diff --git a/experiment/aim.md b/experiment/aim.md index 4bc1c54..b4e04b4 100644 --- a/experiment/aim.md +++ b/experiment/aim.md @@ -1 +1,5 @@ -### Aim of the experiment +### Aim : To develop an application using On-Delay timer. + +### Objective: +1. Study the timing diagram of On Delay Timer +2. Solve the assignment of Ton timer \ No newline at end of file diff --git a/experiment/assert/css/images/Thumbs.db b/experiment/assert/css/images/Thumbs.db new file mode 100644 index 0000000..e3466e0 Binary files /dev/null and b/experiment/assert/css/images/Thumbs.db differ diff --git a/experiment/assert/css/images/add.png b/experiment/assert/css/images/add.png new file mode 100644 index 0000000..7428c48 Binary files /dev/null and b/experiment/assert/css/images/add.png differ diff --git a/experiment/assert/css/images/backnav.png b/experiment/assert/css/images/backnav.png new file mode 100644 index 0000000..d3e19ff Binary files /dev/null and b/experiment/assert/css/images/backnav.png differ diff --git a/experiment/assert/css/images/close.png b/experiment/assert/css/images/close.png new file mode 100644 index 0000000..9b43c0a Binary files /dev/null and b/experiment/assert/css/images/close.png differ diff --git a/experiment/assert/css/images/cut.png b/experiment/assert/css/images/cut.png new file mode 100644 index 0000000..f215d6f Binary files /dev/null and b/experiment/assert/css/images/cut.png differ diff --git a/experiment/assert/css/images/door.png b/experiment/assert/css/images/door.png new file mode 100644 index 0000000..369fc46 Binary files /dev/null and b/experiment/assert/css/images/door.png differ diff --git a/experiment/assert/css/images/down.png b/experiment/assert/css/images/down.png new file mode 100644 index 0000000..ea66d55 Binary files /dev/null and b/experiment/assert/css/images/down.png differ diff --git a/experiment/assert/css/images/full.png b/experiment/assert/css/images/full.png new file mode 100644 index 0000000..3d07183 Binary files /dev/null and b/experiment/assert/css/images/full.png differ diff --git a/experiment/assert/css/images/min.png b/experiment/assert/css/images/min.png new file mode 100644 index 0000000..03fb9be Binary files /dev/null and b/experiment/assert/css/images/min.png differ diff --git a/experiment/assert/css/images/new.png b/experiment/assert/css/images/new.png new file mode 100644 index 0000000..bf11955 Binary files /dev/null and b/experiment/assert/css/images/new.png differ diff --git a/experiment/assert/css/images/open.png b/experiment/assert/css/images/open.png new file mode 100644 index 0000000..4da7ec2 Binary files /dev/null and b/experiment/assert/css/images/open.png differ diff --git a/experiment/assert/css/images/page_white_copy.png b/experiment/assert/css/images/page_white_copy.png new file mode 100644 index 0000000..a9f31a2 Binary files /dev/null and b/experiment/assert/css/images/page_white_copy.png differ diff --git a/experiment/assert/css/images/page_white_delete.png b/experiment/assert/css/images/page_white_delete.png new file mode 100644 index 0000000..af1ecaf Binary files /dev/null and b/experiment/assert/css/images/page_white_delete.png differ diff --git a/experiment/assert/css/images/page_white_edit.png b/experiment/assert/css/images/page_white_edit.png new file mode 100644 index 0000000..b93e776 Binary files /dev/null and b/experiment/assert/css/images/page_white_edit.png differ diff --git a/experiment/assert/css/images/page_white_paste.png b/experiment/assert/css/images/page_white_paste.png new file mode 100644 index 0000000..5b2cbb3 Binary files /dev/null and b/experiment/assert/css/images/page_white_paste.png differ diff --git a/experiment/assert/css/images/play1.png b/experiment/assert/css/images/play1.png new file mode 100644 index 0000000..38f8e8f Binary files /dev/null and b/experiment/assert/css/images/play1.png differ diff --git a/experiment/assert/css/images/run.jpg b/experiment/assert/css/images/run.jpg new file mode 100644 index 0000000..e66e6d6 Binary files /dev/null and b/experiment/assert/css/images/run.jpg differ diff --git a/experiment/assert/css/images/save.png b/experiment/assert/css/images/save.png new file mode 100644 index 0000000..b57a3ca Binary files /dev/null and b/experiment/assert/css/images/save.png differ diff --git a/experiment/assert/css/images/ui-bg_flat_0_aaaaaa_40x100.png b/experiment/assert/css/images/ui-bg_flat_0_aaaaaa_40x100.png new file mode 100644 index 0000000..5b5dab2 Binary files /dev/null and b/experiment/assert/css/images/ui-bg_flat_0_aaaaaa_40x100.png differ diff --git a/experiment/assert/css/images/ui-bg_flat_75_ffffff_40x100.png b/experiment/assert/css/images/ui-bg_flat_75_ffffff_40x100.png new file mode 100644 index 0000000..ac8b229 Binary files /dev/null and b/experiment/assert/css/images/ui-bg_flat_75_ffffff_40x100.png differ diff --git a/experiment/assert/css/images/ui-bg_glass_55_fbf9ee_1x400.png b/experiment/assert/css/images/ui-bg_glass_55_fbf9ee_1x400.png new file mode 100644 index 0000000..ad3d634 Binary files /dev/null and b/experiment/assert/css/images/ui-bg_glass_55_fbf9ee_1x400.png differ diff --git a/experiment/assert/css/images/ui-bg_glass_65_ffffff_1x400.png b/experiment/assert/css/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 0000000..42ccba2 Binary files /dev/null and b/experiment/assert/css/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/experiment/assert/css/images/ui-bg_glass_75_dadada_1x400.png b/experiment/assert/css/images/ui-bg_glass_75_dadada_1x400.png new file mode 100644 index 0000000..5a46b47 Binary files /dev/null and b/experiment/assert/css/images/ui-bg_glass_75_dadada_1x400.png differ diff --git a/experiment/assert/css/images/ui-bg_glass_75_e6e6e6_1x400.png b/experiment/assert/css/images/ui-bg_glass_75_e6e6e6_1x400.png new file mode 100644 index 0000000..86c2baa Binary files /dev/null and b/experiment/assert/css/images/ui-bg_glass_75_e6e6e6_1x400.png differ diff --git a/experiment/assert/css/images/ui-bg_glass_95_fef1ec_1x400.png b/experiment/assert/css/images/ui-bg_glass_95_fef1ec_1x400.png new file mode 100644 index 0000000..4443fdc Binary files /dev/null and b/experiment/assert/css/images/ui-bg_glass_95_fef1ec_1x400.png differ diff --git a/experiment/assert/css/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/experiment/assert/css/images/ui-bg_highlight-soft_75_cccccc_1x100.png new file mode 100644 index 0000000..7c9fa6c Binary files /dev/null and b/experiment/assert/css/images/ui-bg_highlight-soft_75_cccccc_1x100.png differ diff --git a/experiment/assert/css/images/ui-icons_222222_256x240.png b/experiment/assert/css/images/ui-icons_222222_256x240.png new file mode 100644 index 0000000..b273ff1 Binary files /dev/null and b/experiment/assert/css/images/ui-icons_222222_256x240.png differ diff --git a/experiment/assert/css/images/ui-icons_2e83ff_256x240.png b/experiment/assert/css/images/ui-icons_2e83ff_256x240.png new file mode 100644 index 0000000..09d1cdc Binary files /dev/null and b/experiment/assert/css/images/ui-icons_2e83ff_256x240.png differ diff --git a/experiment/assert/css/images/ui-icons_454545_256x240.png b/experiment/assert/css/images/ui-icons_454545_256x240.png new file mode 100644 index 0000000..59bd45b Binary files /dev/null and b/experiment/assert/css/images/ui-icons_454545_256x240.png differ diff --git a/experiment/assert/css/images/ui-icons_888888_256x240.png b/experiment/assert/css/images/ui-icons_888888_256x240.png new file mode 100644 index 0000000..6d02426 Binary files /dev/null and b/experiment/assert/css/images/ui-icons_888888_256x240.png differ diff --git a/experiment/assert/css/images/ui-icons_cd0a0a_256x240.png b/experiment/assert/css/images/ui-icons_cd0a0a_256x240.png new file mode 100644 index 0000000..2ab019b Binary files /dev/null and b/experiment/assert/css/images/ui-icons_cd0a0a_256x240.png differ diff --git a/experiment/assert/css/impromptu.css b/experiment/assert/css/impromptu.css new file mode 100644 index 0000000..82e172f --- /dev/null +++ b/experiment/assert/css/impromptu.css @@ -0,0 +1,291 @@ +/* +------------------------------ + Impromptu +------------------------------ +*/ +.jqifade{ + position: absolute; + background-color: #777777; +} +div.jqi{ + width: 400px; + font-family: Verdana, Geneva, Arial, Helvetica, sans-serif; + position: absolute; + background-color: #ffffff; + font-size: 11px; + text-align: left; + border: solid 1px #eeeeee; + border-radius: 10px; + -moz-border-radius: 10px; + -webkit-border-radius: 10px; + padding: 7px; +} +div.jqi .jqicontainer{ + font-weight: bold; +} +div.jqi .jqiclose{ + position: absolute; + top: 4px; right: -2px; + width: 18px; + cursor: default; + color: #bbbbbb; + font-weight: bold; +} +div.jqi .jqimessage{ + padding: 10px; + line-height: 20px; + color: #444444; +} +div.jqi .jqibuttons{ + text-align: right; + padding: 5px 0 5px 0; + border: solid 1px #eeeeee; + background-color: #f4f4f4; +} +div.jqi button{ + padding: 3px 10px; + margin: 0 10px; + background-color: #2F6073; + border: solid 1px #f4f4f4; + color: #ffffff; + font-weight: bold; + font-size: 12px; +} +div.jqi button:hover{ + background-color: #728A8C; +} +div.jqi button.jqidefaultbutton{ + background-color: #BF5E26; +} +.jqiwarning .jqi .jqibuttons{ + background-color: #BF5E26; +} + +.jqi .jqiarrow{ position: absolute; height: 0; width:0; line-height: 0; font-size: 0; border: solid 10px transparent;} + +.jqi .jqiarrowtl{ left: 10px; top: -20px; border-bottom-color: #ffffff; } +.jqi .jqiarrowtc{ left: 50%; top: -20px; border-bottom-color: #ffffff; margin-left: -10px; } +.jqi .jqiarrowtr{ right: 10px; top: -20px; border-bottom-color: #ffffff; } + +.jqi .jqiarrowbl{ left: 10px; bottom: -20px; border-top-color: #ffffff; } +.jqi .jqiarrowbc{ left: 50%; bottom: -20px; border-top-color: #ffffff; margin-left: -10px; } +.jqi .jqiarrowbr{ right: 10px; bottom: -20px; border-top-color: #ffffff; } + +.jqi .jqiarrowlt{ left: -20px; top: 10px; border-right-color: #ffffff; } +.jqi .jqiarrowlm{ left: -20px; top: 50%; border-right-color: #ffffff; margin-top: -10px; } +.jqi .jqiarrowlb{ left: -20px; bottom: 10px; border-right-color: #ffffff; } + +.jqi .jqiarrowrt{ right: -20px; top: 10px; border-left-color: #ffffff; } +.jqi .jqiarrowrm{ right: -20px; top: 50%; border-left-color: #ffffff; margin-top: -10px; } +.jqi .jqiarrowrb{ right: -20px; bottom: 10px; border-left-color: #ffffff; } + +/* +------------------------------ + impromptu +------------------------------ +*/ +.impromptuwarning .impromptu{ background-color: #aaaaaa; } +.impromptufade{ + position: absolute; + background-color: #ffffff; +} +div.impromptu{ + position: absolute; + background-color: #cccccc; + padding: 10px; + width: 300px; + text-align: left; +} +div.impromptu .impromptuclose{ + float: right; + margin: -35px -10px 0 0; + cursor: pointer; + color: #213e80; +} +div.impromptu .impromptucontainer{ + background-color: #213e80; + padding: 5px; + color: #ffffff; + font-weight: bold; +} +div.impromptu .impromptumessage{ + background-color: #415ea0; + padding: 10px; +} +div.impromptu .impromptubuttons{ + text-align: center; + padding: 5px 0 0 0; +} +div.impromptu button{ + padding: 3px 10px 3px 10px; + margin: 0 10px; +} + +/* +------------------------------ + columns ex +------------------------------ +*/ +.colsJqifadewarning .colsJqi{ background-color: #b0be96; } +.colsJqifade{ + position: absolute; + background-color: #ffffff; +} +div.colsJqi{ + position: absolute; + background-color: #d0dEb6; + padding: 10px; + width: 400px; + text-align: left; +} +div.colsJqi .colsJqiclose{ + float: right; + margin: -35px -10px 0 0; + cursor: pointer; + color: #bbbbbb; +} +div.colsJqi .colsJqicontainer{ + background-color: #e0eEc6; + padding: 5px; + color: #ffffff; + font-weight: bold; + height: 160px; +} +div.colsJqi .colsJqimessage{ + background-color: #c0cEa6; + padding: 10px; + width: 280px; + height: 140px; + float: left; +} +div.colsJqi .jqibuttons{ + text-align: center; + padding: 5px 0 0 0; +} +div.colsJqi button{ + background: url(../images/button_bg.jpg) top left repeat-x #ffffff; + border: solid #777777 1px; + font-size: 12px; + padding: 3px 10px 3px 10px; + margin: 5px 5px 5px 10px; + width: 75px; +} +div.colsJqi button:hover{ + border: solid #aaaaaa 1px; +} + +/* +------------------------------ + brown theme +------------------------------ +*/ +.brownJqiwarning .brownJqi{ background-color: #cccccc; } +.brownJqifade{ + position: absolute; + background-color: #ffffff; +} +div.brownJqi{ + position: absolute; + background-color: transparent; + padding: 10px; + width: 300px; + text-align: left; +} +div.brownJqi .brownJqiclose{ + float: right; + margin: -20px 0 0 0; + cursor: pointer; + color: #777777; + font-size: 11px; +} +div.brownJqi .brownJqicontainer{ + position: relative; + background-color: transparent; + border: solid 1px #5F5D5A; + color: #ffffff; + font-weight: bold; +} +div.brownJqi .brownJqimessage{ + position: relative; + background-color: #F7F6F2; + border-top: solid 1px #C6B8AE; + border-bottom: solid 1px #C6B8AE; +} +div.brownJqi .brownJqimessage h3{ + background: url(../images/brown_theme_gradient.jpg) top left repeat-x #ffffff; + margin: 0; + padding: 7px 0 7px 15px; + color: #4D4A47; +} +div.brownJqi .brownJqimessage p{ + padding: 10px; + color: #777777; +} +div.brownJqi .brownJqimessage img.helpImg{ + position: absolute; + bottom: -25px; + left: 10px; +} +div.brownJqi .brownJqibuttons{ + text-align: right; +} +div.brownJqi button{ + background: url(../images/brown_theme_gradient.jpg) top left repeat-x #ffffff; + border: solid #777777 1px; + font-size: 12px; + padding: 3px 10px 3px 10px; + margin: 5px 5px 5px 10px; +} +div.brownJqi button:hover{ + border: solid #aaaaaa 1px; +} + +/* +*------------------------ +* clean blue ex +*------------------------ +*/ +.cleanbluewarning .cleanblue{ background-color: #acb4c4; } +.cleanbluefade{ position: absolute; background-color: #aaaaaa; } +div.cleanblue{ font-family: Verdana, Geneva, Arial, Helvetica, sans-serif; position: absolute; background-color: #ffffff; width: 300px; font-size: 11px; text-align: left; border: solid 1px #213e80; } +div.cleanblue .cleanbluecontainer{ background-color: #ffffff; border-top: solid 14px #213e80; padding: 5px; font-weight: bold; } +div.cleanblue .cleanblueclose{ float: right; width: 18px; cursor: default; margin: -19px -12px 0 0; color: #ffffff; font-weight: bold; } +div.cleanblue .cleanbluemessage{ padding: 10px; line-height: 20px; font-size: 11px; color: #333333; } +div.cleanblue .cleanbluebuttons{ text-align: right; padding: 5px 0 5px 0; border: solid 1px #eeeeee; background-color: #f4f4f4; } +div.cleanblue button{ padding: 3px 10px; margin: 0 10px; background-color: #314e90; border: solid 1px #f4f4f4; color: #ffffff; font-weight: bold; font-size: 12px; } +div.cleanblue button:hover{ border: solid 1px #d4d4d4; } + +/* +*------------------------ +* Ext Blue Ex +*------------------------ +*/ +.extbluewarning .extblue{ border:1px red solid; } +.extbluefade{ position: absolute; background-color: #ffffff; } +div.extblue{ border:1px #6289B6 solid; position: absolute; background-color: #CAD8EA; padding: 0; width: 300px; text-align: left; } +div.extblue .extblueclose{ background-color: #CAD8EA; margin:2px -2px 0 0; cursor: pointer; color: red; text-align: right; } +div.extblue .extbluecontainer{ background-color: #CAD8EA; padding: 0 5px 5px 5px; color: #000000; font:normal 11px Verdana; } +div.extblue .extbluemessage{ background-color: #CAD8EA; padding: 0; margin:0 15px 15px 15px; } +div.extblue .extbluebuttons{ text-align: center; padding: 0px 0 0 0; } +div.extblue button{ padding: 1px 4px; margin: 0 10px; background-color:#cccccc; font-weight:normal; font-family:Verdana; font-size:10px; } + +/* +*------------------------ +* smooth Ex +*------------------------ +*/ +.jqismoothfade{ position: absolute; background-color: #333333; } +div.jqismooth{ width: 350px; font-family: Verdana, Geneva, Arial, Helvetica, sans-serif; position: absolute; background-color: #ffffff; font-size: 11px; text-align: left; border: solid 3px #e2e8e6; -moz-border-radius: 10px; -webkit-border-radius: 10px; padding: 7px; } +div.jqismooth .jqismoothcontainer{ font-weight: bold; } +div.jqismooth .jqismoothclose{ position: absolute; top: 0; right: 0; width: 18px; cursor: default; text-align: center; padding: 2px 0 4px 0; color: #727876; font-weight: bold; background-color: #e2e8e6; -moz-border-radius-bottomLeft: 5px; -webkit-border-bottom-left-radius: 5px; border-left: solid 1px #e2e8e6; border-bottom: solid 1px #e2e8e6; } +div.jqismooth .jqismoothmessage{ padding: 10px; line-height: 20px; color: #444444; } +div.jqismooth .jqismoothbuttons{ text-align: right; padding: 5px 0 5px 0; border: solid 1px #e2e8e6; background-color: #f2f8f6; } +div.jqismooth button{ padding: 3px 10px; margin: 0 10px; background-color: #2F6073; border: solid 1px #f4f4f4; color: #ffffff; font-weight: bold; font-size: 12px; } +div.jqismooth button:hover{ background-color: #728A8C; } +div.jqismooth button.jqismoothdefaultbutton{ background-color: #BF5E26; } +.jqismoothwarning .jqismooth .jqismoothbuttons{ background-color: #BF5E26; } + +.jqi .errorBlock{ background-color: #FFC6A5; border: solid 1px #ff0000; color: #ff0000; padding: 5px 10px; font-weight: bold; } +.jqi .field{ margin: 4px 0; font-size: 11px; } +.jqi .field label{ font-weight: bold; display: block; width: 100px; float: left; clear: left; color : black} +.jqi .field input { border: solid 1px #777777; width: 100px; } diff --git a/experiment/assert/css/jquery-ui-1.8.20.custom.css b/experiment/assert/css/jquery-ui-1.8.20.custom.css new file mode 100644 index 0000000..d9be863 --- /dev/null +++ b/experiment/assert/css/jquery-ui-1.8.20.custom.css @@ -0,0 +1,568 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?tr&ffDefault=Helvetica,%20Arial,%20sans-serif&fwDefault=normal&fsDefault=1.1&fsDefaultUnit=em&cornerRadius=5&cornerRadiusUnit=px&bgColorHeader=888888&bgTextureHeader=04_highlight_hard.png&bgImgOpacityHeader=15&borderColorHeader=404040&fcHeader=ffffff&iconColorHeader=cccccc&bgColorContent=121212&bgTextureContent=12_gloss_wave.png&bgImgOpacityContent=16&borderColorContent=404040&fcContent=eeeeee&iconColorContent=bbbbbb&bgColorDefault=adadad&bgTextureDefault=03_highlight_soft.png&bgImgOpacityDefault=35&borderColorDefault=cccccc&fcDefault=333333&iconColorDefault=666666&bgColorHover=dddddd&bgTextureHover=03_highlight_soft.png&bgImgOpacityHover=60&borderColorHover=dddddd&fcHover=000000&iconColorHover=c98000&bgColorActive=121212&bgTextureActive=05_inset_soft.png&bgImgOpacityActive=15&borderColorActive=000000&fcActive=ffffff&iconColorActive=f29a00&bgColorHighlight=555555&bgTextureHighlight=04_highlight_hard.png&bgImgOpacityHighlight=55&borderColorHighlight=404040&fcHighlight=cccccc&iconColorHighlight=aaaaaa&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Helvetica, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Helvetica, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #404040; background: #121212 url(images/ui-bg_gloss-wave_16_121212_500x100.png) 50% top repeat-x; color: #eeeeee; } +.ui-widget-content a { color: #eeeeee; } +.ui-widget-header { border: 1px solid #404040; background: #888888 url(images/ui-bg_highlight-hard_15_888888_1x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; } +.ui-widget-header a { color: #ffffff; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #adadad url(images/ui-bg_highlight-soft_35_adadad_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #333333; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #333333; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #dddddd; background: #dddddd url(images/ui-bg_highlight-soft_60_dddddd_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; } +.ui-state-hover a, .ui-state-hover a:hover { color: #000000; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #000000; background: #121212 url(images/ui-bg_inset-soft_15_121212_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #ffffff; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #404040; background: #555555 url(images/ui-bg_highlight-hard_55_555555_1x100.png) 50% top repeat-x; color: #cccccc; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #cccccc; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_bbbbbb_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_bbbbbb_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_cccccc_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_666666_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_c98000_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_f29a00_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_aaaaaa_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -khtml-border-top-left-radius: 5px; border-top-left-radius: 5px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; -khtml-border-top-right-radius: 5px; border-top-right-radius: 5px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; -khtml-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; -khtml-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*! + * jQuery UI Resizable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*! + * jQuery UI Selectable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/*! + * jQuery UI Accordion 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/*! + * jQuery UI Autocomplete 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.20 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/*! + * jQuery UI Button 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; background: url("../images/new-tab.png") no-repeat scroll 0 0 transparent; + height: 16px; + margin: 17px 31px; + width: 14px; overflow: visible; border: medium none; cursor: pointer;} /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/*! + * jQuery UI Dialog 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/*! + * jQuery UI Slider 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/*! + * jQuery UI Tabs 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/*! + * jQuery UI Datepicker 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/*! + * jQuery UI Progressbar 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/experiment/assert/css/jquery.contextMenu.css b/experiment/assert/css/jquery.contextMenu.css new file mode 100644 index 0000000..1cba994 --- /dev/null +++ b/experiment/assert/css/jquery.contextMenu.css @@ -0,0 +1,179 @@ +/*! + * jQuery contextMenu - Plugin for simple contextMenu handling + * + * Version: 1.5.20 + * + * Authors: Rodney Rehm, Addy Osmani (patches for FF) + * Web: http://medialize.github.com/jQuery-contextMenu/ + * + * Licensed under + * MIT License http://www.opensource.org/licenses/mit-license + * GPL v3 http://opensource.org/licenses/GPL-3.0 + * + */ + +.context-menu-list { + margin:0; + padding:0; + + min-width: 120px; + max-width: 250px; + display: inline-block; + position: absolute; + list-style-type: none; + + border: 1px solid #DDD; + background: #EEE; + + -webkit-box-shadow: 0 2px 5px rgba(0, 0, 0, 0.5); + -moz-box-shadow: 0 2px 5px rgba(0, 0, 0, 0.5); + -ms-box-shadow: 0 2px 5px rgba(0, 0, 0, 0.5); + -o-box-shadow: 0 2px 5px rgba(0, 0, 0, 0.5); + box-shadow: 0 2px 5px rgba(0, 0, 0, 0.5); + + font-family: Verdana, Arial, Helvetica, sans-serif; + font-size: 11px; +} + +.context-menu-item { + padding: 2px 2px 2px 24px; + background-color: #EEE; + position: relative; + -webkit-user-select: none; + -moz-user-select: -moz-none; + -ms-user-select: none; + user-select: none; +} + +.context-menu-separator { + padding-bottom:0; + border-bottom: 1px solid #DDD; +} + +.context-menu-item > label > input, +.context-menu-item > label > textarea { + -webkit-user-select: text; + -moz-user-select: text; + -ms-user-select: text; + user-select: text; +} + +.context-menu-item.hover { + cursor: pointer; + background-color: #39F; +} + +.context-menu-item.disabled { + color: #666; +} + +.context-menu-input.hover, +.context-menu-item.disabled.hover { + cursor: default; + background-color: #EEE; +} + +.context-menu-submenu:after { + content: ">"; + color: #666; + position: absolute; + top: 0; + right: 3px; + z-index: 1; +} + +/* icons + #protip: + In case you want to use sprites for icons (which I would suggest you do) have a look at + http://css-tricks.com/13224-pseudo-spriting/ to get an idea of how to implement + .context-menu-item.icon:before {} + */ +.context-menu-item.icon { min-height: 18px; background-repeat: no-repeat; background-position: 4px 2px; } +.context-menu-item.icon-edit { background-image: url(images/page_white_edit.png); } +.context-menu-item.icon-cut { background-image: url(images/cut.png); } +.context-menu-item.icon-copy { background-image: url(images/page_white_copy.png); } +.context-menu-item.icon-paste { background-image: url(images/page_white_paste.png); } +.context-menu-item.icon-delete { background-image: url(images/page_white_delete.png); } +.context-menu-item.icon-quit { background-image: url(images/door.png); } + +/* vertically align inside labels */ +.context-menu-input > label > * { vertical-align: top; } + +/* position checkboxes and radios as icons */ +.context-menu-input > label > input[type="checkbox"], +.context-menu-input > label > input[type="radio"] { + margin-left: -17px; +} +.context-menu-input > label > span { + margin-left: 5px; +} + +.context-menu-input > label, +.context-menu-input > label > input[type="text"], +.context-menu-input > label > textarea, +.context-menu-input > label > select { + display: block; + width: 100%; + + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + -ms-box-sizing: border-box; + -o-box-sizing: border-box; + box-sizing: border-box; +} + +.context-menu-input > label > textarea { + height: 100px; +} +.context-menu-item > .context-menu-list { + display: none; + /* re-positioned by js */ + right: -5px; + top: 5px; +} + +.context-menu-item.hover > .context-menu-list { + display: block; +} + +.context-menu-accesskey { + text-decoration: underline; +} + +/* menu header */ +.css-title:before { + content: "some CSS title"; + display: block; + position: absolute; + top: 0; + right: 0; + left: 0; + background: #DDD; + padding: 2px; + + font-family: Verdana, Arial, Helvetica, sans-serif; + font-size: 11px; + font-weight: bold; +} +.css-title :first-child { + margin-top: 20px; +} + +/* menu header via data attribute */ +.data-title:before { + content: attr(data-menutitle); + display: block; + position: absolute; + top: 0; + right: 0; + left: 0; + background: #DDD; + padding: 2px; + + font-family: Verdana, Arial, Helvetica, sans-serif; + font-size: 11px; + font-weight: bold; +} +.data-title :first-child { + margin-top: 20px; +} \ No newline at end of file diff --git a/experiment/assert/css/jquery.ui.all.css b/experiment/assert/css/jquery.ui.all.css new file mode 100644 index 0000000..e929327 --- /dev/null +++ b/experiment/assert/css/jquery.ui.all.css @@ -0,0 +1,11 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming + */ +@import "jquery.ui.base.css"; +@import "jquery.ui.theme.css"; diff --git a/experiment/assert/css/tabs1.css b/experiment/assert/css/tabs1.css new file mode 100644 index 0000000..fc1e2e8 --- /dev/null +++ b/experiment/assert/css/tabs1.css @@ -0,0 +1,387 @@ +* { + margin: 0; + padding: 0; +} +body { + font: 14px/1.4 arial, Arial, Helvetica, sans-serif; + min-width: 1200px; + background: url(..assert/images/body-bg.png); +} +article,aside,footer,header,nav,section { + display: block; +} +.width-set { + width: 1200px; + margin: 0 auto; +} +.left{ + float: left; +} +.right{ + float: right; +} +.text{ + text-decoration: none; +} +header { + background: url(..assert/images/header-bg.png) repeat-x ; + height: 55px; +} +footer { + background: url(..assert/images/footer-bg.png) repeat-x; + height: 55px; +} +.logo { + color: #73BC1E; + font-size: 30px; + margin-right: 42px; +} +label { + color: #FFFFFF; +} +header nav ul li { + font-size: 12px; + padding: 14px 17px 14px 22px; + background: url(..assert/images/nav-separator.png) no-repeat; + list-style: none; + height: 17px; +} +header nav ul li a { + color: #999999; +} +header nav ul li a:hover { + color: #ffffff; +} +header nav ul li.current a { + color: #ffffff; +} +.main-page { + height: 1069px; +} +hgroup h2{ + color: #666666; + font-size: 15px; + font-weight: normal; + margin: -52px 3px; +} +.main-head { + background: url(..assert/images/plc-head-bg.png); + border: 1px solid #A6A6A6; + border-radius: 8px 8px 8px 8px; + height: 140px; + behavior: url(PIE.htc); +} +.main-head div.button-menu { + background: url("..assert/images/button.png") repeat scroll 0 0 transparent; + border: 1px solid #A6A6A6; + border-radius: 8px 8px 8px 8px; + height: 40px; + margin: 15px 26px; + width: 622px; + behavior: url(PIE.htc); +} +.main-head div.button-menu a { + background: url("..assert/images/button-separator.png") no-repeat scroll 0 0 transparent; + height: 39px; + padding: 8px 23px 0 27px; + font-size: 15px; + color: black; +} +.main-head div.button-menu a.first{ + background:transparent; +} +.main-head div.main-head-left div.button-menu a.current { + height: 33px; + color: #71B51E; + font-weight: bold; +} +.main-head div.main-head-left div.button-menu a:hover { + color: #71B51E; + height: 33px; +} +.main-footer div a.current { + height: 25px; + width: 86px; +} +.full-screen:hover { + background: url("..assert/images/icons/fullscreen-active.png") no-repeat scroll 0 0 transparent; +} +.main-content { + height: 699px; + margin-top: -5px; + border-left: 1px solid #999999; + border-right: 1px solid #999999; +} +.work-space{ + height: 651px; + width: 1198px; + background: white; + box-shadow: 0 -2px 4px #888888 inset; +} +footer label { + color: #727272; + font-size: 10px; + margin: 23px 0px 0px 490px; +} +hgroup h1 { + background: url("..assert/images/name.png") repeat scroll 0 0 transparent; + border-radius: 5px 5px 5px 5px; + font-size: 0; + height: 25px; + margin-top: 9px; + width: 100px; +} +hgroup h3 { + background: url("..assert/images/drop-down.png") no-repeat scroll 0 0 transparent; + font-size: 0; + height: 10px; + margin: 16px -90px; + width: 13px; +} +hgroup h4{ + background: url("..assert/images/plc-heading.png") no-repeat scroll 0 0 transparent; + font-size: 0; + height: 53px; + margin-top: 22px; +} +.menu-separator { + background: url("..assert/images/menu-separator.png") no-repeat scroll 0 0 transparent; + height: 140px; + width: 3px; + margin: 0 0 0 -5px; +} +.button-submenu{ + margin: 37px 22px 0; + padding: 43px 0 0; + width: 34px; + color: black; +} +.main-head-right a:nth-child(4){ + text-indent: -6px; +} +.main-head-right a:nth-child(2){ + text-indent: 6px; +} +.new{ + background: url("..assert/images/icons/new.png") no-repeat scroll 0 0 transparent; +} +.open { + background: url("..assert/images/icons/open.png") no-repeat scroll 0 0 transparent; + width: 48px; +} +.save { + background: url("..assert/images/icons/save.png") no-repeat scroll 0 0 transparent; +} +.compile { + text-indent: -9px; + background: url("..assert/images/icons/compile.png") no-repeat scroll 0 0 transparent; +} +.run { + background: url("..assert/images/icons/run.png") no-repeat scroll 0 0 transparent; +} +.new:hover { + background: url("..assert/images/icons/new-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.open:hover { + background: url("..assert/images/icons/open-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.save:hover { + background: url("..assert/images/icons/save-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.run:hover { + background: url("..assert/images/icons/run-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.compile:hover { + background: url("..assert/images/icons/compile-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.full-screen { + background: url("..assert/images/icons/fullscreen.png") no-repeat scroll 0 0 transparent; + height: 17px; + width: 20px; + margin: 5px 6px; +} +.tab-border { + background: none repeat scroll 0 0 #E7E7E7; + border-top: 1px solid #9C9C9C; + border-bottom: 1px solid #9C9C9C; + height: 8px; + margin-top: -1px; + width: 1198px; +} +section .Basic ,section .Arithmetic,section .Counters-Timers,section .Comparative,section .Instruction{ + margin: 3px 48px; + display:none; +} +.buttons { + background: url("..assert/images/sub-button.png") repeat scroll 0 0 transparent; + border: 1px solid #505050; + border-radius: 6px 6px 6px 6px; + color: #505050; + height: 25px; + margin-left: 20px; + width: 50px; + behavior: url(PIE.htc); +} +.main-footer { + background: none repeat scroll 0 0 white; + border: 1px solid #999999; + box-shadow: 0 2px 4px #888888 inset; + height: 184px; + margin-top: -4px; + width: 1198px; + behavior: url(PIE.htc); +} +article.main-footer div { + background: url("..assert/images/button.png") repeat scroll 0 0 transparent; + height: 28px; + border-bottom: 1px solid #A6A6A6; +} +article.main-footer div a { + border-right: 2px solid #555555; + height: 25px; + width: 86px; +} +article.main-footer div a { + color: black; + text-align: center; + padding: 4px 8px 0 15px; +} +.console-window { + color: red; +} +.tab-list { + height: 34px; + margin: 4px 0 0; + overflow: hidden; + padding: 0; + width: 1198px; +} +.main-head-left { + width: 692px; + height: 137px; +} +.main-head-right { + width: 490px; +} +/* Tab Structure */ +.tab-list{ + list-style-type: none; + overflow: hidden; + height: 35px; + margin: 0; + padding: 0; +} + + +.tab-list dt{ + margin-top: 0px; + height: 33px; + width: 162px; + position: relative; + border-top-right-radius: 20px 60px; + border-top-left-radius: 20px 60px; + border: 1px solid transparent; + margin-left: -10px; + z-index: 1; +} + +.tab-list li:first-child{ + margin-left: 0; +} + +.tab-list .current{ + z-index: 2; +} + +.left-mask, .right-mask{ +} + +.current .left-mask, .current .right-mask{ + height: 4px; +} + +.left-mask{ +} + +.right-mask{ + right: -1px; +} + +.left-mask span, .right-mask span{ +} + +.left-mask span{ +} + +.right-mask span{ +} + +.tab-list dt a{ + display: block; + float: left; + line-height: 25px; + padding-left: 40px; + font-family: sans-serif; + font-size: 13px; + background-image: url(default.png); + background-repeat: no-repeat; + background-position: 18px center; + color: #444; + text-decoration: none; +} + +.tab-list{ + box-shadow: inset 0 1px 1px #fff, inset 0 -1px 1px #9c9c9c; + background: rgb(207,207,207); /* Old browsers */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#cfcfcf', endColorstr='#b0b0b0',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* W3C */ +} + +.tab-list dt{ + background: rgb(255,255,255); /* Old browsers */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#9c9c9c',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* W3C */ + border: 1px solid #9c9c9c; + box-shadow: inset 0 0 2px #fff; +} + +.tab-list dt.current{ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#e7e7e7',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* W3C */ +} + +.left-mask span, .right-mask span{ +} + +.left-mask span{ +} + +.right-mask span{ +} + +.current .left-mask span, .current .right-mask span{ +} +.tab-list dt div.img { + background: url("../images/tab-close.png") no-repeat scroll 0 0 transparent; + height: 7px; + margin: 9px 15px; + width: 12px; +} +.tab-list dt.current div.img,.tab-list dt div.img:hover { + background: url("..assert/images/tab-close-active.png") no-repeat scroll 0 0 transparent; +} +a.create-tab { + background: url("..assert/images/new-tab.png") no-repeat scroll 0 0 transparent; + margin: 17px 31px; + height: 16px; + width: 14px; +} +a.create-tab:hover { + background: url("..assert/images/new-tab-active.png") no-repeat scroll 0 0 transparent; +} + \ No newline at end of file diff --git a/experiment/assert/css/tabs11.css b/experiment/assert/css/tabs11.css new file mode 100644 index 0000000..b966f45 --- /dev/null +++ b/experiment/assert/css/tabs11.css @@ -0,0 +1,433 @@ +* { + margin: 0; + padding: 0; +} +body { + font: 14px/1.4 arial, Arial, Helvetica, sans-serif; + min-width: 1200px; + background: url(../images/body-bg.png); +} +article,aside,footer,header,nav,section { + display: block; +} +.group:before,.group:after { + content: ""; + display: table; +} + +.group:after { + clear: both; +} + +.group { + zoom: 1; /* For IE 6/7 (trigger hasLayout) */ +} +.width-set { + width: 1200px; + margin: 0 auto; +} +.left{ + float: left; +} +.right{ + float: right; +} +.text{ + text-decoration: none; +} +header { + background: url(../images/header-bg.png) repeat-x #303030; + height: 55px; +} +footer { + background: url(../images/footer-bg.png) repeat-x; + height: 55px; +} +.logo { + color: #567F26; + font-size: 35px; + margin-right: 42px; +} +label { + color: #FFFFFF; +} +header nav ul li { + font-size: 13px; + padding: 14px 17px 14px 22px; + background: url(../images/nav-separator.png) no-repeat; + list-style: none; +} +header nav ul li a { + color: #999999; + text-decoration: none; + behavior: url(PIE.htc); +} +header nav ul li a:hover { + color: #ffffff; +} +header nav ul li.current a { + color: #ffffff; + font-weight: bold; +} +.main-page { + height: 1069px; +} +h5 { + color: #888888; + font-size: 16px; + margin: -52px 3px; +} +.main-head { + background: url(../images/plc-head-bg.png); + border: 1px solid #A6A6A6; + border-radius: 5px; + height: 140px; + behavior: url(PIE.htc); +} +.main-head div.button-menu { + background: url("../images/button.png") repeat scroll 0 0 transparent; + border: 1px solid #A6A6A6; + border-radius: 5px 5px 5px 5px; + height: 40px; + margin: 15px 26px 15px 26px; + width: 622px; + behavior: url(PIE.htc); +} +.main-head div.button-menu a { + background: url("../images/button-separator.png") no-repeat scroll 0 0 transparent; + height: 39px; + padding: 8px 23px 0 27px; + font-size: 15px; + color: black; + text-decoration: none; + behavior: url(PIE.htc); +} +.main-head div.main-head-left div.button-menu a.current { + background-image: -webkit-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -moz-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -o-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + height: 33px; + color: #71B51E; + font-weight: bold; +} +.main-head div.main-head-left div.button-menu a:hover { + color: #71B51E; + height: 33px; +} +.main-footer div a.current { + background-image: -webkit-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -moz-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -o-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + height: 28px; + width: 100px; +} +.main-footer div a:hover { + background-image: -webkit-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -moz-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -o-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: linear-gradient(bottom, #FFFFFF 0%, #000000 100%); +} +.full-screen:hover { + background: url("../images/icons/fullscreen-active.png") no-repeat scroll 0 0 transparent; +} +.main-content { + height: 695px; + margin-top: -1px; + border-left: 1px solid #999999; + border-right: 1px solid #999999; + box-shadow: 0 -2px 4px #888888 inset; + behavior: url(PIE.htc); +} +footer label { + color: #727272; + font-size: 10px; + margin: 23px 0px 0px 490px; +} +h1 { + background: url("../images/name.png") repeat scroll 0 0 transparent; + border-radius: 5px 5px 5px 5px; + font-size: 0; + height: 25px; + margin-top: 9px; + width: 100px; + behavior: url(PIE.htc); + background-color:#00ff00; +} +h3 { + background: url("../images/drop-down.png") no-repeat scroll 0 0 transparent; + font-size: 0; + height: 10px; + margin: 16px -90px; + width: 13px; +} +h2 { + background: url("../images/plc-heading.png") no-repeat scroll 0 0 transparent; + font-size: 0; + height: 53px; + margin-top: 22px; +} +.menu-separator { + background: url("../images/menu-separator.png") no-repeat scroll 0 0 transparent; + height: 140px; + width: 3px; + margin: 0 0 0 -5px; +} +.button-submenu{ + margin: 37px 22px 0; + padding: 43px 0 0; + width: 34px; + color: black; + text-decoration: none; +} +.main-head-right a:nth-child(4){ + text-indent: -6px; +} +.main-head-right a:nth-child(2){ + text-indent: 6px; +} +.new{ + background: url("../images/icons/new.png") no-repeat scroll 0 0 transparent; +} +.open { + background: url("../images/icons/open.png") no-repeat scroll 0 0 transparent; + width: 48px; +} +.save { + background: url("../images/icons/save.png") no-repeat scroll 0 0 transparent; +} +.compile { + text-indent: -9px; + background: url("../images/icons/compile.png") no-repeat scroll 0 0 transparent; +} +.run { + background: url("../images/icons/run.png") no-repeat scroll 0 0 transparent; +} +.new:hover { + background: url("../images/icons/new-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.open:hover { + background: url("../images/icons/open-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.save:hover { + background: url("../images/icons/save-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.run:hover { + background: url("../images/icons/run-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.compile:hover { + background: url("../images/icons/compile-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.full-screen { + background: url("../images/icons/fullscreen.png") no-repeat scroll 0 0 transparent; + height: 17px; + width: 20px; + margin: 5px 6px; +} +.tab-border { + border-bottom: 1px solid #9C9C9C; + height: 10px; + width: 1198px; + background: #E7E7E7; +} +section .Basic ,section .Arithmetic,section .Counters-Timers,section .Comparative,section .Instruction{ + margin: 3px 48px; + display:none; +} +.buttons { + background: url("../images/sub-button.png") repeat scroll 0 0 transparent; + border: 1px solid #505050; + border-radius: 6px 6px 6px 6px; + color: #505050; + height: 25px; + margin-left: 20px; + width: 50px; + behavior: url(PIE.htc); +} +.main-footer { + border: 1px solid #999999; + height: 182px; + width: 1198px; + box-shadow: 0 -2px 4px #888888 inset; + behavior: url(PIE.htc); +} +article.main-footer div { + background: url("../images/button.png") repeat scroll 0 0 transparent; + height: 34px; + border-bottom: 1px solid #A6A6A6; +} +article.main-footer div a { + border-right: 2px solid #555555; + height: 28px; + width: 87px; +} +article.main-footer div a { + color: black; + padding: 7px 6px 0 20px; + text-decoration: none; + behavior: url(PIE.htc); +} +.console-window { + color: red; +} +.tab-list { + overflow: hidden; + height: 36px; + margin: 0; + padding: 0; +} +.main-head-left { + width: 675px; + height: 137px; +} +.main-head-right { + height: auto; + width: 521px; +} +/* Tab Structure */ + +.tab-list{ + list-style-type: none; + overflow: hidden; + height: 35px; + margin: 0; + padding: 0; +} +.tab-list dt{ + margin-top: 0px; + height: 33px; + width: 162px; + position: relative; + float:left; + border-top-right-radius: 20px 60px; + border-top-left-radius: 20px 60px; + border: 1px solid transparent; + margin-left: -10px; + z-index: 1; +} +.tab-list dt:first-child{ + margin-left: 0; +} +.tab-list .current{ + z-index: 2; +} +.left-mask, .right-mask{ + +} +.current .left-mask, .current .right-mask{ + height: 4px; +} +.left-mask{ + +} +.right-mask{ right: -1px; +} +.left-mask span, .right-mask span{ +} +.left-mask span{ +} +.right-mask span{ +} +.tab-list dt a{ + display: block; + float: left; + line-height: 25px; + padding-left: 40px; + font-family: sans-serif; + font-size: 13px; + background-image: url(default.png); + background-repeat: no-repeat; + background-position: 18px center; + color: #444; + text-decoration: none; + behavior: url(PIE.htc); +} +/* + +Theme For Tabs - based off of Chrome Default on MacOS X + +Gradients Generated by: http://www.colorzilla.com/gradient-editor/ + +*/ +.tab-list{ + box-shadow: inset 0 1px 1px #fff, inset 0 -1px 1px #9c9c9c; + background: rgb(207,207,207); /* Old browsers */ + background: -moz-linear-gradient(top, rgba(207,207,207,1) 0%, rgba(176,176,176,1) 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(207,207,207,1)), color-stop(100%,rgba(176,176,176,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#cfcfcf', endColorstr='#b0b0b0',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* W3C */ +} +.tab-list dt{ + background: rgb(255,255,255); /* Old browsers */ + background: -moz-linear-gradient(top, rgba(255,255,255,1) 0%, rgba(220,221,220,1) 4%, rgba(207,208,207,1) 39%, rgba(156,156,156,1) 40%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,1)), color-stop(4%,rgba(220,221,220,1)), color-stop(39%,rgba(207,208,207,1)), color-stop(40%,rgba(156,156,156,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#9c9c9c',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* W3C */ + border: 1px solid #9c9c9c; + box-shadow: inset 0 0 2px #fff; +} +.tab-list dt.current{ + background: rgb(255,255,255); /* Old browsers */ + background: -moz-linear-gradient(top, rgba(255,255,255,1) 0%, rgba(231,231,231,1) 30%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,1)), color-stop(30%,rgba(231,231,231,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#e7e7e7',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* W3C */ +} +.left-mask span, .right-mask span{ + +} + +.left-mask span{ + + +} + +.right-mask span{ + +} + +.current .left-mask span, .current .right-mask span{ + +} +.tab-list dt div.img { + background: url("../images/tab-close.png") no-repeat scroll 0 0 transparent; + float: right; + height: 7px; + margin: 3px 14px; + width: 12px; +} +.tab-list dt.current div.img,.tab-list dt div.img:hover { + background: url("../images/tab-close-active.png") no-repeat scroll 0 0 transparent; + float: right; + height: 7px; + margin: 3px 14px; + width: 12px; +} +a.create-tab { + background: url("../images/new-tab.png") no-repeat scroll 0 0 transparent; + margin: 17px 31px; + height: 16px; + width: 14px; +} +a.create-tab:hover { + background: url("../images/new-tab-active.png") no-repeat scroll 0 0 transparent; +} + \ No newline at end of file diff --git a/experiment/assert/css/tabs2.css b/experiment/assert/css/tabs2.css new file mode 100644 index 0000000..5edb973 --- /dev/null +++ b/experiment/assert/css/tabs2.css @@ -0,0 +1,383 @@ +* { + margin: 0; + padding: 0; +} +body { + font: 14px/1.4 arial, Arial, Helvetica, sans-serif; + min-width: 1200px; + background: url(..assert/images/body-bg.png); +} +article,aside,footer,header,nav,section { + display: block; +} +.width-set { + width: 1200px; + margin: 0 auto; +} +.left{ + float: left; +} +.right{ + float: right; +} +.text{ + text-decoration: none; +} +header { + background: url(..assert/images/header-bg.png) repeat-x ; + height: 55px; +} +footer { + background: url(..assert/images/footer-bg.png) repeat-x; + height: 55px; +} +.logo { + color: #73BC1E; + font-size: 30px; + margin-right: 42px; +} +label { + color: #FFFFFF; +} +header nav ul li { + font-size: 12px; + padding: 14px 17px 14px 22px; + background: url(..assert/images/nav-separator.png) no-repeat; + list-style: none; + height: 17px; +} +header nav ul li a { + color: #999999; +} +header nav ul li a:hover { + color: #ffffff; +} +header nav ul li.current a { + color: #ffffff; +} +.main-page { + height: 1069px; +} +hgroup h2{ + color: #666666; + font-size: 15px; + font-weight: normal; + margin: -52px 3px; +} +.main-head { + background: url(..assert/images/plc-head-bg.png); + border: 1px solid #A6A6A6; + border-radius: 8px 8px 8px 8px; + height: 140px; + behavior: url(PIE.htc); +} +.main-head div.button-menu { + background: url("..assert/images/button.png") repeat scroll 0 0 transparent; + border: 1px solid #A6A6A6; + border-radius: 8px 8px 8px 8px; + height: 40px; + margin: 15px 26px; + behavior: url(PIE.htc); +} +.main-head div.button-menu a { + background: url("..assert/images/button-separator.png") no-repeat scroll 0 0 transparent; + height: 39px; + padding: 8px 23px 0 27px; + font-size: 15px; + color: black; +} +.main-head div.button-menu a.first{ + background:transparent; +} +.main-head div.main-head-left div.button-menu a.current { + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + height: 33px; + color: #71B51E; + font-weight: bold; +} +.main-head div.main-head-left div.button-menu a:hover { + color: #71B51E; + height: 33px; +} +.main-footer div a.current { + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + height: 25px; + width: 86px; +} +.main-footer div a:hover { + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); +} +.full-screen:hover { + background: url("..assert/images/icons/fullscreen-active.png") no-repeat scroll 0 0 transparent; +} +.main-content { + height: 699px; + margin-top: -5px; + border-left: 1px solid #999999; + border-right: 1px solid #999999; +} +.work-space{ + height: 651px; + width: 1198px; + background: white; + box-shadow: 0 -2px 4px #888888 inset; +} +footer label { + color: #727272; + font-size: 10px; + margin: 23px 0px 0px 490px; +} +hgroup h1 { + background: url("..assert/images/name.png") repeat scroll 0 0 transparent; + border-radius: 5px 5px 5px 5px; + font-size: 0; + height: 25px; + margin-top: 9px; + width: 100px; +} +hgroup h3 { + background: url("..assert/images/drop-down.png") no-repeat scroll 0 0 transparent; + font-size: 0; + height: 10px; + margin: 16px -90px; + width: 13px; +} +hgroup h4{ + background: url("..assert/images/plc-heading.png") no-repeat scroll 0 0 transparent; + font-size: 0; + height: 53px; + margin-top: 22px; +} +.menu-separator { + background: url("..assert/images/menu-separator.png") no-repeat scroll 0 0 transparent; + height: 140px; + width: 3px; + margin: 0 0 0 -5px; +} +.button-submenu{ + margin: 37px 22px 0; + padding: 43px 0 0; + width: 34px; + color: black; +} +.main-head-right a:nth-child(4){ + text-indent: -6px; +} +.main-head-right a:nth-child(2){ + text-indent: 6px; +} +.new{ + background: url("..assert/images/icons/new.png") no-repeat scroll 0 0 transparent; +} +.open { + background: url("..assert/images/icons/open.png") no-repeat scroll 0 0 transparent; + width: 48px; +} +.save { + background: url("..assert/images/icons/save.png") no-repeat scroll 0 0 transparent; +} +.compile { + text-indent: -9px; + background: url("..assert/images/icons/compile.png") no-repeat scroll 0 0 transparent; +} +.run { + background: url("..assert/images/icons/run.png") no-repeat scroll 0 0 transparent; +} +.new:hover { + background: url("..assert/images/icons/new-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.open:hover { + background: url("..assert/images/icons/open-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.save:hover { + background: url("..assert/images/icons/save-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.run:hover { + background: url("..assert/images/icons/run-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.compile:hover { + background: url("..assert/images/icons/compile-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.full-screen { + background: url("..assert/images/icons/fullscreen.png") no-repeat scroll 0 0 transparent; + height: 17px; + width: 20px; + margin: 5px 6px; +} +.tab-border { + background: none repeat scroll 0 0 #E7E7E7; + border-top: 1px solid #9C9C9C; + border-bottom: 1px solid #9C9C9C; + height: 8px; + margin-top: -1px; + width: 1198px; +} +section .Basic ,section .Arithmetic,section .Counters-Timers,section .Comparative,section .Instruction{ + margin: 3px 48px; + display:none; +} +.buttons { + background: url("..assert/images/sub-button.png") repeat scroll 0 0 transparent; + border: 1px solid #505050; + border-radius: 6px 6px 6px 6px; + color: #505050; + height: 25px; + margin-left: 20px; + width: 50px; + behavior: url(PIE.htc); +} +.main-footer { + background: none repeat scroll 0 0 white; + border: 1px solid #999999; + box-shadow: 0 2px 4px #888888 inset; + height: 184px; + margin-top: -4px; + width: 1198px; + behavior: url(PIE.htc); +} +article.main-footer div { + background: url("..assert/images/button.png") repeat scroll 0 0 transparent; + height: 28px; + border-bottom: 1px solid #A6A6A6; +} +article.main-footer div a { + border-right: 2px solid #555555; + height: 25px; + width: 86px; +} +article.main-footer div a { + color: black; + text-align: center; + padding: 4px 8px 0 15px; +} +.console-window { + color: red; +} +.tab-list { + height: 34px; + margin: 4px 0 0; + overflow: hidden; + padding: 0; + width: 1198px; +} +.main-head-left { + width: 692px; + height: 137px; +} +.main-head-right { + width: 490px; +} +/* Tab Structure */ + +.tab-list{ + list-style-type: none; + overflow: hidden; + height: 35px; + margin: 0; + padding: 0; +} + + +.tab-list dt{ + margin-top: 0px; + height: 33px; + width: 162px; + position: relative; + float:left; + border-top-right-radius: 0px; + border-top-left-radius: 0px; + border: 1px solid transparent; + margin-left: -10px; + z-index: 1; +} + +.tab-list dt:first-child{ + margin-left: 0; +} + +.tab-list .current{ + z-index: 2; +} + +.left-mask, .right-mask{ } + +.current .left-mask, .current .right-mask{ + height: 4px; +} + +.left-mask{ } + +.right-mask{ + right: -1px; +} + +.left-mask span, .right-mask span{ } + +.left-mask span{ } + +.right-mask span{ } + +.tab-list dt a{ + display: block; + float: left; + line-height: 25px; + padding-left: 40px; + font-family: sans-serif; + font-size: 13px; + background-image: url(default.png); + background-repeat: no-repeat; + background-position: 18px center; + color: #444; + text-decoration: none; +} +.tab-list{ + box-shadow: inset 0 1px 1px #fff, inset 0 -1px 1px #9c9c9c; + background: rgb(207,207,207); /* Old browsers */ + background: -ms-linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#cfcfcf', endColorstr='#b0b0b0',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* W3C */ +} + +.tab-list dt{ + background: rgb(255,255,255); /* Old browsers */ + background: -ms-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#9c9c9c',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* W3C */ + border: 1px solid #9c9c9c; + box-shadow: inset 0 0 2px #fff; +} + +.tab-list dt.current{ + background: rgb(255,255,255); /* Old browsers */ + background: -ms-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#e7e7e7',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* W3C */ +} +.left-mask span, .right-mask span{ } +.left-mask span{ } +.right-mask span{ } +.current .left-mask span, .current .right-mask span{ } +.tab-list dt div.img { + background: url("../images/tab-close.png") no-repeat scroll 0 0 transparent; + height: 7px; + margin: 9px 15px; + width: 12px; +} +.tab-list dt.current div.img,.tab-list dt div.img:hover { + background: url("..assert/images/tab-close-active.png") no-repeat scroll 0 0 transparent; +} +a.create-tab { + background: url("..assert/images/new-tab.png") no-repeat scroll 0 0 transparent; + margin: 17px 31px; + height: 16px; + width: 14px; +} +a.create-tab:hover { + background: url("..assert/images/new-tab-active.png") no-repeat scroll 0 0 transparent; +} + \ No newline at end of file diff --git a/experiment/assert/css/tabs22.css b/experiment/assert/css/tabs22.css new file mode 100644 index 0000000..33c86e7 --- /dev/null +++ b/experiment/assert/css/tabs22.css @@ -0,0 +1,426 @@ +* { + margin: 0; + padding: 0; +} +body { + font: 14px/1.4 arial, Arial, Helvetica, sans-serif; + min-width: 1200px; + background: url(../images/body-bg.png); +} +article,aside,footer,header,nav,section { + display: block; +} +.width-set { + width: 1200px; + margin: 0 auto; +} +.left{ + float: left; +} +.right{ + float: right; +} +header { + background: url(../images/header-bg.png) repeat-x #303030; + height: 55px; +} +footer { + background: url(../images/footer-bg.png) repeat-x; + height: 55px; +} +.logo { + color: #567F26; + font-size: 35px; + margin-right: 42px; +} +label { + color: #FFFFFF; +} +header nav ul li { + font-size: 13px; + padding: 14px 17px 14px 22px; + background: url(../images/nav-separator.png) no-repeat; + list-style: none; +} +header nav ul li a { + color: #999999; + text-decoration: none; +} +header nav ul li a:hover { + color: #ffffff; +} +header nav ul li.current a { + color: #ffffff; + font-weight: bold; +} +.main-page { + height: 1069px; +} +h5 { + color: #888888; + font-size: 16px; + margin: -52px 3px; +} +.main-head { + background: url(../images/plc-head-bg.png); + border: 1px solid #A6A6A6; + border-radius: 5px; + height: 140px; + behavior: url(PIE.htc); +} +.main-head div.button-menu { + background: url("../images/button.png") repeat scroll 0 0 transparent; + border: 1px solid #A6A6A6; + border-radius: 5px 5px 5px 5px; + height: 40px; + margin: 15px 26px; + width: 628px; + behavior: url(PIE.htc); +} +.main-head div.button-menu a { + background: url("../images/button-separator.png") no-repeat scroll 0 0 transparent; + height: 39px; + padding: 8px 23px 0 27px; + font-size: 15px; + color: black; + text-decoration: none; + behavior: url(PIE.htc); +} +.main-head div.main-head-left div.button-menu a.current { + background-image: -webkit-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -moz-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -o-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + height: 33px; + color: #71B51E; + font-weight: bold; +} +.main-head div.main-head-left div.button-menu a:hover { + color: #71B51E; + height: 33px; +} +.main-footer div a.current { + background-image: -webkit-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -moz-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -o-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + height: 28px; + width: 100px; +} +.main-footer div a:hover { + background-image: -webkit-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -moz-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -o-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: -ms-linear-gradient(bottom, #FFFFFF 0%, #000000 100%); + background-image: linear-gradient(bottom, #FFFFFF 0%, #000000 100%); +} +.full-screen:hover { + background: url("../images/icons/fullscreen-active.png") no-repeat scroll 0 0 transparent; +} +.main-content { + height: 695px; + margin-top: -1px; + border-left: 1px solid #A6A6A6; + border-right: 1px solid #A6A6A6; +} +footer label { + color: #727272; + font-size: 10px; + margin: 23px 0px 0px 490px; +} +h1 { + background: url("../images/name.png") repeat scroll 0 0 transparent; + border-radius: 5px 5px 5px 5px; + font-size: 0; + height: 25px; + margin-top: 9px; + width: 100px; + behavior: url(PIE.htc); +} +h3 { + background: url("../images/drop-down.png") no-repeat scroll 0 0 transparent; + font-size: 0; + height: 10px; + margin: 16px -90px; + width: 13px; +} +h2 { + background: url("../images/plc-heading.png") no-repeat scroll 0 0 transparent; + font-size: 0; + height: 53px; + margin-top: 22px; +} +.menu-separator { + background: url("../images/menu-separator.png") no-repeat scroll 0 0 transparent; + height: 140px; + width: 3px; + margin: 0 0 0 -5px; +} +.button-submenu{ + margin: 37px 22px 0; + padding: 43px 0 0; + width: 34px; + color: black; + text-decoration: none; +} +.main-head-right a:nth-child(4){ + text-indent: -6px; +} +.main-head-right a:nth-child(2){ + text-indent: 6px; +} +.new{ + background: url("../images/icons/new.png") no-repeat scroll 0 0 transparent; +} +.open { + background: url("../images/icons/open.png") no-repeat scroll 0 0 transparent; + width: 48px; +} +.save { + background: url("../images/icons/save.png") no-repeat scroll 0 0 transparent; +} +.compile { + text-indent: -9px; + background: url("../images/icons/compile.png") no-repeat scroll 0 0 transparent; +} +.run { + background: url("../images/icons/run.png") no-repeat scroll 0 0 transparent; +} +.new:hover { + background: url("../images/icons/new-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.open:hover { + background: url("../images/icons/open-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.save:hover { + background: url("../images/icons/save-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.run:hover { + background: url("../images/icons/run-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.compile:hover { + background: url("../images/icons/compile-active.png") no-repeat scroll 0 0 transparent; + color: #65A41A; +} +.full-screen { + background: url("../images/icons/fullscreen.png") no-repeat scroll 0 0 transparent; + height: 17px; + width: 20px; + margin: 5px 6px; +} +.tab-border { + border-bottom: 1px solid #9C9C9C; + height: 10px; + width: 1198px; + background: #E7E7E7; +} +section .Basic ,section .Arithmetic,section .Counters-Timers,section .Comparative,section .Instruction{ + margin: 3px 48px; + display:none; +} +.buttons { + background: url("../images/sub-button.png") repeat scroll 0 0 transparent; + border: 1px solid #505050; + border-radius: 6px 6px 6px 6px; + color: #505050; + height: 25px; + margin-left: 20px; + width: 50px; + behavior: url(PIE.htc); +} +.main-footer { + border: 1px solid #999999; + height: 182px; + width: 1198px; + box-shadow: 0 -2px 4px #888888 inset; +} +article.main-footer div { + background: url("../images/button.png") repeat scroll 0 0 transparent; + height: 34px; + border-bottom: 1px solid #A6A6A6; +} +article.main-footer div a { + border-right: 2px solid #555555; + height: 28px; + width: 87px; +} +article.main-footer div a { + color: black; + padding: 7px 6px 0 20px; + text-decoration: none; +} +.console-window { + color: red; +} +.tab-list { + overflow: hidden; + height: 36px; + margin: 0; + padding: 0; +} +.main-head-left { + width: 675px; + height: 137px; +} +.main-head-right { + height: auto; + width: 521px; +} + +/* Tab Structure */ + +.tab-list{ + list-style-type: none; + overflow: hidden; + height: 35px; + margin: 0; + padding: 0; +} + + +.tab-list dt{ + margin-top: 0px; + height: 33px; + width: 162px; + position: relative; + float:left; + border-top-right-radius: 0px; + border-top-left-radius: 0px; + border: 1px solid transparent; + margin-left: -10px; + z-index: 1; +} + +.tab-list dt:first-child{ + margin-left: 0; +} + +.tab-list .current{ + z-index: 2; +} + +.left-mask, .right-mask{ + +} + +.current .left-mask, .current .right-mask{ + height: 4px; +} + +.left-mask{ + +} + +.right-mask{ right: -1px; +} + +.left-mask span, .right-mask span{ + + + +} + +.left-mask span{ + +} + +.right-mask span{ + +} + +.tab-list dt a{ + display: block; + float: left; + line-height: 25px; + padding-left: 40px; + font-family: sans-serif; + font-size: 13px; + background-image: url(default.png); + background-repeat: no-repeat; + background-position: 18px center; + color: #444; + text-decoration: none; +} + +.tab-list{ + box-shadow: inset 0 1px 1px #fff, inset 0 -1px 1px #9c9c9c; + background: rgb(207,207,207); /* Old browsers */ + background: -moz-linear-gradient(top, rgba(207,207,207,1) 0%, rgba(176,176,176,1) 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(207,207,207,1)), color-stop(100%,rgba(176,176,176,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#cfcfcf', endColorstr='#b0b0b0',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(207,207,207,1) 0%,rgba(176,176,176,1) 100%); /* W3C */ +} + +.tab-list dt{ + background: rgb(255,255,255); /* Old browsers */ + background: -moz-linear-gradient(top, rgba(255,255,255,1) 0%, rgba(220,221,220,1) 4%, rgba(207,208,207,1) 39%, rgba(156,156,156,1) 40%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,1)), color-stop(4%,rgba(220,221,220,1)), color-stop(39%,rgba(207,208,207,1)), color-stop(40%,rgba(156,156,156,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#9c9c9c',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,1) 0%,rgba(220,221,220,1) 4%,rgba(207,208,207,1) 39%,rgba(156,156,156,1) 40%); /* W3C */ + border: 1px solid #9c9c9c; + box-shadow: inset 0 0 2px #fff; +} + +.tab-list dt.current{ + background: rgb(255,255,255); /* Old browsers */ + background: -moz-linear-gradient(top, rgba(255,255,255,1) 0%, rgba(231,231,231,1) 30%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,1)), color-stop(30%,rgba(231,231,231,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#e7e7e7',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,1) 0%,rgba(231,231,231,1) 30%); /* W3C */ +} + +.left-mask span, .right-mask span{ + +} + +.left-mask span{ + + +} + +.right-mask span{ + +} + +.current .left-mask span, .current .right-mask span{ + +} + +.tab-list dt div.img { + background: url("../images/tab-close.png") no-repeat scroll 0 0 transparent; + float: right; + height: 7px; + margin: 3px 14px; + width: 12px; +} +.tab-list dt.current div.img,.tab-list dt div.img:hover { + background: url("../images/tab-close-active.png") no-repeat scroll 0 0 transparent; + float: right; + height: 7px; + margin: 3px 14px; + width: 12px; +} +a.create-tab { + background: url("../images/new-tab.png") no-repeat scroll 0 0 transparent; + margin: 17px 31px; + height: 16px; + width: 14px; +} +a.create-tab:hover { + background: url("../images/new-tab-active.png") no-repeat scroll 0 0 transparent; +} \ No newline at end of file diff --git a/experiment/assert/css/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png b/experiment/assert/css/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png new file mode 100644 index 0000000..5b5dab2 Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png differ diff --git a/experiment/assert/css/themes/base/images/ui-bg_flat_75_ffffff_40x100.png b/experiment/assert/css/themes/base/images/ui-bg_flat_75_ffffff_40x100.png new file mode 100644 index 0000000..ac8b229 Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-bg_flat_75_ffffff_40x100.png differ diff --git a/experiment/assert/css/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png b/experiment/assert/css/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png new file mode 100644 index 0000000..ad3d634 Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png differ diff --git a/experiment/assert/css/themes/base/images/ui-bg_glass_65_ffffff_1x400.png b/experiment/assert/css/themes/base/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 0000000..42ccba2 Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/experiment/assert/css/themes/base/images/ui-bg_glass_75_dadada_1x400.png b/experiment/assert/css/themes/base/images/ui-bg_glass_75_dadada_1x400.png new file mode 100644 index 0000000..5a46b47 Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-bg_glass_75_dadada_1x400.png differ diff --git a/experiment/assert/css/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png b/experiment/assert/css/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png new file mode 100644 index 0000000..86c2baa Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png differ diff --git a/experiment/assert/css/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png b/experiment/assert/css/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png new file mode 100644 index 0000000..4443fdc Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png differ diff --git a/experiment/assert/css/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/experiment/assert/css/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png new file mode 100644 index 0000000..7c9fa6c Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png differ diff --git a/experiment/assert/css/themes/base/images/ui-icons_222222_256x240.png b/experiment/assert/css/themes/base/images/ui-icons_222222_256x240.png new file mode 100644 index 0000000..ee039dc Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-icons_222222_256x240.png differ diff --git a/experiment/assert/css/themes/base/images/ui-icons_2e83ff_256x240.png b/experiment/assert/css/themes/base/images/ui-icons_2e83ff_256x240.png new file mode 100644 index 0000000..45e8928 Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-icons_2e83ff_256x240.png differ diff --git a/experiment/assert/css/themes/base/images/ui-icons_454545_256x240.png b/experiment/assert/css/themes/base/images/ui-icons_454545_256x240.png new file mode 100644 index 0000000..7ec70d1 Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-icons_454545_256x240.png differ diff --git a/experiment/assert/css/themes/base/images/ui-icons_888888_256x240.png b/experiment/assert/css/themes/base/images/ui-icons_888888_256x240.png new file mode 100644 index 0000000..5ba708c Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-icons_888888_256x240.png differ diff --git a/experiment/assert/css/themes/base/images/ui-icons_cd0a0a_256x240.png b/experiment/assert/css/themes/base/images/ui-icons_cd0a0a_256x240.png new file mode 100644 index 0000000..7930a55 Binary files /dev/null and b/experiment/assert/css/themes/base/images/ui-icons_cd0a0a_256x240.png differ diff --git a/experiment/assert/css/themes/base/jquery.ui.all.css b/experiment/assert/css/themes/base/jquery.ui.all.css new file mode 100644 index 0000000..e929327 --- /dev/null +++ b/experiment/assert/css/themes/base/jquery.ui.all.css @@ -0,0 +1,11 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming + */ +@import "jquery.ui.base.css"; +@import "jquery.ui.theme.css"; diff --git a/experiment/assert/css/themes/base/jquery.ui.base.css b/experiment/assert/css/themes/base/jquery.ui.base.css new file mode 100644 index 0000000..f52ee39 --- /dev/null +++ b/experiment/assert/css/themes/base/jquery.ui.base.css @@ -0,0 +1,11 @@ +@import url("jquery.ui.core.css"); +@import url("jquery.ui.resizable.css"); +@import url("jquery.ui.selectable.css"); +@import url("jquery.ui.accordion.css"); +@import url("jquery.ui.autocomplete.css"); +@import url("jquery.ui.button.css"); +@import url("jquery.ui.dialog.css"); +@import url("jquery.ui.slider.css"); +@import url("jquery.ui.tabs.css"); +@import url("jquery.ui.datepicker.css"); +@import url("jquery.ui.progressbar.css"); \ No newline at end of file diff --git a/experiment/assert/css/themes/base/jquery.ui.theme.css b/experiment/assert/css/themes/base/jquery.ui.theme.css new file mode 100644 index 0000000..b705ff6 --- /dev/null +++ b/experiment/assert/css/themes/base/jquery.ui.theme.css @@ -0,0 +1,247 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/ + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -khtml-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -khtml-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -khtml-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; } \ No newline at end of file diff --git a/experiment/assert/css/themes/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png b/experiment/assert/css/themes/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png new file mode 100644 index 0000000..5b5dab2 Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-bg_flat_75_ffffff_40x100.png b/experiment/assert/css/themes/smoothness/images/ui-bg_flat_75_ffffff_40x100.png new file mode 100644 index 0000000..ac8b229 Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-bg_flat_75_ffffff_40x100.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png new file mode 100644 index 0000000..ad3d634 Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-bg_glass_65_ffffff_1x400.png b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 0000000..42ccba2 Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-bg_glass_75_dadada_1x400.png b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_75_dadada_1x400.png new file mode 100644 index 0000000..5a46b47 Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_75_dadada_1x400.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png new file mode 100644 index 0000000..86c2baa Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png new file mode 100644 index 0000000..4443fdc Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/experiment/assert/css/themes/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png new file mode 100644 index 0000000..7c9fa6c Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-icons_222222_256x240.png b/experiment/assert/css/themes/smoothness/images/ui-icons_222222_256x240.png new file mode 100644 index 0000000..b273ff1 Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-icons_222222_256x240.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-icons_2e83ff_256x240.png b/experiment/assert/css/themes/smoothness/images/ui-icons_2e83ff_256x240.png new file mode 100644 index 0000000..09d1cdc Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-icons_2e83ff_256x240.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-icons_454545_256x240.png b/experiment/assert/css/themes/smoothness/images/ui-icons_454545_256x240.png new file mode 100644 index 0000000..59bd45b Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-icons_454545_256x240.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-icons_888888_256x240.png b/experiment/assert/css/themes/smoothness/images/ui-icons_888888_256x240.png new file mode 100644 index 0000000..6d02426 Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-icons_888888_256x240.png differ diff --git a/experiment/assert/css/themes/smoothness/images/ui-icons_cd0a0a_256x240.png b/experiment/assert/css/themes/smoothness/images/ui-icons_cd0a0a_256x240.png new file mode 100644 index 0000000..2ab019b Binary files /dev/null and b/experiment/assert/css/themes/smoothness/images/ui-icons_cd0a0a_256x240.png differ diff --git a/experiment/assert/css/themes/smoothness/jquery-ui-1.8.20.custom.css b/experiment/assert/css/themes/smoothness/jquery-ui-1.8.20.custom.css new file mode 100644 index 0000000..9c0c5a7 --- /dev/null +++ b/experiment/assert/css/themes/smoothness/jquery-ui-1.8.20.custom.css @@ -0,0 +1,565 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*! + * jQuery UI Resizable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*! + * jQuery UI Selectable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/*! + * jQuery UI Accordion 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/*! + * jQuery UI Autocomplete 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.20 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/*! + * jQuery UI Button 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/*! + * jQuery UI Dialog 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/*! + * jQuery UI Slider 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/*! + * jQuery UI Tabs 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/*! + * jQuery UI Datepicker 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/*! + * jQuery UI Progressbar 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/experiment/assert/images/Development-tools.png b/experiment/assert/images/Development-tools.png new file mode 100644 index 0000000..9a91a8d Binary files /dev/null and b/experiment/assert/images/Development-tools.png differ diff --git a/experiment/assert/images/Thumbs.db b/experiment/assert/images/Thumbs.db new file mode 100644 index 0000000..1dee1dc Binary files /dev/null and b/experiment/assert/images/Thumbs.db differ diff --git a/experiment/assert/images/addOutput.cur b/experiment/assert/images/addOutput.cur new file mode 100644 index 0000000..b511781 Binary files /dev/null and b/experiment/assert/images/addOutput.cur differ diff --git a/experiment/assert/images/body-bg.png b/experiment/assert/images/body-bg.png new file mode 100644 index 0000000..9a47ec0 Binary files /dev/null and b/experiment/assert/images/body-bg.png differ diff --git a/experiment/assert/images/button-separator.png b/experiment/assert/images/button-separator.png new file mode 100644 index 0000000..e5b2e19 Binary files /dev/null and b/experiment/assert/images/button-separator.png differ diff --git a/experiment/assert/images/button.png b/experiment/assert/images/button.png new file mode 100644 index 0000000..99d4e1d Binary files /dev/null and b/experiment/assert/images/button.png differ diff --git a/experiment/assert/images/closeContact.cur b/experiment/assert/images/closeContact.cur new file mode 100644 index 0000000..93483c0 Binary files /dev/null and b/experiment/assert/images/closeContact.cur differ diff --git a/experiment/assert/images/close_normal.png b/experiment/assert/images/close_normal.png new file mode 100644 index 0000000..19db65c Binary files /dev/null and b/experiment/assert/images/close_normal.png differ diff --git a/experiment/assert/images/close_toggle.png b/experiment/assert/images/close_toggle.png new file mode 100644 index 0000000..941829e Binary files /dev/null and b/experiment/assert/images/close_toggle.png differ diff --git a/experiment/assert/images/coep_logo.png b/experiment/assert/images/coep_logo.png new file mode 100644 index 0000000..25f80e6 Binary files /dev/null and b/experiment/assert/images/coep_logo.png differ diff --git a/experiment/assert/images/coep_logo1 (2).png b/experiment/assert/images/coep_logo1 (2).png new file mode 100644 index 0000000..c34b5d3 Binary files /dev/null and b/experiment/assert/images/coep_logo1 (2).png differ diff --git a/experiment/assert/images/down.png b/experiment/assert/images/down.png new file mode 100644 index 0000000..05a8b44 Binary files /dev/null and b/experiment/assert/images/down.png differ diff --git a/experiment/assert/images/download-plc.png b/experiment/assert/images/download-plc.png new file mode 100644 index 0000000..02d3a8a Binary files /dev/null and b/experiment/assert/images/download-plc.png differ diff --git a/experiment/assert/images/drop-down.png b/experiment/assert/images/drop-down.png new file mode 100644 index 0000000..bf67c72 Binary files /dev/null and b/experiment/assert/images/drop-down.png differ diff --git a/experiment/assert/images/footer-bg.png b/experiment/assert/images/footer-bg.png new file mode 100644 index 0000000..dadd20d Binary files /dev/null and b/experiment/assert/images/footer-bg.png differ diff --git a/experiment/assert/images/header, footer, bg/body-bg.png b/experiment/assert/images/header, footer, bg/body-bg.png new file mode 100644 index 0000000..9a47ec0 Binary files /dev/null and b/experiment/assert/images/header, footer, bg/body-bg.png differ diff --git a/experiment/assert/images/header, footer, bg/drop-down.png b/experiment/assert/images/header, footer, bg/drop-down.png new file mode 100644 index 0000000..bf67c72 Binary files /dev/null and b/experiment/assert/images/header, footer, bg/drop-down.png differ diff --git a/experiment/assert/images/header, footer, bg/footer-bg.png b/experiment/assert/images/header, footer, bg/footer-bg.png new file mode 100644 index 0000000..dadd20d Binary files /dev/null and b/experiment/assert/images/header, footer, bg/footer-bg.png differ diff --git a/experiment/assert/images/header, footer, bg/header-bg.png b/experiment/assert/images/header, footer, bg/header-bg.png new file mode 100644 index 0000000..c797b5a Binary files /dev/null and b/experiment/assert/images/header, footer, bg/header-bg.png differ diff --git a/experiment/assert/images/header, footer, bg/nav-separator.png b/experiment/assert/images/header, footer, bg/nav-separator.png new file mode 100644 index 0000000..0a13619 Binary files /dev/null and b/experiment/assert/images/header, footer, bg/nav-separator.png differ diff --git a/experiment/assert/images/header, footer, bg/plc-heading.png b/experiment/assert/images/header, footer, bg/plc-heading.png new file mode 100644 index 0000000..86db8f8 Binary files /dev/null and b/experiment/assert/images/header, footer, bg/plc-heading.png differ diff --git a/experiment/assert/images/header-bg.png b/experiment/assert/images/header-bg.png new file mode 100644 index 0000000..c797b5a Binary files /dev/null and b/experiment/assert/images/header-bg.png differ diff --git a/experiment/assert/images/icons/Development-active.png b/experiment/assert/images/icons/Development-active.png new file mode 100644 index 0000000..d0e82d0 Binary files /dev/null and b/experiment/assert/images/icons/Development-active.png differ diff --git a/experiment/assert/images/icons/Development-tools.png b/experiment/assert/images/icons/Development-tools.png new file mode 100644 index 0000000..9a91a8d Binary files /dev/null and b/experiment/assert/images/icons/Development-tools.png differ diff --git a/experiment/assert/images/icons/compile-active.png b/experiment/assert/images/icons/compile-active.png new file mode 100644 index 0000000..a218a82 Binary files /dev/null and b/experiment/assert/images/icons/compile-active.png differ diff --git a/experiment/assert/images/icons/compile.png b/experiment/assert/images/icons/compile.png new file mode 100644 index 0000000..8161f1f Binary files /dev/null and b/experiment/assert/images/icons/compile.png differ diff --git a/experiment/assert/images/icons/download-plc-active.png b/experiment/assert/images/icons/download-plc-active.png new file mode 100644 index 0000000..6f0caec Binary files /dev/null and b/experiment/assert/images/icons/download-plc-active.png differ diff --git a/experiment/assert/images/icons/download-plc.png b/experiment/assert/images/icons/download-plc.png new file mode 100644 index 0000000..02d3a8a Binary files /dev/null and b/experiment/assert/images/icons/download-plc.png differ diff --git a/experiment/assert/images/icons/fullscreen-active.png b/experiment/assert/images/icons/fullscreen-active.png new file mode 100644 index 0000000..039ff1d Binary files /dev/null and b/experiment/assert/images/icons/fullscreen-active.png differ diff --git a/experiment/assert/images/icons/fullscreen.png b/experiment/assert/images/icons/fullscreen.png new file mode 100644 index 0000000..ad12078 Binary files /dev/null and b/experiment/assert/images/icons/fullscreen.png differ diff --git a/experiment/assert/images/icons/new-active.png b/experiment/assert/images/icons/new-active.png new file mode 100644 index 0000000..8d7414b Binary files /dev/null and b/experiment/assert/images/icons/new-active.png differ diff --git a/experiment/assert/images/icons/new.png b/experiment/assert/images/icons/new.png new file mode 100644 index 0000000..af00d68 Binary files /dev/null and b/experiment/assert/images/icons/new.png differ diff --git a/experiment/assert/images/icons/open-active.png b/experiment/assert/images/icons/open-active.png new file mode 100644 index 0000000..8a160f2 Binary files /dev/null and b/experiment/assert/images/icons/open-active.png differ diff --git a/experiment/assert/images/icons/open.png b/experiment/assert/images/icons/open.png new file mode 100644 index 0000000..b931501 Binary files /dev/null and b/experiment/assert/images/icons/open.png differ diff --git a/experiment/assert/images/icons/run-active.png b/experiment/assert/images/icons/run-active.png new file mode 100644 index 0000000..a1f2b24 Binary files /dev/null and b/experiment/assert/images/icons/run-active.png differ diff --git a/experiment/assert/images/icons/run.png b/experiment/assert/images/icons/run.png new file mode 100644 index 0000000..c437854 Binary files /dev/null and b/experiment/assert/images/icons/run.png differ diff --git a/experiment/assert/images/icons/save-active.png b/experiment/assert/images/icons/save-active.png new file mode 100644 index 0000000..a79c256 Binary files /dev/null and b/experiment/assert/images/icons/save-active.png differ diff --git a/experiment/assert/images/icons/save.png b/experiment/assert/images/icons/save.png new file mode 100644 index 0000000..0a81a7a Binary files /dev/null and b/experiment/assert/images/icons/save.png differ diff --git a/experiment/assert/images/latch.png b/experiment/assert/images/latch.png new file mode 100644 index 0000000..4437f5d Binary files /dev/null and b/experiment/assert/images/latch.png differ diff --git a/experiment/assert/images/latch_toggle.png b/experiment/assert/images/latch_toggle.png new file mode 100644 index 0000000..2a46d60 Binary files /dev/null and b/experiment/assert/images/latch_toggle.png differ diff --git a/experiment/assert/images/menu-separator.png b/experiment/assert/images/menu-separator.png new file mode 100644 index 0000000..e3b1db5 Binary files /dev/null and b/experiment/assert/images/menu-separator.png differ diff --git a/experiment/assert/images/name.png b/experiment/assert/images/name.png new file mode 100644 index 0000000..a7c483a Binary files /dev/null and b/experiment/assert/images/name.png differ diff --git a/experiment/assert/images/nav-separator.png b/experiment/assert/images/nav-separator.png new file mode 100644 index 0000000..0a13619 Binary files /dev/null and b/experiment/assert/images/nav-separator.png differ diff --git a/experiment/assert/images/new-tab-active.png b/experiment/assert/images/new-tab-active.png new file mode 100644 index 0000000..776be5e Binary files /dev/null and b/experiment/assert/images/new-tab-active.png differ diff --git a/experiment/assert/images/new-tab.png b/experiment/assert/images/new-tab.png new file mode 100644 index 0000000..11748c5 Binary files /dev/null and b/experiment/assert/images/new-tab.png differ diff --git a/experiment/assert/images/openContact.cur b/experiment/assert/images/openContact.cur new file mode 100644 index 0000000..5810749 Binary files /dev/null and b/experiment/assert/images/openContact.cur differ diff --git a/experiment/assert/images/open_normal.png b/experiment/assert/images/open_normal.png new file mode 100644 index 0000000..d06bf4e Binary files /dev/null and b/experiment/assert/images/open_normal.png differ diff --git a/experiment/assert/images/open_toggle.png b/experiment/assert/images/open_toggle.png new file mode 100644 index 0000000..1e32740 Binary files /dev/null and b/experiment/assert/images/open_toggle.png differ diff --git a/experiment/assert/images/output.png b/experiment/assert/images/output.png new file mode 100644 index 0000000..40b8037 Binary files /dev/null and b/experiment/assert/images/output.png differ diff --git a/experiment/assert/images/output_toggle.png b/experiment/assert/images/output_toggle.png new file mode 100644 index 0000000..f5e97c8 Binary files /dev/null and b/experiment/assert/images/output_toggle.png differ diff --git a/experiment/assert/images/plc-head-bg.png b/experiment/assert/images/plc-head-bg.png new file mode 100644 index 0000000..f3da8fd Binary files /dev/null and b/experiment/assert/images/plc-head-bg.png differ diff --git a/experiment/assert/images/plc-heading.png b/experiment/assert/images/plc-heading.png new file mode 100644 index 0000000..86db8f8 Binary files /dev/null and b/experiment/assert/images/plc-heading.png differ diff --git a/experiment/assert/images/plc_cursor.cur b/experiment/assert/images/plc_cursor.cur new file mode 100644 index 0000000..70508b2 Binary files /dev/null and b/experiment/assert/images/plc_cursor.cur differ diff --git a/experiment/assert/images/plc_cursor_close.cur b/experiment/assert/images/plc_cursor_close.cur new file mode 100644 index 0000000..93483c0 Binary files /dev/null and b/experiment/assert/images/plc_cursor_close.cur differ diff --git a/experiment/assert/images/plc_cursor_open.cur b/experiment/assert/images/plc_cursor_open.cur new file mode 100644 index 0000000..5810749 Binary files /dev/null and b/experiment/assert/images/plc_cursor_open.cur differ diff --git a/experiment/assert/images/plc_cursor_output.cur b/experiment/assert/images/plc_cursor_output.cur new file mode 100644 index 0000000..b511781 Binary files /dev/null and b/experiment/assert/images/plc_cursor_output.cur differ diff --git a/experiment/assert/images/reset.png b/experiment/assert/images/reset.png new file mode 100644 index 0000000..c28601f Binary files /dev/null and b/experiment/assert/images/reset.png differ diff --git a/experiment/assert/images/reset1.png b/experiment/assert/images/reset1.png new file mode 100644 index 0000000..77bdc0f Binary files /dev/null and b/experiment/assert/images/reset1.png differ diff --git a/experiment/assert/images/reset_toggle.png b/experiment/assert/images/reset_toggle.png new file mode 100644 index 0000000..a64f2de Binary files /dev/null and b/experiment/assert/images/reset_toggle.png differ diff --git a/experiment/assert/images/sub-button.png b/experiment/assert/images/sub-button.png new file mode 100644 index 0000000..f658909 Binary files /dev/null and b/experiment/assert/images/sub-button.png differ diff --git a/experiment/assert/images/tab-close-active.png b/experiment/assert/images/tab-close-active.png new file mode 100644 index 0000000..f2cf43c Binary files /dev/null and b/experiment/assert/images/tab-close-active.png differ diff --git a/experiment/assert/images/tab-close.png b/experiment/assert/images/tab-close.png new file mode 100644 index 0000000..f8343e6 Binary files /dev/null and b/experiment/assert/images/tab-close.png differ diff --git a/experiment/assert/images/unlatch.png b/experiment/assert/images/unlatch.png new file mode 100644 index 0000000..d40c996 Binary files /dev/null and b/experiment/assert/images/unlatch.png differ diff --git a/experiment/assert/images/unlatch_toggle.png b/experiment/assert/images/unlatch_toggle.png new file mode 100644 index 0000000..7f9c694 Binary files /dev/null and b/experiment/assert/images/unlatch_toggle.png differ diff --git a/experiment/assert/img/OLT.cur b/experiment/assert/img/OLT.cur new file mode 100644 index 0000000..22e7437 Binary files /dev/null and b/experiment/assert/img/OLT.cur differ diff --git a/experiment/assert/img/OTU.cur b/experiment/assert/img/OTU.cur new file mode 100644 index 0000000..c55e23e Binary files /dev/null and b/experiment/assert/img/OTU.cur differ diff --git a/experiment/assert/img/RES.cur b/experiment/assert/img/RES.cur new file mode 100644 index 0000000..5511331 Binary files /dev/null and b/experiment/assert/img/RES.cur differ diff --git a/experiment/assert/img/addOutput.cur b/experiment/assert/img/addOutput.cur new file mode 100644 index 0000000..3ca8da1 Binary files /dev/null and b/experiment/assert/img/addOutput.cur differ diff --git a/experiment/assert/img/closeContact.cur b/experiment/assert/img/closeContact.cur new file mode 100644 index 0000000..b7ce4d3 Binary files /dev/null and b/experiment/assert/img/closeContact.cur differ diff --git a/experiment/assert/img/close_normal.png b/experiment/assert/img/close_normal.png new file mode 100644 index 0000000..19db65c Binary files /dev/null and b/experiment/assert/img/close_normal.png differ diff --git a/experiment/assert/img/close_toggle.png b/experiment/assert/img/close_toggle.png new file mode 100644 index 0000000..941829e Binary files /dev/null and b/experiment/assert/img/close_toggle.png differ diff --git a/experiment/assert/img/latch.png b/experiment/assert/img/latch.png new file mode 100644 index 0000000..4437f5d Binary files /dev/null and b/experiment/assert/img/latch.png differ diff --git a/experiment/assert/img/latch_toggle.png b/experiment/assert/img/latch_toggle.png new file mode 100644 index 0000000..2a46d60 Binary files /dev/null and b/experiment/assert/img/latch_toggle.png differ diff --git a/experiment/assert/img/openContact.cur b/experiment/assert/img/openContact.cur new file mode 100644 index 0000000..b579ac7 Binary files /dev/null and b/experiment/assert/img/openContact.cur differ diff --git a/experiment/assert/img/open_normal.png b/experiment/assert/img/open_normal.png new file mode 100644 index 0000000..fbe43c4 Binary files /dev/null and b/experiment/assert/img/open_normal.png differ diff --git a/experiment/assert/img/open_toggle.png b/experiment/assert/img/open_toggle.png new file mode 100644 index 0000000..1e32740 Binary files /dev/null and b/experiment/assert/img/open_toggle.png differ diff --git a/experiment/assert/img/output.png b/experiment/assert/img/output.png new file mode 100644 index 0000000..40b8037 Binary files /dev/null and b/experiment/assert/img/output.png differ diff --git a/experiment/assert/img/output_toggle.png b/experiment/assert/img/output_toggle.png new file mode 100644 index 0000000..f5e97c8 Binary files /dev/null and b/experiment/assert/img/output_toggle.png differ diff --git a/experiment/assert/img/reset.png b/experiment/assert/img/reset.png new file mode 100644 index 0000000..77bdc0f Binary files /dev/null and b/experiment/assert/img/reset.png differ diff --git a/experiment/assert/img/reset_toggle.png b/experiment/assert/img/reset_toggle.png new file mode 100644 index 0000000..a64f2de Binary files /dev/null and b/experiment/assert/img/reset_toggle.png differ diff --git a/experiment/assert/img/unlatch.png b/experiment/assert/img/unlatch.png new file mode 100644 index 0000000..d40c996 Binary files /dev/null and b/experiment/assert/img/unlatch.png differ diff --git a/experiment/assert/img/unlatch_toggle.png b/experiment/assert/img/unlatch_toggle.png new file mode 100644 index 0000000..7f9c694 Binary files /dev/null and b/experiment/assert/img/unlatch_toggle.png differ diff --git a/experiment/assert/lib/backbone-relational.js b/experiment/assert/lib/backbone-relational.js new file mode 100644 index 0000000..7ed9a04 --- /dev/null +++ b/experiment/assert/lib/backbone-relational.js @@ -0,0 +1,1652 @@ +/** + * Backbone-relational.js 0.5.0 + * (c) 2011 Paul Uithol + * + * Backbone-relational may be freely distributed under the MIT license. + * For details and documentation: https://github.com/PaulUithol/Backbone-relational. + * Depends on Backbone: https://github.com/documentcloud/backbone. + */ +( function( undefined ) { + "use strict"; + + /** + * CommonJS shim + **/ + var _, Backbone, exports; + if ( typeof window === 'undefined' ) { + _ = require( 'underscore' ); + Backbone = require( 'backbone' ); + exports = module.exports = Backbone; + } + else { + var _ = window._; + Backbone = window.Backbone; + exports = window; + } + + Backbone.Relational = { + showWarnings: true + }; + + /** + * Semaphore mixin; can be used as both binary and counting. + **/ + Backbone.Semaphore = { + _permitsAvailable: null, + _permitsUsed: 0, + + acquire: function() { + if ( this._permitsAvailable && this._permitsUsed >= this._permitsAvailable ) { + throw new Error( 'Max permits acquired' ); + } + else { + this._permitsUsed++; + } + }, + + release: function() { + if ( this._permitsUsed === 0 ) { + throw new Error( 'All permits released' ); + } + else { + this._permitsUsed--; + } + }, + + isLocked: function() { + return this._permitsUsed > 0; + }, + + setAvailablePermits: function( amount ) { + if ( this._permitsUsed > amount ) { + throw new Error( 'Available permits cannot be less than used permits' ); + } + this._permitsAvailable = amount; + } + }; + + /** + * A BlockingQueue that accumulates items while blocked (via 'block'), + * and processes them when unblocked (via 'unblock'). + * Process can also be called manually (via 'process'). + */ + Backbone.BlockingQueue = function() { + this._queue = []; + }; + _.extend( Backbone.BlockingQueue.prototype, Backbone.Semaphore, { + _queue: null, + + add: function( func ) { + if ( this.isBlocked() ) { + this._queue.push( func ); + } + else { + func(); + } + }, + + process: function() { + while ( this._queue && this._queue.length ) { + this._queue.shift()(); + } + }, + + block: function() { + this.acquire(); + }, + + unblock: function() { + this.release(); + if ( !this.isBlocked() ) { + this.process(); + } + }, + + isBlocked: function() { + return this.isLocked(); + } + }); + /** + * Global event queue. Accumulates external events ('add:', 'remove:' and 'update:') + * until the top-level object is fully initialized (see 'Backbone.RelationalModel'). + */ + Backbone.Relational.eventQueue = new Backbone.BlockingQueue(); + + /** + * Backbone.Store keeps track of all created (and destruction of) Backbone.RelationalModel. + * Handles lookup for relations. + */ + Backbone.Store = function() { + this._collections = []; + this._reverseRelations = []; + this._subModels = []; + }; + _.extend( Backbone.Store.prototype, Backbone.Events, { + /** + * Add a set of subModelTypes to the store, that can be used to resolve the '_superModel' + * for a model later in 'setupSuperModel'. + * + * @param {Backbone.RelationalModel} subModelTypes + * @param {Backbone.RelationalModel} superModelType + */ + addSubModels: function( subModelTypes, superModelType ) { + this._subModels.push({ + 'superModelType': superModelType, + 'subModels': subModelTypes + }); + }, + + /** + * Check if the given modelType is registered as another model's subModel. If so, add it to the super model's + * '_subModels', and set the modelType's '_superModel', '_subModelTypeName', and '_subModelTypeAttribute'. + * + * @param {Backbone.RelationalModel} modelType + */ + setupSuperModel: function( modelType ) { + _.find( this._subModels, function( subModelDef ) { + return _.find( subModelDef.subModels, function( subModelTypeName, typeValue ) { + var subModelType = this.getObjectByName( subModelTypeName ); + + if ( modelType === subModelType ) { + // Set 'modelType' as a child of the found superModel + subModelDef.superModelType._subModels[ typeValue ] = modelType; + + // Set '_superModel', '_subModelTypeValue', and '_subModelTypeAttribute' on 'modelType'. + modelType._superModel = subModelDef.superModelType; + modelType._subModelTypeValue = typeValue; + modelType._subModelTypeAttribute = subModelDef.superModelType.prototype.subModelTypeAttribute; + return true; + } + }, this ); + }, this ); + }, + + /** + * Add a reverse relation. Is added to the 'relations' property on model's prototype, and to + * existing instances of 'model' in the store as well. + * @param {Object} relation + * @param {Backbone.RelationalModel} relation.model + * @param {String} relation.type + * @param {String} relation.key + * @param {String|Object} relation.relatedModel + */ + addReverseRelation: function( relation ) { + var exists = _.any( this._reverseRelations, function( rel ) { + return _.all( relation, function( val, key ) { + return val === rel[ key ]; + }); + }); + + if ( !exists && relation.model && relation.type ) { + this._reverseRelations.push( relation ); + + var addRelation = function( model, relation ) { + if ( !model.prototype.relations ) { + model.prototype.relations = []; + } + model.prototype.relations.push( relation ); + + _.each( model._subModels, function( subModel ) { + addRelation( subModel, relation ); + }, this ); + }; + + addRelation( relation.model, relation ); + + this.retroFitRelation( relation ); + } + }, + + /** + * Add a 'relation' to all existing instances of 'relation.model' in the store + * @param {Object} relation + */ + retroFitRelation: function( relation ) { + var coll = this.getCollection( relation.model ); + coll.each( function( model ) { + if ( !( model instanceof relation.model ) ) { + return; + } + + new relation.type( model, relation ); + }, this); + }, + + /** + * Find the Store's collection for a certain type of model. + * @param {Backbone.RelationalModel} model + * @return {Backbone.Collection} A collection if found (or applicable for 'model'), or null + */ + getCollection: function( model ) { + if ( model instanceof Backbone.RelationalModel ) { + model = model.constructor; + } + + var rootModel = model; + while ( rootModel._superModel ) { + rootModel = rootModel._superModel; + } + + var coll = _.detect( this._collections, function( c ) { + return c.model === rootModel; + }); + + if ( !coll ) { + coll = this._createCollection( model ); + } + + return coll; + }, + + /** + * Find a type on the global object by name. Splits name on dots. + * @param {String} name + * @return {Object} + */ + getObjectByName: function( name ) { + var type = _.reduce( name.split( '.' ), function( memo, val ) { + return memo[ val ]; + }, exports); + return type !== exports ? type: null; + }, + + _createCollection: function( type ) { + var coll; + + // If 'type' is an instance, take its constructor + if ( type instanceof Backbone.RelationalModel ) { + type = type.constructor; + } + + // Type should inherit from Backbone.RelationalModel. + if ( type.prototype instanceof Backbone.RelationalModel ) { + coll = new Backbone.Collection(); + coll.model = type; + + this._collections.push( coll ); + } + + return coll; + }, + + /** + * Find the attribute that is to be used as the `id` on a given object + * @param type + * @param {String|Number|Object|Backbone.RelationalModel} item + */ + resolveIdForItem: function( type, item ) { + var id = _.isString( item ) || _.isNumber( item ) ? item : null; + + if ( id == null ) { + if ( item instanceof Backbone.RelationalModel ) { + id = item.id; + } + else if ( _.isObject( item ) ) { + id = item[ type.prototype.idAttribute ]; + } + } + + return id; + }, + + /** + * + * @param type + * @param {String|Number|Object|Backbone.RelationalModel} item + */ + find: function( type, item ) { + var id = this.resolveIdForItem( type, item ); + var coll = this.getCollection( type ); + + // Because the found object could be of any of the type's superModel + // types, only return it if it's actually of the type asked for. + if ( coll ) { + var obj = coll.get( id ); + + if ( obj instanceof type ) { + return obj; + } + } + + return null; + }, + + /** + * Add a 'model' to it's appropriate collection. Retain the original contents of 'model.collection'. + * @param {Backbone.RelationalModel} model + */ + register: function( model ) { + var modelColl = model.collection; + var coll = this.getCollection( model ); + coll && coll.add( model ); + model.bind( 'destroy', this.unregister, this ); + model.collection = modelColl; + }, + + /** + * Explicitly update a model's id in it's store collection + * @param {Backbone.RelationalModel} model + */ + update: function( model ) { + var coll = this.getCollection( model ); + coll._onModelEvent( 'change:' + model.idAttribute, model, coll ); + }, + + /** + * Remove a 'model' from the store. + * @param {Backbone.RelationalModel} model + */ + unregister: function( model ) { + model.unbind( 'destroy', this.unregister ); + var coll = this.getCollection( model ); + coll && coll.remove( model ); + } + }); + Backbone.Relational.store = new Backbone.Store(); + + /** + * The main Relation class, from which 'HasOne' and 'HasMany' inherit. Internally, 'relational:' events + * are used to regulate addition and removal of models from relations. + * + * @param {Backbone.RelationalModel} instance + * @param {Object} options + * @param {string} options.key + * @param {Backbone.RelationalModel.constructor} options.relatedModel + * @param {Boolean|String} [options.includeInJSON=true] Serialize the given attribute for related model(s)' in toJSON, or just their ids. + * @param {Boolean} [options.createModels=true] Create objects from the contents of keys if the object is not found in Backbone.store. + * @param {Object} [options.reverseRelation] Specify a bi-directional relation. If provided, Relation will reciprocate + * the relation to the 'relatedModel'. Required and optional properties match 'options', except that it also needs + * {Backbone.Relation|String} type ('HasOne' or 'HasMany'). + */ + Backbone.Relation = function( instance, options ) { + this.instance = instance; + // Make sure 'options' is sane, and fill with defaults from subclasses and this object's prototype + options = _.isObject( options ) ? options : {}; + this.reverseRelation = _.defaults( options.reverseRelation || {}, this.options.reverseRelation ); + this.reverseRelation.type = !_.isString( this.reverseRelation.type ) ? this.reverseRelation.type : + Backbone[ this.reverseRelation.type ] || Backbone.Relational.store.getObjectByName( this.reverseRelation.type ); + this.model = options.model || this.instance.constructor; + this.options = _.defaults( options, this.options, Backbone.Relation.prototype.options ); + + this.key = this.options.key; + this.keySource = this.options.keySource || this.key; + this.keyDestination = this.options.keyDestination || this.options.keySource || this.key; + + // 'exports' should be the global object where 'relatedModel' can be found on if given as a string. + this.relatedModel = this.options.relatedModel; + if ( _.isString( this.relatedModel ) ) { + this.relatedModel = Backbone.Relational.store.getObjectByName( this.relatedModel ); + } + + if ( !this.checkPreconditions() ) { + return false; + } + + if ( instance ) { + this.keyContents = this.instance.get( this.keySource ); + + // Explicitly clear 'keySource', to prevent a leaky abstraction if 'keySource' differs from 'key'. + if ( this.key !== this.keySource ) { + this.instance.unset( this.keySource, { silent: true } ); + } + + // Add this Relation to instance._relations + this.instance._relations.push( this ); + } + + // Add the reverse relation on 'relatedModel' to the store's reverseRelations + if ( !this.options.isAutoRelation && this.reverseRelation.type && this.reverseRelation.key ) { + Backbone.Relational.store.addReverseRelation( _.defaults( { + isAutoRelation: true, + model: this.relatedModel, + relatedModel: this.model, + reverseRelation: this.options // current relation is the 'reverseRelation' for it's own reverseRelation + }, + this.reverseRelation // Take further properties from this.reverseRelation (type, key, etc.) + ) ); + } + + _.bindAll( this, '_modelRemovedFromCollection', '_relatedModelAdded', '_relatedModelRemoved' ); + + if ( instance ) { + this.initialize(); + + // When a model in the store is destroyed, check if it is 'this.instance'. + Backbone.Relational.store.getCollection( this.instance ) + .bind( 'relational:remove', this._modelRemovedFromCollection ); + + // When 'relatedModel' are created or destroyed, check if it affects this relation. + Backbone.Relational.store.getCollection( this.relatedModel ) + .bind( 'relational:add', this._relatedModelAdded ) + .bind( 'relational:remove', this._relatedModelRemoved ); + } + }; + // Fix inheritance :\ + Backbone.Relation.extend = Backbone.Model.extend; + // Set up all inheritable **Backbone.Relation** properties and methods. + _.extend( Backbone.Relation.prototype, Backbone.Events, Backbone.Semaphore, { + options: { + createModels: true, + includeInJSON: true, + isAutoRelation: false + }, + + instance: null, + key: null, + keyContents: null, + relatedModel: null, + reverseRelation: null, + related: null, + + _relatedModelAdded: function( model, coll, options ) { + // Allow 'model' to set up it's relations, before calling 'tryAddRelated' + // (which can result in a call to 'addRelated' on a relation of 'model') + var dit = this; + model.queue( function() { + dit.tryAddRelated( model, options ); + }); + }, + + _relatedModelRemoved: function( model, coll, options ) { + this.removeRelated( model, options ); + }, + + _modelRemovedFromCollection: function( model ) { + if ( model === this.instance ) { + this.destroy(); + } + }, + + /** + * Check several pre-conditions. + * @return {Boolean} True if pre-conditions are satisfied, false if they're not. + */ + checkPreconditions: function() { + var i = this.instance, + k = this.key, + m = this.model, + rm = this.relatedModel, + warn = Backbone.Relational.showWarnings && typeof console !== 'undefined'; + + if ( !m || !k || !rm ) { + warn && console.warn( 'Relation=%o; no model, key or relatedModel (%o, %o, %o)', this, m, k, rm ); + return false; + } + // Check if the type in 'relatedModel' inherits from Backbone.RelationalModel + if ( !( m.prototype instanceof Backbone.RelationalModel ) ) { + warn && console.warn( 'Relation=%o; model does not inherit from Backbone.RelationalModel (%o)', this, i ); + return false; + } + // Check if the type in 'relatedModel' inherits from Backbone.RelationalModel + if ( !( rm.prototype instanceof Backbone.RelationalModel ) ) { + warn && console.warn( 'Relation=%o; relatedModel does not inherit from Backbone.RelationalModel (%o)', this, rm ); + return false; + } + // Check if this is not a HasMany, and the reverse relation is HasMany as well + if ( this instanceof Backbone.HasMany && this.reverseRelation.type === Backbone.HasMany ) { + warn && console.warn( 'Relation=%o; relation is a HasMany, and the reverseRelation is HasMany as well.', this ); + return false; + } + + // Check if we're not attempting to create a duplicate relationship + if ( i && i._relations.length ) { + var exists = _.any( i._relations, function( rel ) { + var hasReverseRelation = this.reverseRelation.key && rel.reverseRelation.key; + return rel.relatedModel === rm && rel.key === k && + ( !hasReverseRelation || this.reverseRelation.key === rel.reverseRelation.key ); + }, this ); + + if ( exists ) { + warn && console.warn( 'Relation=%o between instance=%o.%s and relatedModel=%o.%s already exists', + this, i, k, rm, this.reverseRelation.key ); + return false; + } + } + + return true; + }, + + /** + * Set the related model(s) for this relation + * @param {Backbone.Mode|Backbone.Collection} related + * @param {Object} [options] + */ + setRelated: function( related, options ) { + this.related = related; + + this.instance.acquire(); + this.instance.set( this.key, related, _.defaults( options || {}, { silent: true } ) ); + this.instance.release(); + }, + + /** + * Determine if a relation (on a different RelationalModel) is the reverse + * relation of the current one. + * @param {Backbone.Relation} relation + * @return {Boolean} + */ + _isReverseRelation: function( relation ) { + if ( relation.instance instanceof this.relatedModel && this.reverseRelation.key === relation.key && + this.key === relation.reverseRelation.key ) { + return true; + } + return false; + }, + + /** + * Get the reverse relations (pointing back to 'this.key' on 'this.instance') for the currently related model(s). + * @param {Backbone.RelationalModel} [model] Get the reverse relations for a specific model. + * If not specified, 'this.related' is used. + * @return {Backbone.Relation[]} + */ + getReverseRelations: function( model ) { + var reverseRelations = []; + // Iterate over 'model', 'this.related.models' (if this.related is a Backbone.Collection), or wrap 'this.related' in an array. + var models = !_.isUndefined( model ) ? [ model ] : this.related && ( this.related.models || [ this.related ] ); + _.each( models , function( related ) { + _.each( related.getRelations(), function( relation ) { + if ( this._isReverseRelation( relation ) ) { + reverseRelations.push( relation ); + } + }, this ); + }, this ); + + return reverseRelations; + }, + + /** + * Rename options.silent to options.silentChange, so events propagate properly. + * (for example in HasMany, from 'addRelated'->'handleAddition') + * @param {Object} [options] + * @return {Object} + */ + sanitizeOptions: function( options ) { + options = options ? _.clone( options ) : {}; + if ( options.silent ) { + options = _.extend( {}, options, { silentChange: true } ); + delete options.silent; + } + return options; + }, + + /** + * Rename options.silentChange to options.silent, so events are silenced as intended in Backbone's + * original functions. + * @param {Object} [options] + * @return {Object} + */ + unsanitizeOptions: function( options ) { + options = options ? _.clone( options ) : {}; + if ( options.silentChange ) { + options = _.extend( {}, options, { silent: true } ); + delete options.silentChange; + } + return options; + }, + + // Cleanup. Get reverse relation, call removeRelated on each. + destroy: function() { + Backbone.Relational.store.getCollection( this.instance ) + .unbind( 'relational:remove', this._modelRemovedFromCollection ); + + Backbone.Relational.store.getCollection( this.relatedModel ) + .unbind( 'relational:add', this._relatedModelAdded ) + .unbind( 'relational:remove', this._relatedModelRemoved ); + + _.each( this.getReverseRelations(), function( relation ) { + relation.removeRelated( this.instance ); + }, this ); + } + }); + + Backbone.HasOne = Backbone.Relation.extend({ + options: { + reverseRelation: { type: 'HasMany' } + }, + + initialize: function() { + _.bindAll( this, 'onChange' ); + + this.instance.bind( 'relational:change:' + this.key, this.onChange ); + + var model = this.findRelated( { silent: true } ); + this.setRelated( model ); + + // Notify new 'related' object of the new relation. + _.each( this.getReverseRelations(), function( relation ) { + relation.addRelated( this.instance ); + }, this ); + }, + + findRelated: function( options ) { + var item = this.keyContents; + var model = null; + + if ( item instanceof this.relatedModel ) { + model = item; + } + else if ( item ) { + model = this.relatedModel.findOrCreate( item, { create: this.options.createModels } ); + } + + return model; + }, + + /** + * If the key is changed, notify old & new reverse relations and initialize the new relation + */ + onChange: function( model, attr, options ) { + // Don't accept recursive calls to onChange (like onChange->findRelated->findOrCreate->initializeRelations->addRelated->onChange) + if ( this.isLocked() ) { + return; + } + this.acquire(); + options = this.sanitizeOptions( options ); + + // 'options._related' is set by 'addRelated'/'removeRelated'. If it is set, the change + // is the result of a call from a relation. If it's not, the change is the result of + // a 'set' call on this.instance. + var changed = _.isUndefined( options._related ); + var oldRelated = changed ? this.related : options._related; + + if ( changed ) { + this.keyContents = attr; + + // Set new 'related' + if ( attr instanceof this.relatedModel ) { + this.related = attr; + } + else if ( attr ) { + var related = this.findRelated( options ); + this.setRelated( related ); + } + else { + this.setRelated( null ); + } + } + + // Notify old 'related' object of the terminated relation + if ( oldRelated && this.related !== oldRelated ) { + _.each( this.getReverseRelations( oldRelated ), function( relation ) { + relation.removeRelated( this.instance, options ); + }, this ); + } + + // Notify new 'related' object of the new relation. Note we do re-apply even if this.related is oldRelated; + // that can be necessary for bi-directional relations if 'this.instance' was created after 'this.related'. + // In that case, 'this.instance' will already know 'this.related', but the reverse might not exist yet. + _.each( this.getReverseRelations(), function( relation ) { + relation.addRelated( this.instance, options ); + }, this); + + // Fire the 'update:' event if 'related' was updated + if ( !options.silentChange && this.related !== oldRelated ) { + var dit = this; + Backbone.Relational.eventQueue.add( function() { + dit.instance.trigger( 'update:' + dit.key, dit.instance, dit.related, options ); + }); + } + this.release(); + }, + + /** + * If a new 'this.relatedModel' appears in the 'store', try to match it to the last set 'keyContents' + */ + tryAddRelated: function( model, options ) { + if ( this.related ) { + return; + } + options = this.sanitizeOptions( options ); + + var item = this.keyContents; + if ( item ) { + var id = Backbone.Relational.store.resolveIdForItem( this.relatedModel, item ); + if ( model.id === id ) { + this.addRelated( model, options ); + } + } + }, + + addRelated: function( model, options ) { + if ( model !== this.related ) { + var oldRelated = this.related || null; + this.setRelated( model ); + this.onChange( this.instance, model, { _related: oldRelated } ); + } + }, + + removeRelated: function( model, options ) { + if ( !this.related ) { + return; + } + + if ( model === this.related ) { + var oldRelated = this.related || null; + this.setRelated( null ); + this.onChange( this.instance, model, { _related: oldRelated } ); + } + } + }); + + Backbone.HasMany = Backbone.Relation.extend({ + collectionType: null, + + options: { + reverseRelation: { type: 'HasOne' }, + collectionType: Backbone.Collection, + collectionKey: true, + collectionOptions: {} + }, + + initialize: function() { + _.bindAll( this, 'onChange', 'handleAddition', 'handleRemoval', 'handleReset' ); + this.instance.bind( 'relational:change:' + this.key, this.onChange ); + + // Handle a custom 'collectionType' + this.collectionType = this.options.collectionType; + if ( _.isString( this.collectionType ) ) { + this.collectionType = Backbone.Relational.store.getObjectByName( this.collectionType ); + } + if ( !this.collectionType.prototype instanceof Backbone.Collection ){ + throw new Error( 'collectionType must inherit from Backbone.Collection' ); + } + + // Handle cases where a model/relation is created with a collection passed straight into 'attributes' + if ( this.keyContents instanceof Backbone.Collection ) { + this.setRelated( this._prepareCollection( this.keyContents ) ); + } + else { + this.setRelated( this._prepareCollection() ); + } + + this.findRelated( { silent: true } ); + }, + + _getCollectionOptions: function() { + return _.isFunction( this.options.collectionOptions ) ? + this.options.collectionOptions( this.instance ) : + this.options.collectionOptions; + }, + + /** + * Bind events and setup collectionKeys for a collection that is to be used as the backing store for a HasMany. + * If no 'collection' is supplied, a new collection will be created of the specified 'collectionType' option. + * @param {Backbone.Collection} [collection] + */ + _prepareCollection: function( collection ) { + if ( this.related ) { + this.related + .unbind( 'relational:add', this.handleAddition ) + .unbind( 'relational:remove', this.handleRemoval ) + .unbind( 'relational:reset', this.handleReset ) + } + + if ( !collection || !( collection instanceof Backbone.Collection ) ) { + collection = new this.collectionType( [], this._getCollectionOptions() ); + } + + collection.model = this.relatedModel; + + if ( this.options.collectionKey ) { + var key = this.options.collectionKey === true ? this.options.reverseRelation.key : this.options.collectionKey; + + if ( collection[ key ] && collection[ key ] !== this.instance ) { + if ( Backbone.Relational.showWarnings && typeof console !== 'undefined' ) { + console.warn( 'Relation=%o; collectionKey=%s already exists on collection=%o', this, key, this.options.collectionKey ); + } + } + else if ( key ) { + collection[ key ] = this.instance; + } + } + + collection + .bind( 'relational:add', this.handleAddition ) + .bind( 'relational:remove', this.handleRemoval ) + .bind( 'relational:reset', this.handleReset ); + + return collection; + }, + + findRelated: function( options ) { + if ( this.keyContents ) { + var models = []; + + if ( this.keyContents instanceof Backbone.Collection ) { + models = this.keyContents.models; + } + else { + // Handle cases the an API/user supplies just an Object/id instead of an Array + this.keyContents = _.isArray( this.keyContents ) ? this.keyContents : [ this.keyContents ]; + + // Try to find instances of the appropriate 'relatedModel' in the store + _.each( this.keyContents, function( item ) { + var model = null; + if ( item instanceof this.relatedModel ) { + model = item; + } + else { + model = this.relatedModel.findOrCreate( item, { create: this.options.createModels } ); + } + + if ( model && !this.related.getByCid( model ) && !this.related.get( model ) ) { + models.push( model ); + } + }, this ); + } + + // Add all found 'models' in on go, so 'add' will only be called once (and thus 'sort', etc.) + if ( models.length ) { + options = this.unsanitizeOptions( options ); + this.related.add( models, options ); + } + } + }, + + /** + * If the key is changed, notify old & new reverse relations and initialize the new relation + */ + onChange: function( model, attr, options ) { + options = this.sanitizeOptions( options ); + this.keyContents = attr; + + // Notify old 'related' object of the terminated relation + _.each( this.getReverseRelations(), function( relation ) { + relation.removeRelated( this.instance, options ); + }, this ); + + // Replace 'this.related' by 'attr' if it is a Backbone.Collection + if ( attr instanceof Backbone.Collection ) { + this._prepareCollection( attr ); + this.related = attr; + } + // Otherwise, 'attr' should be an array of related object ids. + // Re-use the current 'this.related' if it is a Backbone.Collection, and remove any current entries. + // Otherwise, create a new collection. + else { + var coll; + + if ( this.related instanceof Backbone.Collection ) { + coll = this.related; + coll.remove( coll.models ); + } + else { + coll = this._prepareCollection(); + } + + this.setRelated( coll ); + this.findRelated( options ); + } + + // Notify new 'related' object of the new relation + _.each( this.getReverseRelations(), function( relation ) { + relation.addRelated( this.instance, options ); + }, this ); + + var dit = this; + Backbone.Relational.eventQueue.add( function() { + !options.silentChange && dit.instance.trigger( 'update:' + dit.key, dit.instance, dit.related, options ); + }); + }, + + tryAddRelated: function( model, options ) { + options = this.sanitizeOptions( options ); + if ( !this.related.getByCid( model ) && !this.related.get( model ) ) { + // Check if this new model was specified in 'this.keyContents' + var item = _.any( this.keyContents, function( item ) { + var id = Backbone.Relational.store.resolveIdForItem( this.relatedModel, item ); + return id && id === model.id; + }, this ); + + if ( item ) { + this.related.add( model, options ); + } + } + }, + + /** + * When a model is added to a 'HasMany', trigger 'add' on 'this.instance' and notify reverse relations. + * (should be 'HasOne', must set 'this.instance' as their related). + */ + handleAddition: function( model, coll, options ) { + //console.debug('handleAddition called; args=%o', arguments); + // Make sure the model is in fact a valid model before continuing. + // (it can be invalid as a result of failing validation in Backbone.Collection._prepareModel) + if ( !( model instanceof Backbone.Model ) ) { + return; + } + + options = this.sanitizeOptions( options ); + + _.each( this.getReverseRelations( model ), function( relation ) { + relation.addRelated( this.instance, options ); + }, this ); + + // Only trigger 'add' once the newly added model is initialized (so, has it's relations set up) + var dit = this; + Backbone.Relational.eventQueue.add( function() { + !options.silentChange && dit.instance.trigger( 'add:' + dit.key, model, dit.related, options ); + }); + }, + + /** + * When a model is removed from a 'HasMany', trigger 'remove' on 'this.instance' and notify reverse relations. + * (should be 'HasOne', which should be nullified) + */ + handleRemoval: function( model, coll, options ) { + //console.debug('handleRemoval called; args=%o', arguments); + if ( !( model instanceof Backbone.Model ) ) { + return; + } + + options = this.sanitizeOptions( options ); + + _.each( this.getReverseRelations( model ), function( relation ) { + relation.removeRelated( this.instance, options ); + }, this ); + + var dit = this; + Backbone.Relational.eventQueue.add( function() { + !options.silentChange && dit.instance.trigger( 'remove:' + dit.key, model, dit.related, options ); + }); + }, + + handleReset: function( coll, options ) { + options = this.sanitizeOptions( options ); + + var dit = this; + Backbone.Relational.eventQueue.add( function() { + !options.silentChange && dit.instance.trigger( 'reset:' + dit.key, dit.related, options ); + }); + }, + + addRelated: function( model, options ) { + var dit = this; + options = this.unsanitizeOptions( options ); + model.queue( function() { // Queued to avoid errors for adding 'model' to the 'this.related' set twice + if ( dit.related && !dit.related.getByCid( model ) && !dit.related.get( model ) ) { + dit.related.add( model, options ); + } + }); + }, + + removeRelated: function( model, options ) { + options = this.unsanitizeOptions( options ); + if ( this.related.getByCid( model ) || this.related.get( model ) ) { + this.related.remove( model, options ); + } + } + }); + + /** + * A type of Backbone.Model that also maintains relations to other models and collections. + * New events when compared to the original: + * - 'add:' (model, related collection, options) + * - 'remove:' (model, related collection, options) + * - 'update:' (model, related model or collection, options) + */ + Backbone.RelationalModel = Backbone.Model.extend({ + relations: null, // Relation descriptions on the prototype + _relations: null, // Relation instances + _isInitialized: false, + _deferProcessing: false, + _queue: null, + + subModelTypeAttribute: 'type', + subModelTypes: null, + + constructor: function( attributes, options ) { + // Nasty hack, for cases like 'model.get( ).add( item )'. + // Defer 'processQueue', so that when 'Relation.createModels' is used we: + // a) Survive 'Backbone.Collection.add'; this takes care we won't error on "can't add model to a set twice" + // (by creating a model from properties, having the model add itself to the collection via one of + // it's relations, then trying to add it to the collection). + // b) Trigger 'HasMany' collection events only after the model is really fully set up. + // Example that triggers both a and b: "p.get('jobs').add( { company: c, person: p } )". + var dit = this; + if ( options && options.collection ) { + this._deferProcessing = true; + + var processQueue = function( model ) { + if ( model === dit ) { + dit._deferProcessing = false; + dit.processQueue(); + options.collection.unbind( 'relational:add', processQueue ); + } + }; + options.collection.bind( 'relational:add', processQueue ); + + // So we do process the queue eventually, regardless of whether this model really gets added to 'options.collection'. + _.defer( function() { + processQueue( dit ); + }); + } + + this._queue = new Backbone.BlockingQueue(); + this._queue.block(); + Backbone.Relational.eventQueue.block(); + + Backbone.Model.apply( this, arguments ); + + // Try to run the global queue holding external events + Backbone.Relational.eventQueue.unblock(); + }, + + /** + * Override 'trigger' to queue 'change' and 'change:*' events + */ + trigger: function( eventName ) { + if ( eventName.length > 5 && 'change' === eventName.substr( 0, 6 ) ) { + var dit = this, args = arguments; + Backbone.Relational.eventQueue.add( function() { + Backbone.Model.prototype.trigger.apply( dit, args ); + }); + } + else { + Backbone.Model.prototype.trigger.apply( this, arguments ); + } + + return this; + }, + + /** + * Initialize Relations present in this.relations; determine the type (HasOne/HasMany), then creates a new instance. + * Invoked in the first call so 'set' (which is made from the Backbone.Model constructor). + */ + initializeRelations: function() { + this.acquire(); // Setting up relations often also involve calls to 'set', and we only want to enter this function once + this._relations = []; + + _.each( this.relations, function( rel ) { + var type = !_.isString( rel.type ) ? rel.type : Backbone[ rel.type ] || Backbone.Relational.store.getObjectByName( rel.type ); + if ( type && type.prototype instanceof Backbone.Relation ) { + new type( this, rel ); // Also pushes the new Relation into _relations + } + else { + Backbone.Relational.showWarnings && typeof console !== 'undefined' && console.warn( 'Relation=%o; missing or invalid type!', rel ); + } + }, this ); + + this._isInitialized = true; + this.release(); + this.processQueue(); + }, + + /** + * When new values are set, notify this model's relations (also if options.silent is set). + * (Relation.setRelated locks this model before calling 'set' on it to prevent loops) + */ + updateRelations: function( options ) { + if ( this._isInitialized && !this.isLocked() ) { + _.each( this._relations, function( rel ) { + var val = this.attributes[ rel.key ]; + if ( rel.related !== val ) { + this.trigger( 'relational:change:' + rel.key, this, val, options || {} ); + } + }, this ); + } + }, + + /** + * Either add to the queue (if we're not initialized yet), or execute right away. + */ + queue: function( func ) { + this._queue.add( func ); + }, + + /** + * Process _queue + */ + processQueue: function() { + if ( this._isInitialized && !this._deferProcessing && this._queue.isBlocked() ) { + this._queue.unblock(); + } + }, + + /** + * Get a specific relation. + * @param key {string} The relation key to look for. + * @return {Backbone.Relation} An instance of 'Backbone.Relation', if a relation was found for 'key', or null. + */ + getRelation: function( key ) { + return _.detect( this._relations, function( rel ) { + if ( rel.key === key ) { + return true; + } + }, this ); + }, + + /** + * Get all of the created relations. + * @return {Backbone.Relation[]} + */ + getRelations: function() { + return this._relations; + }, + + /** + * Retrieve related objects. + * @param key {string} The relation key to fetch models for. + * @param options {Object} Options for 'Backbone.Model.fetch' and 'Backbone.sync'. + * @param update {boolean} Whether to force a fetch from the server (updating existing models). + * @return {jQuery.when[]} An array of request objects + */ + fetchRelated: function( key, options, update ) { + options || ( options = {} ); + var setUrl, + requests = [], + rel = this.getRelation( key ), + keyContents = rel && rel.keyContents, + toFetch = keyContents && _.select( _.isArray( keyContents ) ? keyContents : [ keyContents ], function( item ) { + var id = Backbone.Relational.store.resolveIdForItem( rel.relatedModel, item ); + return id && ( update || !Backbone.Relational.store.find( rel.relatedModel, id ) ); + }, this ); + + if ( toFetch && toFetch.length ) { + // Create a model for each entry in 'keyContents' that is to be fetched + var models = _.map( toFetch, function( item ) { + var model; + + if ( _.isObject( item ) ) { + model = rel.relatedModel.build( item ); + } + else { + var attrs = {}; + attrs[ rel.relatedModel.prototype.idAttribute ] = item; + model = rel.relatedModel.build( attrs ); + } + + return model; + }, this ); + + // Try if the 'collection' can provide a url to fetch a set of models in one request. + if ( rel.related instanceof Backbone.Collection && _.isFunction( rel.related.url ) ) { + setUrl = rel.related.url( models ); + } + + // An assumption is that when 'Backbone.Collection.url' is a function, it can handle building of set urls. + // To make sure it can, test if the url we got by supplying a list of models to fetch is different from + // the one supplied for the default fetch action (without args to 'url'). + if ( setUrl && setUrl !== rel.related.url() ) { + var opts = _.defaults( + { + error: function() { + var args = arguments; + _.each( models, function( model ) { + model.trigger( 'destroy', model, model.collection, options ); + options.error && options.error.apply( model, args ); + }); + }, + url: setUrl + }, + options, + { add: true } + ); + + requests = [ rel.related.fetch( opts ) ]; + } + else { + requests = _.map( models, function( model ) { + var opts = _.defaults( + { + error: function() { + model.trigger( 'destroy', model, model.collection, options ); + options.error && options.error.apply( model, arguments ); + } + }, + options + ); + return model.fetch( opts ); + }, this ); + } + } + + return requests; + }, + + set: function( key, value, options ) { + Backbone.Relational.eventQueue.block(); + + // Duplicate backbone's behavior to allow separate key/value parameters, instead of a single 'attributes' object + var attributes; + if ( _.isObject( key ) || key == null ) { + attributes = key; + options = value; + } + else { + attributes = {}; + attributes[ key ] = value; + } + + var result = Backbone.Model.prototype.set.apply( this, arguments ); + + // Ideal place to set up relations :) + if ( !this._isInitialized && !this.isLocked() ) { + this.constructor.initializeModelHierarchy(); + + Backbone.Relational.store.register( this ); + + this.initializeRelations(); + } + // Update the 'idAttribute' in Backbone.store if; we don't want it to miss an 'id' update due to {silent:true} + else if ( attributes && this.idAttribute in attributes ) { + Backbone.Relational.store.update( this ); + } + + if ( attributes ) { + this.updateRelations( options ); + } + + // Try to run the global queue holding external events + Backbone.Relational.eventQueue.unblock(); + + return result; + }, + + unset: function( attribute, options ) { + Backbone.Relational.eventQueue.block(); + + var result = Backbone.Model.prototype.unset.apply( this, arguments ); + this.updateRelations( options ); + + // Try to run the global queue holding external events + Backbone.Relational.eventQueue.unblock(); + + return result; + }, + + clear: function( options ) { + Backbone.Relational.eventQueue.block(); + + var result = Backbone.Model.prototype.clear.apply( this, arguments ); + this.updateRelations( options ); + + // Try to run the global queue holding external events + Backbone.Relational.eventQueue.unblock(); + + return result; + }, + + /** + * Override 'change', so the change will only execute after 'set' has finised (relations are updated), + * and 'previousAttributes' will be available when the event is fired. + */ + change: function( options ) { + var dit = this, args = arguments; + Backbone.Relational.eventQueue.add( function() { + Backbone.Model.prototype.change.apply( dit, args ); + }); + }, + + clone: function() { + var attributes = _.clone( this.attributes ); + if ( !_.isUndefined( attributes[ this.idAttribute ] ) ) { + attributes[ this.idAttribute ] = null; + } + + _.each( this.getRelations(), function( rel ) { + delete attributes[ rel.key ]; + }); + + return new this.constructor( attributes ); + }, + + /** + * Convert relations to JSON, omits them when required + */ + toJSON: function() { + // If this Model has already been fully serialized in this branch once, return to avoid loops + if ( this.isLocked() ) { + return this.id; + } + + this.acquire(); + var json = Backbone.Model.prototype.toJSON.call( this ); + + if ( this.constructor._superModel && !( this.constructor._subModelTypeAttribute in json ) ) { + json[ this.constructor._subModelTypeAttribute ] = this.constructor._subModelTypeValue; + } + + _.each( this._relations, function( rel ) { + var value = json[ rel.key ]; + + if ( rel.options.includeInJSON === true) { + if ( value && _.isFunction( value.toJSON ) ) { + json[ rel.keyDestination ] = value.toJSON(); + } + else { + json[ rel.keyDestination ] = null; + } + } + else if ( _.isString( rel.options.includeInJSON ) ) { + if ( value instanceof Backbone.Collection ) { + json[ rel.keyDestination ] = value.pluck( rel.options.includeInJSON ); + } + else if ( value instanceof Backbone.Model ) { + json[ rel.keyDestination ] = value.get( rel.options.includeInJSON ); + } + else { + json[ rel.keyDestination ] = null; + } + } + else if ( _.isArray( rel.options.includeInJSON ) ) { + if ( value instanceof Backbone.Collection ) { + var valueSub = []; + value.each( function( model ) { + var curJson = {}; + _.each( rel.options.includeInJSON, function( key ) { + curJson[ key ] = model.get( key ); + }); + valueSub.push( curJson ); + }); + json[ rel.keyDestination ] = valueSub; + } + else if ( value instanceof Backbone.Model ) { + var valueSub = {}; + _.each( rel.options.includeInJSON, function( key ) { + valueSub[ key ] = value.get( key ); + }); + json[ rel.keyDestination ] = valueSub; + } + else { + json[ rel.keyDestination ] = null; + } + } + else { + delete json[ rel.key ]; + } + + if ( rel.keyDestination !== rel.key ) { + delete json[ rel.key ]; + } + }); + + this.release(); + return json; + } + }, + { + setup: function( superModel ) { + // We don't want to share a relations array with a parent, as this will cause problems with + // reverse relations. + this.prototype.relations = ( this.prototype.relations || [] ).slice( 0 ); + + this._subModels = {}; + this._superModel = null; + + // If this model has 'subModelTypes' itself, remember them in the store + if ( this.prototype.hasOwnProperty( 'subModelTypes' ) ) { + Backbone.Relational.store.addSubModels( this.prototype.subModelTypes, this ); + } + // The 'subModelTypes' property should not be inherited, so reset it. + else { + this.prototype.subModelTypes = null; + } + + // Initialize all reverseRelations that belong to this new model. + _.each( this.prototype.relations, function( rel ) { + if ( !rel.model ) { + rel.model = this; + } + + if ( rel.reverseRelation && rel.model === this ) { + var preInitialize = true; + if ( _.isString( rel.relatedModel ) ) { + /** + * The related model might not be defined for two reasons + * 1. it never gets defined, e.g. a typo + * 2. it is related to itself + * In neither of these cases do we need to pre-initialize reverse relations. + */ + var relatedModel = Backbone.Relational.store.getObjectByName( rel.relatedModel ); + preInitialize = relatedModel && ( relatedModel.prototype instanceof Backbone.RelationalModel ); + } + + var type = !_.isString( rel.type ) ? rel.type : Backbone[ rel.type ] || Backbone.Relational.store.getObjectByName( rel.type ); + if ( preInitialize && type && type.prototype instanceof Backbone.Relation ) { + new type( null, rel ); + } + } + }, this ); + }, + + /** + * Create a 'Backbone.Model' instance based on 'attributes'. + * @param {Object} attributes + * @param {Object} [options] + * @return {Backbone.Model} + */ + build: function( attributes, options ) { + var model = this; + + // 'build' is a possible entrypoint; it's possible no model hierarchy has been determined yet. + this.initializeModelHierarchy(); + + // Determine what type of (sub)model should be built if applicable. + // Lookup the proper subModelType in 'this._subModels'. + if ( this._subModels && this.prototype.subModelTypeAttribute in attributes ) { + var subModelTypeAttribute = attributes[ this.prototype.subModelTypeAttribute ]; + var subModelType = this._subModels[ subModelTypeAttribute ]; + if ( subModelType ) { + model = subModelType; + } + } + + return new model( attributes, options ); + }, + + initializeModelHierarchy: function() { + // If we're here for the first time, try to determine if this modelType has a 'superModel'. + if ( _.isUndefined( this._superModel ) || _.isNull( this._superModel ) ) { + Backbone.Relational.store.setupSuperModel( this ); + + // If a superModel has been found, copy relations from the _superModel if they haven't been + // inherited automatically (due to a redefinition of 'relations'). + // Otherwise, make sure we don't get here again for this type by making '_superModel' false so we fail + // the isUndefined/isNull check next time. + if ( this._superModel ) { + // + if ( this._superModel.prototype.relations ) { + var supermodelRelationsExist = _.any( this.prototype.relations, function( rel ) { + return rel.model && rel.model !== this; + }, this ); + + if ( !supermodelRelationsExist ) { + this.prototype.relations = this._superModel.prototype.relations.concat( this.prototype.relations ); + } + } + } + else { + this._superModel = false; + } + } + + // If we came here through 'build' for a model that has 'subModelTypes', and not all of them have been resolved yet, try to resolve each. + if ( this.prototype.subModelTypes && _.keys( this.prototype.subModelTypes ).length !== _.keys( this._subModels ).length ) { + _.each( this.prototype.subModelTypes, function( subModelTypeName ) { + var subModelType = Backbone.Relational.store.getObjectByName( subModelTypeName ); + subModelType && subModelType.initializeModelHierarchy(); + }); + } + }, + + /** + * Find an instance of `this` type in 'Backbone.Relational.store'. + * - If `attributes` is a string or a number, `findOrCreate` will just query the `store` and return a model if found. + * - If `attributes` is an object, the model will be updated with `attributes` if found. + * Otherwise, a new model is created with `attributes` (unless `options.create` is explicitly set to `false`). + * @param {Object|String|Number} attributes Either a model's id, or the attributes used to create or update a model. + * @param {Object} [options] + * @param {Boolean} [options.create=true] + * @return {Backbone.RelationalModel} + */ + findOrCreate: function( attributes, options ) { + // Try to find an instance of 'this' model type in the store + var model = Backbone.Relational.store.find( this, attributes ); + + // If we found an instance, update it with the data in 'item'; if not, create an instance + // (unless 'options.create' is false). + if ( _.isObject( attributes ) ) { + if ( model ) { + model.set( attributes, options ); + } + else if ( !options || ( options && options.create !== false ) ) { + model = this.build( attributes, options ); + } + } + + return model; + } + }); + _.extend( Backbone.RelationalModel.prototype, Backbone.Semaphore ); + + /** + * Override Backbone.Collection._prepareModel, so objects will be built using the correct type + * if the collection.model has subModels. + */ + Backbone.Collection.prototype.__prepareModel = Backbone.Collection.prototype._prepareModel; + Backbone.Collection.prototype._prepareModel = function ( model, options ) { + options || (options = {}); + if ( !( model instanceof Backbone.Model ) ) { + var attrs = model; + options.collection = this; + + if ( typeof this.model.build !== 'undefined' ) { + model = this.model.build( attrs, options ); + } + else { + model = new this.model( attrs, options ); + } + + if ( !model._validate( model.attributes, options ) ) { + model = false; + } + } + else if ( !model.collection ) { + model.collection = this; + } + + return model; + } + + /** + * Override Backbone.Collection.add, so objects fetched from the server multiple times will + * update the existing Model. Also, trigger 'relational:add'. + */ + var add = Backbone.Collection.prototype.__add = Backbone.Collection.prototype.add; + Backbone.Collection.prototype.add = function( models, options ) { + options || (options = {}); + if ( !_.isArray( models ) ) { + models = [ models ]; + } + + var modelsToAdd = []; + + //console.debug( 'calling add on coll=%o; model=%o, options=%o', this, models, options ); + _.each( models, function( model ) { + if ( !( model instanceof Backbone.Model ) ) { + // Try to find 'model' in Backbone.store. If it already exists, set the new properties on it. + var existingModel = Backbone.Relational.store.find( this.model, model[ this.model.prototype.idAttribute ] ); + if ( existingModel ) { + existingModel.set( existingModel.parse ? existingModel.parse( model ) : model, options ); + model = existingModel; + } + else { + model = Backbone.Collection.prototype._prepareModel.call( this, model, options ); + } + } + + if ( model instanceof Backbone.Model && !this.get( model ) && !this.getByCid( model ) ) { + modelsToAdd.push( model ); + } + }, this ); + + + // Add 'models' in a single batch, so the original add will only be called once (and thus 'sort', etc). + if ( modelsToAdd.length ) { + add.call( this, modelsToAdd, options ); + + _.each( modelsToAdd, function( model ) { + this.trigger( 'relational:add', model, this, options ); + }, this ); + } + + return this; + }; + + /** + * Override 'Backbone.Collection.remove' to trigger 'relational:remove'. + */ + var remove = Backbone.Collection.prototype.__remove = Backbone.Collection.prototype.remove; + Backbone.Collection.prototype.remove = function( models, options ) { + options || (options = {}); + if ( !_.isArray( models ) ) { + models = [ models ]; + } + else { + models = models.slice( 0 ); + } + + //console.debug('calling remove on coll=%o; models=%o, options=%o', this, models, options ); + _.each( models, function( model ) { + model = this.getByCid( model ) || this.get( model ); + + if ( model instanceof Backbone.Model ) { + remove.call( this, model, options ); + this.trigger('relational:remove', model, this, options); + } + }, this ); + + return this; + }; + + /** + * Override 'Backbone.Collection.reset' to trigger 'relational:reset'. + */ + var reset = Backbone.Collection.prototype.__reset = Backbone.Collection.prototype.reset; + Backbone.Collection.prototype.reset = function( models, options ) { + reset.call( this, models, options ); + this.trigger( 'relational:reset', this, options ); + + return this; + }; + + /** + * Override 'Backbone.Collection.sort' to trigger 'relational:reset'. + */ + var sort = Backbone.Collection.prototype.__sort = Backbone.Collection.prototype.sort; + Backbone.Collection.prototype.sort = function( options ) { + sort.call( this, options ); + this.trigger( 'relational:reset', this, options ); + + return this; + }; + + /** + * Override 'Backbone.Collection.trigger' so 'add', 'remove' and 'reset' events are queued until relations + * are ready. + */ + var trigger = Backbone.Collection.prototype.__trigger = Backbone.Collection.prototype.trigger; + Backbone.Collection.prototype.trigger = function( eventName ) { + if ( eventName === 'add' || eventName === 'remove' || eventName === 'reset' ) { + var dit = this, args = arguments; + Backbone.Relational.eventQueue.add( function() { + trigger.apply( dit, args ); + }); + } + else { + trigger.apply( this, arguments ); + } + + return this; + }; + + // Override .extend() to automatically call .setup() + Backbone.RelationalModel.extend = function( protoProps, classProps ) { + var child = Backbone.Model.extend.apply( this, arguments ); + + child.setup( this ); + + return child; + }; +})(); diff --git a/experiment/assert/lib/backbone.js b/experiment/assert/lib/backbone.js new file mode 100644 index 0000000..d0410b5 --- /dev/null +++ b/experiment/assert/lib/backbone.js @@ -0,0 +1,1431 @@ +// Backbone.js 0.9.2 + +// (c) 2010-2012 Jeremy Ashkenas, DocumentCloud Inc. +// Backbone may be freely distributed under the MIT license. +// For all details and documentation: +// http://backbonejs.org + +(function(){ + + // Initial Setup + // ------------- + + // Save a reference to the global object (`window` in the browser, `global` + // on the server). + var root = this; + + // Save the previous value of the `Backbone` variable, so that it can be + // restored later on, if `noConflict` is used. + var previousBackbone = root.Backbone; + + // Create a local reference to slice/splice. + var slice = Array.prototype.slice; + var splice = Array.prototype.splice; + + // The top-level namespace. All public Backbone classes and modules will + // be attached to this. Exported for both CommonJS and the browser. + var Backbone; + if (typeof exports !== 'undefined') { + Backbone = exports; + } else { + Backbone = root.Backbone = {}; + } + + // Current version of the library. Keep in sync with `package.json`. + Backbone.VERSION = '0.9.2'; + + // Require Underscore, if we're on the server, and it's not already present. + var _ = root._; + if (!_ && (typeof require !== 'undefined')) _ = require('underscore'); + + // For Backbone's purposes, jQuery, Zepto, or Ender owns the `$` variable. + var $ = root.jQuery || root.Zepto || root.ender; + + // Set the JavaScript library that will be used for DOM manipulation and + // Ajax calls (a.k.a. the `$` variable). By default Backbone will use: jQuery, + // Zepto, or Ender; but the `setDomLibrary()` method lets you inject an + // alternate JavaScript library (or a mock library for testing your views + // outside of a browser). + Backbone.setDomLibrary = function(lib) { + $ = lib; + }; + + // Runs Backbone.js in *noConflict* mode, returning the `Backbone` variable + // to its previous owner. Returns a reference to this Backbone object. + Backbone.noConflict = function() { + root.Backbone = previousBackbone; + return this; + }; + + // Turn on `emulateHTTP` to support legacy HTTP servers. Setting this option + // will fake `"PUT"` and `"DELETE"` requests via the `_method` parameter and + // set a `X-Http-Method-Override` header. + Backbone.emulateHTTP = false; + + // Turn on `emulateJSON` to support legacy servers that can't deal with direct + // `application/json` requests ... will encode the body as + // `application/x-www-form-urlencoded` instead and will send the model in a + // form param named `model`. + Backbone.emulateJSON = false; + + // Backbone.Events + // ----------------- + + // Regular expression used to split event strings + var eventSplitter = /\s+/; + + // A module that can be mixed in to *any object* in order to provide it with + // custom events. You may bind with `on` or remove with `off` callback functions + // to an event; trigger`-ing an event fires all callbacks in succession. + // + // var object = {}; + // _.extend(object, Backbone.Events); + // object.on('expand', function(){ alert('expanded'); }); + // object.trigger('expand'); + // + var Events = Backbone.Events = { + + // Bind one or more space separated events, `events`, to a `callback` + // function. Passing `"all"` will bind the callback to all events fired. + on: function(events, callback, context) { + + var calls, event, node, tail, list; + if (!callback) return this; + events = events.split(eventSplitter); + calls = this._callbacks || (this._callbacks = {}); + + // Create an immutable callback list, allowing traversal during + // modification. The tail is an empty object that will always be used + // as the next node. + while (event = events.shift()) { + list = calls[event]; + node = list ? list.tail : {}; + node.next = tail = {}; + node.context = context; + node.callback = callback; + calls[event] = {tail: tail, next: list ? list.next : node}; + } + + return this; + }, + + // Remove one or many callbacks. If `context` is null, removes all callbacks + // with that function. If `callback` is null, removes all callbacks for the + // event. If `events` is null, removes all bound callbacks for all events. + off: function(events, callback, context) { + var event, calls, node, tail, cb, ctx; + + // No events, or removing *all* events. + if (!(calls = this._callbacks)) return; + if (!(events || callback || context)) { + delete this._callbacks; + return this; + } + + // Loop through the listed events and contexts, splicing them out of the + // linked list of callbacks if appropriate. + events = events ? events.split(eventSplitter) : _.keys(calls); + while (event = events.shift()) { + node = calls[event]; + delete calls[event]; + if (!node || !(callback || context)) continue; + // Create a new list, omitting the indicated callbacks. + tail = node.tail; + while ((node = node.next) !== tail) { + cb = node.callback; + ctx = node.context; + if ((callback && cb !== callback) || (context && ctx !== context)) { + this.on(event, cb, ctx); + } + } + } + + return this; + }, + + // Trigger one or many events, firing all bound callbacks. Callbacks are + // passed the same arguments as `trigger` is, apart from the event name + // (unless you're listening on `"all"`, which will cause your callback to + // receive the true name of the event as the first argument). + trigger: function(events) { + var event, node, calls, tail, args, all, rest; + if (!(calls = this._callbacks)) return this; + all = calls.all; + events = events.split(eventSplitter); + rest = slice.call(arguments, 1); + + // For each event, walk through the linked list of callbacks twice, + // first to trigger the event, then to trigger any `"all"` callbacks. + while (event = events.shift()) { + if (node = calls[event]) { + tail = node.tail; + while ((node = node.next) !== tail) { + node.callback.apply(node.context || this, rest); + } + } + if (node = all) { + tail = node.tail; + args = [event].concat(rest); + while ((node = node.next) !== tail) { + node.callback.apply(node.context || this, args); + } + } + } + + return this; + } + + }; + + // Aliases for backwards compatibility. + Events.bind = Events.on; + Events.unbind = Events.off; + + // Backbone.Model + // -------------- + + // Create a new model, with defined attributes. A client id (`cid`) + // is automatically generated and assigned for you. + var Model = Backbone.Model = function(attributes, options) { + var defaults; + attributes || (attributes = {}); + if (options && options.parse) attributes = this.parse(attributes); + if (defaults = getValue(this, 'defaults')) { + attributes = _.extend({}, defaults, attributes); + } + if (options && options.collection) this.collection = options.collection; + this.attributes = {}; + this._escapedAttributes = {}; + this.cid = _.uniqueId('c'); + this.changed = {}; + this._silent = {}; + this._pending = {}; + this.set(attributes, {silent: true}); + // Reset change tracking. + this.changed = {}; + this._silent = {}; + this._pending = {}; + this._previousAttributes = _.clone(this.attributes); + this.initialize.apply(this, arguments); + }; + + // Attach all inheritable methods to the Model prototype. + _.extend(Model.prototype, Events, { + + // A hash of attributes whose current and previous value differ. + changed: null, + + // A hash of attributes that have silently changed since the last time + // `change` was called. Will become pending attributes on the next call. + _silent: null, + + // A hash of attributes that have changed since the last `'change'` event + // began. + _pending: null, + + // The default name for the JSON `id` attribute is `"id"`. MongoDB and + // CouchDB users may want to set this to `"_id"`. + idAttribute: 'id', + + // Initialize is an empty function by default. Override it with your own + // initialization logic. + initialize: function(){}, + + // Return a copy of the model's `attributes` object. + toJSON: function(options) { + return _.clone(this.attributes); + }, + + // Get the value of an attribute. + get: function(attr) { + return this.attributes[attr]; + }, + + // Get the HTML-escaped value of an attribute. + escape: function(attr) { + var html; + if (html = this._escapedAttributes[attr]) return html; + var val = this.get(attr); + return this._escapedAttributes[attr] = _.escape(val == null ? '' : '' + val); + }, + + // Returns `true` if the attribute contains a value that is not null + // or undefined. + has: function(attr) { + return this.get(attr) != null; + }, + + // Set a hash of model attributes on the object, firing `"change"` unless + // you choose to silence it. + set: function(key, value, options) { + var attrs, attr, val; + + // Handle both `"key", value` and `{key: value}` -style arguments. + if (_.isObject(key) || key == null) { + attrs = key; + options = value; + } else { + attrs = {}; + attrs[key] = value; + } + + // Extract attributes and options. + options || (options = {}); + if (!attrs) return this; + if (attrs instanceof Model) attrs = attrs.attributes; + if (options.unset) for (attr in attrs) attrs[attr] = void 0; + + // Run validation. + if (!this._validate(attrs, options)) return false; + + // Check for changes of `id`. + if (this.idAttribute in attrs) this.id = attrs[this.idAttribute]; + + var changes = options.changes = {}; + var now = this.attributes; + var escaped = this._escapedAttributes; + var prev = this._previousAttributes || {}; + + // For each `set` attribute... + for (attr in attrs) { + val = attrs[attr]; + + // If the new and current value differ, record the change. + if (!_.isEqual(now[attr], val) || (options.unset && _.has(now, attr))) { + delete escaped[attr]; + (options.silent ? this._silent : changes)[attr] = true; + } + + // Update or delete the current value. + options.unset ? delete now[attr] : now[attr] = val; + + // If the new and previous value differ, record the change. If not, + // then remove changes for this attribute. + if (!_.isEqual(prev[attr], val) || (_.has(now, attr) != _.has(prev, attr))) { + this.changed[attr] = val; + if (!options.silent) this._pending[attr] = true; + } else { + delete this.changed[attr]; + delete this._pending[attr]; + } + } + + // Fire the `"change"` events. + if (!options.silent) this.change(options); + return this; + }, + + // Remove an attribute from the model, firing `"change"` unless you choose + // to silence it. `unset` is a noop if the attribute doesn't exist. + unset: function(attr, options) { + (options || (options = {})).unset = true; + return this.set(attr, null, options); + }, + + // Clear all attributes on the model, firing `"change"` unless you choose + // to silence it. + clear: function(options) { + (options || (options = {})).unset = true; + return this.set(_.clone(this.attributes), options); + }, + + // Fetch the model from the server. If the server's representation of the + // model differs from its current attributes, they will be overriden, + // triggering a `"change"` event. + fetch: function(options) { + options = options ? _.clone(options) : {}; + var model = this; + var success = options.success; + options.success = function(resp, status, xhr) { + if (!model.set(model.parse(resp, xhr), options)) return false; + if (success) success(model, resp); + }; + options.error = Backbone.wrapError(options.error, model, options); + return (this.sync || Backbone.sync).call(this, 'read', this, options); + }, + + // Set a hash of model attributes, and sync the model to the server. + // If the server returns an attributes hash that differs, the model's + // state will be `set` again. + save: function(key, value, options) { + var attrs, current; + + // Handle both `("key", value)` and `({key: value})` -style calls. + if (_.isObject(key) || key == null) { + attrs = key; + options = value; + } else { + attrs = {}; + attrs[key] = value; + } + options = options ? _.clone(options) : {}; + + // If we're "wait"-ing to set changed attributes, validate early. + if (options.wait) { + if (!this._validate(attrs, options)) return false; + current = _.clone(this.attributes); + } + + // Regular saves `set` attributes before persisting to the server. + var silentOptions = _.extend({}, options, {silent: true}); + if (attrs && !this.set(attrs, options.wait ? silentOptions : options)) { + return false; + } + + // After a successful server-side save, the client is (optionally) + // updated with the server-side state. + var model = this; + var success = options.success; + options.success = function(resp, status, xhr) { + var serverAttrs = model.parse(resp, xhr); + if (options.wait) { + delete options.wait; + serverAttrs = _.extend(attrs || {}, serverAttrs); + } + if (!model.set(serverAttrs, options)) return false; + if (success) { + success(model, resp); + } else { + model.trigger('sync', model, resp, options); + } + }; + + // Finish configuring and sending the Ajax request. + options.error = Backbone.wrapError(options.error, model, options); + var method = this.isNew() ? 'create' : 'update'; + var xhr = (this.sync || Backbone.sync).call(this, method, this, options); + if (options.wait) this.set(current, silentOptions); + return xhr; + }, + + // Destroy this model on the server if it was already persisted. + // Optimistically removes the model from its collection, if it has one. + // If `wait: true` is passed, waits for the server to respond before removal. + destroy: function(options) { + options = options ? _.clone(options) : {}; + var model = this; + var success = options.success; + + var triggerDestroy = function() { + model.trigger('destroy', model, model.collection, options); + }; + + if (this.isNew()) { + triggerDestroy(); + return false; + } + + options.success = function(resp) { + if (options.wait) triggerDestroy(); + if (success) { + success(model, resp); + } else { + model.trigger('sync', model, resp, options); + } + }; + + options.error = Backbone.wrapError(options.error, model, options); + var xhr = (this.sync || Backbone.sync).call(this, 'delete', this, options); + if (!options.wait) triggerDestroy(); + return xhr; + }, + + // Default URL for the model's representation on the server -- if you're + // using Backbone's restful methods, override this to change the endpoint + // that will be called. + url: function() { + var base = getValue(this, 'urlRoot') || getValue(this.collection, 'url') || urlError(); + if (this.isNew()) return base; + return base + (base.charAt(base.length - 1) == '/' ? '' : '/') + encodeURIComponent(this.id); + }, + + // **parse** converts a response into the hash of attributes to be `set` on + // the model. The default implementation is just to pass the response along. + parse: function(resp, xhr) { + return resp; + }, + + // Create a new model with identical attributes to this one. + clone: function() { + return new this.constructor(this.attributes); + }, + + // A model is new if it has never been saved to the server, and lacks an id. + isNew: function() { + return this.id == null; + }, + + // Call this method to manually fire a `"change"` event for this model and + // a `"change:attribute"` event for each changed attribute. + // Calling this will cause all objects observing the model to update. + change: function(options) { + options || (options = {}); + var changing = this._changing; + this._changing = true; + + // Silent changes become pending changes. + for (var attr in this._silent) this._pending[attr] = true; + + // Silent changes are triggered. + var changes = _.extend({}, options.changes, this._silent); + this._silent = {}; + for (var attr in changes) { + this.trigger('change:' + attr, this, this.get(attr), options); + } + if (changing) return this; + + // Continue firing `"change"` events while there are pending changes. + while (!_.isEmpty(this._pending)) { + this._pending = {}; + this.trigger('change', this, options); + // Pending and silent changes still remain. + for (var attr in this.changed) { + if (this._pending[attr] || this._silent[attr]) continue; + delete this.changed[attr]; + } + this._previousAttributes = _.clone(this.attributes); + } + + this._changing = false; + return this; + }, + + // Determine if the model has changed since the last `"change"` event. + // If you specify an attribute name, determine if that attribute has changed. + hasChanged: function(attr) { + if (!arguments.length) return !_.isEmpty(this.changed); + return _.has(this.changed, attr); + }, + + // Return an object containing all the attributes that have changed, or + // false if there are no changed attributes. Useful for determining what + // parts of a view need to be updated and/or what attributes need to be + // persisted to the server. Unset attributes will be set to undefined. + // You can also pass an attributes object to diff against the model, + // determining if there *would be* a change. + changedAttributes: function(diff) { + if (!diff) return this.hasChanged() ? _.clone(this.changed) : false; + var val, changed = false, old = this._previousAttributes; + for (var attr in diff) { + if (_.isEqual(old[attr], (val = diff[attr]))) continue; + (changed || (changed = {}))[attr] = val; + } + return changed; + }, + + // Get the previous value of an attribute, recorded at the time the last + // `"change"` event was fired. + previous: function(attr) { + if (!arguments.length || !this._previousAttributes) return null; + return this._previousAttributes[attr]; + }, + + // Get all of the attributes of the model at the time of the previous + // `"change"` event. + previousAttributes: function() { + return _.clone(this._previousAttributes); + }, + + // Check if the model is currently in a valid state. It's only possible to + // get into an *invalid* state if you're using silent changes. + isValid: function() { + return !this.validate(this.attributes); + }, + + // Run validation against the next complete set of model attributes, + // returning `true` if all is well. If a specific `error` callback has + // been passed, call that instead of firing the general `"error"` event. + _validate: function(attrs, options) { + if (options.silent || !this.validate) return true; + attrs = _.extend({}, this.attributes, attrs); + var error = this.validate(attrs, options); + if (!error) return true; + if (options && options.error) { + options.error(this, error, options); + } else { + this.trigger('error', this, error, options); + } + return false; + } + + }); + + // Backbone.Collection + // ------------------- + + // Provides a standard collection class for our sets of models, ordered + // or unordered. If a `comparator` is specified, the Collection will maintain + // its models in sort order, as they're added and removed. + var Collection = Backbone.Collection = function(models, options) { + options || (options = {}); + if (options.model) this.model = options.model; + if (options.comparator) this.comparator = options.comparator; + this._reset(); + this.initialize.apply(this, arguments); + if (models) this.reset(models, {silent: true, parse: options.parse}); + }; + + // Define the Collection's inheritable methods. + _.extend(Collection.prototype, Events, { + + // The default model for a collection is just a **Backbone.Model**. + // This should be overridden in most cases. + model: Model, + + // Initialize is an empty function by default. Override it with your own + // initialization logic. + initialize: function(){}, + + // The JSON representation of a Collection is an array of the + // models' attributes. + toJSON: function(options) { + return this.map(function(model){ return model.toJSON(options); }); + }, + + // Add a model, or list of models to the set. Pass **silent** to avoid + // firing the `add` event for every new model. + add: function(models, options) { + var i, index, length, model, cid, id, cids = {}, ids = {}, dups = []; + options || (options = {}); + models = _.isArray(models) ? models.slice() : [models]; + + // Begin by turning bare objects into model references, and preventing + // invalid models or duplicate models from being added. + for (i = 0, length = models.length; i < length; i++) { + if (!(model = models[i] = this._prepareModel(models[i], options))) { + throw new Error("Can't add an invalid model to a collection"); + } + cid = model.cid; + id = model.id; + if (cids[cid] || this._byCid[cid] || ((id != null) && (ids[id] || this._byId[id]))) { + dups.push(i); + continue; + } + cids[cid] = ids[id] = model; + } + + // Remove duplicates. + i = dups.length; + while (i--) { + models.splice(dups[i], 1); + } + + // Listen to added models' events, and index models for lookup by + // `id` and by `cid`. + for (i = 0, length = models.length; i < length; i++) { + (model = models[i]).on('all', this._onModelEvent, this); + this._byCid[model.cid] = model; + if (model.id != null) this._byId[model.id] = model; + } + + // Insert models into the collection, re-sorting if needed, and triggering + // `add` events unless silenced. + this.length += length; + index = options.at != null ? options.at : this.models.length; + splice.apply(this.models, [index, 0].concat(models)); + if (this.comparator) this.sort({silent: true}); + if (options.silent) return this; + for (i = 0, length = this.models.length; i < length; i++) { + if (!cids[(model = this.models[i]).cid]) continue; + options.index = i; + model.trigger('add', model, this, options); + } + return this; + }, + + // Remove a model, or a list of models from the set. Pass silent to avoid + // firing the `remove` event for every model removed. + remove: function(models, options) { + var i, l, index, model; + options || (options = {}); + models = _.isArray(models) ? models.slice() : [models]; + for (i = 0, l = models.length; i < l; i++) { + model = this.getByCid(models[i]) || this.get(models[i]); + if (!model) continue; + delete this._byId[model.id]; + delete this._byCid[model.cid]; + index = this.indexOf(model); + this.models.splice(index, 1); + this.length--; + if (!options.silent) { + options.index = index; + model.trigger('remove', model, this, options); + } + this._removeReference(model); + } + return this; + }, + + // Add a model to the end of the collection. + push: function(model, options) { + model = this._prepareModel(model, options); + this.add(model, options); + return model; + }, + + // Remove a model from the end of the collection. + pop: function(options) { + var model = this.at(this.length - 1); + this.remove(model, options); + return model; + }, + + // Add a model to the beginning of the collection. + unshift: function(model, options) { + model = this._prepareModel(model, options); + this.add(model, _.extend({at: 0}, options)); + return model; + }, + + // Remove a model from the beginning of the collection. + shift: function(options) { + var model = this.at(0); + this.remove(model, options); + return model; + }, + + // Get a model from the set by id. + get: function(id) { + if (id == null) return void 0; + return this._byId[id.id != null ? id.id : id]; + }, + + // Get a model from the set by client id. + getByCid: function(cid) { + return cid && this._byCid[cid.cid || cid]; + }, + + // Get the model at the given index. + at: function(index) { + return this.models[index]; + }, + + // Return models with matching attributes. Useful for simple cases of `filter`. + where: function(attrs) { + if (_.isEmpty(attrs)) return []; + return this.filter(function(model) { + for (var key in attrs) { + if (attrs[key] !== model.get(key)) return false; + } + return true; + }); + }, + + // Force the collection to re-sort itself. You don't need to call this under + // normal circumstances, as the set will maintain sort order as each item + // is added. + sort: function(options) { + options || (options = {}); + if (!this.comparator) throw new Error('Cannot sort a set without a comparator'); + var boundComparator = _.bind(this.comparator, this); + if (this.comparator.length == 1) { + this.models = this.sortBy(boundComparator); + } else { + this.models.sort(boundComparator); + } + if (!options.silent) this.trigger('reset', this, options); + return this; + }, + + // Pluck an attribute from each model in the collection. + pluck: function(attr) { + return _.map(this.models, function(model){ return model.get(attr); }); + }, + + // When you have more items than you want to add or remove individually, + // you can reset the entire set with a new list of models, without firing + // any `add` or `remove` events. Fires `reset` when finished. + reset: function(models, options) { + models || (models = []); + options || (options = {}); + for (var i = 0, l = this.models.length; i < l; i++) { + this._removeReference(this.models[i]); + } + this._reset(); + this.add(models, _.extend({silent: true}, options)); + if (!options.silent) this.trigger('reset', this, options); + return this; + }, + + // Fetch the default set of models for this collection, resetting the + // collection when they arrive. If `add: true` is passed, appends the + // models to the collection instead of resetting. + fetch: function(options) { + options = options ? _.clone(options) : {}; + if (options.parse === undefined) options.parse = true; + var collection = this; + var success = options.success; + options.success = function(resp, status, xhr) { + collection[options.add ? 'add' : 'reset'](collection.parse(resp, xhr), options); + if (success) success(collection, resp); + }; + options.error = Backbone.wrapError(options.error, collection, options); + return (this.sync || Backbone.sync).call(this, 'read', this, options); + }, + + // Create a new instance of a model in this collection. Add the model to the + // collection immediately, unless `wait: true` is passed, in which case we + // wait for the server to agree. + create: function(model, options) { + var coll = this; + options = options ? _.clone(options) : {}; + model = this._prepareModel(model, options); + if (!model) return false; + if (!options.wait) coll.add(model, options); + var success = options.success; + options.success = function(nextModel, resp, xhr) { + if (options.wait) coll.add(nextModel, options); + if (success) { + success(nextModel, resp); + } else { + nextModel.trigger('sync', model, resp, options); + } + }; + model.save(null, options); + return model; + }, + + // **parse** converts a response into a list of models to be added to the + // collection. The default implementation is just to pass it through. + parse: function(resp, xhr) { + return resp; + }, + + // Proxy to _'s chain. Can't be proxied the same way the rest of the + // underscore methods are proxied because it relies on the underscore + // constructor. + chain: function () { + return _(this.models).chain(); + }, + + // Reset all internal state. Called when the collection is reset. + _reset: function(options) { + this.length = 0; + this.models = []; + this._byId = {}; + this._byCid = {}; + }, + + // Prepare a model or hash of attributes to be added to this collection. + _prepareModel: function(model, options) { + options || (options = {}); + if (!(model instanceof Model)) { + var attrs = model; + options.collection = this; + model = new this.model(attrs, options); + if (!model._validate(model.attributes, options)) model = false; + } else if (!model.collection) { + model.collection = this; + } + return model; + }, + + // Internal method to remove a model's ties to a collection. + _removeReference: function(model) { + if (this == model.collection) { + delete model.collection; + } + model.off('all', this._onModelEvent, this); + }, + + // Internal method called every time a model in the set fires an event. + // Sets need to update their indexes when models change ids. All other + // events simply proxy through. "add" and "remove" events that originate + // in other collections are ignored. + _onModelEvent: function(event, model, collection, options) { + if ((event == 'add' || event == 'remove') && collection != this) return; + if (event == 'destroy') { + this.remove(model, options); + } + if (model && event === 'change:' + model.idAttribute) { + delete this._byId[model.previous(model.idAttribute)]; + this._byId[model.id] = model; + } + this.trigger.apply(this, arguments); + } + + }); + + // Underscore methods that we want to implement on the Collection. + var methods = ['forEach', 'each', 'map', 'reduce', 'reduceRight', 'find', + 'detect', 'filter', 'select', 'reject', 'every', 'all', 'some', 'any', + 'include', 'contains', 'invoke', 'max', 'min', 'sortBy', 'sortedIndex', + 'toArray', 'size', 'first', 'initial', 'rest', 'last', 'without', 'indexOf', + 'shuffle', 'lastIndexOf', 'isEmpty', 'groupBy']; + + // Mix in each Underscore method as a proxy to `Collection#models`. + _.each(methods, function(method) { + Collection.prototype[method] = function() { + return _[method].apply(_, [this.models].concat(_.toArray(arguments))); + }; + }); + + // Backbone.Router + // ------------------- + + // Routers map faux-URLs to actions, and fire events when routes are + // matched. Creating a new one sets its `routes` hash, if not set statically. + var Router = Backbone.Router = function(options) { + options || (options = {}); + if (options.routes) this.routes = options.routes; + this._bindRoutes(); + this.initialize.apply(this, arguments); + }; + + // Cached regular expressions for matching named param parts and splatted + // parts of route strings. + var namedParam = /:\w+/g; + var splatParam = /\*\w+/g; + var escapeRegExp = /[-[\]{}()+?.,\\^$|#\s]/g; + + // Set up all inheritable **Backbone.Router** properties and methods. + _.extend(Router.prototype, Events, { + + // Initialize is an empty function by default. Override it with your own + // initialization logic. + initialize: function(){}, + + // Manually bind a single named route to a callback. For example: + // + // this.route('search/:query/p:num', 'search', function(query, num) { + // ... + // }); + // + route: function(route, name, callback) { + Backbone.history || (Backbone.history = new History); + if (!_.isRegExp(route)) route = this._routeToRegExp(route); + if (!callback) callback = this[name]; + Backbone.history.route(route, _.bind(function(fragment) { + var args = this._extractParameters(route, fragment); + callback && callback.apply(this, args); + this.trigger.apply(this, ['route:' + name].concat(args)); + Backbone.history.trigger('route', this, name, args); + }, this)); + return this; + }, + + // Simple proxy to `Backbone.history` to save a fragment into the history. + navigate: function(fragment, options) { + Backbone.history.navigate(fragment, options); + }, + + // Bind all defined routes to `Backbone.history`. We have to reverse the + // order of the routes here to support behavior where the most general + // routes can be defined at the bottom of the route map. + _bindRoutes: function() { + if (!this.routes) return; + var routes = []; + for (var route in this.routes) { + routes.unshift([route, this.routes[route]]); + } + for (var i = 0, l = routes.length; i < l; i++) { + this.route(routes[i][0], routes[i][1], this[routes[i][1]]); + } + }, + + // Convert a route string into a regular expression, suitable for matching + // against the current location hash. + _routeToRegExp: function(route) { + route = route.replace(escapeRegExp, '\\$&') + .replace(namedParam, '([^\/]+)') + .replace(splatParam, '(.*?)'); + return new RegExp('^' + route + '$'); + }, + + // Given a route, and a URL fragment that it matches, return the array of + // extracted parameters. + _extractParameters: function(route, fragment) { + return route.exec(fragment).slice(1); + } + + }); + + // Backbone.History + // ---------------- + + // Handles cross-browser history management, based on URL fragments. If the + // browser does not support `onhashchange`, falls back to polling. + var History = Backbone.History = function() { + this.handlers = []; + _.bindAll(this, 'checkUrl'); + }; + + // Cached regex for cleaning leading hashes and slashes . + var routeStripper = /^[#\/]/; + + // Cached regex for detecting MSIE. + var isExplorer = /msie [\w.]+/; + + // Has the history handling already been started? + History.started = false; + + // Set up all inheritable **Backbone.History** properties and methods. + _.extend(History.prototype, Events, { + + // The default interval to poll for hash changes, if necessary, is + // twenty times a second. + interval: 50, + + // Gets the true hash value. Cannot use location.hash directly due to bug + // in Firefox where location.hash will always be decoded. + getHash: function(windowOverride) { + var loc = windowOverride ? windowOverride.location : window.location; + var match = loc.href.match(/#(.*)$/); + return match ? match[1] : ''; + }, + + // Get the cross-browser normalized URL fragment, either from the URL, + // the hash, or the override. + getFragment: function(fragment, forcePushState) { + if (fragment == null) { + if (this._hasPushState || forcePushState) { + fragment = window.location.pathname; + var search = window.location.search; + if (search) fragment += search; + } else { + fragment = this.getHash(); + } + } + if (!fragment.indexOf(this.options.root)) fragment = fragment.substr(this.options.root.length); + return fragment.replace(routeStripper, ''); + }, + + // Start the hash change handling, returning `true` if the current URL matches + // an existing route, and `false` otherwise. + start: function(options) { + if (History.started) throw new Error("Backbone.history has already been started"); + History.started = true; + + // Figure out the initial configuration. Do we need an iframe? + // Is pushState desired ... is it available? + this.options = _.extend({}, {root: '/'}, this.options, options); + this._wantsHashChange = this.options.hashChange !== false; + this._wantsPushState = !!this.options.pushState; + this._hasPushState = !!(this.options.pushState && window.history && window.history.pushState); + var fragment = this.getFragment(); + var docMode = document.documentMode; + var oldIE = (isExplorer.exec(navigator.userAgent.toLowerCase()) && (!docMode || docMode <= 7)); + + if (oldIE) { + this.iframe = $('';}else{if(ie6){$('select').css('visibility','hidden');}msgbox+='
';}msgbox+='
X
';msgbox+='
';$.prompt.jqib=$(msgbox).appendTo($body);$.prompt.jqi=$.prompt.jqib.children('#'+$.prompt.options.prefix);$.prompt.jqif=$.prompt.jqib.children('#'+$.prompt.options.prefix+'fade');if(message.constructor==String){message={state0:{html:message,buttons:$.prompt.options.buttons,focus:$.prompt.options.focus,submit:$.prompt.options.submit}};}var states="";$.each(message,function(statename,stateobj){stateobj=$.extend({},$.prompt.defaults.state,stateobj);message[statename]=stateobj;var arrow="";if(stateobj.position.arrow!==null)arrow='
';states+='';});$.prompt.states=message;$.prompt.jqi.find('#'+$.prompt.options.prefix+'states').html(states).children('.'+$.prompt.options.prefix+'_state:first').css('display','block');$.prompt.jqi.find('.'+$.prompt.options.prefix+'buttons:empty').css('display','none');$.each(message,function(statename,stateobj){var $state=$.prompt.jqi.find('#'+$.prompt.options.prefix+'_state_'+statename);if($.prompt.currentStateName==="")$.prompt.currentStateName=statename;$state.bind('promptsubmit',stateobj.submit);$state.children('.'+$.prompt.options.prefix+'buttons').children('button').click(function(){var msg=$state.children('.'+$.prompt.options.prefix+'message');var clicked=stateobj.buttons[$(this).text()];if(clicked==undefined){for(var i in stateobj.buttons)if(stateobj.buttons[i].title==$(this).text())clicked=stateobj.buttons[i].value;}if(typeof clicked=='object')clicked=clicked.value;var forminputs={};$.each($.prompt.jqi.find('#'+$.prompt.options.prefix+'states :input').serializeArray(),function(i,obj){if(forminputs[obj.name]===undefined){forminputs[obj.name]=obj.value;}else if(typeof forminputs[obj.name]==Array||typeof forminputs[obj.name]=='object'){forminputs[obj.name].push(obj.value);}else{forminputs[obj.name]=[forminputs[obj.name],obj.value];}});var promptsubmite=new $.Event('promptsubmit');promptsubmite.stateName=statename;promptsubmite.state=$state;$state.trigger(promptsubmite,[clicked,msg,forminputs]);if(!promptsubmite.isDefaultPrevented()){$.prompt.close(true,clicked,msg,forminputs);}});$state.find('.'+$.prompt.options.prefix+'buttons button:eq('+stateobj.focus+')').addClass($.prompt.options.prefix+'defaultbutton');});var fadeClicked=function(){if($.prompt.options.persistent){var offset=($.prompt.options.top.toString().indexOf('%')>=0?($window.height()*(parseInt($.prompt.options.top,10)/100)):parseInt($.prompt.options.top,10)),top=parseInt($.prompt.jqi.css('top').replace('px',''),10)-offset;$('html,body').animate({scrollTop:top},'fast',function(){var i=0;$.prompt.jqib.addClass($.prompt.options.prefix+'warning');var intervalid=setInterval(function(){$.prompt.jqib.toggleClass($.prompt.options.prefix+'warning');if(i++>1){clearInterval(intervalid);$.prompt.jqib.removeClass($.prompt.options.prefix+'warning');}},100);});}else{$.prompt.close(true);}};var keyPressEventHandler=function(e){var key=(window.event)?event.keyCode:e.keyCode;if(key==27){fadeClicked();}if(key==9){var $inputels=$(':input:enabled:visible',$.prompt.jqib);var fwd=!e.shiftKey&&e.target==$inputels[$inputels.length-1];var back=e.shiftKey&&e.target==$inputels[0];if(fwd||back){setTimeout(function(){if(!$inputels)return;var el=$inputels[back===true?$inputels.length-1:0];if(el)el.focus();},10);return false;}}};$.prompt.position();$.prompt.style();$.prompt.jqif.click(fadeClicked);$window.resize({animate:false},$.prompt.position);$.prompt.jqib.bind("keydown keypress",keyPressEventHandler);$.prompt.jqi.find('.'+$.prompt.options.prefix+'close').click($.prompt.close);$.prompt.jqib.bind('promptloaded',$.prompt.options.loaded);$.prompt.jqib.bind('promptclose',$.prompt.options.callback);$.prompt.jqib.bind('promptstatechanging',$.prompt.options.statechanging);$.prompt.jqib.bind('promptstatechanged',$.prompt.options.statechanged);$.prompt.jqif.fadeIn($.prompt.options.overlayspeed);$.prompt.jqi[$.prompt.options.show]($.prompt.options.promptspeed,function(){$.prompt.jqib.trigger('promptloaded');});$.prompt.jqi.find('#'+$.prompt.options.prefix+'states .'+$.prompt.options.prefix+'_state:first .'+$.prompt.options.prefix+'defaultbutton').focus();if($.prompt.options.timeout>0)setTimeout($.prompt.close,$.prompt.options.timeout);return $.prompt.jqib;};$.prompt.defaults={prefix:'jqi',classes:'',buttons:{Ok:true},loaded:function(e){},submit:function(e,v,m,f){},callback:function(e,v,m,f){},statechanging:function(e,from,to){},statechanged:function(e,to){},opacity:0.6,zIndex:999,overlayspeed:'slow',promptspeed:'fast',show:'fadeIn',focus:0,useiframe:false,top:'15%',persistent:true,timeout:0,state:{html:'',buttons:{Ok:true},focus:0,position:{container:null,x:null,y:null,arrow:null},submit:function(e,v,m,f){return true;}}};$.prompt.currentPrefix=$.prompt.defaults.prefix;$.prompt.currentStateName="";$.prompt.setDefaults=function(o){$.prompt.defaults=$.extend({},$.prompt.defaults,o);};$.prompt.setStateDefaults=function(o){$.prompt.defaults.state=$.extend({},$.prompt.defaults.state,o);};$.prompt.position=function(e){var restoreFx=$.fx.off,$window=$(window),bodyHeight=$(document.body).outerHeight(true),windowHeight=$(window).height(),documentHeight=$(document).height(),height=bodyHeight>windowHeight?bodyHeight:windowHeight,top=parseInt($window.scrollTop(),10)+($.prompt.options.top.toString().indexOf('%')>=0?(windowHeight*(parseInt($.prompt.options.top,10)/100)):parseInt($.prompt.options.top,10));if(e!==undefined&&e.data.animate===false)$.fx.off=true;$.prompt.jqib.css({position:"absolute",height:height,width:"100%",top:0,left:0,right:0,bottom:0});$.prompt.jqif.css({position:"absolute",height:height,width:"100%",top:0,left:0,right:0,bottom:0});if($.prompt.states[$.prompt.currentStateName].position.container!==null){var pos=$.prompt.states[$.prompt.currentStateName].position,offset=$(pos.container).offset();$.prompt.jqi.css({position:"absolute"});$.prompt.jqi.animate({top:offset.top+pos.y,left:offset.left+pos.x,marginLeft:0,width:(pos.width!==undefined)?pos.width:null});top=(offset.top+pos.y)-($.prompt.options.top.toString().indexOf('%')>=0?(windowHeight*(parseInt($.prompt.options.top,10)/100)):parseInt($.prompt.options.top,10));$('html,body').animate({scrollTop:top},'slow','swing',function(){});}else{$.prompt.jqi.css({position:"absolute",top:top,left:'50%',marginLeft:(($.prompt.jqi.outerWidth()/2)*-1)});}if(e!==undefined&&e.data.animate===false)$.fx.off=restoreFx;};$.prompt.style=function(){$.prompt.jqif.css({zIndex:$.prompt.options.zIndex,display:"none",opacity:$.prompt.options.opacity});$.prompt.jqi.css({zIndex:$.prompt.options.zIndex+1,display:"none"});$.prompt.jqib.css({zIndex:$.prompt.options.zIndex});};$.prompt.getStateContent=function(state){return $('#'+$.prompt.currentPrefix+'_state_'+state);};$.prompt.getCurrentState=function(){return $('.'+$.prompt.currentPrefix+'_state:visible');};$.prompt.getCurrentStateName=function(){var stateid=$.prompt.getCurrentState().attr('id');return stateid.replace($.prompt.currentPrefix+'_state_','');};$.prompt.goToState=function(state,callback){var promptstatechanginge=new $.Event('promptstatechanging');$.prompt.jqib.trigger(promptstatechanginge,[$.prompt.currentStateName,state]);if(!promptstatechanginge.isDefaultPrevented()){$.prompt.currentStateName=state;$('.'+$.prompt.currentPrefix+'_state').slideUp('slow').find('.'+$.prompt.currentPrefix+'arrow').fadeOut();$('#'+$.prompt.currentPrefix+'_state_'+state).slideDown('slow',function(){var $t=$(this);$t.find('.'+$.prompt.currentPrefix+'defaultbutton').focus();$t.find('.'+$.prompt.currentPrefix+'arrow').fadeIn('slow');if(typeof callback=='function'){$.prompt.jqib.bind('promptstatechanged.tmp',callback);}$.prompt.jqib.trigger('promptstatechanged',[state]);if(typeof callback=='function'){$.prompt.jqib.unbind('promptstatechanged.tmp');}});$.prompt.position();}};$.prompt.nextState=function(callback){var $next=$('#'+$.prompt.currentPrefix+'_state_'+$.prompt.currentStateName).next();$.prompt.goToState($next.attr('id').replace($.prompt.currentPrefix+'_state_',''),callback);};$.prompt.prevState=function(callback){var $prev=$('#'+$.prompt.currentPrefix+'_state_'+$.prompt.currentStateName).prev();$.prompt.goToState($prev.attr('id').replace($.prompt.currentPrefix+'_state_',''),callback);};$.prompt.close=function(callCallback,clicked,msg,formvals){$.prompt.jqib.fadeOut('fast',function(){if(callCallback){$.prompt.jqib.trigger('promptclose',[clicked,msg,formvals]);}$.prompt.jqib.remove();$('window').unbind('resize',$.prompt.position);if(($.browser.msie&&$.browser.version<7)&&!$.prompt.options.useiframe){$('select').css('visibility','visible');}});};$.fn.extend({prompt:function(options){if(options==undefined)options={};if(options.withDataAndEvents==undefined)options.withDataAndEvents=false;$.prompt($(this).clone(options.withDataAndEvents).html(),options);},promptDropIn:function(speed,callback){var $t=$(this);if($t.css("display")=="none"){var eltop=$t.css('top');$t.css({top:$(window).scrollTop(),display:'block'}).animate({top:eltop},speed,'swing',callback);}}});})(jQuery); diff --git a/experiment/assert/lib/jquery-migrate-1.2.1.min.js b/experiment/assert/lib/jquery-migrate-1.2.1.min.js new file mode 100644 index 0000000..62149c2 --- /dev/null +++ b/experiment/assert/lib/jquery-migrate-1.2.1.min.js @@ -0,0 +1,2 @@ +/*! jQuery Migrate v1.2.1 | (c) 2005, 2013 jQuery Foundation, Inc. and other contributors | jquery.org/license */ +jQuery.migrateMute===void 0&&(jQuery.migrateMute=!0),function(e,t,n){function r(n){var r=t.console;i[n]||(i[n]=!0,e.migrateWarnings.push(n),r&&r.warn&&!e.migrateMute&&(r.warn("JQMIGRATE: "+n),e.migrateTrace&&r.trace&&r.trace()))}function a(t,a,i,o){if(Object.defineProperty)try{return Object.defineProperty(t,a,{configurable:!0,enumerable:!0,get:function(){return r(o),i},set:function(e){r(o),i=e}}),n}catch(s){}e._definePropertyBroken=!0,t[a]=i}var i={};e.migrateWarnings=[],!e.migrateMute&&t.console&&t.console.log&&t.console.log("JQMIGRATE: Logging is active"),e.migrateTrace===n&&(e.migrateTrace=!0),e.migrateReset=function(){i={},e.migrateWarnings.length=0},"BackCompat"===document.compatMode&&r("jQuery is not compatible with Quirks Mode");var o=e("",{size:1}).attr("size")&&e.attrFn,s=e.attr,u=e.attrHooks.value&&e.attrHooks.value.get||function(){return null},c=e.attrHooks.value&&e.attrHooks.value.set||function(){return n},l=/^(?:input|button)$/i,d=/^[238]$/,p=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,f=/^(?:checked|selected)$/i;a(e,"attrFn",o||{},"jQuery.attrFn is deprecated"),e.attr=function(t,a,i,u){var c=a.toLowerCase(),g=t&&t.nodeType;return u&&(4>s.length&&r("jQuery.fn.attr( props, pass ) is deprecated"),t&&!d.test(g)&&(o?a in o:e.isFunction(e.fn[a])))?e(t)[a](i):("type"===a&&i!==n&&l.test(t.nodeName)&&t.parentNode&&r("Can't change the 'type' of an input or button in IE 6/7/8"),!e.attrHooks[c]&&p.test(c)&&(e.attrHooks[c]={get:function(t,r){var a,i=e.prop(t,r);return i===!0||"boolean"!=typeof i&&(a=t.getAttributeNode(r))&&a.nodeValue!==!1?r.toLowerCase():n},set:function(t,n,r){var a;return n===!1?e.removeAttr(t,r):(a=e.propFix[r]||r,a in t&&(t[a]=!0),t.setAttribute(r,r.toLowerCase())),r}},f.test(c)&&r("jQuery.fn.attr('"+c+"') may use property instead of attribute")),s.call(e,t,a,i))},e.attrHooks.value={get:function(e,t){var n=(e.nodeName||"").toLowerCase();return"button"===n?u.apply(this,arguments):("input"!==n&&"option"!==n&&r("jQuery.fn.attr('value') no longer gets properties"),t in e?e.value:null)},set:function(e,t){var a=(e.nodeName||"").toLowerCase();return"button"===a?c.apply(this,arguments):("input"!==a&&"option"!==a&&r("jQuery.fn.attr('value', val) no longer sets properties"),e.value=t,n)}};var g,h,v=e.fn.init,m=e.parseJSON,y=/^([^<]*)(<[\w\W]+>)([^>]*)$/;e.fn.init=function(t,n,a){var i;return t&&"string"==typeof t&&!e.isPlainObject(n)&&(i=y.exec(e.trim(t)))&&i[0]&&("<"!==t.charAt(0)&&r("$(html) HTML strings must start with '<' character"),i[3]&&r("$(html) HTML text after last tag is ignored"),"#"===i[0].charAt(0)&&(r("HTML string cannot start with a '#' character"),e.error("JQMIGRATE: Invalid selector string (XSS)")),n&&n.context&&(n=n.context),e.parseHTML)?v.call(this,e.parseHTML(i[2],n,!0),n,a):v.apply(this,arguments)},e.fn.init.prototype=e.fn,e.parseJSON=function(e){return e||null===e?m.apply(this,arguments):(r("jQuery.parseJSON requires a valid JSON string"),null)},e.uaMatch=function(e){e=e.toLowerCase();var t=/(chrome)[ \/]([\w.]+)/.exec(e)||/(webkit)[ \/]([\w.]+)/.exec(e)||/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(e)||/(msie) ([\w.]+)/.exec(e)||0>e.indexOf("compatible")&&/(mozilla)(?:.*? rv:([\w.]+)|)/.exec(e)||[];return{browser:t[1]||"",version:t[2]||"0"}},e.browser||(g=e.uaMatch(navigator.userAgent),h={},g.browser&&(h[g.browser]=!0,h.version=g.version),h.chrome?h.webkit=!0:h.webkit&&(h.safari=!0),e.browser=h),a(e,"browser",e.browser,"jQuery.browser is deprecated"),e.sub=function(){function t(e,n){return new t.fn.init(e,n)}e.extend(!0,t,this),t.superclass=this,t.fn=t.prototype=this(),t.fn.constructor=t,t.sub=this.sub,t.fn.init=function(r,a){return a&&a instanceof e&&!(a instanceof t)&&(a=t(a)),e.fn.init.call(this,r,a,n)},t.fn.init.prototype=t.fn;var n=t(document);return r("jQuery.sub() is deprecated"),t},e.ajaxSetup({converters:{"text json":e.parseJSON}});var b=e.fn.data;e.fn.data=function(t){var a,i,o=this[0];return!o||"events"!==t||1!==arguments.length||(a=e.data(o,t),i=e._data(o,t),a!==n&&a!==i||i===n)?b.apply(this,arguments):(r("Use of jQuery.fn.data('events') is deprecated"),i)};var j=/\/(java|ecma)script/i,w=e.fn.andSelf||e.fn.addBack;e.fn.andSelf=function(){return r("jQuery.fn.andSelf() replaced by jQuery.fn.addBack()"),w.apply(this,arguments)},e.clean||(e.clean=function(t,a,i,o){a=a||document,a=!a.nodeType&&a[0]||a,a=a.ownerDocument||a,r("jQuery.clean() is deprecated");var s,u,c,l,d=[];if(e.merge(d,e.buildFragment(t,a).childNodes),i)for(c=function(e){return!e.type||j.test(e.type)?o?o.push(e.parentNode?e.parentNode.removeChild(e):e):i.appendChild(e):n},s=0;null!=(u=d[s]);s++)e.nodeName(u,"script")&&c(u)||(i.appendChild(u),u.getElementsByTagName!==n&&(l=e.grep(e.merge([],u.getElementsByTagName("script")),c),d.splice.apply(d,[s+1,0].concat(l)),s+=l.length));return d});var Q=e.event.add,x=e.event.remove,k=e.event.trigger,N=e.fn.toggle,T=e.fn.live,M=e.fn.die,S="ajaxStart|ajaxStop|ajaxSend|ajaxComplete|ajaxError|ajaxSuccess",C=RegExp("\\b(?:"+S+")\\b"),H=/(?:^|\s)hover(\.\S+|)\b/,A=function(t){return"string"!=typeof t||e.event.special.hover?t:(H.test(t)&&r("'hover' pseudo-event is deprecated, use 'mouseenter mouseleave'"),t&&t.replace(H,"mouseenter$1 mouseleave$1"))};e.event.props&&"attrChange"!==e.event.props[0]&&e.event.props.unshift("attrChange","attrName","relatedNode","srcElement"),e.event.dispatch&&a(e.event,"handle",e.event.dispatch,"jQuery.event.handle is undocumented and deprecated"),e.event.add=function(e,t,n,a,i){e!==document&&C.test(t)&&r("AJAX events should be attached to document: "+t),Q.call(this,e,A(t||""),n,a,i)},e.event.remove=function(e,t,n,r,a){x.call(this,e,A(t)||"",n,r,a)},e.fn.error=function(){var e=Array.prototype.slice.call(arguments,0);return r("jQuery.fn.error() is deprecated"),e.splice(0,0,"error"),arguments.length?this.bind.apply(this,e):(this.triggerHandler.apply(this,e),this)},e.fn.toggle=function(t,n){if(!e.isFunction(t)||!e.isFunction(n))return N.apply(this,arguments);r("jQuery.fn.toggle(handler, handler...) is deprecated");var a=arguments,i=t.guid||e.guid++,o=0,s=function(n){var r=(e._data(this,"lastToggle"+t.guid)||0)%o;return e._data(this,"lastToggle"+t.guid,r+1),n.preventDefault(),a[r].apply(this,arguments)||!1};for(s.guid=i;a.length>o;)a[o++].guid=i;return this.click(s)},e.fn.live=function(t,n,a){return r("jQuery.fn.live() is deprecated"),T?T.apply(this,arguments):(e(this.context).on(t,this.selector,n,a),this)},e.fn.die=function(t,n){return r("jQuery.fn.die() is deprecated"),M?M.apply(this,arguments):(e(this.context).off(t,this.selector||"**",n),this)},e.event.trigger=function(e,t,n,a){return n||C.test(e)||r("Global events are undocumented and deprecated"),k.call(this,e,t,n||document,a)},e.each(S.split("|"),function(t,n){e.event.special[n]={setup:function(){var t=this;return t!==document&&(e.event.add(document,n+"."+e.guid,function(){e.event.trigger(n,null,t,!0)}),e._data(this,n,e.guid++)),!1},teardown:function(){return this!==document&&e.event.remove(document,n+"."+e._data(this,n)),!1}}})}(jQuery,window); \ No newline at end of file diff --git a/experiment/assert/lib/jquery-ui-1.8.16.custom.min.js b/experiment/assert/lib/jquery-ui-1.8.16.custom.min.js new file mode 100644 index 0000000..14c9064 --- /dev/null +++ b/experiment/assert/lib/jquery-ui-1.8.16.custom.min.js @@ -0,0 +1,791 @@ +/*! + * jQuery UI 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d= +this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this, +"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart": +"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight, +outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a, +"tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&& +a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options; +this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, +_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= +false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, +10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| +!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& +a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), +10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, +(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= +"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), +10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ +this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& +!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= +i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= +false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= +{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; +if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, +_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, +{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: +Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(cb.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= +null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ +a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ +c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); +b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), +10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- +f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? +e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= +e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, +step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= +e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; +var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: +a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- +d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, +f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, +display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= +e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= +d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== +"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& +!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.16", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.propAttr("readOnly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("
    ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, +this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("");e.secondary&&a.append("");if(!this.options.text){d.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== +"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +b.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()};c.ui.dialog.maxZ+=1; +d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
    ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&& +c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j"); +this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", +g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length? +(h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i- +m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false; +this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b= +this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b= +this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b); +c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a= +this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e- +g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"}, +b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
    • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.16"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.bind("mouseout", +function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); +b.addClass("ui-state-hover");b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.16"}});var B=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, +setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g, +"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
    '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", +function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b);b.settings.disabled&&this._disableDatepicker(a)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c== +"focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker(): +d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a, +b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.settings.disabled&&this._disableDatepicker(a);b.dpDiv.css("display","block")}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+= +1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ +2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b= +d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e= +a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a, +"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f== +a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input", +a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=d.datepicker._get(b,"beforeShow");c=c?c.apply(a,[a,b]):{};if(c!==false){H(b.settings,c);b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value= +"";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b); +c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing= +true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}); +a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&& +!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(), +h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b= +this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b); +this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): +0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e["selected"+(c=="M"? +"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a); +this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField"); +if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"? +b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd", +COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames: +null)||this._defaults.monthNames;var i=function(o){(o=k+1 +12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&& +a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay? +new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a)); +n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m, +g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+s+"":f?"":''+s+"";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&& +a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
    '+(/all|left/.test(t)&& +x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
    ';var z=j?'":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="=5?' class="ui-datepicker-week-end"':"")+'>'+q[r]+""}y+=z+"";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay, +z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&ro;R+='";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
    '+this._get(a,"weekHeader")+"
    '+this._get(a,"calculateWeek")(r)+""+(F&&!D?" ":L?''+ +r.getDate()+"":''+r.getDate()+"")+"
    "+(l?""+(i[0]>0&&G==i[1]-1?'
    ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'': +"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b, +e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+ +(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input? +a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c, +e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a, +"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this; +if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a== +"string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.16";window["DP_jQuery_"+B]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.16"})})(jQuery); +;/* + * jQuery UI Effects 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.16",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), +d=document.activeElement;c.wrap(b);if(c[0]===d||f.contains(c[0],d))f(d).focus();b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(e,g){a[g]=c.css(g);if(isNaN(parseInt(a[g],10)))a[g]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){var a,b=document.activeElement; +if(c.parent().is(".ui-effects-wrapper")){a=c.parent().replaceWith(c);if(c[0]===b||f.contains(c[0],b))f(b).focus();return a}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)}); +return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this, +arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/ +2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b, +d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c, +a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b, +d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +; \ No newline at end of file diff --git a/experiment/assert/lib/jquery-ui-1.8.20.custom.js b/experiment/assert/lib/jquery-ui-1.8.20.custom.js new file mode 100644 index 0000000..9a386e4 --- /dev/null +++ b/experiment/assert/lib/jquery-ui-1.8.20.custom.js @@ -0,0 +1,11814 @@ +/*! + * jQuery UI 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.20", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
    + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/*! + * jQuery UI Position 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); +/*! + * jQuery UI Draggable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
    ') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + var element = this.element[0], elementInDom = false; + while ( element && (element = element.parentNode) ) { + if (element == document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + if (this.options.iframeFix === true) { + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); //Remove frame helpers + } + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.20" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/*! + * jQuery UI Droppable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.20" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); +/*! + * jQuery UI Resizable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
    ').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
    '); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
    '); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.20" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/*! + * jQuery UI Selectable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
    "); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.20" +}); + +})(jQuery); +/*! + * jQuery UI Sortable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + destroy: function() { + $.Widget.prototype.destroy.call( this ); + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.20" +}); + +})(jQuery); +/*! + * jQuery UI Accordion 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.20", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( s.parent().width() + - parseFloat( s.css( "paddingLeft" ) ) + - parseFloat( s.css( "paddingRight" ) ) + - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 ) + - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/*! + * jQuery UI Autocomplete 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + this.isMultiLine = this.element.is( "textarea" ); + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + self._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.menu = $( "
      " ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + self.beforeunloadHandler = function() { + self.element.removeAttr( "autocomplete" ); + }; + $( window ).bind( "beforeunload", self.beforeunloadHandler ); + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $( window ).unbind( "beforeunload", this.beforeunloadHandler ); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "
    • " ) + .data( "item.autocomplete", item ) + .append( $( "" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/*! + * jQuery UI Button 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = !!this.element.propAttr( "disabled" ); + } else { + this.element.propAttr( "disabled", this.options.disabled ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "", this.element[0].ownerDocument ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "" ); + } + + if ( icons.secondary ) { + buttonElement.append( "" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var rtl = this.element.css( "direction" ) === "rtl"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/*! + * jQuery UI Dialog 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
      ')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
      ')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
      ') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "
      " ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.20", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('
      ').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/*! + * jQuery UI Slider 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "
      " ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.20" +}); + +}(jQuery)); +/*! + * jQuery UI Tabs 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "
      ", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "
    • #{label}
      • " + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
    • + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.20" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); +/*! + * jQuery UI Datepicker 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.20" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('
      ')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('
      ')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('' + appendText + ''); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
      ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
      ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
      '; + } + calender += '
      ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
      ' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
      ' + this._get(inst, 'weekHeader') + '
      ' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
      ' + (isMultiMonth ? '
      ' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
      ' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
      '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
      '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.20"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/*! + * jQuery UI Progressbar 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "
      " ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.20" +}); + +})( jQuery ); +/*! + * jQuery UI Effects 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class') || ""; + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.20", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('
      ') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + element.wrap(wrapper); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + var unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); +/*! + * jQuery UI Effects Blind 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Bounce 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Clip 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Drop 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Explode 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Fade 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/*! + * jQuery UI Effects Fold 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Highlight 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/*! + * jQuery UI Effects Pulsate 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'), + times = ((o.options.times || 5) * 2) - 1, + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/*! + * jQuery UI Effects Scale 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + var child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Shake 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Slide 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/*! + * jQuery UI Effects Transfer 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
      ') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); diff --git a/experiment/assert/lib/jquery-ui-1.8.20.custom.min.js b/experiment/assert/lib/jquery-ui-1.8.20.custom.min.js new file mode 100644 index 0000000..8b173d9 --- /dev/null +++ b/experiment/assert/lib/jquery-ui-1.8.20.custom.min.js @@ -0,0 +1,125 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){function c(b,c){var e=b.nodeName.toLowerCase();if("area"===e){var f=b.parentNode,g=f.name,h;return!b.href||!g||f.nodeName.toLowerCase()!=="map"?!1:(h=a("img[usemap=#"+g+"]")[0],!!h&&d(h))}return(/input|select|textarea|button|object/.test(e)?!b.disabled:"a"==e?b.href||c:c)&&d(b)}function d(b){return!a(b).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(a.ui.version)return;a.extend(a.ui,{version:"1.8.20",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}}),a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(b,c){return typeof b=="number"?this.each(function(){var d=this;setTimeout(function(){a(d).focus(),c&&c.call(d)},b)}):this._focus.apply(this,arguments)},scrollParent:function(){var b;return a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?b=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):b=this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0),/fixed/.test(this.css("position"))||!b.length?a(document):b},zIndex:function(c){if(c!==b)return this.css("zIndex",c);if(this.length){var d=a(this[0]),e,f;while(d.length&&d[0]!==document){e=d.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){f=parseInt(d.css("zIndex"),10);if(!isNaN(f)&&f!==0)return f}d=d.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a.each(["Width","Height"],function(c,d){function h(b,c,d,f){return a.each(e,function(){c-=parseFloat(a.curCSS(b,"padding"+this,!0))||0,d&&(c-=parseFloat(a.curCSS(b,"border"+this+"Width",!0))||0),f&&(c-=parseFloat(a.curCSS(b,"margin"+this,!0))||0)}),c}var e=d==="Width"?["Left","Right"]:["Top","Bottom"],f=d.toLowerCase(),g={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+d]=function(c){return c===b?g["inner"+d].call(this):this.each(function(){a(this).css(f,h(this,c)+"px")})},a.fn["outer"+d]=function(b,c){return typeof b!="number"?g["outer"+d].call(this,b):this.each(function(){a(this).css(f,h(this,b,!0,c)+"px")})}}),a.extend(a.expr[":"],{data:function(b,c,d){return!!a.data(b,d[3])},focusable:function(b){return c(b,!isNaN(a.attr(b,"tabindex")))},tabbable:function(b){var d=a.attr(b,"tabindex"),e=isNaN(d);return(e||d>=0)&&c(b,!e)}}),a(function(){var b=document.body,c=b.appendChild(c=document.createElement("div"));c.offsetHeight,a.extend(c.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=c.offsetHeight===100,a.support.selectstart="onselectstart"in c,b.removeChild(c).style.display="none"}),a.extend(a.ui,{plugin:{add:function(b,c,d){var e=a.ui[b].prototype;for(var f in d)e.plugins[f]=e.plugins[f]||[],e.plugins[f].push([c,d[f]])},call:function(a,b,c){var d=a.plugins[b];if(!d||!a.element[0].parentNode)return;for(var e=0;e0?!0:(b[d]=1,e=b[d]>0,b[d]=0,e)},isOverAxis:function(a,b,c){return a>b&&a=9||!!b.button?this._mouseStarted?(this._mouseDrag(b),b.preventDefault()):(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,b)!==!1,this._mouseStarted?this._mouseDrag(b):this._mouseUp(b)),!this._mouseStarted):this._mouseUp(b)},_mouseUp:function(b){return a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,b.target==this._mouseDownEvent.target&&a.data(b.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(b)),!1},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(a){return this.mouseDelayMet},_mouseStart:function(a){},_mouseDrag:function(a){},_mouseStop:function(a){},_mouseCapture:function(a){return!0}})})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.position.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.ui=a.ui||{};var c=/left|center|right/,d=/top|center|bottom/,e="center",f={},g=a.fn.position,h=a.fn.offset;a.fn.position=function(b){if(!b||!b.of)return g.apply(this,arguments);b=a.extend({},b);var h=a(b.of),i=h[0],j=(b.collision||"flip").split(" "),k=b.offset?b.offset.split(" "):[0,0],l,m,n;return i.nodeType===9?(l=h.width(),m=h.height(),n={top:0,left:0}):i.setTimeout?(l=h.width(),m=h.height(),n={top:h.scrollTop(),left:h.scrollLeft()}):i.preventDefault?(b.at="left top",l=m=0,n={top:b.of.pageY,left:b.of.pageX}):(l=h.outerWidth(),m=h.outerHeight(),n=h.offset()),a.each(["my","at"],function(){var a=(b[this]||"").split(" ");a.length===1&&(a=c.test(a[0])?a.concat([e]):d.test(a[0])?[e].concat(a):[e,e]),a[0]=c.test(a[0])?a[0]:e,a[1]=d.test(a[1])?a[1]:e,b[this]=a}),j.length===1&&(j[1]=j[0]),k[0]=parseInt(k[0],10)||0,k.length===1&&(k[1]=k[0]),k[1]=parseInt(k[1],10)||0,b.at[0]==="right"?n.left+=l:b.at[0]===e&&(n.left+=l/2),b.at[1]==="bottom"?n.top+=m:b.at[1]===e&&(n.top+=m/2),n.left+=k[0],n.top+=k[1],this.each(function(){var c=a(this),d=c.outerWidth(),g=c.outerHeight(),h=parseInt(a.curCSS(this,"marginLeft",!0))||0,i=parseInt(a.curCSS(this,"marginTop",!0))||0,o=d+h+(parseInt(a.curCSS(this,"marginRight",!0))||0),p=g+i+(parseInt(a.curCSS(this,"marginBottom",!0))||0),q=a.extend({},n),r;b.my[0]==="right"?q.left-=d:b.my[0]===e&&(q.left-=d/2),b.my[1]==="bottom"?q.top-=g:b.my[1]===e&&(q.top-=g/2),f.fractions||(q.left=Math.round(q.left),q.top=Math.round(q.top)),r={left:q.left-h,top:q.top-i},a.each(["left","top"],function(c,e){a.ui.position[j[c]]&&a.ui.position[j[c]][e](q,{targetWidth:l,targetHeight:m,elemWidth:d,elemHeight:g,collisionPosition:r,collisionWidth:o,collisionHeight:p,offset:k,my:b.my,at:b.at})}),a.fn.bgiframe&&c.bgiframe(),c.offset(a.extend(q,{using:b.using}))})},a.ui.position={fit:{left:function(b,c){var d=a(window),e=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft();b.left=e>0?b.left-e:Math.max(b.left-c.collisionPosition.left,b.left)},top:function(b,c){var d=a(window),e=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop();b.top=e>0?b.top-e:Math.max(b.top-c.collisionPosition.top,b.top)}},flip:{left:function(b,c){if(c.at[0]===e)return;var d=a(window),f=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft(),g=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,h=c.at[0]==="left"?c.targetWidth:-c.targetWidth,i=-2*c.offset[0];b.left+=c.collisionPosition.left<0?g+h+i:f>0?g+h+i:0},top:function(b,c){if(c.at[1]===e)return;var d=a(window),f=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop(),g=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,h=c.at[1]==="top"?c.targetHeight:-c.targetHeight,i=-2*c.offset[1];b.top+=c.collisionPosition.top<0?g+h+i:f>0?g+h+i:0}}},a.offset.setOffset||(a.offset.setOffset=function(b,c){/static/.test(a.curCSS(b,"position"))&&(b.style.position="relative");var d=a(b),e=d.offset(),f=parseInt(a.curCSS(b,"top",!0),10)||0,g=parseInt(a.curCSS(b,"left",!0),10)||0,h={top:c.top-e.top+f,left:c.left-e.left+g};"using"in c?c.using.call(b,h):d.css(h)},a.fn.offset=function(b){var c=this[0];return!c||!c.ownerDocument?null:b?this.each(function(){a.offset.setOffset(this,b)}):h.call(this)}),function(){var b=document.getElementsByTagName("body")[0],c=document.createElement("div"),d,e,g,h,i;d=document.createElement(b?"div":"body"),g={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},b&&a.extend(g,{position:"absolute",left:"-1000px",top:"-1000px"});for(var j in g)d.style[j]=g[j];d.appendChild(c),e=b||document.documentElement,e.insertBefore(d,e.firstChild),c.style.cssText="position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;",h=a(c).offset(function(a,b){return b}).offset(),d.innerHTML="",e.removeChild(d),i=h.top+h.left+(b?2e3:0),f.fractions=i>21&&i<22}()})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.draggable.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},destroy:function(){if(!this.element.data("draggable"))return;return this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options;return this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(b),this.handle?(c.iframeFix&&a(c.iframeFix===!0?"iframe":c.iframeFix).each(function(){a('
      ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(a(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(b){var c=this.options;return this.helper=this._createHelper(b),this._cacheHelperProportions(),a.ui.ddmanager&&(a.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt),c.containment&&this._setContainment(),this._trigger("start",b)===!1?(this._clear(),!1):(this._cacheHelperProportions(),a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.helper.addClass("ui-draggable-dragging"),this._mouseDrag(b,!0),a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,b),!0)},_mouseDrag:function(b,c){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute");if(!c){var d=this._uiHash();if(this._trigger("drag",b,d)===!1)return this._mouseUp({}),!1;this.position=d.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),!1},_mouseStop:function(b){var c=!1;a.ui.ddmanager&&!this.options.dropBehaviour&&(c=a.ui.ddmanager.drop(this,b)),this.dropped&&(c=this.dropped,this.dropped=!1);var d=this.element[0],e=!1;while(d&&(d=d.parentNode))d==document&&(e=!0);if(!e&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===!0||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",b)!==!1&&f._clear()})}else this._trigger("stop",b)!==!1&&this._clear();return!1},_mouseUp:function(b){return this.options.iframeFix===!0&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,b),a.ui.mouse.prototype._mouseUp.call(this,b)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?!0:!1;return a(this.options.handle,this.element).find("*").andSelf().each(function(){this==b.target&&(c=!0)}),c},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo),d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute"),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[b.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,b.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(b.containment=="document"?0:a(window).scrollLeft())+a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b.containment=="document"?0:a(window).scrollTop())+(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)&&b.containment.constructor!=Array){var c=a(b.containment),d=c[0];if(!d)return;var e=c.offset(),f=a(d).css("overflow")!="hidden";this.containment=[(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),(f?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=c}else b.containment.constructor==Array&&(this.containment=b.containment)},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName),f=b.pageX,g=b.pageY;if(this.originalPosition){var h;if(this.containment){if(this.relative_container){var i=this.relative_container.offset();h=[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]}else h=this.containment;b.pageX-this.offset.click.lefth[2]&&(f=h[2]+this.offset.click.left),b.pageY-this.offset.click.top>h[3]&&(g=h[3]+this.offset.click.top)}if(c.grid){var j=c.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;g=h?j-this.offset.click.toph[3]?j-this.offset.click.toph[2]?k-this.offset.click.left=0;k--){var l=d.snapElements[k].left,m=l+d.snapElements[k].width,n=d.snapElements[k].top,o=n+d.snapElements[k].height;if(!(l-f=k&&g<=l||h>=k&&h<=l||gl)&&(e>=i&&e<=j||f>=i&&f<=j||ej);default:return!1}},a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(b,c){var d=a.ui.ddmanager.droppables[b.options.scope]||[],e=c?c.type:null,f=(b.currentItem||b.element).find(":data(droppable)").andSelf();g:for(var h=0;h').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=c.handles||(a(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var d=this.handles.split(",");this.handles={};for(var e=0;e');h.css({zIndex:c.zIndex}),"se"==f&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[f]=".ui-resizable-"+f,this.element.append(h)}}this._renderAxis=function(b){b=b||this.element;for(var c in this.handles){this.handles[c].constructor==String&&(this.handles[c]=a(this.handles[c],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var d=a(this.handles[c],this.element),e=0;e=/sw|ne|nw|se|n|s/.test(c)?d.outerHeight():d.outerWidth();var f=["padding",/ne|nw|n/.test(c)?"Top":/se|sw|s/.test(c)?"Bottom":/^e$/.test(c)?"Right":"Left"].join("");b.css(f,e),this._proportionallyResize()}if(!a(this.handles[c]).length)continue}},this._renderAxis(this.element),this._handles=a(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!b.resizing){if(this.className)var a=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=a&&a[1]?a[1]:"se"}}),c.autoHide&&(this._handles.hide(),a(this.element).addClass("ui-resizable-autohide").hover(function(){if(c.disabled)return;a(this).removeClass("ui-resizable-autohide"),b._handles.show()},function(){if(c.disabled)return;b.resizing||(a(this).addClass("ui-resizable-autohide"),b._handles.hide())})),this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(b){a(b).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var c=this.element;c.after(this.originalElement.css({position:c.css("position"),width:c.outerWidth(),height:c.outerHeight(),top:c.css("top"),left:c.css("left")})).remove()}return this.originalElement.css("resize",this.originalResizeStyle),b(this.originalElement),this},_mouseCapture:function(b){var c=!1;for(var d in this.handles)a(this.handles[d])[0]==b.target&&(c=!0);return!this.options.disabled&&c},_mouseStart:function(b){var d=this.options,e=this.element.position(),f=this.element;this.resizing=!0,this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()},(f.is(".ui-draggable")||/absolute/.test(f.css("position")))&&f.css({position:"absolute",top:e.top,left:e.left}),this._renderProxy();var g=c(this.helper.css("left")),h=c(this.helper.css("top"));d.containment&&(g+=a(d.containment).scrollLeft()||0,h+=a(d.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:g,top:h},this.size=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalSize=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalPosition={left:g,top:h},this.sizeDiff={width:f.outerWidth()-f.width(),height:f.outerHeight()-f.height()},this.originalMousePosition={left:b.pageX,top:b.pageY},this.aspectRatio=typeof d.aspectRatio=="number"?d.aspectRatio:this.originalSize.width/this.originalSize.height||1;var i=a(".ui-resizable-"+this.axis).css("cursor");return a("body").css("cursor",i=="auto"?this.axis+"-resize":i),f.addClass("ui-resizable-resizing"),this._propagate("start",b),!0},_mouseDrag:function(b){var c=this.helper,d=this.options,e={},f=this,g=this.originalMousePosition,h=this.axis,i=b.pageX-g.left||0,j=b.pageY-g.top||0,k=this._change[h];if(!k)return!1;var l=k.apply(this,[b,i,j]),m=a.browser.msie&&a.browser.version<7,n=this.sizeDiff;this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)l=this._updateRatio(l,b);return l=this._respectSize(l,b),this._propagate("resize",b),c.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",b,this.ui()),!1},_mouseStop:function(b){this.resizing=!1;var c=this.options,d=this;if(this._helper){var e=this._proportionallyResizeElements,f=e.length&&/textarea/i.test(e[0].nodeName),g=f&&a.ui.hasScroll(e[0],"left")?0:d.sizeDiff.height,h=f?0:d.sizeDiff.width,i={width:d.helper.width()-h,height:d.helper.height()-g},j=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,k=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;c.animate||this.element.css(a.extend(i,{top:k,left:j})),d.helper.height(d.size.height),d.helper.width(d.size.width),this._helper&&!c.animate&&this._proportionallyResize()}return a("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",b),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(a){var b=this.options,c,e,f,g,h;h={minWidth:d(b.minWidth)?b.minWidth:0,maxWidth:d(b.maxWidth)?b.maxWidth:Infinity,minHeight:d(b.minHeight)?b.minHeight:0,maxHeight:d(b.maxHeight)?b.maxHeight:Infinity};if(this._aspectRatio||a)c=h.minHeight*this.aspectRatio,f=h.minWidth/this.aspectRatio,e=h.maxHeight*this.aspectRatio,g=h.maxWidth/this.aspectRatio,c>h.minWidth&&(h.minWidth=c),f>h.minHeight&&(h.minHeight=f),ea.width,k=d(a.height)&&e.minHeight&&e.minHeight>a.height;j&&(a.width=e.minWidth),k&&(a.height=e.minHeight),h&&(a.width=e.maxWidth),i&&(a.height=e.maxHeight);var l=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height,n=/sw|nw|w/.test(g),o=/nw|ne|n/.test(g);j&&n&&(a.left=l-e.minWidth),h&&n&&(a.left=l-e.maxWidth),k&&o&&(a.top=m-e.minHeight),i&&o&&(a.top=m-e.maxHeight);var p=!a.width&&!a.height;return p&&!a.left&&a.top?a.top=null:p&&!a.top&&a.left&&(a.left=null),a},_proportionallyResize:function(){var b=this.options;if(!this._proportionallyResizeElements.length)return;var c=this.helper||this.element;for(var d=0;d');var d=a.browser.msie&&a.browser.version<7,e=d?1:0,f=d?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++c.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(a,b,c){return{width:this.originalSize.width+b}},w:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{left:f.left+b,width:e.width-b}},n:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{top:f.top+c,height:e.height-c}},s:function(a,b,c){return{height:this.originalSize.height+c}},se:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},sw:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,c,d]))},ne:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},nw:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,c,d]))}},_propagate:function(b,c){a.ui.plugin.call(this,b,[c,this.ui()]),b!="resize"&&this._trigger(b,c,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),a.extend(a.ui.resizable,{version:"1.8.20"}),a.ui.plugin.add("resizable","alsoResize",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=function(b){a(b).each(function(){var b=a(this);b.data("resizable-alsoresize",{width:parseInt(b.width(),10),height:parseInt(b.height(),10),left:parseInt(b.css("left"),10),top:parseInt(b.css("top"),10)})})};typeof e.alsoResize=="object"&&!e.alsoResize.parentNode?e.alsoResize.length?(e.alsoResize=e.alsoResize[0],f(e.alsoResize)):a.each(e.alsoResize,function(a){f(a)}):f(e.alsoResize)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.originalSize,g=d.originalPosition,h={height:d.size.height-f.height||0,width:d.size.width-f.width||0,top:d.position.top-g.top||0,left:d.position.left-g.left||0},i=function(b,d){a(b).each(function(){var b=a(this),e=a(this).data("resizable-alsoresize"),f={},g=d&&d.length?d:b.parents(c.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(g,function(a,b){var c=(e[b]||0)+(h[b]||0);c&&c>=0&&(f[b]=c||null)}),b.css(f)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?a.each(e.alsoResize,function(a,b){i(a,b)}):i(e.alsoResize)},stop:function(b,c){a(this).removeData("resizable-alsoresize")}}),a.ui.plugin.add("resizable","animate",{stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d._proportionallyResizeElements,g=f.length&&/textarea/i.test(f[0].nodeName),h=g&&a.ui.hasScroll(f[0],"left")?0:d.sizeDiff.height,i=g?0:d.sizeDiff.width,j={width:d.size.width-i,height:d.size.height-h},k=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,l=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;d.element.animate(a.extend(j,l&&k?{top:l,left:k}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var c={width:parseInt(d.element.css("width"),10),height:parseInt(d.element.css("height"),10),top:parseInt(d.element.css("top"),10),left:parseInt(d.element.css("left"),10)};f&&f.length&&a(f[0]).css({width:c.width,height:c.height}),d._updateCache(c),d._propagate("resize",b)}})}}),a.ui.plugin.add("resizable","containment",{start:function(b,d){var e=a(this).data("resizable"),f=e.options,g=e.element,h=f.containment,i=h instanceof a?h.get(0):/parent/.test(h)?g.parent().get(0):h;if(!i)return;e.containerElement=a(i);if(/document/.test(h)||h==document)e.containerOffset={left:0,top:0},e.containerPosition={left:0,top:0},e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight};else{var j=a(i),k=[];a(["Top","Right","Left","Bottom"]).each(function(a,b){k[a]=c(j.css("padding"+b))}),e.containerOffset=j.offset(),e.containerPosition=j.position(),e.containerSize={height:j.innerHeight()-k[3],width:j.innerWidth()-k[1]};var l=e.containerOffset,m=e.containerSize.height,n=e.containerSize.width,o=a.ui.hasScroll(i,"left")?i.scrollWidth:n,p=a.ui.hasScroll(i)?i.scrollHeight:m;e.parentData={element:i,left:l.left,top:l.top,width:o,height:p}}},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.containerSize,g=d.containerOffset,h=d.size,i=d.position,j=d._aspectRatio||b.shiftKey,k={top:0,left:0},l=d.containerElement;l[0]!=document&&/static/.test(l.css("position"))&&(k=g),i.left<(d._helper?g.left:0)&&(d.size.width=d.size.width+(d._helper?d.position.left-g.left:d.position.left-k.left),j&&(d.size.height=d.size.width/d.aspectRatio),d.position.left=e.helper?g.left:0),i.top<(d._helper?g.top:0)&&(d.size.height=d.size.height+(d._helper?d.position.top-g.top:d.position.top),j&&(d.size.width=d.size.height*d.aspectRatio),d.position.top=d._helper?g.top:0),d.offset.left=d.parentData.left+d.position.left,d.offset.top=d.parentData.top+d.position.top;var m=Math.abs((d._helper?d.offset.left-k.left:d.offset.left-k.left)+d.sizeDiff.width),n=Math.abs((d._helper?d.offset.top-k.top:d.offset.top-g.top)+d.sizeDiff.height),o=d.containerElement.get(0)==d.element.parent().get(0),p=/relative|absolute/.test(d.containerElement.css("position"));o&&p&&(m-=d.parentData.left),m+d.size.width>=d.parentData.width&&(d.size.width=d.parentData.width-m,j&&(d.size.height=d.size.width/d.aspectRatio)),n+d.size.height>=d.parentData.height&&(d.size.height=d.parentData.height-n,j&&(d.size.width=d.size.height*d.aspectRatio))},stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.position,g=d.containerOffset,h=d.containerPosition,i=d.containerElement,j=a(d.helper),k=j.offset(),l=j.outerWidth()-d.sizeDiff.width,m=j.outerHeight()-d.sizeDiff.height;d._helper&&!e.animate&&/relative/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m}),d._helper&&!e.animate&&/static/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m})}}),a.ui.plugin.add("resizable","ghost",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size;d.ghost=d.originalElement.clone(),d.ghost.css({opacity:.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:""),d.ghost.appendTo(d.helper)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})},stop:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.helper&&d.helper.get(0).removeChild(d.ghost.get(0))}}),a.ui.plugin.add("resizable","grid",{resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size,g=d.originalSize,h=d.originalPosition,i=d.axis,j=e._aspectRatio||b.shiftKey;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var k=Math.round((f.width-g.width)/(e.grid[0]||1))*(e.grid[0]||1),l=Math.round((f.height-g.height)/(e.grid[1]||1))*(e.grid[1]||1);/^(se|s|e)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l):/^(ne)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l):/^(sw)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.left=h.left-k):(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l,d.position.left=h.left-k)}});var c=function(a){return parseInt(a,10)||0},d=function(a){return!isNaN(parseInt(a,10))}})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.selectable.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var b=this;this.element.addClass("ui-selectable"),this.dragged=!1;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]),c.addClass("ui-selectee"),c.each(function(){var b=a(this),c=b.offset();a.data(this,"selectable-item",{element:this,$element:b,left:c.left,top:c.top,right:c.left+b.outerWidth(),bottom:c.top+b.outerHeight(),startselected:!1,selected:b.hasClass("ui-selected"),selecting:b.hasClass("ui-selecting"),unselecting:b.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=c.addClass("ui-selectee"),this._mouseInit(),this.helper=a("
      ")},destroy:function(){return this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable"),this._mouseDestroy(),this},_mouseStart:function(b){var c=this;this.opos=[b.pageX,b.pageY];if(this.options.disabled)return;var d=this.options;this.selectees=a(d.filter,this.element[0]),this._trigger("start",b),a(d.appendTo).append(this.helper),this.helper.css({left:b.clientX,top:b.clientY,width:0,height:0}),d.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var d=a.data(this,"selectable-item");d.startselected=!0,!b.metaKey&&!b.ctrlKey&&(d.$element.removeClass("ui-selected"),d.selected=!1,d.$element.addClass("ui-unselecting"),d.unselecting=!0,c._trigger("unselecting",b,{unselecting:d.element}))}),a(b.target).parents().andSelf().each(function(){var d=a.data(this,"selectable-item");if(d){var e=!b.metaKey&&!b.ctrlKey||!d.$element.hasClass("ui-selected");return d.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),d.unselecting=!e,d.selecting=e,d.selected=e,e?c._trigger("selecting",b,{selecting:d.element}):c._trigger("unselecting",b,{unselecting:d.element}),!1}})},_mouseDrag:function(b){var c=this;this.dragged=!0;if(this.options.disabled)return;var d=this.options,e=this.opos[0],f=this.opos[1],g=b.pageX,h=b.pageY;if(e>g){var i=g;g=e,e=i}if(f>h){var i=h;h=f,f=i}return this.helper.css({left:e,top:f,width:g-e,height:h-f}),this.selectees.each(function(){var i=a.data(this,"selectable-item");if(!i||i.element==c.element[0])return;var j=!1;d.tolerance=="touch"?j=!(i.left>g||i.righth||i.bottome&&i.rightf&&i.bottom *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var a=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},destroy:function(){a.Widget.prototype.destroy.call(this),this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--)this.items[b].item.removeData(this.widgetName+"-item");return this},_setOption:function(b,c){b==="disabled"?(this.options[b]=c,this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")):a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(b,c){var d=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(b);var e=null,f=this,g=a(b.target).parents().each(function(){if(a.data(this,d.widgetName+"-item")==f)return e=a(this),!1});a.data(b.target,d.widgetName+"-item")==f&&(e=a(b.target));if(!e)return!1;if(this.options.handle&&!c){var h=!1;a(this.options.handle,e).find("*").andSelf().each(function(){this==b.target&&(h=!0)});if(!h)return!1}return this.currentItem=e,this._removeCurrentsFromItems(),!0},_mouseStart:function(b,c,d){var e=this.options,f=this;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(b),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),e.containment&&this._setContainment(),e.cursor&&(a("body").css("cursor")&&(this._storedCursor=a("body").css("cursor")),a("body").css("cursor",e.cursor)),e.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",e.opacity)),e.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",e.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",b,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!d)for(var g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",b,f._uiHash(this));return a.ui.ddmanager&&(a.ui.ddmanager.current=this),a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(b),!0},_mouseDrag:function(b){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var c=this.options,d=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-b.pageY=0;e--){var f=this.items[e],g=f.item[0],h=this._intersectsWithPointer(f);if(!h)continue;if(g!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],g):!0)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(b,f);else break;this._trigger("change",b,this._uiHash());break}}return this._contactContainers(b),a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),this._trigger("sort",b,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(b,c){if(!b)return;a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,b);if(this.options.revert){var d=this,e=d.placeholder.offset();d.reverting=!0,a(this.helper).animate({left:e.left-this.offset.parent.left-d.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-d.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){d._clear(b)})}else this._clear(b,c);return!1},cancel:function(){var b=this;if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("deactivate",null,b._uiHash(this)),this.containers[c].containerCache.over&&(this.containers[c]._trigger("out",null,b._uiHash(this)),this.containers[c].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),a.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},a(c).each(function(){var c=(a(b.item||this).attr(b.attribute||"id")||"").match(b.expression||/(.+)[-=_](.+)/);c&&d.push((b.key||c[1]+"[]")+"="+(b.key&&b.expression?c[1]:c[2]))}),!d.length&&b.key&&d.push(b.key+"="),d.join("&")},toArray:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},c.each(function(){d.push(a(b.item||this).attr(b.attribute||"id")||"")}),d},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,d=this.positionAbs.top,e=d+this.helperProportions.height,f=a.left,g=f+a.width,h=a.top,i=h+a.height,j=this.offset.click.top,k=this.offset.click.left,l=d+j>h&&d+jf&&b+ka[this.floating?"width":"height"]?l:f0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){return this._refreshItems(a),this.refreshPositions(),this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(b){var c=this,d=[],e=[],f=this._connectWith();if(f&&b)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&e.push([a.isFunction(j.options.items)?j.options.items.call(j.element):a(j.options.items,j.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),j])}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var g=e.length-1;g>=0;g--)e[g][0].each(function(){d.push(this)});return a(d)},_removeCurrentsFromItems:function(){var a=this.currentItem.find(":data("+this.widgetName+"-item)");for(var b=0;b=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&(e.push([a.isFunction(j.options.items)?j.options.items.call(j.element[0],b,{item:this.currentItem}):a(j.options.items,j.element),j]),this.containers.push(j))}}for(var g=e.length-1;g>=0;g--){var k=e[g][1],l=e[g][0];for(var i=0,m=l.length;i=0;c--){var d=this.items[c];if(d.instance!=this.currentContainer&&this.currentContainer&&d.item[0]!=this.currentItem[0])continue;var e=this.options.toleranceElement?a(this.options.toleranceElement,d.item):d.item;b||(d.width=e.outerWidth(),d.height=e.outerHeight());var f=e.offset();d.left=f.left,d.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var c=this.containers.length-1;c>=0;c--){var f=this.containers[c].element.offset();this.containers[c].containerCache.left=f.left,this.containers[c].containerCache.top=f.top,this.containers[c].containerCache.width=this.containers[c].element.outerWidth(),this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(b){var c=b||this,d=c.options;if(!d.placeholder||d.placeholder.constructor==String){var e=d.placeholder;d.placeholder={element:function(){var b=a(document.createElement(c.currentItem[0].nodeName)).addClass(e||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return e||(b.style.visibility="hidden"),b},update:function(a,b){if(e&&!d.forcePlaceholderSize)return;b.height()||b.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10)),b.width()||b.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}c.placeholder=a(d.placeholder.element.call(c.element,c.currentItem)),c.currentItem.after(c.placeholder),d.placeholder.update(c,c.placeholder)},_contactContainers:function(b){var c=null,d=null;for(var e=this.containers.length-1;e>=0;e--){if(a.ui.contains(this.currentItem[0],this.containers[e].element[0]))continue;if(this._intersectsWith(this.containers[e].containerCache)){if(c&&a.ui.contains(this.containers[e].element[0],c.element[0]))continue;c=this.containers[e],d=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",b,this._uiHash(this)),this.containers[e].containerCache.over=0)}if(!c)return;if(this.containers.length===1)this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1;else if(this.currentContainer!=this.containers[d]){var f=1e4,g=null,h=this.positionAbs[this.containers[d].floating?"left":"top"];for(var i=this.items.length-1;i>=0;i--){if(!a.ui.contains(this.containers[d].element[0],this.items[i].item[0]))continue;var j=this.items[i][this.containers[d].floating?"left":"top"];Math.abs(j-h)this.containment[2]&&(f=this.containment[2]+this.offset.click.left),b.pageY-this.offset.click.top>this.containment[3]&&(g=this.containment[3]+this.offset.click.top));if(c.grid){var h=this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1];g=this.containment?h-this.offset.click.topthis.containment[3]?h-this.offset.click.topthis.containment[2]?i-this.offset.click.left=0;f--)a.ui.contains(this.containers[f].element[0],this.currentItem[0])&&!c&&(d.push(function(a){return function(b){a._trigger("receive",b,this._uiHash(this))}}.call(this,this.containers[f])),d.push(function(a){return function(b){a._trigger("update",b,this._uiHash(this))}}.call(this,this.containers[f])))}for(var f=this.containers.length-1;f>=0;f--)c||d.push(function(a){return function(b){a._trigger("deactivate",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over&&(d.push(function(a){return function(b){a._trigger("out",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over=0);this._storedCursor&&a("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",b,this._uiHash());for(var f=0;f li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var b=this,c=b.options;b.running=0,b.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"),b.headers=b.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-focus")}),b.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(c.navigation){var d=b.element.find("a").filter(c.navigationFilter).eq(0);if(d.length){var e=d.closest(".ui-accordion-header");e.length?b.active=e:b.active=d.closest(".ui-accordion-content").prev()}}b.active=b._findActive(b.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"),b.active.next().addClass("ui-accordion-content-active"),b._createIcons(),b.resize(),b.element.attr("role","tablist"),b.headers.attr("role","tab").bind("keydown.accordion",function(a){return b._keydown(a)}).next().attr("role","tabpanel"),b.headers.not(b.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide(),b.active.length?b.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):b.headers.eq(0).attr("tabIndex",0),a.browser.safari||b.headers.find("a").attr("tabIndex",-1),c.event&&b.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(a){b._clickHandler.call(b,a,this),a.preventDefault()})},_createIcons:function(){var b=this.options;b.icons&&(a("").addClass("ui-icon "+b.icons.header).prependTo(this.headers),this.active.children(".ui-icon").toggleClass(b.icons.header).toggleClass(b.icons.headerSelected),this.element.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.children(".ui-icon").remove(),this.element.removeClass("ui-accordion-icons")},destroy:function(){var b=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"),this.headers.find("a").removeAttr("tabIndex"),this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");return(b.autoHeight||b.fillHeight)&&c.css("height",""),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b=="active"&&this.activate(c),b=="icons"&&(this._destroyIcons(),c&&this._createIcons()),b=="disabled"&&this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(b){if(this.options.disabled||b.altKey||b.ctrlKey)return;var c=a.ui.keyCode,d=this.headers.length,e=this.headers.index(b.target),f=!1;switch(b.keyCode){case c.RIGHT:case c.DOWN:f=this.headers[(e+1)%d];break;case c.LEFT:case c.UP:f=this.headers[(e-1+d)%d];break;case c.SPACE:case c.ENTER:this._clickHandler({target:b.target},b.target),b.preventDefault()}return f?(a(b.target).attr("tabIndex",-1),a(f).attr("tabIndex",0),f.focus(),!1):!0},resize:function(){var b=this.options,c;if(b.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height(),a.browser.msie&&this.element.parent().css("overflow",d),this.headers.each(function(){c-=a(this).outerHeight(!0)}),this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else b.autoHeight&&(c=0,this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c));return this},activate:function(a){this.options.active=a;var b=this._findActive(a)[0];return this._clickHandler({target:b},b),this},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===!1?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,c){var d=this.options;if(d.disabled)return;if(!b.target){if(!d.collapsible)return;this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),f={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:e},g=this.active=a([]);this._toggle(g,e,f);return}var h=a(b.currentTarget||c),i=h[0]===this.active[0];d.active=d.collapsible&&i?!1:this.headers.index(h);if(this.running||!d.collapsible&&i)return;var j=this.active,g=h.next(),e=this.active.next(),f={options:d,newHeader:i&&d.collapsible?a([]):h,oldHeader:this.active,newContent:i&&d.collapsible?a([]):g,oldContent:e},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=i?a([]):h,this._toggle(g,e,f,i,k),j.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),i||(h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected),h.next().addClass("ui-accordion-content-active"));return},_toggle:function(b,c,d,e,f){var g=this,h=g.options;g.toShow=b,g.toHide=c,g.data=d;var i=function(){if(!g)return;return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data),g.running=c.size()===0?b.size():c.size();if(h.animated){var j={};h.collapsible&&e?j={toShow:a([]),toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace}:j={toShow:b,toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace},h.proxied||(h.proxied=h.animated),h.proxiedDuration||(h.proxiedDuration=h.duration),h.animated=a.isFunction(h.proxied)?h.proxied(j):h.proxied,h.duration=a.isFunction(h.proxiedDuration)?h.proxiedDuration(j):h.proxiedDuration;var k=a.ui.accordion.animations,l=h.duration,m=h.animated;m&&!k[m]&&!a.easing[m]&&(m="slide"),k[m]||(k[m]=function(a){this.slide(a,{easing:m,duration:l||700})}),k[m](j)}else h.collapsible&&e?b.toggle():(c.hide(),b.show()),i(!0);c.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur(),b.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(this.running)return;this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""}),this.toHide.removeClass("ui-accordion-content-active"),this.toHide.length&&(this.toHide.parent()[0].className=this.toHide.parent()[0].className),this._trigger("change",null,this.data)}}),a.extend(a.ui.accordion,{version:"1.8.20",animations:{slide:function(b,c){b=a.extend({easing:"swing",duration:300},b,c);if(!b.toHide.size()){b.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},b);return}if(!b.toShow.size()){b.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},b);return}var d=b.toShow.css("overflow"),e=0,f={},g={},h=["height","paddingTop","paddingBottom"],i,j=b.toShow;i=j[0].style.width,j.width(j.parent().width()-parseFloat(j.css("paddingLeft"))-parseFloat(j.css("paddingRight"))-(parseFloat(j.css("borderLeftWidth"))||0)-(parseFloat(j.css("borderRightWidth"))||0)),a.each(h,function(c,d){g[d]="hide";var e=(""+a.css(b.toShow[0],d)).match(/^([\d+-.]+)(.*)$/);f[d]={value:e[1],unit:e[2]||"px"}}),b.toShow.css({height:0,overflow:"hidden"}).show(),b.toHide.filter(":hidden").each(b.complete).end().filter(":visible").animate(g,{step:function(a,c){c.prop=="height"&&(e=c.end-c.start===0?0:(c.now-c.start)/(c.end-c.start)),b.toShow[0].style[c.prop]=e*f[c.prop].value+f[c.prop].unit},duration:b.duration,easing:b.easing,complete:function(){b.autoHeight||b.toShow.css("height",""),b.toShow.css({width:i,overflow:d}),b.complete()}})},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1e3:200})}}})})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.autocomplete.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var b=this,c=this.element[0].ownerDocument,d;this.isMultiLine=this.element.is("textarea"),this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(b.options.disabled||b.element.propAttr("readOnly"))return;d=!1;var e=a.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:b._move("previousPage",c);break;case e.PAGE_DOWN:b._move("nextPage",c);break;case e.UP:b._keyEvent("previous",c);break;case e.DOWN:b._keyEvent("next",c);break;case e.ENTER:case e.NUMPAD_ENTER:b.menu.active&&(d=!0,c.preventDefault());case e.TAB:if(!b.menu.active)return;b.menu.select(c);break;case e.ESCAPE:b.element.val(b.term),b.close(c);break;default:clearTimeout(b.searching),b.searching=setTimeout(function(){b.term!=b.element.val()&&(b.selectedItem=null,b.search(null,c))},b.options.delay)}}).bind("keypress.autocomplete",function(a){d&&(d=!1,a.preventDefault())}).bind("focus.autocomplete",function(){if(b.options.disabled)return;b.selectedItem=null,b.previous=b.element.val()}).bind("blur.autocomplete",function(a){if(b.options.disabled)return;clearTimeout(b.searching),b.closing=setTimeout(function(){b.close(a),b._change(a)},150)}),this._initSource(),this.menu=a("
        ").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",c)[0]).mousedown(function(c){var d=b.menu.element[0];a(c.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(c){c.target!==b.element[0]&&c.target!==d&&!a.ui.contains(d,c.target)&&b.close()})},1),setTimeout(function(){clearTimeout(b.closing)},13)}).menu({focus:function(a,c){var d=c.item.data("item.autocomplete");!1!==b._trigger("focus",a,{item:d})&&/^key/.test(a.originalEvent.type)&&b.element.val(d.value)},selected:function(a,d){var e=d.item.data("item.autocomplete"),f=b.previous;b.element[0]!==c.activeElement&&(b.element.focus(),b.previous=f,setTimeout(function(){b.previous=f,b.selectedItem=e},1)),!1!==b._trigger("select",a,{item:e})&&b.element.val(e.value),b.term=b.element.val(),b.close(a),b.selectedItem=e},blur:function(a,c){b.menu.element.is(":visible")&&b.element.val()!==b.term&&b.element.val(b.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"),a.fn.bgiframe&&this.menu.element.bgiframe(),b.beforeunloadHandler=function(){b.element.removeAttr("autocomplete")},a(window).bind("beforeunload",b.beforeunloadHandler)},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"),this.menu.element.remove(),a(window).unbind("beforeunload",this.beforeunloadHandler),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b==="source"&&this._initSource(),b==="appendTo"&&this.menu.element.appendTo(a(c||"body",this.element[0].ownerDocument)[0]),b==="disabled"&&c&&this.xhr&&this.xhr.abort()},_initSource:function(){var b=this,c,d;a.isArray(this.options.source)?(c=this.options.source,this.source=function(b,d){d(a.ui.autocomplete.filter(c,b.term))}):typeof this.options.source=="string"?(d=this.options.source,this.source=function(c,e){b.xhr&&b.xhr.abort(),b.xhr=a.ajax({url:d,data:c,dataType:"json",success:function(a,b){e(a)},error:function(){e([])}})}):this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val(),this.term=this.element.val();if(a.length
        • ").data("item.autocomplete",c).append(a("").text(c.label)).appendTo(b)},_move:function(a,b){if(!this.menu.element.is(":visible")){this.search(null,b);return}if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term),this.menu.deactivate();return}this.menu[a](b)},widget:function(){return this.menu.element},_keyEvent:function(a,b){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(a,b),b.preventDefault()}}),a.extend(a.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(b,c){var d=new RegExp(a.ui.autocomplete.escapeRegex(c),"i");return a.grep(b,function(a){return d.test(a.label||a.value||a)})}})})(jQuery),function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length)return;c.preventDefault(),b.select(c)}),this.refresh()},refresh:function(){var b=this,c=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");c.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(c){b.activate(c,a(this).parent())}).mouseleave(function(){b.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.scrollTop(),e=this.element.height();c<0?this.element.scrollTop(d+c):c>=e&&this.element.scrollTop(d+c-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end(),this._trigger("focus",a,{item:b})},deactivate:function(){if(!this.active)return;this.active.children("a").removeClass("ui-state-hover").removeAttr("id"),this._trigger("blur"),this.active=null},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(!this.active){this.activate(c,this.element.children(b));return}var d=this.active[a+"All"](".ui-menu-item").eq(0);d.length?this.activate(c,d):this.activate(c,this.element.children(b))},nextPage:function(b){if(this.hasScroll()){if(!this.active||this.last()){this.activate(b,this.element.children(".ui-menu-item:first"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c-d+a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:last")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(b){if(this.hasScroll()){if(!this.active||this.first()){this.activate(b,this.element.children(".ui-menu-item:last"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c+d-a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:first")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()",this.element[0].ownerDocument).addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary,f=[];d.primary||d.secondary?(this.options.text&&f.push("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary")),d.primary&&b.prepend(""),d.secondary&&b.append(""),this.options.text||(f.push(e?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||b.attr("title",c))):f.push("ui-button-text-only"),b.addClass(f.join(" "))}}),a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c),a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(b?"ui-corner-left":"ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"),a.Widget.prototype.destroy.call(this)}})})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.dialog.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",d={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},e={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0},f=a.attrFn||{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0,click:!0};a.widget("ui.dialog",{options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",collision:"fit",using:function(b){var c=a(this).css(b).offset().top;c<0&&a(this).css("top",b.top-c)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.options.title=this.options.title||this.originalTitle;var b=this,d=b.options,e=d.title||" ",f=a.ui.dialog.getTitleId(b.element),g=(b.uiDialog=a("
        ")).appendTo(document.body).hide().addClass(c+d.dialogClass).css({zIndex:d.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(c){d.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(a){b.moveToTop(!1,a)}),h=b.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g),i=(b.uiDialogTitlebar=a("
        ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),j=a('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){j.addClass("ui-state-hover")},function(){j.removeClass("ui-state-hover")}).focus(function(){j.addClass("ui-state-focus")}).blur(function(){j.removeClass("ui-state-focus")}).click(function(a){return b.close(a),!1}).appendTo(i),k=(b.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(d.closeText).appendTo(j),l=a("").addClass("ui-dialog-title").attr("id",f).html(e).prependTo(i);a.isFunction(d.beforeclose)&&!a.isFunction(d.beforeClose)&&(d.beforeClose=d.beforeclose),i.find("*").add(i).disableSelection(),d.draggable&&a.fn.draggable&&b._makeDraggable(),d.resizable&&a.fn.resizable&&b._makeResizable(),b._createButtons(d.buttons),b._isOpen=!1,a.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;return a.overlay&&a.overlay.destroy(),a.uiDialog.hide(),a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),a.uiDialog.remove(),a.originalTitle&&a.element.attr("title",a.originalTitle),a},widget:function(){return this.uiDialog},close:function(b){var c=this,d,e;if(!1===c._trigger("beforeClose",b))return;return c.overlay&&c.overlay.destroy(),c.uiDialog.unbind("keypress.ui-dialog"),c._isOpen=!1,c.options.hide?c.uiDialog.hide(c.options.hide,function(){c._trigger("close",b)}):(c.uiDialog.hide(),c._trigger("close",b)),a.ui.dialog.overlay.resize(),c.options.modal&&(d=0,a(".ui-dialog").each(function(){this!==c.uiDialog[0]&&(e=a(this).css("z-index"),isNaN(e)||(d=Math.max(d,e)))}),a.ui.dialog.maxZ=d),c},isOpen:function(){return this._isOpen},moveToTop:function(b,c){var d=this,e=d.options,f;return e.modal&&!b||!e.stack&&!e.modal?d._trigger("focus",c):(e.zIndex>a.ui.dialog.maxZ&&(a.ui.dialog.maxZ=e.zIndex),d.overlay&&(a.ui.dialog.maxZ+=1,d.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)),f={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()},a.ui.dialog.maxZ+=1,d.uiDialog.css("z-index",a.ui.dialog.maxZ),d.element.attr(f),d._trigger("focus",c),d)},open:function(){if(this._isOpen)return;var b=this,c=b.options,d=b.uiDialog;return b.overlay=c.modal?new a.ui.dialog.overlay(b):null,b._size(),b._position(c.position),d.show(c.show),b.moveToTop(!0),c.modal&&d.bind("keydown.ui-dialog",function(b){if(b.keyCode!==a.ui.keyCode.TAB)return;var c=a(":tabbable",this),d=c.filter(":first"),e=c.filter(":last");if(b.target===e[0]&&!b.shiftKey)return d.focus(1),!1;if(b.target===d[0]&&b.shiftKey)return e.focus(1),!1}),a(b.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus(),b._isOpen=!0,b._trigger("open"),b},_createButtons:function(b){var c=this,d=!1,e=a("
        ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=a("
        ").addClass("ui-dialog-buttonset").appendTo(e);c.uiDialog.find(".ui-dialog-buttonpane").remove(),typeof b=="object"&&b!==null&&a.each(b,function(){return!(d=!0)}),d&&(a.each(b,function(b,d){d=a.isFunction(d)?{click:d,text:b}:d;var e=a('').click(function(){d.click.apply(c.element[0],arguments)}).appendTo(g);a.each(d,function(a,b){if(a==="click")return;a in f?e[a](b):e.attr(a,b)}),a.fn.button&&e.button()}),e.appendTo(c.uiDialog))},_makeDraggable:function(){function f(a){return{position:a.position,offset:a.offset}}var b=this,c=b.options,d=a(document),e;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(d,g){e=c.height==="auto"?"auto":a(this).height(),a(this).height(a(this).height()).addClass("ui-dialog-dragging"),b._trigger("dragStart",d,f(g))},drag:function(a,c){b._trigger("drag",a,f(c))},stop:function(g,h){c.position=[h.position.left-d.scrollLeft(),h.position.top-d.scrollTop()],a(this).removeClass("ui-dialog-dragging").height(e),b._trigger("dragStop",g,f(h)),a.ui.dialog.overlay.resize()}})},_makeResizable:function(c){function h(a){return{originalPosition:a.originalPosition,originalSize:a.originalSize,position:a.position,size:a.size}}c=c===b?this.options.resizable:c;var d=this,e=d.options,f=d.uiDialog.css("position"),g=typeof c=="string"?c:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:g,start:function(b,c){a(this).addClass("ui-dialog-resizing"),d._trigger("resizeStart",b,h(c))},resize:function(a,b){d._trigger("resize",a,h(b))},stop:function(b,c){a(this).removeClass("ui-dialog-resizing"),e.height=a(this).height(),e.width=a(this).width(),d._trigger("resizeStop",b,h(c)),a.ui.dialog.overlay.resize()}}).css("position",f).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(b){var c=[],d=[0,0],e;if(b){if(typeof b=="string"||typeof b=="object"&&"0"in b)c=b.split?b.split(" "):[b[0],b[1]],c.length===1&&(c[1]=c[0]),a.each(["left","top"],function(a,b){+c[a]===c[a]&&(d[a]=c[a],c[a]=b)}),b={my:c.join(" "),at:c.join(" "),offset:d.join(" ")};b=a.extend({},a.ui.dialog.prototype.options.position,b)}else b=a.ui.dialog.prototype.options.position;e=this.uiDialog.is(":visible"),e||this.uiDialog.show(),this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},b)),e||this.uiDialog.hide()},_setOptions:function(b){var c=this,f={},g=!1;a.each(b,function(a,b){c._setOption(a,b),a in d&&(g=!0),a in e&&(f[a]=b)}),g&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",f)},_setOption:function(b,d){var e=this,f=e.uiDialog;switch(b){case"beforeclose":b="beforeClose";break;case"buttons":e._createButtons(d);break;case"closeText":e.uiDialogTitlebarCloseText.text(""+d);break;case"dialogClass":f.removeClass(e.options.dialogClass).addClass(c+d);break;case"disabled":d?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case"draggable":var g=f.is(":data(draggable)");g&&!d&&f.draggable("destroy"),!g&&d&&e._makeDraggable();break;case"position":e._position(d);break;case"resizable":var h=f.is(":data(resizable)");h&&!d&&f.resizable("destroy"),h&&typeof d=="string"&&f.resizable("option","handles",d),!h&&d!==!1&&e._makeResizable(d);break;case"title":a(".ui-dialog-title",e.uiDialogTitlebar).html(""+(d||" "))}a.Widget.prototype._setOption.apply(e,arguments)},_size:function(){var b=this.options,c,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),b.minWidth>b.width&&(b.width=b.minWidth),c=this.uiDialog.css({height:"auto",width:b.width}).height(),d=Math.max(0,b.minHeight-c);if(b.height==="auto")if(a.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();var f=this.element.css("height","auto").height();e||this.uiDialog.hide(),this.element.height(Math.max(f,d))}else this.element.height(Math.max(b.height-c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),a.extend(a.ui.dialog,{version:"1.8.20",uuid:0,maxZ:0,getTitleId:function(a){var b=a.attr("id");return b||(this.uuid+=1,b=this.uuid),"ui-dialog-title-"+b},overlay:function(b){this.$el=a.ui.dialog.overlay.create(b)}}),a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(b){this.instances.length===0&&(setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});return a.fn.bgiframe&&c.bgiframe(),this.instances.push(c),c},destroy:function(b){var c=a.inArray(b,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]),this.instances.length===0&&a([document,window]).unbind(".dialog-overlay"),b.remove();var d=0;a.each(this.instances,function(){d=Math.max(d,this.css("z-index"))}),this.maxZ=d},height:function(){var b,c;return a.browser.msie&&a.browser.version<7?(b=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),b").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(d.range==="min"||d.range==="max"?" ui-slider-range-"+d.range:"")));for(var i=e.length;ic&&(f=c,g=a(this),i=b)}),c.range===!0&&this.values(1)===c.min&&(i+=1,g=a(this.handles[i])),j=this._start(b,i),j===!1?!1:(this._mouseSliding=!0,h._handleIndex=i,g.addClass("ui-state-active").focus(),k=g.offset(),l=!a(b.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:b.pageX-k.left-g.width()/2,top:b.pageY-k.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(b,i,e),this._animateOff=!0,!0))},_mouseStart:function(a){return!0},_mouseDrag:function(a){var b={x:a.pageX,y:a.pageY},c=this._normValueFromMouse(b);return this._slide(a,this._handleIndex,c),!1},_mouseStop:function(a){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(a,this._handleIndex),this._change(a,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b,c,d,e,f;return this.orientation==="horizontal"?(b=this.elementSize.width,c=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(b=this.elementSize.height,c=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),d=c/b,d>1&&(d=1),d<0&&(d=0),this.orientation==="vertical"&&(d=1-d),e=this._valueMax()-this._valueMin(),f=this._valueMin()+d*e,this._trimAlignValue(f)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};return this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("start",a,c)},_slide:function(a,b,c){var d,e,f;this.options.values&&this.options.values.length?(d=this.values(b?0:1),this.options.values.length===2&&this.options.range===!0&&(b===0&&c>d||b===1&&c1){this.options.values[b]=this._trimAlignValue(c),this._refreshValue(),this._change(null,b);return}if(!arguments.length)return this._values();if(!a.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(b):this.value();d=this.options.values,e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b,d=a-c;return Math.abs(c)*2>=b&&(d+=c>0?b:-b),parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,c=this.options,d=this,e=this._animateOff?!1:c.animate,f,g={},h,i,j,k;this.options.values&&this.options.values.length?this.handles.each(function(b,i){f=(d.values(b)-d._valueMin())/(d._valueMax()-d._valueMin())*100,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",a(this).stop(1,1)[e?"animate":"css"](g,c.animate),d.options.range===!0&&(d.orientation==="horizontal"?(b===0&&d.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({width:f-h+"%"},{queue:!1,duration:c.animate})):(b===0&&d.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({height:f-h+"%"},{queue:!1,duration:c.animate}))),h=f}):(i=this.value(),j=this._valueMin(),k=this._valueMax(),f=k!==j?(i-j)/(k-j)*100:0,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",this.handle.stop(1,1)[e?"animate":"css"](g,c.animate),b==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},c.animate),b==="max"&&this.orientation==="horizontal"&&this.range[e?"animate":"css"]({width:100-f+"%"},{queue:!1,duration:c.animate}),b==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},c.animate),b==="max"&&this.orientation==="vertical"&&this.range[e?"animate":"css"]({height:100-f+"%"},{queue:!1,duration:c.animate}))}}),a.extend(a.ui.slider,{version:"1.8.20"})})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){function e(){return++c}function f(){return++d}var c=0,d=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:!1,cookie:null,collapsible:!1,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
        ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
      • #{label}
        • "},_create:function(){this._tabify(!0)},_setOption:function(a,b){if(a=="selected"){if(this.options.collapsible&&b==this.options.selected)return;this.select(b)}else this.options[a]=b,this._tabify()},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(a,b){return{tab:a,panel:b,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function m(b,c){b.css("display",""),!a.support.opacity&&c.opacity&&b[0].style.removeAttribute("filter")}var d=this,e=this.options,f=/^#.+/;this.list=this.element.find("ol,ul").eq(0),this.lis=a(" > li:has(a[href])",this.list),this.anchors=this.lis.map(function(){return a("a",this)[0]}),this.panels=a([]),this.anchors.each(function(b,c){var g=a(c).attr("href"),h=g.split("#")[0],i;h&&(h===location.toString().split("#")[0]||(i=a("base")[0])&&h===i.href)&&(g=c.hash,c.href=g);if(f.test(g))d.panels=d.panels.add(d.element.find(d._sanitizeSelector(g)));else if(g&&g!=="#"){a.data(c,"href.tabs",g),a.data(c,"load.tabs",g.replace(/#.*$/,""));var j=d._tabId(c);c.href="#"+j;var k=d.element.find("#"+j);k.length||(k=a(e.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(d.panels[b-1]||d.list),k.data("destroy.tabs",!0)),d.panels=d.panels.add(k)}else e.disabled.push(b)}),c?(this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"),this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.lis.addClass("ui-state-default ui-corner-top"),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom"),e.selected===b?(location.hash&&this.anchors.each(function(a,b){if(b.hash==location.hash)return e.selected=a,!1}),typeof e.selected!="number"&&e.cookie&&(e.selected=parseInt(d._cookie(),10)),typeof e.selected!="number"&&this.lis.filter(".ui-tabs-selected").length&&(e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))),e.selected=e.selected||(this.lis.length?0:-1)):e.selected===null&&(e.selected=-1),e.selected=e.selected>=0&&this.anchors[e.selected]||e.selected<0?e.selected:0,e.disabled=a.unique(e.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(a,b){return d.lis.index(a)}))).sort(),a.inArray(e.selected,e.disabled)!=-1&&e.disabled.splice(a.inArray(e.selected,e.disabled),1),this.panels.addClass("ui-tabs-hide"),this.lis.removeClass("ui-tabs-selected ui-state-active"),e.selected>=0&&this.anchors.length&&(d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash)).removeClass("ui-tabs-hide"),this.lis.eq(e.selected).addClass("ui-tabs-selected ui-state-active"),d.element.queue("tabs",function(){d._trigger("show",null,d._ui(d.anchors[e.selected],d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash))[0]))}),this.load(e.selected)),a(window).bind("unload",function(){d.lis.add(d.anchors).unbind(".tabs"),d.lis=d.anchors=d.panels=null})):e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")),this.element[e.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible"),e.cookie&&this._cookie(e.selected,e.cookie);for(var g=0,h;h=this.lis[g];g++)a(h)[a.inArray(g,e.disabled)!=-1&&!a(h).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");e.cache===!1&&this.anchors.removeData("cache.tabs"),this.lis.add(this.anchors).unbind(".tabs");if(e.event!=="mouseover"){var i=function(a,b){b.is(":not(.ui-state-disabled)")&&b.addClass("ui-state-"+a)},j=function(a,b){b.removeClass("ui-state-"+a)};this.lis.bind("mouseover.tabs",function(){i("hover",a(this))}),this.lis.bind("mouseout.tabs",function(){j("hover",a(this))}),this.anchors.bind("focus.tabs",function(){i("focus",a(this).closest("li"))}),this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var k,l;e.fx&&(a.isArray(e.fx)?(k=e.fx[0],l=e.fx[1]):k=l=e.fx);var n=l?function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.hide().removeClass("ui-tabs-hide").animate(l,l.duration||"normal",function(){m(c,l),d._trigger("show",null,d._ui(b,c[0]))})}:function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.removeClass("ui-tabs-hide"),d._trigger("show",null,d._ui(b,c[0]))},o=k?function(a,b){b.animate(k,k.duration||"normal",function(){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),m(b,k),d.element.dequeue("tabs")})}:function(a,b,c){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),d.element.dequeue("tabs")};this.anchors.bind(e.event+".tabs",function(){var b=this,c=a(b).closest("li"),f=d.panels.filter(":not(.ui-tabs-hide)"),g=d.element.find(d._sanitizeSelector(b.hash));if(c.hasClass("ui-tabs-selected")&&!e.collapsible||c.hasClass("ui-state-disabled")||c.hasClass("ui-state-processing")||d.panels.filter(":animated").length||d._trigger("select",null,d._ui(this,g[0]))===!1)return this.blur(),!1;e.selected=d.anchors.index(this),d.abort();if(e.collapsible){if(c.hasClass("ui-tabs-selected"))return e.selected=-1,e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){o(b,f)}).dequeue("tabs"),this.blur(),!1;if(!f.length)return e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this)),this.blur(),!1}e.cookie&&d._cookie(e.selected,e.cookie);if(g.length)f.length&&d.element.queue("tabs",function(){o(b,f)}),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this));else throw"jQuery UI Tabs: Mismatching fragment identifier.";a.browser.msie&&this.blur()}),this.anchors.bind("click.tabs",function(){return!1})},_getIndex:function(a){return typeof a=="string"&&(a=this.anchors.index(this.anchors.filter("[href$='"+a+"']"))),a},destroy:function(){var b=this.options;return this.abort(),this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs"),this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.anchors.each(function(){var b=a.data(this,"href.tabs");b&&(this.href=b);var c=a(this).unbind(".tabs");a.each(["href","load","cache"],function(a,b){c.removeData(b+".tabs")})}),this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}),b.cookie&&this._cookie(null,b.cookie),this},add:function(c,d,e){e===b&&(e=this.anchors.length);var f=this,g=this.options,h=a(g.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,d)),i=c.indexOf("#")?this._tabId(a("a",h)[0]):c.replace("#","");h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",!0);var j=f.element.find("#"+i);return j.length||(j=a(g.panelTemplate).attr("id",i).data("destroy.tabs",!0)),j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide"),e>=this.lis.length?(h.appendTo(this.list),j.appendTo(this.list[0].parentNode)):(h.insertBefore(this.lis[e]),j.insertBefore(this.panels[e])),g.disabled=a.map(g.disabled,function(a,b){return a>=e?++a:a}),this._tabify(),this.anchors.length==1&&(g.selected=0,h.addClass("ui-tabs-selected ui-state-active"),j.removeClass("ui-tabs-hide"),this.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[0],f.panels[0]))}),this.load(0)),this._trigger("add",null,this._ui(this.anchors[e],this.panels[e])),this},remove:function(b){b=this._getIndex(b);var c=this.options,d=this.lis.eq(b).remove(),e=this.panels.eq(b).remove();return d.hasClass("ui-tabs-selected")&&this.anchors.length>1&&this.select(b+(b+1=b?--a:a}),this._tabify(),this._trigger("remove",null,this._ui(d.find("a")[0],e[0])),this},enable:function(b){b=this._getIndex(b);var c=this.options;if(a.inArray(b,c.disabled)==-1)return;return this.lis.eq(b).removeClass("ui-state-disabled"),c.disabled=a.grep(c.disabled,function(a,c){return a!=b}),this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b])),this},disable:function(a){a=this._getIndex(a);var b=this,c=this.options;return a!=c.selected&&(this.lis.eq(a).addClass("ui-state-disabled"),c.disabled.push(a),c.disabled.sort(),this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))),this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;return this.anchors.eq(a).trigger(this.options.event+".tabs"),this},load:function(b){b=this._getIndex(b);var c=this,d=this.options,e=this.anchors.eq(b)[0],f=a.data(e,"load.tabs");this.abort();if(!f||this.element.queue("tabs").length!==0&&a.data(e,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(b).addClass("ui-state-processing");if(d.spinner){var g=a("span",e);g.data("label.tabs",g.html()).html(d.spinner)}return this.xhr=a.ajax(a.extend({},d.ajaxOptions,{url:f,success:function(f,g){c.element.find(c._sanitizeSelector(e.hash)).html(f),c._cleanup(),d.cache&&a.data(e,"cache.tabs",!0),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.success(f,g)}catch(h){}},error:function(a,f,g){c._cleanup(),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.error(a,f,b,e)}catch(g){}}})),c.element.dequeue("tabs"),this},abort:function(){return this.element.queue([]),this.panels.stop(!1,!0),this.element.queue("tabs",this.element.queue("tabs").splice(-2,2)),this.xhr&&(this.xhr.abort(),delete this.xhr),this._cleanup(),this},url:function(a,b){return this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",b),this},length:function(){return this.anchors.length}}),a.extend(a.ui.tabs,{version:"1.8.20"}),a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(a,b){var c=this,d=this.options,e=c._rotate||(c._rotate=function(b){clearTimeout(c.rotation),c.rotation=setTimeout(function(){var a=d.selected;c.select(++a'))}function bindHover(a){var b="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return a.bind("mouseout",function(a){var c=$(a.target).closest(b);if(!c.length)return;c.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(c){var d=$(c.target).closest(b);if($.datepicker._isDisabledDatepicker(instActive.inline?a.parent()[0]:instActive.input[0])||!d.length)return;d.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),d.addClass("ui-state-hover"),d.hasClass("ui-datepicker-prev")&&d.addClass("ui-datepicker-prev-hover"),d.hasClass("ui-datepicker-next")&&d.addClass("ui-datepicker-next-hover")})}function extendRemove(a,b){$.extend(a,b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}function isArray(a){return a&&($.browser.safari&&typeof a=="object"&&a.length||a.constructor&&a.constructor.toString().match(/\Array\(\)/))}$.extend($.ui,{datepicker:{version:"1.8.20"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){return extendRemove(this._defaults,a||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(a,b){var c=a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:c,input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:b?bindHover($('
        ')):this.dpDiv}},_connectDatepicker:function(a,b){var c=$(a);b.append=$([]),b.trigger=$([]);if(c.hasClass(this.markerClassName))return;this._attachments(c,b),c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),this._autoSize(b),$.data(a,PROP_NAME,b),b.settings.disabled&&this._disableDatepicker(a)},_attachments:function(a,b){var c=this._get(b,"appendText"),d=this._get(b,"isRTL");b.append&&b.append.remove(),c&&(b.append=$(''+c+""),a[d?"before":"after"](b.append)),a.unbind("focus",this._showDatepicker),b.trigger&&b.trigger.remove();var e=this._get(b,"showOn");(e=="focus"||e=="both")&&a.focus(this._showDatepicker);if(e=="button"||e=="both"){var f=this._get(b,"buttonText"),g=this._get(b,"buttonImage");b.trigger=$(this._get(b,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:g,alt:f,title:f}):$('').addClass(this._triggerClass).html(g==""?f:$("").attr({src:g,alt:f,title:f}))),a[d?"before":"after"](b.trigger),b.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==a[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=a[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(a[0])):$.datepicker._showDatepicker(a[0]),!1})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var d=function(a){var b=0,c=0;for(var d=0;db&&(b=a[d].length,c=d);return c};b.setMonth(d(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort"))),b.setDate(d(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=$(a);if(c.hasClass(this.markerClassName))return;c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),$.data(a,PROP_NAME,b),this._setDate(b,this._getDefaultDate(b),!0),this._updateDatepicker(b),this._updateAlternate(b),b.settings.disabled&&this._disableDatepicker(a),b.dpDiv.css("display","block")},_dialogDatepicker:function(a,b,c,d,e){var f=this._dialogInst;if(!f){this.uuid+=1;var g="dp"+this.uuid;this._dialogInput=$(''),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),f=this._dialogInst=this._newInst(this._dialogInput,!1),f.settings={},$.data(this._dialogInput[0],PROP_NAME,f)}extendRemove(f.settings,d||{}),b=b&&b.constructor==Date?this._formatDate(f,b):b,this._dialogInput.val(b),this._pos=e?e.length?e:[e.pageX,e.pageY]:null;if(!this._pos){var h=document.documentElement.clientWidth,i=document.documentElement.clientHeight,j=document.documentElement.scrollLeft||document.body.scrollLeft,k=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[h/2-100+j,i/2-150+k]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),f.settings.onSelect=c,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,f),this},_destroyDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();$.removeData(a,PROP_NAME),d=="input"?(c.append.remove(),c.trigger.remove(),b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(d=="div"||d=="span")&&b.removeClass(this.markerClassName).empty()},_enableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!1,c.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().removeClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b})},_disableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!0,c.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().addClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b}),this._disabledInputs[this._disabledInputs.length]=a},_isDisabledDatepicker:function(a){if(!a)return!1;for(var b=0;b-1}},_doKeyUp:function(a){var b=$.datepicker._getInst(a.target);if(b.input.val()!=b.lastVal)try{var c=$.datepicker.parseDate($.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,$.datepicker._getFormatConfig(b));c&&($.datepicker._setDateFromField(b),$.datepicker._updateAlternate(b),$.datepicker._updateDatepicker(b))}catch(d){$.datepicker.log(d)}return!0},_showDatepicker:function(a){a=a.target||a,a.nodeName.toLowerCase()!="input"&&(a=$("input",a.parentNode)[0]);if($.datepicker._isDisabledDatepicker(a)||$.datepicker._lastInput==a)return;var b=$.datepicker._getInst(a);$.datepicker._curInst&&$.datepicker._curInst!=b&&($.datepicker._curInst.dpDiv.stop(!0,!0),b&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var c=$.datepicker._get(b,"beforeShow"),d=c?c.apply(a,[a,b]):{};if(d===!1)return;extendRemove(b.settings,d),b.lastVal=null,$.datepicker._lastInput=a,$.datepicker._setDateFromField(b),$.datepicker._inDialog&&(a.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(a),$.datepicker._pos[1]+=a.offsetHeight);var e=!1;$(a).parents().each(function(){return e|=$(this).css("position")=="fixed",!e}),e&&$.browser.opera&&($.datepicker._pos[0]-=document.documentElement.scrollLeft,$.datepicker._pos[1]-=document.documentElement.scrollTop);var f={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,b.dpDiv.empty(),b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(b),f=$.datepicker._checkOffset(b,f,e),b.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":e?"fixed":"absolute",display:"none",left:f.left+"px",top:f.top+"px"});if(!b.inline){var g=$.datepicker._get(b,"showAnim"),h=$.datepicker._get(b,"duration"),i=function(){var a=b.dpDiv.find("iframe.ui-datepicker-cover");if(!!a.length){var c=$.datepicker._getBorders(b.dpDiv);a.css({left:-c[0],top:-c[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex($(a).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&$.effects[g]?b.dpDiv.show(g,$.datepicker._get(b,"showOptions"),h,i):b.dpDiv[g||"show"](g?h:null,i),(!g||!h)&&i(),b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus(),$.datepicker._curInst=b}},_updateDatepicker:function(a){var b=this;b.maxRows=4;var c=$.datepicker._getBorders(a.dpDiv);instActive=a,a.dpDiv.empty().append(this._generateHTML(a));var d=a.dpDiv.find("iframe.ui-datepicker-cover");!d.length||d.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}),a.dpDiv.find("."+this._dayOverClass+" a").mouseover();var e=this._getNumberOfMonths(a),f=e[1],g=17;a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),f>1&&a.dpDiv.addClass("ui-datepicker-multi-"+f).css("width",g*f+"em"),a.dpDiv[(e[0]!=1||e[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),a==$.datepicker._curInst&&$.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var h=a.yearshtml;setTimeout(function(){h===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml),h=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(a){return{thin:1,medium:2,thick:3}[a]||a};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var d=a.dpDiv.outerWidth(),e=a.dpDiv.outerHeight(),f=a.input?a.input.outerWidth():0,g=a.input?a.input.outerHeight():0,h=document.documentElement.clientWidth+$(document).scrollLeft(),i=document.documentElement.clientHeight+$(document).scrollTop();return b.left-=this._get(a,"isRTL")?d-f:0,b.left-=c&&b.left==a.input.offset().left?$(document).scrollLeft():0,b.top-=c&&b.top==a.input.offset().top+g?$(document).scrollTop():0,b.left-=Math.min(b.left,b.left+d>h&&h>d?Math.abs(b.left+d-h):0),b.top-=Math.min(b.top,b.top+e>i&&i>e?Math.abs(e+g):0),b},_findPos:function(a){var b=this._getInst(a),c=this._get(b,"isRTL");while(a&&(a.type=="hidden"||a.nodeType!=1||$.expr.filters.hidden(a)))a=a[c?"previousSibling":"nextSibling"];var d=$(a).offset();return[d.left,d.top]},_hideDatepicker:function(a){var b=this._curInst;if(!b||a&&b!=$.data(a,PROP_NAME))return;if(this._datepickerShowing){var c=this._get(b,"showAnim"),d=this._get(b,"duration"),e=function(){$.datepicker._tidyDialog(b)};$.effects&&$.effects[c]?b.dpDiv.hide(c,$.datepicker._get(b,"showOptions"),d,e):b.dpDiv[c=="slideDown"?"slideUp":c=="fadeIn"?"fadeOut":"hide"](c?d:null,e),c||e(),this._datepickerShowing=!1;var f=this._get(b,"onClose");f&&f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(!$.datepicker._curInst)return;var b=$(a.target),c=$.datepicker._getInst(b[0]);(b[0].id!=$.datepicker._mainDivId&&b.parents("#"+$.datepicker._mainDivId).length==0&&!b.hasClass($.datepicker.markerClassName)&&!b.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||b.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=c)&&$.datepicker._hideDatepicker()},_adjustDate:function(a,b,c){var d=$(a),e=this._getInst(d[0]);if(this._isDisabledDatepicker(d[0]))return;this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c),this._updateDatepicker(e)},_gotoToday:function(a){var b=$(a),c=this._getInst(b[0]);if(this._get(c,"gotoCurrent")&&c.currentDay)c.selectedDay=c.currentDay,c.drawMonth=c.selectedMonth=c.currentMonth,c.drawYear=c.selectedYear=c.currentYear;else{var d=new Date;c.selectedDay=d.getDate(),c.drawMonth=c.selectedMonth=d.getMonth(),c.drawYear=c.selectedYear=d.getFullYear()}this._notifyChange(c),this._adjustDate(b)},_selectMonthYear:function(a,b,c){var d=$(a),e=this._getInst(d[0]);e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10),this._notifyChange(e),this._adjustDate(d)},_selectDay:function(a,b,c,d){var e=$(a);if($(d).hasClass(this._unselectableClass)||this._isDisabledDatepicker(e[0]))return;var f=this._getInst(e[0]);f.selectedDay=f.currentDay=$("a",d).html(),f.selectedMonth=f.currentMonth=b,f.selectedYear=f.currentYear=c,this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))},_clearDate:function(a){var b=$(a),c=this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(a,b){var c=$(a),d=this._getInst(c[0]);b=b!=null?b:this._formatDate(d),d.input&&d.input.val(b),this._updateAlternate(d);var e=this._get(d,"onSelect");e?e.apply(d.input?d.input[0]:null,[b,d]):d.input&&d.input.trigger("change"),d.inline?this._updateDatepicker(d):(this._hideDatepicker(),this._lastInput=d.input[0],typeof d.input[0]!="object"&&d.input.focus(),this._lastInput=null)},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),d=this._getDate(a),e=this.formatDate(c,d,this._getFormatConfig(a));$(b).each(function(){$(this).val(e)})}},noWeekends:function(a){var b=a.getDay();return[b>0&&b<6,""]},iso8601Week:function(a){var b=new Date(a.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var c=b.getTime();return b.setMonth(0),b.setDate(1),Math.floor(Math.round((c-b)/864e5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var d=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,g=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,h=(c?c.monthNames:null)||this._defaults.monthNames,i=-1,j=-1,k=-1,l=-1,m=!1,n=function(b){var c=s+1-1){j=1,k=l;do{var u=this._getDaysInMonth(i,j-1);if(k<=u)break;j++,k-=u}while(!0)}var t=this._daylightSavingAdjust(new Date(i,j-1,k));if(t.getFullYear()!=i||t.getMonth()+1!=j||t.getDate()!=k)throw"Invalid date";return t},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(a,b,c){if(!b)return"";var d=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,e=(c?c.dayNames:null)||this._defaults.dayNames,f=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,h=function(b){var c=m+112?a.getHours()+2:0),a):null},_setDate:function(a,b,c){var d=!b,e=a.selectedMonth,f=a.selectedYear,g=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=g.getDate(),a.drawMonth=a.selectedMonth=a.currentMonth=g.getMonth(),a.drawYear=a.selectedYear=a.currentYear=g.getFullYear(),(e!=a.selectedMonth||f!=a.selectedYear)&&!c&&this._notifyChange(a),this._adjustInstDate(a),a.input&&a.input.val(d?"":this._formatDate(a))},_getDate:function(a){var b=!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return b},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),d=this._get(a,"showButtonPanel"),e=this._get(a,"hideIfNoPrevNext"),f=this._get(a,"navigationAsDateFormat"),g=this._getNumberOfMonths(a),h=this._get(a,"showCurrentAtPos"),i=this._get(a,"stepMonths"),j=g[0]!=1||g[1]!=1,k=this._daylightSavingAdjust(a.currentDay?new Date(a.currentYear,a.currentMonth,a.currentDay):new Date(9999,9,9)),l=this._getMinMaxDate(a,"min"),m=this._getMinMaxDate(a,"max"),n=a.drawMonth-h,o=a.drawYear;n<0&&(n+=12,o--);if(m){var p=this._daylightSavingAdjust(new Date(m.getFullYear(),m.getMonth()-g[0]*g[1]+1,m.getDate()));p=l&&pp)n--,n<0&&(n=11,o--)}a.drawMonth=n,a.drawYear=o;var q=this._get(a,"prevText");q=f?this.formatDate(q,this._daylightSavingAdjust(new Date(o,n-i,1)),this._getFormatConfig(a)):q;var r=this._canAdjustMonth(a,-1,o,n)?''+q+"":e?"":''+q+"",s=this._get(a,"nextText");s=f?this.formatDate(s,this._daylightSavingAdjust(new Date(o,n+i,1)),this._getFormatConfig(a)):s;var t=this._canAdjustMonth(a,1,o,n)?''+s+"":e?"":''+s+"",u=this._get(a,"currentText"),v=this._get(a,"gotoCurrent")&&a.currentDay?k:b;u=f?this.formatDate(u,v,this._getFormatConfig(a)):u;var w=a.inline?"":'",x=d?'
        '+(c?w:"")+(this._isInRange(a,v)?'":"")+(c?"":w)+"
        ":"",y=parseInt(this._get(a,"firstDay"),10);y=isNaN(y)?0:y;var z=this._get(a,"showWeek"),A=this._get(a,"dayNames"),B=this._get(a,"dayNamesShort"),C=this._get(a,"dayNamesMin"),D=this._get(a,"monthNames"),E=this._get(a,"monthNamesShort"),F=this._get(a,"beforeShowDay"),G=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths"),I=this._get(a,"calculateWeek")||this.iso8601Week,J=this._getDefaultDate(a),K="";for(var L=0;L1)switch(N){case 0:Q+=" ui-datepicker-group-first",P=" ui-corner-"+(c?"right":"left");break;case g[1]-1:Q+=" ui-datepicker-group-last",P=" ui-corner-"+(c?"left":"right");break;default:Q+=" ui-datepicker-group-middle",P=""}Q+='">'}Q+='
        '+(/all|left/.test(P)&&L==0?c?t:r:"")+(/all|right/.test(P)&&L==0?c?r:t:"")+this._generateMonthYearHeader(a,n,o,l,m,L>0||N>0,D,E)+'
        '+"";var R=z?'":"";for(var S=0;S<7;S++){var T=(S+y)%7;R+="=5?' class="ui-datepicker-week-end"':"")+">"+''+C[T]+""}Q+=R+"";var U=this._getDaysInMonth(o,n);o==a.selectedYear&&n==a.selectedMonth&&(a.selectedDay=Math.min(a.selectedDay,U));var V=(this._getFirstDayOfMonth(o,n)-y+7)%7,W=Math.ceil((V+U)/7),X=j?this.maxRows>W?this.maxRows:W:W;this.maxRows=X;var Y=this._daylightSavingAdjust(new Date(o,n,1-V));for(var Z=0;Z";var _=z?'":"";for(var S=0;S<7;S++){var ba=F?F.apply(a.input?a.input[0]:null,[Y]):[!0,""],bb=Y.getMonth()!=n,bc=bb&&!H||!ba[0]||l&&Ym;_+='",Y.setDate(Y.getDate()+1),Y=this._daylightSavingAdjust(Y)}Q+=_+""}n++,n>11&&(n=0,o++),Q+="
        '+this._get(a,"weekHeader")+"
        '+this._get(a,"calculateWeek")(Y)+""+(bb&&!G?" ":bc?''+Y.getDate()+"":''+Y.getDate()+"")+"
        "+(j?""+(g[0]>0&&N==g[1]-1?'
        ':""):""),M+=Q}K+=M}return K+=x+($.browser.msie&&parseInt($.browser.version,10)<7&&!a.inline?'':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='
        ',m="";if(f||!i)m+=''+g[b]+"";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+=''+c+"";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="
        ",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&bd?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.20",window["DP_jQuery_"+dpuuid]=$})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.progressbar.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("
        ").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.20"})})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.core.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +jQuery.effects||function(a,b){function c(b){var c;return b&&b.constructor==Array&&b.length==3?b:(c=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(b))?[parseInt(c[1],10),parseInt(c[2],10),parseInt(c[3],10)]:(c=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(b))?[parseFloat(c[1])*2.55,parseFloat(c[2])*2.55,parseFloat(c[3])*2.55]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(b))?[parseInt(c[1],16),parseInt(c[2],16),parseInt(c[3],16)]:(c=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(b))?[parseInt(c[1]+c[1],16),parseInt(c[2]+c[2],16),parseInt(c[3]+c[3],16)]:(c=/rgba\(0, 0, 0, 0\)/.exec(b))?e.transparent:e[a.trim(b).toLowerCase()]}function d(b,d){var e;do{e=a.curCSS(b,d);if(e!=""&&e!="transparent"||a.nodeName(b,"body"))break;d="backgroundColor"}while(b=b.parentNode);return c(e)}function h(){var a=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,b={},c,d;if(a&&a.length&&a[0]&&a[a[0]]){var e=a.length;while(e--)c=a[e],typeof a[c]=="string"&&(d=c.replace(/\-(\w)/g,function(a,b){return b.toUpperCase()}),b[d]=a[c])}else for(c in a)typeof a[c]=="string"&&(b[c]=a[c]);return b}function i(b){var c,d;for(c in b)d=b[c],(d==null||a.isFunction(d)||c in g||/scrollbar/.test(c)||!/color/i.test(c)&&isNaN(parseFloat(d)))&&delete b[c];return b}function j(a,b){var c={_:0},d;for(d in b)a[d]!=b[d]&&(c[d]=b[d]);return c}function k(b,c,d,e){typeof b=="object"&&(e=c,d=null,c=b,b=c.effect),a.isFunction(c)&&(e=c,d=null,c={});if(typeof c=="number"||a.fx.speeds[c])e=d,d=c,c={};return a.isFunction(d)&&(e=d,d=null),c=c||{},d=d||c.duration,d=a.fx.off?0:typeof d=="number"?d:d in a.fx.speeds?a.fx.speeds[d]:a.fx.speeds._default,e=e||c.complete,[b,c,d,e]}function l(b){return!b||typeof b=="number"||a.fx.speeds[b]?!0:typeof b=="string"&&!a.effects[b]?!0:!1}a.effects={},a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(b,e){a.fx.step[e]=function(a){a.colorInit||(a.start=d(a.elem,e),a.end=c(a.end),a.colorInit=!0),a.elem.style[e]="rgb("+Math.max(Math.min(parseInt(a.pos*(a.end[0]-a.start[0])+a.start[0],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[1]-a.start[1])+a.start[1],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[2]-a.start[2])+a.start[2],10),255),0)+")"}});var e={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},f=["add","remove","toggle"],g={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(b,c,d,e){return a.isFunction(d)&&(e=d,d=null),this.queue(function(){var g=a(this),k=g.attr("style")||" ",l=i(h.call(this)),m,n=g.attr("class")||"";a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),m=i(h.call(this)),g.attr("class",n),g.animate(j(l,m),{queue:!1,duration:c,easing:d,complete:function(){a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),typeof g.attr("style")=="object"?(g.attr("style").cssText="",g.attr("style").cssText=k):g.attr("style",k),e&&e.apply(this,arguments),a.dequeue(this)}})})},a.fn.extend({_addClass:a.fn.addClass,addClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{add:b},c,d,e]):this._addClass(b)},_removeClass:a.fn.removeClass,removeClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{remove:b},c,d,e]):this._removeClass(b)},_toggleClass:a.fn.toggleClass,toggleClass:function(c,d,e,f,g){return typeof d=="boolean"||d===b?e?a.effects.animateClass.apply(this,[d?{add:c}:{remove:c},e,f,g]):this._toggleClass(c,d):a.effects.animateClass.apply(this,[{toggle:c},d,e,f])},switchClass:function(b,c,d,e,f){return a.effects.animateClass.apply(this,[{add:c,remove:b},d,e,f])}}),a.extend(a.effects,{version:"1.8.20",save:function(a,b){for(var c=0;c").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}}),a.easing.jswing=a.easing.swing,a.extend(a.easing,{def:"easeOutQuad",swing:function(b,c,d,e,f){return a.easing[a.easing.def](b,c,d,e,f)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return b==0?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return b==0?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.fade.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.fold.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.highlight.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.pulsate.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);; \ No newline at end of file diff --git a/experiment/assert/lib/jquery.contextMenu.js b/experiment/assert/lib/jquery.contextMenu.js new file mode 100644 index 0000000..5021409 --- /dev/null +++ b/experiment/assert/lib/jquery.contextMenu.js @@ -0,0 +1,1580 @@ +/*! + * jQuery contextMenu - Plugin for simple contextMenu handling + * + * Version: 1.5.20 + * + * Authors: Rodney Rehm, Addy Osmani (patches for FF) + * Web: http://medialize.github.com/jQuery-contextMenu/ + * + * Licensed under + * MIT License http://www.opensource.org/licenses/mit-license + * GPL v3 http://opensource.org/licenses/GPL-3.0 + * + */ + +(function($, undefined){ + + // TODO: - + // ARIA stuff: menuitem, menuitemcheckbox und menuitemradio + // create structure if $.support[htmlCommand || htmlMenuitem] and !opt.disableNative + +// determine html5 compatibility +$.support.htmlMenuitem = ('HTMLMenuItemElement' in window); +$.support.htmlCommand = ('HTMLCommandElement' in window); +$.support.eventSelectstart = ("onselectstart" in document.documentElement); +/* // should the need arise, test for css user-select +$.support.cssUserSelect = (function(){ + var t = false, + e = document.createElement('div'); + + $.each('Moz|Webkit|Khtml|O|ms|Icab|'.split('|'), function(i, prefix) { + var propCC = prefix + (prefix ? 'U' : 'u') + 'serSelect', + prop = (prefix ? ('-' + prefix.toLowerCase() + '-') : '') + 'user-select'; + + e.style.cssText = prop + ': text;'; + if (e.style[propCC] == 'text') { + t = true; + return false; + } + + return true; + }); + + return t; +})(); +*/ + +var // currently active contextMenu trigger + $currentTrigger = null, + // is contextMenu initialized with at least one menu? + initialized = false, + // window handle + $win = $(window), + // number of registered menus + counter = 0, + // mapping selector to namespace + namespaces = {}, + // mapping namespace to options + menus = {}, + // custom command type handlers + types = {}, + // default values + defaults = { + // selector of contextMenu trigger + selector: null, + // where to append the menu to + appendTo: null, + // method to trigger context menu ["right", "left", "hover"] + trigger: "right", + // hide menu when mouse leaves trigger / menu elements + autoHide: false, + // ms to wait before showing a hover-triggered context menu + delay: 200, + // determine position to show menu at + determinePosition: function($menu) { + // position to the lower middle of the trigger element + if ($.ui && $.ui.position) { + // .position() is provided as a jQuery UI utility + // (...and it won't work on hidden elements) + $menu.css('display', 'block').position({ + my: "center top", + at: "center bottom", + of: this, + offset: "0 5", + collision: "fit" + }).css('display', 'none'); + } else { + // determine contextMenu position + var offset = this.offset(); + offset.top += this.outerHeight(); + offset.left += this.outerWidth() / 2 - $menu.outerWidth() / 2; + $menu.css(offset); + } + }, + // position menu + position: function(opt, x, y) { + var $this = this, + offset; + // determine contextMenu position + if (!x && !y) { + opt.determinePosition.call(this, opt.$menu); + return; + } else if (x === "maintain" && y === "maintain") { + // x and y must not be changed (after re-show on command click) + offset = opt.$menu.position(); + } else { + // x and y are given (by mouse event) + var triggerIsFixed = opt.$trigger.parents().andSelf() + .filter(function() { + return $(this).css('position') == "fixed"; + }).length; + + if (triggerIsFixed) { + y -= $win.scrollTop(); + x -= $win.scrollLeft(); + } + offset = {top: y, left: x}; + } + + // correct offset if viewport demands it + var bottom = $win.scrollTop() + $win.height(), + right = $win.scrollLeft() + $win.width(), + height = opt.$menu.height(), + width = opt.$menu.width(); + + if (offset.top + height > bottom) { + offset.top -= height; + } + + if (offset.left + width > right) { + offset.left -= width; + } + + opt.$menu.css(offset); + }, + // position the sub-menu + positionSubmenu: function($menu) { + if ($.ui && $.ui.position) { + // .position() is provided as a jQuery UI utility + // (...and it won't work on hidden elements) + $menu.css('display', 'block').position({ + my: "left top", + at: "right top", + of: this, + collision: "fit" + }).css('display', ''); + } else { + // determine contextMenu position + var offset = { + top: 0, + left: this.outerWidth() + }; + $menu.css(offset); + } + }, + // offset to add to zIndex + zIndex: 1, + // show hide animation settings + animation: { + duration: 50, + show: 'slideDown', + hide: 'slideUp' + }, + // events + events: { + show: $.noop, + hide: $.noop + }, + // default callback + callback: null, + // list of contextMenu items + items: {} + }, + // mouse position for hover activation + hoveract = { + timer: null, + pageX: null, + pageY: null + }, + // determine zIndex + zindex = function($t) { + var zin = 0, + $tt = $t; + + while (true) { + zin = Math.max(zin, parseInt($tt.css('z-index'), 10) || 0); + $tt = $tt.parent(); + if (!$tt || !$tt.length || "html body".indexOf($tt.prop('nodeName').toLowerCase()) > -1 ) { + break; + } + } + + return zin; + }, + // event handlers + handle = { + // abort anything + abortevent: function(e){ + e.preventDefault(); + e.stopImmediatePropagation(); + }, + + // contextmenu show dispatcher + contextmenu: function(e) { + var $this = $(this); + + // disable actual context-menu + e.preventDefault(); + e.stopImmediatePropagation(); + + // abort native-triggered events unless we're triggering on right click + if (e.data.trigger != 'right' && e.originalEvent) { + return; + } + + if (!$this.hasClass('context-menu-disabled')) { + // theoretically need to fire a show event at + // http://www.whatwg.org/specs/web-apps/current-work/multipage/interactive-elements.html#context-menus + // var evt = jQuery.Event("show", { data: data, pageX: e.pageX, pageY: e.pageY, relatedTarget: this }); + // e.data.$menu.trigger(evt); + + $currentTrigger = $this; + if (e.data.build) { + var built = e.data.build($currentTrigger, e); + // abort if build() returned false + if (built === false) { + return; + } + + // dynamically build menu on invocation + e.data = $.extend(true, {}, defaults, e.data, built || {}); + + // abort if there are no items to display + if (!e.data.items || $.isEmptyObject(e.data.items)) { + // Note: jQuery captures and ignores errors from event handlers + if (window.console) { + (console.error || console.log)("No items specified to show in contextMenu"); + } + + throw new Error('No Items sepcified'); + } + + // backreference for custom command type creation + e.data.$trigger = $currentTrigger; + + op.create(e.data); + } + // show menu + op.show.call($this, e.data, e.pageX, e.pageY); + } + }, + // contextMenu left-click trigger + click: function(e) { + e.preventDefault(); + e.stopImmediatePropagation(); + $(this).trigger(jQuery.Event("contextmenu", { data: e.data, pageX: e.pageX, pageY: e.pageY })); + }, + // contextMenu right-click trigger + mousedown: function(e) { + // register mouse down + var $this = $(this); + + // hide any previous menus + if ($currentTrigger && $currentTrigger.length && !$currentTrigger.is($this)) { + $currentTrigger.data('contextMenu').$menu.trigger('contextmenu:hide'); + } + + // activate on right click + if (e.button == 2) { + $currentTrigger = $this.data('contextMenuActive', true); + } + }, + // contextMenu right-click trigger + mouseup: function(e) { + // show menu + var $this = $(this); + if ($this.data('contextMenuActive') && $currentTrigger && $currentTrigger.length && $currentTrigger.is($this) && !$this.hasClass('context-menu-disabled')) { + e.preventDefault(); + e.stopImmediatePropagation(); + $currentTrigger = $this; + $this.trigger(jQuery.Event("contextmenu", { data: e.data, pageX: e.pageX, pageY: e.pageY })); + } + + $this.removeData('contextMenuActive'); + }, + // contextMenu hover trigger + mouseenter: function(e) { + var $this = $(this), + $related = $(e.relatedTarget), + $document = $(document); + + // abort if we're coming from a menu + if ($related.is('.context-menu-list') || $related.closest('.context-menu-list').length) { + return; + } + + // abort if a menu is shown + if ($currentTrigger && $currentTrigger.length) { + return; + } + + hoveract.pageX = e.pageX; + hoveract.pageY = e.pageY; + hoveract.data = e.data; + $document.on('mousemove.contextMenuShow', handle.mousemove); + hoveract.timer = setTimeout(function() { + hoveract.timer = null; + $document.off('mousemove.contextMenuShow'); + $currentTrigger = $this; + $this.trigger(jQuery.Event("contextmenu", { data: hoveract.data, pageX: hoveract.pageX, pageY: hoveract.pageY })); + }, e.data.delay ); + }, + // contextMenu hover trigger + mousemove: function(e) { + hoveract.pageX = e.pageX; + hoveract.pageY = e.pageY; + }, + // contextMenu hover trigger + mouseleave: function(e) { + // abort if we're leaving for a menu + var $related = $(e.relatedTarget); + if ($related.is('.context-menu-list') || $related.closest('.context-menu-list').length) { + return; + } + + try { + clearTimeout(hoveract.timer); + } catch(e) {} + + hoveract.timer = null; + }, + + // click on layer to hide contextMenu + layerClick: function(e) { + var $this = $(this), + root = $this.data('contextMenuRoot'), + mouseup = false, + button = e.button, + x = e.pageX, + y = e.pageY, + target, + offset, + selectors; + + e.preventDefault(); + e.stopImmediatePropagation(); + + // This hack looks about as ugly as it is + // Firefox 12 (at least) fires the contextmenu event directly "after" mousedown + // for some reason `root.$layer.hide(); document.elementFromPoint()` causes this + // contextmenu event to be triggered on the uncovered element instead of on the + // layer (where every other sane browser, including Firefox nightly at the time) + // triggers the event. This workaround might be obsolete by September 2012. + $this.on('mouseup', function() { + mouseup = true; + }); + setTimeout(function() { + var $window, hideshow; + + // test if we need to reposition the menu + if ((root.trigger == 'left' && button == 0) || (root.trigger == 'right' && button == 2)) { + if (document.elementFromPoint) { + root.$layer.hide(); + target = document.elementFromPoint(x, y); + root.$layer.show(); + + selectors = []; + for (var s in namespaces) { + selectors.push(s); + } + + target = $(target).closest(selectors.join(', ')); + + if (target.length) { + if (target.is(root.$trigger[0])) { + root.position.call(root.$trigger, root, x, y); + return; + } + } + } else { + offset = root.$trigger.offset(); + $window = $(window); + // while this looks kinda awful, it's the best way to avoid + // unnecessarily calculating any positions + offset.top += $window.scrollTop(); + if (offset.top <= e.pageY) { + offset.left += $window.scrollLeft(); + if (offset.left <= e.pageX) { + offset.bottom = offset.top + root.$trigger.outerHeight(); + if (offset.bottom >= e.pageY) { + offset.right = offset.left + root.$trigger.outerWidth(); + if (offset.right >= e.pageX) { + // reposition + root.position.call(root.$trigger, root, x, y); + return; + } + } + } + } + } + } + + hideshow = function(e) { + if (e) { + e.preventDefault(); + e.stopImmediatePropagation(); + } + + root.$menu.trigger('contextmenu:hide'); + if (target && target.length) { + setTimeout(function() { + target.contextMenu({x: x, y: y}); + }, 50); + } + }; + + if (mouseup) { + // mouseup has already happened + hideshow(); + } else { + // remove only after mouseup has completed + $this.on('mouseup', hideshow); + } + }, 50); + }, + // key handled :hover + keyStop: function(e, opt) { + if (!opt.isInput) { + e.preventDefault(); + } + + e.stopPropagation(); + }, + key: function(e) { + var opt = $currentTrigger.data('contextMenu') || {}, + $children = opt.$menu.children(), + $round; + + switch (e.keyCode) { + case 9: + case 38: // up + handle.keyStop(e, opt); + // if keyCode is [38 (up)] or [9 (tab) with shift] + if (opt.isInput) { + if (e.keyCode == 9 && e.shiftKey) { + e.preventDefault(); + opt.$selected && opt.$selected.find('input, textarea, select').blur(); + opt.$menu.trigger('prevcommand'); + return; + } else if (e.keyCode == 38 && opt.$selected.find('input, textarea, select').prop('type') == 'checkbox') { + // checkboxes don't capture this key + e.preventDefault(); + return; + } + } else if (e.keyCode != 9 || e.shiftKey) { + opt.$menu.trigger('prevcommand'); + return; + } + + case 9: // tab + case 40: // down + handle.keyStop(e, opt); + if (opt.isInput) { + if (e.keyCode == 9) { + e.preventDefault(); + opt.$selected && opt.$selected.find('input, textarea, select').blur(); + opt.$menu.trigger('nextcommand'); + return; + } else if (e.keyCode == 40 && opt.$selected.find('input, textarea, select').prop('type') == 'checkbox') { + // checkboxes don't capture this key + e.preventDefault(); + return; + } + } else { + opt.$menu.trigger('nextcommand'); + return; + } + break; + + case 37: // left + handle.keyStop(e, opt); + if (opt.isInput || !opt.$selected || !opt.$selected.length) { + break; + } + + if (!opt.$selected.parent().hasClass('context-menu-root')) { + var $parent = opt.$selected.parent().parent(); + opt.$selected.trigger('contextmenu:blur'); + opt.$selected = $parent; + return; + } + break; + + case 39: // right + handle.keyStop(e, opt); + if (opt.isInput || !opt.$selected || !opt.$selected.length) { + break; + } + + var itemdata = opt.$selected.data('contextMenu') || {}; + if (itemdata.$menu && opt.$selected.hasClass('context-menu-submenu')) { + opt.$selected = null; + itemdata.$selected = null; + itemdata.$menu.trigger('nextcommand'); + return; + } + break; + + case 35: // end + case 36: // home + if (opt.$selected && opt.$selected.find('input, textarea, select').length) { + return; + } else { + (opt.$selected && opt.$selected.parent() || opt.$menu) + .children(':not(.disabled, .not-selectable)')[e.keyCode == 36 ? 'first' : 'last']() + .trigger('contextmenu:focus'); + e.preventDefault(); + return; + } + break; + + case 13: // enter + handle.keyStop(e, opt); + if (opt.isInput) { + if (opt.$selected && !opt.$selected.is('textarea, select')) { + e.preventDefault(); + return; + } + break; + } + opt.$selected && opt.$selected.trigger('mouseup'); + return; + + case 32: // space + case 33: // page up + case 34: // page down + // prevent browser from scrolling down while menu is visible + handle.keyStop(e, opt); + return; + + case 27: // esc + handle.keyStop(e, opt); + opt.$menu.trigger('contextmenu:hide'); + return; + + default: // 0-9, a-z + var k = (String.fromCharCode(e.keyCode)).toUpperCase(); + if (opt.accesskeys[k]) { + // according to the specs accesskeys must be invoked immediately + opt.accesskeys[k].$node.trigger(opt.accesskeys[k].$menu + ? 'contextmenu:focus' + : 'mouseup' + ); + return; + } + break; + } + // pass event to selected item, + // stop propagation to avoid endless recursion + e.stopPropagation(); + opt.$selected && opt.$selected.trigger(e); + }, + + // select previous possible command in menu + prevItem: function(e) { + e.stopPropagation(); + var opt = $(this).data('contextMenu') || {}; + + // obtain currently selected menu + if (opt.$selected) { + var $s = opt.$selected; + opt = opt.$selected.parent().data('contextMenu') || {}; + opt.$selected = $s; + } + + var $children = opt.$menu.children(), + $prev = !opt.$selected || !opt.$selected.prev().length ? $children.last() : opt.$selected.prev(), + $round = $prev; + + // skip disabled + while ($prev.hasClass('disabled') || $prev.hasClass('not-selectable')) { + if ($prev.prev().length) { + $prev = $prev.prev(); + } else { + $prev = $children.last(); + } + if ($prev.is($round)) { + // break endless loop + return; + } + } + + // leave current + if (opt.$selected) { + handle.itemMouseleave.call(opt.$selected.get(0), e); + } + + // activate next + handle.itemMouseenter.call($prev.get(0), e); + + // focus input + var $input = $prev.find('input, textarea, select'); + if ($input.length) { + $input.focus(); + } + }, + // select next possible command in menu + nextItem: function(e) { + e.stopPropagation(); + var opt = $(this).data('contextMenu') || {}; + + // obtain currently selected menu + if (opt.$selected) { + var $s = opt.$selected; + opt = opt.$selected.parent().data('contextMenu') || {}; + opt.$selected = $s; + } + + var $children = opt.$menu.children(), + $next = !opt.$selected || !opt.$selected.next().length ? $children.first() : opt.$selected.next(), + $round = $next; + + // skip disabled + while ($next.hasClass('disabled') || $next.hasClass('not-selectable')) { + if ($next.next().length) { + $next = $next.next(); + } else { + $next = $children.first(); + } + if ($next.is($round)) { + // break endless loop + return; + } + } + + // leave current + if (opt.$selected) { + handle.itemMouseleave.call(opt.$selected.get(0), e); + } + + // activate next + handle.itemMouseenter.call($next.get(0), e); + + // focus input + var $input = $next.find('input, textarea, select'); + if ($input.length) { + $input.focus(); + } + }, + + // flag that we're inside an input so the key handler can act accordingly + focusInput: function(e) { + var $this = $(this).closest('.context-menu-item'), + data = $this.data(), + opt = data.contextMenu, + root = data.contextMenuRoot; + + root.$selected = opt.$selected = $this; + root.isInput = opt.isInput = true; + }, + // flag that we're inside an input so the key handler can act accordingly + blurInput: function(e) { + var $this = $(this).closest('.context-menu-item'), + data = $this.data(), + opt = data.contextMenu, + root = data.contextMenuRoot; + + root.isInput = opt.isInput = false; + }, + + // :hover on menu + menuMouseenter: function(e) { + var root = $(this).data().contextMenuRoot; + root.hovering = true; + }, + // :hover on menu + menuMouseleave: function(e) { + var root = $(this).data().contextMenuRoot; + if (root.$layer && root.$layer.is(e.relatedTarget)) { + root.hovering = false; + } + }, + + // :hover done manually so key handling is possible + itemMouseenter: function(e) { + var $this = $(this), + data = $this.data(), + opt = data.contextMenu, + root = data.contextMenuRoot; + + root.hovering = true; + + // abort if we're re-entering + if (e && root.$layer && root.$layer.is(e.relatedTarget)) { + e.preventDefault(); + e.stopImmediatePropagation(); + } + + // make sure only one item is selected + (opt.$menu ? opt : root).$menu + .children('.hover').trigger('contextmenu:blur'); + + if ($this.hasClass('disabled') || $this.hasClass('not-selectable')) { + opt.$selected = null; + return; + } + + $this.trigger('contextmenu:focus'); + }, + // :hover done manually so key handling is possible + itemMouseleave: function(e) { + var $this = $(this), + data = $this.data(), + opt = data.contextMenu, + root = data.contextMenuRoot; + + if (root !== opt && root.$layer && root.$layer.is(e.relatedTarget)) { + root.$selected && root.$selected.trigger('contextmenu:blur'); + e.preventDefault(); + e.stopImmediatePropagation(); + root.$selected = opt.$selected = opt.$node; + return; + } + + $this.trigger('contextmenu:blur'); + }, + // contextMenu item click + itemClick: function(e) { + var $this = $(this), + data = $this.data(), + opt = data.contextMenu, + root = data.contextMenuRoot, + key = data.contextMenuKey, + callback; + + // abort if the key is unknown or disabled or is a menu + if (!opt.items[key] || $this.hasClass('disabled') || $this.hasClass('context-menu-submenu')) { + return; + } + + e.preventDefault(); + e.stopImmediatePropagation(); + + if ($.isFunction(root.callbacks[key])) { + // item-specific callback + callback = root.callbacks[key]; + } else if ($.isFunction(root.callback)) { + // default callback + callback = root.callback; + } else { + // no callback, no action + return; + } + + // hide menu if callback doesn't stop that + if (callback.call(root.$trigger, key, root) !== false) { + root.$menu.trigger('contextmenu:hide'); + } else { + op.update.call(root.$trigger, root); + } + }, + // ignore click events on input elements + inputClick: function(e) { + e.stopImmediatePropagation(); + }, + + // hide + hideMenu: function(e) { + var root = $(this).data('contextMenuRoot'); + op.hide.call(root.$trigger, root); + }, + // focus + focusItem: function(e) { + e.stopPropagation(); + var $this = $(this), + data = $this.data(), + opt = data.contextMenu, + root = data.contextMenuRoot; + + $this.addClass('hover') + .siblings('.hover').trigger('contextmenu:blur'); + + // remember selected + opt.$selected = root.$selected = $this; + + // position sub-menu - do after show so dumb $.ui.position can keep up + if (opt.$node) { + root.positionSubmenu.call(opt.$node, opt.$menu); + } + }, + // blur + blurItem: function(e) { + e.stopPropagation(); + var $this = $(this), + data = $this.data(), + opt = data.contextMenu, + root = data.contextMenuRoot; + + $this.removeClass('hover'); + opt.$selected = null; + } + }, + // operations + op = { + show: function(opt, x, y) { + var $this = $(this), + offset, + css = {}; + + // hide any open menus + $('#context-menu-layer').trigger('mousedown'); + + // backreference for callbacks + opt.$trigger = $this; + + // show event + if (opt.events.show.call($this, opt) === false) { + $currentTrigger = null; + return; + } + + // create or update context menu + op.update.call($this, opt); + + // position menu + opt.position.call($this, opt, x, y); + + // make sure we're in front + if (opt.zIndex) { + css.zIndex = zindex($this) + opt.zIndex; + } + + // add layer + op.layer.call(opt.$menu, opt, css.zIndex); + + // adjust sub-menu zIndexes + opt.$menu.find('ul').css('zIndex', css.zIndex + 1); + + // position and show context menu + opt.$menu.css( css )[opt.animation.show](opt.animation.duration); + // make options available + $this.data('contextMenu', opt); + // register key handler + $(document).off('keydown.contextMenu').on('keydown.contextMenu', handle.key); + // register autoHide handler + if (opt.autoHide) { + // trigger element coordinates + var pos = $this.position(); + pos.right = pos.left + $this.outerWidth(); + pos.bottom = pos.top + this.outerHeight(); + // mouse position handler + $(document).on('mousemove.contextMenuAutoHide', function(e) { + if (opt.$layer && !opt.hovering && (!(e.pageX >= pos.left && e.pageX <= pos.right) || !(e.pageY >= pos.top && e.pageY <= pos.bottom))) { + // if mouse in menu... + opt.$menu.trigger('contextmenu:hide'); + } + }); + } + }, + hide: function(opt) { + var $this = $(this); + if (!opt) { + opt = $this.data('contextMenu') || {}; + } + + // hide event + if (opt.events && opt.events.hide.call($this, opt) === false) { + return; + } + + if (opt.$layer) { + // keep layer for a bit so the contextmenu event can be aborted properly by opera + setTimeout((function($layer){ return function(){ + $layer.remove(); + }; + })(opt.$layer), 10); + + try { + delete opt.$layer; + } catch(e) { + opt.$layer = null; + } + } + + // remove handle + $currentTrigger = null; + // remove selected + opt.$menu.find('.hover').trigger('contextmenu:blur'); + opt.$selected = null; + // unregister key and mouse handlers + //$(document).off('.contextMenuAutoHide keydown.contextMenu'); // http://bugs.jquery.com/ticket/10705 + $(document).off('.contextMenuAutoHide').off('keydown.contextMenu'); + // hide menu + opt.$menu && opt.$menu[opt.animation.hide](opt.animation.duration); + + // tear down dynamically built menu + if (opt.build) { + opt.$menu.remove(); + $.each(opt, function(key, value) { + switch (key) { + case 'ns': + case 'selector': + case 'build': + case 'trigger': + return true; + + default: + opt[key] = undefined; + try { + delete opt[key]; + } catch (e) {} + return true; + } + }); + } + }, + create: function(opt, root) { + if (root === undefined) { + root = opt; + } + // create contextMenu + opt.$menu = $('
          ').data({ + 'contextMenu': opt, + 'contextMenuRoot': root + }); + + $.each(['callbacks', 'commands', 'inputs'], function(i,k){ + opt[k] = {}; + if (!root[k]) { + root[k] = {}; + } + }); + + root.accesskeys || (root.accesskeys = {}); + + // create contextMenu items + $.each(opt.items, function(key, item){ + var $t = $('
        • '), + $label = null, + $input = null; + + item.$node = $t.data({ + 'contextMenu': opt, + 'contextMenuRoot': root, + 'contextMenuKey': key + }); + + // register accesskey + // NOTE: the accesskey attribute should be applicable to any element, but Safari5 and Chrome13 still can't do that + if (item.accesskey) { + var aks = splitAccesskey(item.accesskey); + for (var i=0, ak; ak = aks[i]; i++) { + if (!root.accesskeys[ak]) { + root.accesskeys[ak] = item; + item._name = item.name.replace(new RegExp('(' + ak + ')', 'i'), '$1'); + break; + } + } + } + + if (typeof item == "string") { + $t.addClass('context-menu-separator not-selectable'); + } else if (item.type && types[item.type]) { + // run custom type handler + types[item.type].call($t, item, opt, root); + // register commands + $.each([opt, root], function(i,k){ + k.commands[key] = item; + if ($.isFunction(item.callback)) { + k.callbacks[key] = item.callback; + } + }); + } else { + // add label for input + if (item.type == 'html') { + $t.addClass('context-menu-html not-selectable'); + } else if (item.type) { + $label = $('').appendTo($t); + $('').html(item._name || item.name).appendTo($label); + $t.addClass('context-menu-input'); + opt.hasTypes = true; + $.each([opt, root], function(i,k){ + k.commands[key] = item; + k.inputs[key] = item; + }); + } else if (item.items) { + item.type = 'sub'; + } + + switch (item.type) { + case 'text': + $input = $('') + .val(item.value || "").appendTo($label); + break; + + case 'textarea': + $input = $('') + .val(item.value || "").appendTo($label); + + if (item.height) { + $input.height(item.height); + } + break; + + case 'checkbox': + $input = $('') + .val(item.value || "").prop("checked", !!item.selected).prependTo($label); + break; + + case 'radio': + $input = $('') + .val(item.value || "").prop("checked", !!item.selected).prependTo($label); + break; + + case 'select': + $input = $(' + if (item.type && item.type != 'sub' && item.type != 'html') { + $input + .on('focus', handle.focusInput) + .on('blur', handle.blurInput); + + if (item.events) { + $input.on(item.events); + } + } + + // add icons + if (item.icon) { + $t.addClass("icon icon-" + item.icon); + } + } + + // cache contained elements + item.$input = $input; + item.$label = $label; + + // attach item to menu + $t.appendTo(opt.$menu); + + // Disable text selection + if (!opt.hasTypes && $.support.eventSelectstart) { + // browsers support user-select: none, + // IE has a special event for text-selection + // browsers supporting neither will not be preventing text-selection + $t.on('selectstart.disableTextSelect', handle.abortevent); + } + }); + // attach contextMenu to (to bypass any possible overflow:hidden issues on parents of the trigger element) + if (!opt.$node) { + opt.$menu.css('display', 'none').addClass('context-menu-root'); + } + opt.$menu.appendTo(opt.appendTo || document.body); + }, + update: function(opt, root) { + var $this = this; + if (root === undefined) { + root = opt; + // determine widths of submenus, as CSS won't grow them automatically + // position:absolute > position:absolute; min-width:100; max-width:200; results in width: 100; + // kinda sucks hard... + opt.$menu.find('ul').andSelf().css({position: 'static', display: 'block'}).each(function(){ + var $this = $(this); + $this.width($this.css('position', 'absolute').width()) + .css('position', 'static'); + }).css({position: '', display: ''}); + } + // re-check disabled for each item + opt.$menu.children().each(function(){ + var $item = $(this), + key = $item.data('contextMenuKey'), + item = opt.items[key], + disabled = ($.isFunction(item.disabled) && item.disabled.call($this, key, root)) || item.disabled === true; + + // dis- / enable item + $item[disabled ? 'addClass' : 'removeClass']('disabled'); + + if (item.type) { + // dis- / enable input elements + $item.find('input, select, textarea').prop('disabled', disabled); + + // update input states + switch (item.type) { + case 'text': + case 'textarea': + item.$input.val(item.value || ""); + break; + + case 'checkbox': + case 'radio': + item.$input.val(item.value || "").prop('checked', !!item.selected); + break; + + case 'select': + item.$input.val(item.selected || ""); + break; + } + } + + if (item.$menu) { + // update sub-menu + op.update.call($this, item, root); + } + }); + }, + layer: function(opt, zIndex) { + // add transparent layer for click area + // filter and background for Internet Explorer, Issue #23 + var $layer = opt.$layer = $('
          ') + .css({height: $win.height(), width: $win.width(), display: 'block'}) + .data('contextMenuRoot', opt) + .insertBefore(this) + .on('contextmenu', handle.abortevent) + .on('mousedown', handle.layerClick); + + // IE6 doesn't know position:fixed; + if (!$.support.fixedPosition) { + $layer.css({ + 'position' : 'absolute', + 'height' : $(document).height() + }); + } + + return $layer; + } + }; + +// split accesskey according to http://www.whatwg.org/specs/web-apps/current-work/multipage/editing.html#assigned-access-key +function splitAccesskey(val) { + var t = val.split(/\s+/), + keys = []; + + for (var i=0, k; k = t[i]; i++) { + k = k[0].toUpperCase(); // first character only + // theoretically non-accessible characters should be ignored, but different systems, different keyboard layouts, ... screw it. + // a map to look up already used access keys would be nice + keys.push(k); + } + + return keys; +} + +// handle contextMenu triggers +$.fn.contextMenu = function(operation) { + if (operation === undefined) { + this.first().trigger('contextmenu'); + } else if (operation.x && operation.y) { + this.first().trigger(jQuery.Event("contextmenu", {pageX: operation.x, pageY: operation.y})); + } else if (operation === "hide") { + var $menu = this.data('contextMenu').$menu; + $menu && $menu.trigger('contextmenu:hide'); + } else if (operation) { + this.removeClass('context-menu-disabled'); + } else if (!operation) { + this.addClass('context-menu-disabled'); + } + + return this; +}; + +// manage contextMenu instances +$.contextMenu = function(operation, options) { + if (typeof operation != 'string') { + options = operation; + operation = 'create'; + } + + if (typeof options == 'string') { + options = {selector: options}; + } else if (options === undefined) { + options = {}; + } + + // merge with default options + var o = $.extend(true, {}, defaults, options || {}), + $document = $(document); + + switch (operation) { + case 'create': + // no selector no joy + if (!o.selector) { + throw new Error('No selector specified'); + } + // make sure internal classes are not bound to + /* if (o.selector.match(/.context-menu-(list|item|input)($|\s)/)) { + throw new Error('Cannot bind to selector "' + o.selector + '" as it contains a reserved className'); + }*/ + if (!o.build && (!o.items || $.isEmptyObject(o.items))) { + throw new Error('No Items sepcified'); + } + counter ++; + o.ns = '.contextMenu' + counter; + namespaces[o.selector] = o.ns; + menus[o.ns] = o; + + // default to right click + if (!o.trigger) { + o.trigger = 'right'; + } + + if (!initialized) { + // make sure item click is registered first + $document + .on({ + 'contextmenu:hide.contextMenu': handle.hideMenu, + 'prevcommand.contextMenu': handle.prevItem, + 'nextcommand.contextMenu': handle.nextItem, + 'contextmenu.contextMenu': handle.abortevent, + 'mouseenter.contextMenu': handle.menuMouseenter, + 'mouseleave.contextMenu': handle.menuMouseleave + }, '.context-menu-list') + .on('mouseup.contextMenu', '.context-menu-input', handle.inputClick) + .on({ + 'mouseup.contextMenu': handle.itemClick, + 'contextmenu:focus.contextMenu': handle.focusItem, + 'contextmenu:blur.contextMenu': handle.blurItem, + 'contextmenu.contextMenu': handle.abortevent, + 'mouseenter.contextMenu': handle.itemMouseenter, + 'mouseleave.contextMenu': handle.itemMouseleave + }, '.context-menu-item'); + + initialized = true; + } + + // engage native contextmenu event + $document + .on('contextmenu' + o.ns, o.selector, o, handle.contextmenu); + + switch (o.trigger) { + case 'hover': + $document + .on('mouseenter' + o.ns, o.selector, o, handle.mouseenter) + .on('mouseleave' + o.ns, o.selector, o, handle.mouseleave); + break; + + case 'left': + $document.on('click' + o.ns, o.selector, o, handle.click); + break; + /* + default: + // http://www.quirksmode.org/dom/events/contextmenu.html + $document + .on('mousedown' + o.ns, o.selector, o, handle.mousedown) + .on('mouseup' + o.ns, o.selector, o, handle.mouseup); + break; + */ + } + + // create menu + if (!o.build) { + op.create(o); + } + break; + + case 'destroy': + if (!o.selector) { + $document.off('.contextMenu .contextMenuAutoHide'); + $.each(namespaces, function(key, value) { + $document.off(value); + }); + + namespaces = {}; + menus = {}; + counter = 0; + initialized = false; + + $('#context-menu-layer, .context-menu-list').remove(); + } else if (namespaces[o.selector]) { + try { + if (menus[namespaces[o.selector]].$menu) { + menus[namespaces[o.selector]].$menu.remove(); + } + + delete menus[namespaces[o.selector]]; + } catch(e) { + menus[namespaces[o.selector]] = null; + } + + $document.off(namespaces[o.selector]); + } + break; + + case 'html5': + // if or are not handled by the browser, + // or options was a bool true, + // initialize $.contextMenu for them + if ((!$.support.htmlCommand && !$.support.htmlMenuitem) || (typeof options == "boolean" && options)) { + $('menu[type="context"]').each(function() { + if (this.id) { + $.contextMenu({ + selector: '[contextmenu=' + this.id +']', + items: $.contextMenu.fromMenu(this) + }); + } + }).css('display', 'none'); + } + break; + + default: + throw new Error('Unknown operation "' + operation + '"'); + } + + return this; +}; + +// import values into commands +$.contextMenu.setInputValues = function(opt, data) { + if (data === undefined) { + data = {}; + } + + $.each(opt.inputs, function(key, item) { + switch (item.type) { + case 'text': + case 'textarea': + item.value = data[key] || ""; + break; + + case 'checkbox': + item.selected = data[key] ? true : false; + break; + + case 'radio': + item.selected = (data[item.radio] || "") == item.value ? true : false; + break; + + case 'select': + item.selected = data[key] || ""; + break; + } + }); +}; + +// export values from commands +$.contextMenu.getInputValues = function(opt, data) { + if (data === undefined) { + data = {}; + } + + $.each(opt.inputs, function(key, item) { + switch (item.type) { + case 'text': + case 'textarea': + case 'select': + data[key] = item.$input.val(); + break; + + case 'checkbox': + data[key] = item.$input.prop('checked'); + break; + + case 'radio': + if (item.$input.prop('checked')) { + data[item.radio] = item.value; + } + break; + } + }); + + return data; +}; + +// find