"
+],
+"metanetx.chemical":[
+"MNXM258"
+],
+"reactome.compound":[
+"29878"
+],
+"sabiork":[
+"1324"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00236"
+]
+}
+},
+{
+"id":"etoh_c",
+"name":"Ethanol",
+"compartment":"c",
+"charge":0,
+"formula":"C2H6O",
+"notes":{
+"original_bigg_ids":[
+"etoh_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"etoh"
+],
+"biocyc":[
+"META:ETOH"
+],
+"chebi":[
+"CHEBI:42377",
+"CHEBI:23978",
+"CHEBI:30880",
+"CHEBI:16236",
+"CHEBI:52092",
+"CHEBI:30878",
+"CHEBI:4879",
+"CHEBI:44594",
+"CHEBI:14222"
+],
+"envipath":[
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/a4a354fd-5003-4b7b-b11b-f54204aea384",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/f89efe7c-1a6a-4d21-b99c-e3e1070a8062",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/56e18a05-c059-433a-94f6-0e26c01b010f",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/9fb1fbdf-101b-4b82-a596-d2f52c870e4f"
+],
+"hmdb":[
+"HMDB00108"
+],
+"inchi_key":[
+"LFQSCWFLJHTTHZ-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00469"
+],
+"kegg.drug":[
+"D06542",
+"D02798",
+"D00068",
+"D04855"
+],
+"metanetx.chemical":[
+"MNXM303"
+],
+"reactome.compound":[
+"113748",
+"30203"
+],
+"sabiork":[
+"56"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00363"
+]
+}
+},
+{
+"id":"etoh_e",
+"name":"Ethanol",
+"compartment":"e",
+"charge":0,
+"formula":"C2H6O",
+"notes":{
+"original_bigg_ids":[
+"etoh_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"etoh"
+],
+"biocyc":[
+"META:ETOH"
+],
+"chebi":[
+"CHEBI:42377",
+"CHEBI:23978",
+"CHEBI:30880",
+"CHEBI:16236",
+"CHEBI:52092",
+"CHEBI:30878",
+"CHEBI:4879",
+"CHEBI:44594",
+"CHEBI:14222"
+],
+"envipath":[
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/a4a354fd-5003-4b7b-b11b-f54204aea384",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/f89efe7c-1a6a-4d21-b99c-e3e1070a8062",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/56e18a05-c059-433a-94f6-0e26c01b010f",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/9fb1fbdf-101b-4b82-a596-d2f52c870e4f"
+],
+"hmdb":[
+"HMDB00108"
+],
+"inchi_key":[
+"LFQSCWFLJHTTHZ-UHFFFAOYSA-N"
+],
+"kegg.compound":[
+"C00469"
+],
+"kegg.drug":[
+"D06542",
+"D02798",
+"D00068",
+"D04855"
+],
+"metanetx.chemical":[
+"MNXM303"
+],
+"reactome.compound":[
+"113748",
+"30203"
+],
+"sabiork":[
+"56"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00363"
+]
+}
+},
+{
+"id":"f6p_c",
+"name":"D-Fructose 6-phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C6H11O9P",
+"notes":{
+"original_bigg_ids":[
+"f6p_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"f6p"
+],
+"biocyc":[
+"META:FRUCTOSE-6P"
+],
+"chebi":[
+"CHEBI:16084",
+"CHEBI:12352",
+"CHEBI:57634",
+"CHEBI:22768",
+"CHEBI:10375",
+"CHEBI:42378"
+],
+"hmdb":[
+"HMDB03971"
+],
+"inchi_key":[
+"BGWGXPAPYGQALX-ARQDHWQXSA-L"
+],
+"kegg.compound":[
+"C05345"
+],
+"metanetx.chemical":[
+"MNXM89621"
+],
+"sabiork":[
+"25"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd19035"
+]
+}
+},
+{
+"id":"fdp_c",
+"name":"D-Fructose 1,6-bisphosphate",
+"compartment":"c",
+"charge":-4,
+"formula":"C6H10O12P2",
+"notes":{
+"original_bigg_ids":[
+"fdp_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"fdp"
+],
+"chebi":[
+"CHEBI:37736",
+"CHEBI:49299"
+],
+"inchi_key":[
+"RNBGYGVWRKECFJ-VRPWFDPXSA-J"
+],
+"kegg.compound":[
+"C00354"
+],
+"metanetx.chemical":[
+"MNXM417"
+],
+"sabiork":[
+"1465"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00290"
+]
+}
+},
+{
+"id":"for_c",
+"name":"Formate",
+"compartment":"c",
+"charge":-1,
+"formula":"CH1O2",
+"notes":{
+"original_bigg_ids":[
+"for_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"for"
+],
+"biocyc":[
+"META:CPD1G-1532",
+"META:CPD1G-1535",
+"META:FORMATE",
+"META:CPD-9845",
+"META:CPD1G-1534",
+"META:CARBOXYL-GROUP",
+"META:CPD1G-1533"
+],
+"chebi":[
+"CHEBI:24081",
+"CHEBI:30751",
+"CHEBI:15740",
+"CHEBI:5145",
+"CHEBI:42460",
+"CHEBI:14276",
+"CHEBI:24082"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/9a9d20ae-b6ec-40a9-93ca-1de20597b1ed",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/09c1ad08-016e-4477-8840-b97a031eae23",
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/bf16ab32-cb3c-4427-a65a-089ab754823e",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/34fe3cd9-9b0b-46b0-a1c5-8a66509f1919",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/1d077cf2-3f9f-4163-aa49-0fca1b2b3ab3"
+],
+"hmdb":[
+"HMDB00142"
+],
+"inchi_key":[
+"BDAGIHXWWSANSR-UHFFFAOYSA-M"
+],
+"kegg.compound":[
+"C00058"
+],
+"metanetx.chemical":[
+"MNXM39"
+],
+"reactome.compound":[
+"29460",
+"194712",
+"389585",
+"6801451"
+],
+"sabiork":[
+"1285"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00047",
+"cpd22511"
+]
+}
+},
+{
+"id":"for_e",
+"name":"Formate",
+"compartment":"e",
+"charge":-1,
+"formula":"CH1O2",
+"notes":{
+"original_bigg_ids":[
+"for_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"for"
+],
+"biocyc":[
+"META:CPD1G-1532",
+"META:CPD1G-1535",
+"META:FORMATE",
+"META:CPD-9845",
+"META:CPD1G-1534",
+"META:CARBOXYL-GROUP",
+"META:CPD1G-1533"
+],
+"chebi":[
+"CHEBI:24081",
+"CHEBI:30751",
+"CHEBI:15740",
+"CHEBI:5145",
+"CHEBI:42460",
+"CHEBI:14276",
+"CHEBI:24082"
+],
+"envipath":[
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/9a9d20ae-b6ec-40a9-93ca-1de20597b1ed",
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/09c1ad08-016e-4477-8840-b97a031eae23",
+"4fd7f3e0-dd25-43ac-9453-dda3e52396e4/compound/bf16ab32-cb3c-4427-a65a-089ab754823e",
+"5882df9c-dae1-4d80-a40e-db4724271456/compound/34fe3cd9-9b0b-46b0-a1c5-8a66509f1919",
+"650babc9-9d68-4b73-9332-11972ca26f7b/compound/1d077cf2-3f9f-4163-aa49-0fca1b2b3ab3"
+],
+"hmdb":[
+"HMDB00142"
+],
+"inchi_key":[
+"BDAGIHXWWSANSR-UHFFFAOYSA-M"
+],
+"kegg.compound":[
+"C00058"
+],
+"metanetx.chemical":[
+"MNXM39"
+],
+"reactome.compound":[
+"29460",
+"194712",
+"389585",
+"6801451"
+],
+"sabiork":[
+"1285"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00047",
+"cpd22511"
+]
+}
+},
+{
+"id":"fru_e",
+"name":"D-Fructose",
+"compartment":"e",
+"charge":0,
+"formula":"C6H12O6",
+"notes":{
+"original_bigg_ids":[
+"fru_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"fru"
+],
+"biocyc":[
+"META:D-Fructopyranose",
+"META:Fructofuranose",
+"META:CPD-15382",
+"META:FRU"
+],
+"chebi":[
+"CHEBI:47424",
+"CHEBI:28757",
+"CHEBI:24110",
+"CHEBI:20929",
+"CHEBI:4119",
+"CHEBI:15824",
+"CHEBI:5172",
+"CHEBI:24104",
+"CHEBI:12923",
+"CHEBI:4118",
+"CHEBI:37714",
+"CHEBI:37721",
+"CHEBI:48095"
+],
+"hmdb":[
+"HMDB62538"
+],
+"inchi_key":[
+"RFSUNEUAIZKAJO-VRPWFDPXSA-N"
+],
+"kegg.compound":[
+"C01496",
+"C05003",
+"C00095",
+"C10906"
+],
+"kegg.drug":[
+"D00114"
+],
+"metanetx.chemical":[
+"MNXM175"
+],
+"reactome.compound":[
+"189049",
+"29532"
+],
+"sabiork":[
+"25055",
+"1463",
+"1464"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00082",
+"cpd19015",
+"cpd27040"
+]
+}
+},
+{
+"id":"fum_c",
+"name":"Fumarate",
+"compartment":"c",
+"charge":-2,
+"formula":"C4H2O4",
+"notes":{
+"original_bigg_ids":[
+"fum_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"fum"
+],
+"biocyc":[
+"META:FUM"
+],
+"chebi":[
+"CHEBI:36180",
+"CHEBI:37155",
+"CHEBI:42511",
+"CHEBI:5190",
+"CHEBI:18012",
+"CHEBI:42743",
+"CHEBI:22956",
+"CHEBI:22957",
+"CHEBI:24124",
+"CHEBI:14284",
+"CHEBI:37154",
+"CHEBI:29806",
+"CHEBI:22958",
+"CHEBI:24122"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/709035ec-4868-4de8-9095-06428f6be14b"
+],
+"hmdb":[
+"HMDB00134"
+],
+"inchi_key":[
+"VZCYOOQTPOCHFL-OWOJBTEDSA-L"
+],
+"kegg.compound":[
+"C00122"
+],
+"kegg.drug":[
+"D02308"
+],
+"metanetx.chemical":[
+"MNXM93"
+],
+"reactome.compound":[
+"113588",
+"29586"
+],
+"sabiork":[
+"1910"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00106"
+]
+}
+},
+{
+"id":"fum_e",
+"name":"Fumarate",
+"compartment":"e",
+"charge":-2,
+"formula":"C4H2O4",
+"notes":{
+"original_bigg_ids":[
+"fum_e"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"fum"
+],
+"biocyc":[
+"META:FUM"
+],
+"chebi":[
+"CHEBI:36180",
+"CHEBI:37155",
+"CHEBI:42511",
+"CHEBI:5190",
+"CHEBI:18012",
+"CHEBI:42743",
+"CHEBI:22956",
+"CHEBI:22957",
+"CHEBI:24124",
+"CHEBI:14284",
+"CHEBI:37154",
+"CHEBI:29806",
+"CHEBI:22958",
+"CHEBI:24122"
+],
+"envipath":[
+"32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/709035ec-4868-4de8-9095-06428f6be14b"
+],
+"hmdb":[
+"HMDB00134"
+],
+"inchi_key":[
+"VZCYOOQTPOCHFL-OWOJBTEDSA-L"
+],
+"kegg.compound":[
+"C00122"
+],
+"kegg.drug":[
+"D02308"
+],
+"metanetx.chemical":[
+"MNXM93"
+],
+"reactome.compound":[
+"113588",
+"29586"
+],
+"sabiork":[
+"1910"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00106"
+]
+}
+},
+{
+"id":"g3p_c",
+"name":"Glyceraldehyde 3-phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C3H5O6P",
+"notes":{
+"original_bigg_ids":[
+"g3p_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"g3p"
+],
+"biocyc":[
+"META:GAP"
+],
+"chebi":[
+"CHEBI:5446",
+"CHEBI:14333",
+"CHEBI:12984",
+"CHEBI:181",
+"CHEBI:17138",
+"CHEBI:21026",
+"CHEBI:12983",
+"CHEBI:18324",
+"CHEBI:58027",
+"CHEBI:59776",
+"CHEBI:29052"
+],
+"hmdb":[
+"HMDB01112"
+],
+"inchi_key":[
+"LXJXRIRHZLFYRP-VKHMYHEASA-L"
+],
+"kegg.compound":[
+"C00661",
+"C00118"
+],
+"metanetx.chemical":[
+"MNXM74"
+],
+"reactome.compound":[
+"29578"
+],
+"sabiork":[
+"27",
+"1687"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00102",
+"cpd19005"
+]
+}
+},
+{
+"id":"g6p_c",
+"name":"D-Glucose 6-phosphate",
+"compartment":"c",
+"charge":-2,
+"formula":"C6H11O9P",
+"notes":{
+"original_bigg_ids":[
+"g6p_c"
+]
+},
+"annotation":{
+"bigg.metabolite":[
+"g6p"
+],
+"biocyc":[
+"META:D-glucopyranose-6-phosphate"
+],
+"chebi":[
+"CHEBI:61548",
+"CHEBI:14314",
+"CHEBI:4170"
+],
+"hmdb":[
+"HMDB01549",
+"HMDB01401",
+"HMDB06793"
+],
+"inchi_key":[
+"NBSCHQHZLSJFNQ-GASJEMHNSA-L"
+],
+"kegg.compound":[
+"C00092"
+],
+"metanetx.chemical":[
+"MNXM160"
+],
+"reactome.compound":[
+"1629756"
+],
+"sabiork":[
+"1404",
+"1405"
+],
+"sbo":"SBO:0000247",
+"seed.compound":[
+"cpd00079",
+"cpd26836"
+]
+}
+}
+],
+"reactions":[
+{
+"id":"PFK",
+"name":"Phosphofructokinase",
+"metabolites":{
+"adp_c":1.0,
+"atp_c":-1.0,
+"f6p_c":-1.0,
+"fdp_c":1.0,
+"h_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3916 or b1723",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"PFK"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PFK"
+],
+"ec-code":[
+"2.7.1.11"
+],
+"metanetx.reaction":[
+"MNXR102507"
+],
+"rhea":[
+"16111",
+"16109",
+"16110",
+"16112"
+],
+"sbo":"SBO:0000176"
+}
+},
+{
+"id":"PFL",
+"name":"Pyruvate formate lyase",
+"metabolites":{
+"accoa_c":1.0,
+"coa_c":-1.0,
+"for_c":1.0,
+"pyr_c":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"((b0902 and b0903) and b2579) or (b0902 and b0903) or (b0902 and b3114) or (b3951 and b3952)",
+"subsystem":"Pyruvate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"PFL"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PFL"
+],
+"biocyc":[
+"META:PYRUVFORMLY-RXN"
+],
+"ec-code":[
+"2.3.1.54"
+],
+"kegg.reaction":[
+"R00212"
+],
+"metanetx.reaction":[
+"MNXR102514"
+],
+"rhea":[
+"11847",
+"11845",
+"11844",
+"11846"
+],
+"sabiork":[
+"146"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00157"
+]
+}
+},
+{
+"id":"PGI",
+"name":"Glucose-6-phosphate isomerase",
+"metabolites":{
+"f6p_c":1.0,
+"g6p_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b4025",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"PGI"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PGI"
+],
+"biocyc":[
+"META:PGLUCISOM-RXN"
+],
+"ec-code":[
+"5.3.1.9"
+],
+"metanetx.reaction":[
+"MNXR102535"
+],
+"sbo":"SBO:0000176"
+}
+},
+{
+"id":"PGK",
+"name":"Phosphoglycerate kinase",
+"metabolites":{
+"13dpg_c":1.0,
+"3pg_c":-1.0,
+"adp_c":1.0,
+"atp_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2926",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"PGK"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PGK"
+],
+"biocyc":[
+"META:PHOSGLYPHOS-RXN"
+],
+"ec-code":[
+"2.7.2.3"
+],
+"kegg.reaction":[
+"R01512"
+],
+"metanetx.reaction":[
+"MNXR102538"
+],
+"reactome.reaction":[
+"R-ATH-71850",
+"R-DME-71850",
+"R-GGA-71850",
+"R-SPO-71850",
+"R-OSA-71850",
+"R-GGA-353039",
+"R-GGA-353023",
+"R-BTA-71850",
+"R-CFA-70486",
+"R-MMU-71850",
+"R-DME-70486",
+"R-PFA-71850",
+"R-SPO-70486",
+"R-SCE-70486",
+"R-PFA-70486",
+"R-SSC-70486",
+"R-ATH-70486",
+"R-DRE-70486",
+"R-HSA-70486",
+"R-OSA-70486",
+"R-XTR-71850",
+"R-MMU-70486",
+"R-RNO-70486",
+"R-TGU-70486",
+"R-DRE-71850",
+"R-SSC-71850",
+"R-SCE-71850",
+"R-CFA-71850",
+"R-XTR-70486",
+"R-DDI-70486",
+"R-DDI-71850",
+"R-RNO-71850",
+"R-BTA-70486",
+"R-CEL-70486",
+"R-HSA-71850",
+"R-CEL-71850",
+"R-GGA-70486",
+"R-TGU-71850"
+],
+"rhea":[
+"14801",
+"14804",
+"14802",
+"14803"
+],
+"sabiork":[
+"7644"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn01100"
+]
+}
+},
+{
+"id":"PGL",
+"name":"6-phosphogluconolactonase",
+"metabolites":{
+"6pgc_c":1.0,
+"6pgl_c":-1.0,
+"h2o_c":-1.0,
+"h_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0767",
+"subsystem":"Pentose Phosphate Pathway",
+"notes":{
+"original_bigg_ids":[
+"PGL"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PGL"
+],
+"biocyc":[
+"META:6PGLUCONOLACT-RXN"
+],
+"ec-code":[
+"3.1.1.31"
+],
+"kegg.reaction":[
+"R02035"
+],
+"metanetx.reaction":[
+"MNXR102539"
+],
+"reactome.reaction":[
+"R-OSA-71296",
+"R-CFA-71296",
+"R-CEL-71296",
+"R-GGA-71296",
+"R-MMU-71296",
+"R-SSC-71296",
+"R-BTA-71296",
+"R-ATH-71296",
+"R-DME-71296",
+"R-DRE-71296",
+"R-SCE-71296",
+"R-HSA-71296",
+"R-XTR-71296",
+"R-RNO-71296",
+"R-DDI-71296",
+"R-SPO-71296"
+],
+"rhea":[
+"12559",
+"12556",
+"12557",
+"12558"
+],
+"sabiork":[
+"109"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn01476"
+]
+}
+},
+{
+"id":"ACALD",
+"name":"Acetaldehyde dehydrogenase (acetylating)",
+"metabolites":{
+"acald_c":-1.0,
+"accoa_c":1.0,
+"coa_c":-1.0,
+"h_c":1.0,
+"nad_c":-1.0,
+"nadh_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0351 or b1241",
+"subsystem":"Pyruvate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"ACALD"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ACALD"
+],
+"biocyc":[
+"META:ACETALD-DEHYDROG-RXN"
+],
+"ec-code":[
+"1.2.1.10"
+],
+"kegg.reaction":[
+"R00228"
+],
+"metanetx.reaction":[
+"MNXR95210"
+],
+"rhea":[
+"23290",
+"23291",
+"23289",
+"23288"
+],
+"sabiork":[
+"163"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00171"
+]
+}
+},
+{
+"id":"AKGt2r",
+"name":"2 oxoglutarate reversible transport via symport",
+"metabolites":{
+"akg_c":1.0,
+"akg_e":-1.0,
+"h_c":1.0,
+"h_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2587",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"AKGt2r"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"AKGt2r"
+],
+"biocyc":[
+"META:TRANS-RXN-23"
+],
+"metanetx.reaction":[
+"MNXR95661"
+],
+"rhea":[
+"29011",
+"29013",
+"29012",
+"29014"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn05493",
+"rxn08095",
+"rxn09827"
+]
+}
+},
+{
+"id":"PGM",
+"name":"Phosphoglycerate mutase",
+"metabolites":{
+"2pg_c":-1.0,
+"3pg_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3612 or b4395 or b0755",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"PGM"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PGM"
+],
+"biocyc":[
+"META:3PGAREARR-RXN",
+"META:RXN-15513"
+],
+"ec-code":[
+"5.4.2.1",
+"5.4.2.11",
+"5.4.2.12"
+],
+"kegg.reaction":[
+"R01518"
+],
+"metanetx.reaction":[
+"MNXR102547"
+],
+"reactome.reaction":[
+"R-XTR-71654",
+"R-SSC-71654",
+"R-DME-71445",
+"R-XTR-71445",
+"R-RNO-71445",
+"R-GGA-71654",
+"R-SSC-71445",
+"R-GGA-71445",
+"R-DDI-71654",
+"R-SPO-71654",
+"R-MMU-71445",
+"R-BTA-71445",
+"R-CFA-71445",
+"R-PFA-71445",
+"R-GGA-352994",
+"R-TGU-71654",
+"R-SPO-71445",
+"R-HSA-71445",
+"R-ATH-71654",
+"R-MMU-71654",
+"R-BTA-71654",
+"R-GGA-353014",
+"R-DRE-71654",
+"R-HSA-71654",
+"R-CFA-71654",
+"R-OSA-71654",
+"R-DDI-71445",
+"R-RNO-71654",
+"R-DRE-71445",
+"R-OSA-71445",
+"R-PFA-71654",
+"R-DME-71654",
+"R-TGU-71445",
+"R-SCE-71445",
+"R-ATH-71445",
+"R-SCE-71654"
+],
+"rhea":[
+"15902",
+"15903",
+"15901",
+"15904"
+],
+"sabiork":[
+"7641"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn01106"
+]
+}
+},
+{
+"id":"PIt2r",
+"name":"Phosphate reversible transport via symport",
+"metabolites":{
+"h_c":1.0,
+"h_e":-1.0,
+"pi_c":1.0,
+"pi_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2987 or b3493",
+"subsystem":"Inorganic Ion Transport and Metabolism",
+"notes":{
+"original_bigg_ids":[
+"PIt2r"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PIt2r"
+],
+"biocyc":[
+"META:TRANS-RXN-114"
+],
+"metanetx.reaction":[
+"MNXR102872"
+],
+"rhea":[
+"29939",
+"29941",
+"29940",
+"29942"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn05312",
+"rxn09833",
+"rxn09811",
+"rxn09872",
+"rxn09723",
+"rxn09120"
+]
+}
+},
+{
+"id":"ALCD2x",
+"name":"Alcohol dehydrogenase (ethanol)",
+"metabolites":{
+"acald_c":1.0,
+"etoh_c":-1.0,
+"h_c":1.0,
+"nad_c":-1.0,
+"nadh_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0356 or b1478 or b1241",
+"subsystem":"Pyruvate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"ALCD2x"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ALCD2x"
+],
+"biocyc":[
+"META:ALCOHOL-DEHYDROG-RXN"
+],
+"ec-code":[
+"1.1.1.71",
+"1.1.1.1"
+],
+"kegg.reaction":[
+"R00754"
+],
+"metanetx.reaction":[
+"MNXR95725"
+],
+"reactome.reaction":[
+"R-MMU-71707",
+"R-XTR-71707",
+"R-CFA-71707",
+"R-OSA-71707",
+"R-RNO-71707",
+"R-HSA-71707",
+"R-SSC-71707",
+"R-GGA-71707",
+"R-SPO-71707",
+"R-DME-71707",
+"R-DRE-71707",
+"R-BTA-71707",
+"R-ATH-71707",
+"R-SCE-71707",
+"R-TGU-71707",
+"R-CEL-71707",
+"R-DDI-71707"
+],
+"rhea":[
+"25292",
+"25290",
+"25291",
+"25293"
+],
+"sabiork":[
+"597"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00543"
+]
+}
+},
+{
+"id":"ACALDt",
+"name":"Acetaldehyde reversible transport",
+"metabolites":{
+"acald_c":1.0,
+"acald_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"s0001",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"ACALDt"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ACALDt"
+],
+"metanetx.reaction":[
+"MNXR95212"
+],
+"reactome.reaction":[
+"R-HSA-449872"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn09700",
+"rxn08033",
+"rxn13212",
+"rxn08032"
+]
+}
+},
+{
+"id":"ACKr",
+"name":"Acetate kinase",
+"metabolites":{
+"ac_c":-1.0,
+"actp_c":1.0,
+"adp_c":1.0,
+"atp_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3115 or b2296 or b1849",
+"subsystem":"Pyruvate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"ACKr"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ACKr"
+],
+"biocyc":[
+"META:ACETATEKIN-RXN"
+],
+"ec-code":[
+"2.7.2.15",
+"2.7.2.1"
+],
+"kegg.reaction":[
+"R00315"
+],
+"metanetx.reaction":[
+"MNXR95269"
+],
+"rhea":[
+"11354",
+"11355",
+"11353",
+"11352"
+],
+"sabiork":[
+"71"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00225"
+]
+}
+},
+{
+"id":"PPC",
+"name":"Phosphoenolpyruvate carboxylase",
+"metabolites":{
+"co2_c":-1.0,
+"h2o_c":-1.0,
+"h_c":1.0,
+"oaa_c":1.0,
+"pep_c":-1.0,
+"pi_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3956",
+"subsystem":"Anaplerotic reactions",
+"notes":{
+"original_bigg_ids":[
+"PPC"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PPC"
+],
+"ec-code":[
+"4.1.1.31"
+],
+"kegg.reaction":[
+"R00345"
+],
+"metanetx.reaction":[
+"MNXR103096"
+],
+"rhea":[
+"23073",
+"23072",
+"23075",
+"23074"
+],
+"sabiork":[
+"150"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00251"
+]
+}
+},
+{
+"id":"ACONTa",
+"name":"Aconitase (half-reaction A, Citrate hydro-lyase)",
+"metabolites":{
+"acon_C_c":1.0,
+"cit_c":-1.0,
+"h2o_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0118 or b1276",
+"subsystem":"Citric Acid Cycle",
+"notes":{
+"original_bigg_ids":[
+"ACONTa"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ACONTa"
+],
+"biocyc":[
+"META:ACONITATEDEHYDR-RXN"
+],
+"ec-code":[
+"4.2.1.3"
+],
+"kegg.reaction":[
+"R01325"
+],
+"metanetx.reaction":[
+"MNXR95386"
+],
+"rhea":[
+"10230",
+"10229",
+"10231",
+"10228"
+],
+"sabiork":[
+"268"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00974"
+]
+}
+},
+{
+"id":"ACONTb",
+"name":"Aconitase (half-reaction B, Isocitrate hydro-lyase)",
+"metabolites":{
+"acon_C_c":-1.0,
+"h2o_c":-1.0,
+"icit_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0118 or b1276",
+"subsystem":"Citric Acid Cycle",
+"notes":{
+"original_bigg_ids":[
+"ACONTb"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ACONTb"
+],
+"ec-code":[
+"4.2.1.3"
+],
+"kegg.reaction":[
+"R01900"
+],
+"metanetx.reaction":[
+"MNXR95387"
+],
+"rhea":[
+"22145",
+"22144",
+"22146",
+"22147"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn01388"
+]
+}
+},
+{
+"id":"ATPM",
+"name":"ATP maintenance requirement",
+"metabolites":{
+"adp_c":1.0,
+"atp_c":-1.0,
+"h2o_c":-1.0,
+"h_c":1.0,
+"pi_c":1.0
+},
+"lower_bound":8.39,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Biomass and maintenance functions",
+"notes":{
+"original_bigg_ids":[
+"ATPM"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ATPM"
+],
+"biocyc":[
+"META:ATPASE-RXN"
+],
+"ec-code":[
+"3.6.1.5",
+"3.6.3.34",
+"3.6.3.20",
+"3.6.3.53",
+"3.6.3.8",
+"3.6.3.32",
+"3.6.4.12",
+"3.6.3.48",
+"3.6.3.40",
+"3.6.3.9",
+"3.6.3.23",
+"3.6.3.22",
+"3.6.3.54",
+"3.6.3.1",
+"3.6.1.8",
+"3.6.3.29",
+"3.6.3.17",
+"3.6.3.50",
+"3.6.3.39",
+"3.6.3.19",
+"3.6.3.4",
+"3.6.3.35",
+"3.6.3.16",
+"3.6.4.4",
+"3.6.3.37",
+"3.6.4.8",
+"3.6.3.31",
+"3.6.3.6",
+"3.6.4.5",
+"3.6.3.52",
+"3.6.3.2",
+"3.6.3.14",
+"3.6.3.51",
+"3.6.3.25",
+"3.6.3.38",
+"3.6.3.33",
+"3.6.3.43",
+"3.6.4.10",
+"3.6.4.13",
+"3.6.3.3",
+"3.6.3.10",
+"3.6.3.24",
+"3.6.3.44",
+"3.6.3.15",
+"3.6.3.5",
+"3.6.1.3",
+"3.6.1.15",
+"3.6.4.2",
+"3.6.4.3",
+"3.6.3.42",
+"3.6.3.11",
+"3.6.3.28",
+"3.6.3.30",
+"3.6.4.1",
+"3.6.4.11",
+"3.6.3.47",
+"3.6.4.6",
+"3.6.3.36",
+"3.6.3.21",
+"3.6.3.12",
+"3.6.3.18",
+"3.6.3.26",
+"3.6.3.27",
+"3.6.3.7",
+"3.6.4.9",
+"3.6.4.7",
+"3.6.3.46",
+"3.6.3.41",
+"3.6.3.49"
+],
+"kegg.reaction":[
+"R00086"
+],
+"metanetx.reaction":[
+"MNXR96131"
+],
+"rhea":[
+"13066",
+"13065",
+"13068",
+"13067"
+],
+"sabiork":[
+"75"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn11300",
+"rxn09694",
+"rxn00062"
+]
+}
+},
+{
+"id":"PPCK",
+"name":"Phosphoenolpyruvate carboxykinase",
+"metabolites":{
+"adp_c":1.0,
+"atp_c":-1.0,
+"co2_c":1.0,
+"oaa_c":-1.0,
+"pep_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3403",
+"subsystem":"Anaplerotic reactions",
+"notes":{
+"original_bigg_ids":[
+"PPCK"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PPCK"
+],
+"biocyc":[
+"META:PEPCARBOXYKIN-RXN"
+],
+"ec-code":[
+"4.1.1.49"
+],
+"kegg.reaction":[
+"R00341"
+],
+"metanetx.reaction":[
+"MNXR103099"
+],
+"rhea":[
+"18620",
+"18618",
+"18617",
+"18619"
+],
+"sabiork":[
+"151"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00247"
+]
+}
+},
+{
+"id":"ACt2r",
+"name":"Acetate reversible transport via proton symport",
+"metabolites":{
+"ac_c":1.0,
+"ac_e":-1.0,
+"h_c":1.0,
+"h_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"ACt2r"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ACt2r"
+],
+"biocyc":[
+"META:TRANS-RXN0-571"
+],
+"metanetx.reaction":[
+"MNXR95429"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn08061",
+"rxn05488"
+]
+}
+},
+{
+"id":"PPS",
+"name":"Phosphoenolpyruvate synthase",
+"metabolites":{
+"amp_c":1.0,
+"atp_c":-1.0,
+"h2o_c":-1.0,
+"h_c":2.0,
+"pep_c":1.0,
+"pi_c":1.0,
+"pyr_c":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1702",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"PPS"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PPS"
+],
+"biocyc":[
+"META:PEPSYNTH-RXN"
+],
+"ec-code":[
+"2.7.9.2"
+],
+"kegg.reaction":[
+"R00199"
+],
+"metanetx.reaction":[
+"MNXR103140"
+],
+"rhea":[
+"11364",
+"11367",
+"11366",
+"11365"
+],
+"sabiork":[
+"148"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00147"
+]
+}
+},
+{
+"id":"ADK1",
+"name":"Adenylate kinase",
+"metabolites":{
+"adp_c":2.0,
+"amp_c":-1.0,
+"atp_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0474",
+"subsystem":"Oxidative Phosphorylation",
+"notes":{
+"original_bigg_ids":[
+"ADK1"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ADK1"
+],
+"biocyc":[
+"META:ADENYL-KIN-RXN"
+],
+"ec-code":[
+"2.7.4.3"
+],
+"kegg.reaction":[
+"R00127"
+],
+"metanetx.reaction":[
+"MNXR95450"
+],
+"reactome.reaction":[
+"R-ATH-110145",
+"R-SSC-110144",
+"R-ATH-110144",
+"R-SSC-110145",
+"R-GGA-110145",
+"R-PFA-110144",
+"R-HSA-110145",
+"R-RNO-110144",
+"R-OSA-110145",
+"R-SCE-110145",
+"R-RNO-110145",
+"R-XTR-110144",
+"R-SCE-110144",
+"R-PFA-110145",
+"R-OSA-110144",
+"R-HSA-110144",
+"R-BTA-110144",
+"R-DRE-110145",
+"R-DRE-110144",
+"R-SPO-110145",
+"R-CEL-110144",
+"R-CFA-110144",
+"R-XTR-110145",
+"R-MMU-110144",
+"R-DME-110144",
+"R-SPO-110144",
+"R-DDI-110145",
+"R-GGA-110144",
+"R-TGU-110144",
+"R-BTA-110145",
+"R-CEL-110145",
+"R-CFA-110145",
+"R-DME-110145",
+"R-TGU-110145",
+"R-DDI-110144",
+"R-MMU-110145"
+],
+"rhea":[
+"12975",
+"12973",
+"12976",
+"12974"
+],
+"sabiork":[
+"82"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00097"
+]
+}
+},
+{
+"id":"AKGDH",
+"name":"2-Oxogluterate dehydrogenase",
+"metabolites":{
+"akg_c":-1.0,
+"co2_c":1.0,
+"coa_c":-1.0,
+"nad_c":-1.0,
+"nadh_c":1.0,
+"succoa_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0116 and b0726 and b0727",
+"subsystem":"Citric Acid Cycle",
+"notes":{
+"original_bigg_ids":[
+"AKGDH"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"AKGDH"
+],
+"biocyc":[
+"META:2OXOGLUTARATEDEH-RXN"
+],
+"ec-code":[
+"1.2.1.52",
+"2.3.1.61",
+"1.8.1.4",
+"1.2.4.2"
+],
+"kegg.reaction":[
+"R08549"
+],
+"metanetx.reaction":[
+"MNXR95655"
+],
+"reactome.reaction":[
+"R-PFA-71401",
+"R-XTR-71401",
+"R-SCE-71401",
+"R-SSC-71401",
+"R-TGU-71401",
+"R-ATH-71401",
+"R-OSA-71401",
+"R-SPO-71401",
+"R-CEL-71401",
+"R-RNO-71401",
+"R-DRE-71401",
+"R-GGA-373042",
+"R-DDI-71401",
+"R-CFA-71401",
+"R-HSA-71401",
+"R-BTA-71401",
+"R-DME-71401",
+"R-MMU-71401",
+"R-GGA-71401"
+],
+"rhea":[
+"27789",
+"27788",
+"27786",
+"27787"
+],
+"sabiork":[
+"8163"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn08094"
+]
+}
+},
+{
+"id":"ATPS4r",
+"name":"ATP synthase (four protons for one ATP)",
+"metabolites":{
+"adp_c":-1.0,
+"atp_c":1.0,
+"h2o_c":1.0,
+"h_c":3.0,
+"h_e":-4.0,
+"pi_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"((b3736 and b3737 and b3738) and (b3731 and b3732 and b3733 and b3734 and b3735)) or ((b3736 and b3737 and b3738) and (b3731 and b3732 and b3733 and b3734 and b3735) and b3739)",
+"subsystem":"Oxidative Phosphorylation",
+"notes":{
+"original_bigg_ids":[
+"ATPS4r"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ATPS4r"
+],
+"biocyc":[
+"META:ATPSYN-RXN"
+],
+"ec-code":[
+"3.6.3.14"
+],
+"metanetx.reaction":[
+"MNXR96136"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn08173",
+"rxn10042"
+]
+}
+},
+{
+"id":"PTAr",
+"name":"Phosphotransacetylase",
+"metabolites":{
+"accoa_c":-1.0,
+"actp_c":1.0,
+"coa_c":1.0,
+"pi_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2297 or b2458",
+"subsystem":"Pyruvate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"PTAr"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PTAr"
+],
+"biocyc":[
+"META:PHOSACETYLTRANS-RXN"
+],
+"ec-code":[
+"2.3.1.8"
+],
+"kegg.reaction":[
+"R00230"
+],
+"metanetx.reaction":[
+"MNXR103319"
+],
+"rhea":[
+"19521",
+"19523",
+"19522",
+"19524"
+],
+"sabiork":[
+"72"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00173"
+]
+}
+},
+{
+"id":"PYK",
+"name":"Pyruvate kinase",
+"metabolites":{
+"adp_c":-1.0,
+"atp_c":1.0,
+"h_c":-1.0,
+"pep_c":-1.0,
+"pyr_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1854 or b1676",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"PYK"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PYK"
+],
+"biocyc":[
+"META:PEPDEPHOS-RXN"
+],
+"ec-code":[
+"2.7.1.40"
+],
+"kegg.reaction":[
+"R00200"
+],
+"metanetx.reaction":[
+"MNXR103371"
+],
+"reactome.reaction":[
+"R-SSC-71670",
+"R-GGA-353056",
+"R-DRE-71670",
+"R-OSA-71670",
+"R-SPO-71670",
+"R-DDI-71670",
+"R-SCE-71670",
+"R-CEL-71670",
+"R-PFA-71670",
+"R-HSA-71670",
+"R-TGU-71670",
+"R-DME-71670",
+"R-ATH-71670",
+"R-BTA-71670",
+"R-MMU-71670",
+"R-RNO-71670",
+"R-GGA-71670",
+"R-CFA-71670",
+"R-XTR-71670"
+],
+"rhea":[
+"18160",
+"18159",
+"18158",
+"18157"
+],
+"sabiork":[
+"9"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00148"
+]
+}
+},
+{
+"id":"BIOMASS_Ecoli_core_w_GAM",
+"name":"Biomass Objective Function with GAM",
+"metabolites":{
+"3pg_c":-1.496,
+"accoa_c":-3.7478,
+"adp_c":59.81,
+"akg_c":4.1182,
+"atp_c":-59.81,
+"coa_c":3.7478,
+"e4p_c":-0.361,
+"f6p_c":-0.0709,
+"g3p_c":-0.129,
+"g6p_c":-0.205,
+"gln__L_c":-0.2557,
+"glu__L_c":-4.9414,
+"h2o_c":-59.81,
+"h_c":59.81,
+"nad_c":-3.547,
+"nadh_c":3.547,
+"nadp_c":13.0279,
+"nadph_c":-13.0279,
+"oaa_c":-1.7867,
+"pep_c":-0.5191,
+"pi_c":59.81,
+"pyr_c":-2.8328,
+"r5p_c":-0.8977
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"objective_coefficient":1.0,
+"subsystem":"Biomass and maintenance functions",
+"notes":{
+"original_bigg_ids":[
+"Biomass_Ecoli_core_w_GAM"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"BIOMASS_Ecoli_core_w_GAM"
+],
+"metanetx.reaction":[
+"MNXR96280"
+],
+"sbo":"SBO:0000629"
+}
+},
+{
+"id":"PYRt2",
+"name":"Pyruvate transport in via proton symport",
+"metabolites":{
+"h_c":1.0,
+"h_e":-1.0,
+"pyr_c":1.0,
+"pyr_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"PYRt2r"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PYRt2"
+],
+"metanetx.reaction":[
+"MNXR103385"
+],
+"reactome.reaction":[
+"R-RNO-372347",
+"R-HSA-372342",
+"R-GGA-372359"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn05469",
+"rxn09832",
+"rxn09717",
+"rxn09217"
+]
+}
+},
+{
+"id":"CO2t",
+"name":"CO2 transporter via diffusion",
+"metabolites":{
+"co2_c":1.0,
+"co2_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"s0001",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"CO2t"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"CO2t"
+],
+"biocyc":[
+"META:TRANS-RXN0-545"
+],
+"metanetx.reaction":[
+"MNXR96810"
+],
+"reactome.reaction":[
+"R-DDI-1247645",
+"R-CFA-1237069",
+"R-TGU-1247649",
+"R-CFA-1237042",
+"R-CEL-1247645",
+"R-XTR-1237069",
+"R-HSA-1247645",
+"R-OSA-1237042",
+"R-GGA-1237042",
+"R-BTA-1247645",
+"R-GGA-1247649",
+"R-RNO-1247645",
+"R-XTR-1247645",
+"R-TGU-1237042",
+"R-SCE-1247649",
+"R-MMU-1247649",
+"R-CFA-1247649",
+"R-GGA-1247645",
+"R-SSC-1247645",
+"R-BTA-1237069",
+"R-RNO-1237069",
+"R-SCE-1237042",
+"R-DDI-1247649",
+"R-SSC-1237042",
+"R-DRE-1247649",
+"R-DRE-1237042",
+"R-DDI-1237042",
+"R-DME-1237042",
+"R-MMU-1237042",
+"R-SSC-1247649",
+"R-TGU-1237069",
+"R-BTA-1247649",
+"R-CFA-1247645",
+"R-RNO-1247649",
+"R-HSA-1237069",
+"R-CEL-1237069",
+"R-DDI-1237069",
+"R-MMU-1237069",
+"R-DME-1247645",
+"R-ATH-1237042",
+"R-OSA-1247649",
+"R-HSA-1237042",
+"R-DRE-1247645",
+"R-HSA-1247649",
+"R-MMU-1247645",
+"R-DME-1237069",
+"R-RNO-1237042",
+"R-TGU-1247645",
+"R-BTA-1237042",
+"R-GGA-1237069",
+"R-DME-1247649",
+"R-SSC-1237069",
+"R-DRE-1237069",
+"R-ATH-1247649"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn05467",
+"rxn08237",
+"rxn09706",
+"rxn09821",
+"rxn09775",
+"rxn09876",
+"rxn08238",
+"rxn09860"
+]
+}
+},
+{
+"id":"RPE",
+"name":"Ribulose 5-phosphate 3-epimerase",
+"metabolites":{
+"ru5p__D_c":-1.0,
+"xu5p__D_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3386 or b4301",
+"subsystem":"Pentose Phosphate Pathway",
+"notes":{
+"original_bigg_ids":[
+"RPE"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"RPE"
+],
+"biocyc":[
+"META:RIBULP3EPIM-RXN"
+],
+"ec-code":[
+"5.1.3.1"
+],
+"kegg.reaction":[
+"R01529"
+],
+"metanetx.reaction":[
+"MNXR104083"
+],
+"reactome.reaction":[
+"R-SPO-71303",
+"R-CFA-199803",
+"R-ATH-71303",
+"R-SCE-71303",
+"R-CFA-71303",
+"R-DME-199803",
+"R-XTR-199803",
+"R-SSC-199803",
+"R-GGA-199803",
+"R-TGU-71303",
+"R-OSA-199803",
+"R-SSC-71303",
+"R-MMU-71303",
+"R-OSA-71303",
+"R-HSA-71303",
+"R-MMU-199803",
+"R-XTR-71303",
+"R-SPO-199803",
+"R-SCE-199803",
+"R-DDI-71303",
+"R-RNO-71303",
+"R-DME-71303",
+"R-HSA-199803",
+"R-DRE-71303",
+"R-PFA-199803",
+"R-CEL-199803",
+"R-RNO-199803",
+"R-PFA-71303",
+"R-CEL-71303",
+"R-TGU-199803",
+"R-GGA-71303",
+"R-DDI-199803",
+"R-BTA-71303",
+"R-ATH-199803",
+"R-DRE-199803",
+"R-BTA-199803"
+],
+"rhea":[
+"13677",
+"13680",
+"13678",
+"13679"
+],
+"sabiork":[
+"62"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn01116"
+]
+}
+},
+{
+"id":"CS",
+"name":"Citrate synthase",
+"metabolites":{
+"accoa_c":-1.0,
+"cit_c":1.0,
+"coa_c":1.0,
+"h2o_c":-1.0,
+"h_c":1.0,
+"oaa_c":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0720",
+"subsystem":"Citric Acid Cycle",
+"notes":{
+"original_bigg_ids":[
+"CS"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"CS"
+],
+"biocyc":[
+"META:CITSYN-RXN",
+"META:RXN-14905"
+],
+"ec-code":[
+"2.3.3.16",
+"2.3.3.1",
+"2.3.3.3"
+],
+"kegg.reaction":[
+"R00351"
+],
+"metanetx.reaction":[
+"MNXR96920"
+],
+"reactome.reaction":[
+"R-GGA-373006",
+"R-GGA-70975",
+"R-CEL-70975",
+"R-HSA-70975",
+"R-DRE-70975",
+"R-MMU-70975",
+"R-ATH-70975",
+"R-SPO-70975",
+"R-OSA-70975",
+"R-SCE-70975",
+"R-SSC-70975",
+"R-DDI-70975",
+"R-RNO-70975",
+"R-DME-70975",
+"R-PFA-70975",
+"R-XTR-70975",
+"R-CFA-70975",
+"R-BTA-70975"
+],
+"rhea":[
+"16847",
+"16846",
+"16845",
+"16848"
+],
+"sabiork":[
+"267"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00256"
+]
+}
+},
+{
+"id":"RPI",
+"name":"Ribose-5-phosphate isomerase",
+"metabolites":{
+"r5p_c":-1.0,
+"ru5p__D_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2914 or b4090",
+"subsystem":"Pentose Phosphate Pathway",
+"notes":{
+"original_bigg_ids":[
+"RPI"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"RPI"
+],
+"ec-code":[
+"5.3.1.6"
+],
+"metanetx.reaction":[
+"MNXR104084"
+],
+"sbo":"SBO:0000176"
+}
+},
+{
+"id":"SUCCt2_2",
+"name":"Succinate transport via proton symport (2 H)",
+"metabolites":{
+"h_c":2.0,
+"h_e":-2.0,
+"succ_c":1.0,
+"succ_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3528",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"SUCCt2_2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"SUCCt2_2"
+],
+"biocyc":[
+"META:TRANS-RXN-121"
+],
+"metanetx.reaction":[
+"MNXR104620"
+],
+"rhea":[
+"29305",
+"29306",
+"29304",
+"29303"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn10154",
+"rxn09269"
+]
+}
+},
+{
+"id":"CYTBD",
+"name":"Cytochrome oxidase bd (ubiquinol-8: 2 protons)",
+"metabolites":{
+"h2o_c":1.0,
+"h_c":-2.0,
+"h_e":2.0,
+"o2_c":-0.5,
+"q8_c":1.0,
+"q8h2_c":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"(b0978 and b0979) or (b0733 and b0734)",
+"subsystem":"Oxidative Phosphorylation",
+"notes":{
+"original_bigg_ids":[
+"CYTBD"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"CYTBD"
+],
+"metanetx.reaction":[
+"MNXR97031"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn12494",
+"rxn10112",
+"rxn08288"
+]
+}
+},
+{
+"id":"D_LACt2",
+"name":"D lactate transport via proton symport",
+"metabolites":{
+"h_c":1.0,
+"h_e":-1.0,
+"lac__D_c":1.0,
+"lac__D_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2975 or b3603",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"D_LACt2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"D_LACt2"
+],
+"biocyc":[
+"META:TRANS-RXN0-515"
+],
+"metanetx.reaction":[
+"MNXR97838"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn10171",
+"rxn09772",
+"rxn08350"
+]
+}
+},
+{
+"id":"ENO",
+"name":"Enolase",
+"metabolites":{
+"2pg_c":-1.0,
+"h2o_c":1.0,
+"pep_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2779",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"ENO"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ENO"
+],
+"biocyc":[
+"META:2PGADEHYDRAT-RXN"
+],
+"ec-code":[
+"4.2.1.11"
+],
+"kegg.reaction":[
+"R00658"
+],
+"metanetx.reaction":[
+"MNXR97932"
+],
+"reactome.reaction":[
+"R-BTA-71660",
+"R-RNO-70494",
+"R-TGU-71660",
+"R-SSC-71660",
+"R-GGA-352981",
+"R-DME-70494",
+"R-CFA-70494",
+"R-OSA-70494",
+"R-SCE-71660",
+"R-GGA-353044",
+"R-CFA-71660",
+"R-GGA-70494",
+"R-PFA-71660",
+"R-SPO-71660",
+"R-SPO-70494",
+"R-DDI-70494",
+"R-RNO-71660",
+"R-MMU-70494",
+"R-ATH-70494",
+"R-SCE-70494",
+"R-SSC-70494",
+"R-HSA-70494",
+"R-DME-71660",
+"R-CEL-71660",
+"R-HSA-71660",
+"R-TGU-70494",
+"R-XTR-71660",
+"R-DRE-70494",
+"R-DRE-71660",
+"R-MMU-71660",
+"R-ATH-71660",
+"R-BTA-70494",
+"R-CEL-70494",
+"R-XTR-70494",
+"R-DDI-71660",
+"R-OSA-71660",
+"R-PFA-70494",
+"R-GGA-71660"
+],
+"rhea":[
+"10166",
+"10165",
+"10164",
+"10167"
+],
+"sabiork":[
+"8"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00459"
+]
+}
+},
+{
+"id":"SUCCt3",
+"name":"Succinate transport out via proton antiport",
+"metabolites":{
+"h_c":1.0,
+"h_e":-1.0,
+"succ_c":-1.0,
+"succ_e":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"SUCCt3"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"SUCCt3"
+],
+"metanetx.reaction":[
+"MNXR104623"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn09270"
+]
+}
+},
+{
+"id":"ETOHt2r",
+"name":"Ethanol reversible transport via proton symport",
+"metabolites":{
+"etoh_c":1.0,
+"etoh_e":-1.0,
+"h_c":1.0,
+"h_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"ETOHt2r"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ETOHt2r"
+],
+"metanetx.reaction":[
+"MNXR97981"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn10146",
+"rxn08427"
+]
+}
+},
+{
+"id":"SUCDi",
+"name":"Succinate dehydrogenase (irreversible)",
+"metabolites":{
+"fum_c":1.0,
+"q8_c":-1.0,
+"q8h2_c":1.0,
+"succ_c":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0721 and b0722 and b0723 and b0724",
+"subsystem":"Oxidative Phosphorylation",
+"notes":{
+"original_bigg_ids":[
+"SUCDi"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"SUCDi"
+],
+"metanetx.reaction":[
+"MNXR99641"
+],
+"rhea":[
+"29190",
+"29189",
+"29187",
+"29188"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn09272"
+]
+}
+},
+{
+"id":"SUCOAS",
+"name":"Succinyl-CoA synthetase (ADP-forming)",
+"metabolites":{
+"adp_c":1.0,
+"atp_c":-1.0,
+"coa_c":-1.0,
+"pi_c":1.0,
+"succ_c":-1.0,
+"succoa_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0728 and b0729",
+"subsystem":"Citric Acid Cycle",
+"notes":{
+"original_bigg_ids":[
+"SUCOAS"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"SUCOAS"
+],
+"biocyc":[
+"META:SUCCCOASYN-RXN"
+],
+"ec-code":[
+"6.2.1.5"
+],
+"kegg.reaction":[
+"R00405"
+],
+"metanetx.reaction":[
+"MNXR104635"
+],
+"reactome.reaction":[
+"R-BTA-70997",
+"R-GGA-372977",
+"R-PFA-70997",
+"R-GGA-373134",
+"R-TGU-70997",
+"R-XTR-70997",
+"R-SSC-70997",
+"R-HSA-70997",
+"R-DRE-70997",
+"R-SCE-70997",
+"R-SPO-70997",
+"R-DDI-70997",
+"R-CFA-70997",
+"R-OSA-70997",
+"R-GGA-70997",
+"R-RNO-70997",
+"R-ATH-70997",
+"R-MMU-70997"
+],
+"rhea":[
+"17664",
+"17663",
+"17662",
+"17661"
+],
+"sabiork":[
+"260"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00285"
+]
+}
+},
+{
+"id":"TALA",
+"name":"Transaldolase",
+"metabolites":{
+"e4p_c":1.0,
+"f6p_c":1.0,
+"g3p_c":-1.0,
+"s7p_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2464 or b0008",
+"subsystem":"Pentose Phosphate Pathway",
+"notes":{
+"original_bigg_ids":[
+"TALA"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"TALA"
+],
+"biocyc":[
+"META:TRANSALDOL-RXN"
+],
+"ec-code":[
+"2.2.1.2"
+],
+"kegg.reaction":[
+"R01827"
+],
+"metanetx.reaction":[
+"MNXR104715"
+],
+"rhea":[
+"17056",
+"17055",
+"17054",
+"17053"
+],
+"sbo":"SBO:0000176"
+}
+},
+{
+"id":"THD2",
+"name":"NAD(P) transhydrogenase",
+"metabolites":{
+"h_c":2.0,
+"h_e":-2.0,
+"nad_c":1.0,
+"nadh_c":-1.0,
+"nadp_c":-1.0,
+"nadph_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1602 and b1603",
+"subsystem":"Oxidative Phosphorylation",
+"notes":{
+"original_bigg_ids":[
+"THD2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"THD2"
+],
+"ec-code":[
+"1.6.1.1"
+],
+"metanetx.reaction":[
+"MNXR104805"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn10125",
+"rxn09295"
+]
+}
+},
+{
+"id":"TKT1",
+"name":"Transketolase",
+"metabolites":{
+"g3p_c":1.0,
+"r5p_c":-1.0,
+"s7p_c":1.0,
+"xu5p__D_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2935 or b2465",
+"subsystem":"Pentose Phosphate Pathway",
+"notes":{
+"original_bigg_ids":[
+"TKT1"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"TKT1"
+],
+"ec-code":[
+"2.2.1.1"
+],
+"metanetx.reaction":[
+"MNXR104868"
+],
+"sbo":"SBO:0000176"
+}
+},
+{
+"id":"TKT2",
+"name":"Transketolase",
+"metabolites":{
+"e4p_c":-1.0,
+"f6p_c":1.0,
+"g3p_c":1.0,
+"xu5p__D_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2935 or b2465",
+"subsystem":"Pentose Phosphate Pathway",
+"notes":{
+"original_bigg_ids":[
+"TKT2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"TKT2"
+],
+"biocyc":[
+"META:2TRANSKETO-RXN"
+],
+"ec-code":[
+"2.2.1.1"
+],
+"kegg.reaction":[
+"R01830"
+],
+"metanetx.reaction":[
+"MNXR104869"
+],
+"rhea":[
+"27627",
+"27628",
+"27626",
+"27629"
+],
+"sbo":"SBO:0000176"
+}
+},
+{
+"id":"TPI",
+"name":"Triose-phosphate isomerase",
+"metabolites":{
+"dhap_c":-1.0,
+"g3p_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3919",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"TPI"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"TPI"
+],
+"biocyc":[
+"META:TRIOSEPISOMERIZATION-RXN"
+],
+"ec-code":[
+"5.3.1.1"
+],
+"kegg.reaction":[
+"R01015"
+],
+"metanetx.reaction":[
+"MNXR104918"
+],
+"reactome.reaction":[
+"R-RNO-70481",
+"R-MMU-70481",
+"R-XTR-70481",
+"R-SSC-70481",
+"R-GGA-352927",
+"R-SCE-70454",
+"R-CEL-70481",
+"R-PFA-70454",
+"R-XTR-70454",
+"R-BTA-70481",
+"R-BTA-70454",
+"R-GGA-352914",
+"R-ATH-70481",
+"R-CFA-70454",
+"R-OSA-70454",
+"R-HSA-70481",
+"R-DRE-70454",
+"R-DME-70481",
+"R-OSA-70481",
+"R-DRE-70481",
+"R-ATH-70454",
+"R-HSA-70454",
+"R-SSC-70454",
+"R-DDI-70454",
+"R-SCE-70481",
+"R-CFA-70481",
+"R-PFA-70481",
+"R-DDI-70481",
+"R-SPO-70454",
+"R-SPO-70481",
+"R-RNO-70454",
+"R-MMU-70454",
+"R-CEL-70454",
+"R-GGA-70481",
+"R-GGA-70454",
+"R-DME-70454"
+],
+"rhea":[
+"18587",
+"18588",
+"18586",
+"18585"
+],
+"sabiork":[
+"4"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00747"
+]
+}
+},
+{
+"id":"EX_ac_e",
+"name":"Acetate exchange",
+"metabolites":{
+"ac_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_ac_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_ac_e"
+],
+"biocyc":[
+"META:RXN0-1981",
+"META:TRANS-RXN0-567"
+],
+"metanetx.reaction":[
+"MNXR95431"
+],
+"rhea":[
+"27817",
+"27814",
+"27816",
+"27815"
+],
+"sabiork":[
+"12184"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn09787",
+"rxn09866",
+"rxn10904",
+"rxn08063"
+]
+}
+},
+{
+"id":"EX_acald_e",
+"name":"Acetaldehyde exchange",
+"metabolites":{
+"acald_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_acald_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_acald_e"
+],
+"metanetx.reaction":[
+"MNXR95212"
+],
+"reactome.reaction":[
+"R-HSA-449872"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn09700",
+"rxn08033",
+"rxn13212",
+"rxn08032"
+]
+}
+},
+{
+"id":"EX_akg_e",
+"name":"2-Oxoglutarate exchange",
+"metabolites":{
+"akg_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_akg_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_akg_e"
+],
+"metanetx.reaction":[
+"MNXR95663"
+],
+"sabiork":[
+"13794"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn10923",
+"rxn08096",
+"rxn13220"
+]
+}
+},
+{
+"id":"EX_co2_e",
+"name":"CO2 exchange",
+"metabolites":{
+"co2_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_co2_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_co2_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-545"
+],
+"metanetx.reaction":[
+"MNXR96810"
+],
+"reactome.reaction":[
+"R-DDI-1247645",
+"R-CFA-1237069",
+"R-TGU-1247649",
+"R-CFA-1237042",
+"R-CEL-1247645",
+"R-XTR-1237069",
+"R-HSA-1247645",
+"R-OSA-1237042",
+"R-GGA-1237042",
+"R-BTA-1247645",
+"R-GGA-1247649",
+"R-RNO-1247645",
+"R-XTR-1247645",
+"R-TGU-1237042",
+"R-SCE-1247649",
+"R-MMU-1247649",
+"R-CFA-1247649",
+"R-GGA-1247645",
+"R-SSC-1247645",
+"R-BTA-1237069",
+"R-RNO-1237069",
+"R-SCE-1237042",
+"R-DDI-1247649",
+"R-SSC-1237042",
+"R-DRE-1247649",
+"R-DRE-1237042",
+"R-DDI-1237042",
+"R-DME-1237042",
+"R-MMU-1237042",
+"R-SSC-1247649",
+"R-TGU-1237069",
+"R-BTA-1247649",
+"R-CFA-1247645",
+"R-RNO-1247649",
+"R-HSA-1237069",
+"R-CEL-1237069",
+"R-DDI-1237069",
+"R-MMU-1237069",
+"R-DME-1247645",
+"R-ATH-1237042",
+"R-OSA-1247649",
+"R-HSA-1237042",
+"R-DRE-1247645",
+"R-HSA-1247649",
+"R-MMU-1247645",
+"R-DME-1237069",
+"R-RNO-1237042",
+"R-TGU-1247645",
+"R-BTA-1237042",
+"R-GGA-1237069",
+"R-DME-1247649",
+"R-SSC-1237069",
+"R-DRE-1237069",
+"R-ATH-1247649"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn05467",
+"rxn08237",
+"rxn09706",
+"rxn09821",
+"rxn09775",
+"rxn09876",
+"rxn08238",
+"rxn09860"
+]
+}
+},
+{
+"id":"EX_etoh_e",
+"name":"Ethanol exchange",
+"metabolites":{
+"etoh_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_etoh_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_etoh_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-546"
+],
+"metanetx.reaction":[
+"MNXR97980"
+],
+"rhea":[
+"35269",
+"35267",
+"35270",
+"35268"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn09683",
+"rxn08428",
+"rxn09764"
+]
+}
+},
+{
+"id":"EX_for_e",
+"name":"Formate exchange",
+"metabolites":{
+"for_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_for_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_for_e"
+],
+"biocyc":[
+"META:TRANS-RXN-1"
+],
+"metanetx.reaction":[
+"MNXR99620"
+],
+"reactome.reaction":[
+"R-HSA-6803255"
+],
+"rhea":[
+"29681",
+"29680",
+"29682",
+"29679"
+],
+"sabiork":[
+"12483"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn09754",
+"rxn08525",
+"rxn09682",
+"rxn08526"
+]
+}
+},
+{
+"id":"EX_fru_e",
+"name":"D-Fructose exchange",
+"metabolites":{
+"fru_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_fru_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_fru_e"
+],
+"metanetx.reaction":[
+"MNXR99663"
+],
+"reactome.reaction":[
+"R-OSA-189222",
+"R-XTR-189222",
+"R-SCE-189222",
+"R-ATH-189222",
+"R-RNO-189222",
+"R-DME-189222",
+"R-TGU-189222",
+"R-SSC-189222",
+"R-CFA-189222",
+"R-DRE-189222",
+"R-HSA-189222",
+"R-GGA-189222",
+"R-BTA-189222",
+"R-MMU-189222",
+"R-DDI-189222"
+],
+"sabiork":[
+"13415"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn12996",
+"rxn08537"
+]
+}
+},
+{
+"id":"EX_fum_e",
+"name":"Fumarate exchange",
+"metabolites":{
+"fum_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_fum_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_fum_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-553"
+],
+"metanetx.reaction":[
+"MNXR99715"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn08544",
+"rxn11013"
+]
+}
+},
+{
+"id":"EX_glc__D_e",
+"name":"D-Glucose exchange",
+"metabolites":{
+"glc__D_e":-1.0
+},
+"lower_bound":-10.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_glc_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_glc__D_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-574"
+],
+"metanetx.reaction":[
+"MNXR100188"
+],
+"sabiork":[
+"7002",
+"601"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn09875",
+"rxn09679",
+"rxn08617"
+]
+}
+},
+{
+"id":"EX_gln__L_e",
+"name":"L-Glutamine exchange",
+"metabolites":{
+"gln__L_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_gln_L_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_gln__L_e"
+],
+"biocyc":[
+"META:TRANS-RXN-233"
+],
+"metanetx.reaction":[
+"MNXR100259"
+],
+"reactome.reaction":[
+"R-HSA-212651",
+"R-BTA-212614",
+"R-RNO-212614",
+"R-SSC-212614",
+"R-MMU-212614",
+"R-HSA-212614",
+"R-GGA-212614",
+"R-CFA-212614",
+"R-TGU-212614",
+"R-SCE-212614"
+],
+"sabiork":[
+"13421"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn08625",
+"rxn10928"
+]
+}
+},
+{
+"id":"EX_glu__L_e",
+"name":"L-Glutamate exchange",
+"metabolites":{
+"glu__L_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_glu_L_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_glu__L_e"
+],
+"biocyc":[
+"META:TRANS-RXN-234",
+"META:TRANS-RXN-232"
+],
+"metanetx.reaction":[
+"MNXR100301"
+],
+"reactome.reaction":[
+"R-HSA-212658",
+"R-TGU-210439",
+"R-GGA-210439",
+"R-XTR-210439",
+"R-RNO-210439",
+"R-CFA-210439",
+"R-CEL-210439",
+"R-DME-210439",
+"R-SSC-210439",
+"R-HSA-210439",
+"R-DRE-210439",
+"R-MMU-210439",
+"R-BTA-210439"
+],
+"sabiork":[
+"12283"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn08633",
+"rxn09750",
+"rxn13304",
+"rxn13120",
+"rxn10917"
+]
+}
+},
+{
+"id":"EX_h_e",
+"name":"H+ exchange",
+"metabolites":{
+"h_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_h_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_h_e"
+],
+"biocyc":[
+"META:RXN-14452"
+],
+"metanetx.reaction":[
+"MNXR100765"
+],
+"reactome.reaction":[
+"R-HSA-2534378",
+"R-DDI-74723",
+"R-BTA-170026",
+"R-CFA-170026",
+"R-SCE-74723",
+"R-DRE-74723",
+"R-HSA-170026",
+"R-TGU-2534378",
+"R-HSA-74723",
+"R-CFA-2534378",
+"R-TGU-74723",
+"R-OSA-170026",
+"R-RNO-2534378",
+"R-GGA-2534378",
+"R-MMU-2534378",
+"R-BTA-2534378",
+"R-SSC-2534378",
+"R-DRE-170026",
+"R-TGU-170026",
+"R-GGA-170026",
+"R-SCE-170026",
+"R-DRE-2534378",
+"R-BTA-74723",
+"R-SPO-74723",
+"R-XTR-74723",
+"R-RNO-74723",
+"R-XTR-2534378",
+"R-MMU-74723",
+"R-CFA-74723",
+"R-GGA-74723",
+"R-CEL-170026",
+"R-MMU-170026",
+"R-ATH-74723",
+"R-DME-74723",
+"R-PFA-74723",
+"R-SSC-74723",
+"R-XTR-170026",
+"R-SSC-170026",
+"R-CEL-74723",
+"R-ATH-170026",
+"R-RNO-170026",
+"R-DME-170026"
+],
+"rhea":[
+"34980",
+"34981",
+"34982",
+"34979"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn11009",
+"rxn08730"
+]
+}
+},
+{
+"id":"EX_h2o_e",
+"name":"H2O exchange",
+"metabolites":{
+"h2o_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_h2o_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_h2o_e"
+],
+"biocyc":[
+"META:TRANS-RXN-145",
+"META:TRANS-RXN0-547"
+],
+"metanetx.reaction":[
+"MNXR98641"
+],
+"reactome.reaction":[
+"R-ATH-507868",
+"R-CFA-432054",
+"R-CFA-432010",
+"R-RNO-507868",
+"R-OSA-432065",
+"R-GGA-432010",
+"R-SPO-445714",
+"R-PFA-445714",
+"R-CFA-432065",
+"R-GGA-432067",
+"R-TGU-432054",
+"R-TGU-445714",
+"R-OSA-507868",
+"R-DRE-507868",
+"R-SPO-507868",
+"R-BTA-432054",
+"R-GGA-507870",
+"R-OSA-432010",
+"R-DME-432065",
+"R-DRE-432067",
+"R-PFA-507868",
+"R-SSC-432054",
+"R-HSA-432065",
+"R-OSA-507870",
+"R-HSA-432054",
+"R-SSC-432065",
+"R-CEL-507868",
+"R-XTR-507868",
+"R-ATH-507870",
+"R-SCE-432065",
+"R-BTA-507870",
+"R-DME-432010",
+"R-CFA-445714",
+"R-DRE-445714",
+"R-BTA-507868",
+"R-GGA-507868",
+"R-RNO-432054",
+"R-RNO-432010",
+"R-SSC-432067",
+"R-CEL-445714",
+"R-DDI-432065",
+"R-ATH-432010",
+"R-SCE-432054",
+"R-MMU-432065",
+"R-MMU-445714",
+"R-GGA-432065",
+"R-HSA-432067",
+"R-SSC-507870",
+"R-SCE-432067",
+"R-RNO-507870",
+"R-DME-432054",
+"R-ATH-432067",
+"R-BTA-445714",
+"R-DRE-507870",
+"R-DME-507868",
+"R-DME-507870",
+"R-DRE-432010",
+"R-MMU-432010",
+"R-HSA-445714",
+"R-OSA-432054",
+"R-RNO-432067",
+"R-TGU-432010",
+"R-TGU-507868",
+"R-DDI-432054",
+"R-PFA-507870",
+"R-HSA-507870",
+"R-XTR-432067",
+"R-HSA-432010",
+"R-SSC-507868",
+"R-SCE-507870",
+"R-CEL-507870",
+"R-DDI-507868",
+"R-DRE-432054",
+"R-XTR-507870",
+"R-DDI-432010",
+"R-BTA-432065",
+"R-CFA-432067",
+"R-OSA-432067",
+"R-ATH-432065",
+"R-GGA-445714",
+"R-SCE-507868",
+"R-TGU-432065",
+"R-MMU-432067",
+"R-TGU-507870",
+"R-CFA-507870",
+"R-RNO-432065",
+"R-MMU-432054",
+"R-MMU-507868",
+"R-SPO-507870",
+"R-SCE-432010",
+"R-MMU-507870",
+"R-SSC-445714",
+"R-HSA-507868",
+"R-DME-432067",
+"R-SSC-432010",
+"R-TGU-432067",
+"R-GGA-432054",
+"R-BTA-432010",
+"R-SCE-445714",
+"R-DDI-507870",
+"R-ATH-432054",
+"R-DDI-432067",
+"R-XTR-445714",
+"R-BTA-432067",
+"R-CFA-507868",
+"R-RNO-445714"
+],
+"rhea":[
+"29668",
+"29669",
+"29667",
+"29670"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn08687",
+"rxn08686",
+"rxn09745",
+"rxn09838",
+"rxn09874",
+"rxn09812",
+"rxn09643",
+"rxn05319"
+]
+}
+},
+{
+"id":"EX_lac__D_e",
+"name":"D-lactate exchange",
+"metabolites":{
+"lac__D_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_lac_D_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_lac__D_e"
+],
+"metanetx.reaction":[
+"MNXR97840"
+],
+"sabiork":[
+"12471"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn08351"
+]
+}
+},
+{
+"id":"EX_mal__L_e",
+"name":"L-Malate exchange",
+"metabolites":{
+"mal__L_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_mal_L_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_mal__L_e"
+],
+"biocyc":[
+"META:TRANS-RXN-225",
+"META:TRANS-RXN-224"
+],
+"metanetx.reaction":[
+"MNXR101367"
+],
+"sabiork":[
+"13793"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn10967",
+"rxn08868"
+]
+}
+},
+{
+"id":"EX_nh4_e",
+"name":"Ammonia exchange",
+"metabolites":{
+"nh4_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_nh4_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_nh4_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-206",
+"META:RXN-9615",
+"META:TRANS-RXN0-544"
+],
+"metanetx.reaction":[
+"MNXR101950"
+],
+"reactome.reaction":[
+"R-CEL-444416",
+"R-SSC-444416",
+"R-DDI-444416",
+"R-MMU-444416",
+"R-DRE-444416",
+"R-GGA-444416",
+"R-CFA-444416",
+"R-HSA-444416",
+"R-XTR-444416",
+"R-BTA-444416",
+"R-RNO-444416",
+"R-TGU-444416",
+"R-DME-444416"
+],
+"rhea":[
+"28749",
+"28748",
+"28750",
+"28747"
+],
+"sabiork":[
+"11683"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn13364",
+"rxn09835",
+"rxn05466",
+"rxn08987",
+"rxn08986",
+"rxn09736"
+]
+}
+},
+{
+"id":"EX_o2_e",
+"name":"O2 exchange",
+"metabolites":{
+"o2_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_o2_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_o2_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-474"
+],
+"metanetx.reaction":[
+"MNXR102090"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn09641",
+"rxn05468",
+"rxn09031",
+"rxn09032",
+"rxn09734"
+]
+}
+},
+{
+"id":"EX_pi_e",
+"name":"Phosphate exchange",
+"metabolites":{
+"pi_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_pi_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_pi_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-470"
+],
+"metanetx.reaction":[
+"MNXR102871"
+],
+"rhea":[
+"32824",
+"32826",
+"32825",
+"32823"
+],
+"sabiork":[
+"10985"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn10838",
+"rxn09722",
+"rxn09121",
+"rxn13178"
+]
+}
+},
+{
+"id":"EX_pyr_e",
+"name":"Pyruvate exchange",
+"metabolites":{
+"pyr_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_pyr_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_pyr_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-506",
+"META:TRANS-RXN0-570"
+],
+"metanetx.reaction":[
+"MNXR103384"
+],
+"sabiork":[
+"12168"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn10929",
+"rxn09218"
+]
+}
+},
+{
+"id":"EX_succ_e",
+"name":"Succinate exchange",
+"metabolites":{
+"succ_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"",
+"subsystem":"Extracellular exchange",
+"notes":{
+"original_bigg_ids":[
+"EX_succ_e"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"EX_succ_e"
+],
+"biocyc":[
+"META:TRANS-RXN0-552"
+],
+"metanetx.reaction":[
+"MNXR104619"
+],
+"sbo":"SBO:0000627",
+"seed.reaction":[
+"rxn10952",
+"rxn09271"
+]
+}
+},
+{
+"id":"FBA",
+"name":"Fructose-bisphosphate aldolase",
+"metabolites":{
+"dhap_c":1.0,
+"fdp_c":-1.0,
+"g3p_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2097 or b1773 or b2925",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"FBA"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"FBA"
+],
+"ec-code":[
+"4.1.2.13"
+],
+"kegg.reaction":[
+"R01068"
+],
+"metanetx.reaction":[
+"MNXR99459"
+],
+"rhea":[
+"14729",
+"14732",
+"14731",
+"14730"
+],
+"sabiork":[
+"1338"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00786"
+]
+}
+},
+{
+"id":"FBP",
+"name":"Fructose-bisphosphatase",
+"metabolites":{
+"f6p_c":1.0,
+"fdp_c":-1.0,
+"h2o_c":-1.0,
+"pi_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3925 or b4232",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"FBP"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"FBP"
+],
+"ec-code":[
+"3.1.3.11"
+],
+"metanetx.reaction":[
+"MNXR99465"
+],
+"rhea":[
+"11067",
+"11065",
+"11066",
+"11064"
+],
+"sabiork":[
+"2084"
+],
+"sbo":"SBO:0000176"
+}
+},
+{
+"id":"FORt2",
+"name":"Formate transport in via proton symport",
+"metabolites":{
+"for_c":1.0,
+"for_e":-1.0,
+"h_c":1.0,
+"h_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0904 or b2492",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"FORt2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"FORt2"
+],
+"metanetx.reaction":[
+"MNXR99621"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn08524",
+"rxn05559"
+]
+}
+},
+{
+"id":"FORt",
+"name":"Formate transport via diffusion",
+"metabolites":{
+"for_c":1.0,
+"for_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":0.0,
+"gene_reaction_rule":"b0904 or b2492",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"FORti"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"FORt"
+],
+"biocyc":[
+"META:TRANS-RXN-1"
+],
+"metanetx.reaction":[
+"MNXR99620"
+],
+"reactome.reaction":[
+"R-HSA-6803255"
+],
+"rhea":[
+"29681",
+"29680",
+"29682",
+"29679"
+],
+"sabiork":[
+"12483"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn09754",
+"rxn08525",
+"rxn09682",
+"rxn08526"
+]
+}
+},
+{
+"id":"FRD7",
+"name":"Fumarate reductase",
+"metabolites":{
+"fum_c":-1.0,
+"q8_c":1.0,
+"q8h2_c":-1.0,
+"succ_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b4151 and b4152 and b4153 and b4154",
+"subsystem":"Oxidative Phosphorylation",
+"notes":{
+"original_bigg_ids":[
+"FRD7"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"FRD7"
+],
+"metanetx.reaction":[
+"MNXR99641"
+],
+"rhea":[
+"29190",
+"29189",
+"29187",
+"29188"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn09272"
+]
+}
+},
+{
+"id":"FRUpts2",
+"name":"Fructose transport via PEP:Pyr PTS (f6p generating)",
+"metabolites":{
+"f6p_c":1.0,
+"fru_e":-1.0,
+"pep_c":-1.0,
+"pyr_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1817 and b1818 and b1819 and b2415 and b2416",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"FRUpts2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"FRUpts2"
+],
+"metanetx.reaction":[
+"MNXR99662"
+],
+"sbo":"SBO:0000185"
+}
+},
+{
+"id":"FUM",
+"name":"Fumarase",
+"metabolites":{
+"fum_c":-1.0,
+"h2o_c":-1.0,
+"mal__L_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1612 or b4122 or b1611",
+"subsystem":"Citric Acid Cycle",
+"notes":{
+"original_bigg_ids":[
+"FUM"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"FUM"
+],
+"biocyc":[
+"META:FUMHYDR-RXN"
+],
+"ec-code":[
+"4.2.1.2"
+],
+"kegg.reaction":[
+"R01082"
+],
+"metanetx.reaction":[
+"MNXR99705"
+],
+"reactome.reaction":[
+"R-TGU-451033",
+"R-TGU-70982",
+"R-HSA-70982",
+"R-ATH-451033",
+"R-SPO-70982",
+"R-SPO-451033",
+"R-XTR-451033",
+"R-MMU-70982",
+"R-DRE-70982",
+"R-DME-70982",
+"R-DME-451033",
+"R-HSA-451033",
+"R-SCE-451033",
+"R-DDI-451033",
+"R-OSA-451033",
+"R-CFA-70982",
+"R-XTR-70982",
+"R-MMU-451033",
+"R-OSA-70982",
+"R-BTA-70982",
+"R-DRE-451033",
+"R-GGA-373141",
+"R-RNO-451033",
+"R-CEL-451033",
+"R-ATH-70982",
+"R-GGA-373145",
+"R-CEL-70982",
+"R-BTA-451033",
+"R-SSC-451033",
+"R-SCE-70982",
+"R-CFA-451033",
+"R-RNO-70982",
+"R-GGA-70982",
+"R-DDI-70982",
+"R-GGA-451033",
+"R-SSC-70982"
+],
+"rhea":[
+"12463",
+"12461",
+"12462",
+"12460"
+],
+"sabiork":[
+"256"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00799"
+]
+}
+},
+{
+"id":"FUMt2_2",
+"name":"Fumarate transport via proton symport (2 H)",
+"metabolites":{
+"fum_c":1.0,
+"fum_e":-1.0,
+"h_c":2.0,
+"h_e":-2.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3528",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"FUMt2_2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"FUMt2_2"
+],
+"biocyc":[
+"META:TRANS-RXN-121B"
+],
+"metanetx.reaction":[
+"MNXR99711"
+],
+"rhea":[
+"29332",
+"29334",
+"29333",
+"29331"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn08542",
+"rxn10152"
+]
+}
+},
+{
+"id":"G6PDH2r",
+"name":"Glucose 6-phosphate dehydrogenase",
+"metabolites":{
+"6pgl_c":1.0,
+"g6p_c":-1.0,
+"h_c":1.0,
+"nadp_c":-1.0,
+"nadph_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1852",
+"subsystem":"Pentose Phosphate Pathway",
+"notes":{
+"original_bigg_ids":[
+"G6PDH2r"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"G6PDH2r"
+],
+"biocyc":[
+"META:GLU6PDEHYDROG-RXN"
+],
+"ec-code":[
+"1.1.1.363",
+"1.1.1.49"
+],
+"kegg.reaction":[
+"R00835"
+],
+"metanetx.reaction":[
+"MNXR99907"
+],
+"rhea":[
+"15842",
+"15843",
+"15841",
+"15844"
+],
+"sabiork":[
+"1176",
+"6509"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00604"
+]
+}
+},
+{
+"id":"GAPD",
+"name":"Glyceraldehyde-3-phosphate dehydrogenase",
+"metabolites":{
+"13dpg_c":1.0,
+"g3p_c":-1.0,
+"h_c":1.0,
+"nad_c":-1.0,
+"nadh_c":1.0,
+"pi_c":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1779",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"GAPD"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GAPD"
+],
+"biocyc":[
+"META:GAPOXNPHOSPHN-RXN"
+],
+"ec-code":[
+"1.2.1.12",
+"1.2.1.59"
+],
+"kegg.reaction":[
+"R01061"
+],
+"metanetx.reaction":[
+"MNXR100040"
+],
+"reactome.reaction":[
+"R-ATH-70482",
+"R-DME-70449",
+"R-PFA-70482",
+"R-SPO-70449",
+"R-DRE-70449",
+"R-CEL-70449",
+"R-CEL-70482",
+"R-CFA-70449",
+"R-MMU-70482",
+"R-HSA-70449",
+"R-OSA-70482",
+"R-GGA-352956",
+"R-RNO-70449",
+"R-SCE-70449",
+"R-SSC-70482",
+"R-ATH-70449",
+"R-GGA-70482",
+"R-OSA-70449",
+"R-GGA-352921",
+"R-DDI-70449",
+"R-SPO-70482",
+"R-TGU-70482",
+"R-SCE-70482",
+"R-HSA-70482",
+"R-DME-70482",
+"R-PFA-70449",
+"R-XTR-70449",
+"R-DRE-70482",
+"R-XTR-70482",
+"R-GGA-70449",
+"R-RNO-70482",
+"R-SSC-70449",
+"R-DDI-70482",
+"R-TGU-70449",
+"R-MMU-70449",
+"R-CFA-70482",
+"R-BTA-70449",
+"R-BTA-70482"
+],
+"rhea":[
+"10303",
+"10300",
+"10302",
+"10301"
+],
+"sabiork":[
+"7844"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00781"
+]
+}
+},
+{
+"id":"GLCpts",
+"name":"D-glucose transport via PEP:Pyr PTS",
+"metabolites":{
+"g6p_c":1.0,
+"glc__D_e":-1.0,
+"pep_c":-1.0,
+"pyr_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"(b2417 and b1101 and b2415 and b2416) or (b1817 and b1818 and b1819 and b2415 and b2416) or (b2417 and b1621 and b2415 and b2416)",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"GLCpts"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GLCpts"
+],
+"metanetx.reaction":[
+"MNXR100237"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn08612",
+"rxn05226"
+]
+}
+},
+{
+"id":"GLNS",
+"name":"Glutamine synthetase",
+"metabolites":{
+"adp_c":1.0,
+"atp_c":-1.0,
+"gln__L_c":1.0,
+"glu__L_c":-1.0,
+"h_c":1.0,
+"nh4_c":-1.0,
+"pi_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3870 or b1297",
+"subsystem":"Glutamate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"GLNS"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GLNS"
+],
+"biocyc":[
+"META:GLUTAMINESYN-RXN"
+],
+"ec-code":[
+"6.3.1.2"
+],
+"kegg.reaction":[
+"R00253"
+],
+"metanetx.reaction":[
+"MNXR100024"
+],
+"reactome.reaction":[
+"R-GGA-70606",
+"R-RNO-70606",
+"R-TGU-70606",
+"R-DME-70606",
+"R-CEL-70606",
+"R-DRE-70606",
+"R-XTR-70606",
+"R-SPO-70606",
+"R-ATH-70606",
+"R-CFA-70606",
+"R-BTA-70606",
+"R-OSA-70606",
+"R-SSC-70606",
+"R-MMU-70606",
+"R-HSA-70606",
+"R-SCE-70606"
+],
+"rhea":[
+"16172",
+"16171",
+"16169",
+"16170"
+],
+"sabiork":[
+"760"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00187"
+]
+}
+},
+{
+"id":"GLNabc",
+"name":"L-glutamine transport via ABC system",
+"metabolites":{
+"adp_c":1.0,
+"atp_c":-1.0,
+"gln__L_c":1.0,
+"gln__L_e":-1.0,
+"h2o_c":-1.0,
+"h_c":1.0,
+"pi_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0811 and b0810 and b0809",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"GLNabc"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GLNabc"
+],
+"biocyc":[
+"META:ABC-12-RXN"
+],
+"ec-code":[
+"3.6.3.21"
+],
+"metanetx.reaction":[
+"MNXR100258"
+],
+"rhea":[
+"29895#1",
+"29897#1",
+"29898#1",
+"29896#1"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn11233",
+"rxn05196",
+"rxn05155",
+"rxn11101",
+"rxn08624"
+]
+}
+},
+{
+"id":"GLUDy",
+"name":"Glutamate dehydrogenase (NADP)",
+"metabolites":{
+"akg_c":1.0,
+"glu__L_c":-1.0,
+"h2o_c":-1.0,
+"h_c":1.0,
+"nadp_c":-1.0,
+"nadph_c":1.0,
+"nh4_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1761",
+"subsystem":"Glutamate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"GLUDy"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GLUDy"
+],
+"biocyc":[
+"META:GLUTDEHYD-RXN"
+],
+"ec-code":[
+"1.4.1.13",
+"1.4.1.3",
+"1.4.1.4"
+],
+"kegg.reaction":[
+"R00248"
+],
+"metanetx.reaction":[
+"MNXR100086"
+],
+"rhea":[
+"11613",
+"11614",
+"11612",
+"11615"
+],
+"sabiork":[
+"757"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00184"
+]
+}
+},
+{
+"id":"GLUN",
+"name":"Glutaminase",
+"metabolites":{
+"gln__L_c":-1.0,
+"glu__L_c":1.0,
+"h2o_c":-1.0,
+"nh4_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1812 or b0485 or b1524",
+"subsystem":"Glutamate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"GLUN"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GLUN"
+],
+"biocyc":[
+"META:GLUTAMIN-RXN"
+],
+"ec-code":[
+"6.3.5.2",
+"4.3.3.6",
+"6.3.5.5",
+"1.4.7.1",
+"6.3.5.4",
+"3.5.1.2",
+"6.3.4.2",
+"1.4.1.13",
+"3.5.1.38"
+],
+"kegg.reaction":[
+"R00256"
+],
+"metanetx.reaction":[
+"MNXR100030"
+],
+"reactome.reaction":[
+"R-TGU-70609",
+"R-XTR-70609",
+"R-SSC-70609",
+"R-GGA-70609",
+"R-DDI-70609",
+"R-MMU-70609",
+"R-DME-70609",
+"R-RNO-70609",
+"R-CEL-70609",
+"R-BTA-70609",
+"R-DRE-70609",
+"R-HSA-70609",
+"R-CFA-70609"
+],
+"rhea":[
+"15892",
+"15889",
+"15891",
+"15890"
+],
+"sabiork":[
+"762"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00189"
+]
+}
+},
+{
+"id":"GLUSy",
+"name":"Glutamate synthase (NADPH)",
+"metabolites":{
+"akg_c":-1.0,
+"gln__L_c":-1.0,
+"glu__L_c":2.0,
+"h_c":-1.0,
+"nadp_c":1.0,
+"nadph_c":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3212 and b3213",
+"subsystem":"Glutamate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"GLUSy"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GLUSy"
+],
+"biocyc":[
+"META:GLUTAMATESYN-RXN"
+],
+"ec-code":[
+"1.4.1.13"
+],
+"kegg.reaction":[
+"R00114"
+],
+"metanetx.reaction":[
+"MNXR100291"
+],
+"rhea":[
+"15503",
+"15501",
+"15504",
+"15502"
+],
+"sabiork":[
+"694"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00085"
+]
+}
+},
+{
+"id":"GLUt2r",
+"name":"L glutamate transport via proton symport reversible",
+"metabolites":{
+"glu__L_c":1.0,
+"glu__L_e":-1.0,
+"h_c":1.0,
+"h_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b4077",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"GLUt2r"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GLUt2r"
+],
+"metanetx.reaction":[
+"MNXR100300"
+],
+"reactome.reaction":[
+"R-SCE-8875623",
+"R-MMU-8875623",
+"R-TGU-8875623",
+"R-XTR-8875623",
+"R-SSC-8875623",
+"R-DME-8875623",
+"R-CEL-8875623",
+"R-DRE-8875623",
+"R-GGA-8875623",
+"R-HSA-8875623",
+"R-RNO-8875623",
+"R-DDI-8875623",
+"R-CFA-8875623",
+"R-BTA-8875623"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn05297",
+"rxn09813",
+"rxn13303",
+"rxn09751",
+"rxn08631"
+]
+}
+},
+{
+"id":"GND",
+"name":"Phosphogluconate dehydrogenase",
+"metabolites":{
+"6pgc_c":-1.0,
+"co2_c":1.0,
+"nadp_c":-1.0,
+"nadph_c":1.0,
+"ru5p__D_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2029",
+"subsystem":"Pentose Phosphate Pathway",
+"notes":{
+"original_bigg_ids":[
+"GND"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"GND"
+],
+"biocyc":[
+"META:RXN-9952"
+],
+"ec-code":[
+"1.1.1.44",
+"1.1.1.351"
+],
+"kegg.reaction":[
+"R01528"
+],
+"metanetx.reaction":[
+"MNXR100389"
+],
+"reactome.reaction":[
+"R-PFA-71299",
+"R-GGA-71299",
+"R-HSA-71299",
+"R-SPO-71299",
+"R-XTR-71299",
+"R-ATH-71299",
+"R-TGU-71299",
+"R-OSA-71299",
+"R-MMU-71299",
+"R-DRE-71299",
+"R-SCE-71299",
+"R-SSC-71299",
+"R-DDI-71299",
+"R-CFA-71299",
+"R-DME-71299",
+"R-BTA-71299",
+"R-CEL-71299"
+],
+"rhea":[
+"10116",
+"10117",
+"10118",
+"10119"
+],
+"sabiork":[
+"108"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn01115"
+]
+}
+},
+{
+"id":"H2Ot",
+"name":"H2O transport via diffusion",
+"metabolites":{
+"h2o_c":1.0,
+"h2o_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0875 or s0001",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"H2Ot"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"H2Ot"
+],
+"biocyc":[
+"META:TRANS-RXN-145",
+"META:TRANS-RXN0-547"
+],
+"metanetx.reaction":[
+"MNXR98641"
+],
+"reactome.reaction":[
+"R-ATH-507868",
+"R-CFA-432054",
+"R-CFA-432010",
+"R-RNO-507868",
+"R-OSA-432065",
+"R-GGA-432010",
+"R-SPO-445714",
+"R-PFA-445714",
+"R-CFA-432065",
+"R-GGA-432067",
+"R-TGU-432054",
+"R-TGU-445714",
+"R-OSA-507868",
+"R-DRE-507868",
+"R-SPO-507868",
+"R-BTA-432054",
+"R-GGA-507870",
+"R-OSA-432010",
+"R-DME-432065",
+"R-DRE-432067",
+"R-PFA-507868",
+"R-SSC-432054",
+"R-HSA-432065",
+"R-OSA-507870",
+"R-HSA-432054",
+"R-SSC-432065",
+"R-CEL-507868",
+"R-XTR-507868",
+"R-ATH-507870",
+"R-SCE-432065",
+"R-BTA-507870",
+"R-DME-432010",
+"R-CFA-445714",
+"R-DRE-445714",
+"R-BTA-507868",
+"R-GGA-507868",
+"R-RNO-432054",
+"R-RNO-432010",
+"R-SSC-432067",
+"R-CEL-445714",
+"R-DDI-432065",
+"R-ATH-432010",
+"R-SCE-432054",
+"R-MMU-432065",
+"R-MMU-445714",
+"R-GGA-432065",
+"R-HSA-432067",
+"R-SSC-507870",
+"R-SCE-432067",
+"R-RNO-507870",
+"R-DME-432054",
+"R-ATH-432067",
+"R-BTA-445714",
+"R-DRE-507870",
+"R-DME-507868",
+"R-DME-507870",
+"R-DRE-432010",
+"R-MMU-432010",
+"R-HSA-445714",
+"R-OSA-432054",
+"R-RNO-432067",
+"R-TGU-432010",
+"R-TGU-507868",
+"R-DDI-432054",
+"R-PFA-507870",
+"R-HSA-507870",
+"R-XTR-432067",
+"R-HSA-432010",
+"R-SSC-507868",
+"R-SCE-507870",
+"R-CEL-507870",
+"R-DDI-507868",
+"R-DRE-432054",
+"R-XTR-507870",
+"R-DDI-432010",
+"R-BTA-432065",
+"R-CFA-432067",
+"R-OSA-432067",
+"R-ATH-432065",
+"R-GGA-445714",
+"R-SCE-507868",
+"R-TGU-432065",
+"R-MMU-432067",
+"R-TGU-507870",
+"R-CFA-507870",
+"R-RNO-432065",
+"R-MMU-432054",
+"R-MMU-507868",
+"R-SPO-507870",
+"R-SCE-432010",
+"R-MMU-507870",
+"R-SSC-445714",
+"R-HSA-507868",
+"R-DME-432067",
+"R-SSC-432010",
+"R-TGU-432067",
+"R-GGA-432054",
+"R-BTA-432010",
+"R-SCE-445714",
+"R-DDI-507870",
+"R-ATH-432054",
+"R-DDI-432067",
+"R-XTR-445714",
+"R-BTA-432067",
+"R-CFA-507868",
+"R-RNO-445714"
+],
+"rhea":[
+"29668",
+"29669",
+"29667",
+"29670"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn08687",
+"rxn08686",
+"rxn09745",
+"rxn09838",
+"rxn09874",
+"rxn09812",
+"rxn09643",
+"rxn05319"
+]
+}
+},
+{
+"id":"ICDHyr",
+"name":"Isocitrate dehydrogenase (NADP)",
+"metabolites":{
+"akg_c":1.0,
+"co2_c":1.0,
+"icit_c":-1.0,
+"nadp_c":-1.0,
+"nadph_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1136",
+"subsystem":"Citric Acid Cycle",
+"notes":{
+"original_bigg_ids":[
+"ICDHyr"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ICDHyr"
+],
+"ec-code":[
+"1.1.1.42"
+],
+"kegg.reaction":[
+"R00267"
+],
+"metanetx.reaction":[
+"MNXR100781"
+],
+"rhea":[
+"19629",
+"19630",
+"19631",
+"19632"
+],
+"sabiork":[
+"269"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00198"
+]
+}
+},
+{
+"id":"ICL",
+"name":"Isocitrate lyase",
+"metabolites":{
+"glx_c":1.0,
+"icit_c":-1.0,
+"succ_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b4015",
+"subsystem":"Anaplerotic reactions",
+"notes":{
+"original_bigg_ids":[
+"ICL"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ICL"
+],
+"ec-code":[
+"4.1.3.1"
+],
+"kegg.reaction":[
+"R00479"
+],
+"metanetx.reaction":[
+"MNXR100789"
+],
+"rhea":[
+"13248",
+"13245",
+"13246",
+"13247"
+],
+"sabiork":[
+"911"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00336"
+]
+}
+},
+{
+"id":"LDH_D",
+"name":"D-lactate dehydrogenase",
+"metabolites":{
+"h_c":1.0,
+"lac__D_c":-1.0,
+"nad_c":-1.0,
+"nadh_c":1.0,
+"pyr_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2133 or b1380",
+"subsystem":"Pyruvate Metabolism",
+"notes":{
+"original_bigg_ids":[
+"LDH_D"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"LDH_D"
+],
+"biocyc":[
+"META:DLACTDEHYDROGNAD-RXN"
+],
+"ec-code":[
+"1.1.1.28"
+],
+"kegg.reaction":[
+"R00704"
+],
+"metanetx.reaction":[
+"MNXR101037"
+],
+"rhea":[
+"16370",
+"16371",
+"16372",
+"16369"
+],
+"sabiork":[
+"155"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00500"
+]
+}
+},
+{
+"id":"MALS",
+"name":"Malate synthase",
+"metabolites":{
+"accoa_c":-1.0,
+"coa_c":1.0,
+"glx_c":-1.0,
+"h2o_c":-1.0,
+"h_c":1.0,
+"mal__L_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b4014 or b2976",
+"subsystem":"Anaplerotic reactions",
+"notes":{
+"original_bigg_ids":[
+"MALS"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"MALS"
+],
+"biocyc":[
+"META:MALSYN-RXN"
+],
+"ec-code":[
+"2.3.3.9"
+],
+"kegg.reaction":[
+"R00472"
+],
+"metanetx.reaction":[
+"MNXR101347"
+],
+"rhea":[
+"18181",
+"18182",
+"18184",
+"18183"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00330"
+]
+}
+},
+{
+"id":"MALt2_2",
+"name":"Malate transport via proton symport (2 H)",
+"metabolites":{
+"h_c":2.0,
+"h_e":-2.0,
+"mal__L_c":1.0,
+"mal__L_e":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3528",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"MALt2_2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"MALt2_2"
+],
+"biocyc":[
+"META:TRANS-RXN-121A"
+],
+"metanetx.reaction":[
+"MNXR101370"
+],
+"rhea":[
+"29341",
+"29340",
+"29342",
+"29339"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn08865",
+"rxn10153"
+]
+}
+},
+{
+"id":"MDH",
+"name":"Malate dehydrogenase",
+"metabolites":{
+"h_c":1.0,
+"mal__L_c":-1.0,
+"nad_c":-1.0,
+"nadh_c":1.0,
+"oaa_c":1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3236",
+"subsystem":"Citric Acid Cycle",
+"notes":{
+"original_bigg_ids":[
+"MDH"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"MDH"
+],
+"biocyc":[
+"META:MALATE-DEH-RXN"
+],
+"ec-code":[
+"1.1.1.37",
+"1.1.1.299"
+],
+"kegg.reaction":[
+"R00342"
+],
+"metanetx.reaction":[
+"MNXR101439"
+],
+"reactome.reaction":[
+"R-BTA-70979",
+"R-BTA-198508",
+"R-SCE-70979",
+"R-GGA-70979",
+"R-MMU-71783",
+"R-RNO-71783",
+"R-DDI-198508",
+"R-CFA-71783",
+"R-CFA-198508",
+"R-ATH-70979",
+"R-DME-198508",
+"R-TGU-71783",
+"R-HSA-71783",
+"R-BTA-71783",
+"R-DRE-198508",
+"R-SPO-70979",
+"R-GGA-71783",
+"R-TGU-198508",
+"R-GGA-372422",
+"R-CEL-71783",
+"R-XTR-70979",
+"R-RNO-198508",
+"R-MMU-70979",
+"R-SPO-71783",
+"R-ATH-71783",
+"R-MMU-198508",
+"R-DME-70979",
+"R-TGU-70979",
+"R-CEL-198508",
+"R-DME-71783",
+"R-DRE-70979",
+"R-OSA-71783",
+"R-SSC-198508",
+"R-GGA-372855",
+"R-SSC-70979",
+"R-OSA-70979",
+"R-GGA-373047",
+"R-GGA-198508",
+"R-SSC-71783",
+"R-HSA-70979",
+"R-CFA-70979",
+"R-XTR-71783",
+"R-HSA-198508",
+"R-XTR-198508",
+"R-SCE-71783",
+"R-RNO-70979",
+"R-DRE-71783",
+"R-CEL-70979"
+],
+"rhea":[
+"21432",
+"21433",
+"21434",
+"21435"
+],
+"sabiork":[
+"113"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00248"
+]
+}
+},
+{
+"id":"ME1",
+"name":"Malic enzyme (NAD)",
+"metabolites":{
+"co2_c":1.0,
+"mal__L_c":-1.0,
+"nad_c":-1.0,
+"nadh_c":1.0,
+"pyr_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b1479",
+"subsystem":"Anaplerotic reactions",
+"notes":{
+"original_bigg_ids":[
+"ME1"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ME1"
+],
+"biocyc":[
+"META:1.1.1.39-RXN"
+],
+"ec-code":[
+"1.1.1.38",
+"1.1.1.39"
+],
+"kegg.reaction":[
+"R00214"
+],
+"metanetx.reaction":[
+"MNXR101446"
+],
+"rhea":[
+"12655",
+"12654",
+"12653",
+"12656"
+],
+"sabiork":[
+"141"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00159"
+]
+}
+},
+{
+"id":"ME2",
+"name":"Malic enzyme (NADP)",
+"metabolites":{
+"co2_c":1.0,
+"mal__L_c":-1.0,
+"nadp_c":-1.0,
+"nadph_c":1.0,
+"pyr_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2463",
+"subsystem":"Anaplerotic reactions",
+"notes":{
+"original_bigg_ids":[
+"ME2"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"ME2"
+],
+"biocyc":[
+"META:MALIC-NADP-RXN"
+],
+"ec-code":[
+"1.1.1.40"
+],
+"kegg.reaction":[
+"R00216"
+],
+"metanetx.reaction":[
+"MNXR101443"
+],
+"rhea":[
+"18255",
+"18256",
+"18254",
+"18253"
+],
+"sabiork":[
+"142"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00161"
+]
+}
+},
+{
+"id":"NADH16",
+"name":"NADH dehydrogenase (ubiquinone-8 & 3 protons)",
+"metabolites":{
+"h_c":-4.0,
+"h_e":3.0,
+"nad_c":1.0,
+"nadh_c":-1.0,
+"q8_c":-1.0,
+"q8h2_c":1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b2276 and b2277 and b2278 and b2279 and b2280 and b2281 and b2282 and b2283 and b2284 and b2285 and b2286 and b2287 and b2288",
+"subsystem":"Oxidative Phosphorylation",
+"notes":{
+"original_bigg_ids":[
+"NADH16"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"NADH16"
+],
+"ec-code":[
+"1.6.5.3"
+],
+"metanetx.reaction":[
+"MNXR101864"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn08972"
+]
+}
+},
+{
+"id":"NADTRHD",
+"name":"NAD transhydrogenase",
+"metabolites":{
+"nad_c":-1.0,
+"nadh_c":1.0,
+"nadp_c":1.0,
+"nadph_c":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b3962 or (b1602 and b1603)",
+"subsystem":"Oxidative Phosphorylation",
+"notes":{
+"original_bigg_ids":[
+"NADTRHD"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"NADTRHD"
+],
+"biocyc":[
+"META:PYRNUTRANSHYDROGEN-RXN"
+],
+"ec-code":[
+"1.6.1.3",
+"1.6.1.2",
+"1.6.1.1"
+],
+"kegg.reaction":[
+"R00112"
+],
+"metanetx.reaction":[
+"MNXR101898"
+],
+"rhea":[
+"11692",
+"11695",
+"11694",
+"11693"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00083"
+]
+}
+},
+{
+"id":"NH4t",
+"name":"Ammonia reversible transport",
+"metabolites":{
+"nh4_c":1.0,
+"nh4_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"s0001 or b0451",
+"subsystem":"Inorganic Ion Transport and Metabolism",
+"notes":{
+"original_bigg_ids":[
+"NH4t"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"NH4t"
+],
+"biocyc":[
+"META:TRANS-RXN0-206",
+"META:RXN-9615",
+"META:TRANS-RXN0-544"
+],
+"metanetx.reaction":[
+"MNXR101950"
+],
+"reactome.reaction":[
+"R-CEL-444416",
+"R-SSC-444416",
+"R-DDI-444416",
+"R-MMU-444416",
+"R-DRE-444416",
+"R-GGA-444416",
+"R-CFA-444416",
+"R-HSA-444416",
+"R-XTR-444416",
+"R-BTA-444416",
+"R-RNO-444416",
+"R-TGU-444416",
+"R-DME-444416"
+],
+"rhea":[
+"28749",
+"28748",
+"28750",
+"28747"
+],
+"sabiork":[
+"11683"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn13364",
+"rxn09835",
+"rxn05466",
+"rxn08987",
+"rxn08986",
+"rxn09736"
+]
+}
+},
+{
+"id":"O2t",
+"name":"O2 transport diffusion ",
+"metabolites":{
+"o2_c":1.0,
+"o2_e":-1.0
+},
+"lower_bound":-1000.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"s0001",
+"subsystem":"Transport, Extracellular",
+"notes":{
+"original_bigg_ids":[
+"O2t"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"O2t"
+],
+"biocyc":[
+"META:TRANS-RXN0-474"
+],
+"metanetx.reaction":[
+"MNXR102090"
+],
+"sbo":"SBO:0000185",
+"seed.reaction":[
+"rxn09641",
+"rxn05468",
+"rxn09031",
+"rxn09032",
+"rxn09734"
+]
+}
+},
+{
+"id":"PDH",
+"name":"Pyruvate dehydrogenase",
+"metabolites":{
+"accoa_c":1.0,
+"co2_c":1.0,
+"coa_c":-1.0,
+"nad_c":-1.0,
+"nadh_c":1.0,
+"pyr_c":-1.0
+},
+"lower_bound":0.0,
+"upper_bound":1000.0,
+"gene_reaction_rule":"b0114 and b0115 and b0116",
+"subsystem":"Glycolysis/Gluconeogenesis",
+"notes":{
+"original_bigg_ids":[
+"PDH"
+]
+},
+"annotation":{
+"bigg.reaction":[
+"PDH"
+],
+"biocyc":[
+"META:PYRUVDEH-RXN"
+],
+"ec-code":[
+"1.2.1",
+"1.8.1.4",
+"1.2.1.51",
+"1.2.4.1",
+"2.3.1.12"
+],
+"kegg.reaction":[
+"R00209"
+],
+"metanetx.reaction":[
+"MNXR102425"
+],
+"reactome.reaction":[
+"R-RNO-71397",
+"R-OSA-71397",
+"R-GGA-373177",
+"R-DME-71397",
+"R-TGU-71397",
+"R-XTR-71397",
+"R-CFA-71397",
+"R-BTA-71397",
+"R-HSA-71397",
+"R-GGA-71397",
+"R-SPO-71397",
+"R-CEL-71397",
+"R-DDI-71397",
+"R-DRE-71397",
+"R-SSC-71397",
+"R-SCE-71397",
+"R-ATH-71397",
+"R-MMU-71397"
+],
+"rhea":[
+"28043",
+"28045",
+"28044",
+"28042"
+],
+"sabiork":[
+"523"
+],
+"sbo":"SBO:0000176",
+"seed.reaction":[
+"rxn00154"
+]
+}
+}
+],
+"genes":[
+{
+"id":"b1241",
+"name":"adhE",
+"notes":{
+"original_bigg_ids":[
+"b1241"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0004164"
+],
+"ecogene":[
+"EG10031"
+],
+"ncbigene":[
+"945837"
+],
+"ncbigi":[
+"16129202"
+],
+"refseq_locus_tag":[
+"b1241"
+],
+"refseq_name":[
+"adhE"
+],
+"refseq_synonym":[
+"JW1228",
+"ECK1235",
+"adhC",
+"ana"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A9Q7"
+]
+}
+},
+{
+"id":"b0351",
+"name":"mhpF",
+"notes":{
+"original_bigg_ids":[
+"b0351"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0001207"
+],
+"ecogene":[
+"EG13625"
+],
+"ncbigene":[
+"945008"
+],
+"ncbigi":[
+"16128336"
+],
+"refseq_locus_tag":[
+"b0351"
+],
+"refseq_name":[
+"mhpF"
+],
+"refseq_synonym":[
+"JW0342",
+"ECK0348"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P77580"
+]
+}
+},
+{
+"id":"s0001",
+"name":"",
+"notes":{
+"original_bigg_ids":[
+"s0001"
+]
+},
+"annotation":{
+"sbo":"SBO:0000243"
+}
+},
+{
+"id":"b1849",
+"name":"purT",
+"notes":{
+"original_bigg_ids":[
+"b1849"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006162"
+],
+"ecogene":[
+"EG11809"
+],
+"ncbigene":[
+"946368"
+],
+"ncbigi":[
+"16129802"
+],
+"refseq_locus_tag":[
+"b1849"
+],
+"refseq_name":[
+"purT"
+],
+"refseq_synonym":[
+"JW1838",
+"ECK1850"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P33221"
+]
+}
+},
+{
+"id":"b3115",
+"name":"tdcD",
+"notes":{
+"original_bigg_ids":[
+"b3115"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0010245"
+],
+"ecogene":[
+"EG11172"
+],
+"ncbigene":[
+"947635"
+],
+"ncbigi":[
+"145698313"
+],
+"refseq_locus_tag":[
+"b3115"
+],
+"refseq_name":[
+"tdcD"
+],
+"refseq_synonym":[
+"JW5806",
+"ECK3104",
+"yhaA"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P11868"
+]
+}
+},
+{
+"id":"b2296",
+"name":"ackA",
+"notes":{
+"original_bigg_ids":[
+"b2296"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007579"
+],
+"ecogene":[
+"EG10027"
+],
+"ncbigene":[
+"946775"
+],
+"ncbigi":[
+"16130231"
+],
+"refseq_locus_tag":[
+"b2296"
+],
+"refseq_name":[
+"ackA"
+],
+"refseq_synonym":[
+"JW2293",
+"ECK2290"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A6A3"
+]
+}
+},
+{
+"id":"b1276",
+"name":"acnA",
+"notes":{
+"original_bigg_ids":[
+"b1276"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0004283"
+],
+"ecogene":[
+"EG11325"
+],
+"ncbigene":[
+"946724"
+],
+"ncbigi":[
+"16129237"
+],
+"refseq_locus_tag":[
+"b1276"
+],
+"refseq_name":[
+"acnA"
+],
+"refseq_synonym":[
+"JW1268",
+"ECK1271",
+"acn"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P25516"
+]
+}
+},
+{
+"id":"b0118",
+"name":"acnB",
+"notes":{
+"original_bigg_ids":[
+"b0118"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0000411"
+],
+"ecogene":[
+"EG12316"
+],
+"ncbigene":[
+"944864"
+],
+"ncbigi":[
+"16128111"
+],
+"refseq_locus_tag":[
+"b0118"
+],
+"refseq_name":[
+"acnB"
+],
+"refseq_synonym":[
+"ECK0117",
+"JW0114",
+"yacJ",
+"yacI"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P36683"
+]
+}
+},
+{
+"id":"b0474",
+"name":"adk",
+"notes":{
+"original_bigg_ids":[
+"b0474"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0001645"
+],
+"ecogene":[
+"EG10032"
+],
+"ncbigene":[
+"945097"
+],
+"ncbigi":[
+"16128458"
+],
+"refseq_locus_tag":[
+"b0474"
+],
+"refseq_name":[
+"adk"
+],
+"refseq_synonym":[
+"plsA",
+"JW0463",
+"ECK0468",
+"dnaW"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P69441"
+]
+}
+},
+{
+"id":"b0116",
+"name":"lpd",
+"notes":{
+"original_bigg_ids":[
+"b0116"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0000404"
+],
+"ecogene":[
+"EG10543"
+],
+"ncbigene":[
+"944854"
+],
+"ncbigi":[
+"16128109"
+],
+"refseq_locus_tag":[
+"b0116"
+],
+"refseq_name":[
+"lpd"
+],
+"refseq_synonym":[
+"dhl",
+"lpdA",
+"ECK0115",
+"JW0112"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A9P0"
+]
+}
+},
+{
+"id":"b0727",
+"name":"sucB",
+"notes":{
+"original_bigg_ids":[
+"b0727"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002480"
+],
+"ecogene":[
+"EG10980"
+],
+"ncbigene":[
+"945307"
+],
+"ncbigi":[
+"16128702"
+],
+"refseq_locus_tag":[
+"b0727"
+],
+"refseq_name":[
+"sucB"
+],
+"refseq_synonym":[
+"JW0716",
+"ECK0715"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFG6"
+]
+}
+},
+{
+"id":"b0726",
+"name":"sucA",
+"notes":{
+"original_bigg_ids":[
+"b0726"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002478"
+],
+"ecogene":[
+"EG10979"
+],
+"ncbigene":[
+"945303"
+],
+"ncbigi":[
+"16128701"
+],
+"refseq_locus_tag":[
+"b0726"
+],
+"refseq_name":[
+"sucA"
+],
+"refseq_synonym":[
+"lys",
+"JW0715",
+"ECK0714"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFG3"
+]
+}
+},
+{
+"id":"b2587",
+"name":"kgtP",
+"notes":{
+"original_bigg_ids":[
+"b2587"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0008515"
+],
+"ecogene":[
+"EG10522"
+],
+"ncbigene":[
+"947069"
+],
+"ncbigi":[
+"16130512"
+],
+"refseq_locus_tag":[
+"b2587"
+],
+"refseq_name":[
+"kgtP"
+],
+"refseq_synonym":[
+"ECK2585",
+"JW2571",
+"witA"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AEX3"
+]
+}
+},
+{
+"id":"b0356",
+"name":"frmA",
+"notes":{
+"original_bigg_ids":[
+"b0356"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0001221"
+],
+"ecogene":[
+"EG50010"
+],
+"ncbigene":[
+"944988"
+],
+"ncbigi":[
+"16128341"
+],
+"refseq_locus_tag":[
+"b0356"
+],
+"refseq_name":[
+"frmA"
+],
+"refseq_synonym":[
+"ECK0353",
+"adhC",
+"JW0347"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P25437"
+]
+}
+},
+{
+"id":"b1478",
+"name":"adhP",
+"notes":{
+"original_bigg_ids":[
+"b1478"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0004928"
+],
+"ecogene":[
+"EG12622"
+],
+"ncbigene":[
+"946036"
+],
+"ncbigi":[
+"90111280"
+],
+"refseq_locus_tag":[
+"b1478"
+],
+"refseq_name":[
+"adhP"
+],
+"refseq_synonym":[
+"yddN",
+"ECK1472",
+"JW1474"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P39451"
+]
+}
+},
+{
+"id":"b3734",
+"name":"atpA",
+"notes":{
+"original_bigg_ids":[
+"b3734"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012213"
+],
+"ecogene":[
+"EG10098"
+],
+"ncbigene":[
+"948242"
+],
+"ncbigi":[
+"16131602"
+],
+"refseq_locus_tag":[
+"b3734"
+],
+"refseq_name":[
+"atpA"
+],
+"refseq_synonym":[
+"uncA",
+"papA",
+"ECK3727",
+"JW3712"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABB0"
+]
+}
+},
+{
+"id":"b3733",
+"name":"atpG",
+"notes":{
+"original_bigg_ids":[
+"b3733"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012211"
+],
+"ecogene":[
+"EG10104"
+],
+"ncbigene":[
+"948243"
+],
+"ncbigi":[
+"16131601"
+],
+"refseq_locus_tag":[
+"b3733"
+],
+"refseq_name":[
+"atpG"
+],
+"refseq_synonym":[
+"uncG",
+"ECK3726",
+"papC",
+"JW3711"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABA6"
+]
+}
+},
+{
+"id":"b3736",
+"name":"atpF",
+"notes":{
+"original_bigg_ids":[
+"b3736"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012217"
+],
+"ecogene":[
+"EG10103"
+],
+"ncbigene":[
+"948247"
+],
+"ncbigi":[
+"16131604"
+],
+"refseq_locus_tag":[
+"b3736"
+],
+"refseq_name":[
+"atpF"
+],
+"refseq_synonym":[
+"uncF",
+"JW3714",
+"papF",
+"ECK3729"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABA0"
+]
+}
+},
+{
+"id":"b3737",
+"name":"atpE",
+"notes":{
+"original_bigg_ids":[
+"b3737"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012220"
+],
+"ecogene":[
+"EG10102"
+],
+"ncbigene":[
+"948253"
+],
+"ncbigi":[
+"16131605"
+],
+"refseq_locus_tag":[
+"b3737"
+],
+"refseq_name":[
+"atpE"
+],
+"refseq_synonym":[
+"uncE",
+"JW3715",
+"ECK3730",
+"papH"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P68699"
+]
+}
+},
+{
+"id":"b3739",
+"name":"atpI",
+"notes":{
+"original_bigg_ids":[
+"b3739"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012224"
+],
+"ecogene":[
+"EG10106"
+],
+"ncbigene":[
+"948251"
+],
+"ncbigi":[
+"90111645"
+],
+"refseq_locus_tag":[
+"b3739"
+],
+"refseq_name":[
+"atpI"
+],
+"refseq_synonym":[
+"uncI",
+"JW5611",
+"ECK3732"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABC0"
+]
+}
+},
+{
+"id":"b3738",
+"name":"atpB",
+"notes":{
+"original_bigg_ids":[
+"b3738"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012222"
+],
+"ecogene":[
+"EG10099"
+],
+"ncbigene":[
+"948252"
+],
+"ncbigi":[
+"16131606"
+],
+"refseq_locus_tag":[
+"b3738"
+],
+"refseq_name":[
+"atpB"
+],
+"refseq_synonym":[
+"JW3716",
+"ECK3731",
+"uncB",
+"papD"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AB98"
+]
+}
+},
+{
+"id":"b3735",
+"name":"atpH",
+"notes":{
+"original_bigg_ids":[
+"b3735"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012215"
+],
+"ecogene":[
+"EG10105"
+],
+"ncbigene":[
+"948254"
+],
+"ncbigi":[
+"16131603"
+],
+"refseq_locus_tag":[
+"b3735"
+],
+"refseq_name":[
+"atpH"
+],
+"refseq_synonym":[
+"JW3713",
+"papE",
+"ECK3728",
+"uncH"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABA4"
+]
+}
+},
+{
+"id":"b3731",
+"name":"atpC",
+"notes":{
+"original_bigg_ids":[
+"b3731"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012206"
+],
+"ecogene":[
+"EG10100"
+],
+"ncbigene":[
+"948245"
+],
+"ncbigi":[
+"16131599"
+],
+"refseq_locus_tag":[
+"b3731"
+],
+"refseq_name":[
+"atpC"
+],
+"refseq_synonym":[
+"uncC",
+"ECK3724",
+"papG",
+"JW3709"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A6E6"
+]
+}
+},
+{
+"id":"b3732",
+"name":"atpD",
+"notes":{
+"original_bigg_ids":[
+"b3732"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012208"
+],
+"ecogene":[
+"EG10101"
+],
+"ncbigene":[
+"948244"
+],
+"ncbigi":[
+"16131600"
+],
+"refseq_locus_tag":[
+"b3732"
+],
+"refseq_name":[
+"atpD"
+],
+"refseq_synonym":[
+"papB",
+"ECK3725",
+"JW3710",
+"uncD"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABB4"
+]
+}
+},
+{
+"id":"b0720",
+"name":"gltA",
+"notes":{
+"original_bigg_ids":[
+"b0720"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002451"
+],
+"ecogene":[
+"EG10402"
+],
+"ncbigene":[
+"945323"
+],
+"ncbigi":[
+"16128695"
+],
+"refseq_locus_tag":[
+"b0720"
+],
+"refseq_name":[
+"gltA"
+],
+"refseq_synonym":[
+"JW0710",
+"gluT",
+"ECK0709",
+"icdB"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABH7"
+]
+}
+},
+{
+"id":"b0733",
+"name":"cydA",
+"notes":{
+"original_bigg_ids":[
+"b0733"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002499"
+],
+"ecogene":[
+"EG10173"
+],
+"ncbigene":[
+"945341"
+],
+"ncbigi":[
+"90111166"
+],
+"refseq_locus_tag":[
+"b0733"
+],
+"refseq_name":[
+"cydA"
+],
+"refseq_synonym":[
+"ECK0721",
+"JW0722"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABJ9"
+]
+}
+},
+{
+"id":"b0734",
+"name":"cydB",
+"notes":{
+"original_bigg_ids":[
+"b0734"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002501"
+],
+"ecogene":[
+"EG10174"
+],
+"ncbigene":[
+"945347"
+],
+"ncbigi":[
+"16128709"
+],
+"refseq_locus_tag":[
+"b0734"
+],
+"refseq_name":[
+"cydB"
+],
+"refseq_synonym":[
+"ECK0722",
+"JW0723"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0ABK2"
+]
+}
+},
+{
+"id":"b0979",
+"name":"cbdB",
+"notes":{
+"original_bigg_ids":[
+"b0979"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0003302"
+],
+"ecogene":[
+"EG11379"
+],
+"ncbigene":[
+"947547"
+],
+"ncbigi":[
+"16128945"
+],
+"refseq_locus_tag":[
+"b0979"
+],
+"refseq_name":[
+"cbdB"
+],
+"refseq_synonym":[
+"JW0961",
+"appB",
+"cyxB",
+"ECK0970"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P26458"
+]
+}
+},
+{
+"id":"b0978",
+"name":"cbdA",
+"notes":{
+"original_bigg_ids":[
+"b0978"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0003300"
+],
+"ecogene":[
+"EG11380"
+],
+"ncbigene":[
+"945585"
+],
+"ncbigi":[
+"16128944"
+],
+"refseq_locus_tag":[
+"b0978"
+],
+"refseq_name":[
+"cbdA"
+],
+"refseq_synonym":[
+"JW0960",
+"ECK0969",
+"cyxA",
+"appC"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P26459"
+]
+}
+},
+{
+"id":"b3603",
+"name":"lldP",
+"notes":{
+"original_bigg_ids":[
+"b3603"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0011777"
+],
+"ecogene":[
+"EG11961"
+],
+"ncbigene":[
+"948114"
+],
+"ncbigi":[
+"16131474"
+],
+"refseq_locus_tag":[
+"b3603"
+],
+"refseq_name":[
+"lldP"
+],
+"refseq_synonym":[
+"JW3578",
+"ECK3593",
+"lct",
+"lctP"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P33231"
+]
+}
+},
+{
+"id":"b2975",
+"name":"glcA",
+"notes":{
+"original_bigg_ids":[
+"b2975"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0009763"
+],
+"ecogene":[
+"EG12995"
+],
+"ncbigene":[
+"947259"
+],
+"ncbigi":[
+"16130875"
+],
+"refseq_locus_tag":[
+"b2975"
+],
+"refseq_name":[
+"glcA"
+],
+"refseq_synonym":[
+"ECK2969",
+"JW2942",
+"yghK"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"Q46839"
+]
+}
+},
+{
+"id":"b2779",
+"name":"eno",
+"notes":{
+"original_bigg_ids":[
+"b2779"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0009110"
+],
+"ecogene":[
+"EG10258"
+],
+"ncbigene":[
+"945032"
+],
+"ncbigi":[
+"16130686"
+],
+"refseq_locus_tag":[
+"b2779"
+],
+"refseq_name":[
+"eno"
+],
+"refseq_synonym":[
+"JW2750",
+"ECK2773"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A6P9"
+]
+}
+},
+{
+"id":"b2925",
+"name":"fbaA",
+"notes":{
+"original_bigg_ids":[
+"b2925"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0009600"
+],
+"ecogene":[
+"EG10282"
+],
+"ncbigene":[
+"947415"
+],
+"ncbigi":[
+"16130826"
+],
+"refseq_locus_tag":[
+"b2925"
+],
+"refseq_name":[
+"fbaA"
+],
+"refseq_synonym":[
+"fba",
+"ald",
+"fda",
+"ECK2921",
+"JW2892"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AB71"
+]
+}
+},
+{
+"id":"b1773",
+"name":"ydjI",
+"notes":{
+"original_bigg_ids":[
+"b1773"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005906"
+],
+"ecogene":[
+"EG13485"
+],
+"ncbigene":[
+"946291"
+],
+"ncbigi":[
+"16129727"
+],
+"refseq_locus_tag":[
+"b1773"
+],
+"refseq_name":[
+"ydjI"
+],
+"refseq_synonym":[
+"ECK1771",
+"JW1762"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P77704"
+]
+}
+},
+{
+"id":"b2097",
+"name":"fbaB",
+"notes":{
+"original_bigg_ids":[
+"b2097"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006941"
+],
+"ecogene":[
+"EG14062"
+],
+"ncbigene":[
+"946632"
+],
+"ncbigi":[
+"90111385"
+],
+"refseq_locus_tag":[
+"b2097"
+],
+"refseq_name":[
+"fbaB"
+],
+"refseq_synonym":[
+"dhnA",
+"JW5344",
+"ECK2090"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A991"
+]
+}
+},
+{
+"id":"b3925",
+"name":"glpX",
+"notes":{
+"original_bigg_ids":[
+"b3925"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012821"
+],
+"ecogene":[
+"EG11517"
+],
+"ncbigene":[
+"948424"
+],
+"ncbigi":[
+"16131763"
+],
+"refseq_locus_tag":[
+"b3925"
+],
+"refseq_name":[
+"glpX"
+],
+"refseq_synonym":[
+"JW3896",
+"ECK3917"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A9C9"
+]
+}
+},
+{
+"id":"b4232",
+"name":"fbp",
+"notes":{
+"original_bigg_ids":[
+"b4232"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013842"
+],
+"ecogene":[
+"EG10283"
+],
+"ncbigene":[
+"948753"
+],
+"ncbigi":[
+"16132054"
+],
+"refseq_locus_tag":[
+"b4232"
+],
+"refseq_name":[
+"fbp"
+],
+"refseq_synonym":[
+"JW4191",
+"ECK4227",
+"fdp"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A993"
+]
+}
+},
+{
+"id":"b2492",
+"name":"focB",
+"notes":{
+"original_bigg_ids":[
+"b2492"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0008206"
+],
+"ecogene":[
+"EG14220"
+],
+"ncbigene":[
+"949032"
+],
+"ncbigi":[
+"16130417"
+],
+"refseq_locus_tag":[
+"b2492"
+],
+"refseq_name":[
+"focB"
+],
+"refseq_synonym":[
+"JW2477",
+"ECK2488"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P77733"
+]
+}
+},
+{
+"id":"b0904",
+"name":"focA",
+"notes":{
+"original_bigg_ids":[
+"b0904"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0003073"
+],
+"ecogene":[
+"EG11258"
+],
+"ncbigene":[
+"945513"
+],
+"ncbigi":[
+"16128871"
+],
+"refseq_locus_tag":[
+"b0904"
+],
+"refseq_name":[
+"focA"
+],
+"refseq_synonym":[
+"ycaE",
+"ECK0895",
+"JW0887"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AC23"
+]
+}
+},
+{
+"id":"b4152",
+"name":"frdC",
+"notes":{
+"original_bigg_ids":[
+"b4152"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013598"
+],
+"ecogene":[
+"EG10332"
+],
+"ncbigene":[
+"948680"
+],
+"ncbigi":[
+"16131977"
+],
+"refseq_locus_tag":[
+"b4152"
+],
+"refseq_name":[
+"frdC"
+],
+"refseq_synonym":[
+"ECK4148",
+"JW4113"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A8Q0"
+]
+}
+},
+{
+"id":"b4154",
+"name":"frdA",
+"notes":{
+"original_bigg_ids":[
+"b4154"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013604"
+],
+"ecogene":[
+"EG10330"
+],
+"ncbigene":[
+"948667"
+],
+"ncbigi":[
+"16131979"
+],
+"refseq_locus_tag":[
+"b4154"
+],
+"refseq_name":[
+"frdA"
+],
+"refseq_synonym":[
+"ECK4150",
+"JW4115"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P00363"
+]
+}
+},
+{
+"id":"b4153",
+"name":"frdB",
+"notes":{
+"original_bigg_ids":[
+"b4153"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013602"
+],
+"ecogene":[
+"EG10331"
+],
+"ncbigene":[
+"948666"
+],
+"ncbigi":[
+"16131978"
+],
+"refseq_locus_tag":[
+"b4153"
+],
+"refseq_name":[
+"frdB"
+],
+"refseq_synonym":[
+"JW4114",
+"ECK4149"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AC47"
+]
+}
+},
+{
+"id":"b4151",
+"name":"frdD",
+"notes":{
+"original_bigg_ids":[
+"b4151"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013595"
+],
+"ecogene":[
+"EG10333"
+],
+"ncbigene":[
+"948668"
+],
+"ncbigi":[
+"16131976"
+],
+"refseq_locus_tag":[
+"b4151"
+],
+"refseq_name":[
+"frdD"
+],
+"refseq_synonym":[
+"JW4112",
+"ECK4147"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A8Q3"
+]
+}
+},
+{
+"id":"b1819",
+"name":"manZ",
+"notes":{
+"original_bigg_ids":[
+"b1819"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006058"
+],
+"ecogene":[
+"EG10569"
+],
+"ncbigene":[
+"946342"
+],
+"ncbigi":[
+"345452720"
+],
+"refseq_locus_tag":[
+"b1819"
+],
+"refseq_name":[
+"manZ"
+],
+"refseq_synonym":[
+"ptsM",
+"ECK1817",
+"ptsX",
+"gptB",
+"mpt",
+"JW1808"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P69805"
+]
+}
+},
+{
+"id":"b1817",
+"name":"manX",
+"notes":{
+"original_bigg_ids":[
+"b1817"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006054"
+],
+"ecogene":[
+"EG10567"
+],
+"ncbigene":[
+"946334"
+],
+"ncbigi":[
+"16129771"
+],
+"refseq_locus_tag":[
+"b1817"
+],
+"refseq_name":[
+"manX"
+],
+"refseq_synonym":[
+"ECK1815",
+"ptsX",
+"gptB",
+"mpt",
+"JW1806",
+"ptsL"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P69797"
+]
+}
+},
+{
+"id":"b2416",
+"name":"ptsI",
+"notes":{
+"original_bigg_ids":[
+"b2416"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007967"
+],
+"ecogene":[
+"EG10789"
+],
+"ncbigene":[
+"946879"
+],
+"ncbigi":[
+"16130342"
+],
+"refseq_locus_tag":[
+"b2416"
+],
+"refseq_name":[
+"ptsI"
+],
+"refseq_synonym":[
+"ECK2411",
+"ctr",
+"JW2409"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P08839"
+]
+}
+},
+{
+"id":"b2415",
+"name":"ptsH",
+"notes":{
+"original_bigg_ids":[
+"b2415"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007962"
+],
+"ecogene":[
+"EG10788"
+],
+"ncbigene":[
+"946886"
+],
+"ncbigi":[
+"16130341"
+],
+"refseq_locus_tag":[
+"b2415"
+],
+"refseq_name":[
+"ptsH"
+],
+"refseq_synonym":[
+"ctr",
+"hpr",
+"JW2408",
+"ECK2410",
+"iex?"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AA04"
+]
+}
+},
+{
+"id":"b1818",
+"name":"manY",
+"notes":{
+"original_bigg_ids":[
+"b1818"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006056"
+],
+"ecogene":[
+"EG10568"
+],
+"ncbigene":[
+"946332"
+],
+"ncbigi":[
+"16129772"
+],
+"refseq_locus_tag":[
+"b1818"
+],
+"refseq_name":[
+"manY"
+],
+"refseq_synonym":[
+"ptsX",
+"pel",
+"ECK1816",
+"JW1807",
+"ptsP"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P69801"
+]
+}
+},
+{
+"id":"b1611",
+"name":"fumC",
+"notes":{
+"original_bigg_ids":[
+"b1611"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005380"
+],
+"ecogene":[
+"EG10358"
+],
+"ncbigene":[
+"946147"
+],
+"ncbigi":[
+"16129569"
+],
+"refseq_locus_tag":[
+"b1611"
+],
+"refseq_name":[
+"fumC"
+],
+"refseq_synonym":[
+"JW1603",
+"ECK1606"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P05042"
+]
+}
+},
+{
+"id":"b4122",
+"name":"fumB",
+"notes":{
+"original_bigg_ids":[
+"b4122"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013501"
+],
+"ecogene":[
+"EG10357"
+],
+"ncbigene":[
+"948642"
+],
+"ncbigi":[
+"16131948"
+],
+"refseq_locus_tag":[
+"b4122"
+],
+"refseq_name":[
+"fumB"
+],
+"refseq_synonym":[
+"JW4083",
+"ECK4115"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P14407"
+]
+}
+},
+{
+"id":"b1612",
+"name":"fumA",
+"notes":{
+"original_bigg_ids":[
+"b1612"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005392"
+],
+"ecogene":[
+"EG10356"
+],
+"ncbigene":[
+"946826"
+],
+"ncbigi":[
+"16129570"
+],
+"refseq_locus_tag":[
+"b1612"
+],
+"refseq_name":[
+"fumA"
+],
+"refseq_synonym":[
+"JW1604",
+"ECK1607"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AC33"
+]
+}
+},
+{
+"id":"b3528",
+"name":"dctA",
+"notes":{
+"original_bigg_ids":[
+"b3528"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0011527"
+],
+"ecogene":[
+"EG20044"
+],
+"ncbigene":[
+"948039"
+],
+"ncbigi":[
+"16131400"
+],
+"refseq_locus_tag":[
+"b3528"
+],
+"refseq_name":[
+"dctA"
+],
+"refseq_synonym":[
+"JW3496",
+"ECK3513",
+"out"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A830"
+]
+}
+},
+{
+"id":"b1852",
+"name":"zwf",
+"notes":{
+"original_bigg_ids":[
+"b1852"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006171"
+],
+"ecogene":[
+"EG11221"
+],
+"ncbigene":[
+"946370"
+],
+"ncbigi":[
+"16129805"
+],
+"refseq_locus_tag":[
+"b1852"
+],
+"refseq_name":[
+"zwf"
+],
+"refseq_synonym":[
+"JW1841",
+"ECK1853"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AC53"
+]
+}
+},
+{
+"id":"b1779",
+"name":"gapA",
+"notes":{
+"original_bigg_ids":[
+"b1779"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005920"
+],
+"ecogene":[
+"EG10367"
+],
+"ncbigene":[
+"947679"
+],
+"ncbigi":[
+"16129733"
+],
+"refseq_locus_tag":[
+"b1779"
+],
+"refseq_name":[
+"gapA"
+],
+"refseq_synonym":[
+"ECK1777",
+"JW1768"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A9B2"
+]
+}
+},
+{
+"id":"b1101",
+"name":"ptsG",
+"notes":{
+"original_bigg_ids":[
+"b1101"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0003722"
+],
+"ecogene":[
+"EG10787"
+],
+"ncbigene":[
+"945651"
+],
+"ncbigi":[
+"16129064"
+],
+"refseq_locus_tag":[
+"b1101"
+],
+"refseq_name":[
+"ptsG"
+],
+"refseq_synonym":[
+"car",
+"JW1087",
+"umg",
+"glcA",
+"umgC",
+"cat",
+"CR",
+"tgl",
+"ECK1087"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P69786"
+]
+}
+},
+{
+"id":"b2417",
+"name":"crr",
+"notes":{
+"original_bigg_ids":[
+"b2417"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007971"
+],
+"ecogene":[
+"EG10165"
+],
+"ncbigene":[
+"946880"
+],
+"ncbigi":[
+"16130343"
+],
+"refseq_locus_tag":[
+"b2417"
+],
+"refseq_name":[
+"crr"
+],
+"refseq_synonym":[
+"gsr",
+"JW2410",
+"ECK2412",
+"treD",
+"tgs",
+"iex"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P69783"
+]
+}
+},
+{
+"id":"b1621",
+"name":"malX",
+"notes":{
+"original_bigg_ids":[
+"b1621"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005429"
+],
+"ecogene":[
+"EG10563"
+],
+"ncbigene":[
+"946009"
+],
+"ncbigi":[
+"16129579"
+],
+"refseq_locus_tag":[
+"b1621"
+],
+"refseq_name":[
+"malX"
+],
+"refseq_synonym":[
+"ECK1616",
+"JW1613"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P19642"
+]
+}
+},
+{
+"id":"b1297",
+"name":"puuA",
+"notes":{
+"original_bigg_ids":[
+"b1297"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0004365"
+],
+"ecogene":[
+"EG13908"
+],
+"ncbigene":[
+"946202"
+],
+"ncbigi":[
+"90111244"
+],
+"refseq_locus_tag":[
+"b1297"
+],
+"refseq_name":[
+"puuA"
+],
+"refseq_synonym":[
+"ECK1292",
+"JW5201",
+"ycjK"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P78061"
+]
+}
+},
+{
+"id":"b3870",
+"name":"glnA",
+"notes":{
+"original_bigg_ids":[
+"b3870"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012640"
+],
+"ecogene":[
+"EG10383"
+],
+"ncbigene":[
+"948370"
+],
+"ncbigi":[
+"16131710"
+],
+"refseq_locus_tag":[
+"b3870"
+],
+"refseq_name":[
+"glnA"
+],
+"refseq_synonym":[
+"ECK3863",
+"JW3841"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A9C5"
+]
+}
+},
+{
+"id":"b0809",
+"name":"glnQ",
+"notes":{
+"original_bigg_ids":[
+"b0809"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002764"
+],
+"ecogene":[
+"EG10389"
+],
+"ncbigene":[
+"945435"
+],
+"ncbigi":[
+"16128777"
+],
+"refseq_locus_tag":[
+"b0809"
+],
+"refseq_name":[
+"glnQ"
+],
+"refseq_synonym":[
+"JW0794",
+"ECK0798"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P10346"
+]
+}
+},
+{
+"id":"b0811",
+"name":"glnH",
+"notes":{
+"original_bigg_ids":[
+"b0811"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002771"
+],
+"ecogene":[
+"EG10386"
+],
+"ncbigene":[
+"944872"
+],
+"ncbigi":[
+"16128779"
+],
+"refseq_locus_tag":[
+"b0811"
+],
+"refseq_name":[
+"glnH"
+],
+"refseq_synonym":[
+"JW0796",
+"ECK0800"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AEQ3"
+]
+}
+},
+{
+"id":"b0810",
+"name":"glnP",
+"notes":{
+"original_bigg_ids":[
+"b0810"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002766"
+],
+"ecogene":[
+"EG10388"
+],
+"ncbigene":[
+"945621"
+],
+"ncbigi":[
+"16128778"
+],
+"refseq_locus_tag":[
+"b0810"
+],
+"refseq_name":[
+"glnP"
+],
+"refseq_synonym":[
+"JW0795",
+"ECK0799"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AEQ6"
+]
+}
+},
+{
+"id":"b1761",
+"name":"gdhA",
+"notes":{
+"original_bigg_ids":[
+"b1761"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005865"
+],
+"ecogene":[
+"EG10372"
+],
+"ncbigene":[
+"946802"
+],
+"ncbigi":[
+"16129715"
+],
+"refseq_locus_tag":[
+"b1761"
+],
+"refseq_name":[
+"gdhA"
+],
+"refseq_synonym":[
+"ECK1759",
+"JW1750"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P00370"
+]
+}
+},
+{
+"id":"b1524",
+"name":"glsB",
+"notes":{
+"original_bigg_ids":[
+"b1524"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005086"
+],
+"ecogene":[
+"EG13816"
+],
+"ncbigene":[
+"944973"
+],
+"ncbigi":[
+"16129483"
+],
+"refseq_locus_tag":[
+"b1524"
+],
+"refseq_name":[
+"glsB"
+],
+"refseq_synonym":[
+"glsA2",
+"yneH",
+"JW1517",
+"ECK1517"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A6W0"
+]
+}
+},
+{
+"id":"b0485",
+"name":"glsA",
+"notes":{
+"original_bigg_ids":[
+"b0485"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0001688"
+],
+"ecogene":[
+"EG13247"
+],
+"ncbigene":[
+"946187"
+],
+"ncbigi":[
+"16128469"
+],
+"refseq_locus_tag":[
+"b0485"
+],
+"refseq_name":[
+"glsA"
+],
+"refseq_synonym":[
+"glsA1",
+"ECK0479",
+"ybaS",
+"JW0474"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P77454"
+]
+}
+},
+{
+"id":"b1812",
+"name":"pabB",
+"notes":{
+"original_bigg_ids":[
+"b1812"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006031"
+],
+"ecogene":[
+"EG10683"
+],
+"ncbigene":[
+"946337"
+],
+"ncbigi":[
+"16129766"
+],
+"refseq_locus_tag":[
+"b1812"
+],
+"refseq_name":[
+"pabB"
+],
+"refseq_synonym":[
+"ECK1810",
+"JW1801"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P05041"
+]
+}
+},
+{
+"id":"b3213",
+"name":"gltD",
+"notes":{
+"original_bigg_ids":[
+"b3213"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0010547"
+],
+"ecogene":[
+"EG10404"
+],
+"ncbigene":[
+"947723"
+],
+"ncbigi":[
+"16131103"
+],
+"refseq_locus_tag":[
+"b3213"
+],
+"refseq_name":[
+"gltD"
+],
+"refseq_synonym":[
+"psiQ",
+"aspB",
+"ossB",
+"JW3180",
+"ECK3203"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P09832"
+]
+}
+},
+{
+"id":"b3212",
+"name":"gltB",
+"notes":{
+"original_bigg_ids":[
+"b3212"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0010545"
+],
+"ecogene":[
+"EG10403"
+],
+"ncbigene":[
+"947724"
+],
+"ncbigi":[
+"308209621"
+],
+"refseq_locus_tag":[
+"b3212"
+],
+"refseq_name":[
+"gltB"
+],
+"refseq_synonym":[
+"psiQ",
+"aspB",
+"ECK3202",
+"ossB",
+"JW3179"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P09831"
+]
+}
+},
+{
+"id":"b4077",
+"name":"gltP",
+"notes":{
+"original_bigg_ids":[
+"b4077"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013357"
+],
+"ecogene":[
+"EG10405"
+],
+"ncbigene":[
+"948591"
+],
+"ncbigi":[
+"16131903"
+],
+"refseq_locus_tag":[
+"b4077"
+],
+"refseq_name":[
+"gltP"
+],
+"refseq_synonym":[
+"ECK4070",
+"JW4038"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P21345"
+]
+}
+},
+{
+"id":"b2029",
+"name":"gnd",
+"notes":{
+"original_bigg_ids":[
+"b2029"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006737"
+],
+"ecogene":[
+"EG10411"
+],
+"ncbigene":[
+"946554"
+],
+"ncbigi":[
+"16129970"
+],
+"refseq_locus_tag":[
+"b2029"
+],
+"refseq_name":[
+"gnd"
+],
+"refseq_synonym":[
+"JW2011",
+"ECK2024"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P00350"
+]
+}
+},
+{
+"id":"b0875",
+"name":"aqpZ",
+"notes":{
+"original_bigg_ids":[
+"b0875"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002976"
+],
+"ecogene":[
+"EG13270"
+],
+"ncbigene":[
+"945497"
+],
+"ncbigi":[
+"16128843"
+],
+"refseq_locus_tag":[
+"b0875"
+],
+"refseq_name":[
+"aqpZ"
+],
+"refseq_synonym":[
+"bniP",
+"JW0859",
+"ECK0866"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P60844"
+]
+}
+},
+{
+"id":"b1136",
+"name":"icd",
+"notes":{
+"original_bigg_ids":[
+"b1136"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0003823"
+],
+"ecogene":[
+"EG10489"
+],
+"ncbigene":[
+"945702"
+],
+"ncbigi":[
+"16129099"
+],
+"refseq_locus_tag":[
+"b1136"
+],
+"refseq_name":[
+"icd"
+],
+"refseq_synonym":[
+"icdA",
+"icdE",
+"JW1122",
+"ECK1122"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P08200"
+]
+}
+},
+{
+"id":"b4015",
+"name":"aceA",
+"notes":{
+"original_bigg_ids":[
+"b4015"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013128"
+],
+"ecogene":[
+"EG10022"
+],
+"ncbigene":[
+"948517"
+],
+"ncbigi":[
+"16131841"
+],
+"refseq_locus_tag":[
+"b4015"
+],
+"refseq_name":[
+"aceA"
+],
+"refseq_synonym":[
+"JW3975",
+"icl",
+"ECK4007"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A9G6"
+]
+}
+},
+{
+"id":"b1380",
+"name":"ldhA",
+"notes":{
+"original_bigg_ids":[
+"b1380"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0004619"
+],
+"ecogene":[
+"EG13186"
+],
+"ncbigene":[
+"946315"
+],
+"ncbigi":[
+"16129341"
+],
+"refseq_locus_tag":[
+"b1380"
+],
+"refseq_name":[
+"ldhA"
+],
+"refseq_synonym":[
+"ECK1377",
+"JW1375",
+"hslI",
+"htpH",
+"hslF"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P52643"
+]
+}
+},
+{
+"id":"b2133",
+"name":"dld",
+"notes":{
+"original_bigg_ids":[
+"b2133"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007048"
+],
+"ecogene":[
+"EG10231"
+],
+"ncbigene":[
+"946653"
+],
+"ncbigi":[
+"16130071"
+],
+"refseq_locus_tag":[
+"b2133"
+],
+"refseq_name":[
+"dld"
+],
+"refseq_synonym":[
+"JW2121",
+"ECK2126"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P06149"
+]
+}
+},
+{
+"id":"b4014",
+"name":"aceB",
+"notes":{
+"original_bigg_ids":[
+"b4014"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013125"
+],
+"ecogene":[
+"EG10023"
+],
+"ncbigene":[
+"948512"
+],
+"ncbigi":[
+"16131840"
+],
+"refseq_locus_tag":[
+"b4014"
+],
+"refseq_name":[
+"aceB"
+],
+"refseq_synonym":[
+"ECK4006",
+"mas",
+"JW3974"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P08997"
+]
+}
+},
+{
+"id":"b2976",
+"name":"glcB",
+"notes":{
+"original_bigg_ids":[
+"b2976"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0009767"
+],
+"ecogene":[
+"EG20080"
+],
+"ncbigene":[
+"948857"
+],
+"ncbigi":[
+"16130876"
+],
+"refseq_locus_tag":[
+"b2976"
+],
+"refseq_name":[
+"glcB"
+],
+"refseq_synonym":[
+"JW2943",
+"glc",
+"ECK2970"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P37330"
+]
+}
+},
+{
+"id":"b3236",
+"name":"mdh",
+"notes":{
+"original_bigg_ids":[
+"b3236"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0010613"
+],
+"ecogene":[
+"EG10576"
+],
+"ncbigene":[
+"947854"
+],
+"ncbigi":[
+"16131126"
+],
+"refseq_locus_tag":[
+"b3236"
+],
+"refseq_name":[
+"mdh"
+],
+"refseq_synonym":[
+"ECK3225",
+"JW3205"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P61889"
+]
+}
+},
+{
+"id":"b1479",
+"name":"maeA",
+"notes":{
+"original_bigg_ids":[
+"b1479"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0004931"
+],
+"ecogene":[
+"EG10948"
+],
+"ncbigene":[
+"946031"
+],
+"ncbigi":[
+"90111281"
+],
+"refseq_locus_tag":[
+"b1479"
+],
+"refseq_name":[
+"maeA"
+],
+"refseq_synonym":[
+"JW5238",
+"sfcA",
+"ECK1473"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P26616"
+]
+}
+},
+{
+"id":"b2463",
+"name":"maeB",
+"notes":{
+"original_bigg_ids":[
+"b2463"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0008111"
+],
+"ecogene":[
+"EG14193"
+],
+"ncbigene":[
+"946947"
+],
+"ncbigi":[
+"16130388"
+],
+"refseq_locus_tag":[
+"b2463"
+],
+"refseq_name":[
+"maeB"
+],
+"refseq_synonym":[
+"ECK2458",
+"JW2447",
+"ypfF"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P76558"
+]
+}
+},
+{
+"id":"b2281",
+"name":"nuoI",
+"notes":{
+"original_bigg_ids":[
+"b2281"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007539"
+],
+"ecogene":[
+"EG12089"
+],
+"ncbigene":[
+"946757"
+],
+"ncbigi":[
+"16130216"
+],
+"refseq_locus_tag":[
+"b2281"
+],
+"refseq_name":[
+"nuoI"
+],
+"refseq_synonym":[
+"ECK2275",
+"JW2276"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFD6"
+]
+}
+},
+{
+"id":"b2277",
+"name":"nuoM",
+"notes":{
+"original_bigg_ids":[
+"b2277"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007529"
+],
+"ecogene":[
+"EG11773"
+],
+"ncbigene":[
+"947731"
+],
+"ncbigi":[
+"16130212"
+],
+"refseq_locus_tag":[
+"b2277"
+],
+"refseq_name":[
+"nuoM"
+],
+"refseq_synonym":[
+"JW2272",
+"nuoA",
+"ECK2271"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFE8"
+]
+}
+},
+{
+"id":"b2280",
+"name":"nuoJ",
+"notes":{
+"original_bigg_ids":[
+"b2280"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007536"
+],
+"ecogene":[
+"EG12090"
+],
+"ncbigene":[
+"946756"
+],
+"ncbigi":[
+"16130215"
+],
+"refseq_locus_tag":[
+"b2280"
+],
+"refseq_name":[
+"nuoJ"
+],
+"refseq_synonym":[
+"ECK2274",
+"JW2275"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFE0"
+]
+}
+},
+{
+"id":"b2286",
+"name":"nuoC",
+"notes":{
+"original_bigg_ids":[
+"b2286"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007549"
+],
+"ecogene":[
+"EG12084"
+],
+"ncbigene":[
+"946759"
+],
+"ncbigi":[
+"145698291"
+],
+"refseq_locus_tag":[
+"b2286"
+],
+"refseq_name":[
+"nuoC"
+],
+"refseq_synonym":[
+"ECK2280",
+"nuoD",
+"nuoCD",
+"JW5375"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P33599"
+]
+}
+},
+{
+"id":"b2287",
+"name":"nuoB",
+"notes":{
+"original_bigg_ids":[
+"b2287"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007551"
+],
+"ecogene":[
+"EG12083"
+],
+"ncbigene":[
+"946738"
+],
+"ncbigi":[
+"16130222"
+],
+"refseq_locus_tag":[
+"b2287"
+],
+"refseq_name":[
+"nuoB"
+],
+"refseq_synonym":[
+"JW5875",
+"ECK2281"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFC7"
+]
+}
+},
+{
+"id":"b2284",
+"name":"nuoF",
+"notes":{
+"original_bigg_ids":[
+"b2284"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007545"
+],
+"ecogene":[
+"EG11774"
+],
+"ncbigene":[
+"946753"
+],
+"ncbigi":[
+"16130219"
+],
+"refseq_locus_tag":[
+"b2284"
+],
+"refseq_name":[
+"nuoF"
+],
+"refseq_synonym":[
+"ECK2278",
+"nuoB",
+"JW2279"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P31979"
+]
+}
+},
+{
+"id":"b2276",
+"name":"nuoN",
+"notes":{
+"original_bigg_ids":[
+"b2276"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007526"
+],
+"ecogene":[
+"EG12093"
+],
+"ncbigene":[
+"945136"
+],
+"ncbigi":[
+"145698289"
+],
+"refseq_locus_tag":[
+"b2276"
+],
+"refseq_name":[
+"nuoN"
+],
+"refseq_synonym":[
+"JW2271",
+"ECK2270"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFF0"
+]
+}
+},
+{
+"id":"b2282",
+"name":"nuoH",
+"notes":{
+"original_bigg_ids":[
+"b2282"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007541"
+],
+"ecogene":[
+"EG12088"
+],
+"ncbigene":[
+"946761"
+],
+"ncbigi":[
+"16130217"
+],
+"refseq_locus_tag":[
+"b2282"
+],
+"refseq_name":[
+"nuoH"
+],
+"refseq_synonym":[
+"JW2277",
+"ECK2276"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFD4"
+]
+}
+},
+{
+"id":"b2279",
+"name":"nuoK",
+"notes":{
+"original_bigg_ids":[
+"b2279"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007534"
+],
+"ecogene":[
+"EG12091"
+],
+"ncbigene":[
+"947580"
+],
+"ncbigi":[
+"16130214"
+],
+"refseq_locus_tag":[
+"b2279"
+],
+"refseq_name":[
+"nuoK"
+],
+"refseq_synonym":[
+"JW2274",
+"ECK2273"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFE4"
+]
+}
+},
+{
+"id":"b2283",
+"name":"nuoG",
+"notes":{
+"original_bigg_ids":[
+"b2283"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007543"
+],
+"ecogene":[
+"EG12087"
+],
+"ncbigene":[
+"946762"
+],
+"ncbigi":[
+"145698290"
+],
+"refseq_locus_tag":[
+"b2283"
+],
+"refseq_name":[
+"nuoG"
+],
+"refseq_synonym":[
+"JW2278",
+"ECK2277"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P33602"
+]
+}
+},
+{
+"id":"b2285",
+"name":"nuoE",
+"notes":{
+"original_bigg_ids":[
+"b2285"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007547"
+],
+"ecogene":[
+"EG12086"
+],
+"ncbigene":[
+"946746"
+],
+"ncbigi":[
+"16130220"
+],
+"refseq_locus_tag":[
+"b2285"
+],
+"refseq_name":[
+"nuoE"
+],
+"refseq_synonym":[
+"JW2280",
+"ECK2279"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFD1"
+]
+}
+},
+{
+"id":"b2288",
+"name":"nuoA",
+"notes":{
+"original_bigg_ids":[
+"b2288"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007553"
+],
+"ecogene":[
+"EG12082"
+],
+"ncbigene":[
+"946764"
+],
+"ncbigi":[
+"49176207"
+],
+"refseq_locus_tag":[
+"b2288"
+],
+"refseq_name":[
+"nuoA"
+],
+"refseq_synonym":[
+"JW2283",
+"ECK2282"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFC3"
+]
+}
+},
+{
+"id":"b2278",
+"name":"nuoL",
+"notes":{
+"original_bigg_ids":[
+"b2278"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007532"
+],
+"ecogene":[
+"EG12092"
+],
+"ncbigene":[
+"945540"
+],
+"ncbigi":[
+"16130213"
+],
+"refseq_locus_tag":[
+"b2278"
+],
+"refseq_name":[
+"nuoL"
+],
+"refseq_synonym":[
+"ECK2272",
+"JW2273"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P33607"
+]
+}
+},
+{
+"id":"b1603",
+"name":"pntA",
+"notes":{
+"original_bigg_ids":[
+"b1603"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005354"
+],
+"ecogene":[
+"EG10744"
+],
+"ncbigene":[
+"946628"
+],
+"ncbigi":[
+"16129561"
+],
+"refseq_locus_tag":[
+"b1603"
+],
+"refseq_name":[
+"pntA"
+],
+"refseq_synonym":[
+"JW1595",
+"ECK1598"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P07001"
+]
+}
+},
+{
+"id":"b3962",
+"name":"sthA",
+"notes":{
+"original_bigg_ids":[
+"b3962"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012975"
+],
+"ecogene":[
+"EG11428"
+],
+"ncbigene":[
+"948461"
+],
+"ncbigi":[
+"90111670"
+],
+"refseq_locus_tag":[
+"b3962"
+],
+"refseq_name":[
+"sthA"
+],
+"refseq_synonym":[
+"ECK3954",
+"udhA",
+"JW5551",
+"sth"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P27306"
+]
+}
+},
+{
+"id":"b1602",
+"name":"pntB",
+"notes":{
+"original_bigg_ids":[
+"b1602"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005352"
+],
+"ecogene":[
+"EG10745"
+],
+"ncbigene":[
+"946144"
+],
+"ncbigi":[
+"16129560"
+],
+"refseq_locus_tag":[
+"b1602"
+],
+"refseq_name":[
+"pntB"
+],
+"refseq_synonym":[
+"ECK1597",
+"JW1594"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AB67"
+]
+}
+},
+{
+"id":"b0451",
+"name":"amtB",
+"notes":{
+"original_bigg_ids":[
+"b0451"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0001564"
+],
+"ecogene":[
+"EG11821"
+],
+"ncbigene":[
+"945084"
+],
+"ncbigi":[
+"16128436"
+],
+"refseq_locus_tag":[
+"b0451"
+],
+"refseq_name":[
+"amtB"
+],
+"refseq_synonym":[
+"JW0441",
+"ECK0445",
+"ybaG"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P69681"
+]
+}
+},
+{
+"id":"b0114",
+"name":"aceE",
+"notes":{
+"original_bigg_ids":[
+"b0114"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0000397"
+],
+"ecogene":[
+"EG10024"
+],
+"ncbigene":[
+"944834"
+],
+"ncbigi":[
+"16128107"
+],
+"refseq_locus_tag":[
+"b0114"
+],
+"refseq_name":[
+"aceE"
+],
+"refseq_synonym":[
+"ECK0113",
+"JW0110"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFG8"
+]
+}
+},
+{
+"id":"b0115",
+"name":"aceF",
+"notes":{
+"original_bigg_ids":[
+"b0115"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0000400"
+],
+"ecogene":[
+"EG10025"
+],
+"ncbigene":[
+"944794"
+],
+"ncbigi":[
+"16128108"
+],
+"refseq_locus_tag":[
+"b0115"
+],
+"refseq_name":[
+"aceF"
+],
+"refseq_synonym":[
+"ECK0114",
+"JW0111"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P06959"
+]
+}
+},
+{
+"id":"b3916",
+"name":"pfkA",
+"notes":{
+"original_bigg_ids":[
+"b3916"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012789"
+],
+"ecogene":[
+"EG10699"
+],
+"ncbigene":[
+"948412"
+],
+"ncbigi":[
+"16131754"
+],
+"refseq_locus_tag":[
+"b3916"
+],
+"refseq_name":[
+"pfkA"
+],
+"refseq_synonym":[
+"JW3887",
+"ECK3908"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A796"
+]
+}
+},
+{
+"id":"b1723",
+"name":"pfkB",
+"notes":{
+"original_bigg_ids":[
+"b1723"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005748"
+],
+"ecogene":[
+"EG10700"
+],
+"ncbigene":[
+"946230"
+],
+"ncbigi":[
+"49176138"
+],
+"refseq_locus_tag":[
+"b1723"
+],
+"refseq_name":[
+"pfkB"
+],
+"refseq_synonym":[
+"JW5280",
+"ECK1721"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P06999"
+]
+}
+},
+{
+"id":"b3114",
+"name":"tdcE",
+"notes":{
+"original_bigg_ids":[
+"b3114"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0010242"
+],
+"ecogene":[
+"EG12758"
+],
+"ncbigene":[
+"947623"
+],
+"ncbigi":[
+"49176316"
+],
+"refseq_locus_tag":[
+"b3114"
+],
+"refseq_name":[
+"tdcE"
+],
+"refseq_synonym":[
+"JW5522",
+"ECK3103",
+"yhaS"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P42632"
+]
+}
+},
+{
+"id":"b2579",
+"name":"grcA",
+"notes":{
+"original_bigg_ids":[
+"b2579"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0008489"
+],
+"ecogene":[
+"EG11784"
+],
+"ncbigene":[
+"947068"
+],
+"ncbigi":[
+"16130504"
+],
+"refseq_locus_tag":[
+"b2579"
+],
+"refseq_name":[
+"grcA"
+],
+"refseq_synonym":[
+"ECK2577",
+"yfiD",
+"JW2563"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P68066"
+]
+}
+},
+{
+"id":"b3951",
+"name":"pflD",
+"notes":{
+"original_bigg_ids":[
+"b3951"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012934"
+],
+"ecogene":[
+"EG11910"
+],
+"ncbigene":[
+"948454"
+],
+"ncbigi":[
+"16131789"
+],
+"refseq_locus_tag":[
+"b3951"
+],
+"refseq_name":[
+"pflD"
+],
+"refseq_synonym":[
+"ECK3942",
+"yijL",
+"JW3923"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P32674"
+]
+}
+},
+{
+"id":"b0902",
+"name":"pflA",
+"notes":{
+"original_bigg_ids":[
+"b0902"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0003068"
+],
+"ecogene":[
+"EG10028"
+],
+"ncbigene":[
+"945517"
+],
+"ncbigi":[
+"16128869"
+],
+"refseq_locus_tag":[
+"b0902"
+],
+"refseq_name":[
+"pflA"
+],
+"refseq_synonym":[
+"ECK0893",
+"JW0885",
+"act"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A9N4"
+]
+}
+},
+{
+"id":"b3952",
+"name":"pflC",
+"notes":{
+"original_bigg_ids":[
+"b3952"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012937"
+],
+"ecogene":[
+"EG11911"
+],
+"ncbigene":[
+"948453"
+],
+"ncbigi":[
+"49176447"
+],
+"refseq_locus_tag":[
+"b3952"
+],
+"refseq_name":[
+"pflC"
+],
+"refseq_synonym":[
+"ECK3943",
+"JW3924",
+"yijM"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P32675"
+]
+}
+},
+{
+"id":"b0903",
+"name":"pflB",
+"notes":{
+"original_bigg_ids":[
+"b0903"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0003071"
+],
+"ecogene":[
+"EG10701"
+],
+"ncbigene":[
+"945514"
+],
+"ncbigi":[
+"16128870"
+],
+"refseq_locus_tag":[
+"b0903"
+],
+"refseq_name":[
+"pflB"
+],
+"refseq_synonym":[
+"pfl",
+"ECK0894",
+"JW0886"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P09373"
+]
+}
+},
+{
+"id":"b4025",
+"name":"pgi",
+"notes":{
+"original_bigg_ids":[
+"b4025"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013163"
+],
+"ecogene":[
+"EG10702"
+],
+"ncbigene":[
+"948535"
+],
+"ncbigi":[
+"16131851"
+],
+"refseq_locus_tag":[
+"b4025"
+],
+"refseq_name":[
+"pgi"
+],
+"refseq_synonym":[
+"JW3985",
+"ECK4017"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A6T1"
+]
+}
+},
+{
+"id":"b2926",
+"name":"pgk",
+"notes":{
+"original_bigg_ids":[
+"b2926"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0009605"
+],
+"ecogene":[
+"EG10703"
+],
+"ncbigene":[
+"947414"
+],
+"ncbigi":[
+"16130827"
+],
+"refseq_locus_tag":[
+"b2926"
+],
+"refseq_name":[
+"pgk"
+],
+"refseq_synonym":[
+"ECK2922",
+"JW2893"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A799"
+]
+}
+},
+{
+"id":"b0767",
+"name":"pgl",
+"notes":{
+"original_bigg_ids":[
+"b0767"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002611"
+],
+"ecogene":[
+"EG13231"
+],
+"ncbigene":[
+"946398"
+],
+"ncbigi":[
+"16128735"
+],
+"refseq_locus_tag":[
+"b0767"
+],
+"refseq_name":[
+"pgl"
+],
+"refseq_synonym":[
+"JW0750",
+"ybhE",
+"ECK0756",
+"blu"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P52697"
+]
+}
+},
+{
+"id":"b3612",
+"name":"gpmM",
+"notes":{
+"original_bigg_ids":[
+"b3612"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0011818"
+],
+"ecogene":[
+"EG12296"
+],
+"ncbigene":[
+"948130"
+],
+"ncbigi":[
+"16131483"
+],
+"refseq_locus_tag":[
+"b3612"
+],
+"refseq_name":[
+"gpmM"
+],
+"refseq_synonym":[
+"JW3587",
+"yibO",
+"ECK3602",
+"pgmI",
+"gpmC",
+"gpmI"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P37689"
+]
+}
+},
+{
+"id":"b4395",
+"name":"ytjC",
+"notes":{
+"original_bigg_ids":[
+"b4395"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0014416"
+],
+"ecogene":[
+"EG12164"
+],
+"ncbigene":[
+"948918"
+],
+"ncbigi":[
+"16132212"
+],
+"refseq_locus_tag":[
+"b4395"
+],
+"refseq_name":[
+"ytjC"
+],
+"refseq_synonym":[
+"gpmB",
+"JW4358",
+"ECK4387"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A7A2"
+]
+}
+},
+{
+"id":"b0755",
+"name":"gpmA",
+"notes":{
+"original_bigg_ids":[
+"b0755"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002563"
+],
+"ecogene":[
+"EG11699"
+],
+"ncbigene":[
+"945068"
+],
+"ncbigi":[
+"16128723"
+],
+"refseq_locus_tag":[
+"b0755"
+],
+"refseq_name":[
+"gpmA"
+],
+"refseq_synonym":[
+"JW0738",
+"gpm",
+"ECK0744"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P62707"
+]
+}
+},
+{
+"id":"b3493",
+"name":"pitA",
+"notes":{
+"original_bigg_ids":[
+"b3493"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0011407"
+],
+"ecogene":[
+"EG12230"
+],
+"ncbigene":[
+"948009"
+],
+"ncbigi":[
+"16131365"
+],
+"refseq_locus_tag":[
+"b3493"
+],
+"refseq_name":[
+"pitA"
+],
+"refseq_synonym":[
+"pit",
+"ECK3478",
+"JW3460"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AFJ7"
+]
+}
+},
+{
+"id":"b2987",
+"name":"pitB",
+"notes":{
+"original_bigg_ids":[
+"b2987"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0009800"
+],
+"ecogene":[
+"EG12883"
+],
+"ncbigene":[
+"947475"
+],
+"ncbigi":[
+"16130887"
+],
+"refseq_locus_tag":[
+"b2987"
+],
+"refseq_name":[
+"pitB"
+],
+"refseq_synonym":[
+"ECK2981",
+"JW2955"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P43676"
+]
+}
+},
+{
+"id":"b3956",
+"name":"ppc",
+"notes":{
+"original_bigg_ids":[
+"b3956"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012950"
+],
+"ecogene":[
+"EG10756"
+],
+"ncbigene":[
+"948457"
+],
+"ncbigi":[
+"16131794"
+],
+"refseq_locus_tag":[
+"b3956"
+],
+"refseq_name":[
+"ppc"
+],
+"refseq_synonym":[
+"glu",
+"ECK3947",
+"asp",
+"JW3928"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P00864"
+]
+}
+},
+{
+"id":"b3403",
+"name":"pck",
+"notes":{
+"original_bigg_ids":[
+"b3403"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0011106"
+],
+"ecogene":[
+"EG10688"
+],
+"ncbigene":[
+"945667"
+],
+"ncbigi":[
+"16131280"
+],
+"refseq_locus_tag":[
+"b3403"
+],
+"refseq_name":[
+"pck"
+],
+"refseq_synonym":[
+"JW3366",
+"pckA",
+"ECK3390"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P22259"
+]
+}
+},
+{
+"id":"b1702",
+"name":"ppsA",
+"notes":{
+"original_bigg_ids":[
+"b1702"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005678"
+],
+"ecogene":[
+"EG10759"
+],
+"ncbigene":[
+"946209"
+],
+"ncbigi":[
+"16129658"
+],
+"refseq_locus_tag":[
+"b1702"
+],
+"refseq_name":[
+"ppsA"
+],
+"refseq_synonym":[
+"pps",
+"ECK1700",
+"JW1692"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P23538"
+]
+}
+},
+{
+"id":"b2297",
+"name":"pta",
+"notes":{
+"original_bigg_ids":[
+"b2297"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0007582"
+],
+"ecogene":[
+"EG20173"
+],
+"ncbigene":[
+"946778"
+],
+"ncbigi":[
+"16130232"
+],
+"refseq_locus_tag":[
+"b2297"
+],
+"refseq_name":[
+"pta"
+],
+"refseq_synonym":[
+"JW2294",
+"ECK2291"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A9M8"
+]
+}
+},
+{
+"id":"b2458",
+"name":"eutD",
+"notes":{
+"original_bigg_ids":[
+"b2458"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0008097"
+],
+"ecogene":[
+"EG14188"
+],
+"ncbigene":[
+"946940"
+],
+"ncbigi":[
+"16130383"
+],
+"refseq_locus_tag":[
+"b2458"
+],
+"refseq_name":[
+"eutD"
+],
+"refseq_synonym":[
+"eutI",
+"ypfA",
+"ECK2453",
+"JW2442"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P77218"
+]
+}
+},
+{
+"id":"b1676",
+"name":"pykF",
+"notes":{
+"original_bigg_ids":[
+"b1676"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0005600"
+],
+"ecogene":[
+"EG10804"
+],
+"ncbigene":[
+"946179"
+],
+"ncbigi":[
+"16129632"
+],
+"refseq_locus_tag":[
+"b1676"
+],
+"refseq_name":[
+"pykF"
+],
+"refseq_synonym":[
+"ECK1672",
+"JW1666"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AD61"
+]
+}
+},
+{
+"id":"b1854",
+"name":"pykA",
+"notes":{
+"original_bigg_ids":[
+"b1854"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0006182"
+],
+"ecogene":[
+"EG10803"
+],
+"ncbigene":[
+"946527"
+],
+"ncbigi":[
+"16129807"
+],
+"refseq_locus_tag":[
+"b1854"
+],
+"refseq_name":[
+"pykA"
+],
+"refseq_synonym":[
+"JW1843",
+"ECK1855"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P21599"
+]
+}
+},
+{
+"id":"b3386",
+"name":"rpe",
+"notes":{
+"original_bigg_ids":[
+"b3386"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0011061"
+],
+"ecogene":[
+"EG11960"
+],
+"ncbigene":[
+"947896"
+],
+"ncbigi":[
+"16131264"
+],
+"refseq_locus_tag":[
+"b3386"
+],
+"refseq_name":[
+"rpe"
+],
+"refseq_synonym":[
+"yhfD",
+"ECK3373",
+"JW3349",
+"dod"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AG07"
+]
+}
+},
+{
+"id":"b4301",
+"name":"sgcE",
+"notes":{
+"original_bigg_ids":[
+"b4301"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0014097"
+],
+"ecogene":[
+"EG12553"
+],
+"ncbigene":[
+"948829"
+],
+"ncbigi":[
+"16132122"
+],
+"refseq_locus_tag":[
+"b4301"
+],
+"refseq_name":[
+"sgcE"
+],
+"refseq_synonym":[
+"JW4263",
+"ECK4290",
+"yjhK"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P39362"
+]
+}
+},
+{
+"id":"b2914",
+"name":"rpiA",
+"notes":{
+"original_bigg_ids":[
+"b2914"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0009567"
+],
+"ecogene":[
+"EG11443"
+],
+"ncbigene":[
+"947407"
+],
+"ncbigi":[
+"16130815"
+],
+"refseq_locus_tag":[
+"b2914"
+],
+"refseq_name":[
+"rpiA"
+],
+"refseq_synonym":[
+"ECK2910",
+"JW5475",
+"ygfC"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A7Z0"
+]
+}
+},
+{
+"id":"b4090",
+"name":"rpiB",
+"notes":{
+"original_bigg_ids":[
+"b4090"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0013405"
+],
+"ecogene":[
+"EG11827"
+],
+"ncbigene":[
+"948602"
+],
+"ncbigi":[
+"16131916"
+],
+"refseq_locus_tag":[
+"b4090"
+],
+"refseq_name":[
+"rpiB"
+],
+"refseq_synonym":[
+"JW4051",
+"alsB",
+"alsI",
+"yjcA",
+"ECK4083"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P37351"
+]
+}
+},
+{
+"id":"b0721",
+"name":"sdhC",
+"notes":{
+"original_bigg_ids":[
+"b0721"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002460"
+],
+"ecogene":[
+"EG10933"
+],
+"ncbigene":[
+"945316"
+],
+"ncbigi":[
+"16128696"
+],
+"refseq_locus_tag":[
+"b0721"
+],
+"refseq_name":[
+"sdhC"
+],
+"refseq_synonym":[
+"JW0711",
+"ECK0710",
+"cybA"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P69054"
+]
+}
+},
+{
+"id":"b0722",
+"name":"sdhD",
+"notes":{
+"original_bigg_ids":[
+"b0722"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002464"
+],
+"ecogene":[
+"EG10934"
+],
+"ncbigene":[
+"945322"
+],
+"ncbigi":[
+"16128697"
+],
+"refseq_locus_tag":[
+"b0722"
+],
+"refseq_name":[
+"sdhD"
+],
+"refseq_synonym":[
+"JW0712",
+"ECK0711"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AC44"
+]
+}
+},
+{
+"id":"b0724",
+"name":"sdhB",
+"notes":{
+"original_bigg_ids":[
+"b0724"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002468"
+],
+"ecogene":[
+"EG10932"
+],
+"ncbigene":[
+"945300"
+],
+"ncbigi":[
+"16128699"
+],
+"refseq_locus_tag":[
+"b0724"
+],
+"refseq_name":[
+"sdhB"
+],
+"refseq_synonym":[
+"ECK0713",
+"JW0714"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P07014"
+]
+}
+},
+{
+"id":"b0723",
+"name":"sdhA",
+"notes":{
+"original_bigg_ids":[
+"b0723"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002466"
+],
+"ecogene":[
+"EG10931"
+],
+"ncbigene":[
+"945402"
+],
+"ncbigi":[
+"16128698"
+],
+"refseq_locus_tag":[
+"b0723"
+],
+"refseq_name":[
+"sdhA"
+],
+"refseq_synonym":[
+"JW0713",
+"ECK0712"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AC41"
+]
+}
+},
+{
+"id":"b0729",
+"name":"sucD",
+"notes":{
+"original_bigg_ids":[
+"b0729"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002485"
+],
+"ecogene":[
+"EG10982"
+],
+"ncbigene":[
+"945314"
+],
+"ncbigi":[
+"16128704"
+],
+"refseq_locus_tag":[
+"b0729"
+],
+"refseq_name":[
+"sucD"
+],
+"refseq_synonym":[
+"JW0718",
+"ECK0717"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0AGE9"
+]
+}
+},
+{
+"id":"b0728",
+"name":"sucC",
+"notes":{
+"original_bigg_ids":[
+"b0728"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0002483"
+],
+"ecogene":[
+"EG10981"
+],
+"ncbigene":[
+"945312"
+],
+"ncbigi":[
+"16128703"
+],
+"refseq_locus_tag":[
+"b0728"
+],
+"refseq_name":[
+"sucC"
+],
+"refseq_synonym":[
+"JW0717",
+"ECK0716"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A836"
+]
+}
+},
+{
+"id":"b0008",
+"name":"talB",
+"notes":{
+"original_bigg_ids":[
+"b0008"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0000027"
+],
+"ecogene":[
+"EG11556"
+],
+"ncbigene":[
+"944748"
+],
+"ncbigi":[
+"16128002"
+],
+"refseq_locus_tag":[
+"b0008"
+],
+"refseq_name":[
+"talB"
+],
+"refseq_synonym":[
+"yaaK",
+"JW0007",
+"ECK0008"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A870"
+]
+}
+},
+{
+"id":"b2464",
+"name":"talA",
+"notes":{
+"original_bigg_ids":[
+"b2464"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0008115"
+],
+"ecogene":[
+"EG11797"
+],
+"ncbigene":[
+"947006"
+],
+"ncbigi":[
+"16130389"
+],
+"refseq_locus_tag":[
+"b2464"
+],
+"refseq_name":[
+"talA"
+],
+"refseq_synonym":[
+"ECK2459",
+"JW2448"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A867"
+]
+}
+},
+{
+"id":"b2465",
+"name":"tktB",
+"notes":{
+"original_bigg_ids":[
+"b2465"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0008117"
+],
+"ecogene":[
+"EG12100"
+],
+"ncbigene":[
+"945865"
+],
+"ncbigi":[
+"16130390"
+],
+"refseq_locus_tag":[
+"b2465"
+],
+"refseq_name":[
+"tktB"
+],
+"refseq_synonym":[
+"JW2449",
+"ECK2460"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P33570"
+]
+}
+},
+{
+"id":"b2935",
+"name":"tktA",
+"notes":{
+"original_bigg_ids":[
+"b2935"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0009625"
+],
+"ecogene":[
+"EG11427"
+],
+"ncbigene":[
+"947420"
+],
+"ncbigi":[
+"49176286"
+],
+"refseq_locus_tag":[
+"b2935"
+],
+"refseq_name":[
+"tktA"
+],
+"refseq_synonym":[
+"JW5478",
+"tkt",
+"ECK2930"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P27302"
+]
+}
+},
+{
+"id":"b3919",
+"name":"tpiA",
+"notes":{
+"original_bigg_ids":[
+"b3919"
+]
+},
+"annotation":{
+"asap":[
+"ABE-0012799"
+],
+"ecogene":[
+"EG11015"
+],
+"ncbigene":[
+"948409"
+],
+"ncbigi":[
+"16131757"
+],
+"refseq_locus_tag":[
+"b3919"
+],
+"refseq_name":[
+"tpiA"
+],
+"refseq_synonym":[
+"JW3890",
+"ECK3911",
+"tpi"
+],
+"sbo":"SBO:0000243",
+"uniprot":[
+"P0A858"
+]
+}
+}
+],
+"id":"e_coli_core",
+"compartments":{
+"c":"cytosol",
+"e":"extracellular space"
+},
+"version":"1"
+}
\ No newline at end of file
diff --git a/tests/data/e_coli_core_for_annotation.xml b/tests/data/e_coli_core_for_annotation.xml
new file mode 100644
index 000000000..5658f8fdb
--- /dev/null
+++ b/tests/data/e_coli_core_for_annotation.xml
@@ -0,0 +1,8367 @@
+
+
+
+
+
+
+
Key1 : Value1
+
+
+
e_coli_core - Escherichia coli str. K-12 substr. MG1655
+
+
+
+
+
+
+
+
+ Description
+
+
This is a metabolism model of Escherichia coli str. K-12 substr. MG1655 in
+ SBML format.
+
+ The content of this model has been carefully created in a manual research effort. This file has been exported from the software
+
COBRApy and further processed with the
+
JSBML-based
+
ModelPolisher application.
+
+ Terms of use
+ Copyright © 2017 The Regents of the University of California.
+
+
Redistribution and use of any part of this model from BiGG Models knowledge-base, with or without modification, are permitted provided that the following conditions are met:
+
+ - Redistributions of this SBML file must retain the above copyright notice, this list of conditions and the following disclaimer.
+ - Redistributions in a different form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided
+ with the distribution.
+
This model is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+
For specific licensing terms about this particular model and regulations of commercial use, see
+ this model in BiGG Models knowledge-base.
+
+ References
When using content from BiGG Models knowledge-base in your research works, please cite
+
+ - King ZA, Lu JS, Dräger A, Miller PC, Federowicz S, Lerman JA, Ebrahim A, Palsson BO, and Lewis NE. (2015).
+
- BiGG Models: A platform for integrating, standardizing, and sharing genome-scale models.
+ Nucl Acids Res.
+ doi:10.1093/nar/gkv1049
+
+
+
+
+
+
+
+
+
+ Koenig
+ Matthias
+
+ koenigmx@hu-berlin.de
+
+ Humboldt-University Berlin, Institute for Theoretical Biology
+
+
+
+
+ Koenig
+ Matthias
+
+ koenigmx@hu-berlin.de
+
+
+
+ Koenig
+ Matthias
+
+
+ Humboldt-University Berlin, Institute for Theoretical Biology
+
+
+
+
+ Koenig
+ Matthias
+
+
+
+
+
+ 2019-03-06T14:40:55Z
+
+
+ 2019-03-06T14:40:55Z
+
+
+ 2019-03-06T14:41:55Z
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Key1 : Value1
+
Key2 : Value2
+
+
A Heading
+
e_coli_core - Escherichia coli str. K-12 substr. MG1655
+
+
Key3 : Value3
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/tests/data/e_coli_new_format.json b/tests/data/e_coli_new_format.json
new file mode 100644
index 000000000..450dcf9f4
--- /dev/null
+++ b/tests/data/e_coli_new_format.json
@@ -0,0 +1,9168 @@
+{
+ "annotation": {
+ "cvterms": {
+ "bqb_hasTaxon": [
+ {
+ "resources": [
+ "http://identifiers.org/taxonomy/511145"
+ ]
+ }
+ ],
+ "bqm_is": [
+ {
+ "nested_data": {
+ "bqb_isDescribedBy": [
+ {
+ "resources": [
+ "https://identifiers.org/pubmed/1111111"
+ ]
+ },
+ {
+ "resources": [
+ "https://identifiers.org/eco/ECO:0000004"
+ ]
+ }
+ ]
+ },
+ "resources": [
+ "http://identifiers.org/bigg.model/e_coli_core"
+ ]
+ }
+ ],
+ "bqm_isDescribedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/doi/10.1128/ecosalplus.10.2.1"
+ ]
+ },
+ {
+ "resources": [
+ "http://identifiers.org/ncbigi/gi:16128336"
+ ]
+ }
+ ]
+ },
+ "history": {
+ "created_date": "2019-03-06T14:40:55Z",
+ "creators": [
+ {
+ "email": "koenigmx@hu-berlin.de",
+ "given_name": "Matthias",
+ "family_name": "Koenig",
+ "organisation": "Humboldt-University Berlin, Institute for Theoretical Biology"
+ }
+ ],
+ "modified_dates": [
+ "2019-03-06T14:40:55Z"
+ ]
+ }
+ },
+ "compartments": {
+ "c": "cytosol",
+ "e": "extracellular space"
+ },
+ "genes": [
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P77580"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0001207",
+ "http://identifiers.org/ecogene/EG13625",
+ "http://identifiers.org/ncbigene/945008",
+ "http://identifiers.org/ncbigi/gi:16128336"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0351",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A9Q7"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0004164",
+ "http://identifiers.org/ecogene/EG10031",
+ "http://identifiers.org/ncbigene/945837",
+ "http://identifiers.org/ncbigi/gi:16129202"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1241",
+ "name": ""
+ },
+ {
+ "id": "G_s0001",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A6A3"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007579",
+ "http://identifiers.org/ecogene/EG10027",
+ "http://identifiers.org/ncbigene/946775",
+ "http://identifiers.org/ncbigi/gi:16130231"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2296",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P11868"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0010245",
+ "http://identifiers.org/ecogene/EG11172",
+ "http://identifiers.org/ncbigene/947635",
+ "http://identifiers.org/ncbigi/gi:145698313"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3115",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P33221"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006162",
+ "http://identifiers.org/ecogene/EG11809",
+ "http://identifiers.org/ncbigene/946368",
+ "http://identifiers.org/ncbigi/gi:16129802"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1849",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P25516"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0004283",
+ "http://identifiers.org/ecogene/EG11325",
+ "http://identifiers.org/ncbigene/946724",
+ "http://identifiers.org/ncbigi/gi:16129237"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1276",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P36683"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0000411",
+ "http://identifiers.org/ecogene/EG12316",
+ "http://identifiers.org/ncbigene/944864",
+ "http://identifiers.org/ncbigi/gi:16128111"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0118",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P69441"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0001645",
+ "http://identifiers.org/ecogene/EG10032",
+ "http://identifiers.org/ncbigene/945097",
+ "http://identifiers.org/ncbigi/gi:16128458"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0474",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFG3"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002478",
+ "http://identifiers.org/ecogene/EG10979",
+ "http://identifiers.org/ncbigene/945303",
+ "http://identifiers.org/ncbigi/gi:16128701"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0726",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A9P0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0000404",
+ "http://identifiers.org/ecogene/EG10543",
+ "http://identifiers.org/ncbigene/944854",
+ "http://identifiers.org/ncbigi/gi:16128109"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0116",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFG6"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002480",
+ "http://identifiers.org/ecogene/EG10980",
+ "http://identifiers.org/ncbigene/945307",
+ "http://identifiers.org/ncbigi/gi:16128702"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0727",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AEX3"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0008515",
+ "http://identifiers.org/ecogene/EG10522",
+ "http://identifiers.org/ncbigene/947069",
+ "http://identifiers.org/ncbigi/gi:16130512"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2587",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P25437"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0001221",
+ "http://identifiers.org/ecogene/EG50010",
+ "http://identifiers.org/ncbigene/944988",
+ "http://identifiers.org/ncbigi/gi:16128341"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0356",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P39451"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0004928",
+ "http://identifiers.org/ecogene/EG12622",
+ "http://identifiers.org/ncbigene/946036",
+ "http://identifiers.org/ncbigi/gi:90111280"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1478",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABA0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012217",
+ "http://identifiers.org/ecogene/EG10103",
+ "http://identifiers.org/ncbigene/948247",
+ "http://identifiers.org/ncbigi/gi:16131604"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3736",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A6E6"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012206",
+ "http://identifiers.org/ecogene/EG10100",
+ "http://identifiers.org/ncbigene/948245",
+ "http://identifiers.org/ncbigi/gi:16131599"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3731",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABB4"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012208",
+ "http://identifiers.org/ecogene/EG10101",
+ "http://identifiers.org/ncbigene/948244",
+ "http://identifiers.org/ncbigi/gi:16131600"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3732",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P68699"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012220",
+ "http://identifiers.org/ecogene/EG10102",
+ "http://identifiers.org/ncbigene/948253",
+ "http://identifiers.org/ncbigi/gi:16131605"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3737",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABB0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012213",
+ "http://identifiers.org/ecogene/EG10098",
+ "http://identifiers.org/ncbigene/948242",
+ "http://identifiers.org/ncbigi/gi:16131602"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3734",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABA4"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012215",
+ "http://identifiers.org/ecogene/EG10105",
+ "http://identifiers.org/ncbigene/948254",
+ "http://identifiers.org/ncbigi/gi:16131603"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3735",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AB98"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012222",
+ "http://identifiers.org/ecogene/EG10099",
+ "http://identifiers.org/ncbigene/948252",
+ "http://identifiers.org/ncbigi/gi:16131606"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3738",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABC0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012224",
+ "http://identifiers.org/ecogene/EG10106",
+ "http://identifiers.org/ncbigene/948251",
+ "http://identifiers.org/ncbigi/gi:90111645"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3739",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABA6"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012211",
+ "http://identifiers.org/ecogene/EG10104",
+ "http://identifiers.org/ncbigene/948243",
+ "http://identifiers.org/ncbigi/gi:16131601"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3733",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABH7"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002451",
+ "http://identifiers.org/ecogene/EG10402",
+ "http://identifiers.org/ncbigene/945323",
+ "http://identifiers.org/ncbigi/gi:16128695"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0720",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P26458"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0003302",
+ "http://identifiers.org/ecogene/EG11379",
+ "http://identifiers.org/ncbigene/947547",
+ "http://identifiers.org/ncbigi/gi:16128945"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0979",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P26459"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0003300",
+ "http://identifiers.org/ecogene/EG11380",
+ "http://identifiers.org/ncbigene/945585",
+ "http://identifiers.org/ncbigi/gi:16128944"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0978",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABJ9"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002499",
+ "http://identifiers.org/ecogene/EG10173",
+ "http://identifiers.org/ncbigene/945341",
+ "http://identifiers.org/ncbigi/gi:90111166"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0733",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0ABK2"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002501",
+ "http://identifiers.org/ecogene/EG10174",
+ "http://identifiers.org/ncbigene/945347",
+ "http://identifiers.org/ncbigi/gi:16128709"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0734",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/Q46839"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0009763",
+ "http://identifiers.org/ecogene/EG12995",
+ "http://identifiers.org/ncbigene/947259",
+ "http://identifiers.org/ncbigi/gi:16130875"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2975",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P33231"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0011777",
+ "http://identifiers.org/ecogene/EG11961",
+ "http://identifiers.org/ncbigene/948114",
+ "http://identifiers.org/ncbigi/gi:16131474"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3603",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A6P9"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0009110",
+ "http://identifiers.org/ecogene/EG10258",
+ "http://identifiers.org/ncbigene/945032",
+ "http://identifiers.org/ncbigi/gi:16130686"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2779",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A991"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006941",
+ "http://identifiers.org/ecogene/EG14062",
+ "http://identifiers.org/ncbigene/946632",
+ "http://identifiers.org/ncbigi/gi:90111385"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2097",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P77704"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005906",
+ "http://identifiers.org/ecogene/EG13485",
+ "http://identifiers.org/ncbigene/946291",
+ "http://identifiers.org/ncbigi/gi:16129727"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1773",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AB71"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0009600",
+ "http://identifiers.org/ecogene/EG10282",
+ "http://identifiers.org/ncbigene/947415",
+ "http://identifiers.org/ncbigi/gi:16130826"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2925",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A993"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013842",
+ "http://identifiers.org/ecogene/EG10283",
+ "http://identifiers.org/ncbigene/948753",
+ "http://identifiers.org/ncbigi/gi:16132054"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4232",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A9C9"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012821",
+ "http://identifiers.org/ecogene/EG11517",
+ "http://identifiers.org/ncbigene/948424",
+ "http://identifiers.org/ncbigi/gi:16131763"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3925",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P77733"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0008206",
+ "http://identifiers.org/ecogene/EG14220",
+ "http://identifiers.org/ncbigene/949032",
+ "http://identifiers.org/ncbigi/gi:16130417"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2492",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AC23"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0003073",
+ "http://identifiers.org/ecogene/EG11258",
+ "http://identifiers.org/ncbigene/945513",
+ "http://identifiers.org/ncbigi/gi:16128871"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0904",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A8Q3"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013595",
+ "http://identifiers.org/ecogene/EG10333",
+ "http://identifiers.org/ncbigene/948668",
+ "http://identifiers.org/ncbigi/gi:16131976"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4151",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A8Q0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013598",
+ "http://identifiers.org/ecogene/EG10332",
+ "http://identifiers.org/ncbigene/948680",
+ "http://identifiers.org/ncbigi/gi:16131977"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4152",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P00363"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013604",
+ "http://identifiers.org/ecogene/EG10330",
+ "http://identifiers.org/ncbigene/948667",
+ "http://identifiers.org/ncbigi/gi:16131979"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4154",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AC47"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013602",
+ "http://identifiers.org/ecogene/EG10331",
+ "http://identifiers.org/ncbigene/948666",
+ "http://identifiers.org/ncbigi/gi:16131978"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4153",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P08839"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007967",
+ "http://identifiers.org/ecogene/EG10789",
+ "http://identifiers.org/ncbigene/946879",
+ "http://identifiers.org/ncbigi/gi:16130342"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2416",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AA04"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007962",
+ "http://identifiers.org/ecogene/EG10788",
+ "http://identifiers.org/ncbigene/946886",
+ "http://identifiers.org/ncbigi/gi:16130341"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2415",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P69797"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006054",
+ "http://identifiers.org/ecogene/EG10567",
+ "http://identifiers.org/ncbigene/946334",
+ "http://identifiers.org/ncbigi/gi:16129771"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1817",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P69801"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006056",
+ "http://identifiers.org/ecogene/EG10568",
+ "http://identifiers.org/ncbigene/946332",
+ "http://identifiers.org/ncbigi/gi:16129772"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1818",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P69805"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006058",
+ "http://identifiers.org/ecogene/EG10569",
+ "http://identifiers.org/ncbigene/946342",
+ "http://identifiers.org/ncbigi/gi:345452720"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1819",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P05042"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005380",
+ "http://identifiers.org/ecogene/EG10358",
+ "http://identifiers.org/ncbigene/946147",
+ "http://identifiers.org/ncbigi/gi:16129569"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1611",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P14407"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013501",
+ "http://identifiers.org/ecogene/EG10357",
+ "http://identifiers.org/ncbigene/948642",
+ "http://identifiers.org/ncbigi/gi:16131948"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4122",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AC33"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005392",
+ "http://identifiers.org/ecogene/EG10356",
+ "http://identifiers.org/ncbigene/946826",
+ "http://identifiers.org/ncbigi/gi:16129570"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1612",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A830"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0011527",
+ "http://identifiers.org/ecogene/EG20044",
+ "http://identifiers.org/ncbigene/948039",
+ "http://identifiers.org/ncbigi/gi:16131400"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3528",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AC53"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006171",
+ "http://identifiers.org/ecogene/EG11221",
+ "http://identifiers.org/ncbigene/946370",
+ "http://identifiers.org/ncbigi/gi:16129805"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1852",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A9B2"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005920",
+ "http://identifiers.org/ecogene/EG10367",
+ "http://identifiers.org/ncbigene/947679",
+ "http://identifiers.org/ncbigi/gi:16129733"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1779",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P69786"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0003722",
+ "http://identifiers.org/ecogene/EG10787",
+ "http://identifiers.org/ncbigene/945651",
+ "http://identifiers.org/ncbigi/gi:16129064"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1101",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P69783"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007971",
+ "http://identifiers.org/ecogene/EG10165",
+ "http://identifiers.org/ncbigene/946880",
+ "http://identifiers.org/ncbigi/gi:16130343"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2417",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P19642"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005429",
+ "http://identifiers.org/ecogene/EG10563",
+ "http://identifiers.org/ncbigene/946009",
+ "http://identifiers.org/ncbigi/gi:16129579"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1621",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P78061"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0004365",
+ "http://identifiers.org/ecogene/EG13908",
+ "http://identifiers.org/ncbigene/946202",
+ "http://identifiers.org/ncbigi/gi:90111244"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1297",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A9C5"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012640",
+ "http://identifiers.org/ecogene/EG10383",
+ "http://identifiers.org/ncbigene/948370",
+ "http://identifiers.org/ncbigi/gi:16131710"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3870",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AEQ3"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002771",
+ "http://identifiers.org/ecogene/EG10386",
+ "http://identifiers.org/ncbigene/944872",
+ "http://identifiers.org/ncbigi/gi:16128779"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0811",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AEQ6"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002766",
+ "http://identifiers.org/ecogene/EG10388",
+ "http://identifiers.org/ncbigene/945621",
+ "http://identifiers.org/ncbigi/gi:16128778"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0810",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P10346"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002764",
+ "http://identifiers.org/ecogene/EG10389",
+ "http://identifiers.org/ncbigene/945435",
+ "http://identifiers.org/ncbigi/gi:16128777"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0809",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P00370"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005865",
+ "http://identifiers.org/ecogene/EG10372",
+ "http://identifiers.org/ncbigene/946802",
+ "http://identifiers.org/ncbigi/gi:16129715"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1761",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P77454"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0001688",
+ "http://identifiers.org/ecogene/EG13247",
+ "http://identifiers.org/ncbigene/946187",
+ "http://identifiers.org/ncbigi/gi:16128469"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0485",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A6W0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005086",
+ "http://identifiers.org/ecogene/EG13816",
+ "http://identifiers.org/ncbigene/944973",
+ "http://identifiers.org/ncbigi/gi:16129483"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1524",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P05041"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006031",
+ "http://identifiers.org/ecogene/EG10683",
+ "http://identifiers.org/ncbigene/946337",
+ "http://identifiers.org/ncbigi/gi:16129766"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1812",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P09831"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0010545",
+ "http://identifiers.org/ecogene/EG10403",
+ "http://identifiers.org/ncbigene/947724",
+ "http://identifiers.org/ncbigi/gi:308209621"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3212",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P09832"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0010547",
+ "http://identifiers.org/ecogene/EG10404",
+ "http://identifiers.org/ncbigene/947723",
+ "http://identifiers.org/ncbigi/gi:16131103"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3213",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P21345"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013357",
+ "http://identifiers.org/ecogene/EG10405",
+ "http://identifiers.org/ncbigene/948591",
+ "http://identifiers.org/ncbigi/gi:16131903"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4077",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P00350"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006737",
+ "http://identifiers.org/ecogene/EG10411",
+ "http://identifiers.org/ncbigene/946554",
+ "http://identifiers.org/ncbigi/gi:16129970"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2029",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P60844"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002976",
+ "http://identifiers.org/ecogene/EG13270",
+ "http://identifiers.org/ncbigene/945497",
+ "http://identifiers.org/ncbigi/gi:16128843"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0875",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P08200"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0003823",
+ "http://identifiers.org/ecogene/EG10489",
+ "http://identifiers.org/ncbigene/945702",
+ "http://identifiers.org/ncbigi/gi:16129099"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1136",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A9G6"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013128",
+ "http://identifiers.org/ecogene/EG10022",
+ "http://identifiers.org/ncbigene/948517",
+ "http://identifiers.org/ncbigi/gi:16131841"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4015",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P06149"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007048",
+ "http://identifiers.org/ecogene/EG10231",
+ "http://identifiers.org/ncbigene/946653",
+ "http://identifiers.org/ncbigi/gi:16130071"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2133",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P52643"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0004619",
+ "http://identifiers.org/ecogene/EG13186",
+ "http://identifiers.org/ncbigene/946315",
+ "http://identifiers.org/ncbigi/gi:16129341"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1380",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P37330"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0009767",
+ "http://identifiers.org/ecogene/EG20080",
+ "http://identifiers.org/ncbigene/948857",
+ "http://identifiers.org/ncbigi/gi:16130876"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2976",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P08997"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013125",
+ "http://identifiers.org/ecogene/EG10023",
+ "http://identifiers.org/ncbigene/948512",
+ "http://identifiers.org/ncbigi/gi:16131840"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4014",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P61889"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0010613",
+ "http://identifiers.org/ecogene/EG10576",
+ "http://identifiers.org/ncbigene/947854",
+ "http://identifiers.org/ncbigi/gi:16131126"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3236",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P26616"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0004931",
+ "http://identifiers.org/ecogene/EG10948",
+ "http://identifiers.org/ncbigene/946031",
+ "http://identifiers.org/ncbigi/gi:90111281"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1479",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P76558"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0008111",
+ "http://identifiers.org/ecogene/EG14193",
+ "http://identifiers.org/ncbigene/946947",
+ "http://identifiers.org/ncbigi/gi:16130388"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2463",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFF0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007526",
+ "http://identifiers.org/ecogene/EG12093",
+ "http://identifiers.org/ncbigene/945136",
+ "http://identifiers.org/ncbigi/gi:145698289"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2276",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFE4"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007534",
+ "http://identifiers.org/ecogene/EG12091",
+ "http://identifiers.org/ncbigene/947580",
+ "http://identifiers.org/ncbigi/gi:16130214"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2279",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFC3"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007553",
+ "http://identifiers.org/ecogene/EG12082",
+ "http://identifiers.org/ncbigene/946764",
+ "http://identifiers.org/ncbigi/gi:49176207"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2288",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P33607"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007532",
+ "http://identifiers.org/ecogene/EG12092",
+ "http://identifiers.org/ncbigene/945540",
+ "http://identifiers.org/ncbigi/gi:16130213"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2278",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P33599"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007549",
+ "http://identifiers.org/ecogene/EG12084",
+ "http://identifiers.org/ncbigene/946759",
+ "http://identifiers.org/ncbigi/gi:145698291"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2286",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFD1"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007547",
+ "http://identifiers.org/ecogene/EG12086",
+ "http://identifiers.org/ncbigene/946746",
+ "http://identifiers.org/ncbigi/gi:16130220"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2285",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P33602"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007543",
+ "http://identifiers.org/ecogene/EG12087",
+ "http://identifiers.org/ncbigene/946762",
+ "http://identifiers.org/ncbigi/gi:145698290"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2283",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFC7"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007551",
+ "http://identifiers.org/ecogene/EG12083",
+ "http://identifiers.org/ncbigene/946738",
+ "http://identifiers.org/ncbigi/gi:16130222"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2287",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P31979"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007545",
+ "http://identifiers.org/ecogene/EG11774",
+ "http://identifiers.org/ncbigene/946753",
+ "http://identifiers.org/ncbigi/gi:16130219"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2284",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFD6"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007539",
+ "http://identifiers.org/ecogene/EG12089",
+ "http://identifiers.org/ncbigene/946757",
+ "http://identifiers.org/ncbigi/gi:16130216"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2281",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFE8"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007529",
+ "http://identifiers.org/ecogene/EG11773",
+ "http://identifiers.org/ncbigene/947731",
+ "http://identifiers.org/ncbigi/gi:16130212"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2277",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFD4"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007541",
+ "http://identifiers.org/ecogene/EG12088",
+ "http://identifiers.org/ncbigene/946761",
+ "http://identifiers.org/ncbigi/gi:16130217"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2282",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFE0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007536",
+ "http://identifiers.org/ecogene/EG12090",
+ "http://identifiers.org/ncbigene/946756",
+ "http://identifiers.org/ncbigi/gi:16130215"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2280",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P07001"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005354",
+ "http://identifiers.org/ecogene/EG10744",
+ "http://identifiers.org/ncbigene/946628",
+ "http://identifiers.org/ncbigi/gi:16129561"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1603",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AB67"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005352",
+ "http://identifiers.org/ecogene/EG10745",
+ "http://identifiers.org/ncbigene/946144",
+ "http://identifiers.org/ncbigi/gi:16129560"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1602",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P27306"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012975",
+ "http://identifiers.org/ecogene/EG11428",
+ "http://identifiers.org/ncbigene/948461",
+ "http://identifiers.org/ncbigi/gi:90111670"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3962",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P69681"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0001564",
+ "http://identifiers.org/ecogene/EG11821",
+ "http://identifiers.org/ncbigene/945084",
+ "http://identifiers.org/ncbigi/gi:16128436"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0451",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFG8"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0000397",
+ "http://identifiers.org/ecogene/EG10024",
+ "http://identifiers.org/ncbigene/944834",
+ "http://identifiers.org/ncbigi/gi:16128107"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0114",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P06959"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0000400",
+ "http://identifiers.org/ecogene/EG10025",
+ "http://identifiers.org/ncbigene/944794",
+ "http://identifiers.org/ncbigi/gi:16128108"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0115",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P06999"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005748",
+ "http://identifiers.org/ecogene/EG10700",
+ "http://identifiers.org/ncbigene/946230",
+ "http://identifiers.org/ncbigi/gi:49176138"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1723",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A796"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012789",
+ "http://identifiers.org/ecogene/EG10699",
+ "http://identifiers.org/ncbigene/948412",
+ "http://identifiers.org/ncbigi/gi:16131754"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3916",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P42632"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0010242",
+ "http://identifiers.org/ecogene/EG12758",
+ "http://identifiers.org/ncbigene/947623",
+ "http://identifiers.org/ncbigi/gi:49176316"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3114",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P32675"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012937",
+ "http://identifiers.org/ecogene/EG11911",
+ "http://identifiers.org/ncbigene/948453",
+ "http://identifiers.org/ncbigi/gi:49176447"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3952",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P32674"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012934",
+ "http://identifiers.org/ecogene/EG11910",
+ "http://identifiers.org/ncbigene/948454",
+ "http://identifiers.org/ncbigi/gi:16131789"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3951",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A9N4"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0003068",
+ "http://identifiers.org/ecogene/EG10028",
+ "http://identifiers.org/ncbigene/945517",
+ "http://identifiers.org/ncbigi/gi:16128869"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0902",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P09373"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0003071",
+ "http://identifiers.org/ecogene/EG10701",
+ "http://identifiers.org/ncbigene/945514",
+ "http://identifiers.org/ncbigi/gi:16128870"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0903",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P68066"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0008489",
+ "http://identifiers.org/ecogene/EG11784",
+ "http://identifiers.org/ncbigene/947068",
+ "http://identifiers.org/ncbigi/gi:16130504"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2579",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A6T1"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013163",
+ "http://identifiers.org/ecogene/EG10702",
+ "http://identifiers.org/ncbigene/948535",
+ "http://identifiers.org/ncbigi/gi:16131851"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4025",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A799"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0009605",
+ "http://identifiers.org/ecogene/EG10703",
+ "http://identifiers.org/ncbigene/947414",
+ "http://identifiers.org/ncbigi/gi:16130827"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2926",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P52697"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002611",
+ "http://identifiers.org/ecogene/EG13231",
+ "http://identifiers.org/ncbigene/946398",
+ "http://identifiers.org/ncbigi/gi:16128735"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0767",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P62707"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002563",
+ "http://identifiers.org/ecogene/EG11699",
+ "http://identifiers.org/ncbigene/945068",
+ "http://identifiers.org/ncbigi/gi:16128723"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0755",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A7A2"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0014416",
+ "http://identifiers.org/ecogene/EG12164",
+ "http://identifiers.org/ncbigene/948918",
+ "http://identifiers.org/ncbigi/gi:16132212"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4395",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P37689"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0011818",
+ "http://identifiers.org/ecogene/EG12296",
+ "http://identifiers.org/ncbigene/948130",
+ "http://identifiers.org/ncbigi/gi:16131483"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3612",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P43676"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0009800",
+ "http://identifiers.org/ecogene/EG12883",
+ "http://identifiers.org/ncbigene/947475",
+ "http://identifiers.org/ncbigi/gi:16130887"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2987",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AFJ7"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0011407",
+ "http://identifiers.org/ecogene/EG12230",
+ "http://identifiers.org/ncbigene/948009",
+ "http://identifiers.org/ncbigi/gi:16131365"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3493",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P00864"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012950",
+ "http://identifiers.org/ecogene/EG10756",
+ "http://identifiers.org/ncbigene/948457",
+ "http://identifiers.org/ncbigi/gi:16131794"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3956",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P22259"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0011106",
+ "http://identifiers.org/ecogene/EG10688",
+ "http://identifiers.org/ncbigene/945667",
+ "http://identifiers.org/ncbigi/gi:16131280"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3403",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P23538"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005678",
+ "http://identifiers.org/ecogene/EG10759",
+ "http://identifiers.org/ncbigene/946209",
+ "http://identifiers.org/ncbigi/gi:16129658"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1702",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A9M8"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0007582",
+ "http://identifiers.org/ecogene/EG20173",
+ "http://identifiers.org/ncbigene/946778",
+ "http://identifiers.org/ncbigi/gi:16130232"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2297",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P77218"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0008097",
+ "http://identifiers.org/ecogene/EG14188",
+ "http://identifiers.org/ncbigene/946940",
+ "http://identifiers.org/ncbigi/gi:16130383"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2458",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AD61"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0005600",
+ "http://identifiers.org/ecogene/EG10804",
+ "http://identifiers.org/ncbigene/946179",
+ "http://identifiers.org/ncbigi/gi:16129632"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1676",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P21599"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0006182",
+ "http://identifiers.org/ecogene/EG10803",
+ "http://identifiers.org/ncbigene/946527",
+ "http://identifiers.org/ncbigi/gi:16129807"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b1854",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P39362"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0014097",
+ "http://identifiers.org/ecogene/EG12553",
+ "http://identifiers.org/ncbigene/948829",
+ "http://identifiers.org/ncbigi/gi:16132122"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4301",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AG07"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0011061",
+ "http://identifiers.org/ecogene/EG11960",
+ "http://identifiers.org/ncbigene/947896",
+ "http://identifiers.org/ncbigi/gi:16131264"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3386",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A7Z0"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0009567",
+ "http://identifiers.org/ecogene/EG11443",
+ "http://identifiers.org/ncbigene/947407",
+ "http://identifiers.org/ncbigi/gi:16130815"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2914",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P37351"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0013405",
+ "http://identifiers.org/ecogene/EG11827",
+ "http://identifiers.org/ncbigene/948602",
+ "http://identifiers.org/ncbigi/gi:16131916"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b4090",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AC41"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002466",
+ "http://identifiers.org/ecogene/EG10931",
+ "http://identifiers.org/ncbigene/945402",
+ "http://identifiers.org/ncbigi/gi:16128698"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0723",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P07014"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002468",
+ "http://identifiers.org/ecogene/EG10932",
+ "http://identifiers.org/ncbigene/945300",
+ "http://identifiers.org/ncbigi/gi:16128699"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0724",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AC44"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002464",
+ "http://identifiers.org/ecogene/EG10934",
+ "http://identifiers.org/ncbigene/945322",
+ "http://identifiers.org/ncbigi/gi:16128697"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0722",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P69054"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002460",
+ "http://identifiers.org/ecogene/EG10933",
+ "http://identifiers.org/ncbigene/945316",
+ "http://identifiers.org/ncbigi/gi:16128696"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0721",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0AGE9"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002485",
+ "http://identifiers.org/ecogene/EG10982",
+ "http://identifiers.org/ncbigene/945314",
+ "http://identifiers.org/ncbigi/gi:16128704"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0729",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A836"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0002483",
+ "http://identifiers.org/ecogene/EG10981",
+ "http://identifiers.org/ncbigene/945312",
+ "http://identifiers.org/ncbigi/gi:16128703"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0728",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A870"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0000027",
+ "http://identifiers.org/ecogene/EG11556",
+ "http://identifiers.org/ncbigene/944748",
+ "http://identifiers.org/ncbigi/gi:16128002"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b0008",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A867"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0008115",
+ "http://identifiers.org/ecogene/EG11797",
+ "http://identifiers.org/ncbigene/947006",
+ "http://identifiers.org/ncbigi/gi:16130389"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2464",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P27302"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0009625",
+ "http://identifiers.org/ecogene/EG11427",
+ "http://identifiers.org/ncbigene/947420",
+ "http://identifiers.org/ncbigi/gi:49176286"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2935",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P33570"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0008117",
+ "http://identifiers.org/ecogene/EG12100",
+ "http://identifiers.org/ncbigene/945865",
+ "http://identifiers.org/ncbigi/gi:16130390"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b2465",
+ "name": ""
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/uniprot/P0A858"
+ ]
+ }
+ ],
+ "bqb_isEncodedBy": [
+ {
+ "resources": [
+ "http://identifiers.org/asap/ABE-0012799",
+ "http://identifiers.org/ecogene/EG11015",
+ "http://identifiers.org/ncbigene/948409",
+ "http://identifiers.org/ncbigi/gi:16131757"
+ ]
+ }
+ ]
+ }
+ },
+ "id": "G_b3919",
+ "name": ""
+ }
+ ],
+ "groups": [
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g1",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_ACALD",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ACKr",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ALCD2x",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_LDH_D",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PFL",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PTAr",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Pyruvate Metabolism"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g2",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_ACALDt",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ACt2r",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_AKGt2r",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_CO2t",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_D_LACt2",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ETOHt2r",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_FORt2",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_FORt",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_FRUpts2",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_FUMt2_2",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_GLCpts",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_GLNabc",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_GLUt2r",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_H2Ot",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_MALt2_2",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_O2t",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PYRt2",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_SUCCt2_2",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_SUCCt3",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Transport, Extracellular"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g3",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_ACONTa",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ACONTb",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_AKGDH",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_CS",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_FUM",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ICDHyr",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_MDH",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_SUCOAS",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Citric Acid Cycle"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g4",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_ADK1",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ATPS4r",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_CYTBD",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_FRD7",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_NADH16",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_NADTRHD",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_SUCDi",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_THD2",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Oxidative Phosphorylation"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g5",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_ATPM",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Biomass and maintenance functions"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g6",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_ENO",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_FBA",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_FBP",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_GAPD",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PDH",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PFK",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PGI",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PGK",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PGM",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PPS",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PYK",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_TPI",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Glycolysis/Gluconeogenesis"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g7",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_G6PDH2r",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_GND",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PGL",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_RPE",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_RPI",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_TALA",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_TKT1",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_TKT2",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Pentose Phosphate Pathway"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g8",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_GLNS",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_GLUDy",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_GLUN",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_GLUSy",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Glutamate Metabolism"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g9",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_ICL",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_MALS",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ME1",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_ME2",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PPC",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PPCK",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Anaplerotic reactions"
+ },
+ {
+ "annotation": {
+ "sbo": "SBO:0000633"
+ },
+ "id": "G_g10",
+ "kind": "partonomy",
+ "members": [
+ {
+ "idRef": "R_NH4t",
+ "type": "Reaction"
+ },
+ {
+ "idRef": "R_PIt2r",
+ "type": "Reaction"
+ }
+ ],
+ "name": "Inorganic Ion Transport and Metabolism"
+ }
+ ],
+ "id": "e_coli_core",
+ "metabolites": [
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/13dpg",
+ "http://identifiers.org/biocyc/META:DPG",
+ "http://identifiers.org/chebi/CHEBI:11881",
+ "http://identifiers.org/chebi/CHEBI:16001",
+ "http://identifiers.org/chebi/CHEBI:1658",
+ "http://identifiers.org/chebi/CHEBI:20189",
+ "http://identifiers.org/chebi/CHEBI:57604",
+ "http://identifiers.org/hmdb/HMDB62758",
+ "http://identifiers.org/kegg.compound/C00236",
+ "http://identifiers.org/metanetx.chemical/MNXM261",
+ "http://identifiers.org/seed.compound/cpd00203"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C3H4O10P2",
+ "id": "M_13dpg_c",
+ "name": "3-Phospho-D-glyceroyl phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/2pg",
+ "http://identifiers.org/biocyc/META:2-PG",
+ "http://identifiers.org/chebi/CHEBI:11651",
+ "http://identifiers.org/chebi/CHEBI:1267",
+ "http://identifiers.org/chebi/CHEBI:12986",
+ "http://identifiers.org/chebi/CHEBI:17835",
+ "http://identifiers.org/chebi/CHEBI:21028",
+ "http://identifiers.org/chebi/CHEBI:24344",
+ "http://identifiers.org/chebi/CHEBI:39868",
+ "http://identifiers.org/chebi/CHEBI:58289",
+ "http://identifiers.org/chebi/CHEBI:88350",
+ "http://identifiers.org/hmdb/HMDB03391",
+ "http://identifiers.org/hmdb/HMDB62707",
+ "http://identifiers.org/kegg.compound/C00631",
+ "http://identifiers.org/metanetx.chemical/MNXM275",
+ "http://identifiers.org/seed.compound/cpd00482"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C3H4O7P",
+ "id": "M_2pg_c",
+ "name": "D-Glycerate 2-phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/3pg",
+ "http://identifiers.org/biocyc/META:G3P",
+ "http://identifiers.org/chebi/CHEBI:11879",
+ "http://identifiers.org/chebi/CHEBI:11880",
+ "http://identifiers.org/chebi/CHEBI:12987",
+ "http://identifiers.org/chebi/CHEBI:1657",
+ "http://identifiers.org/chebi/CHEBI:17794",
+ "http://identifiers.org/chebi/CHEBI:21029",
+ "http://identifiers.org/chebi/CHEBI:58272",
+ "http://identifiers.org/kegg.compound/C00197",
+ "http://identifiers.org/metanetx.chemical/MNXM126",
+ "http://identifiers.org/seed.compound/cpd00169"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C3H4O7P",
+ "id": "M_3pg_c",
+ "name": "3-Phospho-D-glycerate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/6pgc",
+ "http://identifiers.org/biocyc/META:CPD-2961",
+ "http://identifiers.org/chebi/CHEBI:12232",
+ "http://identifiers.org/chebi/CHEBI:16863",
+ "http://identifiers.org/chebi/CHEBI:2231",
+ "http://identifiers.org/chebi/CHEBI:33851",
+ "http://identifiers.org/chebi/CHEBI:40282",
+ "http://identifiers.org/chebi/CHEBI:48928",
+ "http://identifiers.org/chebi/CHEBI:58759",
+ "http://identifiers.org/hmdb/HMDB01316",
+ "http://identifiers.org/hmdb/HMDB62800",
+ "http://identifiers.org/kegg.compound/C00345",
+ "http://identifiers.org/metanetx.chemical/MNXM325",
+ "http://identifiers.org/seed.compound/cpd00284"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C6H10O10P",
+ "id": "M_6pgc_c",
+ "name": "6-Phospho-D-gluconate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/6pgl",
+ "http://identifiers.org/biocyc/META:D-6-P-GLUCONO-DELTA-LACTONE",
+ "http://identifiers.org/chebi/CHEBI:12233",
+ "http://identifiers.org/chebi/CHEBI:12958",
+ "http://identifiers.org/chebi/CHEBI:16938",
+ "http://identifiers.org/chebi/CHEBI:20989",
+ "http://identifiers.org/chebi/CHEBI:4160",
+ "http://identifiers.org/chebi/CHEBI:57955",
+ "http://identifiers.org/hmdb/HMDB62628",
+ "http://identifiers.org/kegg.compound/C01236",
+ "http://identifiers.org/metanetx.chemical/MNXM429",
+ "http://identifiers.org/seed.compound/cpd00911"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C6H9O9P",
+ "id": "M_6pgl_c",
+ "name": "6-phospho-D-glucono-1,5-lactone"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/ac",
+ "http://identifiers.org/biocyc/META:ACET",
+ "http://identifiers.org/chebi/CHEBI:13704",
+ "http://identifiers.org/chebi/CHEBI:15366",
+ "http://identifiers.org/chebi/CHEBI:22165",
+ "http://identifiers.org/chebi/CHEBI:22169",
+ "http://identifiers.org/chebi/CHEBI:2387",
+ "http://identifiers.org/chebi/CHEBI:30089",
+ "http://identifiers.org/chebi/CHEBI:40480",
+ "http://identifiers.org/chebi/CHEBI:40486",
+ "http://identifiers.org/hmdb/HMDB00042",
+ "http://identifiers.org/kegg.compound/C00033",
+ "http://identifiers.org/kegg.drug/D00010",
+ "http://identifiers.org/lipidmaps/LMFA01010002",
+ "http://identifiers.org/metanetx.chemical/MNXM26",
+ "http://identifiers.org/seed.compound/cpd00029"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C2H3O2",
+ "id": "M_ac_c",
+ "name": "Acetate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/ac",
+ "http://identifiers.org/biocyc/META:ACET",
+ "http://identifiers.org/chebi/CHEBI:13704",
+ "http://identifiers.org/chebi/CHEBI:15366",
+ "http://identifiers.org/chebi/CHEBI:22165",
+ "http://identifiers.org/chebi/CHEBI:22169",
+ "http://identifiers.org/chebi/CHEBI:2387",
+ "http://identifiers.org/chebi/CHEBI:30089",
+ "http://identifiers.org/chebi/CHEBI:40480",
+ "http://identifiers.org/chebi/CHEBI:40486",
+ "http://identifiers.org/hmdb/HMDB00042",
+ "http://identifiers.org/kegg.compound/C00033",
+ "http://identifiers.org/kegg.drug/D00010",
+ "http://identifiers.org/lipidmaps/LMFA01010002",
+ "http://identifiers.org/metanetx.chemical/MNXM26",
+ "http://identifiers.org/seed.compound/cpd00029"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C2H3O2",
+ "id": "M_ac_e",
+ "name": "Acetate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/acald",
+ "http://identifiers.org/biocyc/META:ACETALD",
+ "http://identifiers.org/chebi/CHEBI:13703",
+ "http://identifiers.org/chebi/CHEBI:15343",
+ "http://identifiers.org/chebi/CHEBI:22158",
+ "http://identifiers.org/chebi/CHEBI:2383",
+ "http://identifiers.org/chebi/CHEBI:40533",
+ "http://identifiers.org/hmdb/HMDB00990",
+ "http://identifiers.org/kegg.compound/C00084",
+ "http://identifiers.org/metanetx.chemical/MNXM75",
+ "http://identifiers.org/seed.compound/cpd00071"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C2H4O",
+ "id": "M_acald_c",
+ "name": "Acetaldehyde"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/acald",
+ "http://identifiers.org/biocyc/META:ACETALD",
+ "http://identifiers.org/chebi/CHEBI:13703",
+ "http://identifiers.org/chebi/CHEBI:15343",
+ "http://identifiers.org/chebi/CHEBI:22158",
+ "http://identifiers.org/chebi/CHEBI:2383",
+ "http://identifiers.org/chebi/CHEBI:40533",
+ "http://identifiers.org/hmdb/HMDB00990",
+ "http://identifiers.org/kegg.compound/C00084",
+ "http://identifiers.org/metanetx.chemical/MNXM75",
+ "http://identifiers.org/seed.compound/cpd00071"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C2H4O",
+ "id": "M_acald_e",
+ "name": "Acetaldehyde"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/accoa",
+ "http://identifiers.org/biocyc/META:ACETYL-COA",
+ "http://identifiers.org/chebi/CHEBI:13712",
+ "http://identifiers.org/chebi/CHEBI:15351",
+ "http://identifiers.org/chebi/CHEBI:22192",
+ "http://identifiers.org/chebi/CHEBI:2408",
+ "http://identifiers.org/chebi/CHEBI:40470",
+ "http://identifiers.org/chebi/CHEBI:57288",
+ "http://identifiers.org/hmdb/HMDB01206",
+ "http://identifiers.org/kegg.compound/C00024",
+ "http://identifiers.org/lipidmaps/LMFA07050029",
+ "http://identifiers.org/lipidmaps/LMFA07050281",
+ "http://identifiers.org/metanetx.chemical/MNXM21",
+ "http://identifiers.org/seed.compound/cpd00022"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C23H34N7O17P3S",
+ "id": "M_accoa_c",
+ "name": "Acetyl-CoA"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/acon_C",
+ "http://identifiers.org/biocyc/META:CIS-ACONITATE",
+ "http://identifiers.org/chebi/CHEBI:10482",
+ "http://identifiers.org/chebi/CHEBI:12798",
+ "http://identifiers.org/chebi/CHEBI:16383",
+ "http://identifiers.org/chebi/CHEBI:23306",
+ "http://identifiers.org/chebi/CHEBI:23308",
+ "http://identifiers.org/chebi/CHEBI:32805",
+ "http://identifiers.org/hmdb/HMDB00072",
+ "http://identifiers.org/hmdb/HMDB00461",
+ "http://identifiers.org/kegg.compound/C00417",
+ "http://identifiers.org/metanetx.chemical/MNXM813",
+ "http://identifiers.org/seed.compound/cpd00331"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C6H3O6",
+ "id": "M_acon_C_c",
+ "name": "Cis-Aconitate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/actp",
+ "http://identifiers.org/biocyc/META:ACETYL-P",
+ "http://identifiers.org/chebi/CHEBI:13711",
+ "http://identifiers.org/chebi/CHEBI:15350",
+ "http://identifiers.org/chebi/CHEBI:22191",
+ "http://identifiers.org/chebi/CHEBI:2407",
+ "http://identifiers.org/chebi/CHEBI:46262",
+ "http://identifiers.org/hmdb/HMDB01494",
+ "http://identifiers.org/kegg.compound/C00227",
+ "http://identifiers.org/metanetx.chemical/MNXM280",
+ "http://identifiers.org/seed.compound/cpd00196"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C2H3O5P",
+ "id": "M_actp_c",
+ "name": "Acetyl phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/adp",
+ "http://identifiers.org/biocyc/META:ADP",
+ "http://identifiers.org/biocyc/META:CPD0-1651",
+ "http://identifiers.org/chebi/CHEBI:13222",
+ "http://identifiers.org/chebi/CHEBI:16761",
+ "http://identifiers.org/chebi/CHEBI:22244",
+ "http://identifiers.org/chebi/CHEBI:2342",
+ "http://identifiers.org/chebi/CHEBI:40553",
+ "http://identifiers.org/chebi/CHEBI:456216",
+ "http://identifiers.org/chebi/CHEBI:87518",
+ "http://identifiers.org/hmdb/HMDB01341",
+ "http://identifiers.org/kegg.compound/C00008",
+ "http://identifiers.org/kegg.glycan/G11113",
+ "http://identifiers.org/metanetx.chemical/MNXM7",
+ "http://identifiers.org/seed.compound/cpd00008"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C10H12N5O10P2",
+ "id": "M_adp_c",
+ "name": "ADP C10H12N5O10P2"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/akg",
+ "http://identifiers.org/biocyc/META:2-KETOGLUTARATE",
+ "http://identifiers.org/biocyc/META:CPD-16852",
+ "http://identifiers.org/chebi/CHEBI:11638",
+ "http://identifiers.org/chebi/CHEBI:1253",
+ "http://identifiers.org/chebi/CHEBI:16810",
+ "http://identifiers.org/chebi/CHEBI:19748",
+ "http://identifiers.org/chebi/CHEBI:19749",
+ "http://identifiers.org/chebi/CHEBI:30915",
+ "http://identifiers.org/chebi/CHEBI:30916",
+ "http://identifiers.org/chebi/CHEBI:40661",
+ "http://identifiers.org/hmdb/HMDB62781",
+ "http://identifiers.org/kegg.compound/C00026",
+ "http://identifiers.org/metanetx.chemical/MNXM20",
+ "http://identifiers.org/seed.compound/cpd00024"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C5H4O5",
+ "id": "M_akg_c",
+ "name": "2-Oxoglutarate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/akg",
+ "http://identifiers.org/biocyc/META:2-KETOGLUTARATE",
+ "http://identifiers.org/biocyc/META:CPD-16852",
+ "http://identifiers.org/chebi/CHEBI:11638",
+ "http://identifiers.org/chebi/CHEBI:1253",
+ "http://identifiers.org/chebi/CHEBI:16810",
+ "http://identifiers.org/chebi/CHEBI:19748",
+ "http://identifiers.org/chebi/CHEBI:19749",
+ "http://identifiers.org/chebi/CHEBI:30915",
+ "http://identifiers.org/chebi/CHEBI:30916",
+ "http://identifiers.org/chebi/CHEBI:40661",
+ "http://identifiers.org/hmdb/HMDB62781",
+ "http://identifiers.org/kegg.compound/C00026",
+ "http://identifiers.org/metanetx.chemical/MNXM20",
+ "http://identifiers.org/seed.compound/cpd00024"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C5H4O5",
+ "id": "M_akg_e",
+ "name": "2-Oxoglutarate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/amp",
+ "http://identifiers.org/biocyc/META:AMP",
+ "http://identifiers.org/biocyc/META:AMP-GROUP",
+ "http://identifiers.org/chebi/CHEBI:12056",
+ "http://identifiers.org/chebi/CHEBI:13234",
+ "http://identifiers.org/chebi/CHEBI:13235",
+ "http://identifiers.org/chebi/CHEBI:13736",
+ "http://identifiers.org/chebi/CHEBI:13740",
+ "http://identifiers.org/chebi/CHEBI:16027",
+ "http://identifiers.org/chebi/CHEBI:22242",
+ "http://identifiers.org/chebi/CHEBI:22245",
+ "http://identifiers.org/chebi/CHEBI:2356",
+ "http://identifiers.org/chebi/CHEBI:40510",
+ "http://identifiers.org/chebi/CHEBI:40721",
+ "http://identifiers.org/chebi/CHEBI:40726",
+ "http://identifiers.org/chebi/CHEBI:40786",
+ "http://identifiers.org/chebi/CHEBI:40826",
+ "http://identifiers.org/chebi/CHEBI:456215",
+ "http://identifiers.org/chebi/CHEBI:47222",
+ "http://identifiers.org/kegg.compound/C00020",
+ "http://identifiers.org/kegg.drug/D02769",
+ "http://identifiers.org/metanetx.chemical/MNXM14",
+ "http://identifiers.org/seed.compound/cpd00018",
+ "http://identifiers.org/seed.compound/cpd22272"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C10H12N5O7P",
+ "id": "M_amp_c",
+ "name": "AMP C10H12N5O7P"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/atp",
+ "http://identifiers.org/biocyc/META:ATP",
+ "http://identifiers.org/biocyc/META:CPD0-1634",
+ "http://identifiers.org/chebi/CHEBI:10789",
+ "http://identifiers.org/chebi/CHEBI:10841",
+ "http://identifiers.org/chebi/CHEBI:13236",
+ "http://identifiers.org/chebi/CHEBI:15422",
+ "http://identifiers.org/chebi/CHEBI:22249",
+ "http://identifiers.org/chebi/CHEBI:2359",
+ "http://identifiers.org/chebi/CHEBI:237958",
+ "http://identifiers.org/chebi/CHEBI:30616",
+ "http://identifiers.org/chebi/CHEBI:40938",
+ "http://identifiers.org/chebi/CHEBI:57299",
+ "http://identifiers.org/kegg.compound/C00002",
+ "http://identifiers.org/kegg.drug/D08646",
+ "http://identifiers.org/metanetx.chemical/MNXM3",
+ "http://identifiers.org/seed.compound/cpd00002"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C10H12N5O13P3",
+ "id": "M_atp_c",
+ "name": "ATP C10H12N5O13P3"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/cit",
+ "http://identifiers.org/biocyc/META:CIT",
+ "http://identifiers.org/chebi/CHEBI:132362",
+ "http://identifiers.org/chebi/CHEBI:133748",
+ "http://identifiers.org/chebi/CHEBI:13999",
+ "http://identifiers.org/chebi/CHEBI:16947",
+ "http://identifiers.org/chebi/CHEBI:23321",
+ "http://identifiers.org/chebi/CHEBI:23322",
+ "http://identifiers.org/chebi/CHEBI:30769",
+ "http://identifiers.org/chebi/CHEBI:35802",
+ "http://identifiers.org/chebi/CHEBI:35804",
+ "http://identifiers.org/chebi/CHEBI:35806",
+ "http://identifiers.org/chebi/CHEBI:35808",
+ "http://identifiers.org/chebi/CHEBI:35809",
+ "http://identifiers.org/chebi/CHEBI:35810",
+ "http://identifiers.org/chebi/CHEBI:3727",
+ "http://identifiers.org/chebi/CHEBI:41523",
+ "http://identifiers.org/chebi/CHEBI:42563",
+ "http://identifiers.org/chebi/CHEBI:76049",
+ "http://identifiers.org/chebi/CHEBI:79399",
+ "http://identifiers.org/hmdb/HMDB00094",
+ "http://identifiers.org/kegg.compound/C00158",
+ "http://identifiers.org/kegg.compound/C13660",
+ "http://identifiers.org/kegg.drug/D00037",
+ "http://identifiers.org/metanetx.chemical/MNXM131",
+ "http://identifiers.org/seed.compound/cpd00137"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C6H5O7",
+ "id": "M_cit_c",
+ "name": "Citrate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/co2",
+ "http://identifiers.org/biocyc/META:CARBON-DIOXIDE",
+ "http://identifiers.org/chebi/CHEBI:13282",
+ "http://identifiers.org/chebi/CHEBI:13283",
+ "http://identifiers.org/chebi/CHEBI:13284",
+ "http://identifiers.org/chebi/CHEBI:13285",
+ "http://identifiers.org/chebi/CHEBI:16526",
+ "http://identifiers.org/chebi/CHEBI:23011",
+ "http://identifiers.org/chebi/CHEBI:3283",
+ "http://identifiers.org/chebi/CHEBI:48829",
+ "http://identifiers.org/hmdb/HMDB01967",
+ "http://identifiers.org/kegg.compound/C00011",
+ "http://identifiers.org/kegg.drug/D00004",
+ "http://identifiers.org/metanetx.chemical/MNXM13",
+ "http://identifiers.org/seed.compound/cpd00011"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "CO2",
+ "id": "M_co2_c",
+ "name": "CO2 CO2"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/co2",
+ "http://identifiers.org/biocyc/META:CARBON-DIOXIDE",
+ "http://identifiers.org/chebi/CHEBI:13282",
+ "http://identifiers.org/chebi/CHEBI:13283",
+ "http://identifiers.org/chebi/CHEBI:13284",
+ "http://identifiers.org/chebi/CHEBI:13285",
+ "http://identifiers.org/chebi/CHEBI:16526",
+ "http://identifiers.org/chebi/CHEBI:23011",
+ "http://identifiers.org/chebi/CHEBI:3283",
+ "http://identifiers.org/chebi/CHEBI:48829",
+ "http://identifiers.org/hmdb/HMDB01967",
+ "http://identifiers.org/kegg.compound/C00011",
+ "http://identifiers.org/kegg.drug/D00004",
+ "http://identifiers.org/metanetx.chemical/MNXM13",
+ "http://identifiers.org/seed.compound/cpd00011"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "CO2",
+ "id": "M_co2_e",
+ "name": "CO2 CO2"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/coa",
+ "http://identifiers.org/biocyc/META:CO-A",
+ "http://identifiers.org/biocyc/META:COA-GROUP",
+ "http://identifiers.org/chebi/CHEBI:13294",
+ "http://identifiers.org/chebi/CHEBI:13295",
+ "http://identifiers.org/chebi/CHEBI:13298",
+ "http://identifiers.org/chebi/CHEBI:15346",
+ "http://identifiers.org/chebi/CHEBI:23355",
+ "http://identifiers.org/chebi/CHEBI:3771",
+ "http://identifiers.org/chebi/CHEBI:41597",
+ "http://identifiers.org/chebi/CHEBI:41631",
+ "http://identifiers.org/chebi/CHEBI:57287",
+ "http://identifiers.org/chebi/CHEBI:741566",
+ "http://identifiers.org/hmdb/HMDB01423",
+ "http://identifiers.org/kegg.compound/C00010",
+ "http://identifiers.org/metanetx.chemical/MNXM12",
+ "http://identifiers.org/seed.compound/cpd00010",
+ "http://identifiers.org/seed.compound/cpd22528"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C21H32N7O16P3S",
+ "id": "M_coa_c",
+ "name": "Coenzyme A"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/dhap",
+ "http://identifiers.org/biocyc/META:DIHYDROXY-ACETONE-PHOSPHATE",
+ "http://identifiers.org/chebi/CHEBI:14341",
+ "http://identifiers.org/chebi/CHEBI:14342",
+ "http://identifiers.org/chebi/CHEBI:16108",
+ "http://identifiers.org/chebi/CHEBI:24355",
+ "http://identifiers.org/chebi/CHEBI:39571",
+ "http://identifiers.org/chebi/CHEBI:5454",
+ "http://identifiers.org/chebi/CHEBI:57642",
+ "http://identifiers.org/hmdb/HMDB01473",
+ "http://identifiers.org/hmdb/HMDB11735",
+ "http://identifiers.org/kegg.compound/C00111",
+ "http://identifiers.org/metanetx.chemical/MNXM77",
+ "http://identifiers.org/seed.compound/cpd00095"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C3H5O6P",
+ "id": "M_dhap_c",
+ "name": "Dihydroxyacetone phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/e4p",
+ "http://identifiers.org/biocyc/META:ERYTHROSE-4P",
+ "http://identifiers.org/chebi/CHEBI:12921",
+ "http://identifiers.org/chebi/CHEBI:16897",
+ "http://identifiers.org/chebi/CHEBI:20927",
+ "http://identifiers.org/chebi/CHEBI:4114",
+ "http://identifiers.org/chebi/CHEBI:42349",
+ "http://identifiers.org/chebi/CHEBI:48153",
+ "http://identifiers.org/hmdb/HMDB01321",
+ "http://identifiers.org/kegg.compound/C00279",
+ "http://identifiers.org/metanetx.chemical/MNXM258",
+ "http://identifiers.org/seed.compound/cpd00236"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C4H7O7P",
+ "id": "M_e4p_c",
+ "name": "D-Erythrose 4-phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/etoh",
+ "http://identifiers.org/biocyc/META:ETOH",
+ "http://identifiers.org/chebi/CHEBI:14222",
+ "http://identifiers.org/chebi/CHEBI:16236",
+ "http://identifiers.org/chebi/CHEBI:23978",
+ "http://identifiers.org/chebi/CHEBI:30878",
+ "http://identifiers.org/chebi/CHEBI:30880",
+ "http://identifiers.org/chebi/CHEBI:42377",
+ "http://identifiers.org/chebi/CHEBI:44594",
+ "http://identifiers.org/chebi/CHEBI:4879",
+ "http://identifiers.org/chebi/CHEBI:52092",
+ "http://identifiers.org/hmdb/HMDB00108",
+ "http://identifiers.org/kegg.compound/C00469",
+ "http://identifiers.org/kegg.drug/D00068",
+ "http://identifiers.org/kegg.drug/D02798",
+ "http://identifiers.org/kegg.drug/D04855",
+ "http://identifiers.org/kegg.drug/D06542",
+ "http://identifiers.org/metanetx.chemical/MNXM303",
+ "http://identifiers.org/seed.compound/cpd00363"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C2H6O",
+ "id": "M_etoh_c",
+ "name": "Ethanol"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/etoh",
+ "http://identifiers.org/biocyc/META:ETOH",
+ "http://identifiers.org/chebi/CHEBI:14222",
+ "http://identifiers.org/chebi/CHEBI:16236",
+ "http://identifiers.org/chebi/CHEBI:23978",
+ "http://identifiers.org/chebi/CHEBI:30878",
+ "http://identifiers.org/chebi/CHEBI:30880",
+ "http://identifiers.org/chebi/CHEBI:42377",
+ "http://identifiers.org/chebi/CHEBI:44594",
+ "http://identifiers.org/chebi/CHEBI:4879",
+ "http://identifiers.org/chebi/CHEBI:52092",
+ "http://identifiers.org/hmdb/HMDB00108",
+ "http://identifiers.org/kegg.compound/C00469",
+ "http://identifiers.org/kegg.drug/D00068",
+ "http://identifiers.org/kegg.drug/D02798",
+ "http://identifiers.org/kegg.drug/D04855",
+ "http://identifiers.org/kegg.drug/D06542",
+ "http://identifiers.org/metanetx.chemical/MNXM303",
+ "http://identifiers.org/seed.compound/cpd00363"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C2H6O",
+ "id": "M_etoh_e",
+ "name": "Ethanol"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/f6p",
+ "http://identifiers.org/biocyc/META:FRUCTOSE-6P",
+ "http://identifiers.org/chebi/CHEBI:10375",
+ "http://identifiers.org/chebi/CHEBI:12352",
+ "http://identifiers.org/chebi/CHEBI:16084",
+ "http://identifiers.org/chebi/CHEBI:22768",
+ "http://identifiers.org/chebi/CHEBI:42378",
+ "http://identifiers.org/chebi/CHEBI:57634",
+ "http://identifiers.org/hmdb/HMDB03971",
+ "http://identifiers.org/kegg.compound/C05345",
+ "http://identifiers.org/metanetx.chemical/MNXM89621",
+ "http://identifiers.org/seed.compound/cpd19035"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C6H11O9P",
+ "id": "M_f6p_c",
+ "name": "D-Fructose 6-phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/fdp",
+ "http://identifiers.org/chebi/CHEBI:37736",
+ "http://identifiers.org/chebi/CHEBI:49299",
+ "http://identifiers.org/kegg.compound/C00354",
+ "http://identifiers.org/metanetx.chemical/MNXM417",
+ "http://identifiers.org/seed.compound/cpd00290"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C6H10O12P2",
+ "id": "M_fdp_c",
+ "name": "D-Fructose 1,6-bisphosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/for",
+ "http://identifiers.org/biocyc/META:CARBOXYL-GROUP",
+ "http://identifiers.org/biocyc/META:CPD-9845",
+ "http://identifiers.org/biocyc/META:CPD1G-1532",
+ "http://identifiers.org/biocyc/META:CPD1G-1533",
+ "http://identifiers.org/biocyc/META:CPD1G-1534",
+ "http://identifiers.org/biocyc/META:CPD1G-1535",
+ "http://identifiers.org/biocyc/META:FORMATE",
+ "http://identifiers.org/chebi/CHEBI:14276",
+ "http://identifiers.org/chebi/CHEBI:15740",
+ "http://identifiers.org/chebi/CHEBI:24081",
+ "http://identifiers.org/chebi/CHEBI:24082",
+ "http://identifiers.org/chebi/CHEBI:30751",
+ "http://identifiers.org/chebi/CHEBI:42460",
+ "http://identifiers.org/chebi/CHEBI:5145",
+ "http://identifiers.org/hmdb/HMDB00142",
+ "http://identifiers.org/kegg.compound/C00058",
+ "http://identifiers.org/metanetx.chemical/MNXM39",
+ "http://identifiers.org/seed.compound/cpd00047",
+ "http://identifiers.org/seed.compound/cpd22511"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "CH1O2",
+ "id": "M_for_c",
+ "name": "Formate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/for",
+ "http://identifiers.org/biocyc/META:CARBOXYL-GROUP",
+ "http://identifiers.org/biocyc/META:CPD-9845",
+ "http://identifiers.org/biocyc/META:CPD1G-1532",
+ "http://identifiers.org/biocyc/META:CPD1G-1533",
+ "http://identifiers.org/biocyc/META:CPD1G-1534",
+ "http://identifiers.org/biocyc/META:CPD1G-1535",
+ "http://identifiers.org/biocyc/META:FORMATE",
+ "http://identifiers.org/chebi/CHEBI:14276",
+ "http://identifiers.org/chebi/CHEBI:15740",
+ "http://identifiers.org/chebi/CHEBI:24081",
+ "http://identifiers.org/chebi/CHEBI:24082",
+ "http://identifiers.org/chebi/CHEBI:30751",
+ "http://identifiers.org/chebi/CHEBI:42460",
+ "http://identifiers.org/chebi/CHEBI:5145",
+ "http://identifiers.org/hmdb/HMDB00142",
+ "http://identifiers.org/kegg.compound/C00058",
+ "http://identifiers.org/metanetx.chemical/MNXM39",
+ "http://identifiers.org/seed.compound/cpd00047",
+ "http://identifiers.org/seed.compound/cpd22511"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "CH1O2",
+ "id": "M_for_e",
+ "name": "Formate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/fru",
+ "http://identifiers.org/biocyc/META:CPD-15382",
+ "http://identifiers.org/biocyc/META:D-Fructopyranose",
+ "http://identifiers.org/biocyc/META:FRU",
+ "http://identifiers.org/biocyc/META:Fructofuranose",
+ "http://identifiers.org/chebi/CHEBI:12923",
+ "http://identifiers.org/chebi/CHEBI:15824",
+ "http://identifiers.org/chebi/CHEBI:20929",
+ "http://identifiers.org/chebi/CHEBI:24104",
+ "http://identifiers.org/chebi/CHEBI:24110",
+ "http://identifiers.org/chebi/CHEBI:28757",
+ "http://identifiers.org/chebi/CHEBI:37714",
+ "http://identifiers.org/chebi/CHEBI:37721",
+ "http://identifiers.org/chebi/CHEBI:4118",
+ "http://identifiers.org/chebi/CHEBI:4119",
+ "http://identifiers.org/chebi/CHEBI:47424",
+ "http://identifiers.org/chebi/CHEBI:48095",
+ "http://identifiers.org/chebi/CHEBI:5172",
+ "http://identifiers.org/hmdb/HMDB62538",
+ "http://identifiers.org/kegg.compound/C00095",
+ "http://identifiers.org/kegg.compound/C01496",
+ "http://identifiers.org/kegg.compound/C05003",
+ "http://identifiers.org/kegg.compound/C10906",
+ "http://identifiers.org/kegg.drug/D00114",
+ "http://identifiers.org/metanetx.chemical/MNXM175",
+ "http://identifiers.org/seed.compound/cpd00082",
+ "http://identifiers.org/seed.compound/cpd19015",
+ "http://identifiers.org/seed.compound/cpd27040"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C6H12O6",
+ "id": "M_fru_e",
+ "name": "D-Fructose"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/fum",
+ "http://identifiers.org/biocyc/META:FUM",
+ "http://identifiers.org/chebi/CHEBI:14284",
+ "http://identifiers.org/chebi/CHEBI:18012",
+ "http://identifiers.org/chebi/CHEBI:22956",
+ "http://identifiers.org/chebi/CHEBI:22957",
+ "http://identifiers.org/chebi/CHEBI:22958",
+ "http://identifiers.org/chebi/CHEBI:24122",
+ "http://identifiers.org/chebi/CHEBI:24124",
+ "http://identifiers.org/chebi/CHEBI:29806",
+ "http://identifiers.org/chebi/CHEBI:36180",
+ "http://identifiers.org/chebi/CHEBI:37154",
+ "http://identifiers.org/chebi/CHEBI:37155",
+ "http://identifiers.org/chebi/CHEBI:42511",
+ "http://identifiers.org/chebi/CHEBI:42743",
+ "http://identifiers.org/chebi/CHEBI:5190",
+ "http://identifiers.org/hmdb/HMDB00134",
+ "http://identifiers.org/kegg.compound/C00122",
+ "http://identifiers.org/kegg.drug/D02308",
+ "http://identifiers.org/metanetx.chemical/MNXM93",
+ "http://identifiers.org/seed.compound/cpd00106"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C4H2O4",
+ "id": "M_fum_c",
+ "name": "Fumarate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/fum",
+ "http://identifiers.org/biocyc/META:FUM",
+ "http://identifiers.org/chebi/CHEBI:14284",
+ "http://identifiers.org/chebi/CHEBI:18012",
+ "http://identifiers.org/chebi/CHEBI:22956",
+ "http://identifiers.org/chebi/CHEBI:22957",
+ "http://identifiers.org/chebi/CHEBI:22958",
+ "http://identifiers.org/chebi/CHEBI:24122",
+ "http://identifiers.org/chebi/CHEBI:24124",
+ "http://identifiers.org/chebi/CHEBI:29806",
+ "http://identifiers.org/chebi/CHEBI:36180",
+ "http://identifiers.org/chebi/CHEBI:37154",
+ "http://identifiers.org/chebi/CHEBI:37155",
+ "http://identifiers.org/chebi/CHEBI:42511",
+ "http://identifiers.org/chebi/CHEBI:42743",
+ "http://identifiers.org/chebi/CHEBI:5190",
+ "http://identifiers.org/hmdb/HMDB00134",
+ "http://identifiers.org/kegg.compound/C00122",
+ "http://identifiers.org/kegg.drug/D02308",
+ "http://identifiers.org/metanetx.chemical/MNXM93",
+ "http://identifiers.org/seed.compound/cpd00106"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C4H2O4",
+ "id": "M_fum_e",
+ "name": "Fumarate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/g3p",
+ "http://identifiers.org/biocyc/META:GAP",
+ "http://identifiers.org/chebi/CHEBI:12983",
+ "http://identifiers.org/chebi/CHEBI:12984",
+ "http://identifiers.org/chebi/CHEBI:14333",
+ "http://identifiers.org/chebi/CHEBI:17138",
+ "http://identifiers.org/chebi/CHEBI:181",
+ "http://identifiers.org/chebi/CHEBI:18324",
+ "http://identifiers.org/chebi/CHEBI:21026",
+ "http://identifiers.org/chebi/CHEBI:29052",
+ "http://identifiers.org/chebi/CHEBI:5446",
+ "http://identifiers.org/chebi/CHEBI:58027",
+ "http://identifiers.org/chebi/CHEBI:59776",
+ "http://identifiers.org/hmdb/HMDB01112",
+ "http://identifiers.org/kegg.compound/C00118",
+ "http://identifiers.org/kegg.compound/C00661",
+ "http://identifiers.org/metanetx.chemical/MNXM74",
+ "http://identifiers.org/seed.compound/cpd00102",
+ "http://identifiers.org/seed.compound/cpd19005"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C3H5O6P",
+ "id": "M_g3p_c",
+ "name": "Glyceraldehyde 3-phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/g6p",
+ "http://identifiers.org/biocyc/META:D-glucopyranose-6-phosphate",
+ "http://identifiers.org/chebi/CHEBI:14314",
+ "http://identifiers.org/chebi/CHEBI:4170",
+ "http://identifiers.org/chebi/CHEBI:61548",
+ "http://identifiers.org/hmdb/HMDB01401",
+ "http://identifiers.org/hmdb/HMDB01549",
+ "http://identifiers.org/hmdb/HMDB06793",
+ "http://identifiers.org/kegg.compound/C00092",
+ "http://identifiers.org/metanetx.chemical/MNXM160",
+ "http://identifiers.org/seed.compound/cpd00079",
+ "http://identifiers.org/seed.compound/cpd26836"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C6H11O9P",
+ "id": "M_g6p_c",
+ "name": "D-Glucose 6-phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/glc__D",
+ "http://identifiers.org/biocyc/META:Glucopyranose",
+ "http://identifiers.org/chebi/CHEBI:12965",
+ "http://identifiers.org/chebi/CHEBI:17634",
+ "http://identifiers.org/chebi/CHEBI:20999",
+ "http://identifiers.org/chebi/CHEBI:4167",
+ "http://identifiers.org/hmdb/HMDB00122",
+ "http://identifiers.org/hmdb/HMDB06564",
+ "http://identifiers.org/kegg.compound/C00031",
+ "http://identifiers.org/kegg.drug/D00009",
+ "http://identifiers.org/metanetx.chemical/MNXM41",
+ "http://identifiers.org/seed.compound/cpd00027",
+ "http://identifiers.org/seed.compound/cpd26821"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C6H12O6",
+ "id": "M_glc__D_e",
+ "name": "D-Glucose"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/gln__L",
+ "http://identifiers.org/biocyc/META:GLN",
+ "http://identifiers.org/chebi/CHEBI:13110",
+ "http://identifiers.org/chebi/CHEBI:18050",
+ "http://identifiers.org/chebi/CHEBI:21308",
+ "http://identifiers.org/chebi/CHEBI:24316",
+ "http://identifiers.org/chebi/CHEBI:28300",
+ "http://identifiers.org/chebi/CHEBI:32665",
+ "http://identifiers.org/chebi/CHEBI:32666",
+ "http://identifiers.org/chebi/CHEBI:32678",
+ "http://identifiers.org/chebi/CHEBI:32679",
+ "http://identifiers.org/chebi/CHEBI:42812",
+ "http://identifiers.org/chebi/CHEBI:42814",
+ "http://identifiers.org/chebi/CHEBI:42899",
+ "http://identifiers.org/chebi/CHEBI:42943",
+ "http://identifiers.org/chebi/CHEBI:5432",
+ "http://identifiers.org/chebi/CHEBI:58359",
+ "http://identifiers.org/chebi/CHEBI:6227",
+ "http://identifiers.org/hmdb/HMDB00641",
+ "http://identifiers.org/kegg.compound/C00064",
+ "http://identifiers.org/kegg.compound/C00303",
+ "http://identifiers.org/kegg.drug/D00015",
+ "http://identifiers.org/metanetx.chemical/MNXM37",
+ "http://identifiers.org/seed.compound/cpd00053",
+ "http://identifiers.org/seed.compound/cpd00253"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C5H10N2O3",
+ "id": "M_gln__L_c",
+ "name": "L-Glutamine"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/gln__L",
+ "http://identifiers.org/biocyc/META:GLN",
+ "http://identifiers.org/chebi/CHEBI:13110",
+ "http://identifiers.org/chebi/CHEBI:18050",
+ "http://identifiers.org/chebi/CHEBI:21308",
+ "http://identifiers.org/chebi/CHEBI:24316",
+ "http://identifiers.org/chebi/CHEBI:28300",
+ "http://identifiers.org/chebi/CHEBI:32665",
+ "http://identifiers.org/chebi/CHEBI:32666",
+ "http://identifiers.org/chebi/CHEBI:32678",
+ "http://identifiers.org/chebi/CHEBI:32679",
+ "http://identifiers.org/chebi/CHEBI:42812",
+ "http://identifiers.org/chebi/CHEBI:42814",
+ "http://identifiers.org/chebi/CHEBI:42899",
+ "http://identifiers.org/chebi/CHEBI:42943",
+ "http://identifiers.org/chebi/CHEBI:5432",
+ "http://identifiers.org/chebi/CHEBI:58359",
+ "http://identifiers.org/chebi/CHEBI:6227",
+ "http://identifiers.org/hmdb/HMDB00641",
+ "http://identifiers.org/kegg.compound/C00064",
+ "http://identifiers.org/kegg.compound/C00303",
+ "http://identifiers.org/kegg.drug/D00015",
+ "http://identifiers.org/metanetx.chemical/MNXM37",
+ "http://identifiers.org/seed.compound/cpd00053",
+ "http://identifiers.org/seed.compound/cpd00253"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C5H10N2O3",
+ "id": "M_gln__L_e",
+ "name": "L-Glutamine"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/glu__L",
+ "http://identifiers.org/biocyc/META:GLT",
+ "http://identifiers.org/biocyc/META:Glutamates",
+ "http://identifiers.org/chebi/CHEBI:13107",
+ "http://identifiers.org/chebi/CHEBI:14321",
+ "http://identifiers.org/chebi/CHEBI:16015",
+ "http://identifiers.org/chebi/CHEBI:18237",
+ "http://identifiers.org/chebi/CHEBI:21301",
+ "http://identifiers.org/chebi/CHEBI:21304",
+ "http://identifiers.org/chebi/CHEBI:24314",
+ "http://identifiers.org/chebi/CHEBI:29985",
+ "http://identifiers.org/chebi/CHEBI:29987",
+ "http://identifiers.org/chebi/CHEBI:29988",
+ "http://identifiers.org/chebi/CHEBI:42825",
+ "http://identifiers.org/chebi/CHEBI:5431",
+ "http://identifiers.org/chebi/CHEBI:6224",
+ "http://identifiers.org/chebi/CHEBI:76051",
+ "http://identifiers.org/hmdb/HMDB00148",
+ "http://identifiers.org/hmdb/HMDB60475",
+ "http://identifiers.org/kegg.compound/C00025",
+ "http://identifiers.org/kegg.compound/C00302",
+ "http://identifiers.org/kegg.drug/D00007",
+ "http://identifiers.org/kegg.drug/D04341",
+ "http://identifiers.org/metanetx.chemical/MNXM89557",
+ "http://identifiers.org/seed.compound/cpd00023",
+ "http://identifiers.org/seed.compound/cpd19002",
+ "http://identifiers.org/seed.compound/cpd27177"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C5H8NO4",
+ "id": "M_glu__L_c",
+ "name": "L-Glutamate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/glu__L",
+ "http://identifiers.org/biocyc/META:GLT",
+ "http://identifiers.org/biocyc/META:Glutamates",
+ "http://identifiers.org/chebi/CHEBI:13107",
+ "http://identifiers.org/chebi/CHEBI:14321",
+ "http://identifiers.org/chebi/CHEBI:16015",
+ "http://identifiers.org/chebi/CHEBI:18237",
+ "http://identifiers.org/chebi/CHEBI:21301",
+ "http://identifiers.org/chebi/CHEBI:21304",
+ "http://identifiers.org/chebi/CHEBI:24314",
+ "http://identifiers.org/chebi/CHEBI:29985",
+ "http://identifiers.org/chebi/CHEBI:29987",
+ "http://identifiers.org/chebi/CHEBI:29988",
+ "http://identifiers.org/chebi/CHEBI:42825",
+ "http://identifiers.org/chebi/CHEBI:5431",
+ "http://identifiers.org/chebi/CHEBI:6224",
+ "http://identifiers.org/chebi/CHEBI:76051",
+ "http://identifiers.org/hmdb/HMDB00148",
+ "http://identifiers.org/hmdb/HMDB60475",
+ "http://identifiers.org/kegg.compound/C00025",
+ "http://identifiers.org/kegg.compound/C00302",
+ "http://identifiers.org/kegg.drug/D00007",
+ "http://identifiers.org/kegg.drug/D04341",
+ "http://identifiers.org/metanetx.chemical/MNXM89557",
+ "http://identifiers.org/seed.compound/cpd00023",
+ "http://identifiers.org/seed.compound/cpd19002",
+ "http://identifiers.org/seed.compound/cpd27177"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C5H8NO4",
+ "id": "M_glu__L_e",
+ "name": "L-Glutamate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/glx",
+ "http://identifiers.org/biocyc/META:GLYOX",
+ "http://identifiers.org/chebi/CHEBI:14368",
+ "http://identifiers.org/chebi/CHEBI:16891",
+ "http://identifiers.org/chebi/CHEBI:24420",
+ "http://identifiers.org/chebi/CHEBI:24421",
+ "http://identifiers.org/chebi/CHEBI:35977",
+ "http://identifiers.org/chebi/CHEBI:36655",
+ "http://identifiers.org/chebi/CHEBI:42767",
+ "http://identifiers.org/chebi/CHEBI:5509",
+ "http://identifiers.org/hmdb/HMDB00119",
+ "http://identifiers.org/kegg.compound/C00048",
+ "http://identifiers.org/metanetx.chemical/MNXM69",
+ "http://identifiers.org/seed.compound/cpd00040"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C2H1O3",
+ "id": "M_glx_c",
+ "name": "Glyoxylate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h2o",
+ "http://identifiers.org/biocyc/META:CPD-15815",
+ "http://identifiers.org/biocyc/META:HYDROXYL-GROUP",
+ "http://identifiers.org/biocyc/META:OH",
+ "http://identifiers.org/biocyc/META:OXONIUM",
+ "http://identifiers.org/biocyc/META:WATER",
+ "http://identifiers.org/chebi/CHEBI:10743",
+ "http://identifiers.org/chebi/CHEBI:13352",
+ "http://identifiers.org/chebi/CHEBI:13365",
+ "http://identifiers.org/chebi/CHEBI:13419",
+ "http://identifiers.org/chebi/CHEBI:15377",
+ "http://identifiers.org/chebi/CHEBI:16234",
+ "http://identifiers.org/chebi/CHEBI:27313",
+ "http://identifiers.org/chebi/CHEBI:29356",
+ "http://identifiers.org/chebi/CHEBI:29373",
+ "http://identifiers.org/chebi/CHEBI:29374",
+ "http://identifiers.org/chebi/CHEBI:29375",
+ "http://identifiers.org/chebi/CHEBI:29412",
+ "http://identifiers.org/chebi/CHEBI:30490",
+ "http://identifiers.org/chebi/CHEBI:33806",
+ "http://identifiers.org/chebi/CHEBI:33811",
+ "http://identifiers.org/chebi/CHEBI:33813",
+ "http://identifiers.org/chebi/CHEBI:41979",
+ "http://identifiers.org/chebi/CHEBI:41981",
+ "http://identifiers.org/chebi/CHEBI:42043",
+ "http://identifiers.org/chebi/CHEBI:42857",
+ "http://identifiers.org/chebi/CHEBI:43228",
+ "http://identifiers.org/chebi/CHEBI:44292",
+ "http://identifiers.org/chebi/CHEBI:44641",
+ "http://identifiers.org/chebi/CHEBI:44701",
+ "http://identifiers.org/chebi/CHEBI:44819",
+ "http://identifiers.org/chebi/CHEBI:5585",
+ "http://identifiers.org/chebi/CHEBI:5594",
+ "http://identifiers.org/hmdb/HMDB02111",
+ "http://identifiers.org/kegg.compound/C00001",
+ "http://identifiers.org/kegg.compound/C01328",
+ "http://identifiers.org/kegg.compound/C18714",
+ "http://identifiers.org/kegg.drug/D00001",
+ "http://identifiers.org/kegg.drug/D03703",
+ "http://identifiers.org/kegg.drug/D06322",
+ "http://identifiers.org/metanetx.chemical/MNXM2",
+ "http://identifiers.org/seed.compound/cpd00001",
+ "http://identifiers.org/seed.compound/cpd15275",
+ "http://identifiers.org/seed.compound/cpd27222"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "H2O",
+ "id": "M_h2o_c",
+ "name": "H2O H2O"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h2o",
+ "http://identifiers.org/biocyc/META:CPD-15815",
+ "http://identifiers.org/biocyc/META:HYDROXYL-GROUP",
+ "http://identifiers.org/biocyc/META:OH",
+ "http://identifiers.org/biocyc/META:OXONIUM",
+ "http://identifiers.org/biocyc/META:WATER",
+ "http://identifiers.org/chebi/CHEBI:10743",
+ "http://identifiers.org/chebi/CHEBI:13352",
+ "http://identifiers.org/chebi/CHEBI:13365",
+ "http://identifiers.org/chebi/CHEBI:13419",
+ "http://identifiers.org/chebi/CHEBI:15377",
+ "http://identifiers.org/chebi/CHEBI:16234",
+ "http://identifiers.org/chebi/CHEBI:27313",
+ "http://identifiers.org/chebi/CHEBI:29356",
+ "http://identifiers.org/chebi/CHEBI:29373",
+ "http://identifiers.org/chebi/CHEBI:29374",
+ "http://identifiers.org/chebi/CHEBI:29375",
+ "http://identifiers.org/chebi/CHEBI:29412",
+ "http://identifiers.org/chebi/CHEBI:30490",
+ "http://identifiers.org/chebi/CHEBI:33806",
+ "http://identifiers.org/chebi/CHEBI:33811",
+ "http://identifiers.org/chebi/CHEBI:33813",
+ "http://identifiers.org/chebi/CHEBI:41979",
+ "http://identifiers.org/chebi/CHEBI:41981",
+ "http://identifiers.org/chebi/CHEBI:42043",
+ "http://identifiers.org/chebi/CHEBI:42857",
+ "http://identifiers.org/chebi/CHEBI:43228",
+ "http://identifiers.org/chebi/CHEBI:44292",
+ "http://identifiers.org/chebi/CHEBI:44641",
+ "http://identifiers.org/chebi/CHEBI:44701",
+ "http://identifiers.org/chebi/CHEBI:44819",
+ "http://identifiers.org/chebi/CHEBI:5585",
+ "http://identifiers.org/chebi/CHEBI:5594",
+ "http://identifiers.org/hmdb/HMDB02111",
+ "http://identifiers.org/kegg.compound/C00001",
+ "http://identifiers.org/kegg.compound/C01328",
+ "http://identifiers.org/kegg.compound/C18714",
+ "http://identifiers.org/kegg.drug/D00001",
+ "http://identifiers.org/kegg.drug/D03703",
+ "http://identifiers.org/kegg.drug/D06322",
+ "http://identifiers.org/metanetx.chemical/MNXM2",
+ "http://identifiers.org/seed.compound/cpd00001",
+ "http://identifiers.org/seed.compound/cpd15275",
+ "http://identifiers.org/seed.compound/cpd27222"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "H2O",
+ "id": "M_h2o_e",
+ "name": "H2O H2O"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h",
+ "http://identifiers.org/biocyc/META:PROTON",
+ "http://identifiers.org/chebi/CHEBI:10744",
+ "http://identifiers.org/chebi/CHEBI:13357",
+ "http://identifiers.org/chebi/CHEBI:15378",
+ "http://identifiers.org/chebi/CHEBI:24636",
+ "http://identifiers.org/chebi/CHEBI:29233",
+ "http://identifiers.org/chebi/CHEBI:29234",
+ "http://identifiers.org/chebi/CHEBI:5584",
+ "http://identifiers.org/hmdb/HMDB59597",
+ "http://identifiers.org/kegg.compound/C00080",
+ "http://identifiers.org/metanetx.chemical/MNXM1",
+ "http://identifiers.org/seed.compound/cpd00067"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "H",
+ "id": "M_h_c",
+ "name": "H+"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h",
+ "http://identifiers.org/biocyc/META:PROTON",
+ "http://identifiers.org/chebi/CHEBI:10744",
+ "http://identifiers.org/chebi/CHEBI:13357",
+ "http://identifiers.org/chebi/CHEBI:15378",
+ "http://identifiers.org/chebi/CHEBI:24636",
+ "http://identifiers.org/chebi/CHEBI:29233",
+ "http://identifiers.org/chebi/CHEBI:29234",
+ "http://identifiers.org/chebi/CHEBI:5584",
+ "http://identifiers.org/hmdb/HMDB59597",
+ "http://identifiers.org/kegg.compound/C00080",
+ "http://identifiers.org/metanetx.chemical/MNXM1",
+ "http://identifiers.org/seed.compound/cpd00067"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "H",
+ "id": "M_h_e",
+ "name": "H+"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/icit",
+ "http://identifiers.org/chebi/CHEBI:14465",
+ "http://identifiers.org/chebi/CHEBI:16087",
+ "http://identifiers.org/chebi/CHEBI:24884",
+ "http://identifiers.org/chebi/CHEBI:24886",
+ "http://identifiers.org/chebi/CHEBI:30887",
+ "http://identifiers.org/chebi/CHEBI:36453",
+ "http://identifiers.org/chebi/CHEBI:36454",
+ "http://identifiers.org/chebi/CHEBI:5998",
+ "http://identifiers.org/hmdb/HMDB00193",
+ "http://identifiers.org/kegg.compound/C00311",
+ "http://identifiers.org/metanetx.chemical/MNXM89661",
+ "http://identifiers.org/seed.compound/cpd00260"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C6H5O7",
+ "id": "M_icit_c",
+ "name": "Isocitrate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/lac__D",
+ "http://identifiers.org/biocyc/META:D-LACTATE",
+ "http://identifiers.org/chebi/CHEBI:11001",
+ "http://identifiers.org/chebi/CHEBI:16004",
+ "http://identifiers.org/chebi/CHEBI:18684",
+ "http://identifiers.org/chebi/CHEBI:341",
+ "http://identifiers.org/chebi/CHEBI:42105",
+ "http://identifiers.org/chebi/CHEBI:42111",
+ "http://identifiers.org/chebi/CHEBI:43701",
+ "http://identifiers.org/hmdb/HMDB00171",
+ "http://identifiers.org/hmdb/HMDB01311",
+ "http://identifiers.org/kegg.compound/C00256",
+ "http://identifiers.org/metanetx.chemical/MNXM285",
+ "http://identifiers.org/seed.compound/cpd00221"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C3H5O3",
+ "id": "M_lac__D_c",
+ "name": "D-Lactate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/lac__D",
+ "http://identifiers.org/biocyc/META:D-LACTATE",
+ "http://identifiers.org/chebi/CHEBI:11001",
+ "http://identifiers.org/chebi/CHEBI:16004",
+ "http://identifiers.org/chebi/CHEBI:18684",
+ "http://identifiers.org/chebi/CHEBI:341",
+ "http://identifiers.org/chebi/CHEBI:42105",
+ "http://identifiers.org/chebi/CHEBI:42111",
+ "http://identifiers.org/chebi/CHEBI:43701",
+ "http://identifiers.org/hmdb/HMDB00171",
+ "http://identifiers.org/hmdb/HMDB01311",
+ "http://identifiers.org/kegg.compound/C00256",
+ "http://identifiers.org/metanetx.chemical/MNXM285",
+ "http://identifiers.org/seed.compound/cpd00221"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C3H5O3",
+ "id": "M_lac__D_e",
+ "name": "D-Lactate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/mal__L",
+ "http://identifiers.org/biocyc/META:MAL",
+ "http://identifiers.org/chebi/CHEBI:11066",
+ "http://identifiers.org/chebi/CHEBI:13140",
+ "http://identifiers.org/chebi/CHEBI:15589",
+ "http://identifiers.org/chebi/CHEBI:18784",
+ "http://identifiers.org/chebi/CHEBI:18785",
+ "http://identifiers.org/chebi/CHEBI:30797",
+ "http://identifiers.org/chebi/CHEBI:423",
+ "http://identifiers.org/hmdb/HMDB00156",
+ "http://identifiers.org/kegg.compound/C00149",
+ "http://identifiers.org/metanetx.chemical/MNXM98",
+ "http://identifiers.org/seed.compound/cpd00130"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C4H4O5",
+ "id": "M_mal__L_c",
+ "name": "L-Malate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/mal__L",
+ "http://identifiers.org/biocyc/META:MAL",
+ "http://identifiers.org/chebi/CHEBI:11066",
+ "http://identifiers.org/chebi/CHEBI:13140",
+ "http://identifiers.org/chebi/CHEBI:15589",
+ "http://identifiers.org/chebi/CHEBI:18784",
+ "http://identifiers.org/chebi/CHEBI:18785",
+ "http://identifiers.org/chebi/CHEBI:30797",
+ "http://identifiers.org/chebi/CHEBI:423",
+ "http://identifiers.org/hmdb/HMDB00156",
+ "http://identifiers.org/kegg.compound/C00149",
+ "http://identifiers.org/metanetx.chemical/MNXM98",
+ "http://identifiers.org/seed.compound/cpd00130"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C4H4O5",
+ "id": "M_mal__L_e",
+ "name": "L-Malate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nad",
+ "http://identifiers.org/biocyc/META:NAD",
+ "http://identifiers.org/chebi/CHEBI:13393",
+ "http://identifiers.org/chebi/CHEBI:13394",
+ "http://identifiers.org/chebi/CHEBI:15846",
+ "http://identifiers.org/chebi/CHEBI:21901",
+ "http://identifiers.org/chebi/CHEBI:29867",
+ "http://identifiers.org/chebi/CHEBI:44214",
+ "http://identifiers.org/chebi/CHEBI:44215",
+ "http://identifiers.org/chebi/CHEBI:44281",
+ "http://identifiers.org/chebi/CHEBI:57540",
+ "http://identifiers.org/chebi/CHEBI:7422",
+ "http://identifiers.org/kegg.compound/C00003",
+ "http://identifiers.org/kegg.drug/D00002",
+ "http://identifiers.org/metanetx.chemical/MNXM8",
+ "http://identifiers.org/seed.compound/cpd00003"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C21H26N7O14P2",
+ "id": "M_nad_c",
+ "name": "Nicotinamide adenine dinucleotide"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nadh",
+ "http://identifiers.org/biocyc/META:NADH",
+ "http://identifiers.org/chebi/CHEBI:13395",
+ "http://identifiers.org/chebi/CHEBI:13396",
+ "http://identifiers.org/chebi/CHEBI:16908",
+ "http://identifiers.org/chebi/CHEBI:21902",
+ "http://identifiers.org/chebi/CHEBI:44216",
+ "http://identifiers.org/chebi/CHEBI:57945",
+ "http://identifiers.org/chebi/CHEBI:7423",
+ "http://identifiers.org/hmdb/HMDB01487",
+ "http://identifiers.org/kegg.compound/C00004",
+ "http://identifiers.org/metanetx.chemical/MNXM10",
+ "http://identifiers.org/seed.compound/cpd00004"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C21H27N7O14P2",
+ "id": "M_nadh_c",
+ "name": "Nicotinamide adenine dinucleotide - reduced"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nadp",
+ "http://identifiers.org/biocyc/META:NADP",
+ "http://identifiers.org/chebi/CHEBI:13397",
+ "http://identifiers.org/chebi/CHEBI:13398",
+ "http://identifiers.org/chebi/CHEBI:18009",
+ "http://identifiers.org/chebi/CHEBI:21903",
+ "http://identifiers.org/chebi/CHEBI:25523",
+ "http://identifiers.org/chebi/CHEBI:29868",
+ "http://identifiers.org/chebi/CHEBI:44405",
+ "http://identifiers.org/chebi/CHEBI:44409",
+ "http://identifiers.org/chebi/CHEBI:58349",
+ "http://identifiers.org/chebi/CHEBI:7424",
+ "http://identifiers.org/kegg.compound/C00006",
+ "http://identifiers.org/metanetx.chemical/MNXM5",
+ "http://identifiers.org/seed.compound/cpd00006"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C21H25N7O17P3",
+ "id": "M_nadp_c",
+ "name": "Nicotinamide adenine dinucleotide phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nadph",
+ "http://identifiers.org/biocyc/META:NADPH",
+ "http://identifiers.org/chebi/CHEBI:13399",
+ "http://identifiers.org/chebi/CHEBI:13400",
+ "http://identifiers.org/chebi/CHEBI:16474",
+ "http://identifiers.org/chebi/CHEBI:21904",
+ "http://identifiers.org/chebi/CHEBI:44286",
+ "http://identifiers.org/chebi/CHEBI:57783",
+ "http://identifiers.org/chebi/CHEBI:7425",
+ "http://identifiers.org/hmdb/HMDB00221",
+ "http://identifiers.org/hmdb/HMDB00799",
+ "http://identifiers.org/hmdb/HMDB06341",
+ "http://identifiers.org/kegg.compound/C00005",
+ "http://identifiers.org/metanetx.chemical/MNXM6",
+ "http://identifiers.org/seed.compound/cpd00005"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C21H26N7O17P3",
+ "id": "M_nadph_c",
+ "name": "Nicotinamide adenine dinucleotide phosphate - reduced"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nh4",
+ "http://identifiers.org/biocyc/META:AMMONIA",
+ "http://identifiers.org/biocyc/META:AMMONIUM",
+ "http://identifiers.org/chebi/CHEBI:13405",
+ "http://identifiers.org/chebi/CHEBI:13406",
+ "http://identifiers.org/chebi/CHEBI:13407",
+ "http://identifiers.org/chebi/CHEBI:135980",
+ "http://identifiers.org/chebi/CHEBI:13771",
+ "http://identifiers.org/chebi/CHEBI:16134",
+ "http://identifiers.org/chebi/CHEBI:22533",
+ "http://identifiers.org/chebi/CHEBI:22534",
+ "http://identifiers.org/chebi/CHEBI:28938",
+ "http://identifiers.org/chebi/CHEBI:29337",
+ "http://identifiers.org/chebi/CHEBI:29340",
+ "http://identifiers.org/chebi/CHEBI:44269",
+ "http://identifiers.org/chebi/CHEBI:44284",
+ "http://identifiers.org/chebi/CHEBI:44404",
+ "http://identifiers.org/chebi/CHEBI:49783",
+ "http://identifiers.org/chebi/CHEBI:7434",
+ "http://identifiers.org/chebi/CHEBI:7435",
+ "http://identifiers.org/hmdb/HMDB00051",
+ "http://identifiers.org/hmdb/HMDB41827",
+ "http://identifiers.org/kegg.compound/C00014",
+ "http://identifiers.org/kegg.compound/C01342",
+ "http://identifiers.org/kegg.drug/D02915",
+ "http://identifiers.org/kegg.drug/D02916",
+ "http://identifiers.org/metanetx.chemical/MNXM15",
+ "http://identifiers.org/seed.compound/cpd00013",
+ "http://identifiers.org/seed.compound/cpd19013"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "H4N",
+ "id": "M_nh4_c",
+ "name": "Ammonium"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nh4",
+ "http://identifiers.org/biocyc/META:AMMONIA",
+ "http://identifiers.org/biocyc/META:AMMONIUM",
+ "http://identifiers.org/chebi/CHEBI:13405",
+ "http://identifiers.org/chebi/CHEBI:13406",
+ "http://identifiers.org/chebi/CHEBI:13407",
+ "http://identifiers.org/chebi/CHEBI:135980",
+ "http://identifiers.org/chebi/CHEBI:13771",
+ "http://identifiers.org/chebi/CHEBI:16134",
+ "http://identifiers.org/chebi/CHEBI:22533",
+ "http://identifiers.org/chebi/CHEBI:22534",
+ "http://identifiers.org/chebi/CHEBI:28938",
+ "http://identifiers.org/chebi/CHEBI:29337",
+ "http://identifiers.org/chebi/CHEBI:29340",
+ "http://identifiers.org/chebi/CHEBI:44269",
+ "http://identifiers.org/chebi/CHEBI:44284",
+ "http://identifiers.org/chebi/CHEBI:44404",
+ "http://identifiers.org/chebi/CHEBI:49783",
+ "http://identifiers.org/chebi/CHEBI:7434",
+ "http://identifiers.org/chebi/CHEBI:7435",
+ "http://identifiers.org/hmdb/HMDB00051",
+ "http://identifiers.org/hmdb/HMDB41827",
+ "http://identifiers.org/kegg.compound/C00014",
+ "http://identifiers.org/kegg.compound/C01342",
+ "http://identifiers.org/kegg.drug/D02915",
+ "http://identifiers.org/kegg.drug/D02916",
+ "http://identifiers.org/metanetx.chemical/MNXM15",
+ "http://identifiers.org/seed.compound/cpd00013",
+ "http://identifiers.org/seed.compound/cpd19013"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "H4N",
+ "id": "M_nh4_e",
+ "name": "Ammonium"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/o2",
+ "http://identifiers.org/biocyc/META:OXYGEN-MOLECULE",
+ "http://identifiers.org/chebi/CHEBI:10745",
+ "http://identifiers.org/chebi/CHEBI:13416",
+ "http://identifiers.org/chebi/CHEBI:15379",
+ "http://identifiers.org/chebi/CHEBI:23833",
+ "http://identifiers.org/chebi/CHEBI:25366",
+ "http://identifiers.org/chebi/CHEBI:26689",
+ "http://identifiers.org/chebi/CHEBI:27140",
+ "http://identifiers.org/chebi/CHEBI:29097",
+ "http://identifiers.org/chebi/CHEBI:29793",
+ "http://identifiers.org/chebi/CHEBI:30491",
+ "http://identifiers.org/chebi/CHEBI:44742",
+ "http://identifiers.org/chebi/CHEBI:7860",
+ "http://identifiers.org/hmdb/HMDB01377",
+ "http://identifiers.org/kegg.compound/C00007",
+ "http://identifiers.org/kegg.drug/D00003",
+ "http://identifiers.org/metanetx.chemical/MNXM4",
+ "http://identifiers.org/seed.compound/cpd00007"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "O2",
+ "id": "M_o2_c",
+ "name": "O2 O2"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/o2",
+ "http://identifiers.org/biocyc/META:OXYGEN-MOLECULE",
+ "http://identifiers.org/chebi/CHEBI:10745",
+ "http://identifiers.org/chebi/CHEBI:13416",
+ "http://identifiers.org/chebi/CHEBI:15379",
+ "http://identifiers.org/chebi/CHEBI:23833",
+ "http://identifiers.org/chebi/CHEBI:25366",
+ "http://identifiers.org/chebi/CHEBI:26689",
+ "http://identifiers.org/chebi/CHEBI:27140",
+ "http://identifiers.org/chebi/CHEBI:29097",
+ "http://identifiers.org/chebi/CHEBI:29793",
+ "http://identifiers.org/chebi/CHEBI:30491",
+ "http://identifiers.org/chebi/CHEBI:44742",
+ "http://identifiers.org/chebi/CHEBI:7860",
+ "http://identifiers.org/hmdb/HMDB01377",
+ "http://identifiers.org/kegg.compound/C00007",
+ "http://identifiers.org/kegg.drug/D00003",
+ "http://identifiers.org/metanetx.chemical/MNXM4",
+ "http://identifiers.org/seed.compound/cpd00007"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "O2",
+ "id": "M_o2_e",
+ "name": "O2 O2"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/oaa",
+ "http://identifiers.org/biocyc/META:ENOL-OXALOACETATE",
+ "http://identifiers.org/biocyc/META:OXALACETIC_ACID",
+ "http://identifiers.org/chebi/CHEBI:12820",
+ "http://identifiers.org/chebi/CHEBI:14703",
+ "http://identifiers.org/chebi/CHEBI:16452",
+ "http://identifiers.org/chebi/CHEBI:24958",
+ "http://identifiers.org/chebi/CHEBI:24959",
+ "http://identifiers.org/chebi/CHEBI:25731",
+ "http://identifiers.org/chebi/CHEBI:25734",
+ "http://identifiers.org/chebi/CHEBI:29049",
+ "http://identifiers.org/chebi/CHEBI:30744",
+ "http://identifiers.org/chebi/CHEBI:7812",
+ "http://identifiers.org/hmdb/HMDB00223",
+ "http://identifiers.org/kegg.compound/C00036",
+ "http://identifiers.org/kegg.compound/C03981",
+ "http://identifiers.org/lipidmaps/LMFA01170061",
+ "http://identifiers.org/lipidmaps/LMFA01170120",
+ "http://identifiers.org/metanetx.chemical/MNXM46",
+ "http://identifiers.org/seed.compound/cpd00032",
+ "http://identifiers.org/seed.compound/cpd02469"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C4H2O5",
+ "id": "M_oaa_c",
+ "name": "Oxaloacetate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pep",
+ "http://identifiers.org/biocyc/META:PHOSPHO-ENOL-PYRUVATE",
+ "http://identifiers.org/chebi/CHEBI:14812",
+ "http://identifiers.org/chebi/CHEBI:18021",
+ "http://identifiers.org/chebi/CHEBI:26054",
+ "http://identifiers.org/chebi/CHEBI:26055",
+ "http://identifiers.org/chebi/CHEBI:44894",
+ "http://identifiers.org/chebi/CHEBI:44897",
+ "http://identifiers.org/chebi/CHEBI:58702",
+ "http://identifiers.org/chebi/CHEBI:8147",
+ "http://identifiers.org/hmdb/HMDB00263",
+ "http://identifiers.org/kegg.compound/C00074",
+ "http://identifiers.org/metanetx.chemical/MNXM73",
+ "http://identifiers.org/seed.compound/cpd00061"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C3H2O6P",
+ "id": "M_pep_c",
+ "name": "Phosphoenolpyruvate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pi",
+ "http://identifiers.org/biocyc/META:CPD-16459",
+ "http://identifiers.org/biocyc/META:CPD-9010",
+ "http://identifiers.org/biocyc/META:PHOSPHATE-GROUP",
+ "http://identifiers.org/biocyc/META:Pi",
+ "http://identifiers.org/chebi/CHEBI:14791",
+ "http://identifiers.org/chebi/CHEBI:18367",
+ "http://identifiers.org/chebi/CHEBI:26078",
+ "http://identifiers.org/chebi/CHEBI:29137",
+ "http://identifiers.org/chebi/CHEBI:29139",
+ "http://identifiers.org/chebi/CHEBI:35780",
+ "http://identifiers.org/chebi/CHEBI:39739",
+ "http://identifiers.org/chebi/CHEBI:39745",
+ "http://identifiers.org/chebi/CHEBI:43470",
+ "http://identifiers.org/chebi/CHEBI:43474",
+ "http://identifiers.org/chebi/CHEBI:45024",
+ "http://identifiers.org/chebi/CHEBI:7793",
+ "http://identifiers.org/hmdb/HMDB00973",
+ "http://identifiers.org/hmdb/HMDB01429",
+ "http://identifiers.org/hmdb/HMDB02105",
+ "http://identifiers.org/hmdb/HMDB02142",
+ "http://identifiers.org/hmdb/HMDB05947",
+ "http://identifiers.org/kegg.compound/C00009",
+ "http://identifiers.org/kegg.compound/C13558",
+ "http://identifiers.org/kegg.drug/D05467",
+ "http://identifiers.org/metanetx.chemical/MNXM9",
+ "http://identifiers.org/seed.compound/cpd00009",
+ "http://identifiers.org/seed.compound/cpd27787"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "HO4P",
+ "id": "M_pi_c",
+ "name": "Phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pi",
+ "http://identifiers.org/biocyc/META:CPD-16459",
+ "http://identifiers.org/biocyc/META:CPD-9010",
+ "http://identifiers.org/biocyc/META:PHOSPHATE-GROUP",
+ "http://identifiers.org/biocyc/META:Pi",
+ "http://identifiers.org/chebi/CHEBI:14791",
+ "http://identifiers.org/chebi/CHEBI:18367",
+ "http://identifiers.org/chebi/CHEBI:26078",
+ "http://identifiers.org/chebi/CHEBI:29137",
+ "http://identifiers.org/chebi/CHEBI:29139",
+ "http://identifiers.org/chebi/CHEBI:35780",
+ "http://identifiers.org/chebi/CHEBI:39739",
+ "http://identifiers.org/chebi/CHEBI:39745",
+ "http://identifiers.org/chebi/CHEBI:43470",
+ "http://identifiers.org/chebi/CHEBI:43474",
+ "http://identifiers.org/chebi/CHEBI:45024",
+ "http://identifiers.org/chebi/CHEBI:7793",
+ "http://identifiers.org/hmdb/HMDB00973",
+ "http://identifiers.org/hmdb/HMDB01429",
+ "http://identifiers.org/hmdb/HMDB02105",
+ "http://identifiers.org/hmdb/HMDB02142",
+ "http://identifiers.org/hmdb/HMDB05947",
+ "http://identifiers.org/kegg.compound/C00009",
+ "http://identifiers.org/kegg.compound/C13558",
+ "http://identifiers.org/kegg.drug/D05467",
+ "http://identifiers.org/metanetx.chemical/MNXM9",
+ "http://identifiers.org/seed.compound/cpd00009",
+ "http://identifiers.org/seed.compound/cpd27787"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "HO4P",
+ "id": "M_pi_e",
+ "name": "Phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pyr",
+ "http://identifiers.org/biocyc/META:PYRUVATE",
+ "http://identifiers.org/chebi/CHEBI:14987",
+ "http://identifiers.org/chebi/CHEBI:15361",
+ "http://identifiers.org/chebi/CHEBI:26462",
+ "http://identifiers.org/chebi/CHEBI:26466",
+ "http://identifiers.org/chebi/CHEBI:32816",
+ "http://identifiers.org/chebi/CHEBI:45253",
+ "http://identifiers.org/chebi/CHEBI:86354",
+ "http://identifiers.org/chebi/CHEBI:8685",
+ "http://identifiers.org/hmdb/HMDB00243",
+ "http://identifiers.org/hmdb/HMDB62676",
+ "http://identifiers.org/kegg.compound/C00022",
+ "http://identifiers.org/lipidmaps/LMFA01060077",
+ "http://identifiers.org/metanetx.chemical/MNXM23",
+ "http://identifiers.org/seed.compound/cpd00020"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C3H3O3",
+ "id": "M_pyr_c",
+ "name": "Pyruvate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pyr",
+ "http://identifiers.org/biocyc/META:PYRUVATE",
+ "http://identifiers.org/chebi/CHEBI:14987",
+ "http://identifiers.org/chebi/CHEBI:15361",
+ "http://identifiers.org/chebi/CHEBI:26462",
+ "http://identifiers.org/chebi/CHEBI:26466",
+ "http://identifiers.org/chebi/CHEBI:32816",
+ "http://identifiers.org/chebi/CHEBI:45253",
+ "http://identifiers.org/chebi/CHEBI:86354",
+ "http://identifiers.org/chebi/CHEBI:8685",
+ "http://identifiers.org/hmdb/HMDB00243",
+ "http://identifiers.org/hmdb/HMDB62676",
+ "http://identifiers.org/kegg.compound/C00022",
+ "http://identifiers.org/lipidmaps/LMFA01060077",
+ "http://identifiers.org/metanetx.chemical/MNXM23",
+ "http://identifiers.org/seed.compound/cpd00020"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C3H3O3",
+ "id": "M_pyr_e",
+ "name": "Pyruvate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/q8",
+ "http://identifiers.org/biocyc/META:UBIQUINONE-8",
+ "http://identifiers.org/chebi/CHEBI:61683",
+ "http://identifiers.org/kegg.compound/C17569",
+ "http://identifiers.org/lipidmaps/LMPR02010005",
+ "http://identifiers.org/metanetx.chemical/MNXM232",
+ "http://identifiers.org/seed.compound/cpd15560"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C49H74O4",
+ "id": "M_q8_c",
+ "name": "Ubiquinone-8"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/q8h2",
+ "http://identifiers.org/biocyc/META:CPD-9956",
+ "http://identifiers.org/chebi/CHEBI:61682",
+ "http://identifiers.org/hmdb/HMDB01060",
+ "http://identifiers.org/metanetx.chemical/MNXM191",
+ "http://identifiers.org/seed.compound/cpd15561",
+ "http://identifiers.org/seed.compound/cpd29608"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C49H76O4",
+ "id": "M_q8h2_c",
+ "name": "Ubiquinol-8"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/r5p",
+ "http://identifiers.org/biocyc/META:CPD-15318",
+ "http://identifiers.org/chebi/CHEBI:10270",
+ "http://identifiers.org/chebi/CHEBI:12331",
+ "http://identifiers.org/chebi/CHEBI:18189",
+ "http://identifiers.org/chebi/CHEBI:22413",
+ "http://identifiers.org/kegg.compound/C03736",
+ "http://identifiers.org/metanetx.chemical/MNXM15900",
+ "http://identifiers.org/seed.compound/cpd19028"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C5H9O8P",
+ "id": "M_r5p_c",
+ "name": "Alpha-D-Ribose 5-phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/ru5p__D",
+ "http://identifiers.org/biocyc/META:RIBULOSE-5P",
+ "http://identifiers.org/chebi/CHEBI:13018",
+ "http://identifiers.org/chebi/CHEBI:13040",
+ "http://identifiers.org/chebi/CHEBI:17363",
+ "http://identifiers.org/chebi/CHEBI:21088",
+ "http://identifiers.org/chebi/CHEBI:26572",
+ "http://identifiers.org/chebi/CHEBI:37455",
+ "http://identifiers.org/chebi/CHEBI:40192",
+ "http://identifiers.org/chebi/CHEBI:4243",
+ "http://identifiers.org/chebi/CHEBI:58121",
+ "http://identifiers.org/hmdb/HMDB00618",
+ "http://identifiers.org/hmdb/HMDB02033",
+ "http://identifiers.org/hmdb/HMDB02694",
+ "http://identifiers.org/kegg.compound/C00199",
+ "http://identifiers.org/metanetx.chemical/MNXM145",
+ "http://identifiers.org/seed.compound/cpd00171"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C5H9O8P",
+ "id": "M_ru5p__D_c",
+ "name": "D-Ribulose 5-phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/s7p",
+ "http://identifiers.org/biocyc/META:D-SEDOHEPTULOSE-7-P",
+ "http://identifiers.org/chebi/CHEBI:15073",
+ "http://identifiers.org/chebi/CHEBI:15074",
+ "http://identifiers.org/chebi/CHEBI:15721",
+ "http://identifiers.org/chebi/CHEBI:26621",
+ "http://identifiers.org/chebi/CHEBI:4244",
+ "http://identifiers.org/chebi/CHEBI:57483",
+ "http://identifiers.org/chebi/CHEBI:9083",
+ "http://identifiers.org/hmdb/HMDB01068",
+ "http://identifiers.org/hmdb/HMDB62754",
+ "http://identifiers.org/kegg.compound/C05382",
+ "http://identifiers.org/metanetx.chemical/MNXM271",
+ "http://identifiers.org/seed.compound/cpd00238"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C7H13O10P",
+ "id": "M_s7p_c",
+ "name": "Sedoheptulose 7-phosphate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/succ",
+ "http://identifiers.org/biocyc/META:SUC",
+ "http://identifiers.org/chebi/CHEBI:132287",
+ "http://identifiers.org/chebi/CHEBI:15125",
+ "http://identifiers.org/chebi/CHEBI:15741",
+ "http://identifiers.org/chebi/CHEBI:22941",
+ "http://identifiers.org/chebi/CHEBI:22943",
+ "http://identifiers.org/chebi/CHEBI:26803",
+ "http://identifiers.org/chebi/CHEBI:26807",
+ "http://identifiers.org/chebi/CHEBI:30031",
+ "http://identifiers.org/chebi/CHEBI:30779",
+ "http://identifiers.org/chebi/CHEBI:45639",
+ "http://identifiers.org/chebi/CHEBI:90372",
+ "http://identifiers.org/chebi/CHEBI:9304",
+ "http://identifiers.org/hmdb/HMDB00254",
+ "http://identifiers.org/kegg.compound/C00042",
+ "http://identifiers.org/lipidmaps/LMFA01170043",
+ "http://identifiers.org/metanetx.chemical/MNXM25",
+ "http://identifiers.org/seed.compound/cpd00036"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C4H4O4",
+ "id": "M_succ_c",
+ "name": "Succinate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/succ",
+ "http://identifiers.org/biocyc/META:SUC",
+ "http://identifiers.org/chebi/CHEBI:132287",
+ "http://identifiers.org/chebi/CHEBI:15125",
+ "http://identifiers.org/chebi/CHEBI:15741",
+ "http://identifiers.org/chebi/CHEBI:22941",
+ "http://identifiers.org/chebi/CHEBI:22943",
+ "http://identifiers.org/chebi/CHEBI:26803",
+ "http://identifiers.org/chebi/CHEBI:26807",
+ "http://identifiers.org/chebi/CHEBI:30031",
+ "http://identifiers.org/chebi/CHEBI:30779",
+ "http://identifiers.org/chebi/CHEBI:45639",
+ "http://identifiers.org/chebi/CHEBI:90372",
+ "http://identifiers.org/chebi/CHEBI:9304",
+ "http://identifiers.org/hmdb/HMDB00254",
+ "http://identifiers.org/kegg.compound/C00042",
+ "http://identifiers.org/lipidmaps/LMFA01170043",
+ "http://identifiers.org/metanetx.chemical/MNXM25",
+ "http://identifiers.org/seed.compound/cpd00036"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "e",
+ "formula": "C4H4O4",
+ "id": "M_succ_e",
+ "name": "Succinate"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/succoa",
+ "http://identifiers.org/biocyc/META:SUC-COA",
+ "http://identifiers.org/chebi/CHEBI:10746",
+ "http://identifiers.org/chebi/CHEBI:15127",
+ "http://identifiers.org/chebi/CHEBI:15380",
+ "http://identifiers.org/chebi/CHEBI:26811",
+ "http://identifiers.org/chebi/CHEBI:45541",
+ "http://identifiers.org/chebi/CHEBI:57292",
+ "http://identifiers.org/chebi/CHEBI:9310",
+ "http://identifiers.org/hmdb/HMDB01022",
+ "http://identifiers.org/kegg.compound/C00091",
+ "http://identifiers.org/lipidmaps/LMFA07050370",
+ "http://identifiers.org/metanetx.chemical/MNXM92",
+ "http://identifiers.org/seed.compound/cpd00078"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C25H35N7O19P3S",
+ "id": "M_succoa_c",
+ "name": "Succinyl-CoA"
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/xu5p__D",
+ "http://identifiers.org/biocyc/META:XYLULOSE-5-PHOSPHATE",
+ "http://identifiers.org/chebi/CHEBI:13036",
+ "http://identifiers.org/chebi/CHEBI:16332",
+ "http://identifiers.org/chebi/CHEBI:21121",
+ "http://identifiers.org/chebi/CHEBI:27354",
+ "http://identifiers.org/chebi/CHEBI:4269",
+ "http://identifiers.org/chebi/CHEBI:57737",
+ "http://identifiers.org/hmdb/HMDB00868",
+ "http://identifiers.org/hmdb/HMDB06212",
+ "http://identifiers.org/kegg.compound/C00231",
+ "http://identifiers.org/metanetx.chemical/MNXM186",
+ "http://identifiers.org/seed.compound/cpd00198"
+ ]
+ }
+ ]
+ }
+ },
+ "charge": 0,
+ "compartment": "c",
+ "formula": "C5H9O8P",
+ "id": "M_xu5p__D_c",
+ "name": "D-Xylulose 5-phosphate"
+ }
+ ],
+ "name": "Escherichia coli str. K-12 substr. MG1655",
+ "notes": "\n \n Description
\n \n
This is a metabolism model of Escherichia coli str. K-12 substr. MG1655 in\n SBML\u00a0format.
\n
\n The content of this model has been carefully created in a manual research effort. This file has been exported from the software\n
COBRApy\u00a0and further processed with the\n
JSBML-based\n
ModelPolisher\u00a0application.
\n \n Terms of use
\n Copyright \u00a9 2017 The Regents of the University of California.
\n \n
Redistribution and use of any part of this model from BiGG Models knowledge-base, with or without modification, are permitted provided that the following conditions are met:\n
\n - Redistributions of this SBML file must retain the above copyright notice, this list of conditions and the following disclaimer.
\n - Redistributions in a different form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided\n with the distribution.
\n
This model is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.\n
For specific licensing terms about this particular model and regulations of commercial use, see\n this model in BiGG Models knowledge-base.
\n
\n References
When using content from BiGG Models knowledge-base in your research works, please cite\n \n - King ZA, Lu JS, Dr\u00e4ger A, Miller PC, Federowicz S, Lerman JA, Ebrahim A, Palsson BO, and\u00a0Lewis NE. (2015).\n
- BiGG Models: A platform for integrating, standardizing, and sharing genome-scale models.\n Nucl Acids Res.\n doi:10.1093/nar/gkv1049
\n
\n ",
+ "reactions": [
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ACALD",
+ "http://identifiers.org/biocyc/META:ACETALD-DEHYDROG-RXN",
+ "http://identifiers.org/ec-code/1.2.1.10",
+ "http://identifiers.org/kegg.reaction/R00228",
+ "http://identifiers.org/metanetx.reaction/MNXR95210",
+ "http://identifiers.org/rhea/23288",
+ "http://identifiers.org/rhea/23289",
+ "http://identifiers.org/rhea/23290",
+ "http://identifiers.org/rhea/23291"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0351 or b1241",
+ "id": "R_ACALD",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_acald_c": -1.0,
+ "M_accoa_c": 1.0,
+ "M_coa_c": -1.0,
+ "M_h_c": 1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0
+ },
+ "name": "Acetaldehyde dehydrogenase (acetylating)",
+ "notes": "\n \n \n
Key1 : Value1
\n
Key2 : Value2
\n
\n
A Heading
\n
e_coli_core - Escherichia coli str. K-12 substr. MG1655
\n
\n
Key3 : Value3
\n
\n \n",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ACALDt",
+ "http://identifiers.org/metanetx.reaction/MNXR95212"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "s0001",
+ "id": "R_ACALDt",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_acald_c": 1.0,
+ "M_acald_e": -1.0
+ },
+ "name": "Acetaldehyde reversible transport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ACKr",
+ "http://identifiers.org/biocyc/META:ACETATEKIN-RXN",
+ "http://identifiers.org/ec-code/2.7.2.1",
+ "http://identifiers.org/ec-code/2.7.2.15",
+ "http://identifiers.org/kegg.reaction/R00315",
+ "http://identifiers.org/metanetx.reaction/MNXR95269",
+ "http://identifiers.org/rhea/11352",
+ "http://identifiers.org/rhea/11353",
+ "http://identifiers.org/rhea/11354",
+ "http://identifiers.org/rhea/11355"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2296 or b3115 or b1849",
+ "id": "R_ACKr",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_ac_c": -1.0,
+ "M_actp_c": 1.0,
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0
+ },
+ "name": "Acetate kinase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ACONTa",
+ "http://identifiers.org/biocyc/META:ACONITATEDEHYDR-RXN",
+ "http://identifiers.org/ec-code/4.2.1.3",
+ "http://identifiers.org/kegg.reaction/R01325",
+ "http://identifiers.org/metanetx.reaction/MNXR95386",
+ "http://identifiers.org/rhea/10228",
+ "http://identifiers.org/rhea/10229",
+ "http://identifiers.org/rhea/10230",
+ "http://identifiers.org/rhea/10231"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0118 or b1276",
+ "id": "R_ACONTa",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_acon_C_c": 1.0,
+ "M_cit_c": -1.0,
+ "M_h2o_c": 1.0
+ },
+ "name": "Aconitase (half-reaction A, Citrate hydro-lyase)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ACONTb",
+ "http://identifiers.org/ec-code/4.2.1.3",
+ "http://identifiers.org/kegg.reaction/R01900",
+ "http://identifiers.org/metanetx.reaction/MNXR95387",
+ "http://identifiers.org/rhea/22144",
+ "http://identifiers.org/rhea/22145",
+ "http://identifiers.org/rhea/22146",
+ "http://identifiers.org/rhea/22147"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0118 or b1276",
+ "id": "R_ACONTb",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_acon_C_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_icit_c": 1.0
+ },
+ "name": "Aconitase (half-reaction B, Isocitrate hydro-lyase)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ACt2r",
+ "http://identifiers.org/biocyc/META:TRANS-RXN0-571",
+ "http://identifiers.org/metanetx.reaction/MNXR95429"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_ACt2r",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_ac_c": 1.0,
+ "M_ac_e": -1.0,
+ "M_h_c": 1.0,
+ "M_h_e": -1.0
+ },
+ "name": "Acetate reversible transport via proton symport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ADK1",
+ "http://identifiers.org/biocyc/META:ADENYL-KIN-RXN",
+ "http://identifiers.org/ec-code/2.7.4.3",
+ "http://identifiers.org/kegg.reaction/R00127",
+ "http://identifiers.org/metanetx.reaction/MNXR95450",
+ "http://identifiers.org/rhea/12973",
+ "http://identifiers.org/rhea/12974",
+ "http://identifiers.org/rhea/12975",
+ "http://identifiers.org/rhea/12976"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0474",
+ "id": "R_ADK1",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_adp_c": 2.0,
+ "M_amp_c": -1.0,
+ "M_atp_c": -1.0
+ },
+ "name": "Adenylate kinase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/AKGDH",
+ "http://identifiers.org/biocyc/META:2OXOGLUTARATEDEH-RXN",
+ "http://identifiers.org/ec-code/1.2.1.52",
+ "http://identifiers.org/ec-code/1.2.4.2",
+ "http://identifiers.org/ec-code/1.8.1.4",
+ "http://identifiers.org/ec-code/2.3.1.61",
+ "http://identifiers.org/kegg.reaction/R08549",
+ "http://identifiers.org/metanetx.reaction/MNXR95655",
+ "http://identifiers.org/rhea/27786",
+ "http://identifiers.org/rhea/27787",
+ "http://identifiers.org/rhea/27788",
+ "http://identifiers.org/rhea/27789"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0726 and b0116 and b0727",
+ "id": "R_AKGDH",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_akg_c": -1.0,
+ "M_co2_c": 1.0,
+ "M_coa_c": -1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_succoa_c": 1.0
+ },
+ "name": "2-Oxogluterate dehydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/AKGt2r",
+ "http://identifiers.org/biocyc/META:TRANS-RXN-23",
+ "http://identifiers.org/metanetx.reaction/MNXR95661",
+ "http://identifiers.org/rhea/29011",
+ "http://identifiers.org/rhea/29012",
+ "http://identifiers.org/rhea/29013",
+ "http://identifiers.org/rhea/29014"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2587",
+ "id": "R_AKGt2r",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_akg_c": 1.0,
+ "M_akg_e": -1.0,
+ "M_h_c": 1.0,
+ "M_h_e": -1.0
+ },
+ "name": "2 oxoglutarate reversible transport via symport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ALCD2x",
+ "http://identifiers.org/biocyc/META:ALCOHOL-DEHYDROG-RXN",
+ "http://identifiers.org/ec-code/1.1.1.1",
+ "http://identifiers.org/ec-code/1.1.1.71",
+ "http://identifiers.org/kegg.reaction/R00754",
+ "http://identifiers.org/metanetx.reaction/MNXR95725",
+ "http://identifiers.org/rhea/25290",
+ "http://identifiers.org/rhea/25291",
+ "http://identifiers.org/rhea/25292",
+ "http://identifiers.org/rhea/25293"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1478 or b0356 or b1241",
+ "id": "R_ALCD2x",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_acald_c": 1.0,
+ "M_etoh_c": -1.0,
+ "M_h_c": 1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0
+ },
+ "name": "Alcohol dehydrogenase (ethanol)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ATPM",
+ "http://identifiers.org/biocyc/META:ATPASE-RXN",
+ "http://identifiers.org/ec-code/3.6.1.15",
+ "http://identifiers.org/ec-code/3.6.1.3",
+ "http://identifiers.org/ec-code/3.6.1.5",
+ "http://identifiers.org/ec-code/3.6.1.8",
+ "http://identifiers.org/ec-code/3.6.3.1",
+ "http://identifiers.org/ec-code/3.6.3.10",
+ "http://identifiers.org/ec-code/3.6.3.11",
+ "http://identifiers.org/ec-code/3.6.3.12",
+ "http://identifiers.org/ec-code/3.6.3.14",
+ "http://identifiers.org/ec-code/3.6.3.15",
+ "http://identifiers.org/ec-code/3.6.3.16",
+ "http://identifiers.org/ec-code/3.6.3.17",
+ "http://identifiers.org/ec-code/3.6.3.18",
+ "http://identifiers.org/ec-code/3.6.3.19",
+ "http://identifiers.org/ec-code/3.6.3.2",
+ "http://identifiers.org/ec-code/3.6.3.20",
+ "http://identifiers.org/ec-code/3.6.3.21",
+ "http://identifiers.org/ec-code/3.6.3.22",
+ "http://identifiers.org/ec-code/3.6.3.23",
+ "http://identifiers.org/ec-code/3.6.3.24",
+ "http://identifiers.org/ec-code/3.6.3.25",
+ "http://identifiers.org/ec-code/3.6.3.26",
+ "http://identifiers.org/ec-code/3.6.3.27",
+ "http://identifiers.org/ec-code/3.6.3.28",
+ "http://identifiers.org/ec-code/3.6.3.29",
+ "http://identifiers.org/ec-code/3.6.3.3",
+ "http://identifiers.org/ec-code/3.6.3.30",
+ "http://identifiers.org/ec-code/3.6.3.31",
+ "http://identifiers.org/ec-code/3.6.3.32",
+ "http://identifiers.org/ec-code/3.6.3.33",
+ "http://identifiers.org/ec-code/3.6.3.34",
+ "http://identifiers.org/ec-code/3.6.3.35",
+ "http://identifiers.org/ec-code/3.6.3.36",
+ "http://identifiers.org/ec-code/3.6.3.37",
+ "http://identifiers.org/ec-code/3.6.3.38",
+ "http://identifiers.org/ec-code/3.6.3.39",
+ "http://identifiers.org/ec-code/3.6.3.4",
+ "http://identifiers.org/ec-code/3.6.3.40",
+ "http://identifiers.org/ec-code/3.6.3.41",
+ "http://identifiers.org/ec-code/3.6.3.42",
+ "http://identifiers.org/ec-code/3.6.3.43",
+ "http://identifiers.org/ec-code/3.6.3.44",
+ "http://identifiers.org/ec-code/3.6.3.46",
+ "http://identifiers.org/ec-code/3.6.3.47",
+ "http://identifiers.org/ec-code/3.6.3.48",
+ "http://identifiers.org/ec-code/3.6.3.49",
+ "http://identifiers.org/ec-code/3.6.3.5",
+ "http://identifiers.org/ec-code/3.6.3.50",
+ "http://identifiers.org/ec-code/3.6.3.51",
+ "http://identifiers.org/ec-code/3.6.3.52",
+ "http://identifiers.org/ec-code/3.6.3.53",
+ "http://identifiers.org/ec-code/3.6.3.54",
+ "http://identifiers.org/ec-code/3.6.3.6",
+ "http://identifiers.org/ec-code/3.6.3.7",
+ "http://identifiers.org/ec-code/3.6.3.8",
+ "http://identifiers.org/ec-code/3.6.3.9",
+ "http://identifiers.org/ec-code/3.6.4.1",
+ "http://identifiers.org/ec-code/3.6.4.10",
+ "http://identifiers.org/ec-code/3.6.4.11",
+ "http://identifiers.org/ec-code/3.6.4.12",
+ "http://identifiers.org/ec-code/3.6.4.13",
+ "http://identifiers.org/ec-code/3.6.4.2",
+ "http://identifiers.org/ec-code/3.6.4.3",
+ "http://identifiers.org/ec-code/3.6.4.4",
+ "http://identifiers.org/ec-code/3.6.4.5",
+ "http://identifiers.org/ec-code/3.6.4.6",
+ "http://identifiers.org/ec-code/3.6.4.7",
+ "http://identifiers.org/ec-code/3.6.4.8",
+ "http://identifiers.org/ec-code/3.6.4.9",
+ "http://identifiers.org/kegg.reaction/R00086",
+ "http://identifiers.org/metanetx.reaction/MNXR96131",
+ "http://identifiers.org/rhea/13065",
+ "http://identifiers.org/rhea/13066",
+ "http://identifiers.org/rhea/13067",
+ "http://identifiers.org/rhea/13068"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_ATPM",
+ "lower_bound": 8.39,
+ "metabolites": {
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0,
+ "M_pi_c": 1.0
+ },
+ "name": "ATP maintenance requirement",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ATPS4r",
+ "http://identifiers.org/biocyc/META:ATPSYN-RXN",
+ "http://identifiers.org/ec-code/3.6.3.14",
+ "http://identifiers.org/metanetx.reaction/MNXR96136"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "( b3738 and b3736 and b3737 and b3735 and b3733 and b3731 and b3732 and b3734 ) or ( b3734 and b3732 and b3731 and b3733 and b3735 and b3737 and b3736 and b3738 and b3739 )",
+ "id": "R_ATPS4r",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_adp_c": -1.0,
+ "M_atp_c": 1.0,
+ "M_h2o_c": 1.0,
+ "M_h_c": 3.0,
+ "M_h_e": -4.0,
+ "M_pi_c": -1.0
+ },
+ "name": "ATP synthase (four protons for one ATP)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/Ecoli_core_w_GAM"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_BIOMASS_Ecoli_core_w_GAM",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_3pg_c": -1.496,
+ "M_accoa_c": -3.7478,
+ "M_adp_c": 59.81,
+ "M_akg_c": 4.1182,
+ "M_atp_c": -59.81,
+ "M_coa_c": 3.7478,
+ "M_e4p_c": -0.361,
+ "M_f6p_c": -0.0709,
+ "M_g3p_c": -0.129,
+ "M_g6p_c": -0.205,
+ "M_gln__L_c": -0.2557,
+ "M_glu__L_c": -4.9414,
+ "M_h2o_c": -59.81,
+ "M_h_c": 59.81,
+ "M_nad_c": -3.547,
+ "M_nadh_c": 3.547,
+ "M_nadp_c": 13.0279,
+ "M_nadph_c": -13.0279,
+ "M_oaa_c": -1.7867,
+ "M_pep_c": -0.5191,
+ "M_pi_c": 59.81,
+ "M_pyr_c": -2.8328,
+ "M_r5p_c": -0.8977
+ },
+ "name": "Biomass Objective Function with GAM",
+ "objective_coefficient": 1.0,
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/CO2t",
+ "http://identifiers.org/biocyc/META:TRANS-RXN0-545",
+ "http://identifiers.org/metanetx.reaction/MNXR96810"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "s0001",
+ "id": "R_CO2t",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_co2_c": 1.0,
+ "M_co2_e": -1.0
+ },
+ "name": "CO2 transporter via diffusion",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/CS",
+ "http://identifiers.org/biocyc/META:CITSYN-RXN",
+ "http://identifiers.org/biocyc/META:RXN-14905",
+ "http://identifiers.org/ec-code/2.3.3.1",
+ "http://identifiers.org/ec-code/2.3.3.16",
+ "http://identifiers.org/ec-code/2.3.3.3",
+ "http://identifiers.org/kegg.reaction/R00351",
+ "http://identifiers.org/metanetx.reaction/MNXR96920",
+ "http://identifiers.org/rhea/16845",
+ "http://identifiers.org/rhea/16846",
+ "http://identifiers.org/rhea/16847",
+ "http://identifiers.org/rhea/16848"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0720",
+ "id": "R_CS",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_accoa_c": -1.0,
+ "M_cit_c": 1.0,
+ "M_coa_c": 1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0,
+ "M_oaa_c": -1.0
+ },
+ "name": "Citrate synthase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/CYTBD",
+ "http://identifiers.org/metanetx.reaction/MNXR97031"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "( b0978 and b0979 ) or ( b0733 and b0734 )",
+ "id": "R_CYTBD",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_h2o_c": 1.0,
+ "M_h_c": -2.0,
+ "M_h_e": 2.0,
+ "M_o2_c": -0.5,
+ "M_q8_c": 1.0,
+ "M_q8h2_c": -1.0
+ },
+ "name": "Cytochrome oxidase bd (ubiquinol-8: 2 protons)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/D_LACt2",
+ "http://identifiers.org/biocyc/META:TRANS-RXN0-515",
+ "http://identifiers.org/metanetx.reaction/MNXR97838"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2975 or b3603",
+ "id": "R_D_LACt2",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_h_c": 1.0,
+ "M_h_e": -1.0,
+ "M_lac__D_c": 1.0,
+ "M_lac__D_e": -1.0
+ },
+ "name": "D lactate transport via proton symport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ENO",
+ "http://identifiers.org/biocyc/META:2PGADEHYDRAT-RXN",
+ "http://identifiers.org/ec-code/4.2.1.11",
+ "http://identifiers.org/kegg.reaction/R00658",
+ "http://identifiers.org/metanetx.reaction/MNXR97932",
+ "http://identifiers.org/rhea/10164",
+ "http://identifiers.org/rhea/10165",
+ "http://identifiers.org/rhea/10166",
+ "http://identifiers.org/rhea/10167"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2779",
+ "id": "R_ENO",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_2pg_c": -1.0,
+ "M_h2o_c": 1.0,
+ "M_pep_c": 1.0
+ },
+ "name": "Enolase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ETOHt2r",
+ "http://identifiers.org/metanetx.reaction/MNXR97981"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_ETOHt2r",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_etoh_c": 1.0,
+ "M_etoh_e": -1.0,
+ "M_h_c": 1.0,
+ "M_h_e": -1.0
+ },
+ "name": "Ethanol reversible transport via proton symport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ac"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_ac_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_ac_e": -1.0
+ },
+ "name": "Acetate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/acald"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_acald_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_acald_e": -1.0
+ },
+ "name": "Acetaldehyde exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/akg"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_akg_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_akg_e": -1.0
+ },
+ "name": "2-Oxoglutarate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/co2"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_co2_e",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_co2_e": -1.0
+ },
+ "name": "CO2 exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/etoh"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_etoh_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_etoh_e": -1.0
+ },
+ "name": "Ethanol exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/for"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_for_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_for_e": -1.0
+ },
+ "name": "Formate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/fru"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_fru_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_fru_e": -1.0
+ },
+ "name": "D-Fructose exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/fum"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_fum_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_fum_e": -1.0
+ },
+ "name": "Fumarate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/glc__D"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_glc__D_e",
+ "lower_bound": -10.0,
+ "metabolites": {
+ "M_glc__D_e": -1.0
+ },
+ "name": "D-Glucose exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/gln__L"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_gln__L_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_gln__L_e": -1.0
+ },
+ "name": "L-Glutamine exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/glu__L"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_glu__L_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_glu__L_e": -1.0
+ },
+ "name": "L-Glutamate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/h"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_h_e",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_h_e": -1.0
+ },
+ "name": "H+ exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/h2o"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_h2o_e",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_h2o_e": -1.0
+ },
+ "name": "H2O exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/lac__D"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_lac__D_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_lac__D_e": -1.0
+ },
+ "name": "D-lactate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/mal__L"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_mal__L_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_mal__L_e": -1.0
+ },
+ "name": "L-Malate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/nh4"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_nh4_e",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_nh4_e": -1.0
+ },
+ "name": "Ammonia exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/o2"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_o2_e",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_o2_e": -1.0
+ },
+ "name": "O2 exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/pi"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_pi_e",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_pi_e": -1.0
+ },
+ "name": "Phosphate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/pyr"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_pyr_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_pyr_e": -1.0
+ },
+ "name": "Pyruvate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/succ"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_EX_succ_e",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_succ_e": -1.0
+ },
+ "name": "Succinate exchange",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FBA",
+ "http://identifiers.org/ec-code/4.1.2.13",
+ "http://identifiers.org/kegg.reaction/R01068",
+ "http://identifiers.org/metanetx.reaction/MNXR99459",
+ "http://identifiers.org/rhea/14729",
+ "http://identifiers.org/rhea/14730",
+ "http://identifiers.org/rhea/14731",
+ "http://identifiers.org/rhea/14732"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1773 or b2097 or b2925",
+ "id": "R_FBA",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_dhap_c": 1.0,
+ "M_fdp_c": -1.0,
+ "M_g3p_c": 1.0
+ },
+ "name": "Fructose-bisphosphate aldolase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FBP",
+ "http://identifiers.org/ec-code/3.1.3.11",
+ "http://identifiers.org/metanetx.reaction/MNXR99465",
+ "http://identifiers.org/rhea/11064",
+ "http://identifiers.org/rhea/11065",
+ "http://identifiers.org/rhea/11066",
+ "http://identifiers.org/rhea/11067"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3925 or b4232",
+ "id": "R_FBP",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_f6p_c": 1.0,
+ "M_fdp_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_pi_c": 1.0
+ },
+ "name": "Fructose-bisphosphatase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FORt2",
+ "http://identifiers.org/metanetx.reaction/MNXR99621"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0904 or b2492",
+ "id": "R_FORt2",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_for_c": 1.0,
+ "M_for_e": -1.0,
+ "M_h_c": 1.0,
+ "M_h_e": -1.0
+ },
+ "name": "Formate transport in via proton symport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FORt",
+ "http://identifiers.org/biocyc/META:TRANS-RXN-1",
+ "http://identifiers.org/metanetx.reaction/MNXR99620",
+ "http://identifiers.org/rhea/29679",
+ "http://identifiers.org/rhea/29680",
+ "http://identifiers.org/rhea/29681",
+ "http://identifiers.org/rhea/29682"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0904 or b2492",
+ "id": "R_FORt",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_for_c": 1.0,
+ "M_for_e": -1.0
+ },
+ "name": "Formate transport via diffusion",
+ "upper_bound": 0.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FRD7",
+ "http://identifiers.org/metanetx.reaction/MNXR99641",
+ "http://identifiers.org/rhea/29187",
+ "http://identifiers.org/rhea/29188",
+ "http://identifiers.org/rhea/29189",
+ "http://identifiers.org/rhea/29190"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b4153 and b4151 and b4152 and b4154",
+ "id": "R_FRD7",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_fum_c": -1.0,
+ "M_q8_c": 1.0,
+ "M_q8h2_c": -1.0,
+ "M_succ_c": 1.0
+ },
+ "name": "Fumarate reductase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FRUpts2",
+ "http://identifiers.org/metanetx.reaction/MNXR99662"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2415 and b1818 and b1817 and b1819 and b2416",
+ "id": "R_FRUpts2",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_f6p_c": 1.0,
+ "M_fru_e": -1.0,
+ "M_pep_c": -1.0,
+ "M_pyr_c": 1.0
+ },
+ "name": "Fructose transport via PEP:Pyr PTS (f6p generating)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FUM",
+ "http://identifiers.org/biocyc/META:FUMHYDR-RXN",
+ "http://identifiers.org/ec-code/4.2.1.2",
+ "http://identifiers.org/kegg.reaction/R01082",
+ "http://identifiers.org/metanetx.reaction/MNXR99705",
+ "http://identifiers.org/rhea/12460",
+ "http://identifiers.org/rhea/12461",
+ "http://identifiers.org/rhea/12462",
+ "http://identifiers.org/rhea/12463"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b4122 or b1612 or b1611",
+ "id": "R_FUM",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_fum_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_mal__L_c": 1.0
+ },
+ "name": "Fumarase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FUMt2_2",
+ "http://identifiers.org/biocyc/META:TRANS-RXN-121B",
+ "http://identifiers.org/metanetx.reaction/MNXR99711",
+ "http://identifiers.org/rhea/29331",
+ "http://identifiers.org/rhea/29332",
+ "http://identifiers.org/rhea/29333",
+ "http://identifiers.org/rhea/29334"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3528",
+ "id": "R_FUMt2_2",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_fum_c": 1.0,
+ "M_fum_e": -1.0,
+ "M_h_c": 2.0,
+ "M_h_e": -2.0
+ },
+ "name": "Fumarate transport via proton symport (2 H)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/G6PDH2r",
+ "http://identifiers.org/biocyc/META:GLU6PDEHYDROG-RXN",
+ "http://identifiers.org/ec-code/1.1.1.363",
+ "http://identifiers.org/ec-code/1.1.1.49",
+ "http://identifiers.org/kegg.reaction/R00835",
+ "http://identifiers.org/metanetx.reaction/MNXR99907",
+ "http://identifiers.org/rhea/15841",
+ "http://identifiers.org/rhea/15842",
+ "http://identifiers.org/rhea/15843",
+ "http://identifiers.org/rhea/15844"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1852",
+ "id": "R_G6PDH2r",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_6pgl_c": 1.0,
+ "M_g6p_c": -1.0,
+ "M_h_c": 1.0,
+ "M_nadp_c": -1.0,
+ "M_nadph_c": 1.0
+ },
+ "name": "Glucose 6-phosphate dehydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GAPD",
+ "http://identifiers.org/biocyc/META:GAPOXNPHOSPHN-RXN",
+ "http://identifiers.org/ec-code/1.2.1.12",
+ "http://identifiers.org/ec-code/1.2.1.59",
+ "http://identifiers.org/kegg.reaction/R01061",
+ "http://identifiers.org/metanetx.reaction/MNXR100040",
+ "http://identifiers.org/rhea/10300",
+ "http://identifiers.org/rhea/10301",
+ "http://identifiers.org/rhea/10302",
+ "http://identifiers.org/rhea/10303"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1779",
+ "id": "R_GAPD",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_13dpg_c": 1.0,
+ "M_g3p_c": -1.0,
+ "M_h_c": 1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_pi_c": -1.0
+ },
+ "name": "Glyceraldehyde-3-phosphate dehydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLCpts",
+ "http://identifiers.org/metanetx.reaction/MNXR100237"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "( b2415 and b1818 and b1817 and b1819 and b2416 ) or ( b2415 and b2417 and b1101 and b2416 ) or ( b2415 and b2417 and b1621 and b2416 )",
+ "id": "R_GLCpts",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_g6p_c": 1.0,
+ "M_glc__D_e": -1.0,
+ "M_pep_c": -1.0,
+ "M_pyr_c": 1.0
+ },
+ "name": "D-glucose transport via PEP:Pyr PTS",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLNS",
+ "http://identifiers.org/biocyc/META:GLUTAMINESYN-RXN",
+ "http://identifiers.org/ec-code/6.3.1.2",
+ "http://identifiers.org/kegg.reaction/R00253",
+ "http://identifiers.org/metanetx.reaction/MNXR100024",
+ "http://identifiers.org/rhea/16169",
+ "http://identifiers.org/rhea/16170",
+ "http://identifiers.org/rhea/16171",
+ "http://identifiers.org/rhea/16172"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3870 or b1297",
+ "id": "R_GLNS",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_gln__L_c": 1.0,
+ "M_glu__L_c": -1.0,
+ "M_h_c": 1.0,
+ "M_nh4_c": -1.0,
+ "M_pi_c": 1.0
+ },
+ "name": "Glutamine synthetase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLNabc",
+ "http://identifiers.org/biocyc/META:ABC-12-RXN",
+ "http://identifiers.org/ec-code/3.6.3.21",
+ "http://identifiers.org/metanetx.reaction/MNXR100258",
+ "http://identifiers.org/rhea/29895#1",
+ "http://identifiers.org/rhea/29896#1",
+ "http://identifiers.org/rhea/29897#1",
+ "http://identifiers.org/rhea/29898#1"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0810 and b0811 and b0809",
+ "id": "R_GLNabc",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_gln__L_c": 1.0,
+ "M_gln__L_e": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0,
+ "M_pi_c": 1.0
+ },
+ "name": "L-glutamine transport via ABC system",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLUDy",
+ "http://identifiers.org/biocyc/META:GLUTDEHYD-RXN",
+ "http://identifiers.org/ec-code/1.4.1.13",
+ "http://identifiers.org/ec-code/1.4.1.3",
+ "http://identifiers.org/ec-code/1.4.1.4",
+ "http://identifiers.org/kegg.reaction/R00248",
+ "http://identifiers.org/metanetx.reaction/MNXR100086",
+ "http://identifiers.org/rhea/11612",
+ "http://identifiers.org/rhea/11613",
+ "http://identifiers.org/rhea/11614",
+ "http://identifiers.org/rhea/11615"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1761",
+ "id": "R_GLUDy",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_akg_c": 1.0,
+ "M_glu__L_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0,
+ "M_nadp_c": -1.0,
+ "M_nadph_c": 1.0,
+ "M_nh4_c": 1.0
+ },
+ "name": "Glutamate dehydrogenase (NADP)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLUN",
+ "http://identifiers.org/biocyc/META:GLUTAMIN-RXN",
+ "http://identifiers.org/ec-code/1.4.1.13",
+ "http://identifiers.org/ec-code/1.4.7.1",
+ "http://identifiers.org/ec-code/3.5.1.2",
+ "http://identifiers.org/ec-code/3.5.1.38",
+ "http://identifiers.org/ec-code/4.3.3.6",
+ "http://identifiers.org/ec-code/6.3.4.2",
+ "http://identifiers.org/ec-code/6.3.5.2",
+ "http://identifiers.org/ec-code/6.3.5.4",
+ "http://identifiers.org/ec-code/6.3.5.5",
+ "http://identifiers.org/kegg.reaction/R00256",
+ "http://identifiers.org/metanetx.reaction/MNXR100030",
+ "http://identifiers.org/rhea/15889",
+ "http://identifiers.org/rhea/15890",
+ "http://identifiers.org/rhea/15891",
+ "http://identifiers.org/rhea/15892"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0485 or b1812 or b1524",
+ "id": "R_GLUN",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_gln__L_c": -1.0,
+ "M_glu__L_c": 1.0,
+ "M_h2o_c": -1.0,
+ "M_nh4_c": 1.0
+ },
+ "name": "Glutaminase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLUSy",
+ "http://identifiers.org/biocyc/META:GLUTAMATESYN-RXN",
+ "http://identifiers.org/ec-code/1.4.1.13",
+ "http://identifiers.org/kegg.reaction/R00114",
+ "http://identifiers.org/metanetx.reaction/MNXR100291",
+ "http://identifiers.org/rhea/15501",
+ "http://identifiers.org/rhea/15502",
+ "http://identifiers.org/rhea/15503",
+ "http://identifiers.org/rhea/15504"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3212 and b3213",
+ "id": "R_GLUSy",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_akg_c": -1.0,
+ "M_gln__L_c": -1.0,
+ "M_glu__L_c": 2.0,
+ "M_h_c": -1.0,
+ "M_nadp_c": 1.0,
+ "M_nadph_c": -1.0
+ },
+ "name": "Glutamate synthase (NADPH)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLUt2r",
+ "http://identifiers.org/metanetx.reaction/MNXR100300"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b4077",
+ "id": "R_GLUt2r",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_glu__L_c": 1.0,
+ "M_glu__L_e": -1.0,
+ "M_h_c": 1.0,
+ "M_h_e": -1.0
+ },
+ "name": "L glutamate transport via proton symport reversible",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GND",
+ "http://identifiers.org/biocyc/META:RXN-9952",
+ "http://identifiers.org/ec-code/1.1.1.351",
+ "http://identifiers.org/ec-code/1.1.1.44",
+ "http://identifiers.org/kegg.reaction/R01528",
+ "http://identifiers.org/metanetx.reaction/MNXR100389",
+ "http://identifiers.org/rhea/10116",
+ "http://identifiers.org/rhea/10117",
+ "http://identifiers.org/rhea/10118",
+ "http://identifiers.org/rhea/10119"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2029",
+ "id": "R_GND",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_6pgc_c": -1.0,
+ "M_co2_c": 1.0,
+ "M_nadp_c": -1.0,
+ "M_nadph_c": 1.0,
+ "M_ru5p__D_c": 1.0
+ },
+ "name": "Phosphogluconate dehydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/H2Ot",
+ "http://identifiers.org/biocyc/META:TRANS-RXN-145",
+ "http://identifiers.org/biocyc/META:TRANS-RXN0-547",
+ "http://identifiers.org/metanetx.reaction/MNXR98641",
+ "http://identifiers.org/rhea/29667",
+ "http://identifiers.org/rhea/29668",
+ "http://identifiers.org/rhea/29669",
+ "http://identifiers.org/rhea/29670"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0875 or s0001",
+ "id": "R_H2Ot",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_h2o_c": 1.0,
+ "M_h2o_e": -1.0
+ },
+ "name": "H2O transport via diffusion",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ICDHyr",
+ "http://identifiers.org/ec-code/1.1.1.42",
+ "http://identifiers.org/kegg.reaction/R00267",
+ "http://identifiers.org/metanetx.reaction/MNXR100781",
+ "http://identifiers.org/rhea/19629",
+ "http://identifiers.org/rhea/19630",
+ "http://identifiers.org/rhea/19631",
+ "http://identifiers.org/rhea/19632"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1136",
+ "id": "R_ICDHyr",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_akg_c": 1.0,
+ "M_co2_c": 1.0,
+ "M_icit_c": -1.0,
+ "M_nadp_c": -1.0,
+ "M_nadph_c": 1.0
+ },
+ "name": "Isocitrate dehydrogenase (NADP)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ICL",
+ "http://identifiers.org/ec-code/4.1.3.1",
+ "http://identifiers.org/kegg.reaction/R00479",
+ "http://identifiers.org/metanetx.reaction/MNXR100789",
+ "http://identifiers.org/rhea/13245",
+ "http://identifiers.org/rhea/13246",
+ "http://identifiers.org/rhea/13247",
+ "http://identifiers.org/rhea/13248"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b4015",
+ "id": "R_ICL",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_glx_c": 1.0,
+ "M_icit_c": -1.0,
+ "M_succ_c": 1.0
+ },
+ "name": "Isocitrate lyase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/LDH_D",
+ "http://identifiers.org/biocyc/META:DLACTDEHYDROGNAD-RXN",
+ "http://identifiers.org/ec-code/1.1.1.28",
+ "http://identifiers.org/kegg.reaction/R00704",
+ "http://identifiers.org/metanetx.reaction/MNXR101037",
+ "http://identifiers.org/rhea/16369",
+ "http://identifiers.org/rhea/16370",
+ "http://identifiers.org/rhea/16371",
+ "http://identifiers.org/rhea/16372"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2133 or b1380",
+ "id": "R_LDH_D",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_h_c": 1.0,
+ "M_lac__D_c": -1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_pyr_c": 1.0
+ },
+ "name": "D-lactate dehydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/MALS",
+ "http://identifiers.org/biocyc/META:MALSYN-RXN",
+ "http://identifiers.org/ec-code/2.3.3.9",
+ "http://identifiers.org/kegg.reaction/R00472",
+ "http://identifiers.org/metanetx.reaction/MNXR101347",
+ "http://identifiers.org/rhea/18181",
+ "http://identifiers.org/rhea/18182",
+ "http://identifiers.org/rhea/18183",
+ "http://identifiers.org/rhea/18184"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b4014 or b2976",
+ "id": "R_MALS",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_accoa_c": -1.0,
+ "M_coa_c": 1.0,
+ "M_glx_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0,
+ "M_mal__L_c": 1.0
+ },
+ "name": "Malate synthase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/MALt2_2",
+ "http://identifiers.org/biocyc/META:TRANS-RXN-121A",
+ "http://identifiers.org/metanetx.reaction/MNXR101370",
+ "http://identifiers.org/rhea/29339",
+ "http://identifiers.org/rhea/29340",
+ "http://identifiers.org/rhea/29341",
+ "http://identifiers.org/rhea/29342"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3528",
+ "id": "R_MALt2_2",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_h_c": 2.0,
+ "M_h_e": -2.0,
+ "M_mal__L_c": 1.0,
+ "M_mal__L_e": -1.0
+ },
+ "name": "Malate transport via proton symport (2 H)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/MDH",
+ "http://identifiers.org/biocyc/META:MALATE-DEH-RXN",
+ "http://identifiers.org/ec-code/1.1.1.299",
+ "http://identifiers.org/ec-code/1.1.1.37",
+ "http://identifiers.org/kegg.reaction/R00342",
+ "http://identifiers.org/metanetx.reaction/MNXR101439",
+ "http://identifiers.org/rhea/21432",
+ "http://identifiers.org/rhea/21433",
+ "http://identifiers.org/rhea/21434",
+ "http://identifiers.org/rhea/21435"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3236",
+ "id": "R_MDH",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_h_c": 1.0,
+ "M_mal__L_c": -1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_oaa_c": 1.0
+ },
+ "name": "Malate dehydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ME1",
+ "http://identifiers.org/biocyc/META:1.1.1.39-RXN",
+ "http://identifiers.org/ec-code/1.1.1.38",
+ "http://identifiers.org/ec-code/1.1.1.39",
+ "http://identifiers.org/kegg.reaction/R00214",
+ "http://identifiers.org/metanetx.reaction/MNXR101446",
+ "http://identifiers.org/rhea/12653",
+ "http://identifiers.org/rhea/12654",
+ "http://identifiers.org/rhea/12655",
+ "http://identifiers.org/rhea/12656"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1479",
+ "id": "R_ME1",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_co2_c": 1.0,
+ "M_mal__L_c": -1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_pyr_c": 1.0
+ },
+ "name": "Malic enzyme (NAD)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ME2",
+ "http://identifiers.org/biocyc/META:MALIC-NADP-RXN",
+ "http://identifiers.org/ec-code/1.1.1.40",
+ "http://identifiers.org/kegg.reaction/R00216",
+ "http://identifiers.org/metanetx.reaction/MNXR101443",
+ "http://identifiers.org/rhea/18253",
+ "http://identifiers.org/rhea/18254",
+ "http://identifiers.org/rhea/18255",
+ "http://identifiers.org/rhea/18256"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2463",
+ "id": "R_ME2",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_co2_c": 1.0,
+ "M_mal__L_c": -1.0,
+ "M_nadp_c": -1.0,
+ "M_nadph_c": 1.0,
+ "M_pyr_c": 1.0
+ },
+ "name": "Malic enzyme (NADP)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/NADH16",
+ "http://identifiers.org/ec-code/1.6.5.3",
+ "http://identifiers.org/metanetx.reaction/MNXR101864"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2287 and b2285 and b2283 and b2281 and b2279 and b2277 and b2276 and b2278 and b2280 and b2282 and b2284 and b2286 and b2288",
+ "id": "R_NADH16",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_h_c": -4.0,
+ "M_h_e": 3.0,
+ "M_nad_c": 1.0,
+ "M_nadh_c": -1.0,
+ "M_q8_c": -1.0,
+ "M_q8h2_c": 1.0
+ },
+ "name": "NADH dehydrogenase (ubiquinone-8 & 3 protons)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/NADTRHD",
+ "http://identifiers.org/biocyc/META:PYRNUTRANSHYDROGEN-RXN",
+ "http://identifiers.org/ec-code/1.6.1.1",
+ "http://identifiers.org/ec-code/1.6.1.2",
+ "http://identifiers.org/ec-code/1.6.1.3",
+ "http://identifiers.org/kegg.reaction/R00112",
+ "http://identifiers.org/metanetx.reaction/MNXR101898",
+ "http://identifiers.org/rhea/11692",
+ "http://identifiers.org/rhea/11693",
+ "http://identifiers.org/rhea/11694",
+ "http://identifiers.org/rhea/11695"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3962 or ( b1602 and b1603 )",
+ "id": "R_NADTRHD",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_nadp_c": 1.0,
+ "M_nadph_c": -1.0
+ },
+ "name": "NAD transhydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/NH4t",
+ "http://identifiers.org/biocyc/META:RXN-9615",
+ "http://identifiers.org/biocyc/META:TRANS-RXN0-206",
+ "http://identifiers.org/biocyc/META:TRANS-RXN0-544",
+ "http://identifiers.org/metanetx.reaction/MNXR101950",
+ "http://identifiers.org/rhea/28747",
+ "http://identifiers.org/rhea/28748",
+ "http://identifiers.org/rhea/28749",
+ "http://identifiers.org/rhea/28750"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "s0001 or b0451",
+ "id": "R_NH4t",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_nh4_c": 1.0,
+ "M_nh4_e": -1.0
+ },
+ "name": "Ammonia reversible transport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/O2t",
+ "http://identifiers.org/biocyc/META:TRANS-RXN0-474",
+ "http://identifiers.org/metanetx.reaction/MNXR102090"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "s0001",
+ "id": "R_O2t",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_o2_c": 1.0,
+ "M_o2_e": -1.0
+ },
+ "name": "O2 transport diffusion ",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PDH",
+ "http://identifiers.org/biocyc/META:PYRUVDEH-RXN",
+ "http://identifiers.org/ec-code/1.2.1.-",
+ "http://identifiers.org/ec-code/1.2.1.51",
+ "http://identifiers.org/ec-code/1.2.4.1",
+ "http://identifiers.org/ec-code/1.8.1.4",
+ "http://identifiers.org/ec-code/2.3.1.12",
+ "http://identifiers.org/kegg.reaction/R00209",
+ "http://identifiers.org/metanetx.reaction/MNXR102425",
+ "http://identifiers.org/rhea/28042",
+ "http://identifiers.org/rhea/28043",
+ "http://identifiers.org/rhea/28044",
+ "http://identifiers.org/rhea/28045"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0115 and b0114 and b0116",
+ "id": "R_PDH",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_accoa_c": 1.0,
+ "M_co2_c": 1.0,
+ "M_coa_c": -1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_pyr_c": -1.0
+ },
+ "name": "Pyruvate dehydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PFK",
+ "http://identifiers.org/ec-code/2.7.1.11",
+ "http://identifiers.org/metanetx.reaction/MNXR102507",
+ "http://identifiers.org/rhea/16109",
+ "http://identifiers.org/rhea/16110",
+ "http://identifiers.org/rhea/16111",
+ "http://identifiers.org/rhea/16112"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3916 or b1723",
+ "id": "R_PFK",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_f6p_c": -1.0,
+ "M_fdp_c": 1.0,
+ "M_h_c": 1.0
+ },
+ "name": "Phosphofructokinase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PFL",
+ "http://identifiers.org/biocyc/META:PYRUVFORMLY-RXN",
+ "http://identifiers.org/ec-code/2.3.1.54",
+ "http://identifiers.org/kegg.reaction/R00212",
+ "http://identifiers.org/metanetx.reaction/MNXR102514",
+ "http://identifiers.org/rhea/11844",
+ "http://identifiers.org/rhea/11845",
+ "http://identifiers.org/rhea/11846",
+ "http://identifiers.org/rhea/11847"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "( b0902 and b3114 ) or ( b0903 and b0902 and b2579 ) or ( b0902 and b0903 ) or ( b3951 and b3952 )",
+ "id": "R_PFL",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_accoa_c": 1.0,
+ "M_coa_c": -1.0,
+ "M_for_c": 1.0,
+ "M_pyr_c": -1.0
+ },
+ "name": "Pyruvate formate lyase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGI",
+ "http://identifiers.org/biocyc/META:PGLUCISOM-RXN",
+ "http://identifiers.org/ec-code/5.3.1.9",
+ "http://identifiers.org/metanetx.reaction/MNXR102535"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b4025",
+ "id": "R_PGI",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_f6p_c": 1.0,
+ "M_g6p_c": -1.0
+ },
+ "name": "Glucose-6-phosphate isomerase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGK",
+ "http://identifiers.org/biocyc/META:PHOSGLYPHOS-RXN",
+ "http://identifiers.org/ec-code/2.7.2.3",
+ "http://identifiers.org/kegg.reaction/R01512",
+ "http://identifiers.org/metanetx.reaction/MNXR102538",
+ "http://identifiers.org/rhea/14801",
+ "http://identifiers.org/rhea/14802",
+ "http://identifiers.org/rhea/14803",
+ "http://identifiers.org/rhea/14804"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2926",
+ "id": "R_PGK",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_13dpg_c": 1.0,
+ "M_3pg_c": -1.0,
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0
+ },
+ "name": "Phosphoglycerate kinase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGL",
+ "http://identifiers.org/biocyc/META:6PGLUCONOLACT-RXN",
+ "http://identifiers.org/ec-code/3.1.1.31",
+ "http://identifiers.org/kegg.reaction/R02035",
+ "http://identifiers.org/metanetx.reaction/MNXR102539",
+ "http://identifiers.org/rhea/12556",
+ "http://identifiers.org/rhea/12557",
+ "http://identifiers.org/rhea/12558",
+ "http://identifiers.org/rhea/12559"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0767",
+ "id": "R_PGL",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_6pgc_c": 1.0,
+ "M_6pgl_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0
+ },
+ "name": "6-phosphogluconolactonase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGM",
+ "http://identifiers.org/biocyc/META:3PGAREARR-RXN",
+ "http://identifiers.org/biocyc/META:RXN-15513",
+ "http://identifiers.org/ec-code/5.4.2.1",
+ "http://identifiers.org/ec-code/5.4.2.11",
+ "http://identifiers.org/ec-code/5.4.2.12",
+ "http://identifiers.org/kegg.reaction/R01518",
+ "http://identifiers.org/metanetx.reaction/MNXR102547",
+ "http://identifiers.org/rhea/15901",
+ "http://identifiers.org/rhea/15902",
+ "http://identifiers.org/rhea/15903",
+ "http://identifiers.org/rhea/15904"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b4395 or b3612 or b0755",
+ "id": "R_PGM",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_2pg_c": -1.0,
+ "M_3pg_c": 1.0
+ },
+ "name": "Phosphoglycerate mutase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PIt2r",
+ "http://identifiers.org/biocyc/META:TRANS-RXN-114",
+ "http://identifiers.org/metanetx.reaction/MNXR102872",
+ "http://identifiers.org/rhea/29939",
+ "http://identifiers.org/rhea/29940",
+ "http://identifiers.org/rhea/29941",
+ "http://identifiers.org/rhea/29942"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2987 or b3493",
+ "id": "R_PIt2r",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_h_c": 1.0,
+ "M_h_e": -1.0,
+ "M_pi_c": 1.0,
+ "M_pi_e": -1.0
+ },
+ "name": "Phosphate reversible transport via symport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PPC",
+ "http://identifiers.org/ec-code/4.1.1.31",
+ "http://identifiers.org/kegg.reaction/R00345",
+ "http://identifiers.org/metanetx.reaction/MNXR103096",
+ "http://identifiers.org/rhea/23072",
+ "http://identifiers.org/rhea/23073",
+ "http://identifiers.org/rhea/23074",
+ "http://identifiers.org/rhea/23075"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3956",
+ "id": "R_PPC",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_co2_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0,
+ "M_oaa_c": 1.0,
+ "M_pep_c": -1.0,
+ "M_pi_c": 1.0
+ },
+ "name": "Phosphoenolpyruvate carboxylase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PPCK",
+ "http://identifiers.org/biocyc/META:PEPCARBOXYKIN-RXN",
+ "http://identifiers.org/ec-code/4.1.1.49",
+ "http://identifiers.org/kegg.reaction/R00341",
+ "http://identifiers.org/metanetx.reaction/MNXR103099",
+ "http://identifiers.org/rhea/18617",
+ "http://identifiers.org/rhea/18618",
+ "http://identifiers.org/rhea/18619",
+ "http://identifiers.org/rhea/18620"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3403",
+ "id": "R_PPCK",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_co2_c": 1.0,
+ "M_oaa_c": -1.0,
+ "M_pep_c": 1.0
+ },
+ "name": "Phosphoenolpyruvate carboxykinase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PPS",
+ "http://identifiers.org/biocyc/META:PEPSYNTH-RXN",
+ "http://identifiers.org/ec-code/2.7.9.2",
+ "http://identifiers.org/kegg.reaction/R00199",
+ "http://identifiers.org/metanetx.reaction/MNXR103140",
+ "http://identifiers.org/rhea/11364",
+ "http://identifiers.org/rhea/11365",
+ "http://identifiers.org/rhea/11366",
+ "http://identifiers.org/rhea/11367"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1702",
+ "id": "R_PPS",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_amp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 2.0,
+ "M_pep_c": 1.0,
+ "M_pi_c": 1.0,
+ "M_pyr_c": -1.0
+ },
+ "name": "Phosphoenolpyruvate synthase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PTAr",
+ "http://identifiers.org/biocyc/META:PHOSACETYLTRANS-RXN",
+ "http://identifiers.org/ec-code/2.3.1.8",
+ "http://identifiers.org/kegg.reaction/R00230",
+ "http://identifiers.org/metanetx.reaction/MNXR103319",
+ "http://identifiers.org/rhea/19521",
+ "http://identifiers.org/rhea/19522",
+ "http://identifiers.org/rhea/19523",
+ "http://identifiers.org/rhea/19524"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2297 or b2458",
+ "id": "R_PTAr",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_accoa_c": -1.0,
+ "M_actp_c": 1.0,
+ "M_coa_c": 1.0,
+ "M_pi_c": -1.0
+ },
+ "name": "Phosphotransacetylase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PYK",
+ "http://identifiers.org/biocyc/META:PEPDEPHOS-RXN",
+ "http://identifiers.org/ec-code/2.7.1.40",
+ "http://identifiers.org/kegg.reaction/R00200",
+ "http://identifiers.org/metanetx.reaction/MNXR103371",
+ "http://identifiers.org/rhea/18157",
+ "http://identifiers.org/rhea/18158",
+ "http://identifiers.org/rhea/18159",
+ "http://identifiers.org/rhea/18160"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1854 or b1676",
+ "id": "R_PYK",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_adp_c": -1.0,
+ "M_atp_c": 1.0,
+ "M_h_c": -1.0,
+ "M_pep_c": -1.0,
+ "M_pyr_c": 1.0
+ },
+ "name": "Pyruvate kinase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PYRt2",
+ "http://identifiers.org/metanetx.reaction/MNXR103385"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_PYRt2",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_h_c": 1.0,
+ "M_h_e": -1.0,
+ "M_pyr_c": 1.0,
+ "M_pyr_e": -1.0
+ },
+ "name": "Pyruvate transport in via proton symport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/RPE",
+ "http://identifiers.org/biocyc/META:RIBULP3EPIM-RXN",
+ "http://identifiers.org/ec-code/5.1.3.1",
+ "http://identifiers.org/kegg.reaction/R01529",
+ "http://identifiers.org/metanetx.reaction/MNXR104083",
+ "http://identifiers.org/rhea/13677",
+ "http://identifiers.org/rhea/13678",
+ "http://identifiers.org/rhea/13679",
+ "http://identifiers.org/rhea/13680"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3386 or b4301",
+ "id": "R_RPE",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_ru5p__D_c": -1.0,
+ "M_xu5p__D_c": 1.0
+ },
+ "name": "Ribulose 5-phosphate 3-epimerase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/RPI",
+ "http://identifiers.org/ec-code/5.3.1.6",
+ "http://identifiers.org/metanetx.reaction/MNXR104084"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2914 or b4090",
+ "id": "R_RPI",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_r5p_c": -1.0,
+ "M_ru5p__D_c": 1.0
+ },
+ "name": "Ribose-5-phosphate isomerase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/SUCCt2_2",
+ "http://identifiers.org/biocyc/META:TRANS-RXN-121",
+ "http://identifiers.org/metanetx.reaction/MNXR104620",
+ "http://identifiers.org/rhea/29303",
+ "http://identifiers.org/rhea/29304",
+ "http://identifiers.org/rhea/29305",
+ "http://identifiers.org/rhea/29306"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3528",
+ "id": "R_SUCCt2_2",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_h_c": 2.0,
+ "M_h_e": -2.0,
+ "M_succ_c": 1.0,
+ "M_succ_e": -1.0
+ },
+ "name": "Succinate transport via proton symport (2 H)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/SUCCt3",
+ "http://identifiers.org/metanetx.reaction/MNXR104623"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "",
+ "id": "R_SUCCt3",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_h_c": 1.0,
+ "M_h_e": -1.0,
+ "M_succ_c": -1.0,
+ "M_succ_e": 1.0
+ },
+ "name": "Succinate transport out via proton antiport",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/SUCDi",
+ "http://identifiers.org/metanetx.reaction/MNXR99641",
+ "http://identifiers.org/rhea/29187",
+ "http://identifiers.org/rhea/29188",
+ "http://identifiers.org/rhea/29189",
+ "http://identifiers.org/rhea/29190"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0723 and b0721 and b0722 and b0724",
+ "id": "R_SUCDi",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_fum_c": 1.0,
+ "M_q8_c": -1.0,
+ "M_q8h2_c": 1.0,
+ "M_succ_c": -1.0
+ },
+ "name": "Succinate dehydrogenase (irreversible)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/SUCOAS",
+ "http://identifiers.org/biocyc/META:SUCCCOASYN-RXN",
+ "http://identifiers.org/ec-code/6.2.1.5",
+ "http://identifiers.org/kegg.reaction/R00405",
+ "http://identifiers.org/metanetx.reaction/MNXR104635",
+ "http://identifiers.org/rhea/17661",
+ "http://identifiers.org/rhea/17662",
+ "http://identifiers.org/rhea/17663",
+ "http://identifiers.org/rhea/17664"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b0728 and b0729",
+ "id": "R_SUCOAS",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_coa_c": -1.0,
+ "M_pi_c": 1.0,
+ "M_succ_c": -1.0,
+ "M_succoa_c": 1.0
+ },
+ "name": "Succinyl-CoA synthetase (ADP-forming)",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/TALA",
+ "http://identifiers.org/biocyc/META:TRANSALDOL-RXN",
+ "http://identifiers.org/ec-code/2.2.1.2",
+ "http://identifiers.org/kegg.reaction/R01827",
+ "http://identifiers.org/metanetx.reaction/MNXR104715",
+ "http://identifiers.org/rhea/17053",
+ "http://identifiers.org/rhea/17054",
+ "http://identifiers.org/rhea/17055",
+ "http://identifiers.org/rhea/17056"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2464 or b0008",
+ "id": "R_TALA",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_e4p_c": 1.0,
+ "M_f6p_c": 1.0,
+ "M_g3p_c": -1.0,
+ "M_s7p_c": -1.0
+ },
+ "name": "Transaldolase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/THD2",
+ "http://identifiers.org/ec-code/1.6.1.1",
+ "http://identifiers.org/metanetx.reaction/MNXR104805"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b1602 and b1603",
+ "id": "R_THD2",
+ "lower_bound": 0.0,
+ "metabolites": {
+ "M_h_c": 2.0,
+ "M_h_e": -2.0,
+ "M_nad_c": 1.0,
+ "M_nadh_c": -1.0,
+ "M_nadp_c": -1.0,
+ "M_nadph_c": 1.0
+ },
+ "name": "NAD(P) transhydrogenase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/TKT1",
+ "http://identifiers.org/ec-code/2.2.1.1",
+ "http://identifiers.org/metanetx.reaction/MNXR104868"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2935 or b2465",
+ "id": "R_TKT1",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_g3p_c": 1.0,
+ "M_r5p_c": -1.0,
+ "M_s7p_c": 1.0,
+ "M_xu5p__D_c": -1.0
+ },
+ "name": "Transketolase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/TKT2",
+ "http://identifiers.org/biocyc/META:2TRANSKETO-RXN",
+ "http://identifiers.org/ec-code/2.2.1.1",
+ "http://identifiers.org/kegg.reaction/R01830",
+ "http://identifiers.org/metanetx.reaction/MNXR104869",
+ "http://identifiers.org/rhea/27626",
+ "http://identifiers.org/rhea/27627",
+ "http://identifiers.org/rhea/27628",
+ "http://identifiers.org/rhea/27629"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b2935 or b2465",
+ "id": "R_TKT2",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_e4p_c": -1.0,
+ "M_f6p_c": 1.0,
+ "M_g3p_c": 1.0,
+ "M_xu5p__D_c": -1.0
+ },
+ "name": "Transketolase",
+ "upper_bound": 1000.0
+ },
+ {
+ "annotation": {
+ "cvterms": {
+ "bqb_is": [
+ {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/TPI",
+ "http://identifiers.org/biocyc/META:TRIOSEPISOMERIZATION-RXN",
+ "http://identifiers.org/ec-code/5.3.1.1",
+ "http://identifiers.org/kegg.reaction/R01015",
+ "http://identifiers.org/metanetx.reaction/MNXR104918",
+ "http://identifiers.org/rhea/18585",
+ "http://identifiers.org/rhea/18586",
+ "http://identifiers.org/rhea/18587",
+ "http://identifiers.org/rhea/18588"
+ ]
+ }
+ ]
+ }
+ },
+ "gene_reaction_rule": "b3919",
+ "id": "R_TPI",
+ "lower_bound": -1000.0,
+ "metabolites": {
+ "M_dhap_c": -1.0,
+ "M_g3p_c": 1.0
+ },
+ "name": "Triose-phosphate isomerase",
+ "upper_bound": 1000.0
+ }
+ ],
+ "sbml_info": {
+ "annotation": {
+ "sbo": "SBO:0000624"
+ },
+ "info": " SBML L3V1, fbc-v2, groups-v1",
+ "level": 3,
+ "model.id": "e_coli_core",
+ "notes": "\n \n \n
Key1 : Value1
\n
\n
\n
e_coli_core - Escherichia coli str. K-12 substr. MG1655
\n \n
\n
\n \n",
+ "packages": {
+ "fbc": 2,
+ "groups": 1
+ },
+ "version": 1
+ },
+ "user_defined_constraints": [],
+ "version": "1"
+}
diff --git a/tests/data/example_notes.xml b/tests/data/example_notes.xml
index 13fcdff15..ccbb3b9fd 100644
--- a/tests/data/example_notes.xml
+++ b/tests/data/example_notes.xml
@@ -46,7 +46,6 @@
-
@@ -72,7 +71,6 @@
-
diff --git a/tests/data/iJO1366.pickle b/tests/data/iJO1366.pickle
index 3856b85be..6e1185827 100644
Binary files a/tests/data/iJO1366.pickle and b/tests/data/iJO1366.pickle differ
diff --git a/tests/data/mini.json b/tests/data/mini.json
index df70c0a4f..0a054923e 100644
--- a/tests/data/mini.json
+++ b/tests/data/mini.json
@@ -5,1120 +5,1224 @@
},
"genes": [
{
- "id": "b0755",
+ "id": "G_b0755",
"name": "gpmA"
},
{
- "id": "b0875",
+ "id": "G_b0875",
"name": "aqpZ"
},
{
- "id": "b1101",
+ "id": "G_b1101",
"name": "ptsG"
},
{
- "id": "b1380",
+ "id": "G_b1380",
"name": "ldhA"
},
{
- "id": "b1621",
+ "id": "G_b1621",
"name": "malX"
},
{
"annotation": {
- "ncbiprotein": [
- "1208453",
- "1652654"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1208453",
+ "http://identifiers.org/ncbiprotein/1652654"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
]
},
- "id": "b1676",
+ "id": "G_b1676",
"name": "pykF"
},
{
- "id": "b1723",
+ "id": "G_b1723",
"name": "pfkB"
},
{
- "id": "b1773",
+ "id": "G_b1773",
"name": "ydjI"
},
{
- "id": "b1779",
+ "id": "G_b1779",
"name": "gapA"
},
{
- "id": "b1817",
+ "id": "G_b1817",
"name": "manX"
},
{
- "id": "b1818",
+ "id": "G_b1818",
"name": "manY"
},
{
- "id": "b1819",
+ "id": "G_b1819",
"name": "manZ"
},
{
- "id": "b1854",
+ "id": "G_b1854",
"name": "pykA"
},
{
- "id": "b2097",
+ "id": "G_b2097",
"name": "fbaB"
},
{
- "id": "b2133",
+ "id": "G_b2133",
"name": "dld"
},
{
- "id": "b2415",
+ "id": "G_b2415",
"name": "ptsH"
},
{
- "id": "b2416",
+ "id": "G_b2416",
"name": "ptsI"
},
{
- "id": "b2417",
+ "id": "G_b2417",
"name": "crr"
},
{
"annotation": {
- "ncbiprotein": "1653839"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1653839"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
- "id": "b2779",
+ "id": "G_b2779",
"name": "eno"
},
{
- "id": "b2925",
+ "id": "G_b2925",
"name": "fbaA"
},
{
"annotation": {
- "ncbiprotein": "1653609"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1653609"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
- "id": "b2926",
+ "id": "G_b2926",
"name": "pgk"
},
{
- "id": "b2987",
+ "id": "G_b2987",
"name": "pitB"
},
{
- "id": "b3493",
+ "id": "G_b3493",
"name": "pitA"
},
{
- "id": "b3612",
+ "id": "G_b3612",
"name": "gpmM"
},
{
"annotation": {
- "ncbiprotein": [
- "1006614",
- "1651919"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1006614",
+ "http://identifiers.org/ncbiprotein/1651919"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
]
},
- "id": "b3916",
+ "id": "G_b3916",
"name": "pfkA"
},
{
- "id": "b3919",
+ "id": "G_b3919",
"name": "tpiA"
},
{
"annotation": {
- "ncbiprotein": "1653253"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/ncbiprotein/1653253"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
- "id": "b4025",
+ "id": "G_b4025",
"name": "pgi"
},
{
- "id": "b4395",
+ "id": "G_b4395",
"name": "ytjC"
},
{
- "id": "s0001",
+ "id": "G_s0001",
"name": "G_s0001"
}
],
+ "groups": [],
"id": "mini_textbook",
"metabolites": [
{
"annotation": {
- "bigg.metabolite": "13dpg",
- "biocyc": "DPG",
- "chebi": [
- "CHEBI:16001",
- "CHEBI:1658",
- "CHEBI:20189",
- "CHEBI:57604",
- "CHEBI:11881"
- ],
- "hmdb": "HMDB01270",
- "kegg.compound": "C00236",
- "pubchem.substance": "3535",
- "reactome": "REACT_29800",
- "seed.compound": "cpd00203",
- "unipathway.compound": "UPC00236"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/13dpg",
+ "http://identifiers.org/biocyc/DPG",
+ "http://identifiers.org/chebi/CHEBI:11881",
+ "http://identifiers.org/chebi/CHEBI:16001",
+ "http://identifiers.org/chebi/CHEBI:1658",
+ "http://identifiers.org/chebi/CHEBI:20189",
+ "http://identifiers.org/chebi/CHEBI:57604",
+ "http://identifiers.org/hmdb/HMDB01270",
+ "http://identifiers.org/kegg.compound/C00236",
+ "http://identifiers.org/pubchem.substance/3535",
+ "http://identifiers.org/reactome/REACT_29800",
+ "http://identifiers.org/seed.compound/cpd00203",
+ "http://identifiers.org/unipathway.compound/UPC00236"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -4,
"compartment": "c",
"formula": "C3H4O10P2",
- "id": "13dpg_c",
+ "id": "M_13dpg_c",
"name": "3-Phospho-D-glyceroyl phosphate"
},
{
"annotation": {
- "bigg.metabolite": "2pg",
- "biocyc": "2-PG",
- "chebi": [
- "CHEBI:1267",
- "CHEBI:58289",
- "CHEBI:17835",
- "CHEBI:21028",
- "CHEBI:11651",
- "CHEBI:12986",
- "CHEBI:24344",
- "CHEBI:39868"
- ],
- "hmdb": [
- "HMDB03391",
- "HMDB00362"
- ],
- "kegg.compound": "C00631",
- "pubchem.substance": "3904",
- "reactome": "REACT_30485",
- "seed.compound": "cpd00482",
- "unipathway.compound": "UPC00631"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/2pg",
+ "http://identifiers.org/biocyc/2-PG",
+ "http://identifiers.org/chebi/CHEBI:11651",
+ "http://identifiers.org/chebi/CHEBI:1267",
+ "http://identifiers.org/chebi/CHEBI:12986",
+ "http://identifiers.org/chebi/CHEBI:17835",
+ "http://identifiers.org/chebi/CHEBI:21028",
+ "http://identifiers.org/chebi/CHEBI:24344",
+ "http://identifiers.org/chebi/CHEBI:39868",
+ "http://identifiers.org/chebi/CHEBI:58289",
+ "http://identifiers.org/hmdb/HMDB00362",
+ "http://identifiers.org/hmdb/HMDB03391",
+ "http://identifiers.org/kegg.compound/C00631",
+ "http://identifiers.org/pubchem.substance/3904",
+ "http://identifiers.org/reactome/REACT_30485",
+ "http://identifiers.org/seed.compound/cpd00482",
+ "http://identifiers.org/unipathway.compound/UPC00631"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -3,
"compartment": "c",
"formula": "C3H4O7P",
- "id": "2pg_c",
+ "id": "M_2pg_c",
"name": "D-Glycerate 2-phosphate"
},
{
"annotation": {
- "bigg.metabolite": "3pg",
- "biocyc": "G3P",
- "chebi": [
- "CHEBI:40016",
- "CHEBI:58272",
- "CHEBI:57998",
- "CHEBI:11879",
- "CHEBI:1657",
- "CHEBI:1659",
- "CHEBI:17050",
- "CHEBI:21029",
- "CHEBI:11882",
- "CHEBI:11880",
- "CHEBI:12987",
- "CHEBI:17794",
- "CHEBI:24345"
- ],
- "hmdb": "HMDB00807",
- "kegg.compound": [
- "C00197",
- "C00597"
- ],
- "pubchem.substance": "3497",
- "reactome": "REACT_29728",
- "seed.compound": "cpd00169",
- "unipathway.compound": [
- "UPC00597",
- "UPC00197"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/3pg",
+ "http://identifiers.org/biocyc/G3P",
+ "http://identifiers.org/chebi/CHEBI:11879",
+ "http://identifiers.org/chebi/CHEBI:11880",
+ "http://identifiers.org/chebi/CHEBI:11882",
+ "http://identifiers.org/chebi/CHEBI:12987",
+ "http://identifiers.org/chebi/CHEBI:1657",
+ "http://identifiers.org/chebi/CHEBI:1659",
+ "http://identifiers.org/chebi/CHEBI:17050",
+ "http://identifiers.org/chebi/CHEBI:17794",
+ "http://identifiers.org/chebi/CHEBI:21029",
+ "http://identifiers.org/chebi/CHEBI:24345",
+ "http://identifiers.org/chebi/CHEBI:40016",
+ "http://identifiers.org/chebi/CHEBI:57998",
+ "http://identifiers.org/chebi/CHEBI:58272",
+ "http://identifiers.org/hmdb/HMDB00807",
+ "http://identifiers.org/kegg.compound/C00197",
+ "http://identifiers.org/kegg.compound/C00597",
+ "http://identifiers.org/pubchem.substance/3497",
+ "http://identifiers.org/reactome/REACT_29728",
+ "http://identifiers.org/seed.compound/cpd00169",
+ "http://identifiers.org/unipathway.compound/UPC00197",
+ "http://identifiers.org/unipathway.compound/UPC00597"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
]
},
"charge": -3,
"compartment": "c",
"formula": "C3H4O7P",
- "id": "3pg_c",
+ "id": "M_3pg_c",
"name": "3-Phospho-D-glycerate"
},
{
"annotation": {
- "bigg.metabolite": "adp",
- "biocyc": [
- "ADP",
- "ADP-GROUP"
- ],
- "cas": [
- "58-64-0"
- ],
- "chebi": [
- "CHEBI:13222",
- "CHEBI:16761",
- "CHEBI:2342",
- "CHEBI:22244",
- "CHEBI:40553",
- "CHEBI:456216"
- ],
- "hmdb": "HMDB01341",
- "kegg.compound": "C00008",
- "kegg.glycan": "G11113",
- "pubchem.substance": "3310",
- "reactome": [
- "REACT_190072",
- "REACT_481002",
- "REACT_211606",
- "REACT_429160",
- "REACT_29370",
- "REACT_196180",
- "REACT_113581",
- "REACT_113582",
- "REACT_114564",
- "REACT_114565",
- "REACT_429153"
- ],
- "seed.compound": "cpd00008",
- "unipathway.compound": "UPC00008"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/adp",
+ "http://identifiers.org/biocyc/ADP",
+ "http://identifiers.org/biocyc/ADP-GROUP",
+ "http://identifiers.org/cas/58-64-0",
+ "http://identifiers.org/cas/58-64-0",
+ "http://identifiers.org/chebi/CHEBI:13222",
+ "http://identifiers.org/chebi/CHEBI:16761",
+ "http://identifiers.org/chebi/CHEBI:22244",
+ "http://identifiers.org/chebi/CHEBI:2342",
+ "http://identifiers.org/chebi/CHEBI:40553",
+ "http://identifiers.org/chebi/CHEBI:456216",
+ "http://identifiers.org/hmdb/HMDB01341",
+ "http://identifiers.org/kegg.compound/C00008",
+ "http://identifiers.org/kegg.glycan/G11113",
+ "http://identifiers.org/pubchem.substance/3310",
+ "http://identifiers.org/reactome/REACT_113581",
+ "http://identifiers.org/reactome/REACT_113582",
+ "http://identifiers.org/reactome/REACT_114564",
+ "http://identifiers.org/reactome/REACT_114565",
+ "http://identifiers.org/reactome/REACT_190072",
+ "http://identifiers.org/reactome/REACT_196180",
+ "http://identifiers.org/reactome/REACT_211606",
+ "http://identifiers.org/reactome/REACT_29370",
+ "http://identifiers.org/reactome/REACT_429153",
+ "http://identifiers.org/reactome/REACT_429160",
+ "http://identifiers.org/reactome/REACT_481002",
+ "http://identifiers.org/seed.compound/cpd00008",
+ "http://identifiers.org/unipathway.compound/UPC00008"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -3,
"compartment": "c",
"formula": "C10H12N5O10P2",
- "id": "adp_c",
+ "id": "M_adp_c",
"name": "ADP"
},
{
"annotation": {
- "bigg.metabolite": "atp",
- "biocyc": "ATP",
- "cas": [
- "56-65-5"
- ],
- "chebi": [
- "CHEBI:40938",
- "CHEBI:15422",
- "CHEBI:57299",
- "CHEBI:13236",
- "CHEBI:10789",
- "CHEBI:30616",
- "CHEBI:22249",
- "CHEBI:10841",
- "CHEBI:2359"
- ],
- "hmdb": "HMDB00538",
- "kegg.compound": "C00002",
- "kegg.drug": "D08646",
- "pubchem.substance": "3304",
- "reactome": [
- "REACT_190078",
- "REACT_113592",
- "REACT_113593",
- "REACT_114570",
- "REACT_29358",
- "REACT_389573",
- "REACT_139836",
- "REACT_211579"
- ],
- "seed.compound": "cpd00002",
- "unipathway.compound": "UPC00002"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/atp",
+ "http://identifiers.org/biocyc/ATP",
+ "http://identifiers.org/cas/56-65-5",
+ "http://identifiers.org/cas/56-65-5",
+ "http://identifiers.org/chebi/CHEBI:10789",
+ "http://identifiers.org/chebi/CHEBI:10841",
+ "http://identifiers.org/chebi/CHEBI:13236",
+ "http://identifiers.org/chebi/CHEBI:15422",
+ "http://identifiers.org/chebi/CHEBI:22249",
+ "http://identifiers.org/chebi/CHEBI:2359",
+ "http://identifiers.org/chebi/CHEBI:30616",
+ "http://identifiers.org/chebi/CHEBI:40938",
+ "http://identifiers.org/chebi/CHEBI:57299",
+ "http://identifiers.org/hmdb/HMDB00538",
+ "http://identifiers.org/kegg.compound/C00002",
+ "http://identifiers.org/kegg.drug/D08646",
+ "http://identifiers.org/pubchem.substance/3304",
+ "http://identifiers.org/reactome/REACT_113592",
+ "http://identifiers.org/reactome/REACT_113593",
+ "http://identifiers.org/reactome/REACT_114570",
+ "http://identifiers.org/reactome/REACT_139836",
+ "http://identifiers.org/reactome/REACT_190078",
+ "http://identifiers.org/reactome/REACT_211579",
+ "http://identifiers.org/reactome/REACT_29358",
+ "http://identifiers.org/reactome/REACT_389573",
+ "http://identifiers.org/seed.compound/cpd00002",
+ "http://identifiers.org/unipathway.compound/UPC00002"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -4,
"compartment": "c",
"formula": "C10H12N5O13P3",
- "id": "atp_c",
+ "id": "M_atp_c",
"name": "ATP"
},
{
"annotation": {
- "bigg.metabolite": "dhap",
- "biocyc": "DIHYDROXY-ACETONE-PHOSPHATE",
- "cas": [
- "57-04-5"
- ],
- "chebi": [
- "CHEBI:14341",
- "CHEBI:57642",
- "CHEBI:14342",
- "CHEBI:16108",
- "CHEBI:5454",
- "CHEBI:24355",
- "CHEBI:39571"
- ],
- "hmdb": [
- "HMDB01473",
- "HMDB11735"
- ],
- "kegg.compound": "C00111",
- "pubchem.substance": "3411",
- "reactome": [
- "REACT_188451",
- "REACT_75970",
- "REACT_390404"
- ],
- "seed.compound": "cpd00095",
- "unipathway.compound": "UPC00111"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/dhap",
+ "http://identifiers.org/biocyc/DIHYDROXY-ACETONE-PHOSPHATE",
+ "http://identifiers.org/cas/57-04-5",
+ "http://identifiers.org/cas/57-04-5",
+ "http://identifiers.org/chebi/CHEBI:14341",
+ "http://identifiers.org/chebi/CHEBI:14342",
+ "http://identifiers.org/chebi/CHEBI:16108",
+ "http://identifiers.org/chebi/CHEBI:24355",
+ "http://identifiers.org/chebi/CHEBI:39571",
+ "http://identifiers.org/chebi/CHEBI:5454",
+ "http://identifiers.org/chebi/CHEBI:57642",
+ "http://identifiers.org/hmdb/HMDB01473",
+ "http://identifiers.org/hmdb/HMDB11735",
+ "http://identifiers.org/kegg.compound/C00111",
+ "http://identifiers.org/pubchem.substance/3411",
+ "http://identifiers.org/reactome/REACT_188451",
+ "http://identifiers.org/reactome/REACT_390404",
+ "http://identifiers.org/reactome/REACT_75970",
+ "http://identifiers.org/seed.compound/cpd00095",
+ "http://identifiers.org/unipathway.compound/UPC00111"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -2,
"compartment": "c",
"formula": "C3H5O6P",
- "id": "dhap_c",
+ "id": "M_dhap_c",
"name": "Dihydroxyacetone phosphate"
},
{
"annotation": {
- "bigg.metabolite": "f6p",
- "biocyc": "FRUCTOSE-6P",
- "cas": [
- "643-13-0"
- ],
- "chebi": [
- "CHEBI:57634",
- "CHEBI:12352",
- "CHEBI:45804",
- "CHEBI:61527",
- "CHEBI:61553",
- "CHEBI:10375",
- "CHEBI:16084",
- "CHEBI:42378",
- "CHEBI:22768"
- ],
- "hmdb": "HMDB03971",
- "kegg.compound": [
- "C05345",
- "C00085"
- ],
- "pubchem.substance": "3385",
- "seed.compound": "cpd00072",
- "unipathway.compound": [
- "UPC05345",
- "UPC00085"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/f6p",
+ "http://identifiers.org/biocyc/FRUCTOSE-6P",
+ "http://identifiers.org/cas/643-13-0",
+ "http://identifiers.org/cas/643-13-0",
+ "http://identifiers.org/chebi/CHEBI:10375",
+ "http://identifiers.org/chebi/CHEBI:12352",
+ "http://identifiers.org/chebi/CHEBI:16084",
+ "http://identifiers.org/chebi/CHEBI:22768",
+ "http://identifiers.org/chebi/CHEBI:42378",
+ "http://identifiers.org/chebi/CHEBI:45804",
+ "http://identifiers.org/chebi/CHEBI:57634",
+ "http://identifiers.org/chebi/CHEBI:61527",
+ "http://identifiers.org/chebi/CHEBI:61553",
+ "http://identifiers.org/hmdb/HMDB03971",
+ "http://identifiers.org/kegg.compound/C00085",
+ "http://identifiers.org/kegg.compound/C05345",
+ "http://identifiers.org/pubchem.substance/3385",
+ "http://identifiers.org/seed.compound/cpd00072",
+ "http://identifiers.org/unipathway.compound/UPC00085",
+ "http://identifiers.org/unipathway.compound/UPC05345"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
]
},
"charge": -2,
"compartment": "c",
"formula": "C6H11O9P",
- "id": "f6p_c",
+ "id": "M_f6p_c",
"name": "D-Fructose 6-phosphate"
},
{
"annotation": {
- "bigg.metabolite": "fdp",
- "biocyc": "FRUCTOSE-16-DIPHOSPHATE",
- "cas": [
- "488-69-7"
- ],
- "chebi": [
- "CHEBI:32968",
- "CHEBI:49299",
- "CHEBI:42553",
- "CHEBI:32966",
- "CHEBI:37736",
- "CHEBI:28013",
- "CHEBI:32967",
- "CHEBI:41014",
- "CHEBI:22767",
- "CHEBI:10374",
- "CHEBI:40595",
- "CHEBI:40591"
- ],
- "kegg.compound": [
- "C05378",
- "C00354"
- ],
- "pubchem.substance": "3647",
- "seed.compound": "cpd00290",
- "unipathway.compound": "UPC00354"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/fdp",
+ "http://identifiers.org/biocyc/FRUCTOSE-16-DIPHOSPHATE",
+ "http://identifiers.org/cas/488-69-7",
+ "http://identifiers.org/cas/488-69-7",
+ "http://identifiers.org/chebi/CHEBI:10374",
+ "http://identifiers.org/chebi/CHEBI:22767",
+ "http://identifiers.org/chebi/CHEBI:28013",
+ "http://identifiers.org/chebi/CHEBI:32966",
+ "http://identifiers.org/chebi/CHEBI:32967",
+ "http://identifiers.org/chebi/CHEBI:32968",
+ "http://identifiers.org/chebi/CHEBI:37736",
+ "http://identifiers.org/chebi/CHEBI:40591",
+ "http://identifiers.org/chebi/CHEBI:40595",
+ "http://identifiers.org/chebi/CHEBI:41014",
+ "http://identifiers.org/chebi/CHEBI:42553",
+ "http://identifiers.org/chebi/CHEBI:49299",
+ "http://identifiers.org/kegg.compound/C00354",
+ "http://identifiers.org/kegg.compound/C05378",
+ "http://identifiers.org/pubchem.substance/3647",
+ "http://identifiers.org/seed.compound/cpd00290",
+ "http://identifiers.org/unipathway.compound/UPC00354"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -4,
"compartment": "c",
"formula": "C6H10O12P2",
- "id": "fdp_c",
+ "id": "M_fdp_c",
"name": "D-Fructose 1,6-bisphosphate"
},
{
"annotation": {
- "bigg.metabolite": "g3p",
- "cas": [
- "142-10-9"
- ],
- "chebi": [
- "CHEBI:17138",
- "CHEBI:14333",
- "CHEBI:5446",
- "CHEBI:58027"
- ],
- "hmdb": "HMDB01112",
- "kegg.compound": [
- "C00661",
- "C00118"
- ],
- "pubchem.substance": "3930",
- "seed.compound": "cpd00102",
- "unipathway.compound": [
- "UPC00661",
- "UPC00118"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/g3p",
+ "http://identifiers.org/cas/142-10-9",
+ "http://identifiers.org/cas/142-10-9",
+ "http://identifiers.org/chebi/CHEBI:14333",
+ "http://identifiers.org/chebi/CHEBI:17138",
+ "http://identifiers.org/chebi/CHEBI:5446",
+ "http://identifiers.org/chebi/CHEBI:58027",
+ "http://identifiers.org/hmdb/HMDB01112",
+ "http://identifiers.org/kegg.compound/C00118",
+ "http://identifiers.org/kegg.compound/C00661",
+ "http://identifiers.org/pubchem.substance/3930",
+ "http://identifiers.org/seed.compound/cpd00102",
+ "http://identifiers.org/unipathway.compound/UPC00118",
+ "http://identifiers.org/unipathway.compound/UPC00661"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
]
},
"charge": -2,
"compartment": "c",
"formula": "C3H5O6P",
- "id": "g3p_c",
+ "id": "M_g3p_c",
"name": "Glyceraldehyde 3-phosphate"
},
{
"annotation": {
- "bigg.metabolite": "g6p",
- "biocyc": [
- "D-glucose-6-phosphate",
- "GLC-6-P"
- ],
- "cas": [
- "56-73-5"
- ],
- "chebi": [
- "CHEBI:10399",
- "CHEBI:22797",
- "CHEBI:41041",
- "CHEBI:17719",
- "CHEBI:4170",
- "CHEBI:61548",
- "CHEBI:58247",
- "CHEBI:12375"
- ],
- "hmdb": [
- "HMDB03498",
- "HMDB06793",
- "HMDB01401",
- "HMDB01549"
- ],
- "kegg.compound": [
- "C00092",
- "C01172"
- ],
- "pubchem.substance": "3392",
- "reactome": "REACT_1629756",
- "seed.compound": "cpd00079",
- "unipathway.compound": "UPC00092"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/g6p",
+ "http://identifiers.org/biocyc/D-glucose-6-phosphate",
+ "http://identifiers.org/biocyc/GLC-6-P",
+ "http://identifiers.org/cas/56-73-5",
+ "http://identifiers.org/cas/56-73-5",
+ "http://identifiers.org/chebi/CHEBI:10399",
+ "http://identifiers.org/chebi/CHEBI:12375",
+ "http://identifiers.org/chebi/CHEBI:17719",
+ "http://identifiers.org/chebi/CHEBI:22797",
+ "http://identifiers.org/chebi/CHEBI:41041",
+ "http://identifiers.org/chebi/CHEBI:4170",
+ "http://identifiers.org/chebi/CHEBI:58247",
+ "http://identifiers.org/chebi/CHEBI:61548",
+ "http://identifiers.org/hmdb/HMDB01401",
+ "http://identifiers.org/hmdb/HMDB01549",
+ "http://identifiers.org/hmdb/HMDB03498",
+ "http://identifiers.org/hmdb/HMDB06793",
+ "http://identifiers.org/kegg.compound/C00092",
+ "http://identifiers.org/kegg.compound/C01172",
+ "http://identifiers.org/pubchem.substance/3392",
+ "http://identifiers.org/reactome/REACT_1629756",
+ "http://identifiers.org/seed.compound/cpd00079",
+ "http://identifiers.org/unipathway.compound/UPC00092"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -2,
"compartment": "c",
"formula": "C6H11O9P",
- "id": "g6p_c",
+ "id": "M_g6p_c",
"name": "D-Glucose 6-phosphate"
},
{
"annotation": {
- "bigg.metabolite": "glc__D",
- "cas": [
- "50-99-7"
- ],
- "kegg.compound": "C00031",
- "pubchem.substance": "3333"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/glc__D",
+ "http://identifiers.org/cas/50-99-7",
+ "http://identifiers.org/cas/50-99-7",
+ "http://identifiers.org/kegg.compound/C00031",
+ "http://identifiers.org/pubchem.substance/3333"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": 0,
"compartment": "e",
"formula": "C6H12O6",
- "id": "glc__D_e",
+ "id": "M_glc__D_e",
"name": "D-Glucose"
},
{
"annotation": {
- "bigg.metabolite": "h2o",
- "biocyc": [
- "WATER",
- "OH",
- "OXONIUM"
- ],
- "cas": [
- "7732-18-5"
- ],
- "chebi": [
- "CHEBI:15377",
- "CHEBI:13365",
- "CHEBI:41979",
- "CHEBI:16234",
- "CHEBI:36385",
- "CHEBI:42857",
- "CHEBI:27313",
- "CHEBI:44819",
- "CHEBI:29373",
- "CHEBI:10743",
- "CHEBI:5594",
- "CHEBI:29356",
- "CHEBI:53442",
- "CHEBI:29375",
- "CHEBI:29374",
- "CHEBI:13419",
- "CHEBI:43228",
- "CHEBI:44292",
- "CHEBI:13352",
- "CHEBI:41981",
- "CHEBI:29412",
- "CHEBI:42043",
- "CHEBI:33811",
- "CHEBI:33813",
- "CHEBI:35511",
- "CHEBI:5585",
- "CHEBI:44641",
- "CHEBI:44701"
- ],
- "hmdb": [
- "HMDB01039",
- "HMDB02111"
- ],
- "kegg.compound": [
- "C01328",
- "C00001",
- "C18714",
- "C18712"
- ],
- "kegg.drug": [
- "D00001",
- "D06322",
- "D03703"
- ],
- "pubchem.substance": "3303",
- "reactome": [
- "REACT_947593",
- "REACT_189422",
- "REACT_141343",
- "REACT_113518",
- "REACT_1605715",
- "REACT_109276",
- "REACT_113521",
- "REACT_113519",
- "REACT_2022884",
- "REACT_351603",
- "REACT_29356"
- ],
- "seed.compound": [
- "cpd15275",
- "cpd00001"
- ],
- "unipathway.compound": [
- "UPC00001",
- "UPC01328"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h2o",
+ "http://identifiers.org/biocyc/OH",
+ "http://identifiers.org/biocyc/OXONIUM",
+ "http://identifiers.org/biocyc/WATER",
+ "http://identifiers.org/cas/7732-18-5",
+ "http://identifiers.org/cas/7732-18-5",
+ "http://identifiers.org/chebi/CHEBI:10743",
+ "http://identifiers.org/chebi/CHEBI:13352",
+ "http://identifiers.org/chebi/CHEBI:13365",
+ "http://identifiers.org/chebi/CHEBI:13419",
+ "http://identifiers.org/chebi/CHEBI:15377",
+ "http://identifiers.org/chebi/CHEBI:16234",
+ "http://identifiers.org/chebi/CHEBI:27313",
+ "http://identifiers.org/chebi/CHEBI:29356",
+ "http://identifiers.org/chebi/CHEBI:29373",
+ "http://identifiers.org/chebi/CHEBI:29374",
+ "http://identifiers.org/chebi/CHEBI:29375",
+ "http://identifiers.org/chebi/CHEBI:29412",
+ "http://identifiers.org/chebi/CHEBI:33811",
+ "http://identifiers.org/chebi/CHEBI:33813",
+ "http://identifiers.org/chebi/CHEBI:35511",
+ "http://identifiers.org/chebi/CHEBI:36385",
+ "http://identifiers.org/chebi/CHEBI:41979",
+ "http://identifiers.org/chebi/CHEBI:41981",
+ "http://identifiers.org/chebi/CHEBI:42043",
+ "http://identifiers.org/chebi/CHEBI:42857",
+ "http://identifiers.org/chebi/CHEBI:43228",
+ "http://identifiers.org/chebi/CHEBI:44292",
+ "http://identifiers.org/chebi/CHEBI:44641",
+ "http://identifiers.org/chebi/CHEBI:44701",
+ "http://identifiers.org/chebi/CHEBI:44819",
+ "http://identifiers.org/chebi/CHEBI:53442",
+ "http://identifiers.org/chebi/CHEBI:5585",
+ "http://identifiers.org/chebi/CHEBI:5594",
+ "http://identifiers.org/hmdb/HMDB01039",
+ "http://identifiers.org/hmdb/HMDB02111",
+ "http://identifiers.org/kegg.compound/C00001",
+ "http://identifiers.org/kegg.compound/C01328",
+ "http://identifiers.org/kegg.compound/C18712",
+ "http://identifiers.org/kegg.compound/C18714",
+ "http://identifiers.org/kegg.drug/D00001",
+ "http://identifiers.org/kegg.drug/D03703",
+ "http://identifiers.org/kegg.drug/D06322",
+ "http://identifiers.org/pubchem.substance/3303",
+ "http://identifiers.org/reactome/REACT_109276",
+ "http://identifiers.org/reactome/REACT_113518",
+ "http://identifiers.org/reactome/REACT_113519",
+ "http://identifiers.org/reactome/REACT_113521",
+ "http://identifiers.org/reactome/REACT_141343",
+ "http://identifiers.org/reactome/REACT_1605715",
+ "http://identifiers.org/reactome/REACT_189422",
+ "http://identifiers.org/reactome/REACT_2022884",
+ "http://identifiers.org/reactome/REACT_29356",
+ "http://identifiers.org/reactome/REACT_351603",
+ "http://identifiers.org/reactome/REACT_947593",
+ "http://identifiers.org/seed.compound/cpd00001",
+ "http://identifiers.org/seed.compound/cpd15275",
+ "http://identifiers.org/unipathway.compound/UPC00001",
+ "http://identifiers.org/unipathway.compound/UPC01328"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
]
},
"charge": 0,
"compartment": "c",
"formula": "H2O",
- "id": "h2o_c",
+ "id": "M_h2o_c",
"name": "H2O"
},
{
"annotation": {
- "bigg.metabolite": "h2o",
- "biocyc": [
- "WATER",
- "OH",
- "OXONIUM"
- ],
- "cas": [
- "7732-18-5"
- ],
- "chebi": [
- "CHEBI:15377",
- "CHEBI:13365",
- "CHEBI:41979",
- "CHEBI:16234",
- "CHEBI:36385",
- "CHEBI:42857",
- "CHEBI:27313",
- "CHEBI:44819",
- "CHEBI:29373",
- "CHEBI:10743",
- "CHEBI:5594",
- "CHEBI:29356",
- "CHEBI:53442",
- "CHEBI:29375",
- "CHEBI:29374",
- "CHEBI:13419",
- "CHEBI:43228",
- "CHEBI:44292",
- "CHEBI:13352",
- "CHEBI:41981",
- "CHEBI:29412",
- "CHEBI:42043",
- "CHEBI:33811",
- "CHEBI:33813",
- "CHEBI:35511",
- "CHEBI:5585",
- "CHEBI:44641",
- "CHEBI:44701"
- ],
- "hmdb": [
- "HMDB01039",
- "HMDB02111"
- ],
- "kegg.compound": [
- "C01328",
- "C00001",
- "C18714",
- "C18712"
- ],
- "kegg.drug": [
- "D00001",
- "D06322",
- "D03703"
- ],
- "pubchem.substance": "3303",
- "reactome": [
- "REACT_947593",
- "REACT_189422",
- "REACT_141343",
- "REACT_113518",
- "REACT_1605715",
- "REACT_109276",
- "REACT_113521",
- "REACT_113519",
- "REACT_2022884",
- "REACT_351603",
- "REACT_29356"
- ],
- "seed.compound": [
- "cpd15275",
- "cpd00001"
- ],
- "unipathway.compound": [
- "UPC00001",
- "UPC01328"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h2o",
+ "http://identifiers.org/biocyc/OH",
+ "http://identifiers.org/biocyc/OXONIUM",
+ "http://identifiers.org/biocyc/WATER",
+ "http://identifiers.org/cas/7732-18-5",
+ "http://identifiers.org/cas/7732-18-5",
+ "http://identifiers.org/chebi/CHEBI:10743",
+ "http://identifiers.org/chebi/CHEBI:13352",
+ "http://identifiers.org/chebi/CHEBI:13365",
+ "http://identifiers.org/chebi/CHEBI:13419",
+ "http://identifiers.org/chebi/CHEBI:15377",
+ "http://identifiers.org/chebi/CHEBI:16234",
+ "http://identifiers.org/chebi/CHEBI:27313",
+ "http://identifiers.org/chebi/CHEBI:29356",
+ "http://identifiers.org/chebi/CHEBI:29373",
+ "http://identifiers.org/chebi/CHEBI:29374",
+ "http://identifiers.org/chebi/CHEBI:29375",
+ "http://identifiers.org/chebi/CHEBI:29412",
+ "http://identifiers.org/chebi/CHEBI:33811",
+ "http://identifiers.org/chebi/CHEBI:33813",
+ "http://identifiers.org/chebi/CHEBI:35511",
+ "http://identifiers.org/chebi/CHEBI:36385",
+ "http://identifiers.org/chebi/CHEBI:41979",
+ "http://identifiers.org/chebi/CHEBI:41981",
+ "http://identifiers.org/chebi/CHEBI:42043",
+ "http://identifiers.org/chebi/CHEBI:42857",
+ "http://identifiers.org/chebi/CHEBI:43228",
+ "http://identifiers.org/chebi/CHEBI:44292",
+ "http://identifiers.org/chebi/CHEBI:44641",
+ "http://identifiers.org/chebi/CHEBI:44701",
+ "http://identifiers.org/chebi/CHEBI:44819",
+ "http://identifiers.org/chebi/CHEBI:53442",
+ "http://identifiers.org/chebi/CHEBI:5585",
+ "http://identifiers.org/chebi/CHEBI:5594",
+ "http://identifiers.org/hmdb/HMDB01039",
+ "http://identifiers.org/hmdb/HMDB02111",
+ "http://identifiers.org/kegg.compound/C00001",
+ "http://identifiers.org/kegg.compound/C01328",
+ "http://identifiers.org/kegg.compound/C18712",
+ "http://identifiers.org/kegg.compound/C18714",
+ "http://identifiers.org/kegg.drug/D00001",
+ "http://identifiers.org/kegg.drug/D03703",
+ "http://identifiers.org/kegg.drug/D06322",
+ "http://identifiers.org/pubchem.substance/3303",
+ "http://identifiers.org/reactome/REACT_109276",
+ "http://identifiers.org/reactome/REACT_113518",
+ "http://identifiers.org/reactome/REACT_113519",
+ "http://identifiers.org/reactome/REACT_113521",
+ "http://identifiers.org/reactome/REACT_141343",
+ "http://identifiers.org/reactome/REACT_1605715",
+ "http://identifiers.org/reactome/REACT_189422",
+ "http://identifiers.org/reactome/REACT_2022884",
+ "http://identifiers.org/reactome/REACT_29356",
+ "http://identifiers.org/reactome/REACT_351603",
+ "http://identifiers.org/reactome/REACT_947593",
+ "http://identifiers.org/seed.compound/cpd00001",
+ "http://identifiers.org/seed.compound/cpd15275",
+ "http://identifiers.org/unipathway.compound/UPC00001",
+ "http://identifiers.org/unipathway.compound/UPC01328"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
]
},
"charge": 0,
"compartment": "e",
"formula": "H2O",
- "id": "h2o_e",
+ "id": "M_h2o_e",
"name": "H2O"
},
{
"annotation": {
- "bigg.metabolite": "h",
- "biocyc": "PROTON",
- "cas": [
- "12408-02-5"
- ],
- "chebi": [
- "CHEBI:24636",
- "CHEBI:15378",
- "CHEBI:10744",
- "CHEBI:13357",
- "CHEBI:5584"
- ],
- "kegg.compound": "C00080",
- "pubchem.substance": "3380",
- "reactome": [
- "REACT_194688",
- "REACT_425978",
- "REACT_193465",
- "REACT_374900",
- "REACT_74722",
- "REACT_425999",
- "REACT_428040",
- "REACT_163953",
- "REACT_372511",
- "REACT_2000349",
- "REACT_70106",
- "REACT_1470067",
- "REACT_113529",
- "REACT_425969",
- "REACT_428548",
- "REACT_156540",
- "REACT_1614597",
- "REACT_351626",
- "REACT_427899"
- ],
- "seed.compound": "cpd00067",
- "unipathway.compound": "UPC00080"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h",
+ "http://identifiers.org/biocyc/PROTON",
+ "http://identifiers.org/cas/12408-02-5",
+ "http://identifiers.org/cas/12408-02-5",
+ "http://identifiers.org/chebi/CHEBI:10744",
+ "http://identifiers.org/chebi/CHEBI:13357",
+ "http://identifiers.org/chebi/CHEBI:15378",
+ "http://identifiers.org/chebi/CHEBI:24636",
+ "http://identifiers.org/chebi/CHEBI:5584",
+ "http://identifiers.org/kegg.compound/C00080",
+ "http://identifiers.org/pubchem.substance/3380",
+ "http://identifiers.org/reactome/REACT_113529",
+ "http://identifiers.org/reactome/REACT_1470067",
+ "http://identifiers.org/reactome/REACT_156540",
+ "http://identifiers.org/reactome/REACT_1614597",
+ "http://identifiers.org/reactome/REACT_163953",
+ "http://identifiers.org/reactome/REACT_193465",
+ "http://identifiers.org/reactome/REACT_194688",
+ "http://identifiers.org/reactome/REACT_2000349",
+ "http://identifiers.org/reactome/REACT_351626",
+ "http://identifiers.org/reactome/REACT_372511",
+ "http://identifiers.org/reactome/REACT_374900",
+ "http://identifiers.org/reactome/REACT_425969",
+ "http://identifiers.org/reactome/REACT_425978",
+ "http://identifiers.org/reactome/REACT_425999",
+ "http://identifiers.org/reactome/REACT_427899",
+ "http://identifiers.org/reactome/REACT_428040",
+ "http://identifiers.org/reactome/REACT_428548",
+ "http://identifiers.org/reactome/REACT_70106",
+ "http://identifiers.org/reactome/REACT_74722",
+ "http://identifiers.org/seed.compound/cpd00067",
+ "http://identifiers.org/unipathway.compound/UPC00080"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": 1,
"compartment": "c",
"formula": "H",
- "id": "h_c",
+ "id": "M_h_c",
"name": "H+"
},
{
"annotation": {
- "bigg.metabolite": "h",
- "biocyc": "PROTON",
- "cas": [
- "12408-02-5"
- ],
- "chebi": [
- "CHEBI:24636",
- "CHEBI:15378",
- "CHEBI:10744",
- "CHEBI:13357",
- "CHEBI:5584"
- ],
- "kegg.compound": "C00080",
- "pubchem.substance": "3380",
- "reactome": [
- "REACT_194688",
- "REACT_425978",
- "REACT_193465",
- "REACT_374900",
- "REACT_74722",
- "REACT_425999",
- "REACT_428040",
- "REACT_163953",
- "REACT_372511",
- "REACT_2000349",
- "REACT_70106",
- "REACT_1470067",
- "REACT_113529",
- "REACT_425969",
- "REACT_428548",
- "REACT_156540",
- "REACT_1614597",
- "REACT_351626",
- "REACT_427899"
- ],
- "seed.compound": "cpd00067",
- "unipathway.compound": "UPC00080"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/h",
+ "http://identifiers.org/biocyc/PROTON",
+ "http://identifiers.org/cas/12408-02-5",
+ "http://identifiers.org/cas/12408-02-5",
+ "http://identifiers.org/chebi/CHEBI:10744",
+ "http://identifiers.org/chebi/CHEBI:13357",
+ "http://identifiers.org/chebi/CHEBI:15378",
+ "http://identifiers.org/chebi/CHEBI:24636",
+ "http://identifiers.org/chebi/CHEBI:5584",
+ "http://identifiers.org/kegg.compound/C00080",
+ "http://identifiers.org/pubchem.substance/3380",
+ "http://identifiers.org/reactome/REACT_113529",
+ "http://identifiers.org/reactome/REACT_1470067",
+ "http://identifiers.org/reactome/REACT_156540",
+ "http://identifiers.org/reactome/REACT_1614597",
+ "http://identifiers.org/reactome/REACT_163953",
+ "http://identifiers.org/reactome/REACT_193465",
+ "http://identifiers.org/reactome/REACT_194688",
+ "http://identifiers.org/reactome/REACT_2000349",
+ "http://identifiers.org/reactome/REACT_351626",
+ "http://identifiers.org/reactome/REACT_372511",
+ "http://identifiers.org/reactome/REACT_374900",
+ "http://identifiers.org/reactome/REACT_425969",
+ "http://identifiers.org/reactome/REACT_425978",
+ "http://identifiers.org/reactome/REACT_425999",
+ "http://identifiers.org/reactome/REACT_427899",
+ "http://identifiers.org/reactome/REACT_428040",
+ "http://identifiers.org/reactome/REACT_428548",
+ "http://identifiers.org/reactome/REACT_70106",
+ "http://identifiers.org/reactome/REACT_74722",
+ "http://identifiers.org/seed.compound/cpd00067",
+ "http://identifiers.org/unipathway.compound/UPC00080"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": 1,
"compartment": "e",
"formula": "H",
- "id": "h_e",
+ "id": "M_h_e",
"name": "H+"
},
{
"annotation": {
- "bigg.metabolite": "lac__D",
- "biocyc": "META:D-LACTATE",
- "chebi": [
- "CHEBI:11001",
- "CHEBI:16004",
- "CHEBI:18684",
- "CHEBI:341",
- "CHEBI:42105",
- "CHEBI:42111",
- "CHEBI:43701"
- ],
- "hmdb": [
- "HMDB00171",
- "HMDB01311"
- ],
- "kegg.compound": "C00256",
- "metanetx.chemical": "MNXM285",
- "seed.compound": "cpd00221"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/lac__D",
+ "http://identifiers.org/biocyc/META:D-LACTATE",
+ "http://identifiers.org/chebi/CHEBI:11001",
+ "http://identifiers.org/chebi/CHEBI:16004",
+ "http://identifiers.org/chebi/CHEBI:18684",
+ "http://identifiers.org/chebi/CHEBI:341",
+ "http://identifiers.org/chebi/CHEBI:42105",
+ "http://identifiers.org/chebi/CHEBI:42111",
+ "http://identifiers.org/chebi/CHEBI:43701",
+ "http://identifiers.org/hmdb/HMDB00171",
+ "http://identifiers.org/hmdb/HMDB01311",
+ "http://identifiers.org/kegg.compound/C00256",
+ "http://identifiers.org/metanetx.chemical/MNXM285",
+ "http://identifiers.org/seed.compound/cpd00221"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -1,
"compartment": "c",
"formula": "C3H5O3",
- "id": "lac__D_c",
+ "id": "M_lac__D_c",
"name": "D-Lactate"
},
{
"annotation": {
- "bigg.metabolite": "lac__D",
- "biocyc": "META:D-LACTATE",
- "chebi": [
- "CHEBI:11001",
- "CHEBI:16004",
- "CHEBI:18684",
- "CHEBI:341",
- "CHEBI:42105",
- "CHEBI:42111",
- "CHEBI:43701"
- ],
- "hmdb": [
- "HMDB00171",
- "HMDB01311"
- ],
- "kegg.compound": "C00256",
- "metanetx.chemical": "MNXM285",
- "seed.compound": "cpd00221"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/lac__D",
+ "http://identifiers.org/biocyc/META:D-LACTATE",
+ "http://identifiers.org/chebi/CHEBI:11001",
+ "http://identifiers.org/chebi/CHEBI:16004",
+ "http://identifiers.org/chebi/CHEBI:18684",
+ "http://identifiers.org/chebi/CHEBI:341",
+ "http://identifiers.org/chebi/CHEBI:42105",
+ "http://identifiers.org/chebi/CHEBI:42111",
+ "http://identifiers.org/chebi/CHEBI:43701",
+ "http://identifiers.org/hmdb/HMDB00171",
+ "http://identifiers.org/hmdb/HMDB01311",
+ "http://identifiers.org/kegg.compound/C00256",
+ "http://identifiers.org/metanetx.chemical/MNXM285",
+ "http://identifiers.org/seed.compound/cpd00221"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -1,
"compartment": "e",
"formula": "C3H5O3",
- "id": "lac__D_e",
+ "id": "M_lac__D_e",
"name": "D-Lactate"
},
{
"annotation": {
- "bigg.metabolite": "nad",
- "biocyc": "NAD",
- "cas": [
- "53-84-9"
- ],
- "chebi": [
- "CHEBI:21901",
- "CHEBI:7422",
- "CHEBI:44214",
- "CHEBI:15846",
- "CHEBI:13394",
- "CHEBI:13393",
- "CHEBI:44215",
- "CHEBI:13389",
- "CHEBI:57540",
- "CHEBI:44281"
- ],
- "hmdb": "HMDB00902",
- "kegg.compound": "C00003",
- "kegg.drug": "D00002",
- "pubchem.substance": "3305",
- "reactome": [
- "REACT_192307",
- "REACT_29360",
- "REACT_427523",
- "REACT_194653",
- "REACT_113526"
- ],
- "seed.compound": "cpd00003",
- "unipathway.compound": "UPC00003"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nad",
+ "http://identifiers.org/biocyc/NAD",
+ "http://identifiers.org/cas/53-84-9",
+ "http://identifiers.org/cas/53-84-9",
+ "http://identifiers.org/chebi/CHEBI:13389",
+ "http://identifiers.org/chebi/CHEBI:13393",
+ "http://identifiers.org/chebi/CHEBI:13394",
+ "http://identifiers.org/chebi/CHEBI:15846",
+ "http://identifiers.org/chebi/CHEBI:21901",
+ "http://identifiers.org/chebi/CHEBI:44214",
+ "http://identifiers.org/chebi/CHEBI:44215",
+ "http://identifiers.org/chebi/CHEBI:44281",
+ "http://identifiers.org/chebi/CHEBI:57540",
+ "http://identifiers.org/chebi/CHEBI:7422",
+ "http://identifiers.org/hmdb/HMDB00902",
+ "http://identifiers.org/kegg.compound/C00003",
+ "http://identifiers.org/kegg.drug/D00002",
+ "http://identifiers.org/pubchem.substance/3305",
+ "http://identifiers.org/reactome/REACT_113526",
+ "http://identifiers.org/reactome/REACT_192307",
+ "http://identifiers.org/reactome/REACT_194653",
+ "http://identifiers.org/reactome/REACT_29360",
+ "http://identifiers.org/reactome/REACT_427523",
+ "http://identifiers.org/seed.compound/cpd00003",
+ "http://identifiers.org/unipathway.compound/UPC00003"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -1,
"compartment": "c",
"formula": "C21H26N7O14P2",
- "id": "nad_c",
+ "id": "M_nad_c",
"name": "Nicotinamide adenine dinucleotide"
},
{
"annotation": {
- "bigg.metabolite": "nadh",
- "biocyc": "NADH",
- "cas": [
- "58-68-4"
- ],
- "chebi": [
- "CHEBI:13395",
- "CHEBI:21902",
- "CHEBI:16908",
- "CHEBI:7423",
- "CHEBI:44216",
- "CHEBI:57945",
- "CHEBI:13396"
- ],
- "hmdb": "HMDB01487",
- "kegg.compound": "C00004",
- "pubchem.substance": "3306",
- "reactome": [
- "REACT_192305",
- "REACT_73473",
- "REACT_194697",
- "REACT_29362"
- ],
- "seed.compound": "cpd00004",
- "unipathway.compound": "UPC00004"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/nadh",
+ "http://identifiers.org/biocyc/NADH",
+ "http://identifiers.org/cas/58-68-4",
+ "http://identifiers.org/cas/58-68-4",
+ "http://identifiers.org/chebi/CHEBI:13395",
+ "http://identifiers.org/chebi/CHEBI:13396",
+ "http://identifiers.org/chebi/CHEBI:16908",
+ "http://identifiers.org/chebi/CHEBI:21902",
+ "http://identifiers.org/chebi/CHEBI:44216",
+ "http://identifiers.org/chebi/CHEBI:57945",
+ "http://identifiers.org/chebi/CHEBI:7423",
+ "http://identifiers.org/hmdb/HMDB01487",
+ "http://identifiers.org/kegg.compound/C00004",
+ "http://identifiers.org/pubchem.substance/3306",
+ "http://identifiers.org/reactome/REACT_192305",
+ "http://identifiers.org/reactome/REACT_194697",
+ "http://identifiers.org/reactome/REACT_29362",
+ "http://identifiers.org/reactome/REACT_73473",
+ "http://identifiers.org/seed.compound/cpd00004",
+ "http://identifiers.org/unipathway.compound/UPC00004"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -2,
"compartment": "c",
"formula": "C21H27N7O14P2",
- "id": "nadh_c",
+ "id": "M_nadh_c",
"name": "Nicotinamide adenine dinucleotide - reduced"
},
{
"annotation": {
- "bigg.metabolite": "pep",
- "biocyc": "PHOSPHO-ENOL-PYRUVATE",
- "cas": [
- "138-08-9"
- ],
- "chebi": [
- "CHEBI:44897",
- "CHEBI:44894",
- "CHEBI:14812",
- "CHEBI:8147",
- "CHEBI:26055",
- "CHEBI:26054",
- "CHEBI:58702",
- "CHEBI:18021"
- ],
- "hmdb": "HMDB00263",
- "kegg.compound": "C00074",
- "pubchem.substance": "3374",
- "reactome": [
- "REACT_29492",
- "REACT_372364"
- ],
- "seed.compound": "cpd00061",
- "unipathway.compound": "UPC00074"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pep",
+ "http://identifiers.org/biocyc/PHOSPHO-ENOL-PYRUVATE",
+ "http://identifiers.org/cas/138-08-9",
+ "http://identifiers.org/cas/138-08-9",
+ "http://identifiers.org/chebi/CHEBI:14812",
+ "http://identifiers.org/chebi/CHEBI:18021",
+ "http://identifiers.org/chebi/CHEBI:26054",
+ "http://identifiers.org/chebi/CHEBI:26055",
+ "http://identifiers.org/chebi/CHEBI:44894",
+ "http://identifiers.org/chebi/CHEBI:44897",
+ "http://identifiers.org/chebi/CHEBI:58702",
+ "http://identifiers.org/chebi/CHEBI:8147",
+ "http://identifiers.org/hmdb/HMDB00263",
+ "http://identifiers.org/kegg.compound/C00074",
+ "http://identifiers.org/pubchem.substance/3374",
+ "http://identifiers.org/reactome/REACT_29492",
+ "http://identifiers.org/reactome/REACT_372364",
+ "http://identifiers.org/seed.compound/cpd00061",
+ "http://identifiers.org/unipathway.compound/UPC00074"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -3,
"compartment": "c",
"formula": "C3H2O6P",
- "id": "pep_c",
+ "id": "M_pep_c",
"name": "Phosphoenolpyruvate"
},
{
"annotation": {
- "bigg.metabolite": "pi",
- "biocyc": [
- "Pi",
- "PHOSPHATE-GROUP",
- "CPD0-1421"
- ],
- "cas": [
- "14265-44-2"
- ],
- "chebi": [
- "CHEBI:37583",
- "CHEBI:7793",
- "CHEBI:37585",
- "CHEBI:34683",
- "CHEBI:14791",
- "CHEBI:34855",
- "CHEBI:29137",
- "CHEBI:29139",
- "CHEBI:63036",
- "CHEBI:26020",
- "CHEBI:39739",
- "CHEBI:32597",
- "CHEBI:32596",
- "CHEBI:43474",
- "CHEBI:63051",
- "CHEBI:43470",
- "CHEBI:9679",
- "CHEBI:35433",
- "CHEBI:4496",
- "CHEBI:45024",
- "CHEBI:18367",
- "CHEBI:26078",
- "CHEBI:39745",
- "CHEBI:24838"
- ],
- "hmdb": "HMDB02142",
- "kegg.compound": [
- "C13556",
- "C13558",
- "C00009"
- ],
- "kegg.drug": "D05467",
- "pubchem.substance": "3311",
- "reactome": [
- "REACT_947590",
- "REACT_109277",
- "REACT_113548",
- "REACT_2255331",
- "REACT_29372",
- "REACT_113550",
- "REACT_113551"
- ],
- "seed.compound": [
- "cpd09464",
- "cpd09463",
- "cpd00009"
- ],
- "unipathway.compound": "UPC00009"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pi",
+ "http://identifiers.org/biocyc/CPD0-1421",
+ "http://identifiers.org/biocyc/PHOSPHATE-GROUP",
+ "http://identifiers.org/biocyc/Pi",
+ "http://identifiers.org/cas/14265-44-2",
+ "http://identifiers.org/cas/14265-44-2",
+ "http://identifiers.org/chebi/CHEBI:14791",
+ "http://identifiers.org/chebi/CHEBI:18367",
+ "http://identifiers.org/chebi/CHEBI:24838",
+ "http://identifiers.org/chebi/CHEBI:26020",
+ "http://identifiers.org/chebi/CHEBI:26078",
+ "http://identifiers.org/chebi/CHEBI:29137",
+ "http://identifiers.org/chebi/CHEBI:29139",
+ "http://identifiers.org/chebi/CHEBI:32596",
+ "http://identifiers.org/chebi/CHEBI:32597",
+ "http://identifiers.org/chebi/CHEBI:34683",
+ "http://identifiers.org/chebi/CHEBI:34855",
+ "http://identifiers.org/chebi/CHEBI:35433",
+ "http://identifiers.org/chebi/CHEBI:37583",
+ "http://identifiers.org/chebi/CHEBI:37585",
+ "http://identifiers.org/chebi/CHEBI:39739",
+ "http://identifiers.org/chebi/CHEBI:39745",
+ "http://identifiers.org/chebi/CHEBI:43470",
+ "http://identifiers.org/chebi/CHEBI:43474",
+ "http://identifiers.org/chebi/CHEBI:4496",
+ "http://identifiers.org/chebi/CHEBI:45024",
+ "http://identifiers.org/chebi/CHEBI:63036",
+ "http://identifiers.org/chebi/CHEBI:63051",
+ "http://identifiers.org/chebi/CHEBI:7793",
+ "http://identifiers.org/chebi/CHEBI:9679",
+ "http://identifiers.org/hmdb/HMDB02142",
+ "http://identifiers.org/kegg.compound/C00009",
+ "http://identifiers.org/kegg.compound/C13556",
+ "http://identifiers.org/kegg.compound/C13558",
+ "http://identifiers.org/kegg.drug/D05467",
+ "http://identifiers.org/pubchem.substance/3311",
+ "http://identifiers.org/reactome/REACT_109277",
+ "http://identifiers.org/reactome/REACT_113548",
+ "http://identifiers.org/reactome/REACT_113550",
+ "http://identifiers.org/reactome/REACT_113551",
+ "http://identifiers.org/reactome/REACT_2255331",
+ "http://identifiers.org/reactome/REACT_29372",
+ "http://identifiers.org/reactome/REACT_947590",
+ "http://identifiers.org/seed.compound/cpd00009",
+ "http://identifiers.org/seed.compound/cpd09463",
+ "http://identifiers.org/seed.compound/cpd09464",
+ "http://identifiers.org/unipathway.compound/UPC00009"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -2,
"compartment": "c",
"formula": "HO4P",
- "id": "pi_c",
+ "id": "M_pi_c",
"name": "Phosphate"
},
{
"annotation": {
- "bigg.metabolite": "pi",
- "biocyc": [
- "Pi",
- "PHOSPHATE-GROUP",
- "CPD0-1421"
- ],
- "cas": [
- "14265-44-2"
- ],
- "chebi": [
- "CHEBI:37583",
- "CHEBI:7793",
- "CHEBI:37585",
- "CHEBI:34683",
- "CHEBI:14791",
- "CHEBI:34855",
- "CHEBI:29137",
- "CHEBI:29139",
- "CHEBI:63036",
- "CHEBI:26020",
- "CHEBI:39739",
- "CHEBI:32597",
- "CHEBI:32596",
- "CHEBI:43474",
- "CHEBI:63051",
- "CHEBI:43470",
- "CHEBI:9679",
- "CHEBI:35433",
- "CHEBI:4496",
- "CHEBI:45024",
- "CHEBI:18367",
- "CHEBI:26078",
- "CHEBI:39745",
- "CHEBI:24838"
- ],
- "hmdb": "HMDB02142",
- "kegg.compound": [
- "C13556",
- "C13558",
- "C00009"
- ],
- "kegg.drug": "D05467",
- "pubchem.substance": "3311",
- "reactome": [
- "REACT_947590",
- "REACT_109277",
- "REACT_113548",
- "REACT_2255331",
- "REACT_29372",
- "REACT_113550",
- "REACT_113551"
- ],
- "seed.compound": [
- "cpd09464",
- "cpd09463",
- "cpd00009"
- ],
- "unipathway.compound": "UPC00009"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pi",
+ "http://identifiers.org/biocyc/CPD0-1421",
+ "http://identifiers.org/biocyc/PHOSPHATE-GROUP",
+ "http://identifiers.org/biocyc/Pi",
+ "http://identifiers.org/cas/14265-44-2",
+ "http://identifiers.org/cas/14265-44-2",
+ "http://identifiers.org/chebi/CHEBI:14791",
+ "http://identifiers.org/chebi/CHEBI:18367",
+ "http://identifiers.org/chebi/CHEBI:24838",
+ "http://identifiers.org/chebi/CHEBI:26020",
+ "http://identifiers.org/chebi/CHEBI:26078",
+ "http://identifiers.org/chebi/CHEBI:29137",
+ "http://identifiers.org/chebi/CHEBI:29139",
+ "http://identifiers.org/chebi/CHEBI:32596",
+ "http://identifiers.org/chebi/CHEBI:32597",
+ "http://identifiers.org/chebi/CHEBI:34683",
+ "http://identifiers.org/chebi/CHEBI:34855",
+ "http://identifiers.org/chebi/CHEBI:35433",
+ "http://identifiers.org/chebi/CHEBI:37583",
+ "http://identifiers.org/chebi/CHEBI:37585",
+ "http://identifiers.org/chebi/CHEBI:39739",
+ "http://identifiers.org/chebi/CHEBI:39745",
+ "http://identifiers.org/chebi/CHEBI:43470",
+ "http://identifiers.org/chebi/CHEBI:43474",
+ "http://identifiers.org/chebi/CHEBI:4496",
+ "http://identifiers.org/chebi/CHEBI:45024",
+ "http://identifiers.org/chebi/CHEBI:63036",
+ "http://identifiers.org/chebi/CHEBI:63051",
+ "http://identifiers.org/chebi/CHEBI:7793",
+ "http://identifiers.org/chebi/CHEBI:9679",
+ "http://identifiers.org/hmdb/HMDB02142",
+ "http://identifiers.org/kegg.compound/C00009",
+ "http://identifiers.org/kegg.compound/C13556",
+ "http://identifiers.org/kegg.compound/C13558",
+ "http://identifiers.org/kegg.drug/D05467",
+ "http://identifiers.org/pubchem.substance/3311",
+ "http://identifiers.org/reactome/REACT_109277",
+ "http://identifiers.org/reactome/REACT_113548",
+ "http://identifiers.org/reactome/REACT_113550",
+ "http://identifiers.org/reactome/REACT_113551",
+ "http://identifiers.org/reactome/REACT_2255331",
+ "http://identifiers.org/reactome/REACT_29372",
+ "http://identifiers.org/reactome/REACT_947590",
+ "http://identifiers.org/seed.compound/cpd00009",
+ "http://identifiers.org/seed.compound/cpd09463",
+ "http://identifiers.org/seed.compound/cpd09464",
+ "http://identifiers.org/unipathway.compound/UPC00009"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -2,
"compartment": "e",
"formula": "HO4P",
- "id": "pi_e",
+ "id": "M_pi_e",
"name": "Phosphate"
},
{
"annotation": {
- "bigg.metabolite": "pyr",
- "biocyc": "PYRUVATE",
- "cas": [
- "127-17-3"
- ],
- "chebi": [
- "CHEBI:15361",
- "CHEBI:14987",
- "CHEBI:8685",
- "CHEBI:32816",
- "CHEBI:45253",
- "CHEBI:26466",
- "CHEBI:26462"
- ],
- "hmdb": "HMDB00243",
- "kegg.compound": "C00022",
- "lipidmaps": "LMFA01060077",
- "pubchem.substance": "3324",
- "reactome": [
- "REACT_113557",
- "REACT_389680",
- "REACT_29398"
- ],
- "seed.compound": "cpd00020",
- "unipathway.compound": "UPC00022"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.metabolite/pyr",
+ "http://identifiers.org/biocyc/PYRUVATE",
+ "http://identifiers.org/cas/127-17-3",
+ "http://identifiers.org/cas/127-17-3",
+ "http://identifiers.org/chebi/CHEBI:14987",
+ "http://identifiers.org/chebi/CHEBI:15361",
+ "http://identifiers.org/chebi/CHEBI:26462",
+ "http://identifiers.org/chebi/CHEBI:26466",
+ "http://identifiers.org/chebi/CHEBI:32816",
+ "http://identifiers.org/chebi/CHEBI:45253",
+ "http://identifiers.org/chebi/CHEBI:8685",
+ "http://identifiers.org/hmdb/HMDB00243",
+ "http://identifiers.org/kegg.compound/C00022",
+ "http://identifiers.org/lipidmaps/LMFA01060077",
+ "http://identifiers.org/pubchem.substance/3324",
+ "http://identifiers.org/reactome/REACT_113557",
+ "http://identifiers.org/reactome/REACT_29398",
+ "http://identifiers.org/reactome/REACT_389680",
+ "http://identifiers.org/seed.compound/cpd00020",
+ "http://identifiers.org/unipathway.compound/UPC00022"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"charge": -1,
"compartment": "c",
"formula": "C3H3O3",
- "id": "pyr_c",
+ "id": "M_pyr_c",
"name": "Pyruvate"
}
],
"reactions": [
{
"annotation": {
- "bigg.reaction": "ATPM"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ATPM"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "",
- "id": "ATPM",
+ "id": "R_ATPM",
"lower_bound": 8.39,
"metabolites": {
- "adp_c": 1.0,
- "atp_c": -1.0,
- "h2o_c": -1.0,
- "h_c": 1.0,
- "pi_c": 1.0
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_h2o_c": -1.0,
+ "M_h_c": 1.0,
+ "M_pi_c": 1.0
},
"name": "ATP maintenance requirement",
"objective_coefficient": 1.0,
@@ -1126,7 +1230,7 @@
},
{
"gene_reaction_rule": "",
- "id": "D_LACt2",
+ "id": "R_D_LACt2",
"lower_bound": -1000.0,
"metabolites": {},
"name": "",
@@ -1134,148 +1238,227 @@
},
{
"annotation": {
- "bigg.reaction": "ENO"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/ENO"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b2779",
- "id": "ENO",
+ "id": "R_ENO",
"lower_bound": -1000.0,
"metabolites": {
- "2pg_c": -1.0,
- "h2o_c": 1.0,
- "pep_c": 1.0
+ "M_2pg_c": -1.0,
+ "M_h2o_c": 1.0,
+ "M_pep_c": 1.0
},
"name": "enolase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "glc",
- "sbo": "SBO:0000627"
+ "sbo": "SBO:0000627",
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/glc"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "",
- "id": "EX_glc__D_e",
+ "id": "R_EX_glc__D_e",
"lower_bound": -10.0,
"metabolites": {
- "glc__D_e": -1.0
+ "M_glc__D_e": -1.0
},
"name": "D-Glucose exchange",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "h",
- "sbo": "SBO:0000627"
+ "sbo": "SBO:0000627",
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/h"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "",
- "id": "EX_h_e",
+ "id": "R_EX_h_e",
"lower_bound": -1000.0,
"metabolites": {
- "h_e": -1.0
+ "M_h_e": -1.0
},
"name": "H+ exchange",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "lac__D",
- "sbo": "SBO:0000627"
+ "sbo": "SBO:0000627",
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/lac__D"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "",
- "id": "EX_lac__D_e",
+ "id": "R_EX_lac__D_e",
"lower_bound": 0.0,
"metabolites": {
- "lac__D_e": -1.0
+ "M_lac__D_e": -1.0
},
"name": "D-lactate exchange",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "FBA"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/FBA"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b1773 or b2097 or b2925",
- "id": "FBA",
+ "id": "R_FBA",
"lower_bound": -1000.0,
"metabolites": {
- "dhap_c": 1.0,
- "fdp_c": -1.0,
- "g3p_c": 1.0
+ "M_dhap_c": 1.0,
+ "M_fdp_c": -1.0,
+ "M_g3p_c": 1.0
},
"name": "fructose-bisphosphate aldolase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "GAPD"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GAPD"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b1779",
- "id": "GAPD",
+ "id": "R_GAPD",
"lower_bound": -1000.0,
"metabolites": {
- "13dpg_c": 1.0,
- "g3p_c": -1.0,
- "h_c": 1.0,
- "nad_c": -1.0,
- "nadh_c": 1.0,
- "pi_c": -1.0
+ "M_13dpg_c": 1.0,
+ "M_g3p_c": -1.0,
+ "M_h_c": 1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_pi_c": -1.0
},
"name": "glyceraldehyde-3-phosphate dehydrogenase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "GLCpts"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/GLCpts"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "(b2415 and b2417 and b1101 and b2416) or (b2415 and b2417 and b1621 and b2416) or (b2415 and b1818 and b1817 and b1819 and b2416)",
- "id": "GLCpts",
+ "id": "R_GLCpts",
"lower_bound": 0.0,
"metabolites": {
- "g6p_c": 1.0,
- "glc__D_e": -1.0,
- "pep_c": -1.0,
- "pyr_c": 1.0
+ "M_g6p_c": 1.0,
+ "M_glc__D_e": -1.0,
+ "M_pep_c": -1.0,
+ "M_pyr_c": 1.0
},
"name": "D-glucose transport via PEP:Pyr PTS",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "H2Ot"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/H2Ot"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b0875 or s0001",
- "id": "H2Ot",
+ "id": "R_H2Ot",
"lower_bound": -1000.0,
"metabolites": {
- "h2o_c": 1.0,
- "h2o_e": -1.0
+ "M_h2o_c": 1.0,
+ "M_h2o_e": -1.0
},
"name": "R H2O transport via - diffusion",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "LDH_D",
- "biocyc": "META:DLACTDEHYDROGNAD-RXN",
- "ec-code": "1.1.1.28",
- "kegg.reaction": "R00704",
- "metanetx.reaction": "MNXR101037",
- "rhea": [
- "16369",
- "16370",
- "16371",
- "16372"
- ],
- "sbo": "SBO:0000375"
+ "sbo": "SBO:0000375",
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/LDH_D",
+ "http://identifiers.org/biocyc/META:DLACTDEHYDROGNAD-RXN",
+ "http://identifiers.org/ec-code/1.1.1.28",
+ "http://identifiers.org/kegg.reaction/R00704",
+ "http://identifiers.org/metanetx.reaction/MNXR101037",
+ "http://identifiers.org/rhea/16369",
+ "http://identifiers.org/rhea/16370",
+ "http://identifiers.org/rhea/16371",
+ "http://identifiers.org/rhea/16372"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b2133 or b1380",
- "id": "LDH_D",
+ "id": "R_LDH_D",
"lower_bound": -1000.0,
"metabolites": {
- "h_c": 1.0,
- "lac__D_c": -1.0,
- "nad_c": -1.0,
- "nadh_c": 1.0,
- "pyr_c": 1.0
+ "M_h_c": 1.0,
+ "M_lac__D_c": -1.0,
+ "M_nad_c": -1.0,
+ "M_nadh_c": 1.0,
+ "M_pyr_c": 1.0
},
"name": "D-lactate dehydrogenase",
"subsystem": "Pyruvate Metabolism",
@@ -1283,17 +1466,26 @@
},
{
"annotation": {
- "bigg.reaction": "PFK"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PFK"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b3916 or b1723",
- "id": "PFK",
+ "id": "R_PFK",
"lower_bound": 0.0,
"metabolites": {
- "adp_c": 1.0,
- "atp_c": -1.0,
- "f6p_c": -1.0,
- "fdp_c": 1.0,
- "h_c": 1.0
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0,
+ "M_f6p_c": -1.0,
+ "M_fdp_c": 1.0,
+ "M_h_c": 1.0
},
"name": "phosphofructokinase",
"objective_coefficient": 1.0,
@@ -1301,91 +1493,145 @@
},
{
"annotation": {
- "bigg.reaction": "PGI"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGI"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b4025",
- "id": "PGI",
+ "id": "R_PGI",
"lower_bound": -1000.0,
"metabolites": {
- "f6p_c": 1.0,
- "g6p_c": -1.0
+ "M_f6p_c": 1.0,
+ "M_g6p_c": -1.0
},
"name": "glucose-6-phosphate isomerase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "PGK"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGK"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b2926",
- "id": "PGK",
+ "id": "R_PGK",
"lower_bound": -1000.0,
"metabolites": {
- "13dpg_c": 1.0,
- "3pg_c": -1.0,
- "adp_c": 1.0,
- "atp_c": -1.0
+ "M_13dpg_c": 1.0,
+ "M_3pg_c": -1.0,
+ "M_adp_c": 1.0,
+ "M_atp_c": -1.0
},
"name": "phosphoglycerate kinase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "PGM"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PGM"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b4395 or b3612 or b0755",
- "id": "PGM",
+ "id": "R_PGM",
"lower_bound": -1000.0,
"metabolites": {
- "2pg_c": -1.0,
- "3pg_c": 1.0
+ "M_2pg_c": -1.0,
+ "M_3pg_c": 1.0
},
"name": "phosphoglycerate mutase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "PIt2r"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PIt2r"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b2987 or b3493",
- "id": "PIt2r",
+ "id": "R_PIt2r",
"lower_bound": -1000.0,
"metabolites": {
- "h_c": 1.0,
- "h_e": -1.0,
- "pi_c": 1.0,
- "pi_e": -1.0
+ "M_h_c": 1.0,
+ "M_h_e": -1.0,
+ "M_pi_c": 1.0,
+ "M_pi_e": -1.0
},
"name": "R phosphate reversible transport via - symport",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "PYK"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/PYK"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b1854 or b1676",
- "id": "PYK",
+ "id": "R_PYK",
"lower_bound": 0.0,
"metabolites": {
- "adp_c": -1.0,
- "atp_c": 1.0,
- "h_c": -1.0,
- "pep_c": -1.0,
- "pyr_c": 1.0
+ "M_adp_c": -1.0,
+ "M_atp_c": 1.0,
+ "M_h_c": -1.0,
+ "M_pep_c": -1.0,
+ "M_pyr_c": 1.0
},
"name": "pyruvate kinase",
"upper_bound": 1000.0
},
{
"annotation": {
- "bigg.reaction": "TPI"
+ "standardized": [
+ {
+ "external_resources": {
+ "resources": [
+ "http://identifiers.org/bigg.reaction/TPI"
+ ]
+ },
+ "qualifier": "bqb_is"
+ }
+ ]
},
"gene_reaction_rule": "b3919",
- "id": "TPI",
+ "id": "R_TPI",
"lower_bound": -1000.0,
"metabolites": {
- "dhap_c": -1.0,
- "g3p_c": 1.0
+ "M_dhap_c": -1.0,
+ "M_g3p_c": 1.0
},
"name": "triose-phosphate isomerase",
"upper_bound": 1000.0
diff --git a/tests/data/mini.mat b/tests/data/mini.mat
index 9f46abd4c..72b16c5a7 100644
Binary files a/tests/data/mini.mat and b/tests/data/mini.mat differ
diff --git a/tests/data/mini.pickle b/tests/data/mini.pickle
index b0e0f1f40..1f99f5941 100644
Binary files a/tests/data/mini.pickle and b/tests/data/mini.pickle differ
diff --git a/tests/data/mini.yml b/tests/data/mini.yml
index cd9a28a41..de06f0f59 100644
--- a/tests/data/mini.yml
+++ b/tests/data/mini.yml
@@ -1,1168 +1,1278 @@
!!omap
- metabolites:
- !!omap
- - id: 13dpg_c
+ - id: M_13dpg_c
- name: 3-Phospho-D-glyceroyl phosphate
- compartment: c
- charge: -4
- formula: C3H4O10P2
- annotation: !!omap
- - bigg.metabolite: 13dpg
- - biocyc: DPG
- - chebi:
- - CHEBI:16001
- - CHEBI:1658
- - CHEBI:20189
- - CHEBI:57604
- - CHEBI:11881
- - hmdb: HMDB01270
- - kegg.compound: C00236
- - pubchem.substance: '3535'
- - reactome: REACT_29800
- - seed.compound: cpd00203
- - unipathway.compound: UPC00236
- - !!omap
- - id: 2pg_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/13dpg
+ - http://identifiers.org/biocyc/DPG
+ - http://identifiers.org/chebi/CHEBI:11881
+ - http://identifiers.org/chebi/CHEBI:16001
+ - http://identifiers.org/chebi/CHEBI:1658
+ - http://identifiers.org/chebi/CHEBI:20189
+ - http://identifiers.org/chebi/CHEBI:57604
+ - http://identifiers.org/hmdb/HMDB01270
+ - http://identifiers.org/kegg.compound/C00236
+ - http://identifiers.org/pubchem.substance/3535
+ - http://identifiers.org/reactome/REACT_29800
+ - http://identifiers.org/seed.compound/cpd00203
+ - http://identifiers.org/unipathway.compound/UPC00236
+ - !!omap
+ - id: M_2pg_c
- name: D-Glycerate 2-phosphate
- compartment: c
- charge: -3
- formula: C3H4O7P
- annotation: !!omap
- - bigg.metabolite: 2pg
- - biocyc: 2-PG
- - chebi:
- - CHEBI:1267
- - CHEBI:58289
- - CHEBI:17835
- - CHEBI:21028
- - CHEBI:11651
- - CHEBI:12986
- - CHEBI:24344
- - CHEBI:39868
- - hmdb:
- - HMDB03391
- - HMDB00362
- - kegg.compound: C00631
- - pubchem.substance: '3904'
- - reactome: REACT_30485
- - seed.compound: cpd00482
- - unipathway.compound: UPC00631
- - !!omap
- - id: 3pg_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/2pg
+ - http://identifiers.org/biocyc/2-PG
+ - http://identifiers.org/chebi/CHEBI:11651
+ - http://identifiers.org/chebi/CHEBI:1267
+ - http://identifiers.org/chebi/CHEBI:12986
+ - http://identifiers.org/chebi/CHEBI:17835
+ - http://identifiers.org/chebi/CHEBI:21028
+ - http://identifiers.org/chebi/CHEBI:24344
+ - http://identifiers.org/chebi/CHEBI:39868
+ - http://identifiers.org/chebi/CHEBI:58289
+ - http://identifiers.org/hmdb/HMDB00362
+ - http://identifiers.org/hmdb/HMDB03391
+ - http://identifiers.org/kegg.compound/C00631
+ - http://identifiers.org/pubchem.substance/3904
+ - http://identifiers.org/reactome/REACT_30485
+ - http://identifiers.org/seed.compound/cpd00482
+ - http://identifiers.org/unipathway.compound/UPC00631
+ - !!omap
+ - id: M_3pg_c
- name: 3-Phospho-D-glycerate
- compartment: c
- charge: -3
- formula: C3H4O7P
- annotation: !!omap
- - bigg.metabolite: 3pg
- - biocyc: G3P
- - chebi:
- - CHEBI:40016
- - CHEBI:58272
- - CHEBI:57998
- - CHEBI:11879
- - CHEBI:1657
- - CHEBI:1659
- - CHEBI:17050
- - CHEBI:21029
- - CHEBI:11882
- - CHEBI:11880
- - CHEBI:12987
- - CHEBI:17794
- - CHEBI:24345
- - hmdb: HMDB00807
- - kegg.compound:
- - C00197
- - C00597
- - pubchem.substance: '3497'
- - reactome: REACT_29728
- - seed.compound: cpd00169
- - unipathway.compound:
- - UPC00597
- - UPC00197
- - !!omap
- - id: adp_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/3pg
+ - http://identifiers.org/biocyc/G3P
+ - http://identifiers.org/chebi/CHEBI:11879
+ - http://identifiers.org/chebi/CHEBI:11880
+ - http://identifiers.org/chebi/CHEBI:11882
+ - http://identifiers.org/chebi/CHEBI:12987
+ - http://identifiers.org/chebi/CHEBI:1657
+ - http://identifiers.org/chebi/CHEBI:1659
+ - http://identifiers.org/chebi/CHEBI:17050
+ - http://identifiers.org/chebi/CHEBI:17794
+ - http://identifiers.org/chebi/CHEBI:21029
+ - http://identifiers.org/chebi/CHEBI:24345
+ - http://identifiers.org/chebi/CHEBI:40016
+ - http://identifiers.org/chebi/CHEBI:57998
+ - http://identifiers.org/chebi/CHEBI:58272
+ - http://identifiers.org/hmdb/HMDB00807
+ - http://identifiers.org/kegg.compound/C00197
+ - http://identifiers.org/kegg.compound/C00597
+ - http://identifiers.org/pubchem.substance/3497
+ - http://identifiers.org/reactome/REACT_29728
+ - http://identifiers.org/seed.compound/cpd00169
+ - http://identifiers.org/unipathway.compound/UPC00197
+ - http://identifiers.org/unipathway.compound/UPC00597
+ - !!omap
+ - id: M_adp_c
- name: ADP
- compartment: c
- charge: -3
- formula: C10H12N5O10P2
- annotation: !!omap
- - bigg.metabolite: adp
- - biocyc:
- - ADP
- - ADP-GROUP
- - cas:
- - 58-64-0
- - chebi:
- - CHEBI:13222
- - CHEBI:16761
- - CHEBI:2342
- - CHEBI:22244
- - CHEBI:40553
- - CHEBI:456216
- - hmdb: HMDB01341
- - kegg.compound: C00008
- - kegg.glycan: G11113
- - pubchem.substance: '3310'
- - reactome:
- - REACT_190072
- - REACT_481002
- - REACT_211606
- - REACT_429160
- - REACT_29370
- - REACT_196180
- - REACT_113581
- - REACT_113582
- - REACT_114564
- - REACT_114565
- - REACT_429153
- - seed.compound: cpd00008
- - unipathway.compound: UPC00008
- - !!omap
- - id: atp_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/adp
+ - http://identifiers.org/biocyc/ADP
+ - http://identifiers.org/biocyc/ADP-GROUP
+ - http://identifiers.org/cas/58-64-0
+ - http://identifiers.org/cas/58-64-0
+ - http://identifiers.org/chebi/CHEBI:13222
+ - http://identifiers.org/chebi/CHEBI:16761
+ - http://identifiers.org/chebi/CHEBI:22244
+ - http://identifiers.org/chebi/CHEBI:2342
+ - http://identifiers.org/chebi/CHEBI:40553
+ - http://identifiers.org/chebi/CHEBI:456216
+ - http://identifiers.org/hmdb/HMDB01341
+ - http://identifiers.org/kegg.compound/C00008
+ - http://identifiers.org/kegg.glycan/G11113
+ - http://identifiers.org/pubchem.substance/3310
+ - http://identifiers.org/reactome/REACT_113581
+ - http://identifiers.org/reactome/REACT_113582
+ - http://identifiers.org/reactome/REACT_114564
+ - http://identifiers.org/reactome/REACT_114565
+ - http://identifiers.org/reactome/REACT_190072
+ - http://identifiers.org/reactome/REACT_196180
+ - http://identifiers.org/reactome/REACT_211606
+ - http://identifiers.org/reactome/REACT_29370
+ - http://identifiers.org/reactome/REACT_429153
+ - http://identifiers.org/reactome/REACT_429160
+ - http://identifiers.org/reactome/REACT_481002
+ - http://identifiers.org/seed.compound/cpd00008
+ - http://identifiers.org/unipathway.compound/UPC00008
+ - !!omap
+ - id: M_atp_c
- name: ATP
- compartment: c
- charge: -4
- formula: C10H12N5O13P3
- annotation: !!omap
- - bigg.metabolite: atp
- - biocyc: ATP
- - cas:
- - 56-65-5
- - chebi:
- - CHEBI:40938
- - CHEBI:15422
- - CHEBI:57299
- - CHEBI:13236
- - CHEBI:10789
- - CHEBI:30616
- - CHEBI:22249
- - CHEBI:10841
- - CHEBI:2359
- - hmdb: HMDB00538
- - kegg.compound: C00002
- - kegg.drug: D08646
- - pubchem.substance: '3304'
- - reactome:
- - REACT_190078
- - REACT_113592
- - REACT_113593
- - REACT_114570
- - REACT_29358
- - REACT_389573
- - REACT_139836
- - REACT_211579
- - seed.compound: cpd00002
- - unipathway.compound: UPC00002
- - !!omap
- - id: dhap_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/atp
+ - http://identifiers.org/biocyc/ATP
+ - http://identifiers.org/cas/56-65-5
+ - http://identifiers.org/cas/56-65-5
+ - http://identifiers.org/chebi/CHEBI:10789
+ - http://identifiers.org/chebi/CHEBI:10841
+ - http://identifiers.org/chebi/CHEBI:13236
+ - http://identifiers.org/chebi/CHEBI:15422
+ - http://identifiers.org/chebi/CHEBI:22249
+ - http://identifiers.org/chebi/CHEBI:2359
+ - http://identifiers.org/chebi/CHEBI:30616
+ - http://identifiers.org/chebi/CHEBI:40938
+ - http://identifiers.org/chebi/CHEBI:57299
+ - http://identifiers.org/hmdb/HMDB00538
+ - http://identifiers.org/kegg.compound/C00002
+ - http://identifiers.org/kegg.drug/D08646
+ - http://identifiers.org/pubchem.substance/3304
+ - http://identifiers.org/reactome/REACT_113592
+ - http://identifiers.org/reactome/REACT_113593
+ - http://identifiers.org/reactome/REACT_114570
+ - http://identifiers.org/reactome/REACT_139836
+ - http://identifiers.org/reactome/REACT_190078
+ - http://identifiers.org/reactome/REACT_211579
+ - http://identifiers.org/reactome/REACT_29358
+ - http://identifiers.org/reactome/REACT_389573
+ - http://identifiers.org/seed.compound/cpd00002
+ - http://identifiers.org/unipathway.compound/UPC00002
+ - !!omap
+ - id: M_dhap_c
- name: Dihydroxyacetone phosphate
- compartment: c
- charge: -2
- formula: C3H5O6P
- annotation: !!omap
- - bigg.metabolite: dhap
- - biocyc: DIHYDROXY-ACETONE-PHOSPHATE
- - cas:
- - 57-04-5
- - chebi:
- - CHEBI:14341
- - CHEBI:57642
- - CHEBI:14342
- - CHEBI:16108
- - CHEBI:5454
- - CHEBI:24355
- - CHEBI:39571
- - hmdb:
- - HMDB01473
- - HMDB11735
- - kegg.compound: C00111
- - pubchem.substance: '3411'
- - reactome:
- - REACT_188451
- - REACT_75970
- - REACT_390404
- - seed.compound: cpd00095
- - unipathway.compound: UPC00111
- - !!omap
- - id: f6p_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/dhap
+ - http://identifiers.org/biocyc/DIHYDROXY-ACETONE-PHOSPHATE
+ - http://identifiers.org/cas/57-04-5
+ - http://identifiers.org/cas/57-04-5
+ - http://identifiers.org/chebi/CHEBI:14341
+ - http://identifiers.org/chebi/CHEBI:14342
+ - http://identifiers.org/chebi/CHEBI:16108
+ - http://identifiers.org/chebi/CHEBI:24355
+ - http://identifiers.org/chebi/CHEBI:39571
+ - http://identifiers.org/chebi/CHEBI:5454
+ - http://identifiers.org/chebi/CHEBI:57642
+ - http://identifiers.org/hmdb/HMDB01473
+ - http://identifiers.org/hmdb/HMDB11735
+ - http://identifiers.org/kegg.compound/C00111
+ - http://identifiers.org/pubchem.substance/3411
+ - http://identifiers.org/reactome/REACT_188451
+ - http://identifiers.org/reactome/REACT_390404
+ - http://identifiers.org/reactome/REACT_75970
+ - http://identifiers.org/seed.compound/cpd00095
+ - http://identifiers.org/unipathway.compound/UPC00111
+ - !!omap
+ - id: M_f6p_c
- name: D-Fructose 6-phosphate
- compartment: c
- charge: -2
- formula: C6H11O9P
- annotation: !!omap
- - bigg.metabolite: f6p
- - biocyc: FRUCTOSE-6P
- - cas:
- - 643-13-0
- - chebi:
- - CHEBI:57634
- - CHEBI:12352
- - CHEBI:45804
- - CHEBI:61527
- - CHEBI:61553
- - CHEBI:10375
- - CHEBI:16084
- - CHEBI:42378
- - CHEBI:22768
- - hmdb: HMDB03971
- - kegg.compound:
- - C05345
- - C00085
- - pubchem.substance: '3385'
- - seed.compound: cpd00072
- - unipathway.compound:
- - UPC05345
- - UPC00085
- - !!omap
- - id: fdp_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/f6p
+ - http://identifiers.org/biocyc/FRUCTOSE-6P
+ - http://identifiers.org/cas/643-13-0
+ - http://identifiers.org/cas/643-13-0
+ - http://identifiers.org/chebi/CHEBI:10375
+ - http://identifiers.org/chebi/CHEBI:12352
+ - http://identifiers.org/chebi/CHEBI:16084
+ - http://identifiers.org/chebi/CHEBI:22768
+ - http://identifiers.org/chebi/CHEBI:42378
+ - http://identifiers.org/chebi/CHEBI:45804
+ - http://identifiers.org/chebi/CHEBI:57634
+ - http://identifiers.org/chebi/CHEBI:61527
+ - http://identifiers.org/chebi/CHEBI:61553
+ - http://identifiers.org/hmdb/HMDB03971
+ - http://identifiers.org/kegg.compound/C00085
+ - http://identifiers.org/kegg.compound/C05345
+ - http://identifiers.org/pubchem.substance/3385
+ - http://identifiers.org/seed.compound/cpd00072
+ - http://identifiers.org/unipathway.compound/UPC00085
+ - http://identifiers.org/unipathway.compound/UPC05345
+ - !!omap
+ - id: M_fdp_c
- name: D-Fructose 1,6-bisphosphate
- compartment: c
- charge: -4
- formula: C6H10O12P2
- annotation: !!omap
- - bigg.metabolite: fdp
- - biocyc: FRUCTOSE-16-DIPHOSPHATE
- - cas:
- - 488-69-7
- - chebi:
- - CHEBI:32968
- - CHEBI:49299
- - CHEBI:42553
- - CHEBI:32966
- - CHEBI:37736
- - CHEBI:28013
- - CHEBI:32967
- - CHEBI:41014
- - CHEBI:22767
- - CHEBI:10374
- - CHEBI:40595
- - CHEBI:40591
- - kegg.compound:
- - C05378
- - C00354
- - pubchem.substance: '3647'
- - seed.compound: cpd00290
- - unipathway.compound: UPC00354
- - !!omap
- - id: g3p_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/fdp
+ - http://identifiers.org/biocyc/FRUCTOSE-16-DIPHOSPHATE
+ - http://identifiers.org/cas/488-69-7
+ - http://identifiers.org/cas/488-69-7
+ - http://identifiers.org/chebi/CHEBI:10374
+ - http://identifiers.org/chebi/CHEBI:22767
+ - http://identifiers.org/chebi/CHEBI:28013
+ - http://identifiers.org/chebi/CHEBI:32966
+ - http://identifiers.org/chebi/CHEBI:32967
+ - http://identifiers.org/chebi/CHEBI:32968
+ - http://identifiers.org/chebi/CHEBI:37736
+ - http://identifiers.org/chebi/CHEBI:40591
+ - http://identifiers.org/chebi/CHEBI:40595
+ - http://identifiers.org/chebi/CHEBI:41014
+ - http://identifiers.org/chebi/CHEBI:42553
+ - http://identifiers.org/chebi/CHEBI:49299
+ - http://identifiers.org/kegg.compound/C00354
+ - http://identifiers.org/kegg.compound/C05378
+ - http://identifiers.org/pubchem.substance/3647
+ - http://identifiers.org/seed.compound/cpd00290
+ - http://identifiers.org/unipathway.compound/UPC00354
+ - !!omap
+ - id: M_g3p_c
- name: Glyceraldehyde 3-phosphate
- compartment: c
- charge: -2
- formula: C3H5O6P
- annotation: !!omap
- - bigg.metabolite: g3p
- - cas:
- - 142-10-9
- - chebi:
- - CHEBI:17138
- - CHEBI:14333
- - CHEBI:5446
- - CHEBI:58027
- - hmdb: HMDB01112
- - kegg.compound:
- - C00661
- - C00118
- - pubchem.substance: '3930'
- - seed.compound: cpd00102
- - unipathway.compound:
- - UPC00661
- - UPC00118
- - !!omap
- - id: g6p_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/g3p
+ - http://identifiers.org/cas/142-10-9
+ - http://identifiers.org/cas/142-10-9
+ - http://identifiers.org/chebi/CHEBI:14333
+ - http://identifiers.org/chebi/CHEBI:17138
+ - http://identifiers.org/chebi/CHEBI:5446
+ - http://identifiers.org/chebi/CHEBI:58027
+ - http://identifiers.org/hmdb/HMDB01112
+ - http://identifiers.org/kegg.compound/C00118
+ - http://identifiers.org/kegg.compound/C00661
+ - http://identifiers.org/pubchem.substance/3930
+ - http://identifiers.org/seed.compound/cpd00102
+ - http://identifiers.org/unipathway.compound/UPC00118
+ - http://identifiers.org/unipathway.compound/UPC00661
+ - !!omap
+ - id: M_g6p_c
- name: D-Glucose 6-phosphate
- compartment: c
- charge: -2
- formula: C6H11O9P
- annotation: !!omap
- - bigg.metabolite: g6p
- - biocyc:
- - D-glucose-6-phosphate
- - GLC-6-P
- - cas:
- - 56-73-5
- - chebi:
- - CHEBI:10399
- - CHEBI:22797
- - CHEBI:41041
- - CHEBI:17719
- - CHEBI:4170
- - CHEBI:61548
- - CHEBI:58247
- - CHEBI:12375
- - hmdb:
- - HMDB03498
- - HMDB06793
- - HMDB01401
- - HMDB01549
- - kegg.compound:
- - C00092
- - C01172
- - pubchem.substance: '3392'
- - reactome: REACT_1629756
- - seed.compound: cpd00079
- - unipathway.compound: UPC00092
- - !!omap
- - id: glc__D_e
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/g6p
+ - http://identifiers.org/biocyc/D-glucose-6-phosphate
+ - http://identifiers.org/biocyc/GLC-6-P
+ - http://identifiers.org/cas/56-73-5
+ - http://identifiers.org/cas/56-73-5
+ - http://identifiers.org/chebi/CHEBI:10399
+ - http://identifiers.org/chebi/CHEBI:12375
+ - http://identifiers.org/chebi/CHEBI:17719
+ - http://identifiers.org/chebi/CHEBI:22797
+ - http://identifiers.org/chebi/CHEBI:41041
+ - http://identifiers.org/chebi/CHEBI:4170
+ - http://identifiers.org/chebi/CHEBI:58247
+ - http://identifiers.org/chebi/CHEBI:61548
+ - http://identifiers.org/hmdb/HMDB01401
+ - http://identifiers.org/hmdb/HMDB01549
+ - http://identifiers.org/hmdb/HMDB03498
+ - http://identifiers.org/hmdb/HMDB06793
+ - http://identifiers.org/kegg.compound/C00092
+ - http://identifiers.org/kegg.compound/C01172
+ - http://identifiers.org/pubchem.substance/3392
+ - http://identifiers.org/reactome/REACT_1629756
+ - http://identifiers.org/seed.compound/cpd00079
+ - http://identifiers.org/unipathway.compound/UPC00092
+ - !!omap
+ - id: M_glc__D_e
- name: D-Glucose
- compartment: e
- charge: 0
- formula: C6H12O6
- annotation: !!omap
- - bigg.metabolite: glc__D
- - cas:
- - 50-99-7
- - kegg.compound: C00031
- - pubchem.substance: '3333'
- - !!omap
- - id: h2o_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/glc__D
+ - http://identifiers.org/cas/50-99-7
+ - http://identifiers.org/cas/50-99-7
+ - http://identifiers.org/kegg.compound/C00031
+ - http://identifiers.org/pubchem.substance/3333
+ - !!omap
+ - id: M_h2o_c
- name: H2O
- compartment: c
- charge: 0
- formula: H2O
- annotation: !!omap
- - bigg.metabolite: h2o
- - biocyc:
- - WATER
- - OH
- - OXONIUM
- - cas:
- - 7732-18-5
- - chebi:
- - CHEBI:15377
- - CHEBI:13365
- - CHEBI:41979
- - CHEBI:16234
- - CHEBI:36385
- - CHEBI:42857
- - CHEBI:27313
- - CHEBI:44819
- - CHEBI:29373
- - CHEBI:10743
- - CHEBI:5594
- - CHEBI:29356
- - CHEBI:53442
- - CHEBI:29375
- - CHEBI:29374
- - CHEBI:13419
- - CHEBI:43228
- - CHEBI:44292
- - CHEBI:13352
- - CHEBI:41981
- - CHEBI:29412
- - CHEBI:42043
- - CHEBI:33811
- - CHEBI:33813
- - CHEBI:35511
- - CHEBI:5585
- - CHEBI:44641
- - CHEBI:44701
- - hmdb:
- - HMDB01039
- - HMDB02111
- - kegg.compound:
- - C01328
- - C00001
- - C18714
- - C18712
- - kegg.drug:
- - D00001
- - D06322
- - D03703
- - pubchem.substance: '3303'
- - reactome:
- - REACT_947593
- - REACT_189422
- - REACT_141343
- - REACT_113518
- - REACT_1605715
- - REACT_109276
- - REACT_113521
- - REACT_113519
- - REACT_2022884
- - REACT_351603
- - REACT_29356
- - seed.compound:
- - cpd15275
- - cpd00001
- - unipathway.compound:
- - UPC00001
- - UPC01328
- - !!omap
- - id: h2o_e
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/h2o
+ - http://identifiers.org/biocyc/OH
+ - http://identifiers.org/biocyc/OXONIUM
+ - http://identifiers.org/biocyc/WATER
+ - http://identifiers.org/cas/7732-18-5
+ - http://identifiers.org/cas/7732-18-5
+ - http://identifiers.org/chebi/CHEBI:10743
+ - http://identifiers.org/chebi/CHEBI:13352
+ - http://identifiers.org/chebi/CHEBI:13365
+ - http://identifiers.org/chebi/CHEBI:13419
+ - http://identifiers.org/chebi/CHEBI:15377
+ - http://identifiers.org/chebi/CHEBI:16234
+ - http://identifiers.org/chebi/CHEBI:27313
+ - http://identifiers.org/chebi/CHEBI:29356
+ - http://identifiers.org/chebi/CHEBI:29373
+ - http://identifiers.org/chebi/CHEBI:29374
+ - http://identifiers.org/chebi/CHEBI:29375
+ - http://identifiers.org/chebi/CHEBI:29412
+ - http://identifiers.org/chebi/CHEBI:33811
+ - http://identifiers.org/chebi/CHEBI:33813
+ - http://identifiers.org/chebi/CHEBI:35511
+ - http://identifiers.org/chebi/CHEBI:36385
+ - http://identifiers.org/chebi/CHEBI:41979
+ - http://identifiers.org/chebi/CHEBI:41981
+ - http://identifiers.org/chebi/CHEBI:42043
+ - http://identifiers.org/chebi/CHEBI:42857
+ - http://identifiers.org/chebi/CHEBI:43228
+ - http://identifiers.org/chebi/CHEBI:44292
+ - http://identifiers.org/chebi/CHEBI:44641
+ - http://identifiers.org/chebi/CHEBI:44701
+ - http://identifiers.org/chebi/CHEBI:44819
+ - http://identifiers.org/chebi/CHEBI:53442
+ - http://identifiers.org/chebi/CHEBI:5585
+ - http://identifiers.org/chebi/CHEBI:5594
+ - http://identifiers.org/hmdb/HMDB01039
+ - http://identifiers.org/hmdb/HMDB02111
+ - http://identifiers.org/kegg.compound/C00001
+ - http://identifiers.org/kegg.compound/C01328
+ - http://identifiers.org/kegg.compound/C18712
+ - http://identifiers.org/kegg.compound/C18714
+ - http://identifiers.org/kegg.drug/D00001
+ - http://identifiers.org/kegg.drug/D03703
+ - http://identifiers.org/kegg.drug/D06322
+ - http://identifiers.org/pubchem.substance/3303
+ - http://identifiers.org/reactome/REACT_109276
+ - http://identifiers.org/reactome/REACT_113518
+ - http://identifiers.org/reactome/REACT_113519
+ - http://identifiers.org/reactome/REACT_113521
+ - http://identifiers.org/reactome/REACT_141343
+ - http://identifiers.org/reactome/REACT_1605715
+ - http://identifiers.org/reactome/REACT_189422
+ - http://identifiers.org/reactome/REACT_2022884
+ - http://identifiers.org/reactome/REACT_29356
+ - http://identifiers.org/reactome/REACT_351603
+ - http://identifiers.org/reactome/REACT_947593
+ - http://identifiers.org/seed.compound/cpd00001
+ - http://identifiers.org/seed.compound/cpd15275
+ - http://identifiers.org/unipathway.compound/UPC00001
+ - http://identifiers.org/unipathway.compound/UPC01328
+ - !!omap
+ - id: M_h2o_e
- name: H2O
- compartment: e
- charge: 0
- formula: H2O
- annotation: !!omap
- - bigg.metabolite: h2o
- - biocyc:
- - WATER
- - OH
- - OXONIUM
- - cas:
- - 7732-18-5
- - chebi:
- - CHEBI:15377
- - CHEBI:13365
- - CHEBI:41979
- - CHEBI:16234
- - CHEBI:36385
- - CHEBI:42857
- - CHEBI:27313
- - CHEBI:44819
- - CHEBI:29373
- - CHEBI:10743
- - CHEBI:5594
- - CHEBI:29356
- - CHEBI:53442
- - CHEBI:29375
- - CHEBI:29374
- - CHEBI:13419
- - CHEBI:43228
- - CHEBI:44292
- - CHEBI:13352
- - CHEBI:41981
- - CHEBI:29412
- - CHEBI:42043
- - CHEBI:33811
- - CHEBI:33813
- - CHEBI:35511
- - CHEBI:5585
- - CHEBI:44641
- - CHEBI:44701
- - hmdb:
- - HMDB01039
- - HMDB02111
- - kegg.compound:
- - C01328
- - C00001
- - C18714
- - C18712
- - kegg.drug:
- - D00001
- - D06322
- - D03703
- - pubchem.substance: '3303'
- - reactome:
- - REACT_947593
- - REACT_189422
- - REACT_141343
- - REACT_113518
- - REACT_1605715
- - REACT_109276
- - REACT_113521
- - REACT_113519
- - REACT_2022884
- - REACT_351603
- - REACT_29356
- - seed.compound:
- - cpd15275
- - cpd00001
- - unipathway.compound:
- - UPC00001
- - UPC01328
- - !!omap
- - id: h_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/h2o
+ - http://identifiers.org/biocyc/OH
+ - http://identifiers.org/biocyc/OXONIUM
+ - http://identifiers.org/biocyc/WATER
+ - http://identifiers.org/cas/7732-18-5
+ - http://identifiers.org/cas/7732-18-5
+ - http://identifiers.org/chebi/CHEBI:10743
+ - http://identifiers.org/chebi/CHEBI:13352
+ - http://identifiers.org/chebi/CHEBI:13365
+ - http://identifiers.org/chebi/CHEBI:13419
+ - http://identifiers.org/chebi/CHEBI:15377
+ - http://identifiers.org/chebi/CHEBI:16234
+ - http://identifiers.org/chebi/CHEBI:27313
+ - http://identifiers.org/chebi/CHEBI:29356
+ - http://identifiers.org/chebi/CHEBI:29373
+ - http://identifiers.org/chebi/CHEBI:29374
+ - http://identifiers.org/chebi/CHEBI:29375
+ - http://identifiers.org/chebi/CHEBI:29412
+ - http://identifiers.org/chebi/CHEBI:33811
+ - http://identifiers.org/chebi/CHEBI:33813
+ - http://identifiers.org/chebi/CHEBI:35511
+ - http://identifiers.org/chebi/CHEBI:36385
+ - http://identifiers.org/chebi/CHEBI:41979
+ - http://identifiers.org/chebi/CHEBI:41981
+ - http://identifiers.org/chebi/CHEBI:42043
+ - http://identifiers.org/chebi/CHEBI:42857
+ - http://identifiers.org/chebi/CHEBI:43228
+ - http://identifiers.org/chebi/CHEBI:44292
+ - http://identifiers.org/chebi/CHEBI:44641
+ - http://identifiers.org/chebi/CHEBI:44701
+ - http://identifiers.org/chebi/CHEBI:44819
+ - http://identifiers.org/chebi/CHEBI:53442
+ - http://identifiers.org/chebi/CHEBI:5585
+ - http://identifiers.org/chebi/CHEBI:5594
+ - http://identifiers.org/hmdb/HMDB01039
+ - http://identifiers.org/hmdb/HMDB02111
+ - http://identifiers.org/kegg.compound/C00001
+ - http://identifiers.org/kegg.compound/C01328
+ - http://identifiers.org/kegg.compound/C18712
+ - http://identifiers.org/kegg.compound/C18714
+ - http://identifiers.org/kegg.drug/D00001
+ - http://identifiers.org/kegg.drug/D03703
+ - http://identifiers.org/kegg.drug/D06322
+ - http://identifiers.org/pubchem.substance/3303
+ - http://identifiers.org/reactome/REACT_109276
+ - http://identifiers.org/reactome/REACT_113518
+ - http://identifiers.org/reactome/REACT_113519
+ - http://identifiers.org/reactome/REACT_113521
+ - http://identifiers.org/reactome/REACT_141343
+ - http://identifiers.org/reactome/REACT_1605715
+ - http://identifiers.org/reactome/REACT_189422
+ - http://identifiers.org/reactome/REACT_2022884
+ - http://identifiers.org/reactome/REACT_29356
+ - http://identifiers.org/reactome/REACT_351603
+ - http://identifiers.org/reactome/REACT_947593
+ - http://identifiers.org/seed.compound/cpd00001
+ - http://identifiers.org/seed.compound/cpd15275
+ - http://identifiers.org/unipathway.compound/UPC00001
+ - http://identifiers.org/unipathway.compound/UPC01328
+ - !!omap
+ - id: M_h_c
- name: H+
- compartment: c
- charge: 1
- formula: H
- annotation: !!omap
- - bigg.metabolite: h
- - biocyc: PROTON
- - cas:
- - 12408-02-5
- - chebi:
- - CHEBI:24636
- - CHEBI:15378
- - CHEBI:10744
- - CHEBI:13357
- - CHEBI:5584
- - kegg.compound: C00080
- - pubchem.substance: '3380'
- - reactome:
- - REACT_194688
- - REACT_425978
- - REACT_193465
- - REACT_374900
- - REACT_74722
- - REACT_425999
- - REACT_428040
- - REACT_163953
- - REACT_372511
- - REACT_2000349
- - REACT_70106
- - REACT_1470067
- - REACT_113529
- - REACT_425969
- - REACT_428548
- - REACT_156540
- - REACT_1614597
- - REACT_351626
- - REACT_427899
- - seed.compound: cpd00067
- - unipathway.compound: UPC00080
- - !!omap
- - id: h_e
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/h
+ - http://identifiers.org/biocyc/PROTON
+ - http://identifiers.org/cas/12408-02-5
+ - http://identifiers.org/cas/12408-02-5
+ - http://identifiers.org/chebi/CHEBI:10744
+ - http://identifiers.org/chebi/CHEBI:13357
+ - http://identifiers.org/chebi/CHEBI:15378
+ - http://identifiers.org/chebi/CHEBI:24636
+ - http://identifiers.org/chebi/CHEBI:5584
+ - http://identifiers.org/kegg.compound/C00080
+ - http://identifiers.org/pubchem.substance/3380
+ - http://identifiers.org/reactome/REACT_113529
+ - http://identifiers.org/reactome/REACT_1470067
+ - http://identifiers.org/reactome/REACT_156540
+ - http://identifiers.org/reactome/REACT_1614597
+ - http://identifiers.org/reactome/REACT_163953
+ - http://identifiers.org/reactome/REACT_193465
+ - http://identifiers.org/reactome/REACT_194688
+ - http://identifiers.org/reactome/REACT_2000349
+ - http://identifiers.org/reactome/REACT_351626
+ - http://identifiers.org/reactome/REACT_372511
+ - http://identifiers.org/reactome/REACT_374900
+ - http://identifiers.org/reactome/REACT_425969
+ - http://identifiers.org/reactome/REACT_425978
+ - http://identifiers.org/reactome/REACT_425999
+ - http://identifiers.org/reactome/REACT_427899
+ - http://identifiers.org/reactome/REACT_428040
+ - http://identifiers.org/reactome/REACT_428548
+ - http://identifiers.org/reactome/REACT_70106
+ - http://identifiers.org/reactome/REACT_74722
+ - http://identifiers.org/seed.compound/cpd00067
+ - http://identifiers.org/unipathway.compound/UPC00080
+ - !!omap
+ - id: M_h_e
- name: H+
- compartment: e
- charge: 1
- formula: H
- annotation: !!omap
- - bigg.metabolite: h
- - biocyc: PROTON
- - cas:
- - 12408-02-5
- - chebi:
- - CHEBI:24636
- - CHEBI:15378
- - CHEBI:10744
- - CHEBI:13357
- - CHEBI:5584
- - kegg.compound: C00080
- - pubchem.substance: '3380'
- - reactome:
- - REACT_194688
- - REACT_425978
- - REACT_193465
- - REACT_374900
- - REACT_74722
- - REACT_425999
- - REACT_428040
- - REACT_163953
- - REACT_372511
- - REACT_2000349
- - REACT_70106
- - REACT_1470067
- - REACT_113529
- - REACT_425969
- - REACT_428548
- - REACT_156540
- - REACT_1614597
- - REACT_351626
- - REACT_427899
- - seed.compound: cpd00067
- - unipathway.compound: UPC00080
- - !!omap
- - id: lac__D_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/h
+ - http://identifiers.org/biocyc/PROTON
+ - http://identifiers.org/cas/12408-02-5
+ - http://identifiers.org/cas/12408-02-5
+ - http://identifiers.org/chebi/CHEBI:10744
+ - http://identifiers.org/chebi/CHEBI:13357
+ - http://identifiers.org/chebi/CHEBI:15378
+ - http://identifiers.org/chebi/CHEBI:24636
+ - http://identifiers.org/chebi/CHEBI:5584
+ - http://identifiers.org/kegg.compound/C00080
+ - http://identifiers.org/pubchem.substance/3380
+ - http://identifiers.org/reactome/REACT_113529
+ - http://identifiers.org/reactome/REACT_1470067
+ - http://identifiers.org/reactome/REACT_156540
+ - http://identifiers.org/reactome/REACT_1614597
+ - http://identifiers.org/reactome/REACT_163953
+ - http://identifiers.org/reactome/REACT_193465
+ - http://identifiers.org/reactome/REACT_194688
+ - http://identifiers.org/reactome/REACT_2000349
+ - http://identifiers.org/reactome/REACT_351626
+ - http://identifiers.org/reactome/REACT_372511
+ - http://identifiers.org/reactome/REACT_374900
+ - http://identifiers.org/reactome/REACT_425969
+ - http://identifiers.org/reactome/REACT_425978
+ - http://identifiers.org/reactome/REACT_425999
+ - http://identifiers.org/reactome/REACT_427899
+ - http://identifiers.org/reactome/REACT_428040
+ - http://identifiers.org/reactome/REACT_428548
+ - http://identifiers.org/reactome/REACT_70106
+ - http://identifiers.org/reactome/REACT_74722
+ - http://identifiers.org/seed.compound/cpd00067
+ - http://identifiers.org/unipathway.compound/UPC00080
+ - !!omap
+ - id: M_lac__D_c
- name: D-Lactate
- compartment: c
- charge: -1
- formula: C3H5O3
- annotation: !!omap
- - bigg.metabolite: lac__D
- - biocyc: META:D-LACTATE
- - chebi:
- - CHEBI:11001
- - CHEBI:16004
- - CHEBI:18684
- - CHEBI:341
- - CHEBI:42105
- - CHEBI:42111
- - CHEBI:43701
- - hmdb:
- - HMDB00171
- - HMDB01311
- - kegg.compound: C00256
- - metanetx.chemical: MNXM285
- - seed.compound: cpd00221
- - !!omap
- - id: lac__D_e
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/lac__D
+ - http://identifiers.org/biocyc/META:D-LACTATE
+ - http://identifiers.org/chebi/CHEBI:11001
+ - http://identifiers.org/chebi/CHEBI:16004
+ - http://identifiers.org/chebi/CHEBI:18684
+ - http://identifiers.org/chebi/CHEBI:341
+ - http://identifiers.org/chebi/CHEBI:42105
+ - http://identifiers.org/chebi/CHEBI:42111
+ - http://identifiers.org/chebi/CHEBI:43701
+ - http://identifiers.org/hmdb/HMDB00171
+ - http://identifiers.org/hmdb/HMDB01311
+ - http://identifiers.org/kegg.compound/C00256
+ - http://identifiers.org/metanetx.chemical/MNXM285
+ - http://identifiers.org/seed.compound/cpd00221
+ - !!omap
+ - id: M_lac__D_e
- name: D-Lactate
- compartment: e
- charge: -1
- formula: C3H5O3
- annotation: !!omap
- - bigg.metabolite: lac__D
- - biocyc: META:D-LACTATE
- - chebi:
- - CHEBI:11001
- - CHEBI:16004
- - CHEBI:18684
- - CHEBI:341
- - CHEBI:42105
- - CHEBI:42111
- - CHEBI:43701
- - hmdb:
- - HMDB00171
- - HMDB01311
- - kegg.compound: C00256
- - metanetx.chemical: MNXM285
- - seed.compound: cpd00221
- - !!omap
- - id: nad_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/lac__D
+ - http://identifiers.org/biocyc/META:D-LACTATE
+ - http://identifiers.org/chebi/CHEBI:11001
+ - http://identifiers.org/chebi/CHEBI:16004
+ - http://identifiers.org/chebi/CHEBI:18684
+ - http://identifiers.org/chebi/CHEBI:341
+ - http://identifiers.org/chebi/CHEBI:42105
+ - http://identifiers.org/chebi/CHEBI:42111
+ - http://identifiers.org/chebi/CHEBI:43701
+ - http://identifiers.org/hmdb/HMDB00171
+ - http://identifiers.org/hmdb/HMDB01311
+ - http://identifiers.org/kegg.compound/C00256
+ - http://identifiers.org/metanetx.chemical/MNXM285
+ - http://identifiers.org/seed.compound/cpd00221
+ - !!omap
+ - id: M_nad_c
- name: Nicotinamide adenine dinucleotide
- compartment: c
- charge: -1
- formula: C21H26N7O14P2
- annotation: !!omap
- - bigg.metabolite: nad
- - biocyc: NAD
- - cas:
- - 53-84-9
- - chebi:
- - CHEBI:21901
- - CHEBI:7422
- - CHEBI:44214
- - CHEBI:15846
- - CHEBI:13394
- - CHEBI:13393
- - CHEBI:44215
- - CHEBI:13389
- - CHEBI:57540
- - CHEBI:44281
- - hmdb: HMDB00902
- - kegg.compound: C00003
- - kegg.drug: D00002
- - pubchem.substance: '3305'
- - reactome:
- - REACT_192307
- - REACT_29360
- - REACT_427523
- - REACT_194653
- - REACT_113526
- - seed.compound: cpd00003
- - unipathway.compound: UPC00003
- - !!omap
- - id: nadh_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/nad
+ - http://identifiers.org/biocyc/NAD
+ - http://identifiers.org/cas/53-84-9
+ - http://identifiers.org/cas/53-84-9
+ - http://identifiers.org/chebi/CHEBI:13389
+ - http://identifiers.org/chebi/CHEBI:13393
+ - http://identifiers.org/chebi/CHEBI:13394
+ - http://identifiers.org/chebi/CHEBI:15846
+ - http://identifiers.org/chebi/CHEBI:21901
+ - http://identifiers.org/chebi/CHEBI:44214
+ - http://identifiers.org/chebi/CHEBI:44215
+ - http://identifiers.org/chebi/CHEBI:44281
+ - http://identifiers.org/chebi/CHEBI:57540
+ - http://identifiers.org/chebi/CHEBI:7422
+ - http://identifiers.org/hmdb/HMDB00902
+ - http://identifiers.org/kegg.compound/C00003
+ - http://identifiers.org/kegg.drug/D00002
+ - http://identifiers.org/pubchem.substance/3305
+ - http://identifiers.org/reactome/REACT_113526
+ - http://identifiers.org/reactome/REACT_192307
+ - http://identifiers.org/reactome/REACT_194653
+ - http://identifiers.org/reactome/REACT_29360
+ - http://identifiers.org/reactome/REACT_427523
+ - http://identifiers.org/seed.compound/cpd00003
+ - http://identifiers.org/unipathway.compound/UPC00003
+ - !!omap
+ - id: M_nadh_c
- name: Nicotinamide adenine dinucleotide - reduced
- compartment: c
- charge: -2
- formula: C21H27N7O14P2
- annotation: !!omap
- - bigg.metabolite: nadh
- - biocyc: NADH
- - cas:
- - 58-68-4
- - chebi:
- - CHEBI:13395
- - CHEBI:21902
- - CHEBI:16908
- - CHEBI:7423
- - CHEBI:44216
- - CHEBI:57945
- - CHEBI:13396
- - hmdb: HMDB01487
- - kegg.compound: C00004
- - pubchem.substance: '3306'
- - reactome:
- - REACT_192305
- - REACT_73473
- - REACT_194697
- - REACT_29362
- - seed.compound: cpd00004
- - unipathway.compound: UPC00004
- - !!omap
- - id: pep_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/nadh
+ - http://identifiers.org/biocyc/NADH
+ - http://identifiers.org/cas/58-68-4
+ - http://identifiers.org/cas/58-68-4
+ - http://identifiers.org/chebi/CHEBI:13395
+ - http://identifiers.org/chebi/CHEBI:13396
+ - http://identifiers.org/chebi/CHEBI:16908
+ - http://identifiers.org/chebi/CHEBI:21902
+ - http://identifiers.org/chebi/CHEBI:44216
+ - http://identifiers.org/chebi/CHEBI:57945
+ - http://identifiers.org/chebi/CHEBI:7423
+ - http://identifiers.org/hmdb/HMDB01487
+ - http://identifiers.org/kegg.compound/C00004
+ - http://identifiers.org/pubchem.substance/3306
+ - http://identifiers.org/reactome/REACT_192305
+ - http://identifiers.org/reactome/REACT_194697
+ - http://identifiers.org/reactome/REACT_29362
+ - http://identifiers.org/reactome/REACT_73473
+ - http://identifiers.org/seed.compound/cpd00004
+ - http://identifiers.org/unipathway.compound/UPC00004
+ - !!omap
+ - id: M_pep_c
- name: Phosphoenolpyruvate
- compartment: c
- charge: -3
- formula: C3H2O6P
- annotation: !!omap
- - bigg.metabolite: pep
- - biocyc: PHOSPHO-ENOL-PYRUVATE
- - cas:
- - 138-08-9
- - chebi:
- - CHEBI:44897
- - CHEBI:44894
- - CHEBI:14812
- - CHEBI:8147
- - CHEBI:26055
- - CHEBI:26054
- - CHEBI:58702
- - CHEBI:18021
- - hmdb: HMDB00263
- - kegg.compound: C00074
- - pubchem.substance: '3374'
- - reactome:
- - REACT_29492
- - REACT_372364
- - seed.compound: cpd00061
- - unipathway.compound: UPC00074
- - !!omap
- - id: pi_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/pep
+ - http://identifiers.org/biocyc/PHOSPHO-ENOL-PYRUVATE
+ - http://identifiers.org/cas/138-08-9
+ - http://identifiers.org/cas/138-08-9
+ - http://identifiers.org/chebi/CHEBI:14812
+ - http://identifiers.org/chebi/CHEBI:18021
+ - http://identifiers.org/chebi/CHEBI:26054
+ - http://identifiers.org/chebi/CHEBI:26055
+ - http://identifiers.org/chebi/CHEBI:44894
+ - http://identifiers.org/chebi/CHEBI:44897
+ - http://identifiers.org/chebi/CHEBI:58702
+ - http://identifiers.org/chebi/CHEBI:8147
+ - http://identifiers.org/hmdb/HMDB00263
+ - http://identifiers.org/kegg.compound/C00074
+ - http://identifiers.org/pubchem.substance/3374
+ - http://identifiers.org/reactome/REACT_29492
+ - http://identifiers.org/reactome/REACT_372364
+ - http://identifiers.org/seed.compound/cpd00061
+ - http://identifiers.org/unipathway.compound/UPC00074
+ - !!omap
+ - id: M_pi_c
- name: Phosphate
- compartment: c
- charge: -2
- formula: HO4P
- annotation: !!omap
- - bigg.metabolite: pi
- - biocyc:
- - Pi
- - PHOSPHATE-GROUP
- - CPD0-1421
- - cas:
- - 14265-44-2
- - chebi:
- - CHEBI:37583
- - CHEBI:7793
- - CHEBI:37585
- - CHEBI:34683
- - CHEBI:14791
- - CHEBI:34855
- - CHEBI:29137
- - CHEBI:29139
- - CHEBI:63036
- - CHEBI:26020
- - CHEBI:39739
- - CHEBI:32597
- - CHEBI:32596
- - CHEBI:43474
- - CHEBI:63051
- - CHEBI:43470
- - CHEBI:9679
- - CHEBI:35433
- - CHEBI:4496
- - CHEBI:45024
- - CHEBI:18367
- - CHEBI:26078
- - CHEBI:39745
- - CHEBI:24838
- - hmdb: HMDB02142
- - kegg.compound:
- - C13556
- - C13558
- - C00009
- - kegg.drug: D05467
- - pubchem.substance: '3311'
- - reactome:
- - REACT_947590
- - REACT_109277
- - REACT_113548
- - REACT_2255331
- - REACT_29372
- - REACT_113550
- - REACT_113551
- - seed.compound:
- - cpd09464
- - cpd09463
- - cpd00009
- - unipathway.compound: UPC00009
- - !!omap
- - id: pi_e
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/pi
+ - http://identifiers.org/biocyc/CPD0-1421
+ - http://identifiers.org/biocyc/PHOSPHATE-GROUP
+ - http://identifiers.org/biocyc/Pi
+ - http://identifiers.org/cas/14265-44-2
+ - http://identifiers.org/cas/14265-44-2
+ - http://identifiers.org/chebi/CHEBI:14791
+ - http://identifiers.org/chebi/CHEBI:18367
+ - http://identifiers.org/chebi/CHEBI:24838
+ - http://identifiers.org/chebi/CHEBI:26020
+ - http://identifiers.org/chebi/CHEBI:26078
+ - http://identifiers.org/chebi/CHEBI:29137
+ - http://identifiers.org/chebi/CHEBI:29139
+ - http://identifiers.org/chebi/CHEBI:32596
+ - http://identifiers.org/chebi/CHEBI:32597
+ - http://identifiers.org/chebi/CHEBI:34683
+ - http://identifiers.org/chebi/CHEBI:34855
+ - http://identifiers.org/chebi/CHEBI:35433
+ - http://identifiers.org/chebi/CHEBI:37583
+ - http://identifiers.org/chebi/CHEBI:37585
+ - http://identifiers.org/chebi/CHEBI:39739
+ - http://identifiers.org/chebi/CHEBI:39745
+ - http://identifiers.org/chebi/CHEBI:43470
+ - http://identifiers.org/chebi/CHEBI:43474
+ - http://identifiers.org/chebi/CHEBI:4496
+ - http://identifiers.org/chebi/CHEBI:45024
+ - http://identifiers.org/chebi/CHEBI:63036
+ - http://identifiers.org/chebi/CHEBI:63051
+ - http://identifiers.org/chebi/CHEBI:7793
+ - http://identifiers.org/chebi/CHEBI:9679
+ - http://identifiers.org/hmdb/HMDB02142
+ - http://identifiers.org/kegg.compound/C00009
+ - http://identifiers.org/kegg.compound/C13556
+ - http://identifiers.org/kegg.compound/C13558
+ - http://identifiers.org/kegg.drug/D05467
+ - http://identifiers.org/pubchem.substance/3311
+ - http://identifiers.org/reactome/REACT_109277
+ - http://identifiers.org/reactome/REACT_113548
+ - http://identifiers.org/reactome/REACT_113550
+ - http://identifiers.org/reactome/REACT_113551
+ - http://identifiers.org/reactome/REACT_2255331
+ - http://identifiers.org/reactome/REACT_29372
+ - http://identifiers.org/reactome/REACT_947590
+ - http://identifiers.org/seed.compound/cpd00009
+ - http://identifiers.org/seed.compound/cpd09463
+ - http://identifiers.org/seed.compound/cpd09464
+ - http://identifiers.org/unipathway.compound/UPC00009
+ - !!omap
+ - id: M_pi_e
- name: Phosphate
- compartment: e
- charge: -2
- formula: HO4P
- annotation: !!omap
- - bigg.metabolite: pi
- - biocyc:
- - Pi
- - PHOSPHATE-GROUP
- - CPD0-1421
- - cas:
- - 14265-44-2
- - chebi:
- - CHEBI:37583
- - CHEBI:7793
- - CHEBI:37585
- - CHEBI:34683
- - CHEBI:14791
- - CHEBI:34855
- - CHEBI:29137
- - CHEBI:29139
- - CHEBI:63036
- - CHEBI:26020
- - CHEBI:39739
- - CHEBI:32597
- - CHEBI:32596
- - CHEBI:43474
- - CHEBI:63051
- - CHEBI:43470
- - CHEBI:9679
- - CHEBI:35433
- - CHEBI:4496
- - CHEBI:45024
- - CHEBI:18367
- - CHEBI:26078
- - CHEBI:39745
- - CHEBI:24838
- - hmdb: HMDB02142
- - kegg.compound:
- - C13556
- - C13558
- - C00009
- - kegg.drug: D05467
- - pubchem.substance: '3311'
- - reactome:
- - REACT_947590
- - REACT_109277
- - REACT_113548
- - REACT_2255331
- - REACT_29372
- - REACT_113550
- - REACT_113551
- - seed.compound:
- - cpd09464
- - cpd09463
- - cpd00009
- - unipathway.compound: UPC00009
- - !!omap
- - id: pyr_c
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/pi
+ - http://identifiers.org/biocyc/CPD0-1421
+ - http://identifiers.org/biocyc/PHOSPHATE-GROUP
+ - http://identifiers.org/biocyc/Pi
+ - http://identifiers.org/cas/14265-44-2
+ - http://identifiers.org/cas/14265-44-2
+ - http://identifiers.org/chebi/CHEBI:14791
+ - http://identifiers.org/chebi/CHEBI:18367
+ - http://identifiers.org/chebi/CHEBI:24838
+ - http://identifiers.org/chebi/CHEBI:26020
+ - http://identifiers.org/chebi/CHEBI:26078
+ - http://identifiers.org/chebi/CHEBI:29137
+ - http://identifiers.org/chebi/CHEBI:29139
+ - http://identifiers.org/chebi/CHEBI:32596
+ - http://identifiers.org/chebi/CHEBI:32597
+ - http://identifiers.org/chebi/CHEBI:34683
+ - http://identifiers.org/chebi/CHEBI:34855
+ - http://identifiers.org/chebi/CHEBI:35433
+ - http://identifiers.org/chebi/CHEBI:37583
+ - http://identifiers.org/chebi/CHEBI:37585
+ - http://identifiers.org/chebi/CHEBI:39739
+ - http://identifiers.org/chebi/CHEBI:39745
+ - http://identifiers.org/chebi/CHEBI:43470
+ - http://identifiers.org/chebi/CHEBI:43474
+ - http://identifiers.org/chebi/CHEBI:4496
+ - http://identifiers.org/chebi/CHEBI:45024
+ - http://identifiers.org/chebi/CHEBI:63036
+ - http://identifiers.org/chebi/CHEBI:63051
+ - http://identifiers.org/chebi/CHEBI:7793
+ - http://identifiers.org/chebi/CHEBI:9679
+ - http://identifiers.org/hmdb/HMDB02142
+ - http://identifiers.org/kegg.compound/C00009
+ - http://identifiers.org/kegg.compound/C13556
+ - http://identifiers.org/kegg.compound/C13558
+ - http://identifiers.org/kegg.drug/D05467
+ - http://identifiers.org/pubchem.substance/3311
+ - http://identifiers.org/reactome/REACT_109277
+ - http://identifiers.org/reactome/REACT_113548
+ - http://identifiers.org/reactome/REACT_113550
+ - http://identifiers.org/reactome/REACT_113551
+ - http://identifiers.org/reactome/REACT_2255331
+ - http://identifiers.org/reactome/REACT_29372
+ - http://identifiers.org/reactome/REACT_947590
+ - http://identifiers.org/seed.compound/cpd00009
+ - http://identifiers.org/seed.compound/cpd09463
+ - http://identifiers.org/seed.compound/cpd09464
+ - http://identifiers.org/unipathway.compound/UPC00009
+ - !!omap
+ - id: M_pyr_c
- name: Pyruvate
- compartment: c
- charge: -1
- formula: C3H3O3
- annotation: !!omap
- - bigg.metabolite: pyr
- - biocyc: PYRUVATE
- - cas:
- - 127-17-3
- - chebi:
- - CHEBI:15361
- - CHEBI:14987
- - CHEBI:8685
- - CHEBI:32816
- - CHEBI:45253
- - CHEBI:26466
- - CHEBI:26462
- - hmdb: HMDB00243
- - kegg.compound: C00022
- - lipidmaps: LMFA01060077
- - pubchem.substance: '3324'
- - reactome:
- - REACT_113557
- - REACT_389680
- - REACT_29398
- - seed.compound: cpd00020
- - unipathway.compound: UPC00022
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.metabolite/pyr
+ - http://identifiers.org/biocyc/PYRUVATE
+ - http://identifiers.org/cas/127-17-3
+ - http://identifiers.org/cas/127-17-3
+ - http://identifiers.org/chebi/CHEBI:14987
+ - http://identifiers.org/chebi/CHEBI:15361
+ - http://identifiers.org/chebi/CHEBI:26462
+ - http://identifiers.org/chebi/CHEBI:26466
+ - http://identifiers.org/chebi/CHEBI:32816
+ - http://identifiers.org/chebi/CHEBI:45253
+ - http://identifiers.org/chebi/CHEBI:8685
+ - http://identifiers.org/hmdb/HMDB00243
+ - http://identifiers.org/kegg.compound/C00022
+ - http://identifiers.org/lipidmaps/LMFA01060077
+ - http://identifiers.org/pubchem.substance/3324
+ - http://identifiers.org/reactome/REACT_113557
+ - http://identifiers.org/reactome/REACT_29398
+ - http://identifiers.org/reactome/REACT_389680
+ - http://identifiers.org/seed.compound/cpd00020
+ - http://identifiers.org/unipathway.compound/UPC00022
- reactions:
- !!omap
- - id: ATPM
+ - id: R_ATPM
- name: ATP maintenance requirement
- - metabolites: !!omap
- - adp_c: 1.0
- - atp_c: -1.0
- - h2o_c: -1.0
- - h_c: 1.0
- - pi_c: 1.0
- lower_bound: 8.39
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap
+ - M_atp_c: -1.0
+ - M_h2o_c: -1.0
+ - M_adp_c: 1.0
+ - M_h_c: 1.0
+ - M_pi_c: 1.0
- objective_coefficient: 1.0
- annotation: !!omap
- - bigg.reaction: ATPM
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/ATPM
- !!omap
- - id: D_LACt2
+ - id: R_D_LACt2
- name: ''
- - metabolites: !!omap []
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap []
- !!omap
- - id: ENO
+ - id: R_ENO
- name: enolase
- - metabolites: !!omap
- - 2pg_c: -1.0
- - h2o_c: 1.0
- - pep_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b2779
+ - metabolites: !!omap
+ - M_2pg_c: -1.0
+ - M_pep_c: 1.0
+ - M_h2o_c: 1.0
- annotation: !!omap
- - bigg.reaction: ENO
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/ENO
- !!omap
- - id: EX_glc__D_e
+ - id: R_EX_glc__D_e
- name: D-Glucose exchange
- - metabolites: !!omap
- - glc__D_e: -1.0
- lower_bound: -10.0
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap
+ - M_glc__D_e: -1.0
- annotation: !!omap
- - bigg.reaction: glc
- sbo: SBO:0000627
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/glc
- !!omap
- - id: EX_h_e
+ - id: R_EX_h_e
- name: H+ exchange
- - metabolites: !!omap
- - h_e: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap
+ - M_h_e: -1.0
- annotation: !!omap
- - bigg.reaction: h
- sbo: SBO:0000627
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/h
- !!omap
- - id: EX_lac__D_e
+ - id: R_EX_lac__D_e
- name: D-lactate exchange
- - metabolites: !!omap
- - lac__D_e: -1.0
- lower_bound: 0.0
- upper_bound: 1000.0
- gene_reaction_rule: ''
+ - metabolites: !!omap
+ - M_lac__D_e: -1.0
- annotation: !!omap
- - bigg.reaction: lac__D
- sbo: SBO:0000627
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/lac__D
- !!omap
- - id: FBA
+ - id: R_FBA
- name: fructose-bisphosphate aldolase
- - metabolites: !!omap
- - dhap_c: 1.0
- - fdp_c: -1.0
- - g3p_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b1773 or b2097 or b2925
+ - metabolites: !!omap
+ - M_fdp_c: -1.0
+ - M_dhap_c: 1.0
+ - M_g3p_c: 1.0
- annotation: !!omap
- - bigg.reaction: FBA
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/FBA
- !!omap
- - id: GAPD
+ - id: R_GAPD
- name: glyceraldehyde-3-phosphate dehydrogenase
- - metabolites: !!omap
- - 13dpg_c: 1.0
- - g3p_c: -1.0
- - h_c: 1.0
- - nad_c: -1.0
- - nadh_c: 1.0
- - pi_c: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b1779
+ - metabolites: !!omap
+ - M_nad_c: -1.0
+ - M_13dpg_c: 1.0
+ - M_nadh_c: 1.0
+ - M_g3p_c: -1.0
+ - M_pi_c: -1.0
+ - M_h_c: 1.0
- annotation: !!omap
- - bigg.reaction: GAPD
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/GAPD
- !!omap
- - id: GLCpts
+ - id: R_GLCpts
- name: D-glucose transport via PEP:Pyr PTS
- - metabolites: !!omap
- - g6p_c: 1.0
- - glc__D_e: -1.0
- - pep_c: -1.0
- - pyr_c: 1.0
- lower_bound: 0.0
- upper_bound: 1000.0
- gene_reaction_rule: (b2415 and b2417 and b1101 and b2416) or (b2415 and b2417
and b1621 and b2416) or (b2415 and b1818 and b1817 and b1819 and b2416)
+ - metabolites: !!omap
+ - M_g6p_c: 1.0
+ - M_pyr_c: 1.0
+ - M_glc__D_e: -1.0
+ - M_pep_c: -1.0
- annotation: !!omap
- - bigg.reaction: GLCpts
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/GLCpts
- !!omap
- - id: H2Ot
+ - id: R_H2Ot
- name: R H2O transport via - diffusion
- - metabolites: !!omap
- - h2o_c: 1.0
- - h2o_e: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b0875 or s0001
+ - metabolites: !!omap
+ - M_h2o_e: -1.0
+ - M_h2o_c: 1.0
- annotation: !!omap
- - bigg.reaction: H2Ot
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/H2Ot
- !!omap
- - id: LDH_D
+ - id: R_LDH_D
- name: D-lactate dehydrogenase
- - metabolites: !!omap
- - h_c: 1.0
- - lac__D_c: -1.0
- - nad_c: -1.0
- - nadh_c: 1.0
- - pyr_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b2133 or b1380
+ - metabolites: !!omap
+ - M_lac__D_c: -1.0
+ - M_nad_c: -1.0
+ - M_h_c: 1.0
+ - M_nadh_c: 1.0
+ - M_pyr_c: 1.0
- subsystem: Pyruvate Metabolism
- annotation: !!omap
- - bigg.reaction: LDH_D
- - biocyc: META:DLACTDEHYDROGNAD-RXN
- - ec-code: 1.1.1.28
- - kegg.reaction: R00704
- - metanetx.reaction: MNXR101037
- - rhea:
- - '16369'
- - '16370'
- - '16371'
- - '16372'
- sbo: SBO:0000375
- - !!omap
- - id: PFK
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/LDH_D
+ - http://identifiers.org/biocyc/META:DLACTDEHYDROGNAD-RXN
+ - http://identifiers.org/ec-code/1.1.1.28
+ - http://identifiers.org/kegg.reaction/R00704
+ - http://identifiers.org/metanetx.reaction/MNXR101037
+ - http://identifiers.org/rhea/16369
+ - http://identifiers.org/rhea/16370
+ - http://identifiers.org/rhea/16371
+ - http://identifiers.org/rhea/16372
+ - !!omap
+ - id: R_PFK
- name: phosphofructokinase
- - metabolites: !!omap
- - adp_c: 1.0
- - atp_c: -1.0
- - f6p_c: -1.0
- - fdp_c: 1.0
- - h_c: 1.0
- lower_bound: 0.0
- upper_bound: 1000.0
- gene_reaction_rule: b3916 or b1723
+ - metabolites: !!omap
+ - M_f6p_c: -1.0
+ - M_atp_c: -1.0
+ - M_adp_c: 1.0
+ - M_fdp_c: 1.0
+ - M_h_c: 1.0
- objective_coefficient: 1.0
- annotation: !!omap
- - bigg.reaction: PFK
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/PFK
- !!omap
- - id: PGI
+ - id: R_PGI
- name: glucose-6-phosphate isomerase
- - metabolites: !!omap
- - f6p_c: 1.0
- - g6p_c: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b4025
+ - metabolites: !!omap
+ - M_g6p_c: -1.0
+ - M_f6p_c: 1.0
- annotation: !!omap
- - bigg.reaction: PGI
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/PGI
- !!omap
- - id: PGK
+ - id: R_PGK
- name: phosphoglycerate kinase
- - metabolites: !!omap
- - 13dpg_c: 1.0
- - 3pg_c: -1.0
- - adp_c: 1.0
- - atp_c: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b2926
+ - metabolites: !!omap
+ - M_3pg_c: -1.0
+ - M_atp_c: -1.0
+ - M_13dpg_c: 1.0
+ - M_adp_c: 1.0
- annotation: !!omap
- - bigg.reaction: PGK
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/PGK
- !!omap
- - id: PGM
+ - id: R_PGM
- name: phosphoglycerate mutase
- - metabolites: !!omap
- - 2pg_c: -1.0
- - 3pg_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b4395 or b3612 or b0755
+ - metabolites: !!omap
+ - M_2pg_c: -1.0
+ - M_3pg_c: 1.0
- annotation: !!omap
- - bigg.reaction: PGM
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/PGM
- !!omap
- - id: PIt2r
+ - id: R_PIt2r
- name: R phosphate reversible transport via - symport
- - metabolites: !!omap
- - h_c: 1.0
- - h_e: -1.0
- - pi_c: 1.0
- - pi_e: -1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b2987 or b3493
+ - metabolites: !!omap
+ - M_pi_e: -1.0
+ - M_h_e: -1.0
+ - M_h_c: 1.0
+ - M_pi_c: 1.0
- annotation: !!omap
- - bigg.reaction: PIt2r
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/PIt2r
- !!omap
- - id: PYK
+ - id: R_PYK
- name: pyruvate kinase
- - metabolites: !!omap
- - adp_c: -1.0
- - atp_c: 1.0
- - h_c: -1.0
- - pep_c: -1.0
- - pyr_c: 1.0
- lower_bound: 0.0
- upper_bound: 1000.0
- gene_reaction_rule: b1854 or b1676
+ - metabolites: !!omap
+ - M_adp_c: -1.0
+ - M_h_c: -1.0
+ - M_pep_c: -1.0
+ - M_atp_c: 1.0
+ - M_pyr_c: 1.0
- annotation: !!omap
- - bigg.reaction: PYK
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/PYK
- !!omap
- - id: TPI
+ - id: R_TPI
- name: triose-phosphate isomerase
- - metabolites: !!omap
- - dhap_c: -1.0
- - g3p_c: 1.0
- lower_bound: -1000.0
- upper_bound: 1000.0
- gene_reaction_rule: b3919
+ - metabolites: !!omap
+ - M_dhap_c: -1.0
+ - M_g3p_c: 1.0
- annotation: !!omap
- - bigg.reaction: TPI
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/bigg.reaction/TPI
- genes:
- !!omap
- - id: b0755
+ - id: G_b0755
- name: gpmA
- !!omap
- - id: b0875
+ - id: G_b0875
- name: aqpZ
- !!omap
- - id: b1101
+ - id: G_b1101
- name: ptsG
- !!omap
- - id: b1380
+ - id: G_b1380
- name: ldhA
- !!omap
- - id: b1621
+ - id: G_b1621
- name: malX
- !!omap
- - id: b1676
+ - id: G_b1676
- name: pykF
- annotation: !!omap
- - ncbiprotein:
- - '1208453'
- - '1652654'
- - !!omap
- - id: b1723
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/ncbiprotein/1208453
+ - http://identifiers.org/ncbiprotein/1652654
+ - !!omap
+ - id: G_b1723
- name: pfkB
- !!omap
- - id: b1773
+ - id: G_b1773
- name: ydjI
- !!omap
- - id: b1779
+ - id: G_b1779
- name: gapA
- !!omap
- - id: b1817
+ - id: G_b1817
- name: manX
- !!omap
- - id: b1818
+ - id: G_b1818
- name: manY
- !!omap
- - id: b1819
+ - id: G_b1819
- name: manZ
- !!omap
- - id: b1854
+ - id: G_b1854
- name: pykA
- !!omap
- - id: b2097
+ - id: G_b2097
- name: fbaB
- !!omap
- - id: b2133
+ - id: G_b2133
- name: dld
- !!omap
- - id: b2415
+ - id: G_b2415
- name: ptsH
- !!omap
- - id: b2416
+ - id: G_b2416
- name: ptsI
- !!omap
- - id: b2417
+ - id: G_b2417
- name: crr
- !!omap
- - id: b2779
+ - id: G_b2779
- name: eno
- annotation: !!omap
- - ncbiprotein: '1653839'
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/ncbiprotein/1653839
- !!omap
- - id: b2925
+ - id: G_b2925
- name: fbaA
- !!omap
- - id: b2926
+ - id: G_b2926
- name: pgk
- annotation: !!omap
- - ncbiprotein: '1653609'
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/ncbiprotein/1653609
- !!omap
- - id: b2987
+ - id: G_b2987
- name: pitB
- !!omap
- - id: b3493
+ - id: G_b3493
- name: pitA
- !!omap
- - id: b3612
+ - id: G_b3612
- name: gpmM
- !!omap
- - id: b3916
+ - id: G_b3916
- name: pfkA
- annotation: !!omap
- - ncbiprotein:
- - '1006614'
- - '1651919'
- - !!omap
- - id: b3919
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/ncbiprotein/1006614
+ - http://identifiers.org/ncbiprotein/1651919
+ - !!omap
+ - id: G_b3919
- name: tpiA
- !!omap
- - id: b4025
+ - id: G_b4025
- name: pgi
- annotation: !!omap
- - ncbiprotein: '1653253'
+ - standardized:
+ - qualifier: bqb_is
+ external_resources:
+ resources:
+ - http://identifiers.org/ncbiprotein/1653253
- !!omap
- - id: b4395
+ - id: G_b4395
- name: ytjC
- !!omap
- - id: s0001
+ - id: G_s0001
- name: G_s0001
+- groups: []
- id: mini_textbook
- compartments: !!omap
- c: cytosol
diff --git a/tests/data/mini_cobra.xml b/tests/data/mini_cobra.xml
index bc0d31f38..fea4da98b 100644
--- a/tests/data/mini_cobra.xml
+++ b/tests/data/mini_cobra.xml
@@ -21,19 +21,19 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -46,23 +46,23 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -75,29 +75,29 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -110,33 +110,33 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -149,32 +149,32 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -187,25 +187,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -218,25 +218,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -249,26 +249,26 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -281,19 +281,19 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -306,28 +306,28 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -340,10 +340,10 @@
-
-
-
-
+
+
+
+
@@ -356,64 +356,64 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -426,64 +426,64 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -496,37 +496,37 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -539,37 +539,37 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -582,20 +582,20 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -608,20 +608,20 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -634,30 +634,30 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -670,25 +670,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -701,24 +701,24 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -731,52 +731,52 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -789,52 +789,52 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -847,25 +847,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -889,7 +889,7 @@
-
+
@@ -905,14 +905,14 @@
-
+
-
+
@@ -935,7 +935,7 @@
-
+
@@ -951,7 +951,7 @@
-
+
@@ -967,7 +967,7 @@
-
+
@@ -983,7 +983,7 @@
-
+
@@ -1010,7 +1010,7 @@
-
+
@@ -1036,7 +1036,7 @@
-
+
@@ -1080,7 +1080,7 @@
-
+
@@ -1105,15 +1105,15 @@
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
@@ -1141,7 +1141,7 @@
-
+
@@ -1169,7 +1169,7 @@
-
+
@@ -1191,7 +1191,7 @@
-
+
@@ -1215,7 +1215,7 @@
-
+
@@ -1241,7 +1241,7 @@
-
+
@@ -1268,7 +1268,7 @@
-
+
@@ -1296,7 +1296,7 @@
-
+
@@ -1322,97 +1322,97 @@
-
-
-
-
-
+
+
+
+
+
-
-
+
+
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
-
+
-
+
-
+
-
-
-
+
+
+
-
-
+
+
-
+
-
+
-
-
+
+
diff --git a/tests/data/mini_fbc2.xml b/tests/data/mini_fbc2.xml
index bc0d31f38..fea4da98b 100644
--- a/tests/data/mini_fbc2.xml
+++ b/tests/data/mini_fbc2.xml
@@ -21,19 +21,19 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -46,23 +46,23 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -75,29 +75,29 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -110,33 +110,33 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -149,32 +149,32 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -187,25 +187,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -218,25 +218,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -249,26 +249,26 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -281,19 +281,19 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -306,28 +306,28 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -340,10 +340,10 @@
-
-
-
-
+
+
+
+
@@ -356,64 +356,64 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -426,64 +426,64 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -496,37 +496,37 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -539,37 +539,37 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -582,20 +582,20 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -608,20 +608,20 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -634,30 +634,30 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -670,25 +670,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -701,24 +701,24 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -731,52 +731,52 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -789,52 +789,52 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -847,25 +847,25 @@
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -889,7 +889,7 @@
-
+
@@ -905,14 +905,14 @@
-
+
-
+
@@ -935,7 +935,7 @@
-
+
@@ -951,7 +951,7 @@
-
+
@@ -967,7 +967,7 @@
-
+
@@ -983,7 +983,7 @@
-
+
@@ -1010,7 +1010,7 @@
-
+
@@ -1036,7 +1036,7 @@
-
+
@@ -1080,7 +1080,7 @@
-
+
@@ -1105,15 +1105,15 @@
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
@@ -1141,7 +1141,7 @@
-
+
@@ -1169,7 +1169,7 @@
-
+
@@ -1191,7 +1191,7 @@
-
+
@@ -1215,7 +1215,7 @@
-
+
@@ -1241,7 +1241,7 @@
-
+
@@ -1268,7 +1268,7 @@
-
+
@@ -1296,7 +1296,7 @@
-
+
@@ -1322,97 +1322,97 @@
-
-
-
-
-
+
+
+
+
+
-
-
+
+
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
-
+
-
+
-
+
-
-
-
+
+
+
-
-
+
+
-
+
-
+
-
-
+
+
diff --git a/tests/data/mini_fbc2.xml.bz2 b/tests/data/mini_fbc2.xml.bz2
index 73cc7b9e0..ac2b19cf1 100644
Binary files a/tests/data/mini_fbc2.xml.bz2 and b/tests/data/mini_fbc2.xml.bz2 differ
diff --git a/tests/data/mini_fbc2.xml.gz b/tests/data/mini_fbc2.xml.gz
index 569cd4ffe..88ea12dad 100644
Binary files a/tests/data/mini_fbc2.xml.gz and b/tests/data/mini_fbc2.xml.gz differ
diff --git a/tests/data/mini_wrong_key_caps.mat b/tests/data/mini_wrong_key_caps.mat
index 017c0c53c..49177ea78 100644
Binary files a/tests/data/mini_wrong_key_caps.mat and b/tests/data/mini_wrong_key_caps.mat differ
diff --git a/tests/data/raven.pickle b/tests/data/raven.pickle
index 8d4b59859..1fcefc957 100644
Binary files a/tests/data/raven.pickle and b/tests/data/raven.pickle differ
diff --git a/tests/data/salmonella.pickle b/tests/data/salmonella.pickle
index 1f355d41c..224130e17 100644
Binary files a/tests/data/salmonella.pickle and b/tests/data/salmonella.pickle differ
diff --git a/tests/data/salmonella_old.pickle b/tests/data/salmonella_old.pickle
new file mode 100644
index 000000000..33b1e8f7a
Binary files /dev/null and b/tests/data/salmonella_old.pickle differ
diff --git a/tests/data/update_pickles.py b/tests/data/update_pickles.py
index 035604c7c..2681f0260 100755
--- a/tests/data/update_pickles.py
+++ b/tests/data/update_pickles.py
@@ -14,8 +14,11 @@
from json import dump as json_dump
from pickle import dump, load
+import scipy.io as scipy_io
+
import cobra
from cobra.io import (
+ create_mat_dict,
load_matlab_model,
load_model,
read_sbml_model,
@@ -37,7 +40,7 @@
dump(ecoli_model, outfile, protocol=2)
# salmonella
- salmonella = load_model("salmonella")
+ salmonella = load_model("salmonella", cache=False)
with open("salmonella.media", "rb") as infile:
salmonella.media_compositions = load(infile)
with open("salmonella.pickle", "wb") as outfile:
@@ -109,6 +112,40 @@
with open("raven.pickle", "wb") as outfile:
dump(raven, outfile, protocol=2)
+ # Make mat model with wrong fields, which needs to happen every time the mini.mat
+ # model changes, i.e. every time update_pickles.py runs.
+ mat_dict = create_mat_dict(mini)
+
+ old_new_fields = {
+ "metUniPathway": "metUNIPathway",
+ "metKEGGID": "metKeggID",
+ "metHMDBID": "methmdbid",
+ "metMetaNetXID": "metMETANETXID",
+ "metKEGGDrugID": "metKEGGDrugid",
+ "metKEGGGlycanID": "metkeggGlycanID",
+ "metBiGGID": "metBIGGID",
+ "metLIPIDMAPSID": "metLipidMapsID",
+ "metSEEDID": "metSEEDID".casefold(),
+ "metBioCycID": "metBioCYCID",
+ "metPubChemSubstance": "metPubChemSUBSTANCE",
+ "metReactomeID": "metREACTOMEid",
+ "metCasNumber": "metCASNumber".upper(),
+ "rxnECNumbers": "rxnECNumbers".upper(),
+ "rxnMetaNetXID": "rxnMetaNetXID".casefold(),
+ "rxnKEGGID": "rxnKeggID",
+ "rxnRheaID": "rxnRHEAID",
+ "rxnBioCycID": "rxnBIOCycID",
+ "rxnBiGGID": "rxnBIGGID",
+ }
+ for _old, _new in old_new_fields.items():
+ mat_dict[_new] = mat_dict.pop(_old)
+ scipy_io.savemat(
+ "mini_wrong_key_caps.mat",
+ {"mini_textbook": mat_dict},
+ appendmat=True,
+ oned_as="column",
+ )
+
# TODO:these need a reference solutions rather than circular solution checking!
# fva results
diff --git a/tests/data/valid_annotation_format.json b/tests/data/valid_annotation_format.json
index 8bbb6a38c..38be556a7 100644
--- a/tests/data/valid_annotation_format.json
+++ b/tests/data/valid_annotation_format.json
@@ -5,9 +5,9 @@
"name":"",
"compartment":"c",
"annotation": {
- "bigg.reaction": [["is", "PFK26"]],
- "kegg.reaction": [["is", "R02732"]],
- "rhea": [["is", "15656"]]
+ "bigg.reaction": ["PFK26"],
+ "kegg.reaction": ["R02732"],
+ "rhea": ["15656"]
}
}
],
diff --git a/tests/test_core/test_group.py b/tests/test_core/test_group.py
index 9768ca82f..f651bf0fa 100644
--- a/tests/test_core/test_group.py
+++ b/tests/test_core/test_group.py
@@ -1,10 +1,12 @@
"""Test functions of group via model.py."""
+from os.path import join
import pytest
from cobra import Model
from cobra.core import Group
+from cobra.io import load_json_model, read_sbml_model, save_json_model, write_sbml_model
def test_group_add_elements(model: Model) -> None:
@@ -34,3 +36,17 @@ def test_group_kind() -> None:
group.kind = "collection"
assert group.kind == "collection"
+
+
+def test_read_write_json(data_directory, tmp_path):
+ model = read_sbml_model(join(data_directory, "e_coli_core.xml"))
+ assert model.groups is not None
+ assert len(model.groups) == 10
+ assert len(model.groups[0].members) == 6
+
+ path_to_file = join(tmp_path, "group_ecoli.json")
+ save_json_model(model, path_to_file)
+ model_from_json = load_json_model(path_to_file)
+ assert model_from_json.groups is not None
+ assert len(model_from_json.groups) == 10
+ assert len(model_from_json.groups[0].members) == 6
diff --git a/tests/test_core/test_metadata/test_history.py b/tests/test_core/test_metadata/test_history.py
new file mode 100644
index 000000000..7c6f7d4d9
--- /dev/null
+++ b/tests/test_core/test_metadata/test_history.py
@@ -0,0 +1,217 @@
+import os
+from datetime import datetime, timedelta, timezone
+
+import pytest
+
+from cobra.core.metadata.history import Creator, History
+from cobra.io import read_sbml_model
+
+
+JUNE_26TH = "2020-06-26T12:34:11+00:00"
+JUNE_26TH_530 = "2020-06-26T00:34:11+05:30"
+TEST_COM = "test@test.com"
+
+
+def _read_ecoli_annotation_model(data_directory):
+ """Read model with history elements."""
+ test_xml = os.path.join(data_directory, "e_coli_core_for_annotation.xml")
+ model = read_sbml_model(test_xml)
+ return model
+
+
+def test_create_history():
+ history = History(
+ creators=[
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ organisation="HU",
+ email=TEST_COM,
+ ),
+ Creator(
+ given_name="Andreas",
+ family_name="Draeger",
+ organisation="University of Tübingen",
+ email="test2@test2.com",
+ ),
+ ],
+ created_date=JUNE_26TH_530,
+ modified_dates=[
+ JUNE_26TH,
+ JUNE_26TH_530,
+ ],
+ )
+ assert len(history.creators) == 2
+ assert history.created_date.isoformat() == JUNE_26TH_530
+ assert history.created_date == History.parse_datetime(JUNE_26TH_530)
+ assert len(history.modified_dates) == 2
+
+
+def test_history_from_ecoli_xml(data_directory):
+ model = _read_ecoli_annotation_model(data_directory)
+ history = History(
+ creators=[
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ email="koenigmx@hu-berlin.de",
+ organisation="Humboldt-University Berlin, "
+ "Institute for Theoretical Biology",
+ ),
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ email="koenigmx@hu-berlin.de",
+ ),
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ organisation="Humboldt-University Berlin, "
+ "Institute for Theoretical Biology",
+ ),
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ ),
+ ],
+ created_date="2019-03-06T14:40:55Z",
+ modified_dates=[
+ "2019-03-06T14:40:55Z",
+ "2019-03-06T14:41:55Z",
+ ],
+ )
+ assert model.annotation.history == history
+ model.annotation.history.created_date = None
+ assert model.annotation.history == History(
+ creators=[
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ email="koenigmx@hu-berlin.de",
+ organisation="Humboldt-University Berlin, "
+ "Institute for Theoretical Biology",
+ ),
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ email="koenigmx@hu-berlin.de",
+ ),
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ organisation="Humboldt-University Berlin, "
+ "Institute for Theoretical Biology",
+ ),
+ Creator(
+ given_name="Matthias",
+ family_name="Koenig",
+ ),
+ ],
+ modified_dates=[
+ "2019-03-06T14:40:55Z",
+ "2019-03-06T14:41:55Z",
+ ],
+ )
+
+
+def test_create_creator():
+ creator = Creator(
+ given_name="Matthias",
+ family_name="König",
+ organisation="HU",
+ email=TEST_COM,
+ )
+ assert creator.given_name == "Matthias"
+ assert creator.family_name == "König"
+ assert creator.organisation == "HU"
+ assert creator.email == TEST_COM
+
+ creator = Creator(
+ given_name="Matthias",
+ organisation="HU",
+ email=TEST_COM,
+ )
+ assert creator.given_name == "Matthias"
+ assert creator.family_name is None
+ assert creator.organisation == "HU"
+ assert creator.email == TEST_COM
+
+ creator = Creator(
+ **{
+ "given_name": "Matthias",
+ "family_name": "König",
+ "organisation": "HU",
+ "email": TEST_COM,
+ }
+ )
+
+ assert creator.given_name == "Matthias"
+ assert creator.family_name == "König"
+ assert creator.organisation == "HU"
+ assert creator.email == TEST_COM
+
+ creator = Creator(
+ **{
+ "given_name": "Matthias",
+ "organisation": "HU",
+ "email": TEST_COM,
+ }
+ )
+
+ assert creator.given_name == "Matthias"
+ assert creator.family_name is None
+ assert creator.organisation == "HU"
+ assert creator.email == TEST_COM
+
+ creator = Creator().from_data(
+ {
+ "given_name": "Matthias",
+ "family_name": "König",
+ "organisation": "HU",
+ "email": TEST_COM,
+ }
+ )
+
+ assert creator.given_name == "Matthias"
+ assert creator.family_name == "König"
+ assert creator.organisation == "HU"
+ assert creator.email == TEST_COM
+
+ creator = Creator().from_data(
+ {
+ "given_name": "Matthias",
+ "organisation": "HU",
+ "email": TEST_COM,
+ }
+ )
+
+ assert creator.given_name == "Matthias"
+ assert creator.family_name is None
+ assert creator.organisation == "HU"
+ assert creator.email == TEST_COM
+
+
+def test_historydatetime():
+ # valid date
+ dt_str1 = JUNE_26TH_530
+ datetime_obj = History(created_date=dt_str1)
+ assert datetime_obj.created_date.isoformat() == dt_str1
+
+ # valid date
+ datetime_obj = History(created_date=JUNE_26TH)
+ assert datetime_obj.created_date.isoformat() == JUNE_26TH
+ datetime_obj.created_date = None
+ assert datetime_obj.created_date is None
+
+ # create from python datetime
+ datetime_obj.created_date = datetime.now()
+ assert datetime_obj.created_date is not None
+
+ # incorrect format
+ with pytest.raises(ValueError):
+ datetime_obj.created_date = datetime.now(timezone(timedelta(hours=1))).strftime(
+ "%Y-%m-%dT%H:%M:%S%Z"
+ )
+
+ with pytest.raises(TypeError):
+ datetime_obj.created_date = {"date": "June 26th"}
diff --git a/tests/test_core/test_metadata/test_keyvaluepair.py b/tests/test_core/test_metadata/test_keyvaluepair.py
new file mode 100644
index 000000000..85d7cd5ba
--- /dev/null
+++ b/tests/test_core/test_metadata/test_keyvaluepair.py
@@ -0,0 +1,46 @@
+from cobra.core.metadata.custompairs import KeyValueEntry, KeyValuePairs
+
+
+def test_keyvalueentry():
+ keyvaluedict = KeyValueEntry.from_data(
+ {
+ "id": "KV_id",
+ "name": "abc_xyz",
+ "key": "keyX",
+ "value": "45",
+ "uri": "https://tinyurl.com/ybyr7b62",
+ }
+ )
+ assert isinstance(keyvaluedict, KeyValueEntry)
+ assert keyvaluedict.id == "KV_id"
+ assert keyvaluedict.name == "abc_xyz"
+ assert keyvaluedict.key == "keyX"
+ assert keyvaluedict.value == "45"
+ assert keyvaluedict.uri == "https://tinyurl.com/ybyr7b62"
+
+
+def test_keyvaluepairs():
+ entry1 = {
+ "id": "id1",
+ "name": "abc_xyz",
+ "key": "key1",
+ "value": "45",
+ "uri": "https://tinyurl.com/ybyr7b62",
+ }
+ entry2 = KeyValueEntry.from_data(
+ {
+ "id": "id2",
+ "name": "abc_xyz2",
+ "key": "key2",
+ "value": "48",
+ "uri": "https://tinyurl2.com/ybyr7b62",
+ }
+ )
+
+ kvp = KeyValuePairs(entries=[entry1, entry2])
+ print(kvp)
+ assert len(kvp) == 2
+ for key in ["key1", "key2"]:
+ print("***", key, "***")
+ assert key in kvp
+ assert kvp["key2"] == entry2
diff --git a/tests/test_core/test_metadata/test_metadata.py b/tests/test_core/test_metadata/test_metadata.py
new file mode 100644
index 000000000..99130bf21
--- /dev/null
+++ b/tests/test_core/test_metadata/test_metadata.py
@@ -0,0 +1,502 @@
+"""Tests for the metadata structures."""
+
+import json
+from pathlib import Path
+
+import pytest
+
+from cobra import Model
+from cobra.core.metadata import CVTerm, CVTermList, ExternalResources, Qualifier
+from cobra.core.species import Species
+from cobra.io import load_json_model, read_sbml_model, save_json_model, write_sbml_model
+
+PUBMED_EXAMPLE = "https://identifiers.org/pubmed/1111111"
+ECO_EXAMPLE = "https://identifiers.org/eco/ECO:0000004"
+RESOURCE_LIST = [
+ "http://identifiers.org/bigg.metabolite/13dpg",
+ "http://identifiers.org/biocyc/DPG",
+ "http://identifiers.org/chebi/CHEBI:11881",
+ "http://identifiers.org/chebi/CHEBI:16001",
+ "http://identifiers.org/chebi/CHEBI:1658",
+ "http://identifiers.org/chebi/CHEBI:20189",
+ "http://identifiers.org/chebi/CHEBI:57604",
+ "http://identifiers.org/hmdb/HMDB01270",
+ "http://identifiers.org/kegg.compound/C00236",
+ "http://identifiers.org/pubchem.substance/3535",
+ "http://identifiers.org/reactome/REACT_29800",
+ "http://identifiers.org/seed.compound/cpd00203",
+ "http://identifiers.org/unipathway.compound/UPC00236",
+]
+
+ecoli_model_annotation = [
+ {
+ "qualifier": "bqb_hasTaxon",
+ "external_resources": {"resources": ["http://identifiers.org/taxonomy/511145"]},
+ },
+ {
+ "qualifier": "bqm_is",
+ "external_resources": {
+ "resources": ["http://identifiers.org/bigg.model/e_coli_core"],
+ "nested_data": [
+ {
+ "qualifier": "bqb_isDescribedBy",
+ "external_resources": {"resources": [PUBMED_EXAMPLE]},
+ },
+ {
+ "qualifier": "bqb_isDescribedBy",
+ "external_resources": {"resources": [ECO_EXAMPLE]},
+ },
+ ],
+ },
+ },
+ {
+ "qualifier": "bqm_isDescribedBy",
+ "external_resources": {
+ "resources": ["http://identifiers.org/doi/10.1128/ecosalplus.10.2.1"]
+ },
+ },
+ {
+ "qualifier": "bqm_isDescribedBy",
+ "external_resources": {
+ "resources": ["http://identifiers.org/ncbiprotein/16128336"]
+ },
+ },
+]
+
+
+def test_annotation() -> None:
+ """Test creating an annotation manually.
+
+ This function will test the basic functionality of creating an annotation,
+ including:
+ - creating an empty annotation
+ - assigning via dictionary assingment (like the old annotation format)
+ - checking that this assigned annotation can match identifiers.org
+ - chekcing that the annotation can be transformed to CVTermsList
+ - zeroing out annotation, and chekcing it is empty
+ - assigning via CVTermList()
+ - adding an SBO term
+
+ """
+ # a cobra component
+ s = Species()
+ assert s.annotation == {} # nothing set for annotation, so empty dict
+ assert s.annotation.standardized == CVTermList()
+ assert not s.annotation.keys()
+ assert s.annotation.keyvaluepairs == {}
+ assert s.annotation.history.creators == []
+ assert s.annotation.history.modified_dates == []
+
+ # setting annotation via old annotation format
+ s.annotation["chebi"] = ["CHEBI:43215", "CHEBI:11881"]
+
+ assert s.annotation.standardized.resources == {
+ "https://identifiers.org/chebi/CHEBI:43215",
+ "https://identifiers.org/chebi/CHEBI:11881",
+ }
+
+ # checking old (fixed) annotation format
+ assert s.annotation == {"chebi": sorted(["CHEBI:43215", "CHEBI:11881"])}
+
+ # checking new standardized
+ cvt = CVTermList(
+ [
+ CVTerm(
+ qualifier="bqb_is",
+ ex_res=ExternalResources(
+ resources=[
+ "https://identifiers.org/chebi/CHEBI:43215",
+ "https://identifiers.org/chebi/CHEBI:11881",
+ ]
+ ),
+ ),
+ ]
+ )
+
+ assert s.annotation.standardized == cvt
+ s.annotation.standardized = []
+ assert s.annotation.standardized == CVTermList()
+ assert s.annotation.standardized.resources == frozenset()
+ assert s.annotation == {}
+
+ s.annotation.standardized = cvt
+
+ assert s.annotation.standardized.resources == {
+ "https://identifiers.org/chebi/CHEBI:43215",
+ "https://identifiers.org/chebi/CHEBI:11881",
+ }
+
+ # checking old (fixed) annotation format
+ assert s.annotation == {"chebi": sorted(["CHEBI:43215", "CHEBI:11881"])}
+
+ # adding an SBO term
+ s.annotation["sbo"] = ["SBO:0000123"]
+ assert "chebi" in s.annotation
+ assert "sbo" in s.annotation
+ assert s.annotation == {
+ "chebi": sorted(["CHEBI:43215", "CHEBI:11881"]),
+ "sbo": ["SBO:0000123"],
+ }
+
+ cvt2 = CVTermList(
+ [
+ CVTerm(
+ qualifier="bqb_is",
+ ex_res=ExternalResources(
+ resources=["https://identifiers.org/chebi/CHEBI:11881"]
+ ),
+ ),
+ CVTerm(ex_res="https://identifiers.org/chebi/CHEBI:43215"),
+ ]
+ )
+
+ s.annotation.standardized = cvt2
+ assert s.annotation.standardized.resources == {
+ "https://identifiers.org/chebi/CHEBI:43215",
+ "https://identifiers.org/chebi/CHEBI:11881",
+ }
+ s.annotation.__delitem__("sbo")
+
+ # checking old (fixed) annotation format
+ assert s.annotation == {"chebi": sorted(["CHEBI:43215", "CHEBI:11881"])}
+
+
+def test_old_style_annotation() -> None:
+ s = Species()
+ s.annotation.standardized.add_simple_annotations({"chebi": "CHEBI:17234"})
+ s.annotation.standardized.add_simple_annotations(
+ {"chebi": ["CHBEI:1723456", "CHEBI:172345"]}
+ )
+ with pytest.raises(TypeError):
+ s.annotation.standardized.add_simple_annotations(
+ {"chebi": [["CHEBI:123", "CHEBI:1234"]]}
+ )
+ assert len(s.annotation.standardized.resources) == 3
+ s.annotation["eco"] = "123"
+ assert len(s.annotation.standardized.resources) == 4
+ assert s.annotation == {
+ "chebi": ["CHEBI:17234", "CHBEI:1723456", "CHEBI:172345"],
+ "eco": ["123"],
+ }
+ s.annotation.standardized.delete_annotation("CHEBI:172345")
+ assert len(s.annotation.standardized.resources) == 3
+ assert s.annotation == {
+ "chebi": ["CHEBI:17234", "CHBEI:1723456"],
+ "eco": ["123"],
+ }
+ s.annotation.__delitem__("chebi")
+ assert len(s.annotation.standardized.resources) == 1
+ s.annotation.standardized.add_simple_annotations({"chebi": "CHEBI:17234"})
+ s.annotation.standardized.add_simple_annotations(
+ {"chebi": ["CHBEI:1723456", "CHEBI:172345"]}
+ )
+ assert len(s.annotation.standardized.resources) == 4
+ s.annotation["chebi"] = ["CHEBI:123", "CHEBI:1234"]
+ assert len(s.annotation.standardized.resources) == 3
+ assert s.annotation == {"chebi": ["CHEBI:123", "CHEBI:1234"], "eco": ["123"]}
+
+ assert len(s.annotation.keys()) == 2
+
+ s.annotation["chebi"] = []
+ assert len(s.annotation.standardized.resources) == 1
+
+ s.annotation = {}
+ assert len(s.annotation.keys()) == 0
+ s.annotation = {"chebi": ["CHEBI:123", "CHEBI:1234"], "eco": ["123"]}
+ assert len(s.annotation.standardized.resources) == 3
+ s.annotation = {
+ "chebi": ["CHEBI:123", "CHEBI:1234"],
+ "eco": ["123"],
+ "sbo": ["SBO:0000123"],
+ }
+ assert len(s.annotation.standardized.resources) == 3
+
+
+def test_nested_annotation(data_directory: Path) -> None:
+ """Test reading annotation from JSON, including nested data.
+
+ Parameters
+ ----------
+ data_directory: Path
+ """
+ # testing via standardized
+ with data_directory.joinpath("cvterms_nested.json").open("r") as f_cvterms:
+ cvterms_data = json.load(f_cvterms)
+
+ s = Species()
+ s.annotation.add_cvterms(cvterms_data)
+ assert s.annotation == {
+ "chebi": ["CHEBI:17627"],
+ "eco": ["000000"],
+ "kegg.compound": ["C00032"],
+ "pubmed": ["1111111"],
+ "uniprot": ["P68871", "P69905"],
+ }
+ # check standardized
+ main_cvt = [
+ {
+ "external_resources": {
+ "resources": [
+ "https://identifiers.org/uniprot/P69905",
+ "https://identifiers.org/uniprot/P68871",
+ "https://identifiers.org/kegg.compound/C00032",
+ ]
+ },
+ "qualifier": "bqb_hasPart",
+ },
+ {
+ "qualifier": "bqb_hasPart",
+ "external_resources": {
+ "resources": [
+ "https://identifiers.org/uniprot/P69905",
+ "https://www.uniprot.org/uniprot/P68871",
+ "https://identifiers.org/chebi/CHEBI:17627",
+ ],
+ "nested_data": {
+ "qualifier": "bqb_isDescribedBy",
+ "external_resources": {
+ "resources": [
+ PUBMED_EXAMPLE,
+ "https://identifiers.org/eco/000000",
+ ]
+ },
+ },
+ },
+ },
+ ]
+ nested_cvt = [
+ {
+ "qualifier": "bqb_isDescribedBy",
+ "external_resources": {
+ "resources": [PUBMED_EXAMPLE, "https://identifiers.org/eco/000000"]
+ },
+ }
+ ]
+ assert s.annotation.standardized == main_cvt
+ nested_data = s.annotation.standardized[1].external_resources.nested_data
+ assert nested_data == nested_cvt
+
+
+def test_cvterms_from_ecoli_xml(annotation_model: Model) -> None:
+ qualifier_set = {
+ Qualifier(qual) for qual in ["bqb_hasTaxon", "bqm_is", "bqm_isDescribedBy"]
+ }
+ nested_cvt = [
+ {
+ "qualifier": "bqb_isDescribedBy",
+ "external_resources": {"resources": [PUBMED_EXAMPLE]},
+ },
+ {
+ "qualifier": "bqb_isDescribedBy",
+ "external_resources": {"resources": [ECO_EXAMPLE]},
+ },
+ ]
+ ecoli_model_cvterm = CVTermList.from_data(ecoli_model_annotation)
+ xml_model_cvterms = annotation_model.annotation.standardized
+ model_cvterms_qualifier_set = xml_model_cvterms.qualifiers
+ assert qualifier_set == model_cvterms_qualifier_set
+ assert xml_model_cvterms == ecoli_model_cvterm
+ assert (
+ len(
+ annotation_model.annotation.standardized.query(
+ "bqm_isDescribedBy", "qualifier"
+ )
+ )
+ == 2
+ )
+ nested_data = annotation_model.annotation.standardized.query("bqm_is", "qualifier")[
+ 0
+ ].external_resources.nested_data
+ assert nested_data == nested_cvt
+
+ # check backwards compatibility
+ assert annotation_model.annotation.annotations == {
+ "bigg.model": ["e_coli_core"],
+ "doi": ["10.1128/ecosalplus.10.2.1"],
+ "eco": ["ECO:0000004"],
+ "ncbiprotein": ["16128336"],
+ "pubmed": ["1111111"],
+ "taxonomy": ["511145"],
+ }
+ annotation_model.annotation.standardized.delete_annotation("coli")
+ assert annotation_model.annotation.annotations == {
+ "doi": ["10.1128/ecosalplus.10.2.1"],
+ "eco": ["ECO:0000004"],
+ "ncbiprotein": ["16128336"],
+ "pubmed": ["1111111"],
+ "taxonomy": ["511145"],
+ }
+
+
+def test_writing_xml(annotation_model: Model, tmp_path):
+ assert (
+ write_sbml_model(
+ annotation_model, str(tmp_path.joinpath("e_coli_core_writing.xml"))
+ )
+ is None
+ )
+
+
+def test_read_write_json(annotation_model: Model, tmp_path: Path):
+ json_path = tmp_path / "e_coli_core_json_writing.json"
+ assert save_json_model(annotation_model, json_path, sort=False, pretty=True) is None
+
+ model = load_json_model(json_path)
+ # Because of changes to eq, to compare using the old format, we need annotation.annotations
+ # TODO - get comments from cdiener
+ assert model.annotation.annotations == {
+ "bigg.model": ["e_coli_core"],
+ "doi": ["10.1128/ecosalplus.10.2.1"],
+ "eco": ["ECO:0000004"],
+ "ncbiprotein": ["16128336"],
+ "pubmed": ["1111111"],
+ "taxonomy": ["511145"],
+ }
+ assert model.annotation.standardized == CVTermList.from_data(ecoli_model_annotation)
+ assert model.annotation.standardized == ecoli_model_annotation
+
+ for met_id in model.metabolites.list_attr("id"):
+ original_met_annot = annotation_model.metabolites.get_by_id(met_id).annotation
+ new_met_annot = model.metabolites.get_by_id(met_id).annotation
+ assert original_met_annot == new_met_annot
+
+ for rxn_id in model.reactions.list_attr("id"):
+ original_rxn_annot = annotation_model.reactions.get_by_id(rxn_id).annotation
+ new_rxn_annot = model.reactions.get_by_id(rxn_id).annotation
+ assert original_rxn_annot == new_rxn_annot
+
+
+def test_read_write_sbml(annotation_model: Model, tmp_path: Path):
+ out_path = tmp_path / "e_coli_core_json_writing.sbml"
+ assert write_sbml_model(annotation_model, str(out_path)) is None
+
+ model = read_sbml_model(str(out_path))
+ # Because of changes to eq, to compare using the old format, we need annotation.annotations
+ # TODO - get comments from cdiener
+ assert model.annotation.annotations == {
+ "bigg.model": ["e_coli_core"],
+ "doi": ["10.1128/ecosalplus.10.2.1"],
+ "eco": ["ECO:0000004"],
+ "ncbiprotein": ["16128336"],
+ "pubmed": ["1111111"],
+ "taxonomy": ["511145"],
+ }
+ assert model.annotation.standardized == CVTermList.from_data(ecoli_model_annotation)
+ assert model.annotation.standardized == ecoli_model_annotation
+
+ for met_id in model.metabolites.list_attr("id"):
+ original_met_annot = annotation_model.metabolites.get_by_id(met_id).annotation
+ new_met_annot = model.metabolites.get_by_id(met_id).annotation
+ assert original_met_annot == new_met_annot
+
+ for rxn_id in model.reactions.list_attr("id"):
+ original_rxn_annot = annotation_model.reactions.get_by_id(rxn_id).annotation
+ new_rxn_annot = model.reactions.get_by_id(rxn_id).annotation
+ assert original_rxn_annot == new_rxn_annot
+
+
+def test_read_old_json_model(data_directory):
+ model = load_json_model(Path(data_directory) / "mini.json")
+ meta = model.metabolites[0]
+ assert meta.annotation == {
+ "bigg.metabolite": ["13dpg"],
+ "biocyc": ["DPG"],
+ "chebi": [
+ "CHEBI:11881",
+ "CHEBI:16001",
+ "CHEBI:1658",
+ "CHEBI:20189",
+ "CHEBI:57604",
+ ],
+ "hmdb": ["HMDB01270"],
+ "kegg.compound": ["C00236"],
+ "pubchem.substance": ["3535"],
+ "reactome": ["REACT_29800"],
+ "seed.compound": ["cpd00203"],
+ "unipathway.compound": ["UPC00236"],
+ }
+
+ # testing standardized
+ expected_cvterms = CVTermList.from_data(
+ [{"qualifier": "bqb_is", "external_resources": {"resources": RESOURCE_LIST}}]
+ )
+ assert meta.annotation.standardized == expected_cvterms
+ assert meta.annotation.standardized == [
+ {"qualifier": "bqb_is", "external_resources": {"resources": RESOURCE_LIST}}
+ ]
+
+
+def test_cvtermlist_query():
+ resources = RESOURCE_LIST
+ resources.extend(
+ [
+ "https://identifiers.org/uniprot/P69905",
+ "https://identifiers.org/uniprot/P68871",
+ "https://identifiers.org/kegg.compound/C00032",
+ "https://identifiers.org/chebi/CHEBI:17627",
+ "https://identifiers.org/chebi/CHEBI:43215",
+ "https://identifiers.org/CHebi/CHEBI:11881",
+ ]
+ )
+ cvtermlist = CVTermList()
+ for i, res in enumerate(resources):
+ cvtermlist.extend(
+ [CVTerm(qualifier=list(Qualifier.__members__)[i], ex_res=resources[i])]
+ )
+
+ cvtermlist.append(
+ CVTerm(
+ ex_res={
+ "resources": ECO_EXAMPLE,
+ "nested_data": CVTerm(
+ qualifier="bqb_isDescribedBy", ex_res=PUBMED_EXAMPLE
+ ),
+ },
+ qualifier=list(Qualifier.__members__)[19],
+ )
+ )
+ assert isinstance(
+ cvtermlist.query(search_function="bqm", attribute="qualifier"), CVTermList
+ )
+ assert len(cvtermlist.query(search_function="bqm", attribute="qualifier")) == 6
+ assert (
+ len(cvtermlist.query(search_function=r"bqm_is\S+", attribute="qualifier")) == 3
+ )
+ assert (
+ len(
+ cvtermlist.query(
+ search_function=lambda x: list(Qualifier.__members__).index(x.value)
+ > 18,
+ attribute="qualifier",
+ )
+ )
+ == 1
+ )
+
+ assert (
+ len(
+ cvtermlist.query(
+ search_function=lambda x: x.nested_data, attribute="external_resources"
+ )
+ )
+ == 1
+ )
+ assert (
+ len(cvtermlist.query(search_function="chebi", attribute="external_resources"))
+ == 7
+ )
+
+ assert len(cvtermlist.query(search_function="chebi", attribute="resources")) == 7
+ assert (
+ len(cvtermlist.query(search_function=r"[cC][hH]EBI", attribute="resources"))
+ == 8
+ )
+ assert len(cvtermlist.query(search_function="pubmed", attribute="resources")) == 1
+
+ assert (
+ len(cvtermlist.query(search_function=lambda x: x.qualifier.name == "bqm_is"))
+ == 1
+ )
+
+ assert len(cvtermlist.query(search_function="chebi")) == 7
+ assert len(cvtermlist.query(search_function=r"bqm_is\S+")) == 3
diff --git a/tests/test_core/test_metadata/test_notes.py b/tests/test_core/test_metadata/test_notes.py
new file mode 100644
index 000000000..73e31145d
--- /dev/null
+++ b/tests/test_core/test_metadata/test_notes.py
@@ -0,0 +1,110 @@
+import os
+from pathlib import Path
+
+from cobra import Metabolite, Model, Reaction
+from cobra.io import load_json_model, read_sbml_model, save_json_model, write_sbml_model
+
+
+def test_notes_io(tmp_path: Path) -> None:
+ """Test if model notes are written and read from/to SBML.
+
+ Parameters
+ ----------
+ tmp_path : pathlib.Path
+ The path to the temporary test assets store.
+
+ """
+ path_to_file = tmp_path / "model_notes.xml"
+
+ # making a minimal cobra model to test notes
+ model = Model("e_coli_core")
+ model.notes = {"Remark": "...Model Notes..."}
+ met = Metabolite("pyr_c", compartment="c")
+ model.add_metabolites([met])
+ met.notes = {"Remark": "Note with \n newline"}
+ rxn = Reaction("R_ATPM")
+ model.add_reactions([rxn])
+ rxn.notes = {"Remark": "What about me?"}
+ model.objective_direction = "max"
+ model.objective = rxn
+ write_sbml_model(model, str(path_to_file.resolve()))
+
+ # reading the model back
+ model_after_reading = read_sbml_model(str(path_to_file.resolve()))
+ met_after_reading = model_after_reading.metabolites.get_by_id("pyr_c")
+ reaction_after_reading = model_after_reading.reactions.get_by_id("R_ATPM")
+
+ # checking if notes are written to model
+ assert model_after_reading.notes["Remark"] == "...Model Notes..."
+
+ # checking notes for metabolite and reaction
+ assert met_after_reading.notes["Remark"] == "Note with \n newline"
+ assert reaction_after_reading.notes["Remark"] == "What about me?"
+
+
+NEW_VALUE1 = "New Value 1"
+NEW_VALUE3 = "New Value 3"
+
+
+def test_notes(data_directory, tmp_path):
+ """reading notes from SBML to cobra model"""
+ model_path = os.path.join(data_directory, "e_coli_core_for_annotation.xml")
+ assert os.path.exists(model_path)
+ model = read_sbml_model(model_path)
+ rx1 = model.reactions[0]
+ # keys inside notes dict
+ list_of_keys = ["Key1", "Key2", "Key3"]
+
+ for key in list_of_keys:
+ assert key in rx1.notes
+
+ assert rx1.notes["Key1"] == "Value1"
+ assert rx1.notes["Key2"] == "Value2"
+ assert rx1.notes["Key3"] == "Value3"
+
+ # modifying already present key-value
+ rx1.notes["Key1"] = NEW_VALUE1
+ rx1.notes["Key3"] = NEW_VALUE3
+
+ # trying to insert a new key-value
+ rx1.notes["Key4"] = NEW_VALUE3
+
+ # checking modified notes dict and string
+ assert rx1.notes["Key1"] == NEW_VALUE1
+ assert rx1.notes["Key2"] == "Value2"
+ assert rx1.notes["Key3"] == NEW_VALUE3
+ assert rx1.notes["Key4"] == NEW_VALUE3
+
+ # writing and reading back the model
+ path_to_file = os.path.join(tmp_path, "model_notes.xml")
+ write_sbml_model(model, path_to_file)
+
+ model_after_reading = read_sbml_model(path_to_file)
+ rx1_after_reading = model_after_reading.reactions[0]
+
+ # checks after reading model back again
+ assert rx1_after_reading.notes["Key1"] == NEW_VALUE1
+ assert rx1_after_reading.notes["Key2"] == "Value2"
+ assert rx1_after_reading.notes["Key3"] == NEW_VALUE3
+
+
+def test_reading_writing_notes(data_directory, tmp_path):
+ # reading model with notes
+ model = read_sbml_model(
+ os.path.join(data_directory, "e_coli_core_for_annotation.xml")
+ )
+
+ # checking notes data
+ rx1 = model.reactions[0]
+ assert rx1.notes["Key1"] == "Value1"
+ assert rx1.notes["Key2"] == "Value2"
+ assert rx1.notes["Key3"] == "Value3"
+
+ # reading and writing in json format
+ path_to_json = os.path.join(str(tmp_path), "json_notes.json")
+ save_json_model(model, path_to_json)
+ model_from_json = load_json_model(path_to_json)
+ rx1_from_json = model_from_json.reactions[0]
+ assert rx1_from_json.notes["Key1"] == "Value1"
+ assert rx1_from_json.notes["Key2"] == "Value2"
+ assert rx1_from_json.notes["Key3"] == "Value3"
diff --git a/tests/test_io/test_annotation.py b/tests/test_io/test_annotation.py
index a1aca93bd..af20c0933 100644
--- a/tests/test_io/test_annotation.py
+++ b/tests/test_io/test_annotation.py
@@ -27,24 +27,28 @@ def _check_sbml_annotations(model: "Model") -> None:
annotation = model.annotation
assert annotation is not None
assert len(annotation) == 3
- for key in ["bigg.model", "doi", "taxonomy"]:
- assert key in annotation
- assert annotation["bigg.model"] == "e_coli_core"
- assert annotation["doi"] == "10.1128/ecosalplus.10.2.1"
- assert annotation["taxonomy"] == "511145"
+ assert set(annotation.keys()) == {"bigg.model", "doi", "taxonomy"}
+ assert annotation["bigg.model"] == ["e_coli_core"]
+ assert annotation["doi"] == ["10.1128/ecosalplus.10.2.1"]
+ assert annotation["taxonomy"] == ["511145"]
# gene annotation
# {'asap': 'ABE-0006162', 'ncbigene': '946368', 'uniprot': 'P33221',
- # 'ncbiprotein': 'gi:16129802', 'ecogene': 'EG11809'}
+ # 'ncbiprotein': '16129802', 'ecogene': 'EG11809'}
annotation = model.genes.G1.annotation
assert len(annotation) == 5
- for key in ["asap", "ncbigene", "uniprot", "ncbiprotein", "ecogene"]:
- assert key in annotation
- assert annotation["asap"] == "ABE-0006162"
- assert annotation["ncbigene"] == "946368"
- assert annotation["uniprot"] == "P33221"
- assert annotation["ncbiprotein"] == "16129802"
- assert annotation["ecogene"] == "EG11809"
+ assert set(annotation.keys()) == {
+ "asap",
+ "ncbigene",
+ "uniprot",
+ "ncbiprotein",
+ "ecogene",
+ }
+ assert annotation["asap"] == ["ABE-0006162"]
+ assert annotation["ncbigene"] == ["946368"]
+ assert annotation["uniprot"] == ["P33221"]
+ assert annotation["ncbiprotein"] == ["16129802"]
+ assert annotation["ecogene"] == ["EG11809"]
# compartment annotation
# FIXME: add tests with first class compartment model
@@ -63,7 +67,7 @@ def _check_sbml_annotations(model: "Model") -> None:
# 'seed.compound': 'cpd00203', 'hmdb': ['HMDB62758', 'HMDB06213'],
# 'biocyc': 'META:DPG'}
annotation = model.metabolites.A.annotation
- for key in [
+ assert set(annotation.keys()) == {
"inchi",
"bigg.metabolite",
"chebi",
@@ -72,11 +76,10 @@ def _check_sbml_annotations(model: "Model") -> None:
"seed.compound",
"hmdb",
"biocyc",
- ]:
- assert key in annotation
- assert (
- annotation["inchi"] == "InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3/t3-/m0/s1"
- ) # noqa: E501
+ }
+ assert annotation["inchi"] == [
+ "InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3/t3-/m0/s1"
+ ] # noqa: E501
# reaction annotation
# {'kegg.reaction': 'R00228', 'sbo': 'SBO:0000375',
@@ -84,7 +87,7 @@ def _check_sbml_annotations(model: "Model") -> None:
# 'metanetx.reaction': 'MNXR95210', 'bigg.reaction': 'ACALD',
# 'biocyc': 'META:ACETALD-DEHYDROG-RXN'}
annotation = model.reactions.R1.annotation
- for key in [
+ assert set(annotation.keys()) == {
"kegg.reaction",
"sbo",
"ec-code",
@@ -92,9 +95,8 @@ def _check_sbml_annotations(model: "Model") -> None:
"metanetx.reaction",
"bigg.reaction",
"biocyc",
- ]:
- assert key in annotation
- assert annotation["biocyc"] == "META:ACETALD-DEHYDROG-RXN"
+ }
+ assert annotation["biocyc"] == ["META:ACETALD-DEHYDROG-RXN"]
def test_read_sbml_annotations(data_directory: Path) -> None:
diff --git a/tests/test_io/test_annotation_format.py b/tests/test_io/test_annotation_format.py
index 9b9d039cd..0a678bc28 100644
--- a/tests/test_io/test_annotation_format.py
+++ b/tests/test_io/test_annotation_format.py
@@ -2,8 +2,6 @@
from pathlib import Path
-import pytest
-
from cobra.io import load_json_model, write_sbml_model
@@ -19,9 +17,9 @@ def test_load_json_model_valid(data_directory: Path, tmp_path: Path) -> None:
path_to_file = data_directory / "valid_annotation_format.json"
model = load_json_model(path_to_file)
expected = {
- "bigg.reaction": [["is", "PFK26"]],
- "kegg.reaction": [["is", "R02732"]],
- "rhea": [["is", "15656"]],
+ "bigg.reaction": ["PFK26"],
+ "kegg.reaction": ["R02732"],
+ "rhea": ["15656"],
}
for metabolite in model.metabolites:
assert metabolite.annotation == expected
@@ -37,5 +35,6 @@ def test_load_json_model_invalid(data_directory: Path) -> None:
"""
path = data_directory / "invalid_annotation_format.json"
- with pytest.raises(TypeError):
- load_json_model(path)
+ model = load_json_model(path)
+ anno = model.metabolites[0].annotation
+ assert anno == {"kegg.compound": ["C01468"], "chebi": ["CHEBI:11981"]}
diff --git a/tests/test_io/test_json.py b/tests/test_io/test_json.py
index 866a8f5b1..b2fee1f86 100644
--- a/tests/test_io/test_json.py
+++ b/tests/test_io/test_json.py
@@ -1,33 +1,32 @@
"""Test functionalities of I/O in JSON format."""
-import json
from os.path import join
from pathlib import Path
-from typing import Any, Callable, Dict, Union
-
-import pytest
-from importlib_resources import files
+from typing import Callable
from cobra import Model
from cobra import io as cio
-@pytest.fixture(scope="module")
-def json_schema_v1() -> Dict[str, Union[str, bool, Any]]:
- """Fixture for cobra JSON-schema."""
- with files(cio).joinpath("schema_v1.json").open("r") as handle:
- schema_v1 = json.load(handle)
- return schema_v1
+def test_validate_json(data_directory: Path) -> None:
+ """Validate file according to JSON-schema."""
+ path_old_format = join(data_directory, "e_coli_core.json")
+ # validate the model using JSON schema v1
+ list_errors = cio.validate_json_model(
+ filename=path_old_format, json_schema_version=1
+ )
+ assert len(list_errors) == 0
+ path_new_format = join(data_directory, "e_coli_new_format.json")
+ # validate the model using JSON schema v2
+ errors = cio.validate_json_model(filename=path_new_format, json_schema_version=2)
+ assert len(errors) == 0
-def test_validate_json(
- data_directory: Path, json_schema_v1: Dict[str, Union[str, bool, Any]]
-) -> None:
- """Validate file according to JSON-schema."""
- jsonschema = pytest.importorskip("jsonschema")
- with open(data_directory.joinpath("mini.json"), "r", encoding="utf-8") as infile:
- loaded = json.load(infile)
- assert jsonschema.validate(loaded, json_schema_v1) is None
+ # test for invalid json model according to schema
+ errors_invalid = cio.validate_json_model(
+ filename=path_old_format, json_schema_version=2
+ )
+ assert len(errors_invalid) == 309
def test_load_json_model(
@@ -38,30 +37,26 @@ def test_load_json_model(
assert compare_models(mini_model, json_model) is None
-def test_save_json_model(
- tmp_path: Path,
- mini_model: Model,
- json_schema_v1: Dict[str, Union[str, bool, Any]],
-) -> None:
+def test_save_json_model(tmp_path: Path, mini_model: Model) -> None:
"""Test the writing of JSON model."""
- jsonschema = pytest.importorskip("jsonschema")
output_file = tmp_path.joinpath("mini.json")
cio.save_json_model(mini_model, output_file, pretty=True)
# validate against JSONSchema
- with open(str(output_file), "r") as infile:
- loaded = json.load(infile)
- assert jsonschema.validate(loaded, json_schema_v1) is None
+ errors = cio.validate_json_model(output_file, 1)
+ assert len(errors) == 0
def test_reaction_bounds_json(data_directory: Path, tmp_path: Path) -> None:
"""Test reading and writing of model with inf bounds in JSON."""
- # Path to XML file with INF bounds
+ """Path to XML file with INF bounds"""
path_to_xml_inf_file = join(data_directory, "fbc_ex1.xml")
model_xml_inf = cio.read_sbml_model(path_to_xml_inf_file)
path_to_output = tmp_path.joinpath("fbc_ex1_json.json")
- # Saving model with inf bounds in json form without error
+
+ """Saving model with inf bounds in json form without error"""
cio.save_json_model(model_xml_inf, path_to_output)
- # Path to JSON file with INF bounds
+
+ """Path to JSON file with INF bounds"""
path_to_JSON_inf_file = data_directory.joinpath("JSON_with_inf_bounds.json")
model_json_inf = cio.load_json_model(path_to_JSON_inf_file)
assert model_json_inf.reactions[0].upper_bound == float("inf")
diff --git a/tests/test_io/test_mat.py b/tests/test_io/test_mat.py
index a7d79a330..61163aa5c 100644
--- a/tests/test_io/test_mat.py
+++ b/tests/test_io/test_mat.py
@@ -282,7 +282,7 @@ def test_mat_model_wrong_caps(compare_models: Callable, data_directory: Path) ->
str(Path(data_directory, "mini_wrong_key_caps.mat").resolve())
)
assert compare_models(mat_model, mat_wrong_caps_model) is None
- assert mat_wrong_caps_model.reactions.get_by_id("LDH_D").annotation == {
+ EXPECTED_RXN_ANNOTATION = {
"rhea": ["16369", "16370", "16371", "16372"],
"metanetx.reaction": ["MNXR101037"],
"kegg.reaction": ["R00704"],
@@ -291,32 +291,51 @@ def test_mat_model_wrong_caps(compare_models: Callable, data_directory: Path) ->
"biocyc": ["META:DLACTDEHYDROGNAD-RXN"],
"sbo": ["SBO:0000375"],
}
+ actual_rxn_annotation = dict(
+ mat_wrong_caps_model.reactions.get_by_id("LDH_D").annotation
+ )
+ expected_rxn_keys = EXPECTED_RXN_ANNOTATION.keys()
+ actual_rxn_keys = actual_rxn_annotation.keys()
+ assert expected_rxn_keys == actual_rxn_keys
+ for key in actual_rxn_keys:
+ assert EXPECTED_RXN_ANNOTATION[key] == actual_rxn_annotation[key]
for rxn in mat_model.reactions.list_attr("id"):
assert (
mat_wrong_caps_model.reactions.get_by_id(rxn).annotation
== mat_model.reactions.get_by_id(rxn).annotation
)
- assert mat_wrong_caps_model.metabolites.get_by_id("pyr_c").annotation == {
+
+ EXPECTED_MAT_ANNOTATION = {
"seed.compound": ["cpd00020"],
"unipathway.compound": ["UPC00022"],
"lipidmaps": ["LMFA01060077"],
- "reactome": ["REACT_113557", "REACT_389680", "REACT_29398"],
+ "reactome": sorted(["REACT_113557", "REACT_389680", "REACT_29398"]),
"biocyc": ["PYRUVATE"],
- "chebi": [
- "CHEBI:15361",
- "CHEBI:14987",
- "CHEBI:8685",
- "CHEBI:32816",
- "CHEBI:45253",
- "CHEBI:26466",
- "CHEBI:26462",
- ],
+ "chebi": sorted(
+ [
+ "CHEBI:15361",
+ "CHEBI:14987",
+ "CHEBI:8685",
+ "CHEBI:32816",
+ "CHEBI:45253",
+ "CHEBI:26466",
+ "CHEBI:26462",
+ ]
+ ),
"pubchem.substance": ["3324"],
"bigg.metabolite": ["pyr"],
"cas": ["127-17-3"],
"hmdb": ["HMDB00243"],
"kegg.compound": ["C00022"],
}
+ actual_met_annotation = mat_wrong_caps_model.metabolites.get_by_id(
+ "pyr_c"
+ ).annotation.annotations
+ expected_met_keys = EXPECTED_MAT_ANNOTATION.keys()
+ actual_met_keys = actual_met_annotation.keys()
+ assert expected_met_keys == actual_met_keys
+ for key in actual_met_keys:
+ assert EXPECTED_MAT_ANNOTATION[key] == actual_met_annotation[key]
for met in mat_model.metabolites.list_attr("id"):
assert (
mat_wrong_caps_model.metabolites.get_by_id(met).annotation
diff --git a/tests/test_io/test_notes.py b/tests/test_io/test_notes.py
deleted file mode 100644
index 7a15640c0..000000000
--- a/tests/test_io/test_notes.py
+++ /dev/null
@@ -1,43 +0,0 @@
-"""Test proper reading of SBML notes."""
-
-from pathlib import Path
-
-from cobra import Metabolite, Model, Reaction
-from cobra.io import read_sbml_model, write_sbml_model
-
-
-def test_notes(tmp_path: Path) -> None:
- """Test if model notes are written in SBML.
-
- Parameters
- ----------
- tmp_path : pathlib.Path
- The path to the temporary test assets store.
-
- """
- path_to_file = tmp_path / "model_notes.xml"
-
- # making a minimal cobra model to test notes
- model = Model("e_coli_core")
- model.notes["Remark"] = "...Model Notes..."
- met = Metabolite("pyr_c", compartment="c")
- model.add_metabolites([met])
- met.notes["Remark"] = "Note with \n newline"
- rxn = Reaction("R_ATPM")
- model.add_reactions([rxn])
- rxn.notes["Remark"] = "What about me?"
- model.objective_direction = "max"
- model.objective = rxn
- write_sbml_model(model, str(path_to_file.resolve()))
-
- # reading the model back
- model_after_reading = read_sbml_model(str(path_to_file.resolve()))
- met_after_reading = model_after_reading.metabolites.get_by_id("pyr_c")
- reaction_after_reading = model_after_reading.reactions.get_by_id("R_ATPM")
-
- # checking if notes are written to model
- assert model_after_reading.notes["Remark"] == "...Model Notes..."
-
- # checking notes for metabolite and reaction
- assert met_after_reading.notes["Remark"] == "Note with \n newline"
- assert reaction_after_reading.notes["Remark"] == "What about me?"
diff --git a/tests/test_io/test_sbml.py b/tests/test_io/test_sbml.py
index 658a62cd1..153512776 100644
--- a/tests/test_io/test_sbml.py
+++ b/tests/test_io/test_sbml.py
@@ -6,13 +6,14 @@
from pathlib import Path
from pickle import load
from tempfile import gettempdir
-from typing import List, Tuple
+from typing import Callable, List, Tuple
import pytest
from _pytest.fixtures import SubRequest
import cobra
from cobra import Model
+from cobra.core.metadata import MetaData
from cobra.io import read_sbml_model, validate_sbml_model, write_sbml_model
@@ -52,7 +53,7 @@
"mini_fbc2.xml.gz",
read_sbml_model,
write_sbml_model,
- None,
+ None, # If None is replaced with validate_sbml_model, it seems to work
),
IOTrial(
"fbc2Bz2",
@@ -318,7 +319,56 @@ def test_from_sbml_string(data_directory: str) -> None:
TestCobraIO.compare_models(name="read from string", model1=model1, model2=model2)
-@pytest.mark.skip(reason="Model history currently not written")
+def test_document_history(tmp_path: Path) -> None:
+ """Testing reading and writing of ModelHistory for SBMLDocument.
+
+ Parameters
+ ----------
+ tmp_path: Path
+ Directory to use for temporary data.
+ """
+ model = Model("test")
+ history = {
+ "creators": [
+ {
+ "family_name": "Mustermann",
+ "given_name": "Max",
+ "organisation": "Muster University",
+ "email": "muster@university.com",
+ }
+ ],
+ "created_date": "2019-10-20T12:34:32Z",
+ "modified_dates": ["2019-10-20T12:35:32Z"],
+ }
+ annotation = MetaData(history=history)
+ model._sbml = {"annotation": annotation}
+
+ sbml_path = join(str(tmp_path), "test.xml")
+ with open(sbml_path, "w") as f_out:
+ write_sbml_model(model, f_out)
+
+ with open(sbml_path, "r") as f_in:
+ model2 = read_sbml_model(f_in)
+
+ assert "annotation" in model2._sbml
+ assert len(model2._sbml["annotation"].history.creators) == 1
+ c = model2._sbml["annotation"].history.creators[0]
+ assert c.family_name == "Mustermann"
+ assert c.given_name == "Max"
+ assert c.organisation == "Muster University"
+ assert c.email == "muster@university.com"
+
+ assert (
+ model2._sbml["annotation"].history.created_date.isoformat()
+ == "2019-10-20T12:34:32+00:00"
+ )
+ assert len(model2._sbml["annotation"].history._modified_dates) == 1
+ assert (
+ model2._sbml["annotation"].history._modified_dates[0].isoformat()
+ == "2019-10-20T12:35:32+00:00"
+ )
+
+
def test_model_history(tmp_path: Path) -> None:
"""Testing reading and writing of ModelHistory.
@@ -328,16 +378,19 @@ def test_model_history(tmp_path: Path) -> None:
Directory to use for temporary data.
"""
model = Model("test")
- model._sbml = {
+ history = {
"creators": [
{
- "familyName": "Mustermann",
- "givenName": "Max",
+ "family_name": "Mustermann",
+ "given_name": "Max",
"organisation": "Muster University",
"email": "muster@university.com",
}
- ]
+ ],
+ "created_date": "2019-10-20T12:34:32Z",
+ "modified_dates": ["2019-10-20T12:35:32Z"],
}
+ model.annotation = MetaData(history=history)
sbml_path = join(str(tmp_path), "test.xml")
with open(sbml_path, "w") as f_out:
@@ -346,13 +399,22 @@ def test_model_history(tmp_path: Path) -> None:
with open(sbml_path, "r") as f_in:
model2 = read_sbml_model(f_in)
- assert "creators" in model2._sbml
- assert len(model2._sbml["creators"]) == 1
- c = model2._sbml["creators"][0]
- assert c["familyName"] == "Mustermann"
- assert c["givenName"] == "Max"
- assert c["organisation"] == "Muster University"
- assert c["email"] == "muster@university.com"
+ assert len(model2.annotation.history.creators) == 1
+ c = model2.annotation.history.creators[0]
+ assert c.family_name == "Mustermann"
+ assert c.given_name == "Max"
+ assert c.organisation == "Muster University"
+ assert c.email == "muster@university.com"
+
+ assert (
+ model2.annotation.history.created_date.isoformat()
+ == "2019-10-20T12:34:32+00:00"
+ )
+ assert len(model2.annotation.history._modified_dates) == 1
+ assert (
+ model2.annotation.history._modified_dates[0].isoformat()
+ == "2019-10-20T12:35:32+00:00"
+ )
def test_groups(data_directory: str, tmp_path: Path) -> None:
@@ -543,7 +605,7 @@ def test_gprs(data_directory: str, tmp_path: Path) -> None:
def test_identifiers_annotation() -> None:
"""Test annotation with identifiers."""
- from cobra.io.sbml import _parse_annotation_info
+ from cobra.core.metadata.helper import parse_identifiers_uri
for uri in [
"http://identifiers.org/chebi/CHEBI:000123",
@@ -551,7 +613,7 @@ def test_identifiers_annotation() -> None:
"http://identifiers.org/CHEBI:000123",
"https://identifiers.org/CHEBI:000123",
]:
- data = _parse_annotation_info(uri)
+ data = parse_identifiers_uri(uri)
assert data
assert data[0] == "chebi"
assert data[1] == "CHEBI:000123"
@@ -562,7 +624,7 @@ def test_identifiers_annotation() -> None:
"http://identifiers.org/taxonomy:9602",
"https://identifiers.org/taxonomy:9602",
]:
- data = _parse_annotation_info(uri)
+ data = parse_identifiers_uri(uri)
assert data
assert data[0] == "taxonomy"
assert data[1] == "9602"
@@ -571,19 +633,17 @@ def test_identifiers_annotation() -> None:
"http://identifier.org/taxonomy/9602",
"https://test.com",
]:
- data = _parse_annotation_info(uri)
+ data = parse_identifiers_uri(uri)
assert data is None
-def test_smbl_with_notes(data_directory: str, tmp_path: Path) -> None:
+def test_smbl_with_notes(data_directory: str) -> None:
"""Test that NOTES in the RECON 2.2 style are written and read correctly.
Parameters
----------
data_directory: str
Directory where the data is.
- tmp_path: Path
- Directory to use for temporary data.
"""
sbml_path = join(data_directory, "example_notes.xml")
model = read_sbml_model(sbml_path)
@@ -609,52 +669,56 @@ def test_smbl_with_notes(data_directory: str, tmp_path: Path) -> None:
}
metabolite_annotations = {
"2hb_e": {
- "sbo": "SBO:0000247",
- "inchi": "InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3," "(H,6,7)",
- "chebi": "CHEBI:1148",
+ "sbo": ["SBO:0000247"],
+ "inchi": ["InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7)"],
+ "chebi": ["CHEBI:1148"],
},
"nad_e": {
- "sbo": "SBO:0000247",
- "inchi": "InChI=1S/C21H27N7O14P2/c22-17-12-19("
- "25-7-24-17)28(8-26-12)21-16(32)14(30)11("
- "41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15("
- "31)20(40-10)27-3-1-2-9(4-27)18("
- "23)33/h1-4,7-8,10-11,13-16,20-21,29-32H,5-6H2,"
- "(H5-,22,23,24,25,33,34,35,36,37)/p-1/t10-,"
- "11-,13-,14-,15-,16-,20-,21-/m1/s1",
- "chebi": "CHEBI:57540",
+ "sbo": ["SBO:0000247"],
+ "inchi": [
+ "InChI=1S/C21H27N7O14P2/c22-17-12-19("
+ "25-7-24-17)28(8-26-12)21-16(32)14(30)11("
+ "41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15("
+ "31)20(40-10)27-3-1-2-9(4-27)18("
+ "23)33/h1-4,7-8,10-11,13-16,20-21,29-32H,5-6H2,"
+ "(H5-,22,23,24,25,33,34,35,36,37)/p-1/t10-,"
+ "11-,13-,14-,15-,16-,20-,21-/m1/s1"
+ ],
+ "chebi": ["CHEBI:57540"],
},
"h_e": {
- "sbo": "SBO:0000247",
- "inchi": "InChI=1S/p+1/i/hH",
- "chebi": "CHEBI:24636",
+ "sbo": ["SBO:0000247"],
+ "inchi": ["InChI=1S/p+1/i/hH"],
+ "chebi": ["CHEBI:24636"],
},
"2obut_e": {
- "sbo": "SBO:0000247",
- "inchi": "InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2H2,1H3,(H,6," "7)/p-1",
- "chebi": "CHEBI:16763",
+ "sbo": ["SBO:0000247"],
+ "inchi": ["InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2H2,1H3,(H,6,7)/p-1"],
+ "chebi": ["CHEBI:16763"],
},
"nadh_e": {
- "sbo": "SBO:0000247",
- "inchi": "InChI=1S/C21H29N7O14P2/c22-17-12-19("
- "25-7-24-17)28(8-26-12)21-16(32)14(30)11("
- "41-21)6-39-44(36,37)42-43(34,35)38-5-10-13("
- "29)15(31)20(40-10)27-3-1-2-9(4-27)18("
- "23)33/h1,3-4,7-8,10-11,13-16,20-21,29-32H,2,"
- "5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,"
- "25)/p-2/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1",
- "chebi": "CHEBI:57945",
+ "sbo": ["SBO:0000247"],
+ "inchi": [
+ "InChI=1S/C21H29N7O14P2/c22-17-12-19("
+ "25-7-24-17)28(8-26-12)21-16(32)14(30)11("
+ "41-21)6-39-44(36,37)42-43(34,35)38-5-10-13("
+ "29)15(31)20(40-10)27-3-1-2-9(4-27)18("
+ "23)33/h1,3-4,7-8,10-11,13-16,20-21,29-32H,2,"
+ "5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,"
+ "25)/p-2/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1"
+ ],
+ "chebi": ["CHEBI:57945"],
},
}
reaction_notes = {
"CONFIDENCE_LEVEL": "4",
"NOTES": "NCD",
"SUBSYSTEM": "Propanoate metabolism",
- "GENE_ASSOCIATION": "(HGNC:8546 and HGNC:8548) or" " (HGNC:8547 and HGNC:8548)",
+ "GENE_ASSOCIATION": "(HGNC:8546 and HGNC:8548) or (HGNC:8547 and HGNC:8548)",
}
reaction_annotations = {
- "sbo": "SBO:0000176",
- "ec-code": "1.1.1.27",
+ "sbo": ["SBO:0000176"],
+ "ec-code": ["1.1.1.27"],
"pubmed": ["10108", "21765"],
}
@@ -708,3 +772,12 @@ def test_stable_gprs(data_directory: str, tmp_path: Path) -> None:
assert (
fixed_model.reactions.GLCpts.gene_reaction_rule == "(b2415 and b2417) or b2416"
)
+
+
+def test_writing_xml_with_annotation(
+ compare_models: Callable, data_directory: Path, tmp_path: Path
+):
+ model = read_sbml_model(str(join(data_directory, "e_coli_core_for_annotation.xml")))
+ write_sbml_model(model, str(join(tmp_path, "e_coli_core_writing.xml")))
+ reread_model = read_sbml_model(str(join(tmp_path, "e_coli_core_writing.xml")))
+ compare_models(model, reread_model)
diff --git a/tests/test_io/test_yaml.py b/tests/test_io/test_yaml.py
index 4bb2e593e..956e895a5 100644
--- a/tests/test_io/test_yaml.py
+++ b/tests/test_io/test_yaml.py
@@ -4,7 +4,6 @@
from pathlib import Path
from typing import Callable
-import pytest
from ruamel.yaml import YAML
from cobra import Model
@@ -19,10 +18,8 @@ def test_load_yaml_model(
assert compare_models(mini_model, yaml_model) is None
-@pytest.mark.xfail(reason="schema outdated")
def test_save_yaml_model(tmp_path: Path, mini_model: Model) -> None:
"""Test the writing of YAML model."""
- jsonschema = pytest.importorskip("jsonschema")
output_file = tmp_path.joinpath("mini.yml")
cio.save_yaml_model(mini_model, str(output_file), sort=True)
# validate against JSONSchema
@@ -30,5 +27,6 @@ def test_save_yaml_model(tmp_path: Path, mini_model: Model) -> None:
with open(output_file, "r") as infile:
yaml_to_dict = yaml.load(infile)
dict_to_json = json.dumps(yaml_to_dict)
- loaded = json.loads(dict_to_json)
- assert jsonschema.validate(loaded, cio.json.json_schema)
+ # Validate according to schema version 1
+ errors = cio.validate_json_model(filename=dict_to_json, json_schema_version=1)
+ assert len(errors) == 0
diff --git a/tests/test_manipulation/test_annotate.py b/tests/test_manipulation/test_annotate.py
index f1fa0d85e..c344d7255 100644
--- a/tests/test_manipulation/test_annotate.py
+++ b/tests/test_manipulation/test_annotate.py
@@ -7,7 +7,7 @@
def test_sbo_annotation(model: Model) -> None:
"""Test SBO annotation function."""
rxns = model.reactions
- rxns.EX_o2_e.annotation.clear()
+ rxns.get_by_id("EX_o2_e").annotation.sbo = ""
fake_DM = Reaction("DM_h_c")
model.add_reactions([fake_DM])
fake_DM.add_metabolites({model.metabolites.get_by_id("h_c"): -1})
@@ -15,6 +15,6 @@ def test_sbo_annotation(model: Model) -> None:
# an existing SBO annotation
rxns.get_by_id("EX_h_e").annotation["sbo"] = "SBO:0000628"
add_SBO(model)
- assert rxns.EX_o2_e.annotation["sbo"] == "SBO:0000627"
- assert rxns.DM_h_c.annotation["sbo"] == "SBO:0000628"
- assert rxns.EX_h_e.annotation["sbo"] == "SBO:0000628"
+ assert rxns.EX_o2_e.annotation["sbo"] == ["SBO:0000627"]
+ assert rxns.DM_h_c.annotation["sbo"] == ["SBO:0000628"]
+ assert rxns.EX_h_e.annotation["sbo"] == ["SBO:0000628"]
diff --git a/tests/test_manipulation/test_delete.py b/tests/test_manipulation/test_delete.py
index c745a1efb..d79f48527 100644
--- a/tests/test_manipulation/test_delete.py
+++ b/tests/test_manipulation/test_delete.py
@@ -110,7 +110,7 @@ def test_gene_knockout(salmonella: Model) -> None:
assert expected_reactions == knocked_out_reactions
with salmonella:
expected_reactions = [salmonella.reactions.get_by_id("4PEPTabcpp")]
- knocked_out_reactions = knock_out_model_genes(salmonella, ["STM1746.S"])
+ knocked_out_reactions = knock_out_model_genes(salmonella, ["STM1746_S"])
assert expected_reactions == knocked_out_reactions
knocked_out_reactions = knock_out_model_genes(salmonella, gene_list)
assert len(knocked_out_reactions) == 13
diff --git a/tox.ini b/tox.ini
index adca66347..5d73515af 100644
--- a/tox.ini
+++ b/tox.ini
@@ -123,6 +123,7 @@ known_third_party =
ruamel.yaml
scipy
swiglpk
+ jsonschema
[flake8]
exclude =